From c4194399d322a868ad445b5841c18597c3a2cf50 Mon Sep 17 00:00:00 2001 From: Andrew Wang Date: Wed, 22 Jan 2014 21:43:00 +0000 Subject: [PATCH] Merge HDFS-4949 changes from trunk to branch-2. git-svn-id: https://svn.apache.org/repos/asf/hadoop/common/branches/branch-2@1560522 13f79535-47bb-0310-9956-ffa450edef68 --- dev-support/test-patch.sh | 4 +- .../hadoop/fs/BatchedRemoteIterator.java | 118 ++ .../org/apache/hadoop/fs/BlockLocation.java | 101 +- .../hadoop/fs/InvalidRequestException.java | 32 + .../hadoop/fs/permission/FsPermission.java | 7 + .../org/apache/hadoop/io/ReadaheadPool.java | 4 +- .../main/java/org/apache/hadoop/io/Text.java | 5 +- .../apache/hadoop/io/nativeio/NativeIO.java | 176 ++- .../hadoop/security/UserGroupInformation.java | 8 + .../hadoop/util/IntrusiveCollection.java | 373 +++++ .../apache/hadoop/util/LightWeightCache.java | 25 + .../apache/hadoop/util/LightWeightGSet.java | 49 +- .../org/apache/hadoop/util/StringUtils.java | 79 + .../org/apache/hadoop/io/nativeio/NativeIO.c | 89 +- .../apache/hadoop/fs/TestBlockLocation.java | 108 ++ .../hadoop/io/nativeio/TestNativeIO.java | 61 + .../hadoop/util/TestLightWeightGSet.java | 110 ++ hadoop-hdfs-project/hadoop-hdfs/CHANGES.txt | 209 ++- .../dev-support/findbugsExcludeFile.xml | 16 + .../hadoop-hdfs/src/main/bin/hdfs | 3 + .../java/org/apache/hadoop/fs/CacheFlag.java | 44 + .../apache/hadoop/fs/HdfsBlockLocation.java | 3 +- .../org/apache/hadoop/hdfs/DFSClient.java | 74 + .../org/apache/hadoop/hdfs/DFSConfigKeys.java | 21 + .../java/org/apache/hadoop/hdfs/DFSUtil.java | 81 +- .../hadoop/hdfs/DistributedFileSystem.java | 159 ++ .../apache/hadoop/hdfs/client/ClientMmap.java | 14 +- .../apache/hadoop/hdfs/client/HdfsAdmin.java | 104 ++ .../hadoop/hdfs/protocol/CacheDirective.java | 268 ++++ .../hdfs/protocol/CacheDirectiveEntry.java | 45 + .../hdfs/protocol/CacheDirectiveInfo.java | 358 +++++ .../hdfs/protocol/CacheDirectiveIterator.java | 56 + .../hdfs/protocol/CacheDirectiveStats.java | 169 ++ .../hadoop/hdfs/protocol/CachePoolEntry.java | 45 + .../hadoop/hdfs/protocol/CachePoolInfo.java | 229 +++ .../hdfs/protocol/CachePoolIterator.java | 53 + .../hadoop/hdfs/protocol/CachePoolStats.java | 115 ++ .../hadoop/hdfs/protocol/ClientProtocol.java | 91 +- .../hadoop/hdfs/protocol/DatanodeInfo.java | 80 +- .../hadoop/hdfs/protocol/LayoutVersion.java | 3 +- .../hadoop/hdfs/protocol/LocatedBlock.java | 62 +- ...amenodeProtocolServerSideTranslatorPB.java | 136 +- .../ClientNamenodeProtocolTranslatorPB.java | 179 +++ ...atanodeProtocolClientSideTranslatorPB.java | 38 +- ...atanodeProtocolServerSideTranslatorPB.java | 28 +- .../hadoop/hdfs/protocolPB/PBHelper.java | 334 +++- .../server/blockmanagement/BlockInfo.java | 2 +- .../server/blockmanagement/BlockManager.java | 7 + .../CacheReplicationMonitor.java | 774 +++++++++ .../blockmanagement/DatanodeDescriptor.java | 121 +- .../blockmanagement/DatanodeManager.java | 101 +- .../blockmanagement/DatanodeStatistics.java | 6 + .../blockmanagement/HeartbeatManager.java | 25 +- .../hdfs/server/datanode/BPOfferService.java | 34 + .../hdfs/server/datanode/BPServiceActor.java | 48 +- .../hdfs/server/datanode/BlockReceiver.java | 5 +- .../hdfs/server/datanode/BlockSender.java | 16 +- .../hadoop/hdfs/server/datanode/DNConf.java | 21 +- .../hadoop/hdfs/server/datanode/DataNode.java | 29 + .../datanode/fsdataset/FsDatasetSpi.java | 22 + .../fsdataset/impl/FsDatasetCache.java | 506 ++++++ .../fsdataset/impl/FsDatasetImpl.java | 107 +- .../datanode/fsdataset/impl/FsVolumeImpl.java | 35 +- .../fsdataset/impl/MappableBlock.java | 174 ++ .../datanode/metrics/DataNodeMetrics.java | 16 + .../datanode/metrics/FSDatasetMBean.java | 25 + .../hdfs/server/namenode/CacheManager.java | 1073 +++++++++++++ .../hdfs/server/namenode/CachePool.java | 328 ++++ .../hdfs/server/namenode/CachedBlock.java | 251 +++ .../hdfs/server/namenode/FSDirectory.java | 22 +- .../hdfs/server/namenode/FSEditLog.java | 69 +- .../hdfs/server/namenode/FSEditLogLoader.java | 63 + .../hdfs/server/namenode/FSEditLogOp.java | 425 ++++- .../server/namenode/FSEditLogOpCodes.java | 6 + .../hdfs/server/namenode/FSImageFormat.java | 12 + .../server/namenode/FSImageSerialization.java | 224 +++ .../hdfs/server/namenode/FSNamesystem.java | 302 +++- .../server/namenode/FSPermissionChecker.java | 29 + .../hadoop/hdfs/server/namenode/NameNode.java | 9 +- .../hdfs/server/namenode/NameNodeMXBean.java | 10 + .../server/namenode/NameNodeRpcServer.java | 72 +- .../namenode/metrics/NameNodeMetrics.java | 13 + .../namenode/startupprogress/StepType.java | 12 +- .../hdfs/server/protocol/BlockIdCommand.java | 50 + .../server/protocol/DatanodeProtocol.java | 25 +- .../apache/hadoop/hdfs/tools/CacheAdmin.java | 1059 +++++++++++++ .../hadoop/hdfs/tools/TableListing.java | 284 ++++ .../ImageLoaderCurrent.java | 40 +- .../offlineImageViewer/ImageVisitor.java | 14 +- .../org/apache/hadoop/hdfs/util/XMLUtils.java | 17 +- .../org/apache/hadoop/hdfs/web/JsonUtil.java | 57 +- .../src/main/native/libhdfs/hdfs.c | 2 +- .../main/proto/ClientNamenodeProtocol.proto | 132 ++ .../src/main/proto/DatanodeProtocol.proto | 46 +- .../hadoop-hdfs/src/main/proto/hdfs.proto | 3 + .../src/main/resources/hdfs-default.xml | 96 ++ .../apt/CentralizedCacheManagement.apt.vm | 301 ++++ .../src/site/resources/images/caching.png | Bin 0 -> 27615 bytes .../apache/hadoop/cli/TestCacheAdminCLI.java | 141 ++ .../hadoop/cli/util/CLICommandCacheAdmin.java | 21 + .../cli/util/CacheAdminCmdExecutor.java | 37 + .../org/apache/hadoop/hdfs/DFSTestUtil.java | 23 +- .../hadoop/hdfs/LogVerificationAppender.java | 11 + .../org/apache/hadoop/hdfs/TestDFSUtil.java | 39 + .../hadoop/hdfs/TestDatanodeConfig.java | 37 + .../hadoop/hdfs/protocolPB/TestPBHelper.java | 2 +- .../blockmanagement/TestBlockManager.java | 2 +- .../blockmanagement/TestCachedBlocksList.java | 154 ++ .../TestOverReplicatedBlocks.java | 2 +- .../TestReplicationPolicy.java | 24 +- .../TestReplicationPolicyWithNodeGroup.java | 42 +- .../hdfs/server/common/TestJspHelper.java | 4 +- .../server/datanode/SimulatedFSDataset.java | 44 +- .../server/datanode/TestBPOfferService.java | 2 + .../server/datanode/TestBlockRecovery.java | 2 + .../server/datanode/TestCachingStrategy.java | 14 +- .../server/datanode/TestFsDatasetCache.java | 522 ++++++ .../server/datanode/TestStorageReport.java | 2 +- .../namenode/NNThroughputBenchmark.java | 6 +- .../hdfs/server/namenode/NameNodeAdapter.java | 2 +- .../server/namenode/TestCacheDirectives.java | 1393 +++++++++++++++++ .../server/namenode/TestDeadDatanode.java | 3 +- .../server/namenode/TestNameNodeMXBean.java | 13 + .../namenode/TestNamenodeRetryCache.java | 4 +- .../namenode/ha/TestHAStateTransitions.java | 25 + .../namenode/ha/TestRetryCacheWithHA.java | 411 ++++- .../apache/hadoop/hdfs/web/TestJsonUtil.java | 2 + .../src/test/resources/editsStored | Bin 3943 -> 4401 bytes .../src/test/resources/editsStored.xml | 257 +-- .../src/test/resources/testCacheAdminConf.xml | 493 ++++++ .../src/test/resources/testHDFSConf.xml | 2 +- .../hadoop/mapred/FadvisedChunkedFile.java | 2 +- .../hadoop/mapred/FadvisedFileRegion.java | 2 +- hadoop-project/src/site/site.xml | 1 + 134 files changed, 14867 insertions(+), 360 deletions(-) create mode 100644 hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BatchedRemoteIterator.java create mode 100644 hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/InvalidRequestException.java create mode 100644 hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/IntrusiveCollection.java create mode 100644 hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/fs/TestBlockLocation.java create mode 100644 hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/util/TestLightWeightGSet.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/CacheFlag.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirective.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveEntry.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveInfo.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveIterator.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveStats.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolEntry.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolInfo.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolIterator.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolStats.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/CacheReplicationMonitor.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetCache.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/MappableBlock.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CacheManager.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachePool.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachedBlock.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/BlockIdCommand.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/CacheAdmin.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/TableListing.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/site/apt/CentralizedCacheManagement.apt.vm create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/site/resources/images/caching.png create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/TestCacheAdminCLI.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CLICommandCacheAdmin.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CacheAdminCmdExecutor.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestCachedBlocksList.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestFsDatasetCache.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestCacheDirectives.java create mode 100644 hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testCacheAdminConf.xml diff --git a/dev-support/test-patch.sh b/dev-support/test-patch.sh index 893604e55d6..cc247c580ad 100755 --- a/dev-support/test-patch.sh +++ b/dev-support/test-patch.sh @@ -395,9 +395,9 @@ checkJavadocWarnings () { echo "" echo "There appear to be $javadocWarnings javadoc warnings generated by the patched build." - #There are 11 warnings that are caused by things that are caused by using sun internal APIs. + #There are 12 warnings that are caused by things that are caused by using sun internal APIs. #There are 2 warnings that are caused by the Apache DS Dn class used in MiniKdc. - OK_JAVADOC_WARNINGS=13; + OK_JAVADOC_WARNINGS=14; ### if current warnings greater than OK_JAVADOC_WARNINGS if [[ $javadocWarnings -gt $OK_JAVADOC_WARNINGS ]] ; then JIRA_COMMENT="$JIRA_COMMENT diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BatchedRemoteIterator.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BatchedRemoteIterator.java new file mode 100644 index 00000000000..607fffbcc70 --- /dev/null +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BatchedRemoteIterator.java @@ -0,0 +1,118 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.fs; + +import java.io.IOException; +import java.util.List; +import java.util.NoSuchElementException; + +/** + * A RemoteIterator that fetches elements in batches. + */ +public abstract class BatchedRemoteIterator implements RemoteIterator { + public interface BatchedEntries { + public E get(int i); + public int size(); + public boolean hasMore(); + } + + public static class BatchedListEntries implements BatchedEntries { + private final List entries; + private final boolean hasMore; + + public BatchedListEntries(List entries, boolean hasMore) { + this.entries = entries; + this.hasMore = hasMore; + } + + public E get(int i) { + return entries.get(i); + } + + public int size() { + return entries.size(); + } + + public boolean hasMore() { + return hasMore; + } + } + + private K prevKey; + private BatchedEntries entries; + private int idx; + + public BatchedRemoteIterator(K prevKey) { + this.prevKey = prevKey; + this.entries = null; + this.idx = -1; + } + + /** + * Perform the actual remote request. + * + * @param prevKey The key to send. + * @return A list of replies. + */ + public abstract BatchedEntries makeRequest(K prevKey) throws IOException; + + private void makeRequest() throws IOException { + idx = 0; + entries = null; + entries = makeRequest(prevKey); + if (entries.size() == 0) { + entries = null; + } + } + + private void makeRequestIfNeeded() throws IOException { + if (idx == -1) { + makeRequest(); + } else if ((entries != null) && (idx >= entries.size())) { + if (!entries.hasMore()) { + // Last time, we got fewer entries than requested. + // So we should be at the end. + entries = null; + } else { + makeRequest(); + } + } + } + + @Override + public boolean hasNext() throws IOException { + makeRequestIfNeeded(); + return (entries != null); + } + + /** + * Return the next list key associated with an element. + */ + public abstract K elementToPrevKey(E element); + + @Override + public E next() throws IOException { + makeRequestIfNeeded(); + if (entries == null) { + throw new NoSuchElementException(); + } + E entry = entries.get(idx++); + prevKey = elementToPrevKey(entry); + return entry; + } +} diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BlockLocation.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BlockLocation.java index fa095343c51..286d8514d6f 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BlockLocation.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/BlockLocation.java @@ -31,17 +31,33 @@ import org.apache.hadoop.classification.InterfaceStability; @InterfaceStability.Stable public class BlockLocation { private String[] hosts; // Datanode hostnames + private String[] cachedHosts; // Datanode hostnames with a cached replica private String[] names; // Datanode IP:xferPort for accessing the block private String[] topologyPaths; // Full path name in network topology private long offset; // Offset of the block in the file private long length; private boolean corrupt; + private static final String[] EMPTY_STR_ARRAY = new String[0]; + /** * Default Constructor */ public BlockLocation() { - this(new String[0], new String[0], 0L, 0L); + this(EMPTY_STR_ARRAY, EMPTY_STR_ARRAY, 0L, 0L); + } + + /** + * Copy constructor + */ + public BlockLocation(BlockLocation that) { + this.hosts = that.hosts; + this.cachedHosts = that.cachedHosts; + this.names = that.names; + this.topologyPaths = that.topologyPaths; + this.offset = that.offset; + this.length = that.length; + this.corrupt = that.corrupt; } /** @@ -57,20 +73,7 @@ public class BlockLocation { */ public BlockLocation(String[] names, String[] hosts, long offset, long length, boolean corrupt) { - if (names == null) { - this.names = new String[0]; - } else { - this.names = names; - } - if (hosts == null) { - this.hosts = new String[0]; - } else { - this.hosts = hosts; - } - this.offset = offset; - this.length = length; - this.topologyPaths = new String[0]; - this.corrupt = corrupt; + this(names, hosts, null, offset, length, corrupt); } /** @@ -87,34 +90,55 @@ public class BlockLocation { */ public BlockLocation(String[] names, String[] hosts, String[] topologyPaths, long offset, long length, boolean corrupt) { - this(names, hosts, offset, length, corrupt); + this(names, hosts, null, topologyPaths, offset, length, corrupt); + } + + public BlockLocation(String[] names, String[] hosts, String[] cachedHosts, + String[] topologyPaths, long offset, long length, boolean corrupt) { + if (names == null) { + this.names = EMPTY_STR_ARRAY; + } else { + this.names = names; + } + if (hosts == null) { + this.hosts = EMPTY_STR_ARRAY; + } else { + this.hosts = hosts; + } + if (cachedHosts == null) { + this.cachedHosts = EMPTY_STR_ARRAY; + } else { + this.cachedHosts = cachedHosts; + } if (topologyPaths == null) { - this.topologyPaths = new String[0]; + this.topologyPaths = EMPTY_STR_ARRAY; } else { this.topologyPaths = topologyPaths; } + this.offset = offset; + this.length = length; + this.corrupt = corrupt; } /** * Get the list of hosts (hostname) hosting this block */ public String[] getHosts() throws IOException { - if (hosts == null || hosts.length == 0) { - return new String[0]; - } else { - return hosts; - } + return hosts; + } + + /** + * Get the list of hosts (hostname) hosting a cached replica of the block + */ + public String[] getCachedHosts() { + return cachedHosts; } /** * Get the list of names (IP:xferPort) hosting this block */ public String[] getNames() throws IOException { - if (names == null || names.length == 0) { - return new String[0]; - } else { - return names; - } + return names; } /** @@ -122,11 +146,7 @@ public class BlockLocation { * The last component of the path is the "name" (IP:xferPort). */ public String[] getTopologyPaths() throws IOException { - if (topologyPaths == null || topologyPaths.length == 0) { - return new String[0]; - } else { - return topologyPaths; - } + return topologyPaths; } /** @@ -176,18 +196,29 @@ public class BlockLocation { */ public void setHosts(String[] hosts) throws IOException { if (hosts == null) { - this.hosts = new String[0]; + this.hosts = EMPTY_STR_ARRAY; } else { this.hosts = hosts; } } + /** + * Set the hosts hosting a cached replica of this block + */ + public void setCachedHosts(String[] cachedHosts) { + if (cachedHosts == null) { + this.cachedHosts = EMPTY_STR_ARRAY; + } else { + this.cachedHosts = cachedHosts; + } + } + /** * Set the names (host:port) hosting this block */ public void setNames(String[] names) throws IOException { if (names == null) { - this.names = new String[0]; + this.names = EMPTY_STR_ARRAY; } else { this.names = names; } @@ -198,7 +229,7 @@ public class BlockLocation { */ public void setTopologyPaths(String[] topologyPaths) throws IOException { if (topologyPaths == null) { - this.topologyPaths = new String[0]; + this.topologyPaths = EMPTY_STR_ARRAY; } else { this.topologyPaths = topologyPaths; } diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/InvalidRequestException.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/InvalidRequestException.java new file mode 100644 index 00000000000..437276d5c10 --- /dev/null +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/InvalidRequestException.java @@ -0,0 +1,32 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.fs; + +import java.io.IOException; + +/** + * Thrown when the user makes a malformed request, for example missing required + * parameters or parameters that are not valid. + */ +public class InvalidRequestException extends IOException { + static final long serialVersionUID = 0L; + + public InvalidRequestException(String str) { + super(str); + } +} diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/permission/FsPermission.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/permission/FsPermission.java index 8a3d6e4335f..76950305ed0 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/permission/FsPermission.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/fs/permission/FsPermission.java @@ -304,6 +304,13 @@ public class FsPermission implements Writable { return new FsPermission((short)00666); } + /** + * Get the default permission for cache pools. + */ + public static FsPermission getCachePoolDefault() { + return new FsPermission((short)00755); + } + /** * Create a FsPermission from a Unix symbolic permission string * @param unixSymbolicPermission e.g. "-rw-rw-rw-" diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/ReadaheadPool.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/ReadaheadPool.java index f03a82b5c6b..18099dbb191 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/ReadaheadPool.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/ReadaheadPool.java @@ -203,8 +203,8 @@ public class ReadaheadPool { // It's also possible that we'll end up requesting readahead on some // other FD, which may be wasted work, but won't cause a problem. try { - NativeIO.POSIX.posixFadviseIfPossible(identifier, fd, off, len, - NativeIO.POSIX.POSIX_FADV_WILLNEED); + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible(identifier, + fd, off, len, NativeIO.POSIX.POSIX_FADV_WILLNEED); } catch (IOException ioe) { if (canceled) { // no big deal - the reader canceled the request and closed diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/Text.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/Text.java index a5c8b1ecd5c..e4490f1e34e 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/Text.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/Text.java @@ -454,10 +454,7 @@ public class Text extends BinaryComparable /** Read a UTF8 encoded string from in */ public static String readString(DataInput in) throws IOException { - int length = WritableUtils.readVInt(in); - byte [] bytes = new byte[length]; - in.readFully(bytes, 0, length); - return decode(bytes); + return readString(in, Integer.MAX_VALUE); } /** Read a UTF8 encoded string with a maximum size diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/nativeio/NativeIO.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/nativeio/NativeIO.java index 1412d610431..7ea7e59151b 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/nativeio/NativeIO.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/io/nativeio/NativeIO.java @@ -23,6 +23,9 @@ import java.io.FileInputStream; import java.io.FileOutputStream; import java.io.IOException; import java.io.RandomAccessFile; +import java.lang.reflect.Field; +import java.nio.ByteBuffer; +import java.nio.MappedByteBuffer; import java.util.Map; import java.util.concurrent.ConcurrentHashMap; @@ -33,10 +36,11 @@ import org.apache.hadoop.fs.CommonConfigurationKeys; import org.apache.hadoop.io.SecureIOUtils.AlreadyExistsException; import org.apache.hadoop.util.NativeCodeLoader; import org.apache.hadoop.util.Shell; - import org.apache.commons.logging.Log; import org.apache.commons.logging.LogFactory; +import sun.misc.Unsafe; + import com.google.common.annotations.VisibleForTesting; /** @@ -94,9 +98,6 @@ public class NativeIO { private static final Log LOG = LogFactory.getLog(NativeIO.class); - @VisibleForTesting - public static CacheTracker cacheTracker = null; - private static boolean nativeLoaded = false; private static boolean fadvisePossible = true; private static boolean syncFileRangePossible = true; @@ -107,10 +108,71 @@ public class NativeIO { private static long cacheTimeout = -1; - public static interface CacheTracker { - public void fadvise(String identifier, long offset, long len, int flags); + private static CacheManipulator cacheManipulator = new CacheManipulator(); + + public static CacheManipulator getCacheManipulator() { + return cacheManipulator; } - + + public static void setCacheManipulator(CacheManipulator cacheManipulator) { + POSIX.cacheManipulator = cacheManipulator; + } + + /** + * Used to manipulate the operating system cache. + */ + @VisibleForTesting + public static class CacheManipulator { + public void mlock(String identifier, ByteBuffer buffer, + long len) throws IOException { + POSIX.mlock(buffer, len); + } + + public long getMemlockLimit() { + return NativeIO.getMemlockLimit(); + } + + public long getOperatingSystemPageSize() { + return NativeIO.getOperatingSystemPageSize(); + } + + public void posixFadviseIfPossible(String identifier, + FileDescriptor fd, long offset, long len, int flags) + throws NativeIOException { + NativeIO.POSIX.posixFadviseIfPossible(identifier, fd, offset, + len, flags); + } + + public boolean verifyCanMlock() { + return NativeIO.isAvailable(); + } + } + + /** + * A CacheManipulator used for testing which does not actually call mlock. + * This allows many tests to be run even when the operating system does not + * allow mlock, or only allows limited mlocking. + */ + @VisibleForTesting + public static class NoMlockCacheManipulator extends CacheManipulator { + public void mlock(String identifier, ByteBuffer buffer, + long len) throws IOException { + LOG.info("mlocking " + identifier); + } + + public long getMemlockLimit() { + return 1125899906842624L; + } + + public long getOperatingSystemPageSize() { + return 4096; + } + + public boolean verifyCanMlock() { + return true; + } + } + static { if (NativeCodeLoader.isNativeCodeLoaded()) { try { @@ -145,6 +207,12 @@ public class NativeIO { return NativeCodeLoader.isNativeCodeLoaded() && nativeLoaded; } + private static void assertCodeLoaded() throws IOException { + if (!isAvailable()) { + throw new IOException("NativeIO was not loaded"); + } + } + /** Wrapper around open(2) */ public static native FileDescriptor open(String path, int flags, int mode) throws IOException; /** Wrapper around fstat(2) */ @@ -187,12 +255,9 @@ public class NativeIO { * * @throws NativeIOException if there is an error with the syscall */ - public static void posixFadviseIfPossible(String identifier, + static void posixFadviseIfPossible(String identifier, FileDescriptor fd, long offset, long len, int flags) throws NativeIOException { - if (cacheTracker != null) { - cacheTracker.fadvise(identifier, offset, len, flags); - } if (nativeLoaded && fadvisePossible) { try { posix_fadvise(fd, offset, len, flags); @@ -225,6 +290,66 @@ public class NativeIO { } } + static native void mlock_native( + ByteBuffer buffer, long len) throws NativeIOException; + static native void munlock_native( + ByteBuffer buffer, long len) throws NativeIOException; + + /** + * Locks the provided direct ByteBuffer into memory, preventing it from + * swapping out. After a buffer is locked, future accesses will not incur + * a page fault. + * + * See the mlock(2) man page for more information. + * + * @throws NativeIOException + */ + static void mlock(ByteBuffer buffer, long len) + throws IOException { + assertCodeLoaded(); + if (!buffer.isDirect()) { + throw new IOException("Cannot mlock a non-direct ByteBuffer"); + } + mlock_native(buffer, len); + } + + /** + * Unlocks a locked direct ByteBuffer, allowing it to swap out of memory. + * This is a no-op if the ByteBuffer was not previously locked. + * + * See the munlock(2) man page for more information. + * + * @throws NativeIOException + */ + public static void munlock(ByteBuffer buffer, long len) + throws IOException { + assertCodeLoaded(); + if (!buffer.isDirect()) { + throw new IOException("Cannot munlock a non-direct ByteBuffer"); + } + munlock_native(buffer, len); + } + + /** + * Unmaps the block from memory. See munmap(2). + * + * There isn't any portable way to unmap a memory region in Java. + * So we use the sun.nio method here. + * Note that unmapping a memory region could cause crashes if code + * continues to reference the unmapped code. However, if we don't + * manually unmap the memory, we are dependent on the finalizer to + * do it, and we have no idea when the finalizer will run. + * + * @param buffer The buffer to unmap. + */ + public static void munmap(MappedByteBuffer buffer) { + if (buffer instanceof sun.nio.ch.DirectBuffer) { + sun.misc.Cleaner cleaner = + ((sun.nio.ch.DirectBuffer)buffer).cleaner(); + cleaner.clean(); + } + } + /** Linux only methods used for getOwner() implementation */ private static native long getUIDforFDOwnerforOwner(FileDescriptor fd) throws IOException; private static native String getUserName(long uid) throws IOException; @@ -478,6 +603,35 @@ public class NativeIO { /** Initialize the JNI method ID and class ID cache */ private static native void initNative(); + /** + * Get the maximum number of bytes that can be locked into memory at any + * given point. + * + * @return 0 if no bytes can be locked into memory; + * Long.MAX_VALUE if there is no limit; + * The number of bytes that can be locked into memory otherwise. + */ + static long getMemlockLimit() { + return isAvailable() ? getMemlockLimit0() : 0; + } + + private static native long getMemlockLimit0(); + + /** + * @return the operating system's page size. + */ + static long getOperatingSystemPageSize() { + try { + Field f = Unsafe.class.getDeclaredField("theUnsafe"); + f.setAccessible(true); + Unsafe unsafe = (Unsafe)f.get(null); + return unsafe.pageSize(); + } catch (Throwable e) { + LOG.warn("Unable to get operating system page size. Guessing 4096.", e); + return 4096; + } + } + private static class CachedUid { final long timestamp; final String username; diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/UserGroupInformation.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/UserGroupInformation.java index 729a014575d..69aade19ec8 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/UserGroupInformation.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/security/UserGroupInformation.java @@ -1287,6 +1287,14 @@ public class UserGroupInformation { return null; } + public String getPrimaryGroupName() throws IOException { + String[] groups = getGroupNames(); + if (groups.length == 0) { + throw new IOException("There is no primary group for UGI " + this); + } + return groups[0]; + } + /** * Get the user's full principal name. * @return the user's full principal name. diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/IntrusiveCollection.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/IntrusiveCollection.java new file mode 100644 index 00000000000..0512d4aa5d1 --- /dev/null +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/IntrusiveCollection.java @@ -0,0 +1,373 @@ +/* + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.util; + +import java.util.Collection; +import java.util.Iterator; +import java.util.NoSuchElementException; + +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.classification.InterfaceAudience; + +import com.google.common.base.Preconditions; + +/** + * Implements an intrusive doubly-linked list. + * + * An intrusive linked list is one in which the elements themselves are + * responsible for storing the pointers to previous and next elements. + * This can save a lot of memory if there are many elements in the list or + * many lists. + */ +@InterfaceAudience.Private +public class IntrusiveCollection + implements Collection { + /** + * An element contained in this list. + * + * We pass the list itself as a parameter so that elements can belong to + * multiple lists. (The element will need to store separate prev and next + * pointers for each.) + */ + @InterfaceAudience.Private + public interface Element { + /** + * Insert this element into the list. This is the first thing that will + * be called on the element. + */ + void insertInternal(IntrusiveCollection list, + Element prev, Element next); + + /** + * Set the prev pointer of an element already in the list. + */ + void setPrev(IntrusiveCollection list, Element prev); + + /** + * Set the next pointer of an element already in the list. + */ + void setNext(IntrusiveCollection list, Element next); + + /** + * Remove an element from the list. This is the last thing that will be + * called on an element. + */ + void removeInternal(IntrusiveCollection list); + + /** + * Get the prev pointer of an element. + */ + Element getPrev(IntrusiveCollection list); + + /** + * Get the next pointer of an element. + */ + Element getNext(IntrusiveCollection list); + + /** + * Returns true if this element is in the provided list. + */ + boolean isInList(IntrusiveCollection list); + } + + private Element root = new Element() { + // We keep references to the first and last elements for easy access. + Element first = this; + Element last = this; + + @Override + public void insertInternal(IntrusiveCollection list, + Element prev, Element next) { + throw new RuntimeException("Can't insert root element"); + } + + @Override + public void setPrev(IntrusiveCollection list, + Element prev) { + Preconditions.checkState(list == IntrusiveCollection.this); + last = prev; + } + + @Override + public void setNext(IntrusiveCollection list, + Element next) { + Preconditions.checkState(list == IntrusiveCollection.this); + first = next; + } + + @Override + public void removeInternal(IntrusiveCollection list) { + throw new RuntimeException("Can't remove root element"); + } + + @Override + public Element getNext( + IntrusiveCollection list) { + Preconditions.checkState(list == IntrusiveCollection.this); + return first; + } + + @Override + public Element getPrev( + IntrusiveCollection list) { + Preconditions.checkState(list == IntrusiveCollection.this); + return last; + } + + @Override + public boolean isInList(IntrusiveCollection list) { + return list == IntrusiveCollection.this; + } + + @Override + public String toString() { + return "root"; // + IntrusiveCollection.this + "]"; + } + }; + + private int size = 0; + + /** + * An iterator over the intrusive collection. + * + * Currently, you can remove elements from the list using + * #{IntrusiveIterator#remove()}, but modifying the collection in other + * ways during the iteration is not supported. + */ + public class IntrusiveIterator implements Iterator { + Element cur; + Element next; + + IntrusiveIterator() { + this.cur = root; + this.next = null; + } + + @Override + public boolean hasNext() { + if (next == null) { + next = cur.getNext(IntrusiveCollection.this); + } + return next != root; + } + + @SuppressWarnings("unchecked") + @Override + public E next() { + if (next == null) { + next = cur.getNext(IntrusiveCollection.this); + } + if (next == root) { + throw new NoSuchElementException(); + } + cur = next; + next = null; + return (E)cur; + } + + @Override + public void remove() { + if (cur == null) { + throw new IllegalStateException("Already called remove " + + "once on this element."); + } + next = removeElement(cur); + cur = null; + } + } + + private Element removeElement(Element elem) { + Element prev = elem.getPrev(IntrusiveCollection.this); + Element next = elem.getNext(IntrusiveCollection.this); + elem.removeInternal(IntrusiveCollection.this); + prev.setNext(IntrusiveCollection.this, next); + next.setPrev(IntrusiveCollection.this, prev); + size--; + return next; + } + + /** + * Get an iterator over the list. This can be used to remove elements. + * It is not safe to do concurrent modifications from other threads while + * using this iterator. + * + * @return The iterator. + */ + public Iterator iterator() { + return new IntrusiveIterator(); + } + + @Override + public int size() { + return size; + } + + @Override + public boolean isEmpty() { + return size == 0; + } + + @Override + public boolean contains(Object o) { + try { + Element element = (Element)o; + return element.isInList(this); + } catch (ClassCastException e) { + return false; + } + } + + @Override + public Object[] toArray() { + Object ret[] = new Object[size]; + int i = 0; + for (Iterator iter = iterator(); iter.hasNext(); ) { + ret[i++] = iter.next(); + } + return ret; + } + + @SuppressWarnings("unchecked") + @Override + public T[] toArray(T[] array) { + if (array.length < size) { + return (T[])toArray(); + } else { + int i = 0; + for (Iterator iter = iterator(); iter.hasNext(); ) { + array[i++] = (T)iter.next(); + } + } + return array; + } + + /** + * Add an element to the end of the list. + * + * @param elem The new element to add. + */ + @Override + public boolean add(E elem) { + if (elem == null) { + return false; + } + if (elem.isInList(this)) { + return false; + } + Element prev = root.getPrev(IntrusiveCollection.this); + prev.setNext(IntrusiveCollection.this, elem); + root.setPrev(IntrusiveCollection.this, elem); + elem.insertInternal(IntrusiveCollection.this, prev, root); + size++; + return true; + } + + /** + * Add an element to the front of the list. + * + * @param elem The new element to add. + */ + public boolean addFirst(Element elem) { + if (elem == null) { + return false; + } + if (elem.isInList(this)) { + return false; + } + Element next = root.getNext(IntrusiveCollection.this); + next.setPrev(IntrusiveCollection.this, elem); + root.setNext(IntrusiveCollection.this, elem); + elem.insertInternal(IntrusiveCollection.this, root, next); + size++; + return true; + } + + public static final Log LOG = LogFactory.getLog(IntrusiveCollection.class); + + @Override + public boolean remove(Object o) { + try { + Element elem = (Element)o; + if (!elem.isInList(this)) { + return false; + } + removeElement(elem); + return true; + } catch (ClassCastException e) { + return false; + } + } + + @Override + public boolean containsAll(Collection collection) { + for (Object o : collection) { + if (!contains(o)) { + return false; + } + } + return true; + } + + @Override + public boolean addAll(Collection collection) { + boolean changed = false; + for (E elem : collection) { + if (add(elem)) { + changed = true; + } + } + return changed; + } + + @Override + public boolean removeAll(Collection collection) { + boolean changed = false; + for (Object elem : collection) { + if (remove(elem)) { + changed = true; + } + } + return changed; + } + + @Override + public boolean retainAll(Collection collection) { + boolean changed = false; + for (Iterator iter = iterator(); + iter.hasNext(); ) { + Element elem = iter.next(); + if (!collection.contains(elem)) { + iter.remove(); + changed = true; + } + } + return changed; + } + + /** + * Remove all elements. + */ + @Override + public void clear() { + for (Iterator iter = iterator(); iter.hasNext(); ) { + iter.next(); + iter.remove(); + } + } +} diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightCache.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightCache.java index 7e7ad2c3458..a0a553af103 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightCache.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightCache.java @@ -18,6 +18,7 @@ package org.apache.hadoop.util; import java.util.Comparator; +import java.util.Iterator; import java.util.PriorityQueue; import org.apache.hadoop.HadoopIllegalArgumentException; @@ -235,4 +236,28 @@ public class LightWeightCache extends LightWeightGSet { } return removed; } + + @Override + public Iterator iterator() { + final Iterator iter = super.iterator(); + return new Iterator() { + @Override + public boolean hasNext() { + return iter.hasNext(); + } + + @Override + public E next() { + return iter.next(); + } + + @Override + public void remove() { + // It would be tricky to support this because LightWeightCache#remove + // may evict multiple elements via evictExpiredEntries. + throw new UnsupportedOperationException("Remove via iterator is " + + "not supported for LightWeightCache"); + } + }; + } } diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightGSet.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightGSet.java index cdc991fcb5c..f1661d750d7 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightGSet.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/LightWeightGSet.java @@ -246,10 +246,10 @@ public class LightWeightGSet implements GSet { private class SetIterator implements Iterator { /** The starting modification for fail-fast. */ - private final int startModification = modification; + private int iterModification = modification; /** The current index of the entry array. */ private int index = -1; - /** The next element to return. */ + private LinkedElement cur = null; private LinkedElement next = nextNonemptyEntry(); /** Find the next nonempty entry starting at (index + 1). */ @@ -258,30 +258,51 @@ public class LightWeightGSet implements GSet { return index < entries.length? entries[index]: null; } + private void ensureNext() { + if (modification != iterModification) { + throw new ConcurrentModificationException("modification=" + modification + + " != iterModification = " + iterModification); + } + if (next != null) { + return; + } + if (cur == null) { + return; + } + next = cur.getNext(); + if (next == null) { + next = nextNonemptyEntry(); + } + } + @Override public boolean hasNext() { + ensureNext(); return next != null; } @Override public E next() { - if (modification != startModification) { - throw new ConcurrentModificationException("modification=" + modification - + " != startModification = " + startModification); + ensureNext(); + if (next == null) { + throw new IllegalStateException("There are no more elements"); } - - final E e = convert(next); - - //find the next element - final LinkedElement n = next.getNext(); - next = n != null? n: nextNonemptyEntry(); - - return e; + cur = next; + next = null; + return convert(cur); } + @SuppressWarnings("unchecked") @Override public void remove() { - throw new UnsupportedOperationException("Remove is not supported."); + ensureNext(); + if (cur == null) { + throw new IllegalStateException("There is no current element " + + "to remove"); + } + LightWeightGSet.this.remove((K)cur); + iterModification++; + cur = null; } } diff --git a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/StringUtils.java b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/StringUtils.java index dfa8e65df47..f96353732d4 100644 --- a/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/StringUtils.java +++ b/hadoop-common-project/hadoop-common/src/main/java/org/apache/hadoop/util/StringUtils.java @@ -918,4 +918,83 @@ public class StringUtils { } return str.toString(); } + + /** + * From a list of command-line arguments, remove both an option and the + * next argument. + * + * @param name Name of the option to remove. Example: -foo. + * @param args List of arguments. + * @return null if the option was not found; the value of the + * option otherwise. + * @throws IllegalArgumentException if the option's argument is not present + */ + public static String popOptionWithArgument(String name, List args) + throws IllegalArgumentException { + String val = null; + for (Iterator iter = args.iterator(); iter.hasNext(); ) { + String cur = iter.next(); + if (cur.equals("--")) { + // stop parsing arguments when you see -- + break; + } else if (cur.equals(name)) { + iter.remove(); + if (!iter.hasNext()) { + throw new IllegalArgumentException("option " + name + " requires 1 " + + "argument."); + } + val = iter.next(); + iter.remove(); + break; + } + } + return val; + } + + /** + * From a list of command-line arguments, remove an option. + * + * @param name Name of the option to remove. Example: -foo. + * @param args List of arguments. + * @return true if the option was found and removed; false otherwise. + */ + public static boolean popOption(String name, List args) { + for (Iterator iter = args.iterator(); iter.hasNext(); ) { + String cur = iter.next(); + if (cur.equals("--")) { + // stop parsing arguments when you see -- + break; + } else if (cur.equals(name)) { + iter.remove(); + return true; + } + } + return false; + } + + /** + * From a list of command-line arguments, return the first non-option + * argument. Non-option arguments are those which either come after + * a double dash (--) or do not start with a dash. + * + * @param args List of arguments. + * @return The first non-option argument, or null if there were none. + */ + public static String popFirstNonOption(List args) { + for (Iterator iter = args.iterator(); iter.hasNext(); ) { + String cur = iter.next(); + if (cur.equals("--")) { + if (!iter.hasNext()) { + return null; + } + cur = iter.next(); + iter.remove(); + return cur; + } else if (!cur.startsWith("-")) { + iter.remove(); + return cur; + } + } + return null; + } } diff --git a/hadoop-common-project/hadoop-common/src/main/native/src/org/apache/hadoop/io/nativeio/NativeIO.c b/hadoop-common-project/hadoop-common/src/main/native/src/org/apache/hadoop/io/nativeio/NativeIO.c index cb21a7bee66..a26bf34c12e 100644 --- a/hadoop-common-project/hadoop-common/src/main/native/src/org/apache/hadoop/io/nativeio/NativeIO.c +++ b/hadoop-common-project/hadoop-common/src/main/native/src/org/apache/hadoop/io/nativeio/NativeIO.c @@ -16,8 +16,6 @@ * limitations under the License. */ -#define _GNU_SOURCE - #include "org_apache_hadoop.h" #include "org_apache_hadoop_io_nativeio_NativeIO.h" @@ -28,11 +26,15 @@ #include #include #include +#include #include #include #include +#include +#include #include #include +#include #include #include #include "config.h" @@ -360,6 +362,71 @@ Java_org_apache_hadoop_io_nativeio_NativeIO_00024POSIX_sync_1file_1range( #endif } +#define CHECK_DIRECT_BUFFER_ADDRESS(buf) \ + { \ + if (!buf) { \ + THROW(env, "java/lang/UnsupportedOperationException", \ + "JNI access to direct buffers not available"); \ + return; \ + } \ + } + +/** + * public static native void mlock_native( + * ByteBuffer buffer, long offset); + * + * The "00024" in the function name is an artifact of how JNI encodes + * special characters. U+0024 is '$'. + */ +JNIEXPORT void JNICALL +Java_org_apache_hadoop_io_nativeio_NativeIO_00024POSIX_mlock_1native( + JNIEnv *env, jclass clazz, + jobject buffer, jlong len) +{ +#ifdef UNIX + void* buf = (void*)(*env)->GetDirectBufferAddress(env, buffer); + PASS_EXCEPTIONS(env); + + if (mlock(buf, len)) { + CHECK_DIRECT_BUFFER_ADDRESS(buf); + throw_ioe(env, errno); + } +#endif + +#ifdef WINDOWS + THROW(env, "java/io/IOException", + "The function POSIX.mlock_native() is not supported on Windows"); +#endif +} + +/** + * public static native void munlock_native( + * ByteBuffer buffer, long offset); + * + * The "00024" in the function name is an artifact of how JNI encodes + * special characters. U+0024 is '$'. + */ +JNIEXPORT void JNICALL +Java_org_apache_hadoop_io_nativeio_NativeIO_00024POSIX_munlock_1native( + JNIEnv *env, jclass clazz, + jobject buffer, jlong len) +{ +#ifdef UNIX + void* buf = (void*)(*env)->GetDirectBufferAddress(env, buffer); + PASS_EXCEPTIONS(env); + + if (munlock(buf, len)) { + CHECK_DIRECT_BUFFER_ADDRESS(buf); + throw_ioe(env, errno); + } +#endif + +#ifdef WINDOWS + THROW(env, "java/io/IOException", + "The function POSIX.munlock_native() is not supported on Windows"); +#endif +} + #ifdef __FreeBSD__ static int toFreeBSDFlags(int flags) { @@ -924,6 +991,24 @@ done: #endif } +JNIEXPORT jlong JNICALL +Java_org_apache_hadoop_io_nativeio_NativeIO_getMemlockLimit0( +JNIEnv *env, jclass clazz) +{ +#ifdef WINDOWS + return 0; +#else + struct rlimit rlim; + int rc = getrlimit(RLIMIT_MEMLOCK, &rlim); + if (rc != 0) { + throw_ioe(env, errno); + return 0; + } + return (rlim.rlim_cur == RLIM_INFINITY) ? + INT64_MAX : rlim.rlim_cur; +#endif +} + /** * vim: sw=2: ts=2: et: */ diff --git a/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/fs/TestBlockLocation.java b/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/fs/TestBlockLocation.java new file mode 100644 index 00000000000..3cb608a971f --- /dev/null +++ b/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/fs/TestBlockLocation.java @@ -0,0 +1,108 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.fs; + +import static org.junit.Assert.assertArrayEquals; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertNotNull; + +import org.junit.Test; + +public class TestBlockLocation { + + private static final String[] EMPTY_STR_ARRAY = new String[0]; + + private static void checkBlockLocation(final BlockLocation loc) + throws Exception { + checkBlockLocation(loc, 0, 0, false); + } + + private static void checkBlockLocation(final BlockLocation loc, + final long offset, final long length, final boolean corrupt) + throws Exception { + checkBlockLocation(loc, EMPTY_STR_ARRAY, EMPTY_STR_ARRAY, EMPTY_STR_ARRAY, + EMPTY_STR_ARRAY, offset, length, corrupt); + } + + private static void checkBlockLocation(final BlockLocation loc, + String[] names, String[] hosts, String[] cachedHosts, + String[] topologyPaths, final long offset, final long length, + final boolean corrupt) throws Exception { + assertNotNull(loc.getHosts()); + assertNotNull(loc.getCachedHosts()); + assertNotNull(loc.getNames()); + assertNotNull(loc.getTopologyPaths()); + + assertArrayEquals(hosts, loc.getHosts()); + assertArrayEquals(cachedHosts, loc.getCachedHosts()); + assertArrayEquals(names, loc.getNames()); + assertArrayEquals(topologyPaths, loc.getTopologyPaths()); + + assertEquals(offset, loc.getOffset()); + assertEquals(length, loc.getLength()); + assertEquals(corrupt, loc.isCorrupt()); + } + + /** + * Call all the constructors and verify the delegation is working properly + */ + @Test(timeout = 5000) + public void testBlockLocationConstructors() throws Exception { + // + BlockLocation loc; + loc = new BlockLocation(); + checkBlockLocation(loc); + loc = new BlockLocation(null, null, 1, 2); + checkBlockLocation(loc, 1, 2, false); + loc = new BlockLocation(null, null, null, 1, 2); + checkBlockLocation(loc, 1, 2, false); + loc = new BlockLocation(null, null, null, 1, 2, true); + checkBlockLocation(loc, 1, 2, true); + loc = new BlockLocation(null, null, null, null, 1, 2, true); + checkBlockLocation(loc, 1, 2, true); + } + + /** + * Call each of the setters and verify + */ + @Test(timeout = 5000) + public void testBlockLocationSetters() throws Exception { + BlockLocation loc; + loc = new BlockLocation(); + // Test that null sets the empty array + loc.setHosts(null); + loc.setCachedHosts(null); + loc.setNames(null); + loc.setTopologyPaths(null); + checkBlockLocation(loc); + // Test that not-null gets set properly + String[] names = new String[] { "name" }; + String[] hosts = new String[] { "host" }; + String[] cachedHosts = new String[] { "cachedHost" }; + String[] topologyPaths = new String[] { "path" }; + loc.setNames(names); + loc.setHosts(hosts); + loc.setCachedHosts(cachedHosts); + loc.setTopologyPaths(topologyPaths); + loc.setOffset(1); + loc.setLength(2); + loc.setCorrupt(true); + checkBlockLocation(loc, names, hosts, cachedHosts, topologyPaths, 1, 2, + true); + } +} diff --git a/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/nativeio/TestNativeIO.java b/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/nativeio/TestNativeIO.java index 2e7c62c9339..521ec099716 100644 --- a/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/nativeio/TestNativeIO.java +++ b/hadoop-common-project/hadoop-common/src/test/java/org/apache/hadoop/io/nativeio/TestNativeIO.java @@ -24,6 +24,9 @@ import java.io.FileOutputStream; import java.io.FileReader; import java.io.FileWriter; import java.io.IOException; +import java.nio.MappedByteBuffer; +import java.nio.channels.FileChannel; +import java.nio.channels.FileChannel.MapMode; import java.util.concurrent.atomic.AtomicReference; import java.util.ArrayList; import java.util.Arrays; @@ -32,6 +35,7 @@ import java.util.List; import org.junit.Assert; import org.junit.Before; import org.junit.Test; + import static org.junit.Assume.*; import static org.junit.Assert.*; @@ -45,6 +49,7 @@ import org.apache.hadoop.fs.Path; import org.apache.hadoop.fs.permission.FsPermission; import org.apache.hadoop.security.UserGroupInformation; import org.apache.hadoop.util.NativeCodeLoader; +import org.apache.hadoop.util.Shell; import org.apache.hadoop.util.Time; public class TestNativeIO { @@ -563,4 +568,60 @@ public class TestNativeIO { FileUtils.deleteQuietly(TEST_DIR); } + + @Test(timeout=10000) + public void testMlock() throws Exception { + assumeTrue(NativeIO.isAvailable()); + assumeTrue(Shell.LINUX); + final File TEST_FILE = new File(new File( + System.getProperty("test.build.data","build/test/data")), + "testMlockFile"); + final int BUF_LEN = 12289; + byte buf[] = new byte[BUF_LEN]; + int bufSum = 0; + for (int i = 0; i < buf.length; i++) { + buf[i] = (byte)(i % 60); + bufSum += buf[i]; + } + FileOutputStream fos = new FileOutputStream(TEST_FILE); + try { + fos.write(buf); + fos.getChannel().force(true); + } finally { + fos.close(); + } + + FileInputStream fis = null; + FileChannel channel = null; + try { + // Map file into memory + fis = new FileInputStream(TEST_FILE); + channel = fis.getChannel(); + long fileSize = channel.size(); + MappedByteBuffer mapbuf = channel.map(MapMode.READ_ONLY, 0, fileSize); + // mlock the buffer + NativeIO.POSIX.mlock(mapbuf, fileSize); + // Read the buffer + int sum = 0; + for (int i=0; i getRandomList(int length, int randomSeed) { + Random random = new Random(randomSeed); + ArrayList list = new ArrayList(length); + for (int i = 0; i < length; i++) { + list.add(random.nextInt()); + } + return list; + } + + private static class TestElement implements LightWeightGSet.LinkedElement { + private final int val; + private LinkedElement next; + + TestElement(int val) { + this.val = val; + this.next = null; + } + + public int getVal() { + return val; + } + + @Override + public void setNext(LinkedElement next) { + this.next = next; + } + + @Override + public LinkedElement getNext() { + return next; + } + } + + @Test(timeout=60000) + public void testRemoveAllViaIterator() { + ArrayList list = getRandomList(100, 123); + LightWeightGSet set = + new LightWeightGSet(16); + for (Integer i : list) { + set.put(new TestElement(i)); + } + for (Iterator iter = set.iterator(); + iter.hasNext(); ) { + iter.next(); + iter.remove(); + } + Assert.assertEquals(0, set.size()); + } + + @Test(timeout=60000) + public void testRemoveSomeViaIterator() { + ArrayList list = getRandomList(100, 123); + LightWeightGSet set = + new LightWeightGSet(16); + for (Integer i : list) { + set.put(new TestElement(i)); + } + long sum = 0; + for (Iterator iter = set.iterator(); + iter.hasNext(); ) { + sum += iter.next().getVal(); + } + long mode = sum / set.size(); + LOG.info("Removing all elements above " + mode); + for (Iterator iter = set.iterator(); + iter.hasNext(); ) { + int item = iter.next().getVal(); + if (item > mode) { + iter.remove(); + } + } + for (Iterator iter = set.iterator(); + iter.hasNext(); ) { + Assert.assertTrue(iter.next().getVal() <= mode); + } + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/CHANGES.txt b/hadoop-hdfs-project/hadoop-hdfs/CHANGES.txt index 04e4b4307f5..c395bff788b 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/CHANGES.txt +++ b/hadoop-hdfs-project/hadoop-hdfs/CHANGES.txt @@ -36,6 +36,8 @@ Release 2.4.0 - UNRELEASED HDFS-5703. Add support for HTTPS and swebhdfs to HttpFS. (tucu) + HDFS-4949. Centralized cache management in HDFS (wang and cmccabe) + IMPROVEMENTS HDFS-5267. Remove volatile from LightWeightHashSet. (Junping Du via llu) @@ -426,6 +428,211 @@ Release 2.4.0 - UNRELEASED HDFS-5667. Include DatanodeStorage in StorageReport. (Arpit Agarwal) + BREAKDOWN OF HDFS-4949 SUBTASKS AND RELATED JIRAS + + HDFS-5049. Add JNI mlock support. (Andrew Wang via Colin Patrick McCabe) + + HDFS-5051. Propagate cache status information from the DataNode to the + NameNode (Andrew Wang via Colin Patrick McCabe) + + HDFS-5052. Add cacheRequest/uncacheRequest support to NameNode. + (Contributed by Colin Patrick McCabe.) + + HDFS-5050. Add DataNode support for mlock and munlock (contributed by + Andrew Wang) + + HDFS-5141. Add cache status information to datanode heartbeat. (Contributed + by Andrew Wang) + + HDFS-5121. Add RPCs for creating and manipulating cache pools. + (Contributed by Colin Patrick McCabe) + + HDFS-5163. Miscellaneous cache pool RPC fixes (Contributed by Colin Patrick + McCabe) + + HDFS-5169. hdfs.c: translateZCRException: null pointer deref when + translating some exceptions (Contributed by Colin Patrick McCabe) + + HDFS-5120. Add command-line support for manipulating cache pools. (cmccabe) + + HDFS-5158. Add command-line support for manipulating cache directives. + (cmccabe) + + HDFS-5198. NameNodeRpcServer must not send back DNA_FINALIZE in reply to a + cache report. (cmccabe) + + HDFS-5195. Prevent passing null pointer to mlock and munlock. Contributed + by Chris Nauroth. + + HDFS-5053. NameNode should invoke DataNode APIs to coordinate caching. + (Andrew Wang) + + HDFS-5201. NativeIO: consolidate getrlimit into NativeIO#getMemlockLimit. + (Contributed by Colin Patrick McCabe) + + HDFS-5197. Document dfs.cachereport.intervalMsec in hdfs-default.xml. + Contributed by Chris Nauroth. + + HDFS-5210. Fix some failing unit tests on HDFS-4949 branch. (Contributed by + Andrew Wang) + + HDFS-5213. Separate PathBasedCacheEntry and PathBasedCacheDirectiveWithId. + Contributed by Colin Patrick McCabe. + + HDFS-5236. Change PathBasedCacheDirective APIs to be a single value rather + than batch. (Contributed by Andrew Wang) + + HDFS-5119. Persist CacheManager state in the edit log. (Contributed by + Andrew Wang) + + HDFS-5190. Move cache pool related CLI commands to CacheAdmin. (Contributed + by Andrew Wang) + + HDFS-5309. Fix failing caching unit tests. (Andrew Wang) + + HDFS-5314. Do not expose CachePool type in AddCachePoolOp (Colin Patrick + McCabe) + + HDFS-5304. Expose if a block replica is cached in getFileBlockLocations. + (Contributed by Andrew Wang) + + HDFS-5224. Refactor PathBasedCache* methods to use a Path rather than a + String. Contributed by Chris Nauroth. + + HDFS-5348. Fix error message when dfs.datanode.max.locked.memory is + improperly configured. (Contributed by Colin Patrick McCabe) + + HDFS-5349. DNA_CACHE and DNA_UNCACHE should be by blockId only (cmccabe) + + HDFS-5358. Add replication field to PathBasedCacheDirective. (Contributed + by Colin Patrick McCabe) + + HDFS-5359. Allow LightWeightGSet#Iterator to remove elements. (Contributed + by Colin Patrick McCabe) + + HDFS-5373. hdfs cacheadmin -addDirective short usage does not mention + -replication parameter. Contributed by Chris Nauroth. + + HDFS-5096. Automatically cache new data added to a cached path (contributed + by Colin Patrick McCabe) + + HDFS-5383. fix broken caching unit tests (Andrew Wang) + + HDFS-5388. Loading fsimage fails to find cache pools during namenode + startup (Chris Nauroth via Colin Patrick McCabe) + + HDFS-5203. Concurrent clients that add a cache directive on the same path + may prematurely uncache each other. (Chris Nauroth via Colin Patrick McCabe) + + HDFS-5378. In CacheReport, don't send genstamp and length on the wire + (Contributed by Colin Patrick McCabe) + + HDFS-5385. Caching RPCs are AtMostOnce, but do not persist client ID and + call ID to edit log. (Chris Nauroth via Colin Patrick McCabe) + + HDFS-5404 Resolve regressions in Windows compatibility on HDFS-4949 branch. + Contributed by Chris Nauroth. + + HDFS-5405. Fix possible RetryCache hang for caching RPC handlers in + FSNamesystem. (Contributed by Andrew Wang) + + HDFS-5419. Fixup test-patch.sh warnings on HDFS-4949 branch. (wang) + + HDFS-5386. Add feature documentation for datanode caching. Contributed by + Colin Patrick McCabe. + + HDFS-5468. CacheAdmin help command does not recognize commands (Stephen + Chu via Colin Patrick McCabe) + + HDFS-5326. add modifyDirective to cacheAdmin (cmccabe) + + HDFS-5394: Fix race conditions in DN caching and uncaching (cmccabe) + + HDFS-5320. Add datanode caching metrics. Contributed by Andrew Wang. + + HDFS-5482. DistributedFileSystem#listPathBasedCacheDirectives must support + relative paths. Contributed by Colin Patrick McCabe. + + HDFS-5471. CacheAdmin -listPools fails when user lacks permissions to view + all pools (Andrew Wang via Colin Patrick McCabe) + + HDFS-5450. better API for getting the cached blocks locations. Contributed + by Andrew Wang. + + HDFS-5485. add command-line support for modifyDirective (cmccabe) + + HDFS-5366. recaching improvements (cmccabe) + + HDFS-5520. loading cache path directives from edit log doesnt update + nextEntryId (cmccabe) + + HDFS-5512. CacheAdmin -listPools fails with NPE when user lacks permissions + to view all pools (awang via cmccabe) + + HDFS-5513. CacheAdmin commands fail when using . as the path. Contributed + by Andrew Wang. + + HDFS-5511. improve CacheManipulator interface to allow better unit testing + (cmccabe) + + HDFS-5451. Add byte and file statistics to PathBasedCacheEntry. Contributed + by Colin Patrick McCabe. + + HDFS-5473. Consistent naming of user-visible caching classes and methods + (cmccabe) + + HDFS-5543. Fix narrow race condition in TestPathBasedCacheRequests + (cmccabe) + + HDFS-5565. CacheAdmin help should match against non-dashed commands (wang + via cmccabe) + + HDFS-5556. Add some more NameNode cache statistics, cache pool stats + (cmccabe) + + HDFS-5562. TestCacheDirectives and TestFsDatasetCache should stub out + native mlock. Contributed by Colin Patrick McCabe and Akira Ajisaka. + + HDFS-5430. Support TTL on CacheDirectives. Contributed by Andrew Wang. + + HDFS-5555. CacheAdmin commands fail when first listed NameNode is in + Standby (jxiang via cmccabe) + + HDFS-5626. dfsadmin report shows incorrect values (cmccabe) + + HDFS-5630. Hook up cache directive and pool usage statistics. (wang) + + HDFS-5665. Remove the unnecessary writeLock while initializing CacheManager + in FsNameSystem Ctor. (Uma Maheswara Rao G via Andrew Wang) + + HDFS-5431. Support cachepool-based limit management in path-based caching. + (awang via cmccabe) + + HDFS-5679. TestCacheDirectives should handle the case where native code is + not available. (wang) + + HDFS-5636. Enforce a max TTL per cache pool (awang via cmccabe) + + HDFS-5701. Fix the CacheAdmin -addPool -maxTtl option name. Contributed by + Stephen Chu. + + HDFS-5708. The CacheManager throws a NPE in the DataNode logs when + processing cache reports that refer to a block not known to the BlockManager. + Contributed by Colin Patrick McCabe. + + HDFS-5659. dfsadmin -report doesn't output cache information properly. + Contributed by Andrew Wang. + + HDFS-5651. Remove dfs.namenode.caching.enabled and improve CRM locking. + Contributed by Colin Patrick McCabe. + + HDFS-5589. Namenode loops caching and uncaching when data should be + uncached. (awang via cmccabe) + + HDFS-5724. modifyCacheDirective logging audit log command wrongly as + addCacheDirective (Uma Maheswara Rao G via Colin Patrick McCabe) + + Release 2.3.0 - UNRELEASED INCOMPATIBLE CHANGES @@ -799,7 +1006,7 @@ Release 2.1.1-beta - 2013-09-23 HDFS-5091. Support for spnego keytab separate from the JournalNode keytab for secure HA. (jing9) - HDFS-5051. nn fails to download checkpointed image from snn in some + HDFS-5055. nn fails to download checkpointed image from snn in some setups. (Vinay and suresh via suresh) HDFS-4898. BlockPlacementPolicyWithNodeGroup.chooseRemoteRack() fails to diff --git a/hadoop-hdfs-project/hadoop-hdfs/dev-support/findbugsExcludeFile.xml b/hadoop-hdfs-project/hadoop-hdfs/dev-support/findbugsExcludeFile.xml index 77d9315bfcc..f97110705ac 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/dev-support/findbugsExcludeFile.xml +++ b/hadoop-hdfs-project/hadoop-hdfs/dev-support/findbugsExcludeFile.xml @@ -346,4 +346,20 @@ + + + + + + + + + + + + + + + + diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/bin/hdfs b/hadoop-hdfs-project/hadoop-hdfs/src/main/bin/hdfs index 24bb11fb50a..91c8c9af50d 100755 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/bin/hdfs +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/bin/hdfs @@ -59,6 +59,7 @@ function print_usage(){ echo " Use -help to see options" echo " portmap run a portmap service" echo " nfs3 run an NFS version 3 gateway" + echo " cacheadmin configure the HDFS cache" echo "" echo "Most commands print help when invoked w/o parameters." } @@ -155,6 +156,8 @@ elif [ "$COMMAND" = "portmap" ] ; then CLASS=org.apache.hadoop.portmap.Portmap elif [ "$COMMAND" = "nfs3" ] ; then CLASS=org.apache.hadoop.hdfs.nfs.nfs3.Nfs3 +elif [ "$COMMAND" = "cacheadmin" ] ; then + CLASS=org.apache.hadoop.hdfs.tools.CacheAdmin else CLASS="$COMMAND" fi diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/CacheFlag.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/CacheFlag.java new file mode 100644 index 00000000000..f76fcaa23e7 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/CacheFlag.java @@ -0,0 +1,44 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.fs; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; + +/** + * Specifies semantics for CacheDirective operations. Multiple flags can + * be combined in an EnumSet. + */ +@InterfaceAudience.Public +@InterfaceStability.Evolving +public enum CacheFlag { + + /** + * Ignore cache pool resource limits when performing this operation. + */ + FORCE((short) 0x01); + private final short mode; + + private CacheFlag(short mode) { + this.mode = mode; + } + + short getMode() { + return mode; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/HdfsBlockLocation.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/HdfsBlockLocation.java index f736d9637eb..0ccacda8d84 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/HdfsBlockLocation.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/fs/HdfsBlockLocation.java @@ -37,8 +37,7 @@ public class HdfsBlockLocation extends BlockLocation { public HdfsBlockLocation(BlockLocation loc, LocatedBlock block) throws IOException { // Initialize with data from passed in BlockLocation - super(loc.getNames(), loc.getHosts(), loc.getTopologyPaths(), - loc.getOffset(), loc.getLength(), loc.isCorrupt()); + super(loc); this.block = block; } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSClient.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSClient.java index 3c431438c20..b509e4b782f 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSClient.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSClient.java @@ -87,6 +87,7 @@ import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.conf.Configuration; import org.apache.hadoop.fs.BlockLocation; import org.apache.hadoop.fs.BlockStorageLocation; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.CommonConfigurationKeysPublic; import org.apache.hadoop.fs.ContentSummary; import org.apache.hadoop.fs.CreateFlag; @@ -100,6 +101,7 @@ import org.apache.hadoop.fs.MD5MD5CRC32CastagnoliFileChecksum; import org.apache.hadoop.fs.MD5MD5CRC32FileChecksum; import org.apache.hadoop.fs.MD5MD5CRC32GzipFileChecksum; import org.apache.hadoop.fs.Options; +import org.apache.hadoop.fs.RemoteIterator; import org.apache.hadoop.fs.Options.ChecksumOpt; import org.apache.hadoop.fs.ParentNotDirectoryException; import org.apache.hadoop.fs.Path; @@ -109,6 +111,11 @@ import org.apache.hadoop.fs.permission.FsPermission; import org.apache.hadoop.hdfs.client.ClientMmapManager; import org.apache.hadoop.hdfs.client.HdfsDataInputStream; import org.apache.hadoop.hdfs.client.HdfsDataOutputStream; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveIterator; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolIterator; import org.apache.hadoop.hdfs.protocol.ClientProtocol; import org.apache.hadoop.hdfs.protocol.CorruptFileBlocks; import org.apache.hadoop.hdfs.protocol.DSQuotaExceededException; @@ -117,6 +124,7 @@ import org.apache.hadoop.hdfs.protocol.DirectoryListing; import org.apache.hadoop.hdfs.protocol.ExtendedBlock; import org.apache.hadoop.hdfs.protocol.HdfsBlocksMetadata; import org.apache.hadoop.hdfs.protocol.HdfsConstants; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; import org.apache.hadoop.hdfs.protocol.HdfsConstants.DatanodeReportType; import org.apache.hadoop.hdfs.protocol.HdfsConstants.SafeModeAction; import org.apache.hadoop.hdfs.protocol.HdfsFileStatus; @@ -2312,7 +2320,73 @@ public class DFSClient implements java.io.Closeable { throw re.unwrapRemoteException(); } } + + public long addCacheDirective( + CacheDirectiveInfo info, EnumSet flags) throws IOException { + checkOpen(); + try { + return namenode.addCacheDirective(info, flags); + } catch (RemoteException re) { + throw re.unwrapRemoteException(); + } + } + public void modifyCacheDirective( + CacheDirectiveInfo info, EnumSet flags) throws IOException { + checkOpen(); + try { + namenode.modifyCacheDirective(info, flags); + } catch (RemoteException re) { + throw re.unwrapRemoteException(); + } + } + + public void removeCacheDirective(long id) + throws IOException { + checkOpen(); + try { + namenode.removeCacheDirective(id); + } catch (RemoteException re) { + throw re.unwrapRemoteException(); + } + } + + public RemoteIterator listCacheDirectives( + CacheDirectiveInfo filter) throws IOException { + return new CacheDirectiveIterator(namenode, filter); + } + + public void addCachePool(CachePoolInfo info) throws IOException { + checkOpen(); + try { + namenode.addCachePool(info); + } catch (RemoteException re) { + throw re.unwrapRemoteException(); + } + } + + public void modifyCachePool(CachePoolInfo info) throws IOException { + checkOpen(); + try { + namenode.modifyCachePool(info); + } catch (RemoteException re) { + throw re.unwrapRemoteException(); + } + } + + public void removeCachePool(String poolName) throws IOException { + checkOpen(); + try { + namenode.removeCachePool(poolName); + } catch (RemoteException re) { + throw re.unwrapRemoteException(); + } + } + + public RemoteIterator listCachePools() throws IOException { + return new CachePoolIterator(namenode); + } + /** * Save namespace image. * diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java index 4e63d599911..bacc8a6caf9 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSConfigKeys.java @@ -104,6 +104,13 @@ public class DFSConfigKeys extends CommonConfigurationKeys { public static final boolean DFS_DATANODE_DROP_CACHE_BEHIND_READS_DEFAULT = false; public static final String DFS_DATANODE_USE_DN_HOSTNAME = "dfs.datanode.use.datanode.hostname"; public static final boolean DFS_DATANODE_USE_DN_HOSTNAME_DEFAULT = false; + public static final String DFS_DATANODE_MAX_LOCKED_MEMORY_KEY = "dfs.datanode.max.locked.memory"; + public static final long DFS_DATANODE_MAX_LOCKED_MEMORY_DEFAULT = 0; + public static final String DFS_DATANODE_FSDATASETCACHE_MAX_THREADS_PER_VOLUME_KEY = "dfs.datanode.fsdatasetcache.max.threads.per.volume"; + public static final int DFS_DATANODE_FSDATASETCACHE_MAX_THREADS_PER_VOLUME_DEFAULT = 4; + public static final String DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT = + "dfs.namenode.path.based.cache.block.map.allocation.percent"; + public static final float DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT_DEFAULT = 0.25f; public static final String DFS_NAMENODE_HTTP_PORT_KEY = "dfs.http.port"; public static final int DFS_NAMENODE_HTTP_PORT_DEFAULT = 50070; @@ -210,6 +217,16 @@ public class DFSConfigKeys extends CommonConfigurationKeys { public static final String DFS_NAMENODE_DATANODE_REGISTRATION_IP_HOSTNAME_CHECK_KEY = "dfs.namenode.datanode.registration.ip-hostname-check"; public static final boolean DFS_NAMENODE_DATANODE_REGISTRATION_IP_HOSTNAME_CHECK_DEFAULT = true; + + public static final String DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES = + "dfs.namenode.list.cache.pools.num.responses"; + public static final int DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES_DEFAULT = 100; + public static final String DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES = + "dfs.namenode.list.cache.directives.num.responses"; + public static final int DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES_DEFAULT = 100; + public static final String DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS = + "dfs.namenode.path.based.cache.refresh.interval.ms"; + public static final long DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS_DEFAULT = 300000L; // Whether to enable datanode's stale state detection and usage for reads public static final String DFS_NAMENODE_AVOID_STALE_DATANODE_FOR_READ_KEY = "dfs.namenode.avoid.read.stale.datanode"; @@ -335,6 +352,8 @@ public class DFSConfigKeys extends CommonConfigurationKeys { public static final boolean DFS_DATANODE_TRANSFERTO_ALLOWED_DEFAULT = true; public static final String DFS_HEARTBEAT_INTERVAL_KEY = "dfs.heartbeat.interval"; public static final long DFS_HEARTBEAT_INTERVAL_DEFAULT = 3; + public static final String DFS_NAMENODE_PATH_BASED_CACHE_RETRY_INTERVAL_MS = "dfs.namenode.path.based.cache.retry.interval.ms"; + public static final long DFS_NAMENODE_PATH_BASED_CACHE_RETRY_INTERVAL_MS_DEFAULT = 60000L; public static final String DFS_NAMENODE_DECOMMISSION_INTERVAL_KEY = "dfs.namenode.decommission.interval"; public static final int DFS_NAMENODE_DECOMMISSION_INTERVAL_DEFAULT = 30; public static final String DFS_NAMENODE_DECOMMISSION_NODES_PER_INTERVAL_KEY = "dfs.namenode.decommission.nodes.per.interval"; @@ -378,6 +397,8 @@ public class DFSConfigKeys extends CommonConfigurationKeys { public static final long DFS_BLOCKREPORT_INTERVAL_MSEC_DEFAULT = 60 * 60 * 1000; public static final String DFS_BLOCKREPORT_INITIAL_DELAY_KEY = "dfs.blockreport.initialDelay"; public static final int DFS_BLOCKREPORT_INITIAL_DELAY_DEFAULT = 0; + public static final String DFS_CACHEREPORT_INTERVAL_MSEC_KEY = "dfs.cachereport.intervalMsec"; + public static final long DFS_CACHEREPORT_INTERVAL_MSEC_DEFAULT = 10 * 1000; public static final String DFS_BLOCK_INVALIDATE_LIMIT_KEY = "dfs.block.invalidate.limit"; public static final int DFS_BLOCK_INVALIDATE_LIMIT_DEFAULT = 1000; public static final String DFS_DEFAULT_MAX_CORRUPT_FILES_RETURNED_KEY = "dfs.corruptfilesreturned.max"; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSUtil.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSUtil.java index e207513e1ad..8e7a5e14629 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSUtil.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/DFSUtil.java @@ -41,13 +41,15 @@ import java.net.InetSocketAddress; import java.net.URI; import java.net.URISyntaxException; import java.security.SecureRandom; +import java.text.SimpleDateFormat; import java.util.ArrayList; import java.util.Collection; import java.util.Collections; import java.util.Comparator; -import java.util.HashMap; +import java.util.Date; import java.util.HashSet; import java.util.List; +import java.util.Locale; import java.util.Map; import java.util.Random; import java.util.Set; @@ -449,7 +451,13 @@ public class DFSUtil { locations[hCnt].getNetworkLocation()); racks[hCnt] = node.toString(); } - blkLocations[idx] = new BlockLocation(xferAddrs, hosts, racks, + DatanodeInfo[] cachedLocations = blk.getCachedLocations(); + String[] cachedHosts = new String[cachedLocations.length]; + for (int i=0; i flags) throws IOException { + Preconditions.checkNotNull(info.getPath()); + Path path = new Path(getPathName(fixRelativePart(info.getPath()))). + makeQualified(getUri(), getWorkingDirectory()); + return dfs.addCacheDirective( + new CacheDirectiveInfo.Builder(info). + setPath(path). + build(), + flags); + } + + /** + * @see {@link #modifyCacheDirective(CacheDirectiveInfo, EnumSet)} + */ + public void modifyCacheDirective(CacheDirectiveInfo info) throws IOException { + modifyCacheDirective(info, EnumSet.noneOf(CacheFlag.class)); + } + + /** + * Modify a CacheDirective. + * + * @param info Information about the directive to modify. You must set the ID + * to indicate which CacheDirective you want to modify. + * @param flags {@link CacheFlag}s to use for this operation. + * @throws IOException if the directive could not be modified + */ + public void modifyCacheDirective( + CacheDirectiveInfo info, EnumSet flags) throws IOException { + if (info.getPath() != null) { + info = new CacheDirectiveInfo.Builder(info). + setPath(new Path(getPathName(fixRelativePart(info.getPath()))). + makeQualified(getUri(), getWorkingDirectory())).build(); + } + dfs.modifyCacheDirective(info, flags); + } + + /** + * Remove a CacheDirectiveInfo. + * + * @param id identifier of the CacheDirectiveInfo to remove + * @throws IOException if the directive could not be removed + */ + public void removeCacheDirective(long id) + throws IOException { + dfs.removeCacheDirective(id); + } + /** + * List cache directives. Incrementally fetches results from the server. + * + * @param filter Filter parameters to use when listing the directives, null to + * list all directives visible to us. + * @return A RemoteIterator which returns CacheDirectiveInfo objects. + */ + public RemoteIterator listCacheDirectives( + CacheDirectiveInfo filter) throws IOException { + if (filter == null) { + filter = new CacheDirectiveInfo.Builder().build(); + } + if (filter.getPath() != null) { + filter = new CacheDirectiveInfo.Builder(filter). + setPath(new Path(getPathName(fixRelativePart(filter.getPath())))). + build(); + } + final RemoteIterator iter = + dfs.listCacheDirectives(filter); + return new RemoteIterator() { + @Override + public boolean hasNext() throws IOException { + return iter.hasNext(); + } + + @Override + public CacheDirectiveEntry next() throws IOException { + // Although the paths we get back from the NameNode should always be + // absolute, we call makeQualified to add the scheme and authority of + // this DistributedFilesystem. + CacheDirectiveEntry desc = iter.next(); + CacheDirectiveInfo info = desc.getInfo(); + Path p = info.getPath().makeQualified(getUri(), getWorkingDirectory()); + return new CacheDirectiveEntry( + new CacheDirectiveInfo.Builder(info).setPath(p).build(), + desc.getStats()); + } + }; + } + + /** + * Add a cache pool. + * + * @param info + * The request to add a cache pool. + * @throws IOException + * If the request could not be completed. + */ + public void addCachePool(CachePoolInfo info) throws IOException { + CachePoolInfo.validate(info); + dfs.addCachePool(info); + } + + /** + * Modify an existing cache pool. + * + * @param info + * The request to modify a cache pool. + * @throws IOException + * If the request could not be completed. + */ + public void modifyCachePool(CachePoolInfo info) throws IOException { + CachePoolInfo.validate(info); + dfs.modifyCachePool(info); + } + + /** + * Remove a cache pool. + * + * @param poolName + * Name of the cache pool to remove. + * @throws IOException + * if the cache pool did not exist, or could not be removed. + */ + public void removeCachePool(String poolName) throws IOException { + CachePoolInfo.validateName(poolName); + dfs.removeCachePool(poolName); + } + + /** + * List all cache pools. + * + * @return A remote iterator from which you can get CachePoolEntry objects. + * Requests will be made as needed. + * @throws IOException + * If there was an error listing cache pools. + */ + public RemoteIterator listCachePools() throws IOException { + return dfs.listCachePools(); + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/ClientMmap.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/ClientMmap.java index 566c2b5457c..91a62306f74 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/ClientMmap.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/ClientMmap.java @@ -22,6 +22,7 @@ import java.io.FileInputStream; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.hdfs.protocol.DatanodeID; import org.apache.hadoop.hdfs.protocol.ExtendedBlock; +import org.apache.hadoop.io.nativeio.NativeIO; import java.io.IOException; import java.lang.ref.WeakReference; @@ -147,20 +148,9 @@ public class ClientMmap { /** * Unmap the memory region. - * - * There isn't any portable way to unmap a memory region in Java. - * So we use the sun.nio method here. - * Note that unmapping a memory region could cause crashes if code - * continues to reference the unmapped code. However, if we don't - * manually unmap the memory, we are dependent on the finalizer to - * do it, and we have no idea when the finalizer will run. */ void unmap() { assert(refCount.get() == 0); - if (map instanceof sun.nio.ch.DirectBuffer) { - final sun.misc.Cleaner cleaner = - ((sun.nio.ch.DirectBuffer) map).cleaner(); - cleaner.clean(); - } + NativeIO.POSIX.munmap(map); } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/HdfsAdmin.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/HdfsAdmin.java index 03ff7f45c3c..0f0769e302c 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/HdfsAdmin.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/client/HdfsAdmin.java @@ -19,13 +19,20 @@ package org.apache.hadoop.hdfs.client; import java.io.IOException; import java.net.URI; +import java.util.EnumSet; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.classification.InterfaceStability; import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.FileSystem; import org.apache.hadoop.fs.Path; +import org.apache.hadoop.fs.RemoteIterator; import org.apache.hadoop.hdfs.DistributedFileSystem; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; import org.apache.hadoop.hdfs.protocol.HdfsConstants; import org.apache.hadoop.hdfs.tools.DFSAdmin; @@ -121,4 +128,101 @@ public class HdfsAdmin { public void disallowSnapshot(Path path) throws IOException { dfs.disallowSnapshot(path); } + + /** + * Add a new CacheDirectiveInfo. + * + * @param info Information about a directive to add. + * @param flags {@link CacheFlag}s to use for this operation. + * @return the ID of the directive that was created. + * @throws IOException if the directive could not be added + */ + public long addCacheDirective(CacheDirectiveInfo info, + EnumSet flags) throws IOException { + return dfs.addCacheDirective(info, flags); + } + + /** + * Modify a CacheDirective. + * + * @param info Information about the directive to modify. You must set the ID + * to indicate which CacheDirective you want to modify. + * @param flags {@link CacheFlag}s to use for this operation. + * @throws IOException if the directive could not be modified + */ + public void modifyCacheDirective(CacheDirectiveInfo info, + EnumSet flags) throws IOException { + dfs.modifyCacheDirective(info, flags); + } + + /** + * Remove a CacheDirective. + * + * @param id identifier of the CacheDirectiveInfo to remove + * @throws IOException if the directive could not be removed + */ + public void removeCacheDirective(long id) + throws IOException { + dfs.removeCacheDirective(id); + } + + /** + * List cache directives. Incrementally fetches results from the server. + * + * @param filter Filter parameters to use when listing the directives, null to + * list all directives visible to us. + * @return A RemoteIterator which returns CacheDirectiveInfo objects. + */ + public RemoteIterator listCacheDirectives( + CacheDirectiveInfo filter) throws IOException { + return dfs.listCacheDirectives(filter); + } + + /** + * Add a cache pool. + * + * @param info + * The request to add a cache pool. + * @throws IOException + * If the request could not be completed. + */ + public void addCachePool(CachePoolInfo info) throws IOException { + dfs.addCachePool(info); + } + + /** + * Modify an existing cache pool. + * + * @param info + * The request to modify a cache pool. + * @throws IOException + * If the request could not be completed. + */ + public void modifyCachePool(CachePoolInfo info) throws IOException { + dfs.modifyCachePool(info); + } + + /** + * Remove a cache pool. + * + * @param poolName + * Name of the cache pool to remove. + * @throws IOException + * if the cache pool did not exist, or could not be removed. + */ + public void removeCachePool(String poolName) throws IOException { + dfs.removeCachePool(poolName); + } + + /** + * List all cache pools. + * + * @return A remote iterator from which you can get CachePoolEntry objects. + * Requests will be made as needed. + * @throws IOException + * If there was an error listing cache pools. + */ + public RemoteIterator listCachePools() throws IOException { + return dfs.listCachePools(); + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirective.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirective.java new file mode 100644 index 00000000000..89cf641a02d --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirective.java @@ -0,0 +1,268 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.protocol; + +import static com.google.common.base.Preconditions.checkNotNull; + +import java.util.Date; + +import org.apache.commons.lang.builder.HashCodeBuilder; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.fs.Path; +import org.apache.hadoop.hdfs.DFSUtil; +import org.apache.hadoop.hdfs.server.namenode.CachePool; +import org.apache.hadoop.util.IntrusiveCollection; +import org.apache.hadoop.util.IntrusiveCollection.Element; + +import com.google.common.base.Preconditions; + +/** + * Namenode class that tracks state related to a cached path. + * + * This is an implementation class, not part of the public API. + */ +@InterfaceAudience.Private +public final class CacheDirective implements IntrusiveCollection.Element { + private final long id; + private final String path; + private final short replication; + private CachePool pool; + private final long expiryTime; + + private long bytesNeeded; + private long bytesCached; + private long filesNeeded; + private long filesCached; + + private Element prev; + private Element next; + + public CacheDirective(CacheDirectiveInfo info) { + this( + info.getId(), + info.getPath().toUri().getPath(), + info.getReplication(), + info.getExpiration().getAbsoluteMillis()); + } + + public CacheDirective(long id, String path, + short replication, long expiryTime) { + Preconditions.checkArgument(id > 0); + this.id = id; + this.path = checkNotNull(path); + Preconditions.checkArgument(replication > 0); + this.replication = replication; + this.expiryTime = expiryTime; + } + + public long getId() { + return id; + } + + public String getPath() { + return path; + } + + public short getReplication() { + return replication; + } + + public CachePool getPool() { + return pool; + } + + /** + * @return When this directive expires, in milliseconds since Unix epoch + */ + public long getExpiryTime() { + return expiryTime; + } + + /** + * @return When this directive expires, as an ISO-8601 formatted string. + */ + public String getExpiryTimeString() { + return DFSUtil.dateToIso8601String(new Date(expiryTime)); + } + + /** + * Returns a {@link CacheDirectiveInfo} based on this CacheDirective. + *

+ * This always sets an absolute expiry time, never a relative TTL. + */ + public CacheDirectiveInfo toInfo() { + return new CacheDirectiveInfo.Builder(). + setId(id). + setPath(new Path(path)). + setReplication(replication). + setPool(pool.getPoolName()). + setExpiration(CacheDirectiveInfo.Expiration.newAbsolute(expiryTime)). + build(); + } + + public CacheDirectiveStats toStats() { + return new CacheDirectiveStats.Builder(). + setBytesNeeded(bytesNeeded). + setBytesCached(bytesCached). + setFilesNeeded(filesNeeded). + setFilesCached(filesCached). + setHasExpired(new Date().getTime() > expiryTime). + build(); + } + + public CacheDirectiveEntry toEntry() { + return new CacheDirectiveEntry(toInfo(), toStats()); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("{ id:").append(id). + append(", path:").append(path). + append(", replication:").append(replication). + append(", pool:").append(pool). + append(", expiryTime: ").append(getExpiryTimeString()). + append(", bytesNeeded:").append(bytesNeeded). + append(", bytesCached:").append(bytesCached). + append(", filesNeeded:").append(filesNeeded). + append(", filesCached:").append(filesCached). + append(" }"); + return builder.toString(); + } + + @Override + public boolean equals(Object o) { + if (o == null) { return false; } + if (o == this) { return true; } + if (o.getClass() != this.getClass()) { + return false; + } + CacheDirective other = (CacheDirective)o; + return id == other.id; + } + + @Override + public int hashCode() { + return new HashCodeBuilder().append(id).toHashCode(); + } + + // + // Stats related getters and setters + // + + /** + * Resets the byte and file statistics being tracked by this CacheDirective. + */ + public void resetStatistics() { + bytesNeeded = 0; + bytesCached = 0; + filesNeeded = 0; + filesCached = 0; + } + + public long getBytesNeeded() { + return bytesNeeded; + } + + public void addBytesNeeded(long bytes) { + this.bytesNeeded += bytes; + pool.addBytesNeeded(bytes); + } + + public long getBytesCached() { + return bytesCached; + } + + public void addBytesCached(long bytes) { + this.bytesCached += bytes; + pool.addBytesCached(bytes); + } + + public long getFilesNeeded() { + return filesNeeded; + } + + public void addFilesNeeded(long files) { + this.filesNeeded += files; + pool.addFilesNeeded(files); + } + + public long getFilesCached() { + return filesCached; + } + + public void addFilesCached(long files) { + this.filesCached += files; + pool.addFilesCached(files); + } + + // + // IntrusiveCollection.Element implementation + // + + @SuppressWarnings("unchecked") + @Override // IntrusiveCollection.Element + public void insertInternal(IntrusiveCollection list, + Element prev, Element next) { + assert this.pool == null; + this.pool = ((CachePool.DirectiveList)list).getCachePool(); + this.prev = prev; + this.next = next; + } + + @Override // IntrusiveCollection.Element + public void setPrev(IntrusiveCollection list, Element prev) { + assert list == pool.getDirectiveList(); + this.prev = prev; + } + + @Override // IntrusiveCollection.Element + public void setNext(IntrusiveCollection list, Element next) { + assert list == pool.getDirectiveList(); + this.next = next; + } + + @Override // IntrusiveCollection.Element + public void removeInternal(IntrusiveCollection list) { + assert list == pool.getDirectiveList(); + this.pool = null; + this.prev = null; + this.next = null; + } + + @Override // IntrusiveCollection.Element + public Element getPrev(IntrusiveCollection list) { + if (list != pool.getDirectiveList()) { + return null; + } + return this.prev; + } + + @Override // IntrusiveCollection.Element + public Element getNext(IntrusiveCollection list) { + if (list != pool.getDirectiveList()) { + return null; + } + return this.next; + } + + @Override // IntrusiveCollection.Element + public boolean isInList(IntrusiveCollection list) { + return pool == null ? false : list == pool.getDirectiveList(); + } +}; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveEntry.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveEntry.java new file mode 100644 index 00000000000..fe3215ffcee --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveEntry.java @@ -0,0 +1,45 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.protocol; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; + +/** + * Describes a path-based cache directive entry. + */ +@InterfaceStability.Evolving +@InterfaceAudience.Public +public class CacheDirectiveEntry { + private final CacheDirectiveInfo info; + private final CacheDirectiveStats stats; + + public CacheDirectiveEntry(CacheDirectiveInfo info, + CacheDirectiveStats stats) { + this.info = info; + this.stats = stats; + } + + public CacheDirectiveInfo getInfo() { + return info; + } + + public CacheDirectiveStats getStats() { + return stats; + } +}; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveInfo.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveInfo.java new file mode 100644 index 00000000000..f6b3c34f4ae --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveInfo.java @@ -0,0 +1,358 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.protocol; + +import java.util.Date; + +import org.apache.commons.lang.builder.EqualsBuilder; +import org.apache.commons.lang.builder.HashCodeBuilder; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.Path; +import org.apache.hadoop.hdfs.DFSUtil; + +import com.google.common.base.Preconditions; + +/** + * Describes a path-based cache directive. + */ +@InterfaceStability.Evolving +@InterfaceAudience.Public +public class CacheDirectiveInfo { + /** + * A builder for creating new CacheDirectiveInfo instances. + */ + public static class Builder { + private Long id; + private Path path; + private Short replication; + private String pool; + private Expiration expiration; + + /** + * Builds a new CacheDirectiveInfo populated with the set properties. + * + * @return New CacheDirectiveInfo. + */ + public CacheDirectiveInfo build() { + return new CacheDirectiveInfo(id, path, replication, pool, expiration); + } + + /** + * Creates an empty builder. + */ + public Builder() { + } + + /** + * Creates a builder with all elements set to the same values as the + * given CacheDirectiveInfo. + */ + public Builder(CacheDirectiveInfo directive) { + this.id = directive.getId(); + this.path = directive.getPath(); + this.replication = directive.getReplication(); + this.pool = directive.getPool(); + this.expiration = directive.getExpiration(); + } + + /** + * Sets the id used in this request. + * + * @param id The id used in this request. + * @return This builder, for call chaining. + */ + public Builder setId(Long id) { + this.id = id; + return this; + } + + /** + * Sets the path used in this request. + * + * @param path The path used in this request. + * @return This builder, for call chaining. + */ + public Builder setPath(Path path) { + this.path = path; + return this; + } + + /** + * Sets the replication used in this request. + * + * @param replication The replication used in this request. + * @return This builder, for call chaining. + */ + public Builder setReplication(Short replication) { + this.replication = replication; + return this; + } + + /** + * Sets the pool used in this request. + * + * @param pool The pool used in this request. + * @return This builder, for call chaining. + */ + public Builder setPool(String pool) { + this.pool = pool; + return this; + } + + /** + * Sets when the CacheDirective should expire. A + * {@link CacheDirectiveInfo.Expiration} can specify either an absolute or + * relative expiration time. + * + * @param expiration when this CacheDirective should expire + * @return This builder, for call chaining + */ + public Builder setExpiration(Expiration expiration) { + this.expiration = expiration; + return this; + } + } + + /** + * Denotes a relative or absolute expiration time for a CacheDirective. Use + * factory methods {@link CacheDirectiveInfo.Expiration#newAbsolute(Date)} and + * {@link CacheDirectiveInfo.Expiration#newRelative(long)} to create an + * Expiration. + *

+ * In either case, the server-side clock is used to determine when a + * CacheDirective expires. + */ + public static class Expiration { + + /** + * The maximum value we accept for a relative expiry. + */ + public static final long MAX_RELATIVE_EXPIRY_MS = + Long.MAX_VALUE / 4; // This helps prevent weird overflow bugs + + /** + * An relative Expiration that never expires. + */ + public static final Expiration NEVER = newRelative(MAX_RELATIVE_EXPIRY_MS); + + /** + * Create a new relative Expiration. + *

+ * Use {@link Expiration#NEVER} to indicate an Expiration that never + * expires. + * + * @param ms how long until the CacheDirective expires, in milliseconds + * @return A relative Expiration + */ + public static Expiration newRelative(long ms) { + return new Expiration(ms, true); + } + + /** + * Create a new absolute Expiration. + *

+ * Use {@link Expiration#NEVER} to indicate an Expiration that never + * expires. + * + * @param date when the CacheDirective expires + * @return An absolute Expiration + */ + public static Expiration newAbsolute(Date date) { + return new Expiration(date.getTime(), false); + } + + /** + * Create a new absolute Expiration. + *

+ * Use {@link Expiration#NEVER} to indicate an Expiration that never + * expires. + * + * @param ms when the CacheDirective expires, in milliseconds since the Unix + * epoch. + * @return An absolute Expiration + */ + public static Expiration newAbsolute(long ms) { + return new Expiration(ms, false); + } + + private final long ms; + private final boolean isRelative; + + private Expiration(long ms, boolean isRelative) { + if (isRelative) { + Preconditions.checkArgument(ms <= MAX_RELATIVE_EXPIRY_MS, + "Expiration time is too far in the future!"); + } + this.ms = ms; + this.isRelative = isRelative; + } + + /** + * @return true if Expiration was specified as a relative duration, false if + * specified as an absolute time. + */ + public boolean isRelative() { + return isRelative; + } + + /** + * @return The raw underlying millisecond value, either a relative duration + * or an absolute time as milliseconds since the Unix epoch. + */ + public long getMillis() { + return ms; + } + + /** + * @return Expiration time as a {@link Date} object. This converts a + * relative Expiration into an absolute Date based on the local + * clock. + */ + public Date getAbsoluteDate() { + return new Date(getAbsoluteMillis()); + } + + /** + * @return Expiration time in milliseconds from the Unix epoch. This + * converts a relative Expiration into an absolute time based on the + * local clock. + */ + public long getAbsoluteMillis() { + if (!isRelative) { + return ms; + } else { + return new Date().getTime() + ms; + } + } + + @Override + public String toString() { + if (isRelative) { + return DFSUtil.durationToString(ms); + } + return DFSUtil.dateToIso8601String(new Date(ms)); + } + } + + private final Long id; + private final Path path; + private final Short replication; + private final String pool; + private final Expiration expiration; + + CacheDirectiveInfo(Long id, Path path, Short replication, String pool, + Expiration expiration) { + this.id = id; + this.path = path; + this.replication = replication; + this.pool = pool; + this.expiration = expiration; + } + + /** + * @return The ID of this directive. + */ + public Long getId() { + return id; + } + + /** + * @return The path used in this request. + */ + public Path getPath() { + return path; + } + + /** + * @return The number of times the block should be cached. + */ + public Short getReplication() { + return replication; + } + + /** + * @return The pool used in this request. + */ + public String getPool() { + return pool; + } + + /** + * @return When this directive expires. + */ + public Expiration getExpiration() { + return expiration; + } + + @Override + public boolean equals(Object o) { + if (o == null) { + return false; + } + if (getClass() != o.getClass()) { + return false; + } + CacheDirectiveInfo other = (CacheDirectiveInfo)o; + return new EqualsBuilder().append(getId(), other.getId()). + append(getPath(), other.getPath()). + append(getReplication(), other.getReplication()). + append(getPool(), other.getPool()). + append(getExpiration(), other.getExpiration()). + isEquals(); + } + + @Override + public int hashCode() { + return new HashCodeBuilder().append(id). + append(path). + append(replication). + append(pool). + append(expiration). + hashCode(); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("{"); + String prefix = ""; + if (id != null) { + builder.append(prefix).append("id: ").append(id); + prefix = ", "; + } + if (path != null) { + builder.append(prefix).append("path: ").append(path); + prefix = ", "; + } + if (replication != null) { + builder.append(prefix).append("replication: ").append(replication); + prefix = ", "; + } + if (pool != null) { + builder.append(prefix).append("pool: ").append(pool); + prefix = ", "; + } + if (expiration != null) { + builder.append(prefix).append("expiration: ").append(expiration); + prefix = ", "; + } + builder.append("}"); + return builder.toString(); + } +}; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveIterator.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveIterator.java new file mode 100644 index 00000000000..773a2841321 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveIterator.java @@ -0,0 +1,56 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.protocol; + +import java.io.IOException; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.BatchedRemoteIterator; + +/** + * CacheDirectiveIterator is a remote iterator that iterates cache directives. + * It supports retrying in case of namenode failover. + */ +@InterfaceAudience.Private +@InterfaceStability.Evolving +public class CacheDirectiveIterator + extends BatchedRemoteIterator { + + private final CacheDirectiveInfo filter; + private final ClientProtocol namenode; + + public CacheDirectiveIterator(ClientProtocol namenode, + CacheDirectiveInfo filter) { + super(Long.valueOf(0)); + this.namenode = namenode; + this.filter = filter; + } + + @Override + public BatchedEntries makeRequest(Long prevKey) + throws IOException { + return namenode.listCacheDirectives(prevKey, filter); + } + + @Override + public Long elementToPrevKey(CacheDirectiveEntry entry) { + return entry.getInfo().getId(); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveStats.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveStats.java new file mode 100644 index 00000000000..0fd4ca23bb1 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CacheDirectiveStats.java @@ -0,0 +1,169 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.protocol; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; + +/** + * Describes a path-based cache directive. + */ +@InterfaceStability.Evolving +@InterfaceAudience.Public +public class CacheDirectiveStats { + public static class Builder { + private long bytesNeeded; + private long bytesCached; + private long filesNeeded; + private long filesCached; + private boolean hasExpired; + + /** + * Builds a new CacheDirectiveStats populated with the set properties. + * + * @return New CacheDirectiveStats. + */ + public CacheDirectiveStats build() { + return new CacheDirectiveStats(bytesNeeded, bytesCached, filesNeeded, + filesCached, hasExpired); + } + + /** + * Creates an empty builder. + */ + public Builder() { + } + + /** + * Sets the bytes needed by this directive. + * + * @param bytesNeeded The bytes needed. + * @return This builder, for call chaining. + */ + public Builder setBytesNeeded(long bytesNeeded) { + this.bytesNeeded = bytesNeeded; + return this; + } + + /** + * Sets the bytes cached by this directive. + * + * @param bytesCached The bytes cached. + * @return This builder, for call chaining. + */ + public Builder setBytesCached(long bytesCached) { + this.bytesCached = bytesCached; + return this; + } + + /** + * Sets the files needed by this directive. + * @param filesNeeded The number of files needed + * @return This builder, for call chaining. + */ + public Builder setFilesNeeded(long filesNeeded) { + this.filesNeeded = filesNeeded; + return this; + } + + /** + * Sets the files cached by this directive. + * + * @param filesCached The number of files cached. + * @return This builder, for call chaining. + */ + public Builder setFilesCached(long filesCached) { + this.filesCached = filesCached; + return this; + } + + /** + * Sets whether this directive has expired. + * + * @param hasExpired if this directive has expired + * @return This builder, for call chaining. + */ + public Builder setHasExpired(boolean hasExpired) { + this.hasExpired = hasExpired; + return this; + } + } + + private final long bytesNeeded; + private final long bytesCached; + private final long filesNeeded; + private final long filesCached; + private final boolean hasExpired; + + private CacheDirectiveStats(long bytesNeeded, long bytesCached, + long filesNeeded, long filesCached, boolean hasExpired) { + this.bytesNeeded = bytesNeeded; + this.bytesCached = bytesCached; + this.filesNeeded = filesNeeded; + this.filesCached = filesCached; + this.hasExpired = hasExpired; + } + + /** + * @return The bytes needed. + */ + public long getBytesNeeded() { + return bytesNeeded; + } + + /** + * @return The bytes cached. + */ + public long getBytesCached() { + return bytesCached; + } + + /** + * @return The number of files needed. + */ + public long getFilesNeeded() { + return filesNeeded; + } + + /** + * @return The number of files cached. + */ + public long getFilesCached() { + return filesCached; + } + + /** + * @return Whether this directive has expired. + */ + public boolean hasExpired() { + return hasExpired; + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("{"); + builder.append("bytesNeeded: ").append(bytesNeeded); + builder.append(", ").append("bytesCached: ").append(bytesCached); + builder.append(", ").append("filesNeeded: ").append(filesNeeded); + builder.append(", ").append("filesCached: ").append(filesCached); + builder.append(", ").append("hasExpired: ").append(hasExpired); + builder.append("}"); + return builder.toString(); + } +}; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolEntry.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolEntry.java new file mode 100644 index 00000000000..3c1e345724a --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolEntry.java @@ -0,0 +1,45 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.protocol; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; + +/** + * Describes a Cache Pool entry. + */ +@InterfaceAudience.Public +@InterfaceStability.Evolving +public class CachePoolEntry { + private final CachePoolInfo info; + private final CachePoolStats stats; + + public CachePoolEntry(CachePoolInfo info, CachePoolStats stats) { + this.info = info; + this.stats = stats; + } + + public CachePoolInfo getInfo() { + return info; + } + + public CachePoolStats getStats() { + return stats; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolInfo.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolInfo.java new file mode 100644 index 00000000000..61bbe387b9c --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolInfo.java @@ -0,0 +1,229 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.protocol; + +import java.io.IOException; + +import javax.annotation.Nullable; + +import org.apache.commons.lang.builder.EqualsBuilder; +import org.apache.commons.lang.builder.HashCodeBuilder; +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.InvalidRequestException; +import org.apache.hadoop.fs.permission.FsPermission; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo.Expiration; + +/** + * CachePoolInfo describes a cache pool. + * + * This class is used in RPCs to create and modify cache pools. + * It is serializable and can be stored in the edit log. + */ +@InterfaceAudience.Public +@InterfaceStability.Evolving +public class CachePoolInfo { + public static final Log LOG = LogFactory.getLog(CachePoolInfo.class); + + /** + * Indicates that the pool does not have a maximum relative expiry. + */ + public static final long RELATIVE_EXPIRY_NEVER = + Expiration.MAX_RELATIVE_EXPIRY_MS; + /** + * Default max relative expiry for cache pools. + */ + public static final long DEFAULT_MAX_RELATIVE_EXPIRY = + RELATIVE_EXPIRY_NEVER; + + public static final long LIMIT_UNLIMITED = Long.MAX_VALUE; + public static final long DEFAULT_LIMIT = LIMIT_UNLIMITED; + + final String poolName; + + @Nullable + String ownerName; + + @Nullable + String groupName; + + @Nullable + FsPermission mode; + + @Nullable + Long limit; + + @Nullable + Long maxRelativeExpiryMs; + + public CachePoolInfo(String poolName) { + this.poolName = poolName; + } + + /** + * @return Name of the pool. + */ + public String getPoolName() { + return poolName; + } + + /** + * @return The owner of the pool. Along with the group and mode, determines + * who has access to view and modify the pool. + */ + public String getOwnerName() { + return ownerName; + } + + public CachePoolInfo setOwnerName(String ownerName) { + this.ownerName = ownerName; + return this; + } + + /** + * @return The group of the pool. Along with the owner and mode, determines + * who has access to view and modify the pool. + */ + public String getGroupName() { + return groupName; + } + + public CachePoolInfo setGroupName(String groupName) { + this.groupName = groupName; + return this; + } + + /** + * @return Unix-style permissions of the pool. Along with the owner and group, + * determines who has access to view and modify the pool. + */ + public FsPermission getMode() { + return mode; + } + + public CachePoolInfo setMode(FsPermission mode) { + this.mode = mode; + return this; + } + + /** + * @return The maximum aggregate number of bytes that can be cached by + * directives in this pool. + */ + public Long getLimit() { + return limit; + } + + public CachePoolInfo setLimit(Long bytes) { + this.limit = bytes; + return this; + } + + /** + * @return The maximum relative expiration of directives of this pool in + * milliseconds + */ + public Long getMaxRelativeExpiryMs() { + return maxRelativeExpiryMs; + } + + /** + * Set the maximum relative expiration of directives of this pool in + * milliseconds. + * + * @param ms in milliseconds + * @return This builder, for call chaining. + */ + public CachePoolInfo setMaxRelativeExpiryMs(Long ms) { + this.maxRelativeExpiryMs = ms; + return this; + } + + public String toString() { + return new StringBuilder().append("{"). + append("poolName:").append(poolName). + append(", ownerName:").append(ownerName). + append(", groupName:").append(groupName). + append(", mode:").append((mode == null) ? "null" : + String.format("0%03o", mode.toShort())). + append(", limit:").append(limit). + append(", maxRelativeExpiryMs:").append(maxRelativeExpiryMs). + append("}").toString(); + } + + @Override + public boolean equals(Object o) { + if (o == null) { return false; } + if (o == this) { return true; } + if (o.getClass() != getClass()) { + return false; + } + CachePoolInfo other = (CachePoolInfo)o; + return new EqualsBuilder(). + append(poolName, other.poolName). + append(ownerName, other.ownerName). + append(groupName, other.groupName). + append(mode, other.mode). + append(limit, other.limit). + append(maxRelativeExpiryMs, other.maxRelativeExpiryMs). + isEquals(); + } + + @Override + public int hashCode() { + return new HashCodeBuilder(). + append(poolName). + append(ownerName). + append(groupName). + append(mode). + append(limit). + append(maxRelativeExpiryMs). + hashCode(); + } + + public static void validate(CachePoolInfo info) throws IOException { + if (info == null) { + throw new InvalidRequestException("CachePoolInfo is null"); + } + if ((info.getLimit() != null) && (info.getLimit() < 0)) { + throw new InvalidRequestException("Limit is negative."); + } + if (info.getMaxRelativeExpiryMs() != null) { + long maxRelativeExpiryMs = info.getMaxRelativeExpiryMs(); + if (maxRelativeExpiryMs < 0l) { + throw new InvalidRequestException("Max relative expiry is negative."); + } + if (maxRelativeExpiryMs > Expiration.MAX_RELATIVE_EXPIRY_MS) { + throw new InvalidRequestException("Max relative expiry is too big."); + } + } + validateName(info.poolName); + } + + public static void validateName(String poolName) throws IOException { + if (poolName == null || poolName.isEmpty()) { + // Empty pool names are not allowed because they would be highly + // confusing. They would also break the ability to list all pools + // by starting with prevKey = "" + throw new IOException("invalid empty cache pool name"); + } + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolIterator.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolIterator.java new file mode 100644 index 00000000000..44d6b451742 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolIterator.java @@ -0,0 +1,53 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.protocol; + +import java.io.IOException; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.BatchedRemoteIterator; + +/** + * CachePoolIterator is a remote iterator that iterates cache pools. + * It supports retrying in case of namenode failover. + */ +@InterfaceAudience.Private +@InterfaceStability.Evolving +public class CachePoolIterator + extends BatchedRemoteIterator { + + private final ClientProtocol namenode; + + public CachePoolIterator(ClientProtocol namenode) { + super(""); + this.namenode = namenode; + } + + @Override + public BatchedEntries makeRequest(String prevKey) + throws IOException { + return namenode.listCachePools(prevKey); + } + + @Override + public String elementToPrevKey(CachePoolEntry entry) { + return entry.getInfo().getPoolName(); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolStats.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolStats.java new file mode 100644 index 00000000000..c552652ceb1 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/CachePoolStats.java @@ -0,0 +1,115 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.protocol; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; + +/** + * CachePoolStats describes cache pool statistics. + */ +@InterfaceAudience.Public +@InterfaceStability.Evolving +public class CachePoolStats { + public static class Builder { + private long bytesNeeded; + private long bytesCached; + private long bytesOverlimit; + private long filesNeeded; + private long filesCached; + + public Builder() { + } + + public Builder setBytesNeeded(long bytesNeeded) { + this.bytesNeeded = bytesNeeded; + return this; + } + + public Builder setBytesCached(long bytesCached) { + this.bytesCached = bytesCached; + return this; + } + + public Builder setBytesOverlimit(long bytesOverlimit) { + this.bytesOverlimit = bytesOverlimit; + return this; + } + + public Builder setFilesNeeded(long filesNeeded) { + this.filesNeeded = filesNeeded; + return this; + } + + public Builder setFilesCached(long filesCached) { + this.filesCached = filesCached; + return this; + } + + public CachePoolStats build() { + return new CachePoolStats(bytesNeeded, bytesCached, bytesOverlimit, + filesNeeded, filesCached); + } + }; + + private final long bytesNeeded; + private final long bytesCached; + private final long bytesOverlimit; + private final long filesNeeded; + private final long filesCached; + + private CachePoolStats(long bytesNeeded, long bytesCached, + long bytesOverlimit, long filesNeeded, long filesCached) { + this.bytesNeeded = bytesNeeded; + this.bytesCached = bytesCached; + this.bytesOverlimit = bytesOverlimit; + this.filesNeeded = filesNeeded; + this.filesCached = filesCached; + } + + public long getBytesNeeded() { + return bytesNeeded; + } + + public long getBytesCached() { + return bytesCached; + } + + public long getBytesOverlimit() { + return bytesOverlimit; + } + + public long getFilesNeeded() { + return filesNeeded; + } + + public long getFilesCached() { + return filesCached; + } + + public String toString() { + return new StringBuilder().append("{"). + append("bytesNeeded:").append(bytesNeeded). + append(", bytesCached:").append(bytesCached). + append(", bytesOverlimit:").append(bytesOverlimit). + append(", filesNeeded:").append(filesNeeded). + append(", filesCached:").append(filesCached). + append("}").toString(); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java index b2b45f3dbf2..18751a2246a 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/ClientProtocol.java @@ -19,15 +19,18 @@ package org.apache.hadoop.hdfs.protocol; import java.io.FileNotFoundException; import java.io.IOException; +import java.util.EnumSet; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.ContentSummary; import org.apache.hadoop.fs.CreateFlag; import org.apache.hadoop.fs.FileAlreadyExistsException; import org.apache.hadoop.fs.FsServerDefaults; import org.apache.hadoop.fs.InvalidPathException; import org.apache.hadoop.fs.Options; +import org.apache.hadoop.fs.BatchedRemoteIterator.BatchedEntries; import org.apache.hadoop.fs.Options.Rename; import org.apache.hadoop.fs.ParentNotDirectoryException; import org.apache.hadoop.fs.UnresolvedLinkException; @@ -1094,5 +1097,91 @@ public interface ClientProtocol { @Idempotent public SnapshotDiffReport getSnapshotDiffReport(String snapshotRoot, String fromSnapshot, String toSnapshot) throws IOException; -} + /** + * Add a CacheDirective to the CacheManager. + * + * @param directive A CacheDirectiveInfo to be added + * @param flags {@link CacheFlag}s to use for this operation. + * @return A CacheDirectiveInfo associated with the added directive + * @throws IOException if the directive could not be added + */ + @AtMostOnce + public long addCacheDirective(CacheDirectiveInfo directive, + EnumSet flags) throws IOException; + + /** + * Modify a CacheDirective in the CacheManager. + * + * @return directive The directive to modify. Must contain a directive ID. + * @param flags {@link CacheFlag}s to use for this operation. + * @throws IOException if the directive could not be modified + */ + @AtMostOnce + public void modifyCacheDirective(CacheDirectiveInfo directive, + EnumSet flags) throws IOException; + + /** + * Remove a CacheDirectiveInfo from the CacheManager. + * + * @param id of a CacheDirectiveInfo + * @throws IOException if the cache directive could not be removed + */ + @AtMostOnce + public void removeCacheDirective(long id) throws IOException; + + /** + * List the set of cached paths of a cache pool. Incrementally fetches results + * from the server. + * + * @param prevId The last listed entry ID, or -1 if this is the first call to + * listCacheDirectives. + * @param filter Parameters to use to filter the list results, + * or null to display all directives visible to us. + * @return A batch of CacheDirectiveEntry objects. + */ + @Idempotent + public BatchedEntries listCacheDirectives( + long prevId, CacheDirectiveInfo filter) throws IOException; + + /** + * Add a new cache pool. + * + * @param info Description of the new cache pool + * @throws IOException If the request could not be completed. + */ + @AtMostOnce + public void addCachePool(CachePoolInfo info) throws IOException; + + /** + * Modify an existing cache pool. + * + * @param req + * The request to modify a cache pool. + * @throws IOException + * If the request could not be completed. + */ + @AtMostOnce + public void modifyCachePool(CachePoolInfo req) throws IOException; + + /** + * Remove a cache pool. + * + * @param pool name of the cache pool to remove. + * @throws IOException if the cache pool did not exist, or could not be + * removed. + */ + @AtMostOnce + public void removeCachePool(String pool) throws IOException; + + /** + * List the set of cache pools. Incrementally fetches results from the server. + * + * @param prevPool name of the last pool listed, or the empty string if this is + * the first invocation of listCachePools + * @return A batch of CachePoolEntry objects. + */ + @Idempotent + public BatchedEntries listCachePools(String prevPool) + throws IOException; +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/DatanodeInfo.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/DatanodeInfo.java index d924c45269f..e0a9e2bce20 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/DatanodeInfo.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/DatanodeInfo.java @@ -44,6 +44,8 @@ public class DatanodeInfo extends DatanodeID implements Node { private long dfsUsed; private long remaining; private long blockPoolUsed; + private long cacheCapacity; + private long cacheUsed; private long lastUpdate; private int xceiverCount; private String location = NetworkTopology.DEFAULT_RACK; @@ -82,6 +84,8 @@ public class DatanodeInfo extends DatanodeID implements Node { this.dfsUsed = from.getDfsUsed(); this.remaining = from.getRemaining(); this.blockPoolUsed = from.getBlockPoolUsed(); + this.cacheCapacity = from.getCacheCapacity(); + this.cacheUsed = from.getCacheUsed(); this.lastUpdate = from.getLastUpdate(); this.xceiverCount = from.getXceiverCount(); this.location = from.getNetworkLocation(); @@ -94,6 +98,8 @@ public class DatanodeInfo extends DatanodeID implements Node { this.dfsUsed = 0L; this.remaining = 0L; this.blockPoolUsed = 0L; + this.cacheCapacity = 0L; + this.cacheUsed = 0L; this.lastUpdate = 0L; this.xceiverCount = 0; this.adminState = null; @@ -106,12 +112,13 @@ public class DatanodeInfo extends DatanodeID implements Node { public DatanodeInfo(DatanodeID nodeID, String location, final long capacity, final long dfsUsed, final long remaining, - final long blockPoolUsed, final long lastUpdate, final int xceiverCount, + final long blockPoolUsed, final long cacheCapacity, final long cacheUsed, + final long lastUpdate, final int xceiverCount, final AdminStates adminState) { this(nodeID.getIpAddr(), nodeID.getHostName(), nodeID.getDatanodeUuid(), nodeID.getXferPort(), nodeID.getInfoPort(), nodeID.getInfoSecurePort(), nodeID.getIpcPort(), capacity, dfsUsed, remaining, blockPoolUsed, - lastUpdate, xceiverCount, location, adminState); + cacheCapacity, cacheUsed, lastUpdate, xceiverCount, location, adminState); } /** Constructor */ @@ -119,7 +126,8 @@ public class DatanodeInfo extends DatanodeID implements Node { final String datanodeUuid, final int xferPort, final int infoPort, final int infoSecurePort, final int ipcPort, final long capacity, final long dfsUsed, final long remaining, - final long blockPoolUsed, final long lastUpdate, final int xceiverCount, + final long blockPoolUsed, final long cacheCapacity, final long cacheUsed, + final long lastUpdate, final int xceiverCount, final String networkLocation, final AdminStates adminState) { super(ipAddr, hostName, datanodeUuid, xferPort, infoPort, infoSecurePort, ipcPort); @@ -127,6 +135,8 @@ public class DatanodeInfo extends DatanodeID implements Node { this.dfsUsed = dfsUsed; this.remaining = remaining; this.blockPoolUsed = blockPoolUsed; + this.cacheCapacity = cacheCapacity; + this.cacheUsed = cacheUsed; this.lastUpdate = lastUpdate; this.xceiverCount = xceiverCount; this.location = networkLocation; @@ -172,6 +182,42 @@ public class DatanodeInfo extends DatanodeID implements Node { return DFSUtil.getPercentRemaining(remaining, capacity); } + /** + * @return Amount of cache capacity in bytes + */ + public long getCacheCapacity() { + return cacheCapacity; + } + + /** + * @return Amount of cache used in bytes + */ + public long getCacheUsed() { + return cacheUsed; + } + + /** + * @return Cache used as a percentage of the datanode's total cache capacity + */ + public float getCacheUsedPercent() { + return DFSUtil.getPercentUsed(cacheUsed, cacheCapacity); + } + + /** + * @return Amount of cache remaining in bytes + */ + public long getCacheRemaining() { + return cacheCapacity - cacheUsed; + } + + /** + * @return Cache remaining as a percentage of the datanode's total cache + * capacity + */ + public float getCacheRemainingPercent() { + return DFSUtil.getPercentRemaining(getCacheRemaining(), cacheCapacity); + } + /** The time when this information was accurate. */ public long getLastUpdate() { return lastUpdate; } @@ -198,6 +244,16 @@ public class DatanodeInfo extends DatanodeID implements Node { this.blockPoolUsed = bpUsed; } + /** Sets cache capacity. */ + public void setCacheCapacity(long cacheCapacity) { + this.cacheCapacity = cacheCapacity; + } + + /** Sets cache used. */ + public void setCacheUsed(long cacheUsed) { + this.cacheUsed = cacheUsed; + } + /** Sets time when this information was accurate. */ public void setLastUpdate(long lastUpdate) { this.lastUpdate = lastUpdate; @@ -225,6 +281,11 @@ public class DatanodeInfo extends DatanodeID implements Node { long nonDFSUsed = getNonDfsUsed(); float usedPercent = getDfsUsedPercent(); float remainingPercent = getRemainingPercent(); + long cc = getCacheCapacity(); + long cr = getCacheRemaining(); + long cu = getCacheUsed(); + float cacheUsedPercent = getCacheUsedPercent(); + float cacheRemainingPercent = getCacheRemainingPercent(); String lookupName = NetUtils.getHostNameOfIP(getName()); buffer.append("Name: "+ getName()); @@ -251,6 +312,12 @@ public class DatanodeInfo extends DatanodeID implements Node { buffer.append("DFS Remaining: " +r+ " ("+StringUtils.byteDesc(r)+")"+"\n"); buffer.append("DFS Used%: "+percent2String(usedPercent) + "\n"); buffer.append("DFS Remaining%: "+percent2String(remainingPercent) + "\n"); + buffer.append("Configured Cache Capacity: "+cc+" ("+StringUtils.byteDesc(cc)+")"+"\n"); + buffer.append("Cache Used: "+cu+" ("+StringUtils.byteDesc(cu)+")"+"\n"); + buffer.append("Cache Remaining: " +cr+ " ("+StringUtils.byteDesc(cr)+")"+"\n"); + buffer.append("Cache Used%: "+percent2String(cacheUsedPercent) + "\n"); + buffer.append("Cache Remaining%: "+percent2String(cacheRemainingPercent) + "\n"); + buffer.append("Last contact: "+new Date(lastUpdate)+"\n"); return buffer.toString(); } @@ -261,6 +328,9 @@ public class DatanodeInfo extends DatanodeID implements Node { long c = getCapacity(); long r = getRemaining(); long u = getDfsUsed(); + long cc = getCacheCapacity(); + long cr = getCacheRemaining(); + long cu = getCacheUsed(); buffer.append(getName()); if (!NetworkTopology.DEFAULT_RACK.equals(location)) { buffer.append(" "+location); @@ -276,6 +346,10 @@ public class DatanodeInfo extends DatanodeID implements Node { buffer.append(" " + u + "(" + StringUtils.byteDesc(u)+")"); buffer.append(" " + percent2String(u/(double)c)); buffer.append(" " + r + "(" + StringUtils.byteDesc(r)+")"); + buffer.append(" " + cc + "(" + StringUtils.byteDesc(cc)+")"); + buffer.append(" " + cu + "(" + StringUtils.byteDesc(cu)+")"); + buffer.append(" " + percent2String(cu/(double)cc)); + buffer.append(" " + cr + "(" + StringUtils.byteDesc(cr)+")"); buffer.append(" " + new Date(lastUpdate)); return buffer.toString(); } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LayoutVersion.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LayoutVersion.java index 72bb401d417..923ed70ac8f 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LayoutVersion.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LayoutVersion.java @@ -111,7 +111,8 @@ public class LayoutVersion { + "the new block instead of the entire block list"), ADD_DATANODE_AND_STORAGE_UUIDS(-49, "Replace StorageID with DatanodeUuid." + " Use distinct StorageUuid per storage directory."), - ADD_LAYOUT_FLAGS(-50, "Add support for layout flags."); + ADD_LAYOUT_FLAGS(-50, "Add support for layout flags."), + CACHING(-51, "Support for cache pools and path-based caching"); final int lv; final int ancestorLV; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LocatedBlock.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LocatedBlock.java index e053641afed..0e6dd125464 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LocatedBlock.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocol/LocatedBlock.java @@ -17,6 +17,8 @@ */ package org.apache.hadoop.hdfs.protocol; +import java.util.List; + import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.classification.InterfaceStability; import org.apache.hadoop.hdfs.StorageType; @@ -24,10 +26,14 @@ import org.apache.hadoop.hdfs.security.token.block.BlockTokenIdentifier; import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeStorageInfo; import org.apache.hadoop.security.token.Token; +import com.google.common.base.Preconditions; +import com.google.common.collect.Lists; + /** * Associates a block with the Datanodes that contain its replicas * and other block metadata (E.g. the file offset associated with this - * block, whether it is corrupt, security token, etc). + * block, whether it is corrupt, a location is cached in memory, + * security token, etc). */ @InterfaceAudience.Private @InterfaceStability.Evolving @@ -45,6 +51,13 @@ public class LocatedBlock { // their locations are not part of this object private boolean corrupt; private Token blockToken = new Token(); + /** + * List of cached datanode locations + */ + private DatanodeInfo[] cachedLocs; + + // Used when there are no locations + private static final DatanodeInfo[] EMPTY_LOCS = new DatanodeInfo[0]; public LocatedBlock(ExtendedBlock b, DatanodeInfo[] locs) { this(b, locs, -1, false); // startOffset is unknown @@ -52,7 +65,7 @@ public class LocatedBlock { public LocatedBlock(ExtendedBlock b, DatanodeInfo[] locs, long startOffset, boolean corrupt) { - this(b, locs, null, null, startOffset, corrupt); + this(b, locs, null, null, startOffset, corrupt, EMPTY_LOCS); } public LocatedBlock(ExtendedBlock b, DatanodeStorageInfo[] storages) { @@ -61,7 +74,7 @@ public class LocatedBlock { public LocatedBlock(ExtendedBlock b, DatanodeInfo[] locs, String[] storageIDs, StorageType[] storageTypes) { - this(b, locs, storageIDs, storageTypes, -1, false); + this(b, locs, storageIDs, storageTypes, -1, false, EMPTY_LOCS); } public LocatedBlock(ExtendedBlock b, DatanodeStorageInfo[] storages, @@ -69,22 +82,29 @@ public class LocatedBlock { this(b, DatanodeStorageInfo.toDatanodeInfos(storages), DatanodeStorageInfo.toStorageIDs(storages), DatanodeStorageInfo.toStorageTypes(storages), - startOffset, corrupt); // startOffset is unknown + startOffset, corrupt, EMPTY_LOCS); // startOffset is unknown } public LocatedBlock(ExtendedBlock b, DatanodeInfo[] locs, String[] storageIDs, StorageType[] storageTypes, long startOffset, - boolean corrupt) { + boolean corrupt, DatanodeInfo[] cachedLocs) { this.b = b; this.offset = startOffset; this.corrupt = corrupt; if (locs==null) { - this.locs = new DatanodeInfo[0]; + this.locs = EMPTY_LOCS; } else { this.locs = locs; } this.storageIDs = storageIDs; this.storageTypes = storageTypes; + Preconditions.checkArgument(cachedLocs != null, + "cachedLocs should not be null, use a different constructor"); + if (cachedLocs.length == 0) { + this.cachedLocs = EMPTY_LOCS; + } else { + this.cachedLocs = cachedLocs; + } } public Token getBlockToken() { @@ -131,6 +151,36 @@ public class LocatedBlock { return this.corrupt; } + /** + * Add a the location of a cached replica of the block. + * + * @param loc of datanode with the cached replica + */ + public void addCachedLoc(DatanodeInfo loc) { + List cachedList = Lists.newArrayList(cachedLocs); + if (cachedList.contains(loc)) { + return; + } + // Try to re-use a DatanodeInfo already in loc + for (int i=0; i entries = + server.listCacheDirectives(request.getPrevId(), filter); + ListCacheDirectivesResponseProto.Builder builder = + ListCacheDirectivesResponseProto.newBuilder(); + builder.setHasMore(entries.hasMore()); + for (int i=0, n=entries.size(); i entries = + server.listCachePools(request.getPrevPoolName()); + ListCachePoolsResponseProto.Builder responseBuilder = + ListCachePoolsResponseProto.newBuilder(); + responseBuilder.setHasMore(entries.hasMore()); + for (int i=0, n=entries.size(); i flags) throws IOException { + try { + AddCacheDirectiveRequestProto.Builder builder = + AddCacheDirectiveRequestProto.newBuilder(). + setInfo(PBHelper.convert(directive)); + if (!flags.isEmpty()) { + builder.setCacheFlags(PBHelper.convertCacheFlags(flags)); + } + return rpcProxy.addCacheDirective(null, builder.build()).getId(); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + @Override + public void modifyCacheDirective(CacheDirectiveInfo directive, + EnumSet flags) throws IOException { + try { + ModifyCacheDirectiveRequestProto.Builder builder = + ModifyCacheDirectiveRequestProto.newBuilder(). + setInfo(PBHelper.convert(directive)); + if (!flags.isEmpty()) { + builder.setCacheFlags(PBHelper.convertCacheFlags(flags)); + } + rpcProxy.modifyCacheDirective(null, builder.build()); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + @Override + public void removeCacheDirective(long id) + throws IOException { + try { + rpcProxy.removeCacheDirective(null, + RemoveCacheDirectiveRequestProto.newBuilder(). + setId(id).build()); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + private static class BatchedCacheEntries + implements BatchedEntries { + private ListCacheDirectivesResponseProto response; + + BatchedCacheEntries( + ListCacheDirectivesResponseProto response) { + this.response = response; + } + + @Override + public CacheDirectiveEntry get(int i) { + return PBHelper.convert(response.getElements(i)); + } + + @Override + public int size() { + return response.getElementsCount(); + } + + @Override + public boolean hasMore() { + return response.getHasMore(); + } + } + + @Override + public BatchedEntries + listCacheDirectives(long prevId, + CacheDirectiveInfo filter) throws IOException { + if (filter == null) { + filter = new CacheDirectiveInfo.Builder().build(); + } + try { + return new BatchedCacheEntries( + rpcProxy.listCacheDirectives(null, + ListCacheDirectivesRequestProto.newBuilder(). + setPrevId(prevId). + setFilter(PBHelper.convert(filter)). + build())); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + @Override + public void addCachePool(CachePoolInfo info) throws IOException { + AddCachePoolRequestProto.Builder builder = + AddCachePoolRequestProto.newBuilder(); + builder.setInfo(PBHelper.convert(info)); + try { + rpcProxy.addCachePool(null, builder.build()); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + @Override + public void modifyCachePool(CachePoolInfo req) throws IOException { + ModifyCachePoolRequestProto.Builder builder = + ModifyCachePoolRequestProto.newBuilder(); + builder.setInfo(PBHelper.convert(req)); + try { + rpcProxy.modifyCachePool(null, builder.build()); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + @Override + public void removeCachePool(String cachePoolName) throws IOException { + try { + rpcProxy.removeCachePool(null, + RemoveCachePoolRequestProto.newBuilder(). + setPoolName(cachePoolName).build()); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } + + private static class BatchedCachePoolEntries + implements BatchedEntries { + private final ListCachePoolsResponseProto proto; + + public BatchedCachePoolEntries(ListCachePoolsResponseProto proto) { + this.proto = proto; + } + + @Override + public CachePoolEntry get(int i) { + CachePoolEntryProto elem = proto.getEntries(i); + return PBHelper.convert(elem); + } + + @Override + public int size() { + return proto.getEntriesCount(); + } + + @Override + public boolean hasMore() { + return proto.getHasMore(); + } + } + + @Override + public BatchedEntries listCachePools(String prevKey) + throws IOException { + try { + return new BatchedCachePoolEntries( + rpcProxy.listCachePools(null, + ListCachePoolsRequestProto.newBuilder(). + setPrevPoolName(prevKey).build())); + } catch (ServiceException e) { + throw ProtobufHelper.getRemoteException(e); + } + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolClientSideTranslatorPB.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolClientSideTranslatorPB.java index 315ad92d049..c765315f1c6 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolClientSideTranslatorPB.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolClientSideTranslatorPB.java @@ -22,6 +22,7 @@ import java.io.Closeable; import java.io.IOException; import java.net.InetSocketAddress; import java.util.HashMap; +import java.util.List; import java.util.Map; import java.util.concurrent.TimeUnit; @@ -36,6 +37,8 @@ import org.apache.hadoop.hdfs.protocol.LocatedBlock; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReceivedAndDeletedRequestProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReportRequestProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReportResponseProto; +import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CacheReportRequestProto; +import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CacheReportResponseProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CommitBlockSynchronizationRequestProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.DatanodeCommandProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.ErrorReportRequestProto; @@ -152,8 +155,9 @@ public class DatanodeProtocolClientSideTranslatorPB implements @Override public HeartbeatResponse sendHeartbeat(DatanodeRegistration registration, - StorageReport[] reports, int xmitsInProgress, int xceiverCount, - int failedVolumes) throws IOException { + StorageReport[] reports, long cacheCapacity, long cacheUsed, + int xmitsInProgress, int xceiverCount, int failedVolumes) + throws IOException { HeartbeatRequestProto.Builder builder = HeartbeatRequestProto.newBuilder() .setRegistration(PBHelper.convert(registration)) .setXmitsInProgress(xmitsInProgress).setXceiverCount(xceiverCount) @@ -161,7 +165,12 @@ public class DatanodeProtocolClientSideTranslatorPB implements for (StorageReport r : reports) { builder.addReports(PBHelper.convert(r)); } - + if (cacheCapacity != 0) { + builder.setCacheCapacity(cacheCapacity); + } + if (cacheUsed != 0) { + builder.setCacheUsed(cacheUsed); + } HeartbeatResponseProto resp; try { resp = rpcProxy.sendHeartbeat(NULL_CONTROLLER, builder.build()); @@ -202,6 +211,29 @@ public class DatanodeProtocolClientSideTranslatorPB implements return resp.hasCmd() ? PBHelper.convert(resp.getCmd()) : null; } + @Override + public DatanodeCommand cacheReport(DatanodeRegistration registration, + String poolId, List blockIds) throws IOException { + CacheReportRequestProto.Builder builder = + CacheReportRequestProto.newBuilder() + .setRegistration(PBHelper.convert(registration)) + .setBlockPoolId(poolId); + for (Long blockId : blockIds) { + builder.addBlocks(blockId); + } + + CacheReportResponseProto resp; + try { + resp = rpcProxy.cacheReport(NULL_CONTROLLER, builder.build()); + } catch (ServiceException se) { + throw ProtobufHelper.getRemoteException(se); + } + if (resp.hasCmd()) { + return PBHelper.convert(resp.getCmd()); + } + return null; + } + @Override public void blockReceivedAndDeleted(DatanodeRegistration registration, String poolId, StorageReceivedDeletedBlocks[] receivedAndDeletedBlocks) diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolServerSideTranslatorPB.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolServerSideTranslatorPB.java index 339a03d59d7..e5b08cd6c5a 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolServerSideTranslatorPB.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/DatanodeProtocolServerSideTranslatorPB.java @@ -27,6 +27,8 @@ import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReceive import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReceivedAndDeletedResponseProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReportRequestProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockReportResponseProto; +import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CacheReportRequestProto; +import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CacheReportResponseProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CommitBlockSynchronizationRequestProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.CommitBlockSynchronizationResponseProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.ErrorReportRequestProto; @@ -102,8 +104,9 @@ public class DatanodeProtocolServerSideTranslatorPB implements final StorageReport[] report = PBHelper.convertStorageReports( request.getReportsList()); response = impl.sendHeartbeat(PBHelper.convert(request.getRegistration()), - report, request.getXmitsInProgress(), request.getXceiverCount(), - request.getFailedVolumes()); + report, request.getCacheCapacity(), request.getCacheUsed(), + request.getXmitsInProgress(), + request.getXceiverCount(), request.getFailedVolumes()); } catch (IOException e) { throw new ServiceException(e); } @@ -152,6 +155,27 @@ public class DatanodeProtocolServerSideTranslatorPB implements return builder.build(); } + @Override + public CacheReportResponseProto cacheReport(RpcController controller, + CacheReportRequestProto request) throws ServiceException { + DatanodeCommand cmd = null; + try { + cmd = impl.cacheReport( + PBHelper.convert(request.getRegistration()), + request.getBlockPoolId(), + request.getBlocksList()); + } catch (IOException e) { + throw new ServiceException(e); + } + CacheReportResponseProto.Builder builder = + CacheReportResponseProto.newBuilder(); + if (cmd != null) { + builder.setCmd(PBHelper.convert(cmd)); + } + return builder.build(); + } + + @Override public BlockReceivedAndDeletedResponseProto blockReceivedAndDeleted( RpcController controller, BlockReceivedAndDeletedRequestProto request) diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/PBHelper.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/PBHelper.java index 4514a6710ee..40ad3aea483 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/PBHelper.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/protocolPB/PBHelper.java @@ -17,6 +17,8 @@ */ package org.apache.hadoop.hdfs.protocolPB; +import static com.google.common.base.Preconditions.checkNotNull; + import java.io.EOFException; import java.io.IOException; import java.io.InputStream; @@ -26,18 +28,26 @@ import java.util.EnumSet; import java.util.List; import com.google.common.base.Preconditions; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.ContentSummary; import org.apache.hadoop.fs.CreateFlag; import org.apache.hadoop.fs.FsServerDefaults; +import org.apache.hadoop.fs.Path; import org.apache.hadoop.fs.permission.FsPermission; import org.apache.hadoop.ha.HAServiceProtocol.HAServiceState; import org.apache.hadoop.hdfs.DFSUtil; import org.apache.hadoop.hdfs.StorageType; import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveStats; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolStats; import org.apache.hadoop.hdfs.protocol.ClientProtocol; import org.apache.hadoop.hdfs.protocol.CorruptFileBlocks; import org.apache.hadoop.hdfs.protocol.DatanodeID; import org.apache.hadoop.hdfs.protocol.DatanodeInfo; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; import org.apache.hadoop.hdfs.protocol.SnapshotDiffReport; import org.apache.hadoop.hdfs.protocol.DatanodeInfo.AdminStates; import org.apache.hadoop.hdfs.protocol.DirectoryListing; @@ -52,12 +62,21 @@ import org.apache.hadoop.hdfs.protocol.SnapshotDiffReport.DiffReportEntry; import org.apache.hadoop.hdfs.protocol.SnapshotDiffReport.DiffType; import org.apache.hadoop.hdfs.protocol.SnapshottableDirectoryStatus; import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CacheDirectiveEntryProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CacheDirectiveInfoExpirationProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CacheDirectiveStatsProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CacheFlagProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CachePoolEntryProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CachePoolInfoProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CachePoolStatsProto; import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CreateFlagProto; import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.DatanodeReportTypeProto; import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.GetFsStatsResponseProto; import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.SafeModeActionProto; +import org.apache.hadoop.hdfs.protocol.proto.ClientNamenodeProtocolProtos.CacheDirectiveInfoProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BalancerBandwidthCommandProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockCommandProto; +import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockIdCommandProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.BlockRecoveryCommandProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.DatanodeCommandProto; import org.apache.hadoop.hdfs.protocol.proto.DatanodeProtocolProtos.DatanodeRegistrationProto; @@ -121,6 +140,7 @@ import org.apache.hadoop.hdfs.server.namenode.CheckpointSignature; import org.apache.hadoop.hdfs.server.namenode.INodeId; import org.apache.hadoop.hdfs.server.protocol.BalancerBandwidthCommand; import org.apache.hadoop.hdfs.server.protocol.BlockCommand; +import org.apache.hadoop.hdfs.server.protocol.BlockIdCommand; import org.apache.hadoop.hdfs.server.protocol.BlockRecoveryCommand; import org.apache.hadoop.hdfs.server.protocol.BlockRecoveryCommand.RecoveringBlock; import org.apache.hadoop.hdfs.server.protocol.BlocksWithLocations; @@ -151,7 +171,9 @@ import org.apache.hadoop.security.proto.SecurityProtos.TokenProto; import org.apache.hadoop.security.token.Token; import org.apache.hadoop.util.DataChecksum; +import com.google.common.base.Preconditions; import com.google.common.collect.Lists; +import com.google.common.primitives.Shorts; import com.google.protobuf.ByteString; import com.google.protobuf.CodedInputStream; @@ -482,27 +504,14 @@ public class PBHelper { PBHelper.convert(di.getId()), di.hasLocation() ? di.getLocation() : null , di.getCapacity(), di.getDfsUsed(), di.getRemaining(), - di.getBlockPoolUsed() , di.getLastUpdate() , di.getXceiverCount() , + di.getBlockPoolUsed(), di.getCacheCapacity(), di.getCacheUsed(), + di.getLastUpdate(), di.getXceiverCount(), PBHelper.convert(di.getAdminState())); } static public DatanodeInfoProto convertDatanodeInfo(DatanodeInfo di) { if (di == null) return null; - DatanodeInfoProto.Builder builder = DatanodeInfoProto.newBuilder(); - if (di.getNetworkLocation() != null) { - builder.setLocation(di.getNetworkLocation()); - } - - return builder. - setId(PBHelper.convert((DatanodeID) di)). - setCapacity(di.getCapacity()). - setDfsUsed(di.getDfsUsed()). - setRemaining(di.getRemaining()). - setBlockPoolUsed(di.getBlockPoolUsed()). - setLastUpdate(di.getLastUpdate()). - setXceiverCount(di.getXceiverCount()). - setAdminState(PBHelper.convert(di.getAdminState())). - build(); + return convert(di); } @@ -546,15 +555,20 @@ public class PBHelper { public static DatanodeInfoProto convert(DatanodeInfo info) { DatanodeInfoProto.Builder builder = DatanodeInfoProto.newBuilder(); - builder.setBlockPoolUsed(info.getBlockPoolUsed()); - builder.setAdminState(PBHelper.convert(info.getAdminState())); - builder.setCapacity(info.getCapacity()) - .setDfsUsed(info.getDfsUsed()) + if (info.getNetworkLocation() != null) { + builder.setLocation(info.getNetworkLocation()); + } + builder .setId(PBHelper.convert((DatanodeID)info)) - .setLastUpdate(info.getLastUpdate()) - .setLocation(info.getNetworkLocation()) + .setCapacity(info.getCapacity()) + .setDfsUsed(info.getDfsUsed()) .setRemaining(info.getRemaining()) + .setBlockPoolUsed(info.getBlockPoolUsed()) + .setCacheCapacity(info.getCacheCapacity()) + .setCacheUsed(info.getCacheUsed()) + .setLastUpdate(info.getLastUpdate()) .setXceiverCount(info.getXceiverCount()) + .setAdminState(PBHelper.convert(info.getAdminState())) .build(); return builder.build(); } @@ -575,9 +589,20 @@ public class PBHelper { if (b == null) return null; Builder builder = LocatedBlockProto.newBuilder(); DatanodeInfo[] locs = b.getLocations(); + List cachedLocs = + Lists.newLinkedList(Arrays.asList(b.getCachedLocations())); for (int i = 0; i < locs.length; i++) { - builder.addLocs(i, PBHelper.convert(locs[i])); + DatanodeInfo loc = locs[i]; + builder.addLocs(i, PBHelper.convert(loc)); + boolean locIsCached = cachedLocs.contains(loc); + builder.addIsCached(locIsCached); + if (locIsCached) { + cachedLocs.remove(loc); + } } + Preconditions.checkArgument(cachedLocs.size() == 0, + "Found additional cached replica locations that are not in the set of" + + " storage-backed locations!"); StorageType[] storageTypes = b.getStorageTypes(); if (storageTypes != null) { @@ -621,9 +646,20 @@ public class PBHelper { storageIDs = proto.getStorageIDsList().toArray(new String[storageIDsCount]); } + // Set values from the isCached list, re-using references from loc + List cachedLocs = new ArrayList(locs.size()); + List isCachedList = proto.getIsCachedList(); + for (int i=0; i convert(DatanodeInfo[][] targets) { DatanodeInfosProto[] ret = new DatanodeInfosProto[targets.length]; @@ -817,8 +875,13 @@ public class PBHelper { case DatanodeProtocol.DNA_TRANSFER: case DatanodeProtocol.DNA_INVALIDATE: case DatanodeProtocol.DNA_SHUTDOWN: - builder.setCmdType(DatanodeCommandProto.Type.BlockCommand).setBlkCmd( - PBHelper.convert((BlockCommand) datanodeCommand)); + builder.setCmdType(DatanodeCommandProto.Type.BlockCommand). + setBlkCmd(PBHelper.convert((BlockCommand) datanodeCommand)); + break; + case DatanodeProtocol.DNA_CACHE: + case DatanodeProtocol.DNA_UNCACHE: + builder.setCmdType(DatanodeCommandProto.Type.BlockIdCommand). + setBlkIdCmd(PBHelper.convert((BlockIdCommand) datanodeCommand)); break; case DatanodeProtocol.DNA_UNKNOWN: //Not expected default: @@ -877,11 +940,33 @@ public class PBHelper { case SHUTDOWN: action = DatanodeProtocol.DNA_SHUTDOWN; break; + default: + throw new AssertionError("Unknown action type: " + blkCmd.getAction()); } return new BlockCommand(action, blkCmd.getBlockPoolId(), blocks, targets, targetStorageIDs); } + public static BlockIdCommand convert(BlockIdCommandProto blkIdCmd) { + int numBlockIds = blkIdCmd.getBlockIdsCount(); + long blockIds[] = new long[numBlockIds]; + for (int i = 0; i < numBlockIds; i++) { + blockIds[i] = blkIdCmd.getBlockIds(i); + } + int action = DatanodeProtocol.DNA_UNKNOWN; + switch (blkIdCmd.getAction()) { + case CACHE: + action = DatanodeProtocol.DNA_CACHE; + break; + case UNCACHE: + action = DatanodeProtocol.DNA_UNCACHE; + break; + default: + throw new AssertionError("Unknown action type: " + blkIdCmd.getAction()); + } + return new BlockIdCommand(action, blkIdCmd.getBlockPoolId(), blockIds); + } + public static DatanodeInfo[] convert(DatanodeInfosProto datanodeInfosProto) { List proto = datanodeInfosProto.getDatanodesList(); DatanodeInfo[] infos = new DatanodeInfo[proto.size()]; @@ -1090,7 +1175,7 @@ public class PBHelper { return value; } - public static EnumSetWritable convert(int flag) { + public static EnumSetWritable convertCreateFlag(int flag) { EnumSet result = EnumSet.noneOf(CreateFlag.class); if ((flag & CreateFlagProto.APPEND_VALUE) == CreateFlagProto.APPEND_VALUE) { @@ -1105,7 +1190,23 @@ public class PBHelper { } return new EnumSetWritable(result); } - + + public static int convertCacheFlags(EnumSet flags) { + int value = 0; + if (flags.contains(CacheFlag.FORCE)) { + value |= CacheFlagProto.FORCE.getNumber(); + } + return value; + } + + public static EnumSet convertCacheFlags(int flags) { + EnumSet result = EnumSet.noneOf(CacheFlag.class); + if ((flags & CacheFlagProto.FORCE_VALUE) == CacheFlagProto.FORCE_VALUE) { + result.add(CacheFlag.FORCE); + } + return result; + } + public static HdfsFileStatus convert(HdfsFileStatusProto fs) { if (fs == null) return null; @@ -1455,11 +1556,12 @@ public class PBHelper { } public static StorageReportProto convert(StorageReport r) { - return StorageReportProto.newBuilder() + StorageReportProto.Builder builder = StorageReportProto.newBuilder() .setBlockPoolUsed(r.getBlockPoolUsed()).setCapacity(r.getCapacity()) .setDfsUsed(r.getDfsUsed()).setRemaining(r.getRemaining()) .setStorageUuid(r.getStorage().getStorageID()) - .setStorage(convert(r.getStorage())).build(); + .setStorage(convert(r.getStorage())); + return builder.build(); } public static StorageReport convert(StorageReportProto p) { @@ -1598,6 +1700,178 @@ public class PBHelper { return DataChecksum.Type.valueOf(type.getNumber()); } + public static CacheDirectiveInfoProto convert + (CacheDirectiveInfo info) { + CacheDirectiveInfoProto.Builder builder = + CacheDirectiveInfoProto.newBuilder(); + if (info.getId() != null) { + builder.setId(info.getId()); + } + if (info.getPath() != null) { + builder.setPath(info.getPath().toUri().getPath()); + } + if (info.getReplication() != null) { + builder.setReplication(info.getReplication()); + } + if (info.getPool() != null) { + builder.setPool(info.getPool()); + } + if (info.getExpiration() != null) { + builder.setExpiration(convert(info.getExpiration())); + } + return builder.build(); + } + + public static CacheDirectiveInfo convert + (CacheDirectiveInfoProto proto) { + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(); + if (proto.hasId()) { + builder.setId(proto.getId()); + } + if (proto.hasPath()) { + builder.setPath(new Path(proto.getPath())); + } + if (proto.hasReplication()) { + builder.setReplication(Shorts.checkedCast( + proto.getReplication())); + } + if (proto.hasPool()) { + builder.setPool(proto.getPool()); + } + if (proto.hasExpiration()) { + builder.setExpiration(convert(proto.getExpiration())); + } + return builder.build(); + } + + public static CacheDirectiveInfoExpirationProto convert( + CacheDirectiveInfo.Expiration expiration) { + return CacheDirectiveInfoExpirationProto.newBuilder() + .setIsRelative(expiration.isRelative()) + .setMillis(expiration.getMillis()) + .build(); + } + + public static CacheDirectiveInfo.Expiration convert( + CacheDirectiveInfoExpirationProto proto) { + if (proto.getIsRelative()) { + return CacheDirectiveInfo.Expiration.newRelative(proto.getMillis()); + } + return CacheDirectiveInfo.Expiration.newAbsolute(proto.getMillis()); + } + + public static CacheDirectiveStatsProto convert(CacheDirectiveStats stats) { + CacheDirectiveStatsProto.Builder builder = + CacheDirectiveStatsProto.newBuilder(); + builder.setBytesNeeded(stats.getBytesNeeded()); + builder.setBytesCached(stats.getBytesCached()); + builder.setFilesNeeded(stats.getFilesNeeded()); + builder.setFilesCached(stats.getFilesCached()); + builder.setHasExpired(stats.hasExpired()); + return builder.build(); + } + + public static CacheDirectiveStats convert(CacheDirectiveStatsProto proto) { + CacheDirectiveStats.Builder builder = new CacheDirectiveStats.Builder(); + builder.setBytesNeeded(proto.getBytesNeeded()); + builder.setBytesCached(proto.getBytesCached()); + builder.setFilesNeeded(proto.getFilesNeeded()); + builder.setFilesCached(proto.getFilesCached()); + builder.setHasExpired(proto.getHasExpired()); + return builder.build(); + } + + public static CacheDirectiveEntryProto convert(CacheDirectiveEntry entry) { + CacheDirectiveEntryProto.Builder builder = + CacheDirectiveEntryProto.newBuilder(); + builder.setInfo(PBHelper.convert(entry.getInfo())); + builder.setStats(PBHelper.convert(entry.getStats())); + return builder.build(); + } + + public static CacheDirectiveEntry convert(CacheDirectiveEntryProto proto) { + CacheDirectiveInfo info = PBHelper.convert(proto.getInfo()); + CacheDirectiveStats stats = PBHelper.convert(proto.getStats()); + return new CacheDirectiveEntry(info, stats); + } + + public static CachePoolInfoProto convert(CachePoolInfo info) { + CachePoolInfoProto.Builder builder = CachePoolInfoProto.newBuilder(); + builder.setPoolName(info.getPoolName()); + if (info.getOwnerName() != null) { + builder.setOwnerName(info.getOwnerName()); + } + if (info.getGroupName() != null) { + builder.setGroupName(info.getGroupName()); + } + if (info.getMode() != null) { + builder.setMode(info.getMode().toShort()); + } + if (info.getLimit() != null) { + builder.setLimit(info.getLimit()); + } + if (info.getMaxRelativeExpiryMs() != null) { + builder.setMaxRelativeExpiry(info.getMaxRelativeExpiryMs()); + } + return builder.build(); + } + + public static CachePoolInfo convert (CachePoolInfoProto proto) { + // Pool name is a required field, the rest are optional + String poolName = checkNotNull(proto.getPoolName()); + CachePoolInfo info = new CachePoolInfo(poolName); + if (proto.hasOwnerName()) { + info.setOwnerName(proto.getOwnerName()); + } + if (proto.hasGroupName()) { + info.setGroupName(proto.getGroupName()); + } + if (proto.hasMode()) { + info.setMode(new FsPermission((short)proto.getMode())); + } + if (proto.hasLimit()) { + info.setLimit(proto.getLimit()); + } + if (proto.hasMaxRelativeExpiry()) { + info.setMaxRelativeExpiryMs(proto.getMaxRelativeExpiry()); + } + return info; + } + + public static CachePoolStatsProto convert(CachePoolStats stats) { + CachePoolStatsProto.Builder builder = CachePoolStatsProto.newBuilder(); + builder.setBytesNeeded(stats.getBytesNeeded()); + builder.setBytesCached(stats.getBytesCached()); + builder.setBytesOverlimit(stats.getBytesOverlimit()); + builder.setFilesNeeded(stats.getFilesNeeded()); + builder.setFilesCached(stats.getFilesCached()); + return builder.build(); + } + + public static CachePoolStats convert (CachePoolStatsProto proto) { + CachePoolStats.Builder builder = new CachePoolStats.Builder(); + builder.setBytesNeeded(proto.getBytesNeeded()); + builder.setBytesCached(proto.getBytesCached()); + builder.setBytesOverlimit(proto.getBytesOverlimit()); + builder.setFilesNeeded(proto.getFilesNeeded()); + builder.setFilesCached(proto.getFilesCached()); + return builder.build(); + } + + public static CachePoolEntryProto convert(CachePoolEntry entry) { + CachePoolEntryProto.Builder builder = CachePoolEntryProto.newBuilder(); + builder.setInfo(PBHelper.convert(entry.getInfo())); + builder.setStats(PBHelper.convert(entry.getStats())); + return builder.build(); + } + + public static CachePoolEntry convert (CachePoolEntryProto proto) { + CachePoolInfo info = PBHelper.convert(proto.getInfo()); + CachePoolStats stats = PBHelper.convert(proto.getStats()); + return new CachePoolEntry(info, stats); + } + public static HdfsProtos.ChecksumTypeProto convert(DataChecksum.Type type) { return HdfsProtos.ChecksumTypeProto.valueOf(type.id); } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockInfo.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockInfo.java index c0d4892dc77..5600d78e84e 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockInfo.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockInfo.java @@ -158,7 +158,7 @@ public class BlockInfo extends Block implements LightWeightGSet.LinkedElement { return info; } - int getCapacity() { + public int getCapacity() { assert this.triplets != null : "BlockInfo is not initialized"; assert triplets.length % 3 == 0 : "Malformed BlockInfo"; return triplets.length / 3; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockManager.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockManager.java index bae56e4ed5b..ee59d829b13 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockManager.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/BlockManager.java @@ -3180,6 +3180,13 @@ assert storedBlock.findDatanode(dn) < 0 : "Block " + block UnderReplicatedBlocks.QUEUE_WITH_CORRUPT_BLOCKS); } + /** + * Get the replicas which are corrupt for a given block. + */ + public Collection getCorruptReplicas(Block block) { + return corruptReplicas.getNodes(block); + } + /** @return the size of UnderReplicatedBlocks */ public int numOfUnderReplicatedBlocks() { return neededReplications.size(); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/CacheReplicationMonitor.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/CacheReplicationMonitor.java new file mode 100644 index 00000000000..aef726fa9b9 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/CacheReplicationMonitor.java @@ -0,0 +1,774 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.blockmanagement; + +import static org.apache.hadoop.util.ExitUtil.terminate; + +import java.io.Closeable; +import java.io.IOException; +import java.util.ArrayList; +import java.util.Collection; +import java.util.Date; +import java.util.Iterator; +import java.util.LinkedList; +import java.util.List; +import java.util.Random; +import java.util.TreeMap; +import java.util.concurrent.TimeUnit; +import java.util.concurrent.locks.Condition; +import java.util.concurrent.locks.ReentrantLock; + +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.fs.UnresolvedLinkException; +import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirective; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList.Type; +import org.apache.hadoop.hdfs.server.common.HdfsServerConstants.BlockUCState; +import org.apache.hadoop.hdfs.server.namenode.CacheManager; +import org.apache.hadoop.hdfs.server.namenode.CachePool; +import org.apache.hadoop.hdfs.server.namenode.CachedBlock; +import org.apache.hadoop.hdfs.server.namenode.FSDirectory; +import org.apache.hadoop.hdfs.server.namenode.FSNamesystem; +import org.apache.hadoop.hdfs.server.namenode.INode; +import org.apache.hadoop.hdfs.server.namenode.INodeDirectory; +import org.apache.hadoop.hdfs.server.namenode.INodeFile; +import org.apache.hadoop.hdfs.util.ReadOnlyList; +import org.apache.hadoop.util.GSet; +import org.apache.hadoop.util.Time; + +import com.google.common.base.Preconditions; + +/** + * Scans the namesystem, scheduling blocks to be cached as appropriate. + * + * The CacheReplicationMonitor does a full scan when the NameNode first + * starts up, and at configurable intervals afterwards. + */ +@InterfaceAudience.LimitedPrivate({"HDFS"}) +public class CacheReplicationMonitor extends Thread implements Closeable { + + private static final Log LOG = + LogFactory.getLog(CacheReplicationMonitor.class); + + private final FSNamesystem namesystem; + + private final BlockManager blockManager; + + private final CacheManager cacheManager; + + private final GSet cachedBlocks; + + /** + * Pseudorandom number source + */ + private static final Random random = new Random(); + + /** + * The interval at which we scan the namesystem for caching changes. + */ + private final long intervalMs; + + /** + * The CacheReplicationMonitor (CRM) lock. Used to synchronize starting and + * waiting for rescan operations. + */ + private final ReentrantLock lock; + + /** + * Notifies the scan thread that an immediate rescan is needed. + */ + private final Condition doRescan; + + /** + * Notifies waiting threads that a rescan has finished. + */ + private final Condition scanFinished; + + /** + * Whether there are pending CacheManager operations that necessitate a + * CacheReplicationMonitor rescan. Protected by the CRM lock. + */ + private boolean needsRescan = true; + + /** + * Whether we are currently doing a rescan. Protected by the CRM lock. + */ + private boolean isScanning = false; + + /** + * The number of rescans completed. Used to wait for scans to finish. + * Protected by the CacheReplicationMonitor lock. + */ + private long scanCount = 0; + + /** + * True if this monitor should terminate. Protected by the CRM lock. + */ + private boolean shutdown = false; + + /** + * Mark status of the current scan. + */ + private boolean mark = false; + + /** + * Cache directives found in the previous scan. + */ + private int scannedDirectives; + + /** + * Blocks found in the previous scan. + */ + private long scannedBlocks; + + public CacheReplicationMonitor(FSNamesystem namesystem, + CacheManager cacheManager, long intervalMs, ReentrantLock lock) { + this.namesystem = namesystem; + this.blockManager = namesystem.getBlockManager(); + this.cacheManager = cacheManager; + this.cachedBlocks = cacheManager.getCachedBlocks(); + this.intervalMs = intervalMs; + this.lock = lock; + this.doRescan = this.lock.newCondition(); + this.scanFinished = this.lock.newCondition(); + } + + @Override + public void run() { + long startTimeMs = 0; + Thread.currentThread().setName("CacheReplicationMonitor(" + + System.identityHashCode(this) + ")"); + LOG.info("Starting CacheReplicationMonitor with interval " + + intervalMs + " milliseconds"); + try { + long curTimeMs = Time.monotonicNow(); + while (true) { + lock.lock(); + try { + while (true) { + if (shutdown) { + LOG.info("Shutting down CacheReplicationMonitor"); + return; + } + if (needsRescan) { + LOG.info("Rescanning because of pending operations"); + break; + } + long delta = (startTimeMs + intervalMs) - curTimeMs; + if (delta <= 0) { + LOG.info("Rescanning after " + (curTimeMs - startTimeMs) + + " milliseconds"); + break; + } + doRescan.await(delta, TimeUnit.MILLISECONDS); + curTimeMs = Time.monotonicNow(); + } + isScanning = true; + needsRescan = false; + } finally { + lock.unlock(); + } + startTimeMs = curTimeMs; + mark = !mark; + rescan(); + curTimeMs = Time.monotonicNow(); + // Update synchronization-related variables. + lock.lock(); + try { + isScanning = false; + scanCount++; + scanFinished.signalAll(); + } finally { + lock.unlock(); + } + LOG.info("Scanned " + scannedDirectives + " directive(s) and " + + scannedBlocks + " block(s) in " + (curTimeMs - startTimeMs) + " " + + "millisecond(s)."); + } + } catch (InterruptedException e) { + LOG.info("Shutting down CacheReplicationMonitor."); + return; + } catch (Throwable t) { + LOG.fatal("Thread exiting", t); + terminate(1, t); + } + } + + /** + * Waits for a rescan to complete. This doesn't guarantee consistency with + * pending operations, only relative recency, since it will not force a new + * rescan if a rescan is already underway. + *

+ * Note that this call will release the FSN lock, so operations before and + * after are not atomic. + */ + public void waitForRescanIfNeeded() { + Preconditions.checkArgument(!namesystem.hasWriteLock(), + "Must not hold the FSN write lock when waiting for a rescan."); + Preconditions.checkArgument(lock.isHeldByCurrentThread(), + "Must hold the CRM lock when waiting for a rescan."); + if (!needsRescan) { + return; + } + // If no scan is already ongoing, mark the CRM as dirty and kick + if (!isScanning) { + doRescan.signal(); + } + // Wait until the scan finishes and the count advances + final long startCount = scanCount; + while ((!shutdown) && (startCount >= scanCount)) { + try { + scanFinished.await(); + } catch (InterruptedException e) { + LOG.warn("Interrupted while waiting for CacheReplicationMonitor" + + " rescan", e); + break; + } + } + } + + /** + * Indicates to the CacheReplicationMonitor that there have been CacheManager + * changes that require a rescan. + */ + public void setNeedsRescan() { + Preconditions.checkArgument(lock.isHeldByCurrentThread(), + "Must hold the CRM lock when setting the needsRescan bit."); + this.needsRescan = true; + } + + /** + * Shut down the monitor thread. + */ + @Override + public void close() throws IOException { + Preconditions.checkArgument(namesystem.hasWriteLock()); + lock.lock(); + try { + if (shutdown) return; + // Since we hold both the FSN write lock and the CRM lock here, + // we know that the CRM thread cannot be currently modifying + // the cache manager state while we're closing it. + // Since the CRM thread checks the value of 'shutdown' after waiting + // for a lock, we know that the thread will not modify the cache + // manager state after this point. + shutdown = true; + doRescan.signalAll(); + scanFinished.signalAll(); + } finally { + lock.unlock(); + } + } + + private void rescan() throws InterruptedException { + scannedDirectives = 0; + scannedBlocks = 0; + namesystem.writeLock(); + try { + if (shutdown) { + throw new InterruptedException("CacheReplicationMonitor was " + + "shut down."); + } + resetStatistics(); + rescanCacheDirectives(); + rescanCachedBlockMap(); + blockManager.getDatanodeManager().resetLastCachingDirectiveSentTime(); + } finally { + namesystem.writeUnlock(); + } + } + + private void resetStatistics() { + for (CachePool pool: cacheManager.getCachePools()) { + pool.resetStatistics(); + } + for (CacheDirective directive: cacheManager.getCacheDirectives()) { + directive.resetStatistics(); + } + } + + /** + * Scan all CacheDirectives. Use the information to figure out + * what cache replication factor each block should have. + */ + private void rescanCacheDirectives() { + FSDirectory fsDir = namesystem.getFSDirectory(); + final long now = new Date().getTime(); + for (CacheDirective directive : cacheManager.getCacheDirectives()) { + // Skip processing this entry if it has expired + if (LOG.isTraceEnabled()) { + LOG.trace("Directive expiry is at " + directive.getExpiryTime()); + } + if (directive.getExpiryTime() > 0 && directive.getExpiryTime() <= now) { + if (LOG.isDebugEnabled()) { + LOG.debug("Skipping directive id " + directive.getId() + + " because it has expired (" + directive.getExpiryTime() + "<=" + + now + ")"); + } + continue; + } + scannedDirectives++; + String path = directive.getPath(); + INode node; + try { + node = fsDir.getINode(path); + } catch (UnresolvedLinkException e) { + // We don't cache through symlinks + continue; + } + if (node == null) { + if (LOG.isDebugEnabled()) { + LOG.debug("No inode found at " + path); + } + } else if (node.isDirectory()) { + INodeDirectory dir = node.asDirectory(); + ReadOnlyList children = dir.getChildrenList(null); + for (INode child : children) { + if (child.isFile()) { + rescanFile(directive, child.asFile()); + } + } + } else if (node.isFile()) { + rescanFile(directive, node.asFile()); + } else { + if (LOG.isDebugEnabled()) { + LOG.debug("Ignoring non-directory, non-file inode " + node + + " found at " + path); + } + } + } + } + + /** + * Apply a CacheDirective to a file. + * + * @param directive The CacheDirective to apply. + * @param file The file. + */ + private void rescanFile(CacheDirective directive, INodeFile file) { + BlockInfo[] blockInfos = file.getBlocks(); + + // Increment the "needed" statistics + directive.addFilesNeeded(1); + // We don't cache UC blocks, don't add them to the total here + long neededTotal = file.computeFileSizeNotIncludingLastUcBlock() * + directive.getReplication(); + directive.addBytesNeeded(neededTotal); + + // The pool's bytesNeeded is incremented as we scan. If the demand + // thus far plus the demand of this file would exceed the pool's limit, + // do not cache this file. + CachePool pool = directive.getPool(); + if (pool.getBytesNeeded() > pool.getLimit()) { + if (LOG.isDebugEnabled()) { + LOG.debug(String.format("Skipping directive id %d file %s because " + + "limit of pool %s would be exceeded (%d > %d)", + directive.getId(), + file.getFullPathName(), + pool.getPoolName(), + pool.getBytesNeeded(), + pool.getLimit())); + } + return; + } + + long cachedTotal = 0; + for (BlockInfo blockInfo : blockInfos) { + if (!blockInfo.getBlockUCState().equals(BlockUCState.COMPLETE)) { + // We don't try to cache blocks that are under construction. + continue; + } + Block block = new Block(blockInfo.getBlockId()); + CachedBlock ncblock = new CachedBlock(block.getBlockId(), + directive.getReplication(), mark); + CachedBlock ocblock = cachedBlocks.get(ncblock); + if (ocblock == null) { + cachedBlocks.put(ncblock); + } else { + // Update bytesUsed using the current replication levels. + // Assumptions: we assume that all the blocks are the same length + // on each datanode. We can assume this because we're only caching + // blocks in state COMMITTED. + // Note that if two directives are caching the same block(s), they will + // both get them added to their bytesCached. + List cachedOn = + ocblock.getDatanodes(Type.CACHED); + long cachedByBlock = Math.min(cachedOn.size(), + directive.getReplication()) * blockInfo.getNumBytes(); + cachedTotal += cachedByBlock; + + if ((mark != ocblock.getMark()) || + (ocblock.getReplication() < directive.getReplication())) { + // + // Overwrite the block's replication and mark in two cases: + // + // 1. If the mark on the CachedBlock is different from the mark for + // this scan, that means the block hasn't been updated during this + // scan, and we should overwrite whatever is there, since it is no + // longer valid. + // + // 2. If the replication in the CachedBlock is less than what the + // directive asks for, we want to increase the block's replication + // field to what the directive asks for. + // + ocblock.setReplicationAndMark(directive.getReplication(), mark); + } + } + } + // Increment the "cached" statistics + directive.addBytesCached(cachedTotal); + if (cachedTotal == neededTotal) { + directive.addFilesCached(1); + } + if (LOG.isTraceEnabled()) { + LOG.trace("Directive " + directive.getId() + " is caching " + + file.getFullPathName() + ": " + cachedTotal + "/" + neededTotal + + " bytes"); + } + } + + private String findReasonForNotCaching(CachedBlock cblock, + BlockInfo blockInfo) { + if (blockInfo == null) { + // Somehow, a cache report with the block arrived, but the block + // reports from the DataNode haven't (yet?) described such a block. + // Alternately, the NameNode might have invalidated the block, but the + // DataNode hasn't caught up. In any case, we want to tell the DN + // to uncache this. + return "not tracked by the BlockManager"; + } else if (!blockInfo.isComplete()) { + // When a cached block changes state from complete to some other state + // on the DataNode (perhaps because of append), it will begin the + // uncaching process. However, the uncaching process is not + // instantaneous, especially if clients have pinned the block. So + // there may be a period of time when incomplete blocks remain cached + // on the DataNodes. + return "not complete"; + } else if (cblock.getReplication() == 0) { + // Since 0 is not a valid value for a cache directive's replication + // field, seeing a replication of 0 on a CacheBlock means that it + // has never been reached by any sweep. + return "not needed by any directives"; + } else if (cblock.getMark() != mark) { + // Although the block was needed in the past, we didn't reach it during + // the current sweep. Therefore, it doesn't need to be cached any more. + // Need to set the replication to 0 so it doesn't flip back to cached + // when the mark flips on the next scan + cblock.setReplicationAndMark((short)0, mark); + return "no longer needed by any directives"; + } + return null; + } + + /** + * Scan through the cached block map. + * Any blocks which are under-replicated should be assigned new Datanodes. + * Blocks that are over-replicated should be removed from Datanodes. + */ + private void rescanCachedBlockMap() { + for (Iterator cbIter = cachedBlocks.iterator(); + cbIter.hasNext(); ) { + scannedBlocks++; + CachedBlock cblock = cbIter.next(); + List pendingCached = + cblock.getDatanodes(Type.PENDING_CACHED); + List cached = + cblock.getDatanodes(Type.CACHED); + List pendingUncached = + cblock.getDatanodes(Type.PENDING_UNCACHED); + // Remove nodes from PENDING_UNCACHED if they were actually uncached. + for (Iterator iter = pendingUncached.iterator(); + iter.hasNext(); ) { + DatanodeDescriptor datanode = iter.next(); + if (!cblock.isInList(datanode.getCached())) { + datanode.getPendingUncached().remove(cblock); + iter.remove(); + } + } + BlockInfo blockInfo = blockManager. + getStoredBlock(new Block(cblock.getBlockId())); + String reason = findReasonForNotCaching(cblock, blockInfo); + int neededCached = 0; + if (reason != null) { + if (LOG.isDebugEnabled()) { + LOG.debug("not caching " + cblock + " because it is " + reason); + } + } else { + neededCached = cblock.getReplication(); + } + int numCached = cached.size(); + if (numCached >= neededCached) { + // If we have enough replicas, drop all pending cached. + for (Iterator iter = pendingCached.iterator(); + iter.hasNext(); ) { + DatanodeDescriptor datanode = iter.next(); + datanode.getPendingCached().remove(cblock); + iter.remove(); + } + } + if (numCached < neededCached) { + // If we don't have enough replicas, drop all pending uncached. + for (Iterator iter = pendingUncached.iterator(); + iter.hasNext(); ) { + DatanodeDescriptor datanode = iter.next(); + datanode.getPendingUncached().remove(cblock); + iter.remove(); + } + } + int neededUncached = numCached - + (pendingUncached.size() + neededCached); + if (neededUncached > 0) { + addNewPendingUncached(neededUncached, cblock, cached, + pendingUncached); + } else { + int additionalCachedNeeded = neededCached - + (numCached + pendingCached.size()); + if (additionalCachedNeeded > 0) { + addNewPendingCached(additionalCachedNeeded, cblock, cached, + pendingCached); + } + } + if ((neededCached == 0) && + pendingUncached.isEmpty() && + pendingCached.isEmpty()) { + // we have nothing more to do with this block. + cbIter.remove(); + } + } + } + + /** + * Add new entries to the PendingUncached list. + * + * @param neededUncached The number of replicas that need to be uncached. + * @param cachedBlock The block which needs to be uncached. + * @param cached A list of DataNodes currently caching the block. + * @param pendingUncached A list of DataNodes that will soon uncache the + * block. + */ + private void addNewPendingUncached(int neededUncached, + CachedBlock cachedBlock, List cached, + List pendingUncached) { + // Figure out which replicas can be uncached. + LinkedList possibilities = + new LinkedList(); + for (DatanodeDescriptor datanode : cached) { + if (!pendingUncached.contains(datanode)) { + possibilities.add(datanode); + } + } + while (neededUncached > 0) { + if (possibilities.isEmpty()) { + LOG.warn("Logic error: we're trying to uncache more replicas than " + + "actually exist for " + cachedBlock); + return; + } + DatanodeDescriptor datanode = + possibilities.remove(random.nextInt(possibilities.size())); + pendingUncached.add(datanode); + boolean added = datanode.getPendingUncached().add(cachedBlock); + assert added; + neededUncached--; + } + } + + /** + * Add new entries to the PendingCached list. + * + * @param neededCached The number of replicas that need to be cached. + * @param cachedBlock The block which needs to be cached. + * @param cached A list of DataNodes currently caching the block. + * @param pendingCached A list of DataNodes that will soon cache the + * block. + */ + private void addNewPendingCached(final int neededCached, + CachedBlock cachedBlock, List cached, + List pendingCached) { + // To figure out which replicas can be cached, we consult the + // blocksMap. We don't want to try to cache a corrupt replica, though. + BlockInfo blockInfo = blockManager. + getStoredBlock(new Block(cachedBlock.getBlockId())); + if (blockInfo == null) { + if (LOG.isDebugEnabled()) { + LOG.debug("Not caching block " + cachedBlock + " because there " + + "is no record of it on the NameNode."); + } + return; + } + if (!blockInfo.isComplete()) { + if (LOG.isDebugEnabled()) { + LOG.debug("Not caching block " + cachedBlock + " because it " + + "is not yet complete."); + } + return; + } + // Filter the list of replicas to only the valid targets + List possibilities = + new LinkedList(); + int numReplicas = blockInfo.getCapacity(); + Collection corrupt = + blockManager.getCorruptReplicas(blockInfo); + int outOfCapacity = 0; + for (int i = 0; i < numReplicas; i++) { + DatanodeDescriptor datanode = blockInfo.getDatanode(i); + if (datanode == null) { + continue; + } + if (datanode.isDecommissioned() || datanode.isDecommissionInProgress()) { + continue; + } + if (corrupt != null && corrupt.contains(datanode)) { + continue; + } + if (pendingCached.contains(datanode) || cached.contains(datanode)) { + continue; + } + long pendingCapacity = datanode.getCacheRemaining(); + // Subtract pending cached blocks from effective capacity + Iterator it = datanode.getPendingCached().iterator(); + while (it.hasNext()) { + CachedBlock cBlock = it.next(); + BlockInfo info = + blockManager.getStoredBlock(new Block(cBlock.getBlockId())); + if (info != null) { + pendingCapacity -= info.getNumBytes(); + } + } + it = datanode.getPendingUncached().iterator(); + // Add pending uncached blocks from effective capacity + while (it.hasNext()) { + CachedBlock cBlock = it.next(); + BlockInfo info = + blockManager.getStoredBlock(new Block(cBlock.getBlockId())); + if (info != null) { + pendingCapacity += info.getNumBytes(); + } + } + if (pendingCapacity < blockInfo.getNumBytes()) { + if (LOG.isTraceEnabled()) { + LOG.trace("Datanode " + datanode + " is not a valid possibility for" + + " block " + blockInfo.getBlockId() + " of size " + + blockInfo.getNumBytes() + " bytes, only has " + + datanode.getCacheRemaining() + " bytes of cache remaining."); + } + outOfCapacity++; + continue; + } + possibilities.add(datanode); + } + List chosen = chooseDatanodesForCaching(possibilities, + neededCached, blockManager.getDatanodeManager().getStaleInterval()); + for (DatanodeDescriptor datanode : chosen) { + pendingCached.add(datanode); + boolean added = datanode.getPendingCached().add(cachedBlock); + assert added; + } + // We were unable to satisfy the requested replication factor + if (neededCached > chosen.size()) { + if (LOG.isDebugEnabled()) { + LOG.debug( + "Only have " + + (cachedBlock.getReplication() - neededCached + chosen.size()) + + " of " + cachedBlock.getReplication() + " cached replicas for " + + cachedBlock + " (" + outOfCapacity + " nodes have insufficient " + + "capacity)."); + } + } + } + + /** + * Chooses datanode locations for caching from a list of valid possibilities. + * Non-stale nodes are chosen before stale nodes. + * + * @param possibilities List of candidate datanodes + * @param neededCached Number of replicas needed + * @param staleInterval Age of a stale datanode + * @return A list of chosen datanodes + */ + private static List chooseDatanodesForCaching( + final List possibilities, final int neededCached, + final long staleInterval) { + // Make a copy that we can modify + List targets = + new ArrayList(possibilities); + // Selected targets + List chosen = new LinkedList(); + + // Filter out stale datanodes + List stale = new LinkedList(); + Iterator it = targets.iterator(); + while (it.hasNext()) { + DatanodeDescriptor d = it.next(); + if (d.isStale(staleInterval)) { + it.remove(); + stale.add(d); + } + } + // Select targets + while (chosen.size() < neededCached) { + // Try to use stale nodes if we're out of non-stale nodes, else we're done + if (targets.isEmpty()) { + if (!stale.isEmpty()) { + targets = stale; + } else { + break; + } + } + // Select a random target + DatanodeDescriptor target = + chooseRandomDatanodeByRemainingCapacity(targets); + chosen.add(target); + targets.remove(target); + } + return chosen; + } + + /** + * Choose a single datanode from the provided list of possible + * targets, weighted by the percentage of free space remaining on the node. + * + * @return The chosen datanode + */ + private static DatanodeDescriptor chooseRandomDatanodeByRemainingCapacity( + final List targets) { + // Use a weighted probability to choose the target datanode + float total = 0; + for (DatanodeDescriptor d : targets) { + total += d.getCacheRemainingPercent(); + } + // Give each datanode a portion of keyspace equal to its relative weight + // [0, w1) selects d1, [w1, w2) selects d2, etc. + TreeMap lottery = + new TreeMap(); + int offset = 0; + for (DatanodeDescriptor d : targets) { + // Since we're using floats, be paranoid about negative values + int weight = + Math.max(1, (int)((d.getCacheRemainingPercent() / total) * 1000000)); + offset += weight; + lottery.put(offset, d); + } + // Choose a number from [0, offset), which is the total amount of weight, + // to select the winner + DatanodeDescriptor winner = + lottery.higherEntry(random.nextInt(offset)).getValue(); + return winner; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeDescriptor.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeDescriptor.java index 5ece6602217..607db6f7b84 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeDescriptor.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeDescriptor.java @@ -17,7 +17,15 @@ */ package org.apache.hadoop.hdfs.server.blockmanagement; -import java.util.*; +import java.util.ArrayList; +import java.util.Collection; +import java.util.Collections; +import java.util.HashMap; +import java.util.Iterator; +import java.util.LinkedList; +import java.util.List; +import java.util.Map; +import java.util.Queue; import org.apache.commons.logging.Log; import org.apache.commons.logging.LogFactory; @@ -26,11 +34,15 @@ import org.apache.hadoop.classification.InterfaceStability; import org.apache.hadoop.hdfs.protocol.Block; import org.apache.hadoop.hdfs.protocol.DatanodeID; import org.apache.hadoop.hdfs.protocol.DatanodeInfo; +import org.apache.hadoop.hdfs.server.namenode.CachedBlock; import org.apache.hadoop.hdfs.server.protocol.DatanodeStorage; import org.apache.hadoop.hdfs.server.protocol.StorageReport; import org.apache.hadoop.hdfs.util.LightWeightHashSet; +import org.apache.hadoop.util.IntrusiveCollection; import org.apache.hadoop.util.Time; +import com.google.common.annotations.VisibleForTesting; + /** * This class extends the DatanodeInfo class with ephemeral information (eg * health, capacity, what blocks are associated with the Datanode) that is @@ -99,6 +111,71 @@ public class DatanodeDescriptor extends DatanodeInfo { private final Map storageMap = new HashMap(); + /** + * A list of CachedBlock objects on this datanode. + */ + public static class CachedBlocksList extends IntrusiveCollection { + public enum Type { + PENDING_CACHED, + CACHED, + PENDING_UNCACHED + } + + private final DatanodeDescriptor datanode; + + private final Type type; + + CachedBlocksList(DatanodeDescriptor datanode, Type type) { + this.datanode = datanode; + this.type = type; + } + + public DatanodeDescriptor getDatanode() { + return datanode; + } + + public Type getType() { + return type; + } + } + + /** + * The blocks which we want to cache on this DataNode. + */ + private final CachedBlocksList pendingCached = + new CachedBlocksList(this, CachedBlocksList.Type.PENDING_CACHED); + + /** + * The blocks which we know are cached on this datanode. + * This list is updated by periodic cache reports. + */ + private final CachedBlocksList cached = + new CachedBlocksList(this, CachedBlocksList.Type.CACHED); + + /** + * The blocks which we want to uncache on this DataNode. + */ + private final CachedBlocksList pendingUncached = + new CachedBlocksList(this, CachedBlocksList.Type.PENDING_UNCACHED); + + public CachedBlocksList getPendingCached() { + return pendingCached; + } + + public CachedBlocksList getCached() { + return cached; + } + + public CachedBlocksList getPendingUncached() { + return pendingUncached; + } + + /** + * The time when the last batch of caching directives was sent, in + * monotonic milliseconds. + */ + private long lastCachingDirectiveSentTimeMs; + // isAlive == heartbeats.contains(this) // This is an optimization, because contains takes O(n) time on Arraylist public boolean isAlive = false; @@ -144,7 +221,7 @@ public class DatanodeDescriptor extends DatanodeInfo { */ public DatanodeDescriptor(DatanodeID nodeID) { super(nodeID); - updateHeartbeat(StorageReport.EMPTY_ARRAY, 0, 0); + updateHeartbeat(StorageReport.EMPTY_ARRAY, 0L, 0L, 0, 0); } /** @@ -155,7 +232,7 @@ public class DatanodeDescriptor extends DatanodeInfo { public DatanodeDescriptor(DatanodeID nodeID, String networkLocation) { super(nodeID, networkLocation); - updateHeartbeat(StorageReport.EMPTY_ARRAY, 0, 0); + updateHeartbeat(StorageReport.EMPTY_ARRAY, 0L, 0L, 0, 0); } /** @@ -236,6 +313,11 @@ public class DatanodeDescriptor extends DatanodeInfo { setXceiverCount(0); this.invalidateBlocks.clear(); this.volumeFailures = 0; + // pendingCached, cached, and pendingUncached are protected by the + // FSN lock. + this.pendingCached.clear(); + this.cached.clear(); + this.pendingUncached.clear(); } public void clearBlockQueues() { @@ -244,6 +326,11 @@ public class DatanodeDescriptor extends DatanodeInfo { this.recoverBlocks.clear(); this.replicateBlocks.clear(); } + // pendingCached, cached, and pendingUncached are protected by the + // FSN lock. + this.pendingCached.clear(); + this.cached.clear(); + this.pendingUncached.clear(); } public int numBlocks() { @@ -257,13 +344,15 @@ public class DatanodeDescriptor extends DatanodeInfo { /** * Updates stats from datanode heartbeat. */ - public void updateHeartbeat(StorageReport[] reports, - int xceiverCount, int volFailures) { + public void updateHeartbeat(StorageReport[] reports, long cacheCapacity, + long cacheUsed, int xceiverCount, int volFailures) { long totalCapacity = 0; long totalRemaining = 0; long totalBlockPoolUsed = 0; long totalDfsUsed = 0; + setCacheCapacity(cacheCapacity); + setCacheUsed(cacheUsed); setXceiverCount(xceiverCount); setLastUpdate(Time.now()); this.volumeFailures = volFailures; @@ -331,7 +420,7 @@ public class DatanodeDescriptor extends DatanodeInfo { Iterator getBlockIterator(final String storageID) { return new BlockIterator(getStorageInfo(storageID)); } - + /** * Store block replication work. */ @@ -363,7 +452,7 @@ public class DatanodeDescriptor extends DatanodeInfo { } } } - + /** * The number of work items that are pending to be replicated */ @@ -380,7 +469,7 @@ public class DatanodeDescriptor extends DatanodeInfo { return invalidateBlocks.size(); } } - + public List getReplicationCommand(int maxTransfers) { return replicateBlocks.poll(maxTransfers); } @@ -575,5 +664,21 @@ public class DatanodeDescriptor extends DatanodeInfo { return storage; } } + + /** + * @return The time at which we last sent caching directives to this + * DataNode, in monotonic milliseconds. + */ + public long getLastCachingDirectiveSentTimeMs() { + return this.lastCachingDirectiveSentTimeMs; + } + + /** + * @param time The time at which we last sent caching directives to this + * DataNode, in monotonic milliseconds. + */ + public void setLastCachingDirectiveSentTimeMs(long time) { + this.lastCachingDirectiveSentTimeMs = time; + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeManager.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeManager.java index 9352afafc80..999f36b8e16 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeManager.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeManager.java @@ -32,6 +32,8 @@ import org.apache.hadoop.hdfs.HdfsConfiguration; import org.apache.hadoop.hdfs.protocol.*; import org.apache.hadoop.hdfs.protocol.HdfsConstants.DatanodeReportType; import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.BlockTargetPair; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList; +import org.apache.hadoop.hdfs.server.namenode.CachedBlock; import org.apache.hadoop.hdfs.server.namenode.HostFileManager; import org.apache.hadoop.hdfs.server.namenode.HostFileManager.Entry; import org.apache.hadoop.hdfs.server.namenode.HostFileManager.EntrySet; @@ -143,6 +145,12 @@ public class DatanodeManager { private boolean hasClusterEverBeenMultiRack = false; private final boolean checkIpHostnameInRegistration; + /** + * Whether we should tell datanodes what to cache in replies to + * heartbeat messages. + */ + private boolean shouldSendCachingCommands = false; + /** * The number of datanodes for each software version. This list should change * during rolling upgrades. @@ -151,6 +159,16 @@ public class DatanodeManager { private HashMap datanodesSoftwareVersions = new HashMap(4, 0.75f); + /** + * The minimum time between resending caching directives to Datanodes, + * in milliseconds. + * + * Note that when a rescan happens, we will send the new directives + * as soon as possible. This timeout only applies to resending + * directives that we've already sent. + */ + private final long timeBetweenResendingCachingDirectivesMs; + DatanodeManager(final BlockManager blockManager, final Namesystem namesystem, final Configuration conf) throws IOException { this.namesystem = namesystem; @@ -233,6 +251,9 @@ public class DatanodeManager { DFSConfigKeys.DFS_NAMENODE_USE_STALE_DATANODE_FOR_WRITE_RATIO_KEY + " = '" + ratioUseStaleDataNodesForWrite + "' is invalid. " + "It should be a positive non-zero float value, not greater than 1.0f."); + this.timeBetweenResendingCachingDirectivesMs = conf.getLong( + DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_RETRY_INTERVAL_MS, + DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_RETRY_INTERVAL_MS_DEFAULT); } private static long getStaleIntervalFromConf(Configuration conf, @@ -1203,7 +1224,8 @@ public class DatanodeManager { /** Handle heartbeat from datanodes. */ public DatanodeCommand[] handleHeartbeat(DatanodeRegistration nodeReg, StorageReport[] reports, final String blockPoolId, - int xceiverCount, int maxTransfers, int failedVolumes + long cacheCapacity, long cacheUsed, int xceiverCount, + int maxTransfers, int failedVolumes ) throws IOException { synchronized (heartbeatManager) { synchronized (datanodeMap) { @@ -1225,6 +1247,7 @@ public class DatanodeManager { } heartbeatManager.updateHeartbeat(nodeinfo, reports, + cacheCapacity, cacheUsed, xceiverCount, failedVolumes); // If we are in safemode, do not send back any recovery / replication @@ -1286,7 +1309,30 @@ public class DatanodeManager { cmds.add(new BlockCommand(DatanodeProtocol.DNA_INVALIDATE, blockPoolId, blks)); } - + boolean sendingCachingCommands = false; + long nowMs = Time.monotonicNow(); + if (shouldSendCachingCommands && + ((nowMs - nodeinfo.getLastCachingDirectiveSentTimeMs()) >= + timeBetweenResendingCachingDirectivesMs)) { + DatanodeCommand pendingCacheCommand = + getCacheCommand(nodeinfo.getPendingCached(), nodeinfo, + DatanodeProtocol.DNA_CACHE, blockPoolId); + if (pendingCacheCommand != null) { + cmds.add(pendingCacheCommand); + sendingCachingCommands = true; + } + DatanodeCommand pendingUncacheCommand = + getCacheCommand(nodeinfo.getPendingUncached(), nodeinfo, + DatanodeProtocol.DNA_UNCACHE, blockPoolId); + if (pendingUncacheCommand != null) { + cmds.add(pendingUncacheCommand); + sendingCachingCommands = true; + } + if (sendingCachingCommands) { + nodeinfo.setLastCachingDirectiveSentTimeMs(nowMs); + } + } + blockManager.addKeyUpdateCommand(cmds, nodeinfo); // check for balancer bandwidth update @@ -1305,6 +1351,34 @@ public class DatanodeManager { return new DatanodeCommand[0]; } + /** + * Convert a CachedBlockList into a DatanodeCommand with a list of blocks. + * + * @param list The {@link CachedBlocksList}. This function + * clears the list. + * @param datanode The datanode. + * @param action The action to perform in the command. + * @param poolId The block pool id. + * @return A DatanodeCommand to be sent back to the DN, or null if + * there is nothing to be done. + */ + private DatanodeCommand getCacheCommand(CachedBlocksList list, + DatanodeDescriptor datanode, int action, String poolId) { + int length = list.size(); + if (length == 0) { + return null; + } + // Read the existing cache commands. + long[] blockIds = new long[length]; + int i = 0; + for (Iterator iter = list.iterator(); + iter.hasNext(); ) { + CachedBlock cachedBlock = iter.next(); + blockIds[i++] = cachedBlock.getBlockId(); + } + return new BlockIdCommand(action, poolId, blockIds); + } + /** * Tell all datanodes to use a new, non-persistent bandwidth value for * dfs.balance.bandwidthPerSec. @@ -1351,9 +1425,32 @@ public class DatanodeManager { } } + /** + * Reset the lastCachingDirectiveSentTimeMs field of all the DataNodes we + * know about. + */ + public void resetLastCachingDirectiveSentTime() { + synchronized (datanodeMap) { + for (DatanodeDescriptor dn : datanodeMap.values()) { + dn.setLastCachingDirectiveSentTimeMs(0L); + } + } + } + @Override public String toString() { return getClass().getSimpleName() + ": " + host2DatanodeMap; } + + public void clearPendingCachingCommands() { + for (DatanodeDescriptor dn : datanodeMap.values()) { + dn.getPendingCached().clear(); + dn.getPendingUncached().clear(); + } + } + + public void setShouldSendCachingCommands(boolean shouldSendCachingCommands) { + this.shouldSendCachingCommands = shouldSendCachingCommands; + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeStatistics.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeStatistics.java index 24ec9b15524..9ccc5b1ff4a 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeStatistics.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/DatanodeStatistics.java @@ -42,6 +42,12 @@ public interface DatanodeStatistics { /** @return the percentage of the block pool used space over the total capacity. */ public float getPercentBlockPoolUsed(); + + /** @return the total cache capacity of all DataNodes */ + public long getCacheCapacity(); + + /** @return the total cache used by all DataNodes */ + public long getCacheUsed(); /** @return the xceiver count */ public int getXceiverCount(); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/HeartbeatManager.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/HeartbeatManager.java index 1f146d5e252..e941d19d071 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/HeartbeatManager.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/blockmanagement/HeartbeatManager.java @@ -149,6 +149,17 @@ class HeartbeatManager implements DatanodeStatistics { public synchronized int getXceiverCount() { return stats.xceiverCount; } + + @Override + public synchronized long getCacheCapacity() { + return stats.cacheCapacity; + } + + @Override + public synchronized long getCacheUsed() { + return stats.cacheUsed; + } + @Override public synchronized long[] getStats() { @@ -171,7 +182,7 @@ class HeartbeatManager implements DatanodeStatistics { addDatanode(d); //update its timestamp - d.updateHeartbeat(StorageReport.EMPTY_ARRAY, 0, 0); + d.updateHeartbeat(StorageReport.EMPTY_ARRAY, 0L, 0L, 0, 0); } } @@ -193,9 +204,11 @@ class HeartbeatManager implements DatanodeStatistics { } synchronized void updateHeartbeat(final DatanodeDescriptor node, - StorageReport[] reports, int xceiverCount, int failedVolumes) { + StorageReport[] reports, long cacheCapacity, long cacheUsed, + int xceiverCount, int failedVolumes) { stats.subtract(node); - node.updateHeartbeat(reports, xceiverCount, failedVolumes); + node.updateHeartbeat(reports, cacheCapacity, cacheUsed, + xceiverCount, failedVolumes); stats.add(node); } @@ -307,6 +320,8 @@ class HeartbeatManager implements DatanodeStatistics { private long capacityRemaining = 0L; private long blockPoolUsed = 0L; private int xceiverCount = 0; + private long cacheCapacity = 0L; + private long cacheUsed = 0L; private int expiredHeartbeats = 0; @@ -320,6 +335,8 @@ class HeartbeatManager implements DatanodeStatistics { } else { capacityTotal += node.getDfsUsed(); } + cacheCapacity += node.getCacheCapacity(); + cacheUsed += node.getCacheUsed(); } private void subtract(final DatanodeDescriptor node) { @@ -332,6 +349,8 @@ class HeartbeatManager implements DatanodeStatistics { } else { capacityTotal -= node.getDfsUsed(); } + cacheCapacity -= node.getCacheCapacity(); + cacheUsed -= node.getCacheUsed(); } /** Increment expired heartbeat counter. */ diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPOfferService.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPOfferService.java index 29300a8c3ae..52fe61498fe 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPOfferService.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPOfferService.java @@ -34,6 +34,7 @@ import org.apache.hadoop.hdfs.protocol.ExtendedBlock; import org.apache.hadoop.hdfs.protocolPB.DatanodeProtocolClientSideTranslatorPB; import org.apache.hadoop.hdfs.server.protocol.BalancerBandwidthCommand; import org.apache.hadoop.hdfs.server.protocol.BlockCommand; +import org.apache.hadoop.hdfs.server.protocol.BlockIdCommand; import org.apache.hadoop.hdfs.server.protocol.BlockRecoveryCommand; import org.apache.hadoop.hdfs.server.protocol.DatanodeCommand; import org.apache.hadoop.hdfs.server.protocol.DatanodeProtocol; @@ -538,6 +539,21 @@ class BPOfferService { } } + private String blockIdArrayToString(long ids[]) { + long maxNumberOfBlocksToLog = dn.getMaxNumberOfBlocksToLog(); + StringBuilder bld = new StringBuilder(); + String prefix = ""; + for (int i = 0; i < ids.length; i++) { + if (i >= maxNumberOfBlocksToLog) { + bld.append("..."); + break; + } + bld.append(prefix).append(ids[i]); + prefix = ", "; + } + return bld.toString(); + } + /** * This method should handle all commands from Active namenode except * DNA_REGISTER which should be handled earlier itself. @@ -550,6 +566,8 @@ class BPOfferService { BPServiceActor actor) throws IOException { final BlockCommand bcmd = cmd instanceof BlockCommand? (BlockCommand)cmd: null; + final BlockIdCommand blockIdCmd = + cmd instanceof BlockIdCommand ? (BlockIdCommand)cmd: null; switch(cmd.getAction()) { case DatanodeProtocol.DNA_TRANSFER: @@ -575,6 +593,20 @@ class BPOfferService { } dn.metrics.incrBlocksRemoved(toDelete.length); break; + case DatanodeProtocol.DNA_CACHE: + LOG.info("DatanodeCommand action: DNA_CACHE for " + + blockIdCmd.getBlockPoolId() + " of [" + + blockIdArrayToString(blockIdCmd.getBlockIds()) + "]"); + dn.getFSDataset().cache(blockIdCmd.getBlockPoolId(), blockIdCmd.getBlockIds()); + dn.metrics.incrBlocksCached(blockIdCmd.getBlockIds().length); + break; + case DatanodeProtocol.DNA_UNCACHE: + LOG.info("DatanodeCommand action: DNA_UNCACHE for " + + blockIdCmd.getBlockPoolId() + " of [" + + blockIdArrayToString(blockIdCmd.getBlockIds()) + "]"); + dn.getFSDataset().uncache(blockIdCmd.getBlockPoolId(), blockIdCmd.getBlockIds()); + dn.metrics.incrBlocksUncached(blockIdCmd.getBlockIds().length); + break; case DatanodeProtocol.DNA_SHUTDOWN: // TODO: DNA_SHUTDOWN appears to be unused - the NN never sends this command // See HDFS-2987. @@ -639,6 +671,8 @@ class BPOfferService { case DatanodeProtocol.DNA_FINALIZE: case DatanodeProtocol.DNA_RECOVERBLOCK: case DatanodeProtocol.DNA_BALANCERBANDWIDTHUPDATE: + case DatanodeProtocol.DNA_CACHE: + case DatanodeProtocol.DNA_UNCACHE: LOG.warn("Got a command from standby NN - ignoring command:" + cmd.getAction()); break; default: diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPServiceActor.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPServiceActor.java index de7ecba25a2..c91fca381fa 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPServiceActor.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BPServiceActor.java @@ -24,6 +24,7 @@ import java.net.InetSocketAddress; import java.net.SocketTimeoutException; import java.util.ArrayList; import java.util.Collection; +import java.util.List; import java.util.Map; import org.apache.commons.logging.Log; @@ -86,6 +87,8 @@ class BPServiceActor implements Runnable { boolean resetBlockReportTime = true; + volatile long lastCacheReport = 0; + Thread bpThread; DatanodeProtocolClientSideTranslatorPB bpNamenode; private volatile long lastHeartbeat = 0; @@ -503,6 +506,35 @@ class BPServiceActor implements Runnable { return cmd; } + DatanodeCommand cacheReport() throws IOException { + // If caching is disabled, do not send a cache report + if (dn.getFSDataset().getCacheCapacity() == 0) { + return null; + } + // send cache report if timer has expired. + DatanodeCommand cmd = null; + long startTime = Time.monotonicNow(); + if (startTime - lastCacheReport > dnConf.cacheReportInterval) { + if (LOG.isDebugEnabled()) { + LOG.debug("Sending cacheReport from service actor: " + this); + } + lastCacheReport = startTime; + + String bpid = bpos.getBlockPoolId(); + List blockIds = dn.getFSDataset().getCacheReport(bpid); + long createTime = Time.monotonicNow(); + + cmd = bpNamenode.cacheReport(bpRegistration, bpid, blockIds); + long sendTime = Time.monotonicNow(); + long createCost = createTime - startTime; + long sendCost = sendTime - createTime; + dn.getMetrics().addCacheReport(sendCost); + LOG.debug("CacheReport of " + blockIds.size() + + " block(s) took " + createCost + " msec to generate and " + + sendCost + " msecs for RPC and NN processing"); + } + return cmd; + } HeartbeatResponse sendHeartBeat() throws IOException { StorageReport[] reports = @@ -514,6 +546,8 @@ class BPServiceActor implements Runnable { return bpNamenode.sendHeartbeat(bpRegistration, reports, + dn.getFSDataset().getCacheCapacity(), + dn.getFSDataset().getCacheUsed(), dn.getXmitsInProgress(), dn.getXceiverCount(), dn.getFSDataset().getNumFailedVolumes()); @@ -567,11 +601,12 @@ class BPServiceActor implements Runnable { * forever calling remote NameNode functions. */ private void offerService() throws Exception { - LOG.info("For namenode " + nnAddr + " using DELETEREPORT_INTERVAL of " - + dnConf.deleteReportInterval + " msec " + " BLOCKREPORT_INTERVAL of " - + dnConf.blockReportInterval + "msec" + " Initial delay: " - + dnConf.initialBlockReportDelay + "msec" + "; heartBeatInterval=" - + dnConf.heartBeatInterval); + LOG.info("For namenode " + nnAddr + " using" + + " DELETEREPORT_INTERVAL of " + dnConf.deleteReportInterval + " msec " + + " BLOCKREPORT_INTERVAL of " + dnConf.blockReportInterval + "msec" + + " CACHEREPORT_INTERVAL of " + dnConf.cacheReportInterval + "msec" + + " Initial delay: " + dnConf.initialBlockReportDelay + "msec" + + "; heartBeatInterval=" + dnConf.heartBeatInterval); // // Now loop for a long time.... @@ -627,6 +662,9 @@ class BPServiceActor implements Runnable { DatanodeCommand cmd = blockReport(); processCommand(new DatanodeCommand[]{ cmd }); + cmd = cacheReport(); + processCommand(new DatanodeCommand[]{ cmd }); + // Now safe to start scanning the block pool. // If it has already been started, this is a no-op. if (dn.blockScanner != null) { diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockReceiver.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockReceiver.java index eb91432a822..4bc91ec2bb3 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockReceiver.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockReceiver.java @@ -664,8 +664,9 @@ class BlockReceiver implements Closeable { // long dropPos = lastCacheManagementOffset - CACHE_DROP_LAG_BYTES; if (dropPos > 0 && dropCacheBehindWrites) { - NativeIO.POSIX.posixFadviseIfPossible(block.getBlockName(), - outFd, 0, dropPos, NativeIO.POSIX.POSIX_FADV_DONTNEED); + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible( + block.getBlockName(), outFd, 0, dropPos, + NativeIO.POSIX.POSIX_FADV_DONTNEED); } lastCacheManagementOffset = offsetInBlock; } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockSender.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockSender.java index cb1d550e8e6..50f866f07fe 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockSender.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/BlockSender.java @@ -375,8 +375,9 @@ class BlockSender implements java.io.Closeable { ((dropCacheBehindAllReads) || (dropCacheBehindLargeReads && isLongRead()))) { try { - NativeIO.POSIX.posixFadviseIfPossible(block.getBlockName(), - blockInFd, lastCacheDropOffset, offset - lastCacheDropOffset, + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible( + block.getBlockName(), blockInFd, lastCacheDropOffset, + offset - lastCacheDropOffset, NativeIO.POSIX.POSIX_FADV_DONTNEED); } catch (Exception e) { LOG.warn("Unable to drop cache on file close", e); @@ -674,8 +675,9 @@ class BlockSender implements java.io.Closeable { if (isLongRead() && blockInFd != null) { // Advise that this file descriptor will be accessed sequentially. - NativeIO.POSIX.posixFadviseIfPossible(block.getBlockName(), - blockInFd, 0, 0, NativeIO.POSIX.POSIX_FADV_SEQUENTIAL); + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible( + block.getBlockName(), blockInFd, 0, 0, + NativeIO.POSIX.POSIX_FADV_SEQUENTIAL); } // Trigger readahead of beginning of file if configured. @@ -761,9 +763,9 @@ class BlockSender implements java.io.Closeable { long nextCacheDropOffset = lastCacheDropOffset + CACHE_DROP_INTERVAL_BYTES; if (offset >= nextCacheDropOffset) { long dropLength = offset - lastCacheDropOffset; - NativeIO.POSIX.posixFadviseIfPossible(block.getBlockName(), - blockInFd, lastCacheDropOffset, dropLength, - NativeIO.POSIX.POSIX_FADV_DONTNEED); + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible( + block.getBlockName(), blockInFd, lastCacheDropOffset, + dropLength, NativeIO.POSIX.POSIX_FADV_DONTNEED); lastCacheDropOffset = offset; } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DNConf.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DNConf.java index 1577d78eddc..5d7afc7ecfd 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DNConf.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DNConf.java @@ -18,13 +18,18 @@ package org.apache.hadoop.hdfs.server.datanode; import org.apache.hadoop.classification.InterfaceAudience; + import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_BLOCKREPORT_INITIAL_DELAY_DEFAULT; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_BLOCKREPORT_INITIAL_DELAY_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_BLOCKREPORT_INTERVAL_MSEC_DEFAULT; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_BLOCKREPORT_INTERVAL_MSEC_KEY; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_CACHEREPORT_INTERVAL_MSEC_DEFAULT; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_CACHEREPORT_INTERVAL_MSEC_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_CLIENT_SOCKET_TIMEOUT_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_CLIENT_WRITE_PACKET_SIZE_DEFAULT; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_CLIENT_WRITE_PACKET_SIZE_KEY; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_DEFAULT; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_SOCKET_WRITE_TIMEOUT_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_SYNCONCLOSE_DEFAULT; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_SYNCONCLOSE_KEY; @@ -39,6 +44,7 @@ import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_MIN_SUPPORTED_NA import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_ENCRYPT_DATA_TRANSFER_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_ENCRYPT_DATA_TRANSFER_DEFAULT; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATA_ENCRYPTION_ALGORITHM_KEY; + import org.apache.hadoop.conf.Configuration; import org.apache.hadoop.hdfs.DFSConfigKeys; import org.apache.hadoop.hdfs.server.common.HdfsServerConstants; @@ -66,6 +72,7 @@ public class DNConf { final long blockReportInterval; final long deleteReportInterval; final long initialBlockReportDelay; + final long cacheReportInterval; final int writePacketSize; final String minimumNameNodeVersion; @@ -73,6 +80,8 @@ public class DNConf { final long xceiverStopTimeout; + final long maxLockedMemory; + public DNConf(Configuration conf) { socketTimeout = conf.getInt(DFS_CLIENT_SOCKET_TIMEOUT_KEY, HdfsServerConstants.READ_TIMEOUT); @@ -107,7 +116,9 @@ public class DNConf { DFSConfigKeys.DFS_DATANODE_USE_DN_HOSTNAME, DFSConfigKeys.DFS_DATANODE_USE_DN_HOSTNAME_DEFAULT); this.blockReportInterval = conf.getLong(DFS_BLOCKREPORT_INTERVAL_MSEC_KEY, - DFS_BLOCKREPORT_INTERVAL_MSEC_DEFAULT); + DFS_BLOCKREPORT_INTERVAL_MSEC_DEFAULT); + this.cacheReportInterval = conf.getLong(DFS_CACHEREPORT_INTERVAL_MSEC_KEY, + DFS_CACHEREPORT_INTERVAL_MSEC_DEFAULT); long initBRDelay = conf.getLong( DFS_BLOCKREPORT_INITIAL_DELAY_KEY, @@ -137,6 +148,10 @@ public class DNConf { this.xceiverStopTimeout = conf.getLong( DFS_DATANODE_XCEIVER_STOP_TIMEOUT_MILLIS_KEY, DFS_DATANODE_XCEIVER_STOP_TIMEOUT_MILLIS_DEFAULT); + + this.maxLockedMemory = conf.getLong( + DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + DFS_DATANODE_MAX_LOCKED_MEMORY_DEFAULT); } // We get minimumNameNodeVersion via a method so it can be mocked out in tests. @@ -147,4 +162,8 @@ public class DNConf { public long getXceiverStopTimeout() { return xceiverStopTimeout; } + + public long getMaxLockedMemory() { + return maxLockedMemory; + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DataNode.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DataNode.java index b5bb2dff17c..73273ce25db 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DataNode.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/DataNode.java @@ -124,6 +124,7 @@ import org.apache.hadoop.http.HttpConfig; import org.apache.hadoop.http.HttpServer; import org.apache.hadoop.io.IOUtils; import org.apache.hadoop.io.ReadaheadPool; +import org.apache.hadoop.io.nativeio.NativeIO; import org.apache.hadoop.ipc.ProtobufRpcEngine; import org.apache.hadoop.ipc.RPC; import org.apache.hadoop.ipc.RemoteException; @@ -264,6 +265,7 @@ public class DataNode extends Configured private SecureResources secureResources = null; private List dataDirs; private Configuration conf; + private final long maxNumberOfBlocksToLog; private final List usersWithLocalPathAccess; private boolean connectToDnViaHostname; @@ -279,6 +281,8 @@ public class DataNode extends Configured final List dataDirs, final SecureResources resources) throws IOException { super(conf); + this.maxNumberOfBlocksToLog = conf.getLong(DFS_MAX_NUM_BLOCKS_TO_LOG_KEY, + DFS_MAX_NUM_BLOCKS_TO_LOG_DEFAULT); this.usersWithLocalPathAccess = Arrays.asList( conf.getTrimmedStrings(DFSConfigKeys.DFS_BLOCK_LOCAL_PATH_ACCESS_USER_KEY)); @@ -737,6 +741,27 @@ public class DataNode extends Configured this.conf = conf; this.dnConf = new DNConf(conf); + if (dnConf.maxLockedMemory > 0) { + if (!NativeIO.POSIX.getCacheManipulator().verifyCanMlock()) { + throw new RuntimeException(String.format( + "Cannot start datanode because the configured max locked memory" + + " size (%s) is greater than zero and native code is not available.", + DFS_DATANODE_MAX_LOCKED_MEMORY_KEY)); + } + long ulimit = NativeIO.POSIX.getCacheManipulator().getMemlockLimit(); + if (dnConf.maxLockedMemory > ulimit) { + throw new RuntimeException(String.format( + "Cannot start datanode because the configured max locked memory" + + " size (%s) of %d bytes is more than the datanode's available" + + " RLIMIT_MEMLOCK ulimit of %d bytes.", + DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + dnConf.maxLockedMemory, + ulimit)); + } + } + LOG.info("Starting DataNode with maxLockedMemory = " + + dnConf.maxLockedMemory); + storage = new DataStorage(); // global DN settings @@ -1075,6 +1100,10 @@ public class DataNode extends Configured } } + public long getMaxNumberOfBlocksToLog() { + return maxNumberOfBlocksToLog; + } + @Override public BlockLocalPathInfo getBlockLocalPathInfo(ExtendedBlock block, Token token) throws IOException { diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/FsDatasetSpi.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/FsDatasetSpi.java index 433000a2747..415c6a985ab 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/FsDatasetSpi.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/FsDatasetSpi.java @@ -273,6 +273,14 @@ public interface FsDatasetSpi extends FSDatasetMBean { */ public Map getBlockReports(String bpid); + /** + * Returns the cache report - the full list of cached block IDs of a + * block pool. + * @param bpid Block Pool Id + * @return the cache report - the full list of cached block IDs. + */ + public List getCacheReport(String bpid); + /** Does the dataset contain the block? */ public boolean contains(ExtendedBlock block); @@ -298,6 +306,20 @@ public interface FsDatasetSpi extends FSDatasetMBean { */ public void invalidate(String bpid, Block invalidBlks[]) throws IOException; + /** + * Caches the specified blocks + * @param bpid Block pool id + * @param blockIds - block ids to cache + */ + public void cache(String bpid, long[] blockIds); + + /** + * Uncaches the specified blocks + * @param bpid Block pool id + * @param blockIds - blocks ids to uncache + */ + public void uncache(String bpid, long[] blockIds); + /** * Check if all the data directories are healthy * @throws DiskErrorException diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetCache.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetCache.java new file mode 100644 index 00000000000..fc77b0570fb --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetCache.java @@ -0,0 +1,506 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.server.datanode.fsdataset.impl; + +import com.google.common.base.Preconditions; +import com.google.common.util.concurrent.ThreadFactoryBuilder; + +import java.io.FileInputStream; +import java.io.FileNotFoundException; +import java.io.IOException; +import java.util.ArrayList; +import java.util.HashMap; +import java.util.Iterator; +import java.util.List; +import java.util.Map.Entry; +import java.util.concurrent.Executor; +import java.util.concurrent.LinkedBlockingQueue; +import java.util.concurrent.ThreadFactory; +import java.util.concurrent.ThreadPoolExecutor; +import java.util.concurrent.TimeUnit; +import java.util.concurrent.atomic.AtomicLong; + +import org.apache.commons.io.IOUtils; +import org.apache.commons.lang.builder.HashCodeBuilder; +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.ChecksumException; +import org.apache.hadoop.hdfs.DFSConfigKeys; +import org.apache.hadoop.hdfs.protocol.BlockListAsLongs; +import org.apache.hadoop.hdfs.protocol.ExtendedBlock; +import org.apache.hadoop.io.nativeio.NativeIO; + +/** + * Manages caching for an FsDatasetImpl by using the mmap(2) and mlock(2) + * system calls to lock blocks into memory. Block checksums are verified upon + * entry into the cache. + */ +@InterfaceAudience.Private +@InterfaceStability.Unstable +public class FsDatasetCache { + /** + * Keys which identify MappableBlocks. + */ + private static final class Key { + /** + * Block id. + */ + final long id; + + /** + * Block pool id. + */ + final String bpid; + + Key(long id, String bpid) { + this.id = id; + this.bpid = bpid; + } + + @Override + public boolean equals(Object o) { + if (o == null) { + return false; + } + if (!(o.getClass() == getClass())) { + return false; + } + Key other = (Key)o; + return ((other.id == this.id) && (other.bpid.equals(this.bpid))); + } + + @Override + public int hashCode() { + return new HashCodeBuilder().append(id).append(bpid).hashCode(); + } + }; + + /** + * MappableBlocks that we know about. + */ + private static final class Value { + final State state; + final MappableBlock mappableBlock; + + Value(MappableBlock mappableBlock, State state) { + this.mappableBlock = mappableBlock; + this.state = state; + } + } + + private enum State { + /** + * The MappableBlock is in the process of being cached. + */ + CACHING, + + /** + * The MappableBlock was in the process of being cached, but it was + * cancelled. Only the FsDatasetCache#WorkerTask can remove cancelled + * MappableBlock objects. + */ + CACHING_CANCELLED, + + /** + * The MappableBlock is in the cache. + */ + CACHED, + + /** + * The MappableBlock is in the process of uncaching. + */ + UNCACHING; + + /** + * Whether we should advertise this block as cached to the NameNode and + * clients. + */ + public boolean shouldAdvertise() { + return (this == CACHED); + } + } + + private static final Log LOG = LogFactory.getLog(FsDatasetCache.class); + + /** + * Stores MappableBlock objects and the states they're in. + */ + private final HashMap mappableBlockMap = new HashMap(); + + private final AtomicLong numBlocksCached = new AtomicLong(0); + + private final FsDatasetImpl dataset; + + private final ThreadPoolExecutor uncachingExecutor; + + /** + * The approximate amount of cache space in use. + * + * This number is an overestimate, counting bytes that will be used only + * if pending caching operations succeed. It does not take into account + * pending uncaching operations. + * + * This overestimate is more useful to the NameNode than an underestimate, + * since we don't want the NameNode to assign us more replicas than + * we can cache, because of the current batch of operations. + */ + private final UsedBytesCount usedBytesCount; + + public static class PageRounder { + private final long osPageSize = + NativeIO.POSIX.getCacheManipulator().getOperatingSystemPageSize(); + + /** + * Round up a number to the operating system page size. + */ + public long round(long count) { + long newCount = + (count + (osPageSize - 1)) / osPageSize; + return newCount * osPageSize; + } + } + + private class UsedBytesCount { + private final AtomicLong usedBytes = new AtomicLong(0); + + private PageRounder rounder = new PageRounder(); + + /** + * Try to reserve more bytes. + * + * @param count The number of bytes to add. We will round this + * up to the page size. + * + * @return The new number of usedBytes if we succeeded; + * -1 if we failed. + */ + long reserve(long count) { + count = rounder.round(count); + while (true) { + long cur = usedBytes.get(); + long next = cur + count; + if (next > maxBytes) { + return -1; + } + if (usedBytes.compareAndSet(cur, next)) { + return next; + } + } + } + + /** + * Release some bytes that we're using. + * + * @param count The number of bytes to release. We will round this + * up to the page size. + * + * @return The new number of usedBytes. + */ + long release(long count) { + count = rounder.round(count); + return usedBytes.addAndGet(-count); + } + + long get() { + return usedBytes.get(); + } + } + + /** + * The total cache capacity in bytes. + */ + private final long maxBytes; + + /** + * Number of cache commands that could not be completed successfully + */ + AtomicLong numBlocksFailedToCache = new AtomicLong(0); + /** + * Number of uncache commands that could not be completed successfully + */ + AtomicLong numBlocksFailedToUncache = new AtomicLong(0); + + public FsDatasetCache(FsDatasetImpl dataset) { + this.dataset = dataset; + this.maxBytes = dataset.datanode.getDnConf().getMaxLockedMemory(); + ThreadFactory workerFactory = new ThreadFactoryBuilder() + .setDaemon(true) + .setNameFormat("FsDatasetCache-%d-" + dataset.toString()) + .build(); + this.usedBytesCount = new UsedBytesCount(); + this.uncachingExecutor = new ThreadPoolExecutor( + 0, 1, + 60, TimeUnit.SECONDS, + new LinkedBlockingQueue(), + workerFactory); + this.uncachingExecutor.allowCoreThreadTimeOut(true); + } + + /** + * @return List of cached blocks suitable for translation into a + * {@link BlockListAsLongs} for a cache report. + */ + synchronized List getCachedBlocks(String bpid) { + List blocks = new ArrayList(); + for (Iterator> iter = + mappableBlockMap.entrySet().iterator(); iter.hasNext(); ) { + Entry entry = iter.next(); + if (entry.getKey().bpid.equals(bpid)) { + if (entry.getValue().state.shouldAdvertise()) { + blocks.add(entry.getKey().id); + } + } + } + return blocks; + } + + /** + * Attempt to begin caching a block. + */ + synchronized void cacheBlock(long blockId, String bpid, + String blockFileName, long length, long genstamp, + Executor volumeExecutor) { + Key key = new Key(blockId, bpid); + Value prevValue = mappableBlockMap.get(key); + if (prevValue != null) { + if (LOG.isDebugEnabled()) { + LOG.debug("Block with id " + blockId + ", pool " + bpid + + " already exists in the FsDatasetCache with state " + + prevValue.state); + } + numBlocksFailedToCache.incrementAndGet(); + return; + } + mappableBlockMap.put(key, new Value(null, State.CACHING)); + volumeExecutor.execute( + new CachingTask(key, blockFileName, length, genstamp)); + if (LOG.isDebugEnabled()) { + LOG.debug("Initiating caching for Block with id " + blockId + + ", pool " + bpid); + } + } + + synchronized void uncacheBlock(String bpid, long blockId) { + Key key = new Key(blockId, bpid); + Value prevValue = mappableBlockMap.get(key); + + if (prevValue == null) { + if (LOG.isDebugEnabled()) { + LOG.debug("Block with id " + blockId + ", pool " + bpid + " " + + "does not need to be uncached, because it is not currently " + + "in the mappableBlockMap."); + } + numBlocksFailedToUncache.incrementAndGet(); + return; + } + switch (prevValue.state) { + case CACHING: + if (LOG.isDebugEnabled()) { + LOG.debug("Cancelling caching for block with id " + blockId + + ", pool " + bpid + "."); + } + mappableBlockMap.put(key, + new Value(prevValue.mappableBlock, State.CACHING_CANCELLED)); + break; + case CACHED: + if (LOG.isDebugEnabled()) { + LOG.debug("Block with id " + blockId + ", pool " + bpid + " " + + "has been scheduled for uncaching."); + } + mappableBlockMap.put(key, + new Value(prevValue.mappableBlock, State.UNCACHING)); + uncachingExecutor.execute(new UncachingTask(key)); + break; + default: + if (LOG.isDebugEnabled()) { + LOG.debug("Block with id " + blockId + ", pool " + bpid + " " + + "does not need to be uncached, because it is " + + "in state " + prevValue.state + "."); + } + numBlocksFailedToUncache.incrementAndGet(); + break; + } + } + + /** + * Background worker that mmaps, mlocks, and checksums a block + */ + private class CachingTask implements Runnable { + private final Key key; + private final String blockFileName; + private final long length; + private final long genstamp; + + CachingTask(Key key, String blockFileName, long length, long genstamp) { + this.key = key; + this.blockFileName = blockFileName; + this.length = length; + this.genstamp = genstamp; + } + + @Override + public void run() { + boolean success = false; + FileInputStream blockIn = null, metaIn = null; + MappableBlock mappableBlock = null; + ExtendedBlock extBlk = + new ExtendedBlock(key.bpid, key.id, length, genstamp); + long newUsedBytes = usedBytesCount.reserve(length); + if (newUsedBytes < 0) { + LOG.warn("Failed to cache block id " + key.id + ", pool " + key.bpid + + ": could not reserve " + length + " more bytes in the " + + "cache: " + DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY + + " of " + maxBytes + " exceeded."); + numBlocksFailedToCache.incrementAndGet(); + return; + } + try { + try { + blockIn = (FileInputStream)dataset.getBlockInputStream(extBlk, 0); + metaIn = (FileInputStream)dataset.getMetaDataInputStream(extBlk) + .getWrappedStream(); + } catch (ClassCastException e) { + LOG.warn("Failed to cache block with id " + key.id + ", pool " + + key.bpid + ": Underlying blocks are not backed by files.", e); + return; + } catch (FileNotFoundException e) { + LOG.info("Failed to cache block with id " + key.id + ", pool " + + key.bpid + ": failed to find backing files."); + return; + } catch (IOException e) { + LOG.warn("Failed to cache block with id " + key.id + ", pool " + + key.bpid + ": failed to open file", e); + return; + } + try { + mappableBlock = MappableBlock. + load(length, blockIn, metaIn, blockFileName); + } catch (ChecksumException e) { + // Exception message is bogus since this wasn't caused by a file read + LOG.warn("Failed to cache block " + key.id + " in " + key.bpid + ": " + + "checksum verification failed."); + return; + } catch (IOException e) { + LOG.warn("Failed to cache block " + key.id + " in " + key.bpid, e); + return; + } + synchronized (FsDatasetCache.this) { + Value value = mappableBlockMap.get(key); + Preconditions.checkNotNull(value); + Preconditions.checkState(value.state == State.CACHING || + value.state == State.CACHING_CANCELLED); + if (value.state == State.CACHING_CANCELLED) { + mappableBlockMap.remove(key); + LOG.warn("Caching of block " + key.id + " in " + key.bpid + + " was cancelled."); + return; + } + mappableBlockMap.put(key, new Value(mappableBlock, State.CACHED)); + } + if (LOG.isDebugEnabled()) { + LOG.debug("Successfully cached block " + key.id + " in " + key.bpid + + ". We are now caching " + newUsedBytes + " bytes in total."); + } + numBlocksCached.addAndGet(1); + success = true; + } finally { + if (!success) { + newUsedBytes = usedBytesCount.release(length); + if (LOG.isDebugEnabled()) { + LOG.debug("Caching of block " + key.id + " in " + + key.bpid + " was aborted. We are now caching only " + + newUsedBytes + " + bytes in total."); + } + IOUtils.closeQuietly(blockIn); + IOUtils.closeQuietly(metaIn); + if (mappableBlock != null) { + mappableBlock.close(); + } + numBlocksFailedToCache.incrementAndGet(); + + synchronized (FsDatasetCache.this) { + mappableBlockMap.remove(key); + } + } + } + } + } + + private class UncachingTask implements Runnable { + private final Key key; + + UncachingTask(Key key) { + this.key = key; + } + + @Override + public void run() { + Value value; + + synchronized (FsDatasetCache.this) { + value = mappableBlockMap.get(key); + } + Preconditions.checkNotNull(value); + Preconditions.checkArgument(value.state == State.UNCACHING); + // TODO: we will eventually need to do revocation here if any clients + // are reading via mmap with checksums enabled. See HDFS-5182. + IOUtils.closeQuietly(value.mappableBlock); + synchronized (FsDatasetCache.this) { + mappableBlockMap.remove(key); + } + long newUsedBytes = + usedBytesCount.release(value.mappableBlock.getLength()); + numBlocksCached.addAndGet(-1); + if (LOG.isDebugEnabled()) { + LOG.debug("Uncaching of block " + key.id + " in " + key.bpid + + " completed. usedBytes = " + newUsedBytes); + } + } + } + + // Stats related methods for FSDatasetMBean + + /** + * Get the approximate amount of cache space used. + */ + public long getCacheUsed() { + return usedBytesCount.get(); + } + + /** + * Get the maximum amount of bytes we can cache. This is a constant. + */ + public long getCacheCapacity() { + return maxBytes; + } + + public long getNumBlocksFailedToCache() { + return numBlocksFailedToCache.get(); + } + + public long getNumBlocksFailedToUncache() { + return numBlocksFailedToUncache.get(); + } + + public long getNumBlocksCached() { + return numBlocksCached.get(); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetImpl.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetImpl.java index 17905fe3f5b..c6c4ba32351 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetImpl.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsDatasetImpl.java @@ -32,6 +32,7 @@ import java.util.HashMap; import java.util.Iterator; import java.util.List; import java.util.Map; +import java.util.concurrent.Executor; import javax.management.NotCompliantMBeanException; import javax.management.ObjectName; @@ -194,6 +195,7 @@ class FsDatasetImpl implements FsDatasetSpi { final DataNode datanode; final FsVolumeList volumes; final FsDatasetAsyncDiskService asyncDiskService; + final FsDatasetCache cacheManager; private final int validVolsRequired; final ReplicaMap volumeMap; @@ -258,6 +260,7 @@ class FsDatasetImpl implements FsDatasetSpi { roots[idx] = storage.getStorageDir(idx).getCurrentDir(); } asyncDiskService = new FsDatasetAsyncDiskService(datanode, roots); + cacheManager = new FsDatasetCache(this); registerMBean(datanode.getDatanodeUuid()); } @@ -327,6 +330,31 @@ class FsDatasetImpl implements FsDatasetSpi { return volumes.numberOfFailedVolumes(); } + @Override // FSDatasetMBean + public long getCacheUsed() { + return cacheManager.getCacheUsed(); + } + + @Override // FSDatasetMBean + public long getCacheCapacity() { + return cacheManager.getCacheCapacity(); + } + + @Override // FSDatasetMBean + public long getNumBlocksFailedToCache() { + return cacheManager.getNumBlocksFailedToCache(); + } + + @Override // FSDatasetMBean + public long getNumBlocksFailedToUncache() { + return cacheManager.getNumBlocksFailedToUncache(); + } + + @Override // FSDatasetMBean + public long getNumBlocksCached() { + return cacheManager.getNumBlocksCached(); + } + /** * Find the block's on-disk length */ @@ -571,6 +599,8 @@ class FsDatasetImpl implements FsDatasetSpi { private synchronized ReplicaBeingWritten append(String bpid, FinalizedReplica replicaInfo, long newGS, long estimateBlockLen) throws IOException { + // If the block is cached, start uncaching it. + cacheManager.uncacheBlock(bpid, replicaInfo.getBlockId()); // unlink the finalized replica replicaInfo.unlinkBlock(1); @@ -1050,6 +1080,11 @@ class FsDatasetImpl implements FsDatasetSpi { return blockReportsMap; } + @Override // FsDatasetSpi + public List getCacheReport(String bpid) { + return cacheManager.getCachedBlocks(bpid); + } + /** * Get the list of finalized blocks from in-memory blockmap for a block pool. */ @@ -1192,8 +1227,11 @@ class FsDatasetImpl implements FsDatasetSpi { } volumeMap.remove(bpid, invalidBlks[i]); } - - // Delete the block asynchronously to make sure we can do it fast enough + // If the block is cached, start uncaching it. + cacheManager.uncacheBlock(bpid, invalidBlks[i].getBlockId()); + // Delete the block asynchronously to make sure we can do it fast enough. + // It's ok to unlink the block file before the uncache operation + // finishes. asyncDiskService.deleteAsync(v, f, FsDatasetUtil.getMetaFile(f, invalidBlks[i].getGenerationStamp()), new ExtendedBlock(bpid, invalidBlks[i])); @@ -1203,6 +1241,71 @@ class FsDatasetImpl implements FsDatasetSpi { } } + /** + * Asynchronously attempts to cache a single block via {@link FsDatasetCache}. + */ + private void cacheBlock(String bpid, long blockId) { + FsVolumeImpl volume; + String blockFileName; + long length, genstamp; + Executor volumeExecutor; + + synchronized (this) { + ReplicaInfo info = volumeMap.get(bpid, blockId); + boolean success = false; + try { + if (info == null) { + LOG.warn("Failed to cache block with id " + blockId + ", pool " + + bpid + ": ReplicaInfo not found."); + return; + } + if (info.getState() != ReplicaState.FINALIZED) { + LOG.warn("Failed to cache block with id " + blockId + ", pool " + + bpid + ": replica is not finalized; it is in state " + + info.getState()); + return; + } + try { + volume = (FsVolumeImpl)info.getVolume(); + if (volume == null) { + LOG.warn("Failed to cache block with id " + blockId + ", pool " + + bpid + ": volume not found."); + return; + } + } catch (ClassCastException e) { + LOG.warn("Failed to cache block with id " + blockId + + ": volume was not an instance of FsVolumeImpl."); + return; + } + success = true; + } finally { + if (!success) { + cacheManager.numBlocksFailedToCache.incrementAndGet(); + } + } + blockFileName = info.getBlockFile().getAbsolutePath(); + length = info.getVisibleLength(); + genstamp = info.getGenerationStamp(); + volumeExecutor = volume.getCacheExecutor(); + } + cacheManager.cacheBlock(blockId, bpid, + blockFileName, length, genstamp, volumeExecutor); + } + + @Override // FsDatasetSpi + public void cache(String bpid, long[] blockIds) { + for (int i=0; i < blockIds.length; i++) { + cacheBlock(bpid, blockIds[i]); + } + } + + @Override // FsDatasetSpi + public void uncache(String bpid, long[] blockIds) { + for (int i=0; i < blockIds.length; i++) { + cacheManager.uncacheBlock(bpid, blockIds[i]); + } + } + @Override // FsDatasetSpi public synchronized boolean contains(final ExtendedBlock block) { final long blockId = block.getLocalBlock().getBlockId(); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsVolumeImpl.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsVolumeImpl.java index d2b3f587ab4..9e5b0ebee4f 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsVolumeImpl.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/FsVolumeImpl.java @@ -23,6 +23,11 @@ import java.util.HashMap; import java.util.Map; import java.util.Map.Entry; import java.util.Set; +import java.util.concurrent.Executor; +import java.util.concurrent.LinkedBlockingQueue; +import java.util.concurrent.ThreadFactory; +import java.util.concurrent.ThreadPoolExecutor; +import java.util.concurrent.TimeUnit; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.conf.Configuration; @@ -36,6 +41,8 @@ import org.apache.hadoop.hdfs.server.datanode.fsdataset.FsVolumeSpi; import org.apache.hadoop.hdfs.server.protocol.DatanodeStorage; import org.apache.hadoop.util.DiskChecker.DiskErrorException; +import com.google.common.util.concurrent.ThreadFactoryBuilder; + /** * The underlying volume used to store replica. * @@ -51,6 +58,13 @@ class FsVolumeImpl implements FsVolumeSpi { private final File currentDir; // /current private final DF usage; private final long reserved; + /** + * Per-volume worker pool that processes new blocks to cache. + * The maximum number of workers per volume is bounded (configurable via + * dfs.datanode.fsdatasetcache.max.threads.per.volume) to limit resource + * contention. + */ + private final ThreadPoolExecutor cacheExecutor; FsVolumeImpl(FsDatasetImpl dataset, String storageID, File currentDir, Configuration conf, StorageType storageType) throws IOException { @@ -63,6 +77,20 @@ class FsVolumeImpl implements FsVolumeSpi { File parent = currentDir.getParentFile(); this.usage = new DF(parent, conf); this.storageType = storageType; + final int maxNumThreads = dataset.datanode.getConf().getInt( + DFSConfigKeys.DFS_DATANODE_FSDATASETCACHE_MAX_THREADS_PER_VOLUME_KEY, + DFSConfigKeys.DFS_DATANODE_FSDATASETCACHE_MAX_THREADS_PER_VOLUME_DEFAULT + ); + ThreadFactory workerFactory = new ThreadFactoryBuilder() + .setDaemon(true) + .setNameFormat("FsVolumeImplWorker-" + parent.toString() + "-%d") + .build(); + cacheExecutor = new ThreadPoolExecutor( + 1, maxNumThreads, + 60, TimeUnit.SECONDS, + new LinkedBlockingQueue(), + workerFactory); + cacheExecutor.allowCoreThreadTimeOut(true); } File getCurrentDir() { @@ -170,7 +198,11 @@ class FsVolumeImpl implements FsVolumeSpi { File addBlock(String bpid, Block b, File f) throws IOException { return getBlockPoolSlice(bpid).addBlock(b, f); } - + + Executor getCacheExecutor() { + return cacheExecutor; + } + void checkDirs() throws DiskErrorException { // TODO:FEDERATION valid synchronization for(BlockPoolSlice s : bpSlices.values()) { @@ -214,6 +246,7 @@ class FsVolumeImpl implements FsVolumeSpi { } void shutdown() { + cacheExecutor.shutdown(); Set> set = bpSlices.entrySet(); for (Entry entry : set) { entry.getValue().shutdown(); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/MappableBlock.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/MappableBlock.java new file mode 100644 index 00000000000..ae36822efae --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/fsdataset/impl/MappableBlock.java @@ -0,0 +1,174 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.hdfs.server.datanode.fsdataset.impl; + +import java.io.BufferedInputStream; +import java.io.Closeable; +import java.io.DataInputStream; +import java.io.FileInputStream; +import java.io.IOException; +import java.nio.ByteBuffer; +import java.nio.MappedByteBuffer; +import java.nio.channels.FileChannel; +import java.nio.channels.FileChannel.MapMode; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; +import org.apache.hadoop.fs.ChecksumException; +import org.apache.hadoop.hdfs.server.datanode.BlockMetadataHeader; +import org.apache.hadoop.io.nativeio.NativeIO; +import org.apache.hadoop.util.DataChecksum; + +import com.google.common.annotations.VisibleForTesting; +import com.google.common.base.Preconditions; + +/** + * Represents an HDFS block that is mmapped by the DataNode. + */ +@InterfaceAudience.Private +@InterfaceStability.Unstable +public class MappableBlock implements Closeable { + private MappedByteBuffer mmap; + private final long length; + + MappableBlock(MappedByteBuffer mmap, long length) { + this.mmap = mmap; + this.length = length; + assert length > 0; + } + + public long getLength() { + return length; + } + + /** + * Load the block. + * + * mmap and mlock the block, and then verify its checksum. + * + * @param length The current length of the block. + * @param blockIn The block input stream. Should be positioned at the + * start. The caller must close this. + * @param metaIn The meta file input stream. Should be positioned at + * the start. The caller must close this. + * @param blockFileName The block file name, for logging purposes. + * + * @return The Mappable block. + */ + public static MappableBlock load(long length, + FileInputStream blockIn, FileInputStream metaIn, + String blockFileName) throws IOException { + MappableBlock mappableBlock = null; + MappedByteBuffer mmap = null; + try { + FileChannel blockChannel = blockIn.getChannel(); + if (blockChannel == null) { + throw new IOException("Block InputStream has no FileChannel."); + } + mmap = blockChannel.map(MapMode.READ_ONLY, 0, length); + NativeIO.POSIX.getCacheManipulator().mlock(blockFileName, mmap, length); + verifyChecksum(length, metaIn, blockChannel, blockFileName); + mappableBlock = new MappableBlock(mmap, length); + } finally { + if (mappableBlock == null) { + if (mmap != null) { + NativeIO.POSIX.munmap(mmap); // unmapping also unlocks + } + } + } + return mappableBlock; + } + + /** + * Verifies the block's checksum. This is an I/O intensive operation. + * @return if the block was successfully checksummed. + */ + private static void verifyChecksum(long length, + FileInputStream metaIn, FileChannel blockChannel, String blockFileName) + throws IOException, ChecksumException { + // Verify the checksum from the block's meta file + // Get the DataChecksum from the meta file header + BlockMetadataHeader header = + BlockMetadataHeader.readHeader(new DataInputStream( + new BufferedInputStream(metaIn, BlockMetadataHeader + .getHeaderSize()))); + FileChannel metaChannel = metaIn.getChannel(); + if (metaChannel == null) { + throw new IOException("Block InputStream meta file has no FileChannel."); + } + DataChecksum checksum = header.getChecksum(); + final int bytesPerChecksum = checksum.getBytesPerChecksum(); + final int checksumSize = checksum.getChecksumSize(); + final int numChunks = (8*1024*1024) / bytesPerChecksum; + ByteBuffer blockBuf = ByteBuffer.allocate(numChunks*bytesPerChecksum); + ByteBuffer checksumBuf = ByteBuffer.allocate(numChunks*checksumSize); + // Verify the checksum + int bytesVerified = 0; + while (bytesVerified < length) { + Preconditions.checkState(bytesVerified % bytesPerChecksum == 0, + "Unexpected partial chunk before EOF"); + assert bytesVerified % bytesPerChecksum == 0; + int bytesRead = fillBuffer(blockChannel, blockBuf); + if (bytesRead == -1) { + throw new IOException("checksum verification failed: premature EOF"); + } + blockBuf.flip(); + // Number of read chunks, including partial chunk at end + int chunks = (bytesRead+bytesPerChecksum-1) / bytesPerChecksum; + checksumBuf.limit(chunks*checksumSize); + fillBuffer(metaChannel, checksumBuf); + checksumBuf.flip(); + checksum.verifyChunkedSums(blockBuf, checksumBuf, blockFileName, + bytesVerified); + // Success + bytesVerified += bytesRead; + blockBuf.clear(); + checksumBuf.clear(); + } + } + + /** + * Reads bytes into a buffer until EOF or the buffer's limit is reached + */ + private static int fillBuffer(FileChannel channel, ByteBuffer buf) + throws IOException { + int bytesRead = channel.read(buf); + if (bytesRead < 0) { + //EOF + return bytesRead; + } + while (buf.remaining() > 0) { + int n = channel.read(buf); + if (n < 0) { + //EOF + return bytesRead; + } + bytesRead += n; + } + return bytesRead; + } + + @Override + public void close() { + if (mmap != null) { + NativeIO.POSIX.munmap(mmap); + mmap = null; + } + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/DataNodeMetrics.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/DataNodeMetrics.java index a9237c59106..ffdb8e7cf86 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/DataNodeMetrics.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/DataNodeMetrics.java @@ -57,6 +57,8 @@ public class DataNodeMetrics { @Metric MutableCounterLong blocksRemoved; @Metric MutableCounterLong blocksVerified; @Metric MutableCounterLong blockVerificationFailures; + @Metric MutableCounterLong blocksCached; + @Metric MutableCounterLong blocksUncached; @Metric MutableCounterLong readsFromLocalClient; @Metric MutableCounterLong readsFromRemoteClient; @Metric MutableCounterLong writesFromLocalClient; @@ -74,6 +76,7 @@ public class DataNodeMetrics { @Metric MutableRate replaceBlockOp; @Metric MutableRate heartbeats; @Metric MutableRate blockReports; + @Metric MutableRate cacheReports; @Metric MutableRate packetAckRoundTripTimeNanos; MutableQuantiles[] packetAckRoundTripTimeNanosQuantiles; @@ -151,6 +154,10 @@ public class DataNodeMetrics { blockReports.add(latency); } + public void addCacheReport(long latency) { + cacheReports.add(latency); + } + public void incrBlocksReplicated(int delta) { blocksReplicated.incr(delta); } @@ -175,6 +182,15 @@ public class DataNodeMetrics { blocksVerified.incr(); } + + public void incrBlocksCached(int delta) { + blocksCached.incr(delta); + } + + public void incrBlocksUncached(int delta) { + blocksUncached.incr(delta); + } + public void addReadBlockOp(long latency) { readBlockOp.add(latency); } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/FSDatasetMBean.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/FSDatasetMBean.java index 6c98c71e651..ca8ebade5eb 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/FSDatasetMBean.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/datanode/metrics/FSDatasetMBean.java @@ -76,4 +76,29 @@ public interface FSDatasetMBean { * @return The number of failed volumes in the datanode. */ public int getNumFailedVolumes(); + + /** + * Returns the amount of cache used by the datanode (in bytes). + */ + public long getCacheUsed(); + + /** + * Returns the total cache capacity of the datanode (in bytes). + */ + public long getCacheCapacity(); + + /** + * Returns the number of blocks cached. + */ + public long getNumBlocksCached(); + + /** + * Returns the number of blocks that the datanode was unable to cache + */ + public long getNumBlocksFailedToCache(); + + /** + * Returns the number of blocks that the datanode was unable to uncache + */ + public long getNumBlocksFailedToUncache(); } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CacheManager.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CacheManager.java new file mode 100644 index 00000000000..b3ff8dfef59 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CacheManager.java @@ -0,0 +1,1073 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.namenode; + +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT_DEFAULT; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES_DEFAULT; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES_DEFAULT; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS_DEFAULT; + +import java.io.DataInput; +import java.io.DataOutputStream; +import java.io.IOException; +import java.util.ArrayList; +import java.util.Collection; +import java.util.Collections; +import java.util.Date; +import java.util.EnumSet; +import java.util.Iterator; +import java.util.LinkedList; +import java.util.List; +import java.util.Map.Entry; +import java.util.SortedMap; +import java.util.TreeMap; +import java.util.concurrent.locks.ReentrantLock; + +import org.apache.commons.io.IOUtils; +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.BatchedRemoteIterator.BatchedListEntries; +import org.apache.hadoop.fs.CacheFlag; +import org.apache.hadoop.fs.InvalidRequestException; +import org.apache.hadoop.fs.UnresolvedLinkException; +import org.apache.hadoop.fs.permission.FsAction; +import org.apache.hadoop.hdfs.DFSUtil; +import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirective; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo.Expiration; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveStats; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.DatanodeID; +import org.apache.hadoop.hdfs.protocol.LocatedBlock; +import org.apache.hadoop.hdfs.server.blockmanagement.BlockManager; +import org.apache.hadoop.hdfs.server.blockmanagement.CacheReplicationMonitor; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList.Type; +import org.apache.hadoop.hdfs.server.namenode.metrics.NameNodeMetrics; +import org.apache.hadoop.hdfs.server.namenode.startupprogress.Phase; +import org.apache.hadoop.hdfs.server.namenode.startupprogress.StartupProgress; +import org.apache.hadoop.hdfs.server.namenode.startupprogress.StartupProgress.Counter; +import org.apache.hadoop.hdfs.server.namenode.startupprogress.Step; +import org.apache.hadoop.hdfs.server.namenode.startupprogress.StepType; +import org.apache.hadoop.hdfs.util.ReadOnlyList; +import org.apache.hadoop.security.AccessControlException; +import org.apache.hadoop.util.GSet; +import org.apache.hadoop.util.LightWeightGSet; +import org.apache.hadoop.util.Time; + +import com.google.common.annotations.VisibleForTesting; + +/** + * The Cache Manager handles caching on DataNodes. + * + * This class is instantiated by the FSNamesystem. + * It maintains the mapping of cached blocks to datanodes via processing + * datanode cache reports. Based on these reports and addition and removal of + * caching directives, we will schedule caching and uncaching work. + */ +@InterfaceAudience.LimitedPrivate({"HDFS"}) +public final class CacheManager { + public static final Log LOG = LogFactory.getLog(CacheManager.class); + + private static final float MIN_CACHED_BLOCKS_PERCENT = 0.001f; + + // TODO: add pending / underCached / schedule cached blocks stats. + + /** + * The FSNamesystem that contains this CacheManager. + */ + private final FSNamesystem namesystem; + + /** + * The BlockManager associated with the FSN that owns this CacheManager. + */ + private final BlockManager blockManager; + + /** + * Cache directives, sorted by ID. + * + * listCacheDirectives relies on the ordering of elements in this map + * to track what has already been listed by the client. + */ + private final TreeMap directivesById = + new TreeMap(); + + /** + * The directive ID to use for a new directive. IDs always increase, and are + * never reused. + */ + private long nextDirectiveId; + + /** + * Cache directives, sorted by path + */ + private final TreeMap> directivesByPath = + new TreeMap>(); + + /** + * Cache pools, sorted by name. + */ + private final TreeMap cachePools = + new TreeMap(); + + /** + * Maximum number of cache pools to list in one operation. + */ + private final int maxListCachePoolsResponses; + + /** + * Maximum number of cache pool directives to list in one operation. + */ + private final int maxListCacheDirectivesNumResponses; + + /** + * Interval between scans in milliseconds. + */ + private final long scanIntervalMs; + + /** + * All cached blocks. + */ + private final GSet cachedBlocks; + + /** + * Lock which protects the CacheReplicationMonitor. + */ + private final ReentrantLock crmLock = new ReentrantLock(); + + /** + * The CacheReplicationMonitor. + */ + private CacheReplicationMonitor monitor; + + CacheManager(FSNamesystem namesystem, Configuration conf, + BlockManager blockManager) { + this.namesystem = namesystem; + this.blockManager = blockManager; + this.nextDirectiveId = 1; + this.maxListCachePoolsResponses = conf.getInt( + DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES, + DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES_DEFAULT); + this.maxListCacheDirectivesNumResponses = conf.getInt( + DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES, + DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES_DEFAULT); + scanIntervalMs = conf.getLong( + DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS, + DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS_DEFAULT); + float cachedBlocksPercent = conf.getFloat( + DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT, + DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT_DEFAULT); + if (cachedBlocksPercent < MIN_CACHED_BLOCKS_PERCENT) { + LOG.info("Using minimum value " + MIN_CACHED_BLOCKS_PERCENT + + " for " + DFS_NAMENODE_PATH_BASED_CACHE_BLOCK_MAP_ALLOCATION_PERCENT); + cachedBlocksPercent = MIN_CACHED_BLOCKS_PERCENT; + } + this.cachedBlocks = new LightWeightGSet( + LightWeightGSet.computeCapacity(cachedBlocksPercent, + "cachedBlocks")); + + } + + public void startMonitorThread() { + crmLock.lock(); + try { + if (this.monitor == null) { + this.monitor = new CacheReplicationMonitor(namesystem, this, + scanIntervalMs, crmLock); + this.monitor.start(); + } + } finally { + crmLock.unlock(); + } + } + + public void stopMonitorThread() { + crmLock.lock(); + try { + if (this.monitor != null) { + CacheReplicationMonitor prevMonitor = this.monitor; + this.monitor = null; + IOUtils.closeQuietly(prevMonitor); + } + } finally { + crmLock.unlock(); + } + } + + public void clearDirectiveStats() { + assert namesystem.hasWriteLock(); + for (CacheDirective directive : directivesById.values()) { + directive.resetStatistics(); + } + } + + /** + * @return Unmodifiable view of the collection of CachePools. + */ + public Collection getCachePools() { + assert namesystem.hasReadLock(); + return Collections.unmodifiableCollection(cachePools.values()); + } + + /** + * @return Unmodifiable view of the collection of CacheDirectives. + */ + public Collection getCacheDirectives() { + assert namesystem.hasReadLock(); + return Collections.unmodifiableCollection(directivesById.values()); + } + + @VisibleForTesting + public GSet getCachedBlocks() { + assert namesystem.hasReadLock(); + return cachedBlocks; + } + + private long getNextDirectiveId() throws IOException { + assert namesystem.hasWriteLock(); + if (nextDirectiveId >= Long.MAX_VALUE - 1) { + throw new IOException("No more available IDs."); + } + return nextDirectiveId++; + } + + // Helper getter / validation methods + + private static void checkWritePermission(FSPermissionChecker pc, + CachePool pool) throws AccessControlException { + if ((pc != null)) { + pc.checkPermission(pool, FsAction.WRITE); + } + } + + private static String validatePoolName(CacheDirectiveInfo directive) + throws InvalidRequestException { + String pool = directive.getPool(); + if (pool == null) { + throw new InvalidRequestException("No pool specified."); + } + if (pool.isEmpty()) { + throw new InvalidRequestException("Invalid empty pool name."); + } + return pool; + } + + private static String validatePath(CacheDirectiveInfo directive) + throws InvalidRequestException { + if (directive.getPath() == null) { + throw new InvalidRequestException("No path specified."); + } + String path = directive.getPath().toUri().getPath(); + if (!DFSUtil.isValidName(path)) { + throw new InvalidRequestException("Invalid path '" + path + "'."); + } + return path; + } + + private static short validateReplication(CacheDirectiveInfo directive, + short defaultValue) throws InvalidRequestException { + short repl = (directive.getReplication() != null) + ? directive.getReplication() : defaultValue; + if (repl <= 0) { + throw new InvalidRequestException("Invalid replication factor " + repl + + " <= 0"); + } + return repl; + } + + /** + * Calculates the absolute expiry time of the directive from the + * {@link CacheDirectiveInfo.Expiration}. This converts a relative Expiration + * into an absolute time based on the local clock. + * + * @param info to validate. + * @param maxRelativeExpiryTime of the info's pool. + * @return the expiration time, or the pool's max absolute expiration if the + * info's expiration was not set. + * @throws InvalidRequestException if the info's Expiration is invalid. + */ + private static long validateExpiryTime(CacheDirectiveInfo info, + long maxRelativeExpiryTime) throws InvalidRequestException { + if (LOG.isTraceEnabled()) { + LOG.trace("Validating directive " + info + + " pool maxRelativeExpiryTime " + maxRelativeExpiryTime); + } + final long now = new Date().getTime(); + final long maxAbsoluteExpiryTime = now + maxRelativeExpiryTime; + if (info == null || info.getExpiration() == null) { + return maxAbsoluteExpiryTime; + } + Expiration expiry = info.getExpiration(); + if (expiry.getMillis() < 0l) { + throw new InvalidRequestException("Cannot set a negative expiration: " + + expiry.getMillis()); + } + long relExpiryTime, absExpiryTime; + if (expiry.isRelative()) { + relExpiryTime = expiry.getMillis(); + absExpiryTime = now + relExpiryTime; + } else { + absExpiryTime = expiry.getMillis(); + relExpiryTime = absExpiryTime - now; + } + // Need to cap the expiry so we don't overflow a long when doing math + if (relExpiryTime > Expiration.MAX_RELATIVE_EXPIRY_MS) { + throw new InvalidRequestException("Expiration " + + expiry.toString() + " is too far in the future!"); + } + // Fail if the requested expiry is greater than the max + if (relExpiryTime > maxRelativeExpiryTime) { + throw new InvalidRequestException("Expiration " + expiry.toString() + + " exceeds the max relative expiration time of " + + maxRelativeExpiryTime + " ms."); + } + return absExpiryTime; + } + + /** + * Throws an exception if the CachePool does not have enough capacity to + * cache the given path at the replication factor. + * + * @param pool CachePool where the path is being cached + * @param path Path that is being cached + * @param replication Replication factor of the path + * @throws InvalidRequestException if the pool does not have enough capacity + */ + private void checkLimit(CachePool pool, String path, + short replication) throws InvalidRequestException { + CacheDirectiveStats stats = computeNeeded(path, replication); + if (pool.getLimit() == CachePoolInfo.LIMIT_UNLIMITED) { + return; + } + if (pool.getBytesNeeded() + (stats.getBytesNeeded() * replication) > pool + .getLimit()) { + throw new InvalidRequestException("Caching path " + path + " of size " + + stats.getBytesNeeded() / replication + " bytes at replication " + + replication + " would exceed pool " + pool.getPoolName() + + "'s remaining capacity of " + + (pool.getLimit() - pool.getBytesNeeded()) + " bytes."); + } + } + + /** + * Computes the needed number of bytes and files for a path. + * @return CacheDirectiveStats describing the needed stats for this path + */ + private CacheDirectiveStats computeNeeded(String path, short replication) { + FSDirectory fsDir = namesystem.getFSDirectory(); + INode node; + long requestedBytes = 0; + long requestedFiles = 0; + CacheDirectiveStats.Builder builder = new CacheDirectiveStats.Builder(); + try { + node = fsDir.getINode(path); + } catch (UnresolvedLinkException e) { + // We don't cache through symlinks + return builder.build(); + } + if (node == null) { + return builder.build(); + } + if (node.isFile()) { + requestedFiles = 1; + INodeFile file = node.asFile(); + requestedBytes = file.computeFileSize(); + } else if (node.isDirectory()) { + INodeDirectory dir = node.asDirectory(); + ReadOnlyList children = dir.getChildrenList(null); + requestedFiles = children.size(); + for (INode child : children) { + if (child.isFile()) { + requestedBytes += child.asFile().computeFileSize(); + } + } + } + return new CacheDirectiveStats.Builder() + .setBytesNeeded(requestedBytes) + .setFilesCached(requestedFiles) + .build(); + } + + /** + * Get a CacheDirective by ID, validating the ID and that the directive + * exists. + */ + private CacheDirective getById(long id) throws InvalidRequestException { + // Check for invalid IDs. + if (id <= 0) { + throw new InvalidRequestException("Invalid negative ID."); + } + // Find the directive. + CacheDirective directive = directivesById.get(id); + if (directive == null) { + throw new InvalidRequestException("No directive with ID " + id + + " found."); + } + return directive; + } + + /** + * Get a CachePool by name, validating that it exists. + */ + private CachePool getCachePool(String poolName) + throws InvalidRequestException { + CachePool pool = cachePools.get(poolName); + if (pool == null) { + throw new InvalidRequestException("Unknown pool " + poolName); + } + return pool; + } + + // RPC handlers + + private void addInternal(CacheDirective directive, CachePool pool) { + boolean addedDirective = pool.getDirectiveList().add(directive); + assert addedDirective; + directivesById.put(directive.getId(), directive); + String path = directive.getPath(); + List directives = directivesByPath.get(path); + if (directives == null) { + directives = new ArrayList(1); + directivesByPath.put(path, directives); + } + directives.add(directive); + // Fix up pool stats + CacheDirectiveStats stats = + computeNeeded(directive.getPath(), directive.getReplication()); + directive.addBytesNeeded(stats.getBytesNeeded()); + directive.addFilesNeeded(directive.getFilesNeeded()); + + setNeedsRescan(); + } + + /** + * Adds a directive, skipping most error checking. This should only be called + * internally in special scenarios like edit log replay. + */ + CacheDirectiveInfo addDirectiveFromEditLog(CacheDirectiveInfo directive) + throws InvalidRequestException { + long id = directive.getId(); + CacheDirective entry = new CacheDirective(directive); + CachePool pool = cachePools.get(directive.getPool()); + addInternal(entry, pool); + if (nextDirectiveId <= id) { + nextDirectiveId = id + 1; + } + return entry.toInfo(); + } + + public CacheDirectiveInfo addDirective( + CacheDirectiveInfo info, FSPermissionChecker pc, EnumSet flags) + throws IOException { + assert namesystem.hasWriteLock(); + CacheDirective directive; + try { + CachePool pool = getCachePool(validatePoolName(info)); + checkWritePermission(pc, pool); + String path = validatePath(info); + short replication = validateReplication(info, (short)1); + long expiryTime = validateExpiryTime(info, pool.getMaxRelativeExpiryMs()); + // Do quota validation if required + if (!flags.contains(CacheFlag.FORCE)) { + checkLimit(pool, path, replication); + } + // All validation passed + // Add a new entry with the next available ID. + long id = getNextDirectiveId(); + directive = new CacheDirective(id, path, replication, expiryTime); + addInternal(directive, pool); + } catch (IOException e) { + LOG.warn("addDirective of " + info + " failed: ", e); + throw e; + } + LOG.info("addDirective of " + info + " successful."); + return directive.toInfo(); + } + + /** + * Factory method that makes a new CacheDirectiveInfo by applying fields in a + * CacheDirectiveInfo to an existing CacheDirective. + * + * @param info with some or all fields set. + * @param defaults directive providing default values for unset fields in + * info. + * + * @return new CacheDirectiveInfo of the info applied to the defaults. + */ + private static CacheDirectiveInfo createFromInfoAndDefaults( + CacheDirectiveInfo info, CacheDirective defaults) { + // Initialize the builder with the default values + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(defaults.toInfo()); + // Replace default with new value if present + if (info.getPath() != null) { + builder.setPath(info.getPath()); + } + if (info.getReplication() != null) { + builder.setReplication(info.getReplication()); + } + if (info.getPool() != null) { + builder.setPool(info.getPool()); + } + if (info.getExpiration() != null) { + builder.setExpiration(info.getExpiration()); + } + return builder.build(); + } + + /** + * Modifies a directive, skipping most error checking. This is for careful + * internal use only. modifyDirective can be non-deterministic since its error + * checking depends on current system time, which poses a problem for edit log + * replay. + */ + void modifyDirectiveFromEditLog(CacheDirectiveInfo info) + throws InvalidRequestException { + // Check for invalid IDs. + Long id = info.getId(); + if (id == null) { + throw new InvalidRequestException("Must supply an ID."); + } + CacheDirective prevEntry = getById(id); + CacheDirectiveInfo newInfo = createFromInfoAndDefaults(info, prevEntry); + removeInternal(prevEntry); + addInternal(new CacheDirective(newInfo), getCachePool(newInfo.getPool())); + } + + public void modifyDirective(CacheDirectiveInfo info, + FSPermissionChecker pc, EnumSet flags) throws IOException { + assert namesystem.hasWriteLock(); + String idString = + (info.getId() == null) ? + "(null)" : info.getId().toString(); + try { + // Check for invalid IDs. + Long id = info.getId(); + if (id == null) { + throw new InvalidRequestException("Must supply an ID."); + } + CacheDirective prevEntry = getById(id); + checkWritePermission(pc, prevEntry.getPool()); + + // Fill in defaults + CacheDirectiveInfo infoWithDefaults = + createFromInfoAndDefaults(info, prevEntry); + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(infoWithDefaults); + + // Do validation + validatePath(infoWithDefaults); + validateReplication(infoWithDefaults, (short)-1); + // Need to test the pool being set here to avoid rejecting a modify for a + // directive that's already been forced into a pool + CachePool srcPool = prevEntry.getPool(); + CachePool destPool = getCachePool(validatePoolName(infoWithDefaults)); + if (!srcPool.getPoolName().equals(destPool.getPoolName())) { + checkWritePermission(pc, destPool); + if (!flags.contains(CacheFlag.FORCE)) { + checkLimit(destPool, infoWithDefaults.getPath().toUri().getPath(), + infoWithDefaults.getReplication()); + } + } + // Verify the expiration against the destination pool + validateExpiryTime(infoWithDefaults, destPool.getMaxRelativeExpiryMs()); + + // Indicate changes to the CRM + setNeedsRescan(); + + // Validation passed + removeInternal(prevEntry); + addInternal(new CacheDirective(builder.build()), destPool); + } catch (IOException e) { + LOG.warn("modifyDirective of " + idString + " failed: ", e); + throw e; + } + LOG.info("modifyDirective of " + idString + " successfully applied " + + info+ "."); + } + + private void removeInternal(CacheDirective directive) + throws InvalidRequestException { + assert namesystem.hasWriteLock(); + // Remove the corresponding entry in directivesByPath. + String path = directive.getPath(); + List directives = directivesByPath.get(path); + if (directives == null || !directives.remove(directive)) { + throw new InvalidRequestException("Failed to locate entry " + + directive.getId() + " by path " + directive.getPath()); + } + if (directives.size() == 0) { + directivesByPath.remove(path); + } + // Fix up the stats from removing the pool + final CachePool pool = directive.getPool(); + directive.addBytesNeeded(-directive.getBytesNeeded()); + directive.addFilesNeeded(-directive.getFilesNeeded()); + + directivesById.remove(directive.getId()); + pool.getDirectiveList().remove(directive); + assert directive.getPool() == null; + + setNeedsRescan(); + } + + public void removeDirective(long id, FSPermissionChecker pc) + throws IOException { + assert namesystem.hasWriteLock(); + try { + CacheDirective directive = getById(id); + checkWritePermission(pc, directive.getPool()); + removeInternal(directive); + } catch (IOException e) { + LOG.warn("removeDirective of " + id + " failed: ", e); + throw e; + } + LOG.info("removeDirective of " + id + " successful."); + } + + public BatchedListEntries + listCacheDirectives(long prevId, + CacheDirectiveInfo filter, + FSPermissionChecker pc) throws IOException { + assert namesystem.hasReadLock(); + final int NUM_PRE_ALLOCATED_ENTRIES = 16; + String filterPath = null; + if (filter.getId() != null) { + throw new IOException("Filtering by ID is unsupported."); + } + if (filter.getPath() != null) { + filterPath = validatePath(filter); + } + if (filter.getReplication() != null) { + throw new IOException("Filtering by replication is unsupported."); + } + ArrayList replies = + new ArrayList(NUM_PRE_ALLOCATED_ENTRIES); + int numReplies = 0; + SortedMap tailMap = + directivesById.tailMap(prevId + 1); + for (Entry cur : tailMap.entrySet()) { + if (numReplies >= maxListCacheDirectivesNumResponses) { + return new BatchedListEntries(replies, true); + } + CacheDirective curDirective = cur.getValue(); + CacheDirectiveInfo info = cur.getValue().toInfo(); + if (filter.getPool() != null && + !info.getPool().equals(filter.getPool())) { + continue; + } + if (filterPath != null && + !info.getPath().toUri().getPath().equals(filterPath)) { + continue; + } + boolean hasPermission = true; + if (pc != null) { + try { + pc.checkPermission(curDirective.getPool(), FsAction.READ); + } catch (AccessControlException e) { + hasPermission = false; + } + } + if (hasPermission) { + replies.add(new CacheDirectiveEntry(info, cur.getValue().toStats())); + numReplies++; + } + } + return new BatchedListEntries(replies, false); + } + + /** + * Create a cache pool. + * + * Only the superuser should be able to call this function. + * + * @param info The info for the cache pool to create. + * @return Information about the cache pool we created. + */ + public CachePoolInfo addCachePool(CachePoolInfo info) + throws IOException { + assert namesystem.hasWriteLock(); + CachePool pool; + try { + CachePoolInfo.validate(info); + String poolName = info.getPoolName(); + pool = cachePools.get(poolName); + if (pool != null) { + throw new InvalidRequestException("Cache pool " + poolName + + " already exists."); + } + pool = CachePool.createFromInfoAndDefaults(info); + cachePools.put(pool.getPoolName(), pool); + } catch (IOException e) { + LOG.info("addCachePool of " + info + " failed: ", e); + throw e; + } + LOG.info("addCachePool of " + info + " successful."); + return pool.getInfo(true); + } + + /** + * Modify a cache pool. + * + * Only the superuser should be able to call this function. + * + * @param info + * The info for the cache pool to modify. + */ + public void modifyCachePool(CachePoolInfo info) + throws IOException { + assert namesystem.hasWriteLock(); + StringBuilder bld = new StringBuilder(); + try { + CachePoolInfo.validate(info); + String poolName = info.getPoolName(); + CachePool pool = cachePools.get(poolName); + if (pool == null) { + throw new InvalidRequestException("Cache pool " + poolName + + " does not exist."); + } + String prefix = ""; + if (info.getOwnerName() != null) { + pool.setOwnerName(info.getOwnerName()); + bld.append(prefix). + append("set owner to ").append(info.getOwnerName()); + prefix = "; "; + } + if (info.getGroupName() != null) { + pool.setGroupName(info.getGroupName()); + bld.append(prefix). + append("set group to ").append(info.getGroupName()); + prefix = "; "; + } + if (info.getMode() != null) { + pool.setMode(info.getMode()); + bld.append(prefix).append("set mode to " + info.getMode()); + prefix = "; "; + } + if (info.getLimit() != null) { + pool.setLimit(info.getLimit()); + bld.append(prefix).append("set limit to " + info.getLimit()); + prefix = "; "; + // New limit changes stats, need to set needs refresh + setNeedsRescan(); + } + if (info.getMaxRelativeExpiryMs() != null) { + final Long maxRelativeExpiry = info.getMaxRelativeExpiryMs(); + pool.setMaxRelativeExpiryMs(maxRelativeExpiry); + bld.append(prefix).append("set maxRelativeExpiry to " + + maxRelativeExpiry); + prefix = "; "; + } + if (prefix.isEmpty()) { + bld.append("no changes."); + } + } catch (IOException e) { + LOG.info("modifyCachePool of " + info + " failed: ", e); + throw e; + } + LOG.info("modifyCachePool of " + info.getPoolName() + " successful; " + + bld.toString()); + } + + /** + * Remove a cache pool. + * + * Only the superuser should be able to call this function. + * + * @param poolName + * The name for the cache pool to remove. + */ + public void removeCachePool(String poolName) + throws IOException { + assert namesystem.hasWriteLock(); + try { + CachePoolInfo.validateName(poolName); + CachePool pool = cachePools.remove(poolName); + if (pool == null) { + throw new InvalidRequestException( + "Cannot remove non-existent cache pool " + poolName); + } + // Remove all directives in this pool. + Iterator iter = pool.getDirectiveList().iterator(); + while (iter.hasNext()) { + CacheDirective directive = iter.next(); + directivesByPath.remove(directive.getPath()); + directivesById.remove(directive.getId()); + iter.remove(); + } + setNeedsRescan(); + } catch (IOException e) { + LOG.info("removeCachePool of " + poolName + " failed: ", e); + throw e; + } + LOG.info("removeCachePool of " + poolName + " successful."); + } + + public BatchedListEntries + listCachePools(FSPermissionChecker pc, String prevKey) { + assert namesystem.hasReadLock(); + final int NUM_PRE_ALLOCATED_ENTRIES = 16; + ArrayList results = + new ArrayList(NUM_PRE_ALLOCATED_ENTRIES); + SortedMap tailMap = cachePools.tailMap(prevKey, false); + int numListed = 0; + for (Entry cur : tailMap.entrySet()) { + if (numListed++ >= maxListCachePoolsResponses) { + return new BatchedListEntries(results, true); + } + results.add(cur.getValue().getEntry(pc)); + } + return new BatchedListEntries(results, false); + } + + public void setCachedLocations(LocatedBlock block) { + CachedBlock cachedBlock = + new CachedBlock(block.getBlock().getBlockId(), + (short)0, false); + cachedBlock = cachedBlocks.get(cachedBlock); + if (cachedBlock == null) { + return; + } + List datanodes = cachedBlock.getDatanodes(Type.CACHED); + for (DatanodeDescriptor datanode : datanodes) { + block.addCachedLoc(datanode); + } + } + + public final void processCacheReport(final DatanodeID datanodeID, + final List blockIds) throws IOException { + namesystem.writeLock(); + final long startTime = Time.monotonicNow(); + final long endTime; + try { + final DatanodeDescriptor datanode = + blockManager.getDatanodeManager().getDatanode(datanodeID); + if (datanode == null || !datanode.isAlive) { + throw new IOException( + "processCacheReport from dead or unregistered datanode: " + + datanode); + } + processCacheReportImpl(datanode, blockIds); + } finally { + endTime = Time.monotonicNow(); + namesystem.writeUnlock(); + } + + // Log the block report processing stats from Namenode perspective + final NameNodeMetrics metrics = NameNode.getNameNodeMetrics(); + if (metrics != null) { + metrics.addCacheBlockReport((int) (endTime - startTime)); + } + LOG.info("Processed cache report from " + + datanodeID + ", blocks: " + blockIds.size() + + ", processing time: " + (endTime - startTime) + " msecs"); + } + + private void processCacheReportImpl(final DatanodeDescriptor datanode, + final List blockIds) { + CachedBlocksList cached = datanode.getCached(); + cached.clear(); + CachedBlocksList cachedList = datanode.getCached(); + CachedBlocksList pendingCachedList = datanode.getPendingCached(); + for (Iterator iter = blockIds.iterator(); iter.hasNext(); ) { + long blockId = iter.next(); + CachedBlock cachedBlock = + new CachedBlock(blockId, (short)0, false); + CachedBlock prevCachedBlock = cachedBlocks.get(cachedBlock); + // Add the block ID from the cache report to the cachedBlocks map + // if it's not already there. + if (prevCachedBlock != null) { + cachedBlock = prevCachedBlock; + } else { + cachedBlocks.put(cachedBlock); + } + // Add the block to the datanode's implicit cached block list + // if it's not already there. Similarly, remove it from the pending + // cached block list if it exists there. + if (!cachedBlock.isPresent(cachedList)) { + cachedList.add(cachedBlock); + } + if (cachedBlock.isPresent(pendingCachedList)) { + pendingCachedList.remove(cachedBlock); + } + } + } + + /** + * Saves the current state of the CacheManager to the DataOutput. Used + * to persist CacheManager state in the FSImage. + * @param out DataOutput to persist state + * @param sdPath path of the storage directory + * @throws IOException + */ + public void saveState(DataOutputStream out, String sdPath) + throws IOException { + out.writeLong(nextDirectiveId); + savePools(out, sdPath); + saveDirectives(out, sdPath); + } + + /** + * Reloads CacheManager state from the passed DataInput. Used during namenode + * startup to restore CacheManager state from an FSImage. + * @param in DataInput from which to restore state + * @throws IOException + */ + public void loadState(DataInput in) throws IOException { + nextDirectiveId = in.readLong(); + // pools need to be loaded first since directives point to their parent pool + loadPools(in); + loadDirectives(in); + } + + /** + * Save cache pools to fsimage + */ + private void savePools(DataOutputStream out, + String sdPath) throws IOException { + StartupProgress prog = NameNode.getStartupProgress(); + Step step = new Step(StepType.CACHE_POOLS, sdPath); + prog.beginStep(Phase.SAVING_CHECKPOINT, step); + prog.setTotal(Phase.SAVING_CHECKPOINT, step, cachePools.size()); + Counter counter = prog.getCounter(Phase.SAVING_CHECKPOINT, step); + out.writeInt(cachePools.size()); + for (CachePool pool: cachePools.values()) { + FSImageSerialization.writeCachePoolInfo(out, pool.getInfo(true)); + counter.increment(); + } + prog.endStep(Phase.SAVING_CHECKPOINT, step); + } + + /* + * Save cache entries to fsimage + */ + private void saveDirectives(DataOutputStream out, String sdPath) + throws IOException { + StartupProgress prog = NameNode.getStartupProgress(); + Step step = new Step(StepType.CACHE_ENTRIES, sdPath); + prog.beginStep(Phase.SAVING_CHECKPOINT, step); + prog.setTotal(Phase.SAVING_CHECKPOINT, step, directivesById.size()); + Counter counter = prog.getCounter(Phase.SAVING_CHECKPOINT, step); + out.writeInt(directivesById.size()); + for (CacheDirective directive : directivesById.values()) { + FSImageSerialization.writeCacheDirectiveInfo(out, directive.toInfo()); + counter.increment(); + } + prog.endStep(Phase.SAVING_CHECKPOINT, step); + } + + /** + * Load cache pools from fsimage + */ + private void loadPools(DataInput in) + throws IOException { + StartupProgress prog = NameNode.getStartupProgress(); + Step step = new Step(StepType.CACHE_POOLS); + prog.beginStep(Phase.LOADING_FSIMAGE, step); + int numberOfPools = in.readInt(); + prog.setTotal(Phase.LOADING_FSIMAGE, step, numberOfPools); + Counter counter = prog.getCounter(Phase.LOADING_FSIMAGE, step); + for (int i = 0; i < numberOfPools; i++) { + addCachePool(FSImageSerialization.readCachePoolInfo(in)); + counter.increment(); + } + prog.endStep(Phase.LOADING_FSIMAGE, step); + } + + /** + * Load cache directives from the fsimage + */ + private void loadDirectives(DataInput in) throws IOException { + StartupProgress prog = NameNode.getStartupProgress(); + Step step = new Step(StepType.CACHE_ENTRIES); + prog.beginStep(Phase.LOADING_FSIMAGE, step); + int numDirectives = in.readInt(); + prog.setTotal(Phase.LOADING_FSIMAGE, step, numDirectives); + Counter counter = prog.getCounter(Phase.LOADING_FSIMAGE, step); + for (int i = 0; i < numDirectives; i++) { + CacheDirectiveInfo info = FSImageSerialization.readCacheDirectiveInfo(in); + // Get pool reference by looking it up in the map + final String poolName = info.getPool(); + CachePool pool = cachePools.get(poolName); + if (pool == null) { + throw new IOException("Directive refers to pool " + poolName + + ", which does not exist."); + } + CacheDirective directive = + new CacheDirective(info.getId(), info.getPath().toUri().getPath(), + info.getReplication(), info.getExpiration().getAbsoluteMillis()); + boolean addedDirective = pool.getDirectiveList().add(directive); + assert addedDirective; + if (directivesById.put(directive.getId(), directive) != null) { + throw new IOException("A directive with ID " + directive.getId() + + " already exists"); + } + List directives = + directivesByPath.get(directive.getPath()); + if (directives == null) { + directives = new LinkedList(); + directivesByPath.put(directive.getPath(), directives); + } + directives.add(directive); + counter.increment(); + } + prog.endStep(Phase.LOADING_FSIMAGE, step); + } + + public void waitForRescanIfNeeded() { + crmLock.lock(); + try { + if (monitor != null) { + monitor.waitForRescanIfNeeded(); + } + } finally { + crmLock.unlock(); + } + } + + private void setNeedsRescan() { + crmLock.lock(); + try { + if (monitor != null) { + monitor.setNeedsRescan(); + } + } finally { + crmLock.unlock(); + } + } + + @VisibleForTesting + public Thread getCacheReplicationMonitor() { + crmLock.lock(); + try { + return monitor; + } finally { + crmLock.unlock(); + } + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachePool.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachePool.java new file mode 100644 index 00000000000..3a96a05aca8 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachePool.java @@ -0,0 +1,328 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.namenode; + +import java.io.IOException; + +import javax.annotation.Nonnull; + +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.fs.permission.FsAction; +import org.apache.hadoop.fs.permission.FsPermission; +import org.apache.hadoop.hdfs.protocol.CacheDirective; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolStats; +import org.apache.hadoop.security.AccessControlException; +import org.apache.hadoop.security.UserGroupInformation; +import org.apache.hadoop.util.IntrusiveCollection; + +import com.google.common.base.Preconditions; + +/** + * A CachePool describes a set of cache resources being managed by the NameNode. + * User caching requests are billed to the cache pool specified in the request. + * + * This is an internal class, only used on the NameNode. For identifying or + * describing a cache pool to clients, please use CachePoolInfo. + * + * CachePools must be accessed under the FSNamesystem lock. + */ +@InterfaceAudience.Private +public final class CachePool { + public static final Log LOG = LogFactory.getLog(CachePool.class); + + @Nonnull + private final String poolName; + + @Nonnull + private String ownerName; + + @Nonnull + private String groupName; + + /** + * Cache pool permissions. + * + * READ permission means that you can list the cache directives in this pool. + * WRITE permission means that you can add, remove, or modify cache directives + * in this pool. + * EXECUTE permission is unused. + */ + @Nonnull + private FsPermission mode; + + /** + * Maximum number of bytes that can be cached in this pool. + */ + private long limit; + + /** + * Maximum duration that a CacheDirective in this pool remains valid, + * in milliseconds. + */ + private long maxRelativeExpiryMs; + + private long bytesNeeded; + private long bytesCached; + private long filesNeeded; + private long filesCached; + + public final static class DirectiveList + extends IntrusiveCollection { + private CachePool cachePool; + + private DirectiveList(CachePool cachePool) { + this.cachePool = cachePool; + } + + public CachePool getCachePool() { + return cachePool; + } + } + + @Nonnull + private final DirectiveList directiveList = new DirectiveList(this); + + /** + * Create a new cache pool based on a CachePoolInfo object and the defaults. + * We will fill in information that was not supplied according to the + * defaults. + */ + static CachePool createFromInfoAndDefaults(CachePoolInfo info) + throws IOException { + UserGroupInformation ugi = null; + String ownerName = info.getOwnerName(); + if (ownerName == null) { + if (ugi == null) { + ugi = NameNode.getRemoteUser(); + } + ownerName = ugi.getShortUserName(); + } + String groupName = info.getGroupName(); + if (groupName == null) { + if (ugi == null) { + ugi = NameNode.getRemoteUser(); + } + groupName = ugi.getPrimaryGroupName(); + } + FsPermission mode = (info.getMode() == null) ? + FsPermission.getCachePoolDefault() : info.getMode(); + long limit = info.getLimit() == null ? + CachePoolInfo.DEFAULT_LIMIT : info.getLimit(); + long maxRelativeExpiry = info.getMaxRelativeExpiryMs() == null ? + CachePoolInfo.DEFAULT_MAX_RELATIVE_EXPIRY : + info.getMaxRelativeExpiryMs(); + return new CachePool(info.getPoolName(), + ownerName, groupName, mode, limit, maxRelativeExpiry); + } + + /** + * Create a new cache pool based on a CachePoolInfo object. + * No fields in the CachePoolInfo can be blank. + */ + static CachePool createFromInfo(CachePoolInfo info) { + return new CachePool(info.getPoolName(), + info.getOwnerName(), info.getGroupName(), + info.getMode(), info.getLimit(), info.getMaxRelativeExpiryMs()); + } + + CachePool(String poolName, String ownerName, String groupName, + FsPermission mode, long limit, long maxRelativeExpiry) { + Preconditions.checkNotNull(poolName); + Preconditions.checkNotNull(ownerName); + Preconditions.checkNotNull(groupName); + Preconditions.checkNotNull(mode); + this.poolName = poolName; + this.ownerName = ownerName; + this.groupName = groupName; + this.mode = new FsPermission(mode); + this.limit = limit; + this.maxRelativeExpiryMs = maxRelativeExpiry; + } + + public String getPoolName() { + return poolName; + } + + public String getOwnerName() { + return ownerName; + } + + public CachePool setOwnerName(String ownerName) { + this.ownerName = ownerName; + return this; + } + + public String getGroupName() { + return groupName; + } + + public CachePool setGroupName(String groupName) { + this.groupName = groupName; + return this; + } + + public FsPermission getMode() { + return mode; + } + + public CachePool setMode(FsPermission mode) { + this.mode = new FsPermission(mode); + return this; + } + + public long getLimit() { + return limit; + } + + public CachePool setLimit(long bytes) { + this.limit = bytes; + return this; + } + + public long getMaxRelativeExpiryMs() { + return maxRelativeExpiryMs; + } + + public CachePool setMaxRelativeExpiryMs(long expiry) { + this.maxRelativeExpiryMs = expiry; + return this; + } + + /** + * Get either full or partial information about this CachePool. + * + * @param fullInfo + * If true, only the name will be returned (i.e., what you + * would get if you didn't have read permission for this pool.) + * @return + * Cache pool information. + */ + CachePoolInfo getInfo(boolean fullInfo) { + CachePoolInfo info = new CachePoolInfo(poolName); + if (!fullInfo) { + return info; + } + return info.setOwnerName(ownerName). + setGroupName(groupName). + setMode(new FsPermission(mode)). + setLimit(limit). + setMaxRelativeExpiryMs(maxRelativeExpiryMs); + } + + /** + * Resets statistics related to this CachePool + */ + public void resetStatistics() { + bytesNeeded = 0; + bytesCached = 0; + filesNeeded = 0; + filesCached = 0; + } + + public void addBytesNeeded(long bytes) { + bytesNeeded += bytes; + } + + public void addBytesCached(long bytes) { + bytesCached += bytes; + } + + public void addFilesNeeded(long files) { + filesNeeded += files; + } + + public void addFilesCached(long files) { + filesCached += files; + } + + public long getBytesNeeded() { + return bytesNeeded; + } + + public long getBytesCached() { + return bytesCached; + } + + public long getBytesOverlimit() { + return Math.max(bytesNeeded-limit, 0); + } + + public long getFilesNeeded() { + return filesNeeded; + } + + public long getFilesCached() { + return filesCached; + } + + /** + * Get statistics about this CachePool. + * + * @return Cache pool statistics. + */ + private CachePoolStats getStats() { + return new CachePoolStats.Builder(). + setBytesNeeded(bytesNeeded). + setBytesCached(bytesCached). + setBytesOverlimit(getBytesOverlimit()). + setFilesNeeded(filesNeeded). + setFilesCached(filesCached). + build(); + } + + /** + * Returns a CachePoolInfo describing this CachePool based on the permissions + * of the calling user. Unprivileged users will see only minimal descriptive + * information about the pool. + * + * @param pc Permission checker to be used to validate the user's permissions, + * or null + * @return CachePoolEntry describing this CachePool + */ + public CachePoolEntry getEntry(FSPermissionChecker pc) { + boolean hasPermission = true; + if (pc != null) { + try { + pc.checkPermission(this, FsAction.READ); + } catch (AccessControlException e) { + hasPermission = false; + } + } + return new CachePoolEntry(getInfo(hasPermission), + hasPermission ? getStats() : new CachePoolStats.Builder().build()); + } + + public String toString() { + return new StringBuilder(). + append("{ ").append("poolName:").append(poolName). + append(", ownerName:").append(ownerName). + append(", groupName:").append(groupName). + append(", mode:").append(mode). + append(", limit:").append(limit). + append(", maxRelativeExpiryMs:").append(maxRelativeExpiryMs). + append(" }").toString(); + } + + public DirectiveList getDirectiveList() { + return directiveList; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachedBlock.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachedBlock.java new file mode 100644 index 00000000000..9584ea7100f --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/CachedBlock.java @@ -0,0 +1,251 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.namenode; + +import java.util.Arrays; +import java.util.LinkedList; +import java.util.List; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList.Type; +import org.apache.hadoop.util.IntrusiveCollection; +import org.apache.hadoop.util.LightWeightGSet; +import org.apache.hadoop.util.IntrusiveCollection.Element; +import org.apache.hadoop.util.LightWeightGSet.LinkedElement; + +/** + * Represents a cached block. + */ +@InterfaceAudience.LimitedPrivate({"HDFS"}) +public final class CachedBlock implements Element, + LightWeightGSet.LinkedElement { + private static final Object[] EMPTY_ARRAY = new Object[0]; + + /** + * Block id. + */ + private final long blockId; + + /** + * Used to implement #{LightWeightGSet.LinkedElement} + */ + private LinkedElement nextElement; + + /** + * Bit 15: Mark + * Bit 0-14: cache replication factor. + */ + private short replicationAndMark; + + /** + * Used to implement the CachedBlocksList. + * + * Since this CachedBlock can be in multiple CachedBlocksList objects, + * we need to be able to store multiple 'prev' and 'next' pointers. + * The triplets array does this. + * + * Each triplet contains a CachedBlockList object followed by a + * prev pointer, followed by a next pointer. + */ + private Object[] triplets; + + public CachedBlock(long blockId, short replication, boolean mark) { + this.blockId = blockId; + this.triplets = EMPTY_ARRAY; + setReplicationAndMark(replication, mark); + } + + public long getBlockId() { + return blockId; + } + + @Override + public int hashCode() { + return (int)(blockId^(blockId>>>32)); + } + + @Override + public boolean equals(Object o) { + if (o == null) { return false; } + if (o == this) { return true; } + if (o.getClass() != this.getClass()) { + return false; + } + CachedBlock other = (CachedBlock)o; + return other.blockId == blockId; + } + + public void setReplicationAndMark(short replication, boolean mark) { + assert replication >= 0; + replicationAndMark = (short)((replication << 1) | (mark ? 0x1 : 0x0)); + } + + public boolean getMark() { + return ((replicationAndMark & 0x1) != 0); + } + + public short getReplication() { + return (short) (replicationAndMark >>> 1); + } + + /** + * Return true if this CachedBlock is present on the given list. + */ + public boolean isPresent(CachedBlocksList cachedBlocksList) { + for (int i = 0; i < triplets.length; i += 3) { + CachedBlocksList list = (CachedBlocksList)triplets[i]; + if (list == cachedBlocksList) { + return true; + } + } + return false; + } + + /** + * Get a list of the datanodes which this block is cached, + * planned to be cached, or planned to be uncached on. + * + * @param type If null, this parameter is ignored. + * If it is non-null, we match only datanodes which + * have it on this list. + * See {@link DatanodeDescriptor#CachedBlocksList#Type} + * for a description of all the lists. + * + * @return The list of datanodes. Modifying this list does not + * alter the state of the CachedBlock. + */ + public List getDatanodes(Type type) { + List nodes = new LinkedList(); + for (int i = 0; i < triplets.length; i += 3) { + CachedBlocksList list = (CachedBlocksList)triplets[i]; + if ((type == null) || (list.getType() == type)) { + nodes.add(list.getDatanode()); + } + } + return nodes; + } + + @Override + public void insertInternal(IntrusiveCollection list, Element prev, + Element next) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + throw new RuntimeException("Trying to re-insert an element that " + + "is already in the list."); + } + } + Object newTriplets[] = Arrays.copyOf(triplets, triplets.length + 3); + newTriplets[triplets.length] = list; + newTriplets[triplets.length + 1] = prev; + newTriplets[triplets.length + 2] = next; + triplets = newTriplets; + } + + @Override + public void setPrev(IntrusiveCollection list, Element prev) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + triplets[i + 1] = prev; + return; + } + } + throw new RuntimeException("Called setPrev on an element that wasn't " + + "in the list."); + } + + @Override + public void setNext(IntrusiveCollection list, Element next) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + triplets[i + 2] = next; + return; + } + } + throw new RuntimeException("Called setNext on an element that wasn't " + + "in the list."); + } + + @Override + public void removeInternal(IntrusiveCollection list) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + Object[] newTriplets = new Object[triplets.length - 3]; + System.arraycopy(triplets, 0, newTriplets, 0, i); + System.arraycopy(triplets, i + 3, newTriplets, i, + triplets.length - (i + 3)); + triplets = newTriplets; + return; + } + } + throw new RuntimeException("Called remove on an element that wasn't " + + "in the list."); + } + + @Override + public Element getPrev(IntrusiveCollection list) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + return (Element)triplets[i + 1]; + } + } + throw new RuntimeException("Called getPrev on an element that wasn't " + + "in the list."); + } + + @Override + public Element getNext(IntrusiveCollection list) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + return (Element)triplets[i + 2]; + } + } + throw new RuntimeException("Called getNext on an element that wasn't " + + "in the list."); + } + + @Override + public boolean isInList(IntrusiveCollection list) { + for (int i = 0; i < triplets.length; i += 3) { + if (triplets[i] == list) { + return true; + } + } + return false; + } + + @Override + public String toString() { + return new StringBuilder().append("{"). + append("blockId=").append(blockId).append(", "). + append("replication=").append(getReplication()).append(", "). + append("mark=").append(getMark()).append("}"). + toString(); + } + + @Override // LightWeightGSet.LinkedElement + public void setNext(LinkedElement next) { + this.nextElement = next; + } + + @Override // LightWeightGSet.LinkedElement + public LinkedElement getNext() { + return nextElement; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirectory.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirectory.java index 6439388a545..04edeab7977 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirectory.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSDirectory.java @@ -53,6 +53,7 @@ import org.apache.hadoop.hdfs.protocol.FSLimitException.PathComponentTooLongExce import org.apache.hadoop.hdfs.protocol.HdfsConstants; import org.apache.hadoop.hdfs.protocol.HdfsFileStatus; import org.apache.hadoop.hdfs.protocol.HdfsLocatedFileStatus; +import org.apache.hadoop.hdfs.protocol.LocatedBlock; import org.apache.hadoop.hdfs.protocol.LocatedBlocks; import org.apache.hadoop.hdfs.protocol.QuotaExceededException; import org.apache.hadoop.hdfs.protocol.SnapshotAccessControlException; @@ -2641,12 +2642,21 @@ public class FSDirectory implements Closeable { int childrenNum = node.isDirectory() ? node.asDirectory().getChildrenNum(snapshot) : 0; - return new HdfsLocatedFileStatus(size, node.isDirectory(), replication, - blocksize, node.getModificationTime(snapshot), - node.getAccessTime(snapshot), node.getFsPermission(snapshot), - node.getUserName(snapshot), node.getGroupName(snapshot), - node.isSymlink() ? node.asSymlink().getSymlink() : null, path, - node.getId(), loc, childrenNum); + HdfsLocatedFileStatus status = + new HdfsLocatedFileStatus(size, node.isDirectory(), replication, + blocksize, node.getModificationTime(snapshot), + node.getAccessTime(snapshot), node.getFsPermission(snapshot), + node.getUserName(snapshot), node.getGroupName(snapshot), + node.isSymlink() ? node.asSymlink().getSymlink() : null, path, + node.getId(), loc, childrenNum); + // Set caching information for the located blocks. + if (loc != null) { + CacheManager cacheManager = namesystem.getCacheManager(); + for (LocatedBlock lb: loc.getLocatedBlocks()) { + cacheManager.setCachedLocations(lb); + } + } + return status; } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLog.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLog.java index 5391930ba14..1db2be40368 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLog.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLog.java @@ -17,6 +17,7 @@ */ package org.apache.hadoop.hdfs.server.namenode; +import static org.apache.hadoop.util.ExitUtil.terminate; import static org.apache.hadoop.util.Time.now; import java.net.URI; @@ -34,17 +35,19 @@ import org.apache.hadoop.classification.InterfaceStability; import org.apache.hadoop.fs.Options; import org.apache.hadoop.fs.permission.FsPermission; import org.apache.hadoop.hdfs.DFSConfigKeys; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; import org.apache.hadoop.hdfs.protocol.HdfsConstants; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; import org.apache.hadoop.hdfs.security.token.delegation.DelegationTokenIdentifier; -import static org.apache.hadoop.util.ExitUtil.terminate; - import org.apache.hadoop.hdfs.server.blockmanagement.BlockInfo; import org.apache.hadoop.hdfs.server.common.HdfsServerConstants.NamenodeRole; import org.apache.hadoop.hdfs.server.common.Storage.FormatConfirmable; import org.apache.hadoop.hdfs.server.common.Storage.StorageDirectory; -import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddBlockOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddCachePoolOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddBlockOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddCacheDirectiveInfoOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AllocateBlockIdOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AllowSnapshotOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.CancelDelegationTokenOp; @@ -57,12 +60,18 @@ import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.DisallowSnapshotOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.GetDelegationTokenOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.LogSegmentOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.MkdirOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.ModifyCacheDirectiveInfoOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.ModifyCachePoolOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.OpInstanceCache; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.ReassignLeaseOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RemoveCachePoolOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RemoveCacheDirectiveInfoOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenameOldOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenameOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenameSnapshotOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenewDelegationTokenOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetGenstampV1Op; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetGenstampV2Op; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetOwnerOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetPermissionsOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetQuotaOp; @@ -71,8 +80,6 @@ import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SymlinkOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.TimesOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.UpdateBlocksOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.UpdateMasterKeyOp; -import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetGenstampV1Op; -import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.SetGenstampV2Op; import org.apache.hadoop.hdfs.server.namenode.JournalSet.JournalAndStream; import org.apache.hadoop.hdfs.server.namenode.metrics.NameNodeMetrics; import org.apache.hadoop.hdfs.server.protocol.NamenodeRegistration; @@ -955,7 +962,57 @@ public class FSEditLog implements LogsPurgeable { .setSnapshotRoot(path); logEdit(op); } - + + /** + * Log a CacheDirectiveInfo returned from + * {@link CacheManager#addDirective(CacheDirectiveInfo, FSPermissionChecker)} + */ + void logAddCacheDirectiveInfo(CacheDirectiveInfo directive, + boolean toLogRpcIds) { + AddCacheDirectiveInfoOp op = + AddCacheDirectiveInfoOp.getInstance(cache.get()) + .setDirective(directive); + logRpcIds(op, toLogRpcIds); + logEdit(op); + } + + void logModifyCacheDirectiveInfo( + CacheDirectiveInfo directive, boolean toLogRpcIds) { + ModifyCacheDirectiveInfoOp op = + ModifyCacheDirectiveInfoOp.getInstance( + cache.get()).setDirective(directive); + logRpcIds(op, toLogRpcIds); + logEdit(op); + } + + void logRemoveCacheDirectiveInfo(Long id, boolean toLogRpcIds) { + RemoveCacheDirectiveInfoOp op = + RemoveCacheDirectiveInfoOp.getInstance(cache.get()).setId(id); + logRpcIds(op, toLogRpcIds); + logEdit(op); + } + + void logAddCachePool(CachePoolInfo pool, boolean toLogRpcIds) { + AddCachePoolOp op = + AddCachePoolOp.getInstance(cache.get()).setPool(pool); + logRpcIds(op, toLogRpcIds); + logEdit(op); + } + + void logModifyCachePool(CachePoolInfo info, boolean toLogRpcIds) { + ModifyCachePoolOp op = + ModifyCachePoolOp.getInstance(cache.get()).setInfo(info); + logRpcIds(op, toLogRpcIds); + logEdit(op); + } + + void logRemoveCachePool(String poolName, boolean toLogRpcIds) { + RemoveCachePoolOp op = + RemoveCachePoolOp.getInstance(cache.get()).setPoolName(poolName); + logRpcIds(op, toLogRpcIds); + logEdit(op); + } + /** * Get all the journals this edit log is currently operating on. */ diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogLoader.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogLoader.java index 4ec1b4a2634..e24d62fc5c5 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogLoader.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogLoader.java @@ -24,6 +24,7 @@ import java.io.IOException; import java.io.InputStream; import java.util.Arrays; import java.util.EnumMap; +import java.util.EnumSet; import java.util.List; import org.apache.commons.logging.Log; @@ -31,17 +32,21 @@ import org.apache.commons.logging.LogFactory; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.classification.InterfaceStability; import org.apache.hadoop.fs.FileSystem; +import org.apache.hadoop.fs.Path; import org.apache.hadoop.hdfs.protocol.Block; import org.apache.hadoop.hdfs.protocol.HdfsConstants; import org.apache.hadoop.hdfs.protocol.HdfsFileStatus; import org.apache.hadoop.hdfs.protocol.LayoutVersion; import org.apache.hadoop.hdfs.protocol.LayoutVersion.Feature; import org.apache.hadoop.hdfs.protocol.LocatedBlock; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; import org.apache.hadoop.hdfs.server.blockmanagement.BlockInfo; import org.apache.hadoop.hdfs.server.blockmanagement.BlockInfoUnderConstruction; import org.apache.hadoop.hdfs.server.common.Storage; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddBlockOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddCachePoolOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddCloseOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AddCacheDirectiveInfoOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AllocateBlockIdOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.AllowSnapshotOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.BlockListUpdatingOp; @@ -54,7 +59,11 @@ import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.DeleteSnapshotOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.DisallowSnapshotOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.GetDelegationTokenOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.MkdirOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.ModifyCachePoolOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.ModifyCacheDirectiveInfoOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.ReassignLeaseOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RemoveCachePoolOp; +import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RemoveCacheDirectiveInfoOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenameOldOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenameOp; import org.apache.hadoop.hdfs.server.namenode.FSEditLogOp.RenameSnapshotOp; @@ -78,6 +87,7 @@ import org.apache.hadoop.hdfs.server.namenode.startupprogress.StartupProgress.Co import org.apache.hadoop.hdfs.server.namenode.startupprogress.Step; import org.apache.hadoop.hdfs.util.ChunkedArrayList; import org.apache.hadoop.hdfs.util.Holder; +import org.apache.jasper.tagplugins.jstl.core.Remove; import com.google.common.base.Joiner; import com.google.common.base.Preconditions; @@ -648,6 +658,59 @@ public class FSEditLogLoader { fsNamesys.setLastAllocatedBlockId(allocateBlockIdOp.blockId); break; } + case OP_ADD_CACHE_DIRECTIVE: { + AddCacheDirectiveInfoOp addOp = (AddCacheDirectiveInfoOp) op; + CacheDirectiveInfo result = fsNamesys. + getCacheManager().addDirectiveFromEditLog(addOp.directive); + if (toAddRetryCache) { + Long id = result.getId(); + fsNamesys.addCacheEntryWithPayload(op.rpcClientId, op.rpcCallId, id); + } + break; + } + case OP_MODIFY_CACHE_DIRECTIVE: { + ModifyCacheDirectiveInfoOp modifyOp = + (ModifyCacheDirectiveInfoOp) op; + fsNamesys.getCacheManager().modifyDirectiveFromEditLog( + modifyOp.directive); + if (toAddRetryCache) { + fsNamesys.addCacheEntry(op.rpcClientId, op.rpcCallId); + } + break; + } + case OP_REMOVE_CACHE_DIRECTIVE: { + RemoveCacheDirectiveInfoOp removeOp = + (RemoveCacheDirectiveInfoOp) op; + fsNamesys.getCacheManager().removeDirective(removeOp.id, null); + if (toAddRetryCache) { + fsNamesys.addCacheEntry(op.rpcClientId, op.rpcCallId); + } + break; + } + case OP_ADD_CACHE_POOL: { + AddCachePoolOp addOp = (AddCachePoolOp) op; + fsNamesys.getCacheManager().addCachePool(addOp.info); + if (toAddRetryCache) { + fsNamesys.addCacheEntry(op.rpcClientId, op.rpcCallId); + } + break; + } + case OP_MODIFY_CACHE_POOL: { + ModifyCachePoolOp modifyOp = (ModifyCachePoolOp) op; + fsNamesys.getCacheManager().modifyCachePool(modifyOp.info); + if (toAddRetryCache) { + fsNamesys.addCacheEntry(op.rpcClientId, op.rpcCallId); + } + break; + } + case OP_REMOVE_CACHE_POOL: { + RemoveCachePoolOp removeOp = (RemoveCachePoolOp) op; + fsNamesys.getCacheManager().removeCachePool(removeOp.poolName); + if (toAddRetryCache) { + fsNamesys.addCacheEntry(op.rpcClientId, op.rpcCallId); + } + break; + } default: throw new IOException("Invalid operation read " + op.opCode); } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOp.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOp.java index 2d01b3ead35..1f17841c2fe 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOp.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOp.java @@ -19,6 +19,8 @@ package org.apache.hadoop.hdfs.server.namenode; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_ADD; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_ADD_BLOCK; +import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_ADD_CACHE_DIRECTIVE; +import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_ADD_CACHE_POOL; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_ALLOCATE_BLOCK_ID; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_ALLOW_SNAPSHOT; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_CANCEL_DELEGATION_TOKEN; @@ -33,7 +35,11 @@ import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_END_LOG import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_GET_DELEGATION_TOKEN; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_INVALID; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_MKDIR; +import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_MODIFY_CACHE_DIRECTIVE; +import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_MODIFY_CACHE_POOL; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_REASSIGN_LEASE; +import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_REMOVE_CACHE_DIRECTIVE; +import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_REMOVE_CACHE_POOL; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_RENAME; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_RENAME_OLD; import static org.apache.hadoop.hdfs.server.namenode.FSEditLogOpCodes.OP_RENAME_SNAPSHOT; @@ -57,6 +63,7 @@ import java.io.DataOutput; import java.io.DataOutputStream; import java.io.EOFException; import java.io.IOException; +import java.util.ArrayList; import java.util.Arrays; import java.util.EnumMap; import java.util.List; @@ -74,6 +81,8 @@ import org.apache.hadoop.fs.permission.PermissionStatus; import org.apache.hadoop.hdfs.DFSConfigKeys; import org.apache.hadoop.hdfs.DeprecatedUTF8; import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; import org.apache.hadoop.hdfs.protocol.ClientProtocol; import org.apache.hadoop.hdfs.protocol.HdfsConstants; import org.apache.hadoop.hdfs.protocol.LayoutVersion; @@ -98,6 +107,7 @@ import org.xml.sax.ContentHandler; import org.xml.sax.SAXException; import org.xml.sax.helpers.AttributesImpl; +import com.google.common.base.Joiner; import com.google.common.base.Preconditions; /** @@ -151,6 +161,15 @@ public abstract class FSEditLogOp { inst.put(OP_SET_GENSTAMP_V2, new SetGenstampV2Op()); inst.put(OP_ALLOCATE_BLOCK_ID, new AllocateBlockIdOp()); inst.put(OP_ADD_BLOCK, new AddBlockOp()); + inst.put(OP_ADD_CACHE_DIRECTIVE, + new AddCacheDirectiveInfoOp()); + inst.put(OP_MODIFY_CACHE_DIRECTIVE, + new ModifyCacheDirectiveInfoOp()); + inst.put(OP_REMOVE_CACHE_DIRECTIVE, + new RemoveCacheDirectiveInfoOp()); + inst.put(OP_ADD_CACHE_POOL, new AddCachePoolOp()); + inst.put(OP_MODIFY_CACHE_POOL, new ModifyCachePoolOp()); + inst.put(OP_REMOVE_CACHE_POOL, new RemoveCachePoolOp()); } public FSEditLogOp get(FSEditLogOpCodes opcode) { @@ -525,8 +544,7 @@ public abstract class FSEditLogOp { } else { this.blocks = new Block[0]; } - this.permissions = - permissionStatusFromXml(st.getChildren("PERMISSION_STATUS").get(0)); + this.permissions = permissionStatusFromXml(st); readRpcIdsFromXml(st); } } @@ -1307,8 +1325,7 @@ public abstract class FSEditLogOp { this.inodeId = Long.valueOf(st.getValue("INODEID")); this.path = st.getValue("PATH"); this.timestamp = Long.valueOf(st.getValue("TIMESTAMP")); - this.permissions = - permissionStatusFromXml(st.getChildren("PERMISSION_STATUS").get(0)); + this.permissions = permissionStatusFromXml(st); } } @@ -2039,8 +2056,7 @@ public abstract class FSEditLogOp { this.value = st.getValue("VALUE"); this.mtime = Long.valueOf(st.getValue("MTIME")); this.atime = Long.valueOf(st.getValue("ATIME")); - this.permissionStatus = - permissionStatusFromXml(st.getChildren("PERMISSION_STATUS").get(0)); + this.permissionStatus = permissionStatusFromXml(st); readRpcIdsFromXml(st); } @@ -2947,6 +2963,381 @@ public abstract class FSEditLogOp { } } + /** + * {@literal @AtMostOnce} for + * {@link ClientProtocol#addCacheDirective} + */ + static class AddCacheDirectiveInfoOp extends FSEditLogOp { + CacheDirectiveInfo directive; + + public AddCacheDirectiveInfoOp() { + super(OP_ADD_CACHE_DIRECTIVE); + } + + static AddCacheDirectiveInfoOp getInstance(OpInstanceCache cache) { + return (AddCacheDirectiveInfoOp) cache + .get(OP_ADD_CACHE_DIRECTIVE); + } + + public AddCacheDirectiveInfoOp setDirective( + CacheDirectiveInfo directive) { + this.directive = directive; + assert(directive.getId() != null); + assert(directive.getPath() != null); + assert(directive.getReplication() != null); + assert(directive.getPool() != null); + assert(directive.getExpiration() != null); + return this; + } + + @Override + void readFields(DataInputStream in, int logVersion) throws IOException { + directive = FSImageSerialization.readCacheDirectiveInfo(in); + readRpcIds(in, logVersion); + } + + @Override + public void writeFields(DataOutputStream out) throws IOException { + FSImageSerialization.writeCacheDirectiveInfo(out, directive); + writeRpcIds(rpcClientId, rpcCallId, out); + } + + @Override + protected void toXml(ContentHandler contentHandler) throws SAXException { + FSImageSerialization.writeCacheDirectiveInfo(contentHandler, directive); + appendRpcIdsToXml(contentHandler, rpcClientId, rpcCallId); + } + + @Override + void fromXml(Stanza st) throws InvalidXmlException { + directive = FSImageSerialization.readCacheDirectiveInfo(st); + readRpcIdsFromXml(st); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("AddCacheDirectiveInfo ["); + builder.append("id=" + directive.getId() + ","); + builder.append("path=" + directive.getPath().toUri().getPath() + ","); + builder.append("replication=" + directive.getReplication() + ","); + builder.append("pool=" + directive.getPool() + ","); + builder.append("expiration=" + directive.getExpiration().getMillis()); + appendRpcIdsToString(builder, rpcClientId, rpcCallId); + builder.append("]"); + return builder.toString(); + } + } + + /** + * {@literal @AtMostOnce} for + * {@link ClientProtocol#modifyCacheDirective} + */ + static class ModifyCacheDirectiveInfoOp extends FSEditLogOp { + CacheDirectiveInfo directive; + + public ModifyCacheDirectiveInfoOp() { + super(OP_MODIFY_CACHE_DIRECTIVE); + } + + static ModifyCacheDirectiveInfoOp getInstance(OpInstanceCache cache) { + return (ModifyCacheDirectiveInfoOp) cache + .get(OP_MODIFY_CACHE_DIRECTIVE); + } + + public ModifyCacheDirectiveInfoOp setDirective( + CacheDirectiveInfo directive) { + this.directive = directive; + assert(directive.getId() != null); + return this; + } + + @Override + void readFields(DataInputStream in, int logVersion) throws IOException { + this.directive = FSImageSerialization.readCacheDirectiveInfo(in); + readRpcIds(in, logVersion); + } + + @Override + public void writeFields(DataOutputStream out) throws IOException { + FSImageSerialization.writeCacheDirectiveInfo(out, directive); + writeRpcIds(rpcClientId, rpcCallId, out); + } + + @Override + protected void toXml(ContentHandler contentHandler) throws SAXException { + FSImageSerialization.writeCacheDirectiveInfo(contentHandler, directive); + appendRpcIdsToXml(contentHandler, rpcClientId, rpcCallId); + } + + @Override + void fromXml(Stanza st) throws InvalidXmlException { + this.directive = FSImageSerialization.readCacheDirectiveInfo(st); + readRpcIdsFromXml(st); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("ModifyCacheDirectiveInfoOp["); + builder.append("id=").append(directive.getId()); + if (directive.getPath() != null) { + builder.append(",").append("path=").append(directive.getPath()); + } + if (directive.getReplication() != null) { + builder.append(",").append("replication="). + append(directive.getReplication()); + } + if (directive.getPool() != null) { + builder.append(",").append("pool=").append(directive.getPool()); + } + if (directive.getExpiration() != null) { + builder.append(",").append("expiration="). + append(directive.getExpiration().getMillis()); + } + appendRpcIdsToString(builder, rpcClientId, rpcCallId); + builder.append("]"); + return builder.toString(); + } + } + + /** + * {@literal @AtMostOnce} for + * {@link ClientProtocol#removeCacheDirective} + */ + static class RemoveCacheDirectiveInfoOp extends FSEditLogOp { + long id; + + public RemoveCacheDirectiveInfoOp() { + super(OP_REMOVE_CACHE_DIRECTIVE); + } + + static RemoveCacheDirectiveInfoOp getInstance(OpInstanceCache cache) { + return (RemoveCacheDirectiveInfoOp) cache + .get(OP_REMOVE_CACHE_DIRECTIVE); + } + + public RemoveCacheDirectiveInfoOp setId(long id) { + this.id = id; + return this; + } + + @Override + void readFields(DataInputStream in, int logVersion) throws IOException { + this.id = FSImageSerialization.readLong(in); + readRpcIds(in, logVersion); + } + + @Override + public void writeFields(DataOutputStream out) throws IOException { + FSImageSerialization.writeLong(id, out); + writeRpcIds(rpcClientId, rpcCallId, out); + } + + @Override + protected void toXml(ContentHandler contentHandler) throws SAXException { + XMLUtils.addSaxString(contentHandler, "ID", Long.toString(id)); + appendRpcIdsToXml(contentHandler, rpcClientId, rpcCallId); + } + + @Override + void fromXml(Stanza st) throws InvalidXmlException { + this.id = Long.parseLong(st.getValue("ID")); + readRpcIdsFromXml(st); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("RemoveCacheDirectiveInfo ["); + builder.append("id=" + Long.toString(id)); + appendRpcIdsToString(builder, rpcClientId, rpcCallId); + builder.append("]"); + return builder.toString(); + } + } + + /** {@literal @AtMostOnce} for {@link ClientProtocol#addCachePool} */ + static class AddCachePoolOp extends FSEditLogOp { + CachePoolInfo info; + + public AddCachePoolOp() { + super(OP_ADD_CACHE_POOL); + } + + static AddCachePoolOp getInstance(OpInstanceCache cache) { + return (AddCachePoolOp) cache.get(OP_ADD_CACHE_POOL); + } + + public AddCachePoolOp setPool(CachePoolInfo info) { + this.info = info; + assert(info.getPoolName() != null); + assert(info.getOwnerName() != null); + assert(info.getGroupName() != null); + assert(info.getMode() != null); + assert(info.getLimit() != null); + return this; + } + + @Override + void readFields(DataInputStream in, int logVersion) throws IOException { + info = FSImageSerialization.readCachePoolInfo(in); + readRpcIds(in, logVersion); + } + + @Override + public void writeFields(DataOutputStream out) throws IOException { + FSImageSerialization.writeCachePoolInfo(out, info); + writeRpcIds(rpcClientId, rpcCallId, out); + } + + @Override + protected void toXml(ContentHandler contentHandler) throws SAXException { + FSImageSerialization.writeCachePoolInfo(contentHandler, info); + appendRpcIdsToXml(contentHandler, rpcClientId, rpcCallId); + } + + @Override + void fromXml(Stanza st) throws InvalidXmlException { + this.info = FSImageSerialization.readCachePoolInfo(st); + readRpcIdsFromXml(st); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("AddCachePoolOp ["); + builder.append("poolName=" + info.getPoolName() + ","); + builder.append("ownerName=" + info.getOwnerName() + ","); + builder.append("groupName=" + info.getGroupName() + ","); + builder.append("mode=" + Short.toString(info.getMode().toShort()) + ","); + builder.append("limit=" + Long.toString(info.getLimit())); + appendRpcIdsToString(builder, rpcClientId, rpcCallId); + builder.append("]"); + return builder.toString(); + } + } + + /** {@literal @AtMostOnce} for {@link ClientProtocol#modifyCachePool} */ + static class ModifyCachePoolOp extends FSEditLogOp { + CachePoolInfo info; + + public ModifyCachePoolOp() { + super(OP_MODIFY_CACHE_POOL); + } + + static ModifyCachePoolOp getInstance(OpInstanceCache cache) { + return (ModifyCachePoolOp) cache.get(OP_MODIFY_CACHE_POOL); + } + + public ModifyCachePoolOp setInfo(CachePoolInfo info) { + this.info = info; + return this; + } + + @Override + void readFields(DataInputStream in, int logVersion) throws IOException { + info = FSImageSerialization.readCachePoolInfo(in); + readRpcIds(in, logVersion); + } + + @Override + public void writeFields(DataOutputStream out) throws IOException { + FSImageSerialization.writeCachePoolInfo(out, info); + writeRpcIds(rpcClientId, rpcCallId, out); + } + + @Override + protected void toXml(ContentHandler contentHandler) throws SAXException { + FSImageSerialization.writeCachePoolInfo(contentHandler, info); + appendRpcIdsToXml(contentHandler, rpcClientId, rpcCallId); + } + + @Override + void fromXml(Stanza st) throws InvalidXmlException { + this.info = FSImageSerialization.readCachePoolInfo(st); + readRpcIdsFromXml(st); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("ModifyCachePoolOp ["); + ArrayList fields = new ArrayList(5); + if (info.getPoolName() != null) { + fields.add("poolName=" + info.getPoolName()); + } + if (info.getOwnerName() != null) { + fields.add("ownerName=" + info.getOwnerName()); + } + if (info.getGroupName() != null) { + fields.add("groupName=" + info.getGroupName()); + } + if (info.getMode() != null) { + fields.add("mode=" + info.getMode().toString()); + } + if (info.getLimit() != null) { + fields.add("limit=" + info.getLimit()); + } + builder.append(Joiner.on(",").join(fields)); + appendRpcIdsToString(builder, rpcClientId, rpcCallId); + builder.append("]"); + return builder.toString(); + } + } + + /** {@literal @AtMostOnce} for {@link ClientProtocol#removeCachePool} */ + static class RemoveCachePoolOp extends FSEditLogOp { + String poolName; + + public RemoveCachePoolOp() { + super(OP_REMOVE_CACHE_POOL); + } + + static RemoveCachePoolOp getInstance(OpInstanceCache cache) { + return (RemoveCachePoolOp) cache.get(OP_REMOVE_CACHE_POOL); + } + + public RemoveCachePoolOp setPoolName(String poolName) { + this.poolName = poolName; + return this; + } + + @Override + void readFields(DataInputStream in, int logVersion) throws IOException { + poolName = FSImageSerialization.readString(in); + readRpcIds(in, logVersion); + } + + @Override + public void writeFields(DataOutputStream out) throws IOException { + FSImageSerialization.writeString(poolName, out); + writeRpcIds(rpcClientId, rpcCallId, out); + } + + @Override + protected void toXml(ContentHandler contentHandler) throws SAXException { + XMLUtils.addSaxString(contentHandler, "POOLNAME", poolName); + appendRpcIdsToXml(contentHandler, rpcClientId, rpcCallId); + } + + @Override + void fromXml(Stanza st) throws InvalidXmlException { + this.poolName = st.getValue("POOLNAME"); + readRpcIdsFromXml(st); + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + builder.append("RemoveCachePoolOp ["); + builder.append("poolName=" + poolName); + appendRpcIdsToString(builder, rpcClientId, rpcCallId); + builder.append("]"); + return builder.toString(); + } + } + static private short readShort(DataInputStream in) throws IOException { return Short.parseShort(FSImageSerialization.readString(in)); } @@ -3332,16 +3723,28 @@ public abstract class FSEditLogOp { contentHandler.startElement("", "", "PERMISSION_STATUS", new AttributesImpl()); XMLUtils.addSaxString(contentHandler, "USERNAME", perm.getUserName()); XMLUtils.addSaxString(contentHandler, "GROUPNAME", perm.getGroupName()); - XMLUtils.addSaxString(contentHandler, "MODE", - Short.valueOf(perm.getPermission().toShort()).toString()); + fsPermissionToXml(contentHandler, perm.getPermission()); contentHandler.endElement("", "", "PERMISSION_STATUS"); } public static PermissionStatus permissionStatusFromXml(Stanza st) throws InvalidXmlException { - String username = st.getValue("USERNAME"); - String groupname = st.getValue("GROUPNAME"); + Stanza status = st.getChildren("PERMISSION_STATUS").get(0); + String username = status.getValue("USERNAME"); + String groupname = status.getValue("GROUPNAME"); + FsPermission mode = fsPermissionFromXml(status); + return new PermissionStatus(username, groupname, mode); + } + + public static void fsPermissionToXml(ContentHandler contentHandler, + FsPermission mode) throws SAXException { + XMLUtils.addSaxString(contentHandler, "MODE", Short.valueOf(mode.toShort()) + .toString()); + } + + public static FsPermission fsPermissionFromXml(Stanza st) + throws InvalidXmlException { short mode = Short.valueOf(st.getValue("MODE")); - return new PermissionStatus(username, groupname, new FsPermission(mode)); + return new FsPermission(mode); } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOpCodes.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOpCodes.java index 9b3c77d32c4..0f4969564d6 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOpCodes.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSEditLogOpCodes.java @@ -61,6 +61,12 @@ public enum FSEditLogOpCodes { OP_SET_GENSTAMP_V2 ((byte) 31), OP_ALLOCATE_BLOCK_ID ((byte) 32), OP_ADD_BLOCK ((byte) 33), + OP_ADD_CACHE_DIRECTIVE ((byte) 34), + OP_REMOVE_CACHE_DIRECTIVE ((byte) 35), + OP_ADD_CACHE_POOL ((byte) 36), + OP_MODIFY_CACHE_POOL ((byte) 37), + OP_REMOVE_CACHE_POOL ((byte) 38), + OP_MODIFY_CACHE_DIRECTIVE ((byte) 39), // Note that fromByte(..) depends on OP_INVALID being at the last position. OP_INVALID ((byte) -1); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageFormat.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageFormat.java index c4e93bf04e4..b4b83bc0fdb 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageFormat.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageFormat.java @@ -358,6 +358,8 @@ public class FSImageFormat { loadSecretManagerState(in); + loadCacheManagerState(in); + // make sure to read to the end of file boolean eof = (in.read() == -1); assert eof : "Should have reached the end of image file " + curFile; @@ -897,6 +899,14 @@ public class FSImageFormat { namesystem.loadSecretManagerState(in); } + private void loadCacheManagerState(DataInput in) throws IOException { + int imgVersion = getLayoutVersion(); + if (!LayoutVersion.supports(Feature.CACHING, imgVersion)) { + return; + } + namesystem.getCacheManager().loadState(in); + } + private int getLayoutVersion() { return namesystem.getFSImage().getStorage().getLayoutVersion(); } @@ -1051,6 +1061,8 @@ public class FSImageFormat { context.checkCancelled(); sourceNamesystem.saveSecretManagerState(out, sdPath); context.checkCancelled(); + sourceNamesystem.getCacheManager().saveState(out, sdPath); + context.checkCancelled(); out.flush(); context.checkCancelled(); fout.getChannel().force(true); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageSerialization.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageSerialization.java index 51ab61b2171..e27a2f1df44 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageSerialization.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSImageSerialization.java @@ -30,6 +30,8 @@ import org.apache.hadoop.fs.permission.PermissionStatus; import org.apache.hadoop.hdfs.DFSUtil; import org.apache.hadoop.hdfs.DeprecatedUTF8; import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; import org.apache.hadoop.hdfs.protocol.LayoutVersion; import org.apache.hadoop.hdfs.protocol.LayoutVersion.Feature; import org.apache.hadoop.hdfs.server.blockmanagement.BlockInfo; @@ -39,11 +41,16 @@ import org.apache.hadoop.hdfs.server.namenode.snapshot.INodeDirectorySnapshottab import org.apache.hadoop.hdfs.server.namenode.snapshot.INodeDirectoryWithSnapshot; import org.apache.hadoop.hdfs.server.namenode.snapshot.SnapshotFSImageFormat; import org.apache.hadoop.hdfs.server.namenode.snapshot.SnapshotFSImageFormat.ReferenceMap; +import org.apache.hadoop.hdfs.util.XMLUtils; +import org.apache.hadoop.hdfs.util.XMLUtils.InvalidXmlException; +import org.apache.hadoop.hdfs.util.XMLUtils.Stanza; import org.apache.hadoop.io.IntWritable; import org.apache.hadoop.io.LongWritable; import org.apache.hadoop.io.ShortWritable; import org.apache.hadoop.io.Text; import org.apache.hadoop.io.WritableUtils; +import org.xml.sax.ContentHandler; +import org.xml.sax.SAXException; import com.google.common.base.Preconditions; @@ -480,4 +487,221 @@ public class FSImageSerialization { } return ret; } + + public static void writeCacheDirectiveInfo(DataOutputStream out, + CacheDirectiveInfo directive) throws IOException { + writeLong(directive.getId(), out); + int flags = + ((directive.getPath() != null) ? 0x1 : 0) | + ((directive.getReplication() != null) ? 0x2 : 0) | + ((directive.getPool() != null) ? 0x4 : 0) | + ((directive.getExpiration() != null) ? 0x8 : 0); + out.writeInt(flags); + if (directive.getPath() != null) { + writeString(directive.getPath().toUri().getPath(), out); + } + if (directive.getReplication() != null) { + writeShort(directive.getReplication(), out); + } + if (directive.getPool() != null) { + writeString(directive.getPool(), out); + } + if (directive.getExpiration() != null) { + writeLong(directive.getExpiration().getMillis(), out); + } + } + + public static CacheDirectiveInfo readCacheDirectiveInfo(DataInput in) + throws IOException { + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(); + builder.setId(readLong(in)); + int flags = in.readInt(); + if ((flags & 0x1) != 0) { + builder.setPath(new Path(readString(in))); + } + if ((flags & 0x2) != 0) { + builder.setReplication(readShort(in)); + } + if ((flags & 0x4) != 0) { + builder.setPool(readString(in)); + } + if ((flags & 0x8) != 0) { + builder.setExpiration( + CacheDirectiveInfo.Expiration.newAbsolute(readLong(in))); + } + if ((flags & ~0xF) != 0) { + throw new IOException("unknown flags set in " + + "ModifyCacheDirectiveInfoOp: " + flags); + } + return builder.build(); + } + + public static CacheDirectiveInfo readCacheDirectiveInfo(Stanza st) + throws InvalidXmlException { + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(); + builder.setId(Long.parseLong(st.getValue("ID"))); + String path = st.getValueOrNull("PATH"); + if (path != null) { + builder.setPath(new Path(path)); + } + String replicationString = st.getValueOrNull("REPLICATION"); + if (replicationString != null) { + builder.setReplication(Short.parseShort(replicationString)); + } + String pool = st.getValueOrNull("POOL"); + if (pool != null) { + builder.setPool(pool); + } + String expiryTime = st.getValueOrNull("EXPIRATION"); + if (expiryTime != null) { + builder.setExpiration(CacheDirectiveInfo.Expiration.newAbsolute( + Long.parseLong(expiryTime))); + } + return builder.build(); + } + + public static void writeCacheDirectiveInfo(ContentHandler contentHandler, + CacheDirectiveInfo directive) throws SAXException { + XMLUtils.addSaxString(contentHandler, "ID", + Long.toString(directive.getId())); + if (directive.getPath() != null) { + XMLUtils.addSaxString(contentHandler, "PATH", + directive.getPath().toUri().getPath()); + } + if (directive.getReplication() != null) { + XMLUtils.addSaxString(contentHandler, "REPLICATION", + Short.toString(directive.getReplication())); + } + if (directive.getPool() != null) { + XMLUtils.addSaxString(contentHandler, "POOL", directive.getPool()); + } + if (directive.getExpiration() != null) { + XMLUtils.addSaxString(contentHandler, "EXPIRATION", + "" + directive.getExpiration().getMillis()); + } + } + + public static void writeCachePoolInfo(DataOutputStream out, CachePoolInfo info) + throws IOException { + writeString(info.getPoolName(), out); + + final String ownerName = info.getOwnerName(); + final String groupName = info.getGroupName(); + final Long limit = info.getLimit(); + final FsPermission mode = info.getMode(); + final Long maxRelativeExpiry = info.getMaxRelativeExpiryMs(); + + boolean hasOwner, hasGroup, hasMode, hasLimit, hasMaxRelativeExpiry; + hasOwner = ownerName != null; + hasGroup = groupName != null; + hasMode = mode != null; + hasLimit = limit != null; + hasMaxRelativeExpiry = maxRelativeExpiry != null; + + int flags = + (hasOwner ? 0x1 : 0) | + (hasGroup ? 0x2 : 0) | + (hasMode ? 0x4 : 0) | + (hasLimit ? 0x8 : 0) | + (hasMaxRelativeExpiry ? 0x10 : 0); + + writeInt(flags, out); + + if (hasOwner) { + writeString(ownerName, out); + } + if (hasGroup) { + writeString(groupName, out); + } + if (hasMode) { + mode.write(out); + } + if (hasLimit) { + writeLong(limit, out); + } + if (hasMaxRelativeExpiry) { + writeLong(maxRelativeExpiry, out); + } + } + + public static CachePoolInfo readCachePoolInfo(DataInput in) + throws IOException { + String poolName = readString(in); + CachePoolInfo info = new CachePoolInfo(poolName); + int flags = readInt(in); + if ((flags & 0x1) != 0) { + info.setOwnerName(readString(in)); + } + if ((flags & 0x2) != 0) { + info.setGroupName(readString(in)); + } + if ((flags & 0x4) != 0) { + info.setMode(FsPermission.read(in)); + } + if ((flags & 0x8) != 0) { + info.setLimit(readLong(in)); + } + if ((flags & 0x10) != 0) { + info.setMaxRelativeExpiryMs(readLong(in)); + } + if ((flags & ~0x1F) != 0) { + throw new IOException("Unknown flag in CachePoolInfo: " + flags); + } + return info; + } + + public static void writeCachePoolInfo(ContentHandler contentHandler, + CachePoolInfo info) throws SAXException { + XMLUtils.addSaxString(contentHandler, "POOLNAME", info.getPoolName()); + + final String ownerName = info.getOwnerName(); + final String groupName = info.getGroupName(); + final Long limit = info.getLimit(); + final FsPermission mode = info.getMode(); + final Long maxRelativeExpiry = info.getMaxRelativeExpiryMs(); + + if (ownerName != null) { + XMLUtils.addSaxString(contentHandler, "OWNERNAME", ownerName); + } + if (groupName != null) { + XMLUtils.addSaxString(contentHandler, "GROUPNAME", groupName); + } + if (mode != null) { + FSEditLogOp.fsPermissionToXml(contentHandler, mode); + } + if (limit != null) { + XMLUtils.addSaxString(contentHandler, "LIMIT", + Long.toString(limit)); + } + if (maxRelativeExpiry != null) { + XMLUtils.addSaxString(contentHandler, "MAXRELATIVEEXPIRY", + Long.toString(maxRelativeExpiry)); + } + } + + public static CachePoolInfo readCachePoolInfo(Stanza st) + throws InvalidXmlException { + String poolName = st.getValue("POOLNAME"); + CachePoolInfo info = new CachePoolInfo(poolName); + if (st.hasChildren("OWNERNAME")) { + info.setOwnerName(st.getValue("OWNERNAME")); + } + if (st.hasChildren("GROUPNAME")) { + info.setGroupName(st.getValue("GROUPNAME")); + } + if (st.hasChildren("MODE")) { + info.setMode(FSEditLogOp.fsPermissionFromXml(st)); + } + if (st.hasChildren("LIMIT")) { + info.setLimit(Long.parseLong(st.getValue("LIMIT"))); + } + if (st.hasChildren("MAXRELATIVEEXPIRY")) { + info.setMaxRelativeExpiryMs( + Long.parseLong(st.getValue("MAXRELATIVEEXPIRY"))); + } + return info; + } + } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSNamesystem.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSNamesystem.java index 12d4956d1bf..d1f0234fcac 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSNamesystem.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSNamesystem.java @@ -125,6 +125,8 @@ import org.apache.commons.logging.LogFactory; import org.apache.hadoop.HadoopIllegalArgumentException; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.BatchedRemoteIterator.BatchedListEntries; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.ContentSummary; import org.apache.hadoop.fs.CreateFlag; import org.apache.hadoop.fs.DirectoryListingStartAfterNotFoundException; @@ -150,6 +152,8 @@ import org.apache.hadoop.hdfs.HdfsConfiguration; import org.apache.hadoop.hdfs.StorageType; import org.apache.hadoop.hdfs.protocol.AlreadyBeingCreatedException; import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; import org.apache.hadoop.hdfs.protocol.ClientProtocol; import org.apache.hadoop.hdfs.protocol.DatanodeID; import org.apache.hadoop.hdfs.protocol.DatanodeInfo; @@ -161,6 +165,8 @@ import org.apache.hadoop.hdfs.protocol.HdfsConstants.SafeModeAction; import org.apache.hadoop.hdfs.protocol.HdfsFileStatus; import org.apache.hadoop.hdfs.protocol.LocatedBlock; import org.apache.hadoop.hdfs.protocol.LocatedBlocks; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; import org.apache.hadoop.hdfs.protocol.QuotaExceededException; import org.apache.hadoop.hdfs.protocol.RecoveryInProgressException; import org.apache.hadoop.hdfs.protocol.SnapshotDiffReport; @@ -363,6 +369,7 @@ public class FSNamesystem implements Namesystem, FSClusterStats, FSDirectory dir; private final BlockManager blockManager; private final SnapshotManager snapshotManager; + private final CacheManager cacheManager; private final DatanodeStatistics datanodeStatistics; // Block pool ID used by this namenode @@ -716,6 +723,7 @@ public class FSNamesystem implements Namesystem, FSClusterStats, this.dtSecretManager = createDelegationTokenSecretManager(conf); this.dir = new FSDirectory(fsImage, this, conf); this.snapshotManager = new SnapshotManager(dir); + this.cacheManager = new CacheManager(this, conf, blockManager); this.safeMode = new SafeModeInfo(conf); this.auditLoggers = initAuditLoggers(conf); this.isDefaultAuditLogger = auditLoggers.size() == 1 && @@ -939,7 +947,7 @@ public class FSNamesystem implements Namesystem, FSClusterStats, blockManager.getDatanodeManager().markAllDatanodesStale(); blockManager.clearQueues(); blockManager.processAllPendingDNMessages(); - + if (!isInSafeMode() || (isInSafeMode() && safeMode.isPopulatingReplQueues())) { LOG.info("Reprocessing replication and invalidation queues"); @@ -977,6 +985,8 @@ public class FSNamesystem implements Namesystem, FSClusterStats, editLogRollerThreshold, editLogRollerInterval)); nnEditLogRoller.start(); + cacheManager.startMonitorThread(); + blockManager.getDatanodeManager().setShouldSendCachingCommands(true); } finally { writeUnlock(); startingActiveService = false; @@ -1026,6 +1036,10 @@ public class FSNamesystem implements Namesystem, FSClusterStats, // so that the tailer starts from the right spot. dir.fsImage.updateLastAppliedTxIdFromWritten(); } + cacheManager.stopMonitorThread(); + cacheManager.clearDirectiveStats(); + blockManager.getDatanodeManager().clearPendingCachingCommands(); + blockManager.getDatanodeManager().setShouldSendCachingCommands(false); } finally { writeUnlock(); } @@ -1602,8 +1616,14 @@ public class FSNamesystem implements Namesystem, FSClusterStats, length = Math.min(length, fileSize - offset); isUc = false; } - return blockManager.createLocatedBlocks(inode.getBlocks(), fileSize, + LocatedBlocks blocks = + blockManager.createLocatedBlocks(inode.getBlocks(), fileSize, isUc, offset, length, needBlockToken, iip.isSnapshot()); + // Set caching information for the located blocks. + for (LocatedBlock lb: blocks.getLocatedBlocks()) { + cacheManager.setCachedLocations(lb); + } + return blocks; } finally { if (isReadOp) { readUnlock(); @@ -4108,15 +4128,16 @@ public class FSNamesystem implements Namesystem, FSClusterStats, * @throws IOException */ HeartbeatResponse handleHeartbeat(DatanodeRegistration nodeReg, - StorageReport[] reports, int xceiverCount, int xmitsInProgress, - int failedVolumes) + StorageReport[] reports, long cacheCapacity, long cacheUsed, + int xceiverCount, int xmitsInProgress, int failedVolumes) throws IOException { readLock(); try { final int maxTransfer = blockManager.getMaxReplicationStreams() - xmitsInProgress; DatanodeCommand[] cmds = blockManager.getDatanodeManager().handleHeartbeat( - nodeReg, reports, blockPoolId, xceiverCount, maxTransfer, failedVolumes); + nodeReg, reports, blockPoolId, cacheCapacity, cacheUsed, + xceiverCount, maxTransfer, failedVolumes); return new HeartbeatResponse(cmds, createHaStatusHeartbeat()); } finally { readUnlock(); @@ -6391,6 +6412,16 @@ public class FSNamesystem implements Namesystem, FSClusterStats, return datanodeStatistics.getCapacityRemainingPercent(); } + @Override // NameNodeMXBean + public long getCacheCapacity() { + return datanodeStatistics.getCacheCapacity(); + } + + @Override // NameNodeMXBean + public long getCacheUsed() { + return datanodeStatistics.getCacheUsed(); + } + @Override // NameNodeMXBean public long getTotalBlocks() { return getBlocksTotal(); @@ -6639,6 +6670,10 @@ public class FSNamesystem implements Namesystem, FSClusterStats, public FSDirectory getFSDirectory() { return dir; } + /** @return the cache manager. */ + public CacheManager getCacheManager() { + return cacheManager; + } @Override // NameNodeMXBean public String getCorruptFiles() { @@ -7016,6 +7051,262 @@ public class FSNamesystem implements Namesystem, FSClusterStats, } } + long addCacheDirective(CacheDirectiveInfo directive, EnumSet flags) + throws IOException { + checkOperation(OperationCategory.WRITE); + final FSPermissionChecker pc = isPermissionEnabled ? + getPermissionChecker() : null; + CacheEntryWithPayload cacheEntry = + RetryCache.waitForCompletion(retryCache, null); + if (cacheEntry != null && cacheEntry.isSuccess()) { + return (Long) cacheEntry.getPayload(); + } + boolean success = false; + if (!flags.contains(CacheFlag.FORCE)) { + cacheManager.waitForRescanIfNeeded(); + } + writeLock(); + Long result = null; + try { + checkOperation(OperationCategory.WRITE); + if (isInSafeMode()) { + throw new SafeModeException( + "Cannot add cache directive", safeMode); + } + if (directive.getId() != null) { + throw new IOException("addDirective: you cannot specify an ID " + + "for this operation."); + } + CacheDirectiveInfo effectiveDirective = + cacheManager.addDirective(directive, pc, flags); + getEditLog().logAddCacheDirectiveInfo(effectiveDirective, + cacheEntry != null); + result = effectiveDirective.getId(); + success = true; + } finally { + writeUnlock(); + if (success) { + getEditLog().logSync(); + } + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "addCacheDirective", null, null, null); + } + RetryCache.setState(cacheEntry, success, result); + } + return result; + } + + void modifyCacheDirective(CacheDirectiveInfo directive, + EnumSet flags) throws IOException { + checkOperation(OperationCategory.WRITE); + final FSPermissionChecker pc = isPermissionEnabled ? + getPermissionChecker() : null; + boolean success = false; + CacheEntry cacheEntry = RetryCache.waitForCompletion(retryCache); + if (cacheEntry != null && cacheEntry.isSuccess()) { + return; + } + if (!flags.contains(CacheFlag.FORCE)) { + cacheManager.waitForRescanIfNeeded(); + } + writeLock(); + try { + checkOperation(OperationCategory.WRITE); + if (isInSafeMode()) { + throw new SafeModeException( + "Cannot add cache directive", safeMode); + } + cacheManager.modifyDirective(directive, pc, flags); + getEditLog().logModifyCacheDirectiveInfo(directive, + cacheEntry != null); + success = true; + } finally { + writeUnlock(); + if (success) { + getEditLog().logSync(); + } + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "modifyCacheDirective", null, null, null); + } + RetryCache.setState(cacheEntry, success); + } + } + + void removeCacheDirective(Long id) throws IOException { + checkOperation(OperationCategory.WRITE); + final FSPermissionChecker pc = isPermissionEnabled ? + getPermissionChecker() : null; + CacheEntry cacheEntry = RetryCache.waitForCompletion(retryCache); + if (cacheEntry != null && cacheEntry.isSuccess()) { + return; + } + boolean success = false; + writeLock(); + try { + checkOperation(OperationCategory.WRITE); + if (isInSafeMode()) { + throw new SafeModeException( + "Cannot remove cache directives", safeMode); + } + cacheManager.removeDirective(id, pc); + getEditLog().logRemoveCacheDirectiveInfo(id, cacheEntry != null); + success = true; + } finally { + writeUnlock(); + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "removeCacheDirective", null, null, + null); + } + RetryCache.setState(cacheEntry, success); + } + getEditLog().logSync(); + } + + BatchedListEntries listCacheDirectives( + long startId, CacheDirectiveInfo filter) throws IOException { + checkOperation(OperationCategory.READ); + final FSPermissionChecker pc = isPermissionEnabled ? + getPermissionChecker() : null; + BatchedListEntries results; + cacheManager.waitForRescanIfNeeded(); + readLock(); + boolean success = false; + try { + checkOperation(OperationCategory.READ); + results = + cacheManager.listCacheDirectives(startId, filter, pc); + success = true; + } finally { + readUnlock(); + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "listCacheDirectives", null, null, + null); + } + } + return results; + } + + public void addCachePool(CachePoolInfo req) throws IOException { + checkOperation(OperationCategory.WRITE); + final FSPermissionChecker pc = isPermissionEnabled ? + getPermissionChecker() : null; + CacheEntry cacheEntry = RetryCache.waitForCompletion(retryCache); + if (cacheEntry != null && cacheEntry.isSuccess()) { + return; // Return previous response + } + writeLock(); + boolean success = false; + try { + checkOperation(OperationCategory.WRITE); + if (isInSafeMode()) { + throw new SafeModeException( + "Cannot add cache pool " + req.getPoolName(), safeMode); + } + if (pc != null) { + pc.checkSuperuserPrivilege(); + } + CachePoolInfo info = cacheManager.addCachePool(req); + getEditLog().logAddCachePool(info, cacheEntry != null); + success = true; + } finally { + writeUnlock(); + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "addCachePool", req.getPoolName(), null, null); + } + RetryCache.setState(cacheEntry, success); + } + + getEditLog().logSync(); + } + + public void modifyCachePool(CachePoolInfo req) throws IOException { + checkOperation(OperationCategory.WRITE); + final FSPermissionChecker pc = + isPermissionEnabled ? getPermissionChecker() : null; + CacheEntry cacheEntry = RetryCache.waitForCompletion(retryCache); + if (cacheEntry != null && cacheEntry.isSuccess()) { + return; // Return previous response + } + writeLock(); + boolean success = false; + try { + checkOperation(OperationCategory.WRITE); + if (isInSafeMode()) { + throw new SafeModeException( + "Cannot modify cache pool " + req.getPoolName(), safeMode); + } + if (pc != null) { + pc.checkSuperuserPrivilege(); + } + cacheManager.modifyCachePool(req); + getEditLog().logModifyCachePool(req, cacheEntry != null); + success = true; + } finally { + writeUnlock(); + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "modifyCachePool", req.getPoolName(), null, null); + } + RetryCache.setState(cacheEntry, success); + } + + getEditLog().logSync(); + } + + public void removeCachePool(String cachePoolName) throws IOException { + checkOperation(OperationCategory.WRITE); + final FSPermissionChecker pc = + isPermissionEnabled ? getPermissionChecker() : null; + CacheEntry cacheEntry = RetryCache.waitForCompletion(retryCache); + if (cacheEntry != null && cacheEntry.isSuccess()) { + return; // Return previous response + } + writeLock(); + boolean success = false; + try { + checkOperation(OperationCategory.WRITE); + if (isInSafeMode()) { + throw new SafeModeException( + "Cannot remove cache pool " + cachePoolName, safeMode); + } + if (pc != null) { + pc.checkSuperuserPrivilege(); + } + cacheManager.removeCachePool(cachePoolName); + getEditLog().logRemoveCachePool(cachePoolName, cacheEntry != null); + success = true; + } finally { + writeUnlock(); + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "removeCachePool", cachePoolName, null, null); + } + RetryCache.setState(cacheEntry, success); + } + + getEditLog().logSync(); + } + + public BatchedListEntries listCachePools(String prevKey) + throws IOException { + final FSPermissionChecker pc = + isPermissionEnabled ? getPermissionChecker() : null; + BatchedListEntries results; + checkOperation(OperationCategory.READ); + boolean success = false; + cacheManager.waitForRescanIfNeeded(); + readLock(); + try { + checkOperation(OperationCategory.READ); + results = cacheManager.listCachePools(pc, prevKey); + success = true; + } finally { + readUnlock(); + if (isAuditEnabled() && isExternalInvocation()) { + logAuditEvent(success, "listCachePools", null, null, null); + } + } + return results; + } + /** * Default AuditLogger implementation; used when no access logger is * defined in the config file. It can also be explicitly listed in the @@ -7078,6 +7369,5 @@ public class FSNamesystem implements Namesystem, FSClusterStats, auditLog.info(message); } } - } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSPermissionChecker.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSPermissionChecker.java index a02bc4044de..17b43239c83 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSPermissionChecker.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/FSPermissionChecker.java @@ -255,4 +255,33 @@ class FSPermissionChecker { throw new AccessControlException("Permission denied by sticky bit setting:" + " user=" + user + ", inode=" + inode); } + + /** + * Whether a cache pool can be accessed by the current context + * + * @param pool CachePool being accessed + * @param access type of action being performed on the cache pool + * @throws AccessControlException if pool cannot be accessed + */ + public void checkPermission(CachePool pool, FsAction access) + throws AccessControlException { + FsPermission mode = pool.getMode(); + if (isSuperUser()) { + return; + } + if (user.equals(pool.getOwnerName()) + && mode.getUserAction().implies(access)) { + return; + } + if (groups.contains(pool.getGroupName()) + && mode.getGroupAction().implies(access)) { + return; + } + if (mode.getOtherAction().implies(access)) { + return; + } + throw new AccessControlException("Permission denied while accessing pool " + + pool.getPoolName() + ": user " + user + " does not have " + + access.toString() + " permissions."); + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNode.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNode.java index 163930789c0..8ed607d88df 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNode.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNode.java @@ -656,8 +656,13 @@ public class NameNode implements NameNodeStatusMXBean { try { initializeGenericKeys(conf, nsId, namenodeId); initialize(conf); - state.prepareToEnterState(haContext); - state.enterState(haContext); + try { + haContext.writeLock(); + state.prepareToEnterState(haContext); + state.enterState(haContext); + } finally { + haContext.writeUnlock(); + } } catch (IOException e) { this.stop(); throw e; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeMXBean.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeMXBean.java index ff2e3ea10dd..fd46d546226 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeMXBean.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeMXBean.java @@ -101,6 +101,16 @@ public interface NameNodeMXBean { * @return the percentage of the remaining space on the cluster */ public float getPercentRemaining(); + + /** + * Returns the amount of cache used by the datanode (in bytes). + */ + public long getCacheUsed(); + + /** + * Returns the total cache capacity of the datanode (in bytes). + */ + public long getCacheCapacity(); /** * Get the total space used by the block pools of this namenode diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeRpcServer.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeRpcServer.java index ab64f365728..0f641e48785 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeRpcServer.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/NameNodeRpcServer.java @@ -29,6 +29,7 @@ import java.io.IOException; import java.net.InetSocketAddress; import java.util.Arrays; import java.util.Collection; +import java.util.EnumSet; import java.util.HashSet; import java.util.List; import java.util.Set; @@ -36,6 +37,7 @@ import java.util.Set; import org.apache.commons.logging.Log; import org.apache.hadoop.HadoopIllegalArgumentException; import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.CommonConfigurationKeys; import org.apache.hadoop.fs.ContentSummary; import org.apache.hadoop.fs.CreateFlag; @@ -46,6 +48,7 @@ import org.apache.hadoop.fs.Options; import org.apache.hadoop.fs.ParentNotDirectoryException; import org.apache.hadoop.fs.Path; import org.apache.hadoop.fs.UnresolvedLinkException; +import org.apache.hadoop.fs.BatchedRemoteIterator.BatchedEntries; import org.apache.hadoop.fs.permission.FsPermission; import org.apache.hadoop.fs.permission.PermissionStatus; import org.apache.hadoop.ha.HAServiceStatus; @@ -60,6 +63,10 @@ import org.apache.hadoop.hdfs.HDFSPolicyProvider; import org.apache.hadoop.hdfs.protocol.AlreadyBeingCreatedException; import org.apache.hadoop.hdfs.protocol.Block; import org.apache.hadoop.hdfs.protocol.BlockListAsLongs; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; import org.apache.hadoop.hdfs.protocol.CorruptFileBlocks; import org.apache.hadoop.hdfs.protocol.DSQuotaExceededException; import org.apache.hadoop.hdfs.protocol.DatanodeID; @@ -953,11 +960,13 @@ class NameNodeRpcServer implements NamenodeProtocols { @Override // DatanodeProtocol public HeartbeatResponse sendHeartbeat(DatanodeRegistration nodeReg, - StorageReport[] report, int xmitsInProgress, int xceiverCount, + StorageReport[] report, long dnCacheCapacity, long dnCacheUsed, + int xmitsInProgress, int xceiverCount, int failedVolumes) throws IOException { verifyRequest(nodeReg); return namesystem.handleHeartbeat(nodeReg, report, - xceiverCount, xmitsInProgress, failedVolumes); + dnCacheCapacity, dnCacheUsed, xceiverCount, xmitsInProgress, + failedVolumes); } @Override // DatanodeProtocol @@ -979,6 +988,18 @@ class NameNodeRpcServer implements NamenodeProtocols { return null; } + @Override + public DatanodeCommand cacheReport(DatanodeRegistration nodeReg, + String poolId, List blockIds) throws IOException { + verifyRequest(nodeReg); + if (blockStateChangeLog.isDebugEnabled()) { + blockStateChangeLog.debug("*BLOCK* NameNode.cacheReport: " + + "from " + nodeReg + " " + blockIds.size() + " blocks"); + } + namesystem.getCacheManager().processCacheReport(nodeReg, blockIds); + return null; + } + @Override // DatanodeProtocol public void blockReceivedAndDeleted(DatanodeRegistration nodeReg, String poolId, StorageReceivedDeletedBlocks[] receivedAndDeletedBlocks) throws IOException { @@ -1214,5 +1235,52 @@ class NameNodeRpcServer implements NamenodeProtocols { metrics.incrSnapshotDiffReportOps(); return report; } + + @Override + public long addCacheDirective( + CacheDirectiveInfo path, EnumSet flags) throws IOException { + return namesystem.addCacheDirective(path, flags); + } + + @Override + public void modifyCacheDirective( + CacheDirectiveInfo directive, EnumSet flags) throws IOException { + namesystem.modifyCacheDirective(directive, flags); + } + + @Override + public void removeCacheDirective(long id) throws IOException { + namesystem.removeCacheDirective(id); + } + + @Override + public BatchedEntries listCacheDirectives(long prevId, + CacheDirectiveInfo filter) throws IOException { + if (filter == null) { + filter = new CacheDirectiveInfo.Builder().build(); + } + return namesystem.listCacheDirectives(prevId, filter); + } + + @Override + public void addCachePool(CachePoolInfo info) throws IOException { + namesystem.addCachePool(info); + } + + @Override + public void modifyCachePool(CachePoolInfo info) throws IOException { + namesystem.modifyCachePool(info); + } + + @Override + public void removeCachePool(String cachePoolName) throws IOException { + namesystem.removeCachePool(cachePoolName); + } + + @Override + public BatchedEntries listCachePools(String prevKey) + throws IOException { + return namesystem.listCachePools(prevKey != null ? prevKey : ""); + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/metrics/NameNodeMetrics.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/metrics/NameNodeMetrics.java index 61fcc13dcec..a47eb73d23a 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/metrics/NameNodeMetrics.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/metrics/NameNodeMetrics.java @@ -81,6 +81,8 @@ public class NameNodeMetrics { MutableCounterLong transactionsBatchedInSync; @Metric("Block report") MutableRate blockReport; MutableQuantiles[] blockReportQuantiles; + @Metric("Cache report") MutableRate cacheReport; + MutableQuantiles[] cacheReportQuantiles; @Metric("Duration in SafeMode at startup in msec") MutableGaugeInt safeModeTime; @@ -100,6 +102,7 @@ public class NameNodeMetrics { final int len = intervals.length; syncsQuantiles = new MutableQuantiles[len]; blockReportQuantiles = new MutableQuantiles[len]; + cacheReportQuantiles = new MutableQuantiles[len]; for (int i = 0; i < len; i++) { int interval = intervals[i]; @@ -109,6 +112,9 @@ public class NameNodeMetrics { blockReportQuantiles[i] = registry.newQuantiles( "blockReport" + interval + "s", "Block report", "ops", "latency", interval); + cacheReportQuantiles[i] = registry.newQuantiles( + "cacheReport" + interval + "s", + "Cache report", "ops", "latency", interval); } } @@ -242,6 +248,13 @@ public class NameNodeMetrics { } } + public void addCacheBlockReport(long latency) { + cacheReport.add(latency); + for (MutableQuantiles q : cacheReportQuantiles) { + q.add(latency); + } + } + public void setSafeModeTime(long elapsed) { safeModeTime.set((int) elapsed); } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/startupprogress/StepType.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/startupprogress/StepType.java index 2ef9c8e7013..1b43d6a2b09 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/startupprogress/StepType.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/namenode/startupprogress/StepType.java @@ -42,7 +42,17 @@ public enum StepType { /** * The namenode is performing an operation related to inodes. */ - INODES("Inodes", "inodes"); + INODES("Inodes", "inodes"), + + /** + * The namenode is performing an operation related to cache pools. + */ + CACHE_POOLS("CachePools", "cache pools"), + + /** + * The namenode is performing an operation related to cache entries. + */ + CACHE_ENTRIES("CacheEntries", "cache entries"); private final String name, description; diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/BlockIdCommand.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/BlockIdCommand.java new file mode 100644 index 00000000000..f4837a1d419 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/BlockIdCommand.java @@ -0,0 +1,50 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.protocol; + +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.classification.InterfaceStability; + +/**************************************************** + * A BlockIdCommand is an instruction to a datanode + * regarding some blocks under its control. + ****************************************************/ +@InterfaceAudience.Private +@InterfaceStability.Evolving +public class BlockIdCommand extends DatanodeCommand { + final String poolId; + final long blockIds[]; + + /** + * Create BlockCommand for the given action + * @param blocks blocks related to the action + */ + public BlockIdCommand(int action, String poolId, long[] blockIds) { + super(action); + this.poolId = poolId; + this.blockIds= blockIds; + } + + public String getBlockPoolId() { + return poolId; + } + + public long[] getBlockIds() { + return blockIds; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/DatanodeProtocol.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/DatanodeProtocol.java index 27a10998d44..c990b37160c 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/DatanodeProtocol.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/server/protocol/DatanodeProtocol.java @@ -19,13 +19,14 @@ package org.apache.hadoop.hdfs.server.protocol; import java.io.*; +import java.util.List; import org.apache.hadoop.classification.InterfaceAudience; import org.apache.hadoop.hdfs.DFSConfigKeys; +import org.apache.hadoop.hdfs.protocol.BlockListAsLongs; import org.apache.hadoop.hdfs.protocol.DatanodeID; import org.apache.hadoop.hdfs.protocol.ExtendedBlock; import org.apache.hadoop.hdfs.protocol.LocatedBlock; -import org.apache.hadoop.io.retry.AtMostOnce; import org.apache.hadoop.io.retry.Idempotent; import org.apache.hadoop.security.KerberosInfo; @@ -74,6 +75,8 @@ public interface DatanodeProtocol { final static int DNA_RECOVERBLOCK = 6; // request a block recovery final static int DNA_ACCESSKEYUPDATE = 7; // update access key final static int DNA_BALANCERBANDWIDTHUPDATE = 8; // update balancer bandwidth + final static int DNA_CACHE = 9; // cache blocks + final static int DNA_UNCACHE = 10; // uncache blocks /** * Register Datanode. @@ -104,6 +107,8 @@ public interface DatanodeProtocol { @Idempotent public HeartbeatResponse sendHeartbeat(DatanodeRegistration registration, StorageReport[] reports, + long dnCacheCapacity, + long dnCacheUsed, int xmitsInProgress, int xceiverCount, int failedVolumes) throws IOException; @@ -128,6 +133,24 @@ public interface DatanodeProtocol { public DatanodeCommand blockReport(DatanodeRegistration registration, String poolId, StorageBlockReport[] reports) throws IOException; + + /** + * Communicates the complete list of locally cached blocks to the NameNode. + * + * This method is similar to + * {@link #blockReport(DatanodeRegistration, String, StorageBlockReport[])}, + * which is used to communicated blocks stored on disk. + * + * @param The datanode registration. + * @param poolId The block pool ID for the blocks. + * @param blockIds A list of block IDs. + * @return The DatanodeCommand. + * @throws IOException + */ + @Idempotent + public DatanodeCommand cacheReport(DatanodeRegistration registration, + String poolId, List blockIds) throws IOException; + /** * blockReceivedAndDeleted() allows the DataNode to tell the NameNode about * recently-received and -deleted block data. diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/CacheAdmin.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/CacheAdmin.java new file mode 100644 index 00000000000..341d8b19273 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/CacheAdmin.java @@ -0,0 +1,1059 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.tools; + +import java.io.IOException; +import java.util.EnumSet; +import java.util.LinkedList; +import java.util.List; + +import org.apache.commons.lang.WordUtils; +import org.apache.hadoop.classification.InterfaceAudience; +import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.conf.Configured; +import org.apache.hadoop.fs.CacheFlag; +import org.apache.hadoop.fs.FileSystem; +import org.apache.hadoop.fs.Path; +import org.apache.hadoop.fs.RemoteIterator; +import org.apache.hadoop.fs.permission.FsPermission; +import org.apache.hadoop.hdfs.DFSUtil; +import org.apache.hadoop.hdfs.DistributedFileSystem; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo.Expiration; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveStats; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolStats; +import org.apache.hadoop.hdfs.tools.TableListing.Justification; +import org.apache.hadoop.util.StringUtils; +import org.apache.hadoop.util.Tool; + +import com.google.common.base.Joiner; + +/** + * This class implements command-line operations on the HDFS Cache. + */ +@InterfaceAudience.Private +public class CacheAdmin extends Configured implements Tool { + + /** + * Maximum length for printed lines + */ + private static final int MAX_LINE_WIDTH = 80; + + public CacheAdmin() { + this(null); + } + + public CacheAdmin(Configuration conf) { + super(conf); + } + + @Override + public int run(String[] args) throws IOException { + if (args.length == 0) { + printUsage(false); + return 1; + } + Command command = determineCommand(args[0]); + if (command == null) { + System.err.println("Can't understand command '" + args[0] + "'"); + if (!args[0].startsWith("-")) { + System.err.println("Command names must start with dashes."); + } + printUsage(false); + return 1; + } + List argsList = new LinkedList(); + for (int j = 1; j < args.length; j++) { + argsList.add(args[j]); + } + try { + return command.run(getConf(), argsList); + } catch (IllegalArgumentException e) { + System.err.println(prettifyException(e)); + return -1; + } + } + + public static void main(String[] argsArray) throws IOException { + CacheAdmin cacheAdmin = new CacheAdmin(new Configuration()); + System.exit(cacheAdmin.run(argsArray)); + } + + private static DistributedFileSystem getDFS(Configuration conf) + throws IOException { + FileSystem fs = FileSystem.get(conf); + if (!(fs instanceof DistributedFileSystem)) { + throw new IllegalArgumentException("FileSystem " + fs.getUri() + + " is not an HDFS file system"); + } + return (DistributedFileSystem)fs; + } + + /** + * NN exceptions contain the stack trace as part of the exception message. + * When it's a known error, pretty-print the error and squish the stack trace. + */ + private static String prettifyException(Exception e) { + return e.getClass().getSimpleName() + ": " + + e.getLocalizedMessage().split("\n")[0]; + } + + private static TableListing getOptionDescriptionListing() { + TableListing listing = new TableListing.Builder() + .addField("").addField("", true) + .wrapWidth(MAX_LINE_WIDTH).hideHeaders().build(); + return listing; + } + + /** + * Parses a time-to-live value from a string + * @return The ttl in milliseconds + * @throws IOException if it could not be parsed + */ + private static Long parseTtlString(String maxTtlString) throws IOException { + Long maxTtl = null; + if (maxTtlString != null) { + if (maxTtlString.equalsIgnoreCase("never")) { + maxTtl = CachePoolInfo.RELATIVE_EXPIRY_NEVER; + } else { + maxTtl = DFSUtil.parseRelativeTime(maxTtlString); + } + } + return maxTtl; + } + + private static Expiration parseExpirationString(String ttlString) + throws IOException { + Expiration ex = null; + if (ttlString != null) { + if (ttlString.equalsIgnoreCase("never")) { + ex = CacheDirectiveInfo.Expiration.NEVER; + } else { + long ttl = DFSUtil.parseRelativeTime(ttlString); + ex = CacheDirectiveInfo.Expiration.newRelative(ttl); + } + } + return ex; + } + + interface Command { + String getName(); + String getShortUsage(); + String getLongUsage(); + int run(Configuration conf, List args) throws IOException; + } + + private static class AddCacheDirectiveInfoCommand implements Command { + @Override + public String getName() { + return "-addDirective"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + + " -path -pool " + + "[-force] " + + "[-replication ] [-ttl ]]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("", "A path to cache. The path can be " + + "a directory or a file."); + listing.addRow("", "The pool to which the directive will be " + + "added. You must have write permission on the cache pool " + + "in order to add new directives."); + listing.addRow("-force", + "Skips checking of cache pool resource limits."); + listing.addRow("", "The cache replication factor to use. " + + "Defaults to 1."); + listing.addRow("", "How long the directive is " + + "valid. Can be specified in minutes, hours, and days, e.g. " + + "30m, 4h, 2d. Valid units are [smhd]." + + " \"never\" indicates a directive that never expires." + + " If unspecified, the directive never expires."); + return getShortUsage() + "\n" + + "Add a new cache directive.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + CacheDirectiveInfo.Builder builder = new CacheDirectiveInfo.Builder(); + + String path = StringUtils.popOptionWithArgument("-path", args); + if (path == null) { + System.err.println("You must specify a path with -path."); + return 1; + } + builder.setPath(new Path(path)); + + String poolName = StringUtils.popOptionWithArgument("-pool", args); + if (poolName == null) { + System.err.println("You must specify a pool name with -pool."); + return 1; + } + builder.setPool(poolName); + boolean force = StringUtils.popOption("-force", args); + String replicationString = + StringUtils.popOptionWithArgument("-replication", args); + if (replicationString != null) { + Short replication = Short.parseShort(replicationString); + builder.setReplication(replication); + } + + String ttlString = StringUtils.popOptionWithArgument("-ttl", args); + try { + Expiration ex = parseExpirationString(ttlString); + if (ex != null) { + builder.setExpiration(ex); + } + } catch (IOException e) { + System.err.println( + "Error while parsing ttl value: " + e.getMessage()); + return 1; + } + + if (!args.isEmpty()) { + System.err.println("Can't understand argument: " + args.get(0)); + return 1; + } + + DistributedFileSystem dfs = getDFS(conf); + CacheDirectiveInfo directive = builder.build(); + EnumSet flags = EnumSet.noneOf(CacheFlag.class); + if (force) { + flags.add(CacheFlag.FORCE); + } + try { + long id = dfs.addCacheDirective(directive, flags); + System.out.println("Added cache directive " + id); + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + + return 0; + } + } + + private static class RemoveCacheDirectiveInfoCommand implements Command { + @Override + public String getName() { + return "-removeDirective"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + " ]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("", "The id of the cache directive to remove. " + + "You must have write permission on the pool of the " + + "directive in order to remove it. To see a list " + + "of cache directive IDs, use the -listDirectives command."); + return getShortUsage() + "\n" + + "Remove a cache directive.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + String idString= StringUtils.popFirstNonOption(args); + if (idString == null) { + System.err.println("You must specify a directive ID to remove."); + return 1; + } + long id; + try { + id = Long.valueOf(idString); + } catch (NumberFormatException e) { + System.err.println("Invalid directive ID " + idString + ": expected " + + "a numeric value."); + return 1; + } + if (id <= 0) { + System.err.println("Invalid directive ID " + id + ": ids must " + + "be greater than 0."); + return 1; + } + if (!args.isEmpty()) { + System.err.println("Can't understand argument: " + args.get(0)); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + DistributedFileSystem dfs = getDFS(conf); + try { + dfs.getClient().removeCacheDirective(id); + System.out.println("Removed cached directive " + id); + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + return 0; + } + } + + private static class ModifyCacheDirectiveInfoCommand implements Command { + @Override + public String getName() { + return "-modifyDirective"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + + " -id [-path ] [-force] [-replication ] " + + "[-pool ] [-ttl ]]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("", "The ID of the directive to modify (required)"); + listing.addRow("", "A path to cache. The path can be " + + "a directory or a file. (optional)"); + listing.addRow("-force", + "Skips checking of cache pool resource limits."); + listing.addRow("", "The cache replication factor to use. " + + "(optional)"); + listing.addRow("", "The pool to which the directive will be " + + "added. You must have write permission on the cache pool " + + "in order to move a directive into it. (optional)"); + listing.addRow("", "How long the directive is " + + "valid. Can be specified in minutes, hours, and days, e.g. " + + "30m, 4h, 2d. Valid units are [smhd]." + + " \"never\" indicates a directive that never expires."); + return getShortUsage() + "\n" + + "Modify a cache directive.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(); + boolean modified = false; + String idString = StringUtils.popOptionWithArgument("-id", args); + if (idString == null) { + System.err.println("You must specify a directive ID with -id."); + return 1; + } + builder.setId(Long.parseLong(idString)); + String path = StringUtils.popOptionWithArgument("-path", args); + if (path != null) { + builder.setPath(new Path(path)); + modified = true; + } + boolean force = StringUtils.popOption("-force", args); + String replicationString = + StringUtils.popOptionWithArgument("-replication", args); + if (replicationString != null) { + builder.setReplication(Short.parseShort(replicationString)); + modified = true; + } + String poolName = + StringUtils.popOptionWithArgument("-pool", args); + if (poolName != null) { + builder.setPool(poolName); + modified = true; + } + String ttlString = StringUtils.popOptionWithArgument("-ttl", args); + try { + Expiration ex = parseExpirationString(ttlString); + if (ex != null) { + builder.setExpiration(ex); + modified = true; + } + } catch (IOException e) { + System.err.println( + "Error while parsing ttl value: " + e.getMessage()); + return 1; + } + if (!args.isEmpty()) { + System.err.println("Can't understand argument: " + args.get(0)); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + if (!modified) { + System.err.println("No modifications were specified."); + return 1; + } + DistributedFileSystem dfs = getDFS(conf); + EnumSet flags = EnumSet.noneOf(CacheFlag.class); + if (force) { + flags.add(CacheFlag.FORCE); + } + try { + dfs.modifyCacheDirective(builder.build(), flags); + System.out.println("Modified cache directive " + idString); + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + return 0; + } + } + + private static class RemoveCacheDirectiveInfosCommand implements Command { + @Override + public String getName() { + return "-removeDirectives"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + " -path ]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("-path ", "The path of the cache directives to remove. " + + "You must have write permission on the pool of the directive in order " + + "to remove it. To see a list of cache directives, use the " + + "-listDirectives command."); + return getShortUsage() + "\n" + + "Remove every cache directive with the specified path.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + String path = StringUtils.popOptionWithArgument("-path", args); + if (path == null) { + System.err.println("You must specify a path with -path."); + return 1; + } + if (!args.isEmpty()) { + System.err.println("Can't understand argument: " + args.get(0)); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + int exitCode = 0; + try { + DistributedFileSystem dfs = getDFS(conf); + RemoteIterator iter = + dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder(). + setPath(new Path(path)).build()); + while (iter.hasNext()) { + CacheDirectiveEntry entry = iter.next(); + try { + dfs.removeCacheDirective(entry.getInfo().getId()); + System.out.println("Removed cache directive " + + entry.getInfo().getId()); + } catch (IOException e) { + System.err.println(prettifyException(e)); + exitCode = 2; + } + } + } catch (IOException e) { + System.err.println(prettifyException(e)); + exitCode = 2; + } + if (exitCode == 0) { + System.out.println("Removed every cache directive with path " + + path); + } + return exitCode; + } + } + + private static class ListCacheDirectiveInfoCommand implements Command { + @Override + public String getName() { + return "-listDirectives"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + " [-stats] [-path ] [-pool ]]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("", "List only " + + "cache directives with this path. " + + "Note that if there is a cache directive for " + + "in a cache pool that we don't have read access for, it " + + "will not be listed."); + listing.addRow("", "List only path cache directives in that pool."); + listing.addRow("-stats", "List path-based cache directive statistics."); + return getShortUsage() + "\n" + + "List cache directives.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + CacheDirectiveInfo.Builder builder = + new CacheDirectiveInfo.Builder(); + String pathFilter = StringUtils.popOptionWithArgument("-path", args); + if (pathFilter != null) { + builder.setPath(new Path(pathFilter)); + } + String poolFilter = StringUtils.popOptionWithArgument("-pool", args); + if (poolFilter != null) { + builder.setPool(poolFilter); + } + boolean printStats = StringUtils.popOption("-stats", args); + if (!args.isEmpty()) { + System.err.println("Can't understand argument: " + args.get(0)); + return 1; + } + TableListing.Builder tableBuilder = new TableListing.Builder(). + addField("ID", Justification.RIGHT). + addField("POOL", Justification.LEFT). + addField("REPL", Justification.RIGHT). + addField("EXPIRY", Justification.LEFT). + addField("PATH", Justification.LEFT); + if (printStats) { + tableBuilder.addField("BYTES_NEEDED", Justification.RIGHT). + addField("BYTES_CACHED", Justification.RIGHT). + addField("FILES_NEEDED", Justification.RIGHT). + addField("FILES_CACHED", Justification.RIGHT); + } + TableListing tableListing = tableBuilder.build(); + try { + DistributedFileSystem dfs = getDFS(conf); + RemoteIterator iter = + dfs.listCacheDirectives(builder.build()); + int numEntries = 0; + while (iter.hasNext()) { + CacheDirectiveEntry entry = iter.next(); + CacheDirectiveInfo directive = entry.getInfo(); + CacheDirectiveStats stats = entry.getStats(); + List row = new LinkedList(); + row.add("" + directive.getId()); + row.add(directive.getPool()); + row.add("" + directive.getReplication()); + String expiry; + // This is effectively never, round for nice printing + if (directive.getExpiration().getMillis() > + Expiration.MAX_RELATIVE_EXPIRY_MS / 2) { + expiry = "never"; + } else { + expiry = directive.getExpiration().toString(); + } + row.add(expiry); + row.add(directive.getPath().toUri().getPath()); + if (printStats) { + row.add("" + stats.getBytesNeeded()); + row.add("" + stats.getBytesCached()); + row.add("" + stats.getFilesNeeded()); + row.add("" + stats.getFilesCached()); + } + tableListing.addRow(row.toArray(new String[0])); + numEntries++; + } + System.out.print(String.format("Found %d entr%s\n", + numEntries, numEntries == 1 ? "y" : "ies")); + if (numEntries > 0) { + System.out.print(tableListing); + } + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + return 0; + } + } + + private static class AddCachePoolCommand implements Command { + + private static final String NAME = "-addPool"; + + @Override + public String getName() { + return NAME; + } + + @Override + public String getShortUsage() { + return "[" + NAME + " [-owner ] " + + "[-group ] [-mode ] [-limit ] " + + "[-maxTtl ]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + + listing.addRow("", "Name of the new pool."); + listing.addRow("", "Username of the owner of the pool. " + + "Defaults to the current user."); + listing.addRow("", "Group of the pool. " + + "Defaults to the primary group name of the current user."); + listing.addRow("", "UNIX-style permissions for the pool. " + + "Permissions are specified in octal, e.g. 0755. " + + "By default, this is set to " + String.format("0%03o", + FsPermission.getCachePoolDefault().toShort()) + "."); + listing.addRow("", "The maximum number of bytes that can be " + + "cached by directives in this pool, in aggregate. By default, " + + "no limit is set."); + listing.addRow("", "The maximum allowed time-to-live for " + + "directives being added to the pool. This can be specified in " + + "seconds, minutes, hours, and days, e.g. 120s, 30m, 4h, 2d. " + + "Valid units are [smhd]. By default, no maximum is set. " + + "This can also be manually specified by \"never\"."); + return getShortUsage() + "\n" + + "Add a new cache pool.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + String name = StringUtils.popFirstNonOption(args); + if (name == null) { + System.err.println("You must specify a name when creating a " + + "cache pool."); + return 1; + } + CachePoolInfo info = new CachePoolInfo(name); + + String owner = StringUtils.popOptionWithArgument("-owner", args); + if (owner != null) { + info.setOwnerName(owner); + } + String group = StringUtils.popOptionWithArgument("-group", args); + if (group != null) { + info.setGroupName(group); + } + String modeString = StringUtils.popOptionWithArgument("-mode", args); + if (modeString != null) { + short mode = Short.parseShort(modeString, 8); + info.setMode(new FsPermission(mode)); + } + String limitString = StringUtils.popOptionWithArgument("-limit", args); + if (limitString != null) { + long limit = Long.parseLong(limitString); + info.setLimit(limit); + } + String maxTtlString = StringUtils.popOptionWithArgument("-maxTtl", args); + try { + Long maxTtl = parseTtlString(maxTtlString); + if (maxTtl != null) { + info.setMaxRelativeExpiryMs(maxTtl); + } + } catch (IOException e) { + System.err.println( + "Error while parsing maxTtl value: " + e.getMessage()); + return 1; + } + + if (!args.isEmpty()) { + System.err.print("Can't understand arguments: " + + Joiner.on(" ").join(args) + "\n"); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + DistributedFileSystem dfs = getDFS(conf); + try { + dfs.addCachePool(info); + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + System.out.println("Successfully added cache pool " + name + "."); + return 0; + } + } + + private static class ModifyCachePoolCommand implements Command { + + @Override + public String getName() { + return "-modifyPool"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + " [-owner ] " + + "[-group ] [-mode ] [-limit ] " + + "[-maxTtl ]]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + + listing.addRow("", "Name of the pool to modify."); + listing.addRow("", "Username of the owner of the pool"); + listing.addRow("", "Groupname of the group of the pool."); + listing.addRow("", "Unix-style permissions of the pool in octal."); + listing.addRow("", "Maximum number of bytes that can be cached " + + "by this pool."); + listing.addRow("", "The maximum allowed time-to-live for " + + "directives being added to the pool."); + + return getShortUsage() + "\n" + + WordUtils.wrap("Modifies the metadata of an existing cache pool. " + + "See usage of " + AddCachePoolCommand.NAME + " for more details.", + MAX_LINE_WIDTH) + "\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + String owner = StringUtils.popOptionWithArgument("-owner", args); + String group = StringUtils.popOptionWithArgument("-group", args); + String modeString = StringUtils.popOptionWithArgument("-mode", args); + Integer mode = (modeString == null) ? + null : Integer.parseInt(modeString, 8); + String limitString = StringUtils.popOptionWithArgument("-limit", args); + Long limit = (limitString == null) ? + null : Long.parseLong(limitString); + String maxTtlString = StringUtils.popOptionWithArgument("-maxTtl", args); + Long maxTtl = null; + try { + maxTtl = parseTtlString(maxTtlString); + } catch (IOException e) { + System.err.println( + "Error while parsing maxTtl value: " + e.getMessage()); + return 1; + } + String name = StringUtils.popFirstNonOption(args); + if (name == null) { + System.err.println("You must specify a name when creating a " + + "cache pool."); + return 1; + } + if (!args.isEmpty()) { + System.err.print("Can't understand arguments: " + + Joiner.on(" ").join(args) + "\n"); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + boolean changed = false; + CachePoolInfo info = new CachePoolInfo(name); + if (owner != null) { + info.setOwnerName(owner); + changed = true; + } + if (group != null) { + info.setGroupName(group); + changed = true; + } + if (mode != null) { + info.setMode(new FsPermission(mode.shortValue())); + changed = true; + } + if (limit != null) { + info.setLimit(limit); + changed = true; + } + if (maxTtl != null) { + info.setMaxRelativeExpiryMs(maxTtl); + changed = true; + } + if (!changed) { + System.err.println("You must specify at least one attribute to " + + "change in the cache pool."); + return 1; + } + DistributedFileSystem dfs = getDFS(conf); + try { + dfs.modifyCachePool(info); + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + System.out.print("Successfully modified cache pool " + name); + String prefix = " to have "; + if (owner != null) { + System.out.print(prefix + "owner name " + owner); + prefix = " and "; + } + if (group != null) { + System.out.print(prefix + "group name " + group); + prefix = " and "; + } + if (mode != null) { + System.out.print(prefix + "mode " + new FsPermission(mode.shortValue())); + prefix = " and "; + } + if (limit != null) { + System.out.print(prefix + "limit " + limit); + prefix = " and "; + } + if (maxTtl != null) { + System.out.print(prefix + "max time-to-live " + maxTtlString); + } + System.out.print("\n"); + return 0; + } + } + + private static class RemoveCachePoolCommand implements Command { + + @Override + public String getName() { + return "-removePool"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + " ]\n"; + } + + @Override + public String getLongUsage() { + return getShortUsage() + "\n" + + WordUtils.wrap("Remove a cache pool. This also uncaches paths " + + "associated with the pool.\n\n", MAX_LINE_WIDTH) + + " Name of the cache pool to remove.\n"; + } + + @Override + public int run(Configuration conf, List args) throws IOException { + String name = StringUtils.popFirstNonOption(args); + if (name == null) { + System.err.println("You must specify a name when deleting a " + + "cache pool."); + return 1; + } + if (!args.isEmpty()) { + System.err.print("Can't understand arguments: " + + Joiner.on(" ").join(args) + "\n"); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + DistributedFileSystem dfs = getDFS(conf); + try { + dfs.removeCachePool(name); + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + System.out.println("Successfully removed cache pool " + name + "."); + return 0; + } + } + + private static class ListCachePoolsCommand implements Command { + + @Override + public String getName() { + return "-listPools"; + } + + @Override + public String getShortUsage() { + return "[" + getName() + " [-stats] []]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("-stats", "Display additional cache pool statistics."); + listing.addRow("", "If specified, list only the named cache pool."); + + return getShortUsage() + "\n" + + WordUtils.wrap("Display information about one or more cache pools, " + + "e.g. name, owner, group, permissions, etc.", MAX_LINE_WIDTH) + + "\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + String name = StringUtils.popFirstNonOption(args); + final boolean printStats = StringUtils.popOption("-stats", args); + if (!args.isEmpty()) { + System.err.print("Can't understand arguments: " + + Joiner.on(" ").join(args) + "\n"); + System.err.println("Usage is " + getShortUsage()); + return 1; + } + DistributedFileSystem dfs = getDFS(conf); + TableListing.Builder builder = new TableListing.Builder(). + addField("NAME", Justification.LEFT). + addField("OWNER", Justification.LEFT). + addField("GROUP", Justification.LEFT). + addField("MODE", Justification.LEFT). + addField("LIMIT", Justification.RIGHT). + addField("MAXTTL", Justification.RIGHT); + if (printStats) { + builder. + addField("BYTES_NEEDED", Justification.RIGHT). + addField("BYTES_CACHED", Justification.RIGHT). + addField("BYTES_OVERLIMIT", Justification.RIGHT). + addField("FILES_NEEDED", Justification.RIGHT). + addField("FILES_CACHED", Justification.RIGHT); + } + TableListing listing = builder.build(); + int numResults = 0; + try { + RemoteIterator iter = dfs.listCachePools(); + while (iter.hasNext()) { + CachePoolEntry entry = iter.next(); + CachePoolInfo info = entry.getInfo(); + LinkedList row = new LinkedList(); + if (name == null || info.getPoolName().equals(name)) { + row.add(info.getPoolName()); + row.add(info.getOwnerName()); + row.add(info.getGroupName()); + row.add(info.getMode() != null ? info.getMode().toString() : null); + Long limit = info.getLimit(); + String limitString; + if (limit != null && limit.equals(CachePoolInfo.LIMIT_UNLIMITED)) { + limitString = "unlimited"; + } else { + limitString = "" + limit; + } + row.add(limitString); + Long maxTtl = info.getMaxRelativeExpiryMs(); + String maxTtlString = null; + + if (maxTtl != null) { + if (maxTtl.longValue() == CachePoolInfo.RELATIVE_EXPIRY_NEVER) { + maxTtlString = "never"; + } else { + maxTtlString = DFSUtil.durationToString(maxTtl); + } + } + row.add(maxTtlString); + if (printStats) { + CachePoolStats stats = entry.getStats(); + row.add(Long.toString(stats.getBytesNeeded())); + row.add(Long.toString(stats.getBytesCached())); + row.add(Long.toString(stats.getBytesOverlimit())); + row.add(Long.toString(stats.getFilesNeeded())); + row.add(Long.toString(stats.getFilesCached())); + } + listing.addRow(row.toArray(new String[] {})); + ++numResults; + if (name != null) { + break; + } + } + } + } catch (IOException e) { + System.err.println(prettifyException(e)); + return 2; + } + System.out.print(String.format("Found %d result%s.\n", numResults, + (numResults == 1 ? "" : "s"))); + if (numResults > 0) { + System.out.print(listing); + } + // If there are no results, we return 1 (failure exit code); + // otherwise we return 0 (success exit code). + return (numResults == 0) ? 1 : 0; + } + } + + private static class HelpCommand implements Command { + @Override + public String getName() { + return "-help"; + } + + @Override + public String getShortUsage() { + return "[-help ]\n"; + } + + @Override + public String getLongUsage() { + TableListing listing = getOptionDescriptionListing(); + listing.addRow("", "The command for which to get " + + "detailed help. If no command is specified, print detailed help for " + + "all commands"); + return getShortUsage() + "\n" + + "Get detailed help about a command.\n\n" + + listing.toString(); + } + + @Override + public int run(Configuration conf, List args) throws IOException { + if (args.size() == 0) { + for (Command command : COMMANDS) { + System.err.println(command.getLongUsage()); + } + return 0; + } + if (args.size() != 1) { + System.out.println("You must give exactly one argument to -help."); + return 0; + } + String commandName = args.get(0); + // prepend a dash to match against the command names + Command command = determineCommand("-"+commandName); + if (command == null) { + System.err.print("Sorry, I don't know the command '" + + commandName + "'.\n"); + System.err.print("Valid help command names are:\n"); + String separator = ""; + for (Command c : COMMANDS) { + System.err.print(separator + c.getName().substring(1)); + separator = ", "; + } + System.err.print("\n"); + return 1; + } + System.err.print(command.getLongUsage()); + return 0; + } + } + + private static Command[] COMMANDS = { + new AddCacheDirectiveInfoCommand(), + new ModifyCacheDirectiveInfoCommand(), + new ListCacheDirectiveInfoCommand(), + new RemoveCacheDirectiveInfoCommand(), + new RemoveCacheDirectiveInfosCommand(), + new AddCachePoolCommand(), + new ModifyCachePoolCommand(), + new RemoveCachePoolCommand(), + new ListCachePoolsCommand(), + new HelpCommand(), + }; + + private static void printUsage(boolean longUsage) { + System.err.println( + "Usage: bin/hdfs cacheadmin [COMMAND]"); + for (Command command : COMMANDS) { + if (longUsage) { + System.err.print(command.getLongUsage()); + } else { + System.err.print(" " + command.getShortUsage()); + } + } + System.err.println(); + } + + private static Command determineCommand(String commandName) { + for (int i = 0; i < COMMANDS.length; i++) { + if (COMMANDS[i].getName().equals(commandName)) { + return COMMANDS[i]; + } + } + return null; + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/TableListing.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/TableListing.java new file mode 100644 index 00000000000..cfa409309e1 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/TableListing.java @@ -0,0 +1,284 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.tools; + +import java.util.ArrayList; +import java.util.LinkedList; + +import org.apache.commons.lang.StringUtils; +import org.apache.commons.lang.WordUtils; +import org.apache.hadoop.classification.InterfaceAudience; + +/** + * This class implements a "table listing" with column headers. + * + * Example: + * + * NAME OWNER GROUP MODE WEIGHT + * pool1 andrew andrew rwxr-xr-x 100 + * pool2 andrew andrew rwxr-xr-x 100 + * pool3 andrew andrew rwxr-xr-x 100 + * + */ +@InterfaceAudience.Private +public class TableListing { + public enum Justification { + LEFT, + RIGHT; + } + + private static class Column { + private final ArrayList rows; + private final Justification justification; + private final boolean wrap; + + private int wrapWidth = Integer.MAX_VALUE; + private int maxWidth; + + Column(String title, Justification justification, boolean wrap) { + this.rows = new ArrayList(); + this.justification = justification; + this.wrap = wrap; + this.maxWidth = 0; + addRow(title); + } + + private void addRow(String val) { + if (val == null) { + val = ""; + } + if ((val.length() + 1) > maxWidth) { + maxWidth = val.length() + 1; + } + // Ceiling at wrapWidth, because it'll get wrapped + if (maxWidth > wrapWidth) { + maxWidth = wrapWidth; + } + rows.add(val); + } + + private int getMaxWidth() { + return maxWidth; + } + + private void setWrapWidth(int width) { + wrapWidth = width; + // Ceiling the maxLength at wrapWidth + if (maxWidth > wrapWidth) { + maxWidth = wrapWidth; + } + // Else we need to traverse through and find the real maxWidth + else { + maxWidth = 0; + for (int i=0; i maxWidth) { + maxWidth = length; + } + } + } + } + + /** + * Return the ith row of the column as a set of wrapped strings, each at + * most wrapWidth in length. + */ + String[] getRow(int idx) { + String raw = rows.get(idx); + // Line-wrap if it's too long + String[] lines = new String[] {raw}; + if (wrap) { + lines = WordUtils.wrap(lines[0], wrapWidth, "\n", true).split("\n"); + } + for (int i=0; i columns = new LinkedList(); + private boolean showHeader = true; + private int wrapWidth = Integer.MAX_VALUE; + + /** + * Create a new Builder. + */ + public Builder() { + } + + public Builder addField(String title) { + return addField(title, Justification.LEFT, false); + } + + public Builder addField(String title, Justification justification) { + return addField(title, justification, false); + } + + public Builder addField(String title, boolean wrap) { + return addField(title, Justification.LEFT, wrap); + } + + /** + * Add a new field to the Table under construction. + * + * @param title Field title. + * @param justification Right or left justification. Defaults to left. + * @param wrap Width at which to auto-wrap the content of the cell. + * Defaults to Integer.MAX_VALUE. + * @return This Builder object + */ + public Builder addField(String title, Justification justification, + boolean wrap) { + columns.add(new Column(title, justification, wrap)); + return this; + } + + /** + * Whether to hide column headers in table output + */ + public Builder hideHeaders() { + this.showHeader = false; + return this; + } + + /** + * Whether to show column headers in table output. This is the default. + */ + public Builder showHeaders() { + this.showHeader = true; + return this; + } + + /** + * Set the maximum width of a row in the TableListing. Must have one or + * more wrappable fields for this to take effect. + */ + public Builder wrapWidth(int width) { + this.wrapWidth = width; + return this; + } + + /** + * Create a new TableListing. + */ + public TableListing build() { + return new TableListing(columns.toArray(new Column[0]), showHeader, + wrapWidth); + } + } + + private final Column columns[]; + + private int numRows; + private boolean showHeader; + private int wrapWidth; + + TableListing(Column columns[], boolean showHeader, int wrapWidth) { + this.columns = columns; + this.numRows = 0; + this.showHeader = showHeader; + this.wrapWidth = wrapWidth; + } + + /** + * Add a new row. + * + * @param row The row of objects to add-- one per column. + */ + public void addRow(String... row) { + if (row.length != columns.length) { + throw new RuntimeException("trying to add a row with " + row.length + + " columns, but we have " + columns.length + " columns."); + } + for (int i = 0; i < columns.length; i++) { + columns[i].addRow(row[i]); + } + numRows++; + } + + @Override + public String toString() { + StringBuilder builder = new StringBuilder(); + // Calculate the widths of each column based on their maxWidths and + // the wrapWidth for the entire table + int width = (columns.length-1)*2; // inter-column padding + for (int i=0; i wrapWidth) { + boolean modified = false; + for (int i=0; i 4) { + column.setWrapWidth(maxWidth-1); + modified = true; + width -= 1; + if (width <= wrapWidth) { + break; + } + } + } + } + if (!modified) { + break; + } + } + + int startrow = 0; + if (!showHeader) { + startrow = 1; + } + String[][] columnLines = new String[columns.length][]; + for (int i = startrow; i < numRows + 1; i++) { + int maxColumnLines = 0; + for (int j = 0; j < columns.length; j++) { + columnLines[j] = columns[j].getRow(i); + if (columnLines[j].length > maxColumnLines) { + maxColumnLines = columnLines[j].length; + } + } + + for (int c = 0; c < maxColumnLines; c++) { + // First column gets no left-padding + String prefix = ""; + for (int j = 0; j < columns.length; j++) { + // Prepend padding + builder.append(prefix); + prefix = " "; + if (columnLines[j].length > c) { + builder.append(columnLines[j][c]); + } else { + builder.append(StringUtils.repeat(" ", columns[j].maxWidth)); + } + } + builder.append("\n"); + } + } + return builder.toString(); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/offlineImageViewer/ImageLoaderCurrent.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/offlineImageViewer/ImageLoaderCurrent.java index b5d8ec4b1f1..c529fb5cdc2 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/offlineImageViewer/ImageLoaderCurrent.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/tools/offlineImageViewer/ImageLoaderCurrent.java @@ -127,7 +127,7 @@ class ImageLoaderCurrent implements ImageLoader { new SimpleDateFormat("yyyy-MM-dd HH:mm"); private static int[] versions = { -16, -17, -18, -19, -20, -21, -22, -23, -24, -25, -26, -27, -28, -30, -31, -32, -33, -34, -35, -36, -37, -38, -39, - -40, -41, -42, -43, -44, -45, -46, -47, -48, -49, -50 }; + -40, -41, -42, -43, -44, -45, -46, -47, -48, -49, -50, -51 }; private int imageVersion = 0; private final Map subtreeMap = new HashMap(); @@ -220,6 +220,9 @@ class ImageLoaderCurrent implements ImageLoader { processDelegationTokens(in, v); } + if (LayoutVersion.supports(Feature.CACHING, imageVersion)) { + processCacheManagerState(in, v); + } v.leaveEnclosingElement(); // FSImage done = true; } finally { @@ -231,6 +234,25 @@ class ImageLoaderCurrent implements ImageLoader { } } + /** + * Process CacheManager state from the fsimage. + */ + private void processCacheManagerState(DataInputStream in, ImageVisitor v) + throws IOException { + v.visit(ImageElement.CACHE_NEXT_ENTRY_ID, in.readLong()); + final int numPools = in.readInt(); + for (int i=0; i l = subtrees.get(name); if (l.size() != 1) { throw new InvalidXmlException("More than one value found for " + name); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/web/JsonUtil.java b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/web/JsonUtil.java index 1711ece158f..fab49274367 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/web/JsonUtil.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/java/org/apache/hadoop/hdfs/web/JsonUtil.java @@ -293,6 +293,8 @@ public class JsonUtil { m.put("dfsUsed", datanodeinfo.getDfsUsed()); m.put("remaining", datanodeinfo.getRemaining()); m.put("blockPoolUsed", datanodeinfo.getBlockPoolUsed()); + m.put("cacheCapacity", datanodeinfo.getCacheCapacity()); + m.put("cacheUsed", datanodeinfo.getCacheUsed()); m.put("lastUpdate", datanodeinfo.getLastUpdate()); m.put("xceiverCount", datanodeinfo.getXceiverCount()); m.put("networkLocation", datanodeinfo.getNetworkLocation()); @@ -300,17 +302,37 @@ public class JsonUtil { return m; } + private static int getInt(Map m, String key, final int defaultValue) { + Object value = m.get(key); + if (value == null) { + return defaultValue; + } + return (int) (long) (Long) value; + } + + private static long getLong(Map m, String key, final long defaultValue) { + Object value = m.get(key); + if (value == null) { + return defaultValue; + } + return (long) (Long) value; + } + + private static String getString(Map m, String key, + final String defaultValue) { + Object value = m.get(key); + if (value == null) { + return defaultValue; + } + return (String) value; + } + /** Convert a Json map to an DatanodeInfo object. */ static DatanodeInfo toDatanodeInfo(final Map m) throws IOException { if (m == null) { return null; } - - Object infoSecurePort = m.get("infoSecurePort"); - if (infoSecurePort == null) { - infoSecurePort = 0l; // same as the default value in hdfs.proto - } // ipAddr and xferPort are the critical fields for accessing data. // If any one of the two is missing, an exception needs to be thrown. @@ -353,17 +375,19 @@ public class JsonUtil { (String)m.get("storageID"), xferPort, (int)(long)(Long)m.get("infoPort"), - (int)(long)(Long)infoSecurePort, + getInt(m, "infoSecurePort", 0), (int)(long)(Long)m.get("ipcPort"), - (Long)m.get("capacity"), - (Long)m.get("dfsUsed"), - (Long)m.get("remaining"), - (Long)m.get("blockPoolUsed"), - (Long)m.get("lastUpdate"), - (int)(long)(Long)m.get("xceiverCount"), - (String)m.get("networkLocation"), - AdminStates.valueOf((String)m.get("adminState"))); + getLong(m, "capacity", 0l), + getLong(m, "dfsUsed", 0l), + getLong(m, "remaining", 0l), + getLong(m, "blockPoolUsed", 0l), + getLong(m, "cacheCapacity", 0l), + getLong(m, "cacheUsed", 0l), + getLong(m, "lastUpdate", 0l), + getInt(m, "xceiverCount", 0), + getString(m, "networkLocation", ""), + AdminStates.valueOf(getString(m, "adminState", "NORMAL"))); } /** Convert a DatanodeInfo[] to a Json array. */ @@ -410,6 +434,7 @@ public class JsonUtil { m.put("startOffset", locatedblock.getStartOffset()); m.put("block", toJsonMap(locatedblock.getBlock())); m.put("locations", toJsonArray(locatedblock.getLocations())); + m.put("cachedLocations", toJsonArray(locatedblock.getCachedLocations())); return m; } @@ -424,9 +449,11 @@ public class JsonUtil { (Object[])m.get("locations")); final long startOffset = (Long)m.get("startOffset"); final boolean isCorrupt = (Boolean)m.get("isCorrupt"); + final DatanodeInfo[] cachedLocations = toDatanodeInfoArray( + (Object[])m.get("cachedLocations")); final LocatedBlock locatedblock = new LocatedBlock(b, locations, - null, null, startOffset, isCorrupt); + null, null, startOffset, isCorrupt, cachedLocations); locatedblock.setBlockToken(toBlockToken((Map)m.get("blockToken"))); return locatedblock; } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/native/libhdfs/hdfs.c b/hadoop-hdfs-project/hadoop-hdfs/src/main/native/libhdfs/hdfs.c index 07088d09c41..e519f35de83 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/native/libhdfs/hdfs.c +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/native/libhdfs/hdfs.c @@ -2375,7 +2375,7 @@ static int translateZCRException(JNIEnv *env, jthrowable exc) ret = EPROTONOSUPPORT; goto done; } - ret = printExceptionAndFree(env, jthr, PRINT_EXC_ALL, + ret = printExceptionAndFree(env, exc, PRINT_EXC_ALL, "hadoopZeroCopyRead: ZeroCopyCursor#read failed"); done: free(className); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/ClientNamenodeProtocol.proto b/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/ClientNamenodeProtocol.proto index fda60857ce1..c7a6465f11f 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/ClientNamenodeProtocol.proto +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/ClientNamenodeProtocol.proto @@ -364,6 +364,122 @@ message IsFileClosedResponseProto { required bool result = 1; } +message CacheDirectiveInfoProto { + optional int64 id = 1; + optional string path = 2; + optional uint32 replication = 3; + optional string pool = 4; + optional CacheDirectiveInfoExpirationProto expiration = 5; +} + +message CacheDirectiveInfoExpirationProto { + required int64 millis = 1; + required bool isRelative = 2; +} + +message CacheDirectiveStatsProto { + required int64 bytesNeeded = 1; + required int64 bytesCached = 2; + required int64 filesNeeded = 3; + required int64 filesCached = 4; + required bool hasExpired = 5; +} + +enum CacheFlagProto { + FORCE = 0x01; // Ignore pool resource limits +} + +message AddCacheDirectiveRequestProto { + required CacheDirectiveInfoProto info = 1; + optional uint32 cacheFlags = 2; // bits set using CacheFlag +} + +message AddCacheDirectiveResponseProto { + required int64 id = 1; +} + +message ModifyCacheDirectiveRequestProto { + required CacheDirectiveInfoProto info = 1; + optional uint32 cacheFlags = 2; // bits set using CacheFlag +} + +message ModifyCacheDirectiveResponseProto { +} + +message RemoveCacheDirectiveRequestProto { + required int64 id = 1; +} + +message RemoveCacheDirectiveResponseProto { +} + +message ListCacheDirectivesRequestProto { + required int64 prevId = 1; + required CacheDirectiveInfoProto filter = 2; +} + +message CacheDirectiveEntryProto { + required CacheDirectiveInfoProto info = 1; + required CacheDirectiveStatsProto stats = 2; +} + +message ListCacheDirectivesResponseProto { + repeated CacheDirectiveEntryProto elements = 1; + required bool hasMore = 2; +} + +message CachePoolInfoProto { + optional string poolName = 1; + optional string ownerName = 2; + optional string groupName = 3; + optional int32 mode = 4; + optional int64 limit = 5; + optional int64 maxRelativeExpiry = 6; +} + +message CachePoolStatsProto { + required int64 bytesNeeded = 1; + required int64 bytesCached = 2; + required int64 bytesOverlimit = 3; + required int64 filesNeeded = 4; + required int64 filesCached = 5; +} + +message AddCachePoolRequestProto { + required CachePoolInfoProto info = 1; +} + +message AddCachePoolResponseProto { // void response +} + +message ModifyCachePoolRequestProto { + required CachePoolInfoProto info = 1; +} + +message ModifyCachePoolResponseProto { // void response +} + +message RemoveCachePoolRequestProto { + required string poolName = 1; +} + +message RemoveCachePoolResponseProto { // void response +} + +message ListCachePoolsRequestProto { + required string prevPoolName = 1; +} + +message ListCachePoolsResponseProto { + repeated CachePoolEntryProto entries = 1; + required bool hasMore = 2; +} + +message CachePoolEntryProto { + required CachePoolInfoProto info = 1; + required CachePoolStatsProto stats = 2; +} + message GetFileLinkInfoRequestProto { required string src = 1; } @@ -546,6 +662,22 @@ service ClientNamenodeProtocol { returns(ListCorruptFileBlocksResponseProto); rpc metaSave(MetaSaveRequestProto) returns(MetaSaveResponseProto); rpc getFileInfo(GetFileInfoRequestProto) returns(GetFileInfoResponseProto); + rpc addCacheDirective(AddCacheDirectiveRequestProto) + returns (AddCacheDirectiveResponseProto); + rpc modifyCacheDirective(ModifyCacheDirectiveRequestProto) + returns (ModifyCacheDirectiveResponseProto); + rpc removeCacheDirective(RemoveCacheDirectiveRequestProto) + returns (RemoveCacheDirectiveResponseProto); + rpc listCacheDirectives(ListCacheDirectivesRequestProto) + returns (ListCacheDirectivesResponseProto); + rpc addCachePool(AddCachePoolRequestProto) + returns(AddCachePoolResponseProto); + rpc modifyCachePool(ModifyCachePoolRequestProto) + returns(ModifyCachePoolResponseProto); + rpc removeCachePool(RemoveCachePoolRequestProto) + returns(RemoveCachePoolResponseProto); + rpc listCachePools(ListCachePoolsRequestProto) + returns(ListCachePoolsResponseProto); rpc getFileLinkInfo(GetFileLinkInfoRequestProto) returns(GetFileLinkInfoResponseProto); rpc getContentSummary(GetContentSummaryRequestProto) diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/DatanodeProtocol.proto b/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/DatanodeProtocol.proto index 21bc7164743..473959ccae0 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/DatanodeProtocol.proto +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/DatanodeProtocol.proto @@ -70,6 +70,7 @@ message DatanodeCommandProto { RegisterCommand = 5; UnusedUpgradeCommand = 6; NullDatanodeCommand = 7; + BlockIdCommand = 8; } required Type cmdType = 1; // Type of the command @@ -82,6 +83,7 @@ message DatanodeCommandProto { optional FinalizeCommandProto finalizeCmd = 5; optional KeyUpdateCommandProto keyUpdateCmd = 6; optional RegisterCommandProto registerCmd = 7; + optional BlockIdCommandProto blkIdCmd = 8; } /** @@ -102,7 +104,7 @@ message BlockCommandProto { enum Action { TRANSFER = 1; // Transfer blocks to another datanode INVALIDATE = 2; // Invalidate blocks - SHUTDOWN = 3; // Shutdown the datanode + SHUTDOWN = 3; // Shutdown the datanode } required Action action = 1; @@ -112,6 +114,20 @@ message BlockCommandProto { repeated StorageUuidsProto targetStorageUuids = 5; } +/** + * Command to instruct datanodes to perform certain action + * on the given set of block IDs. + */ +message BlockIdCommandProto { + enum Action { + CACHE = 1; + UNCACHE = 2; + } + required Action action = 1; + required string blockPoolId = 2; + repeated uint64 blockIds = 3 [packed=true]; +} + /** * List of blocks to be recovered by the datanode */ @@ -165,6 +181,8 @@ message RegisterDatanodeResponseProto { * xmitsInProgress - number of transfers from this datanode to others * xceiverCount - number of active transceiver threads * failedVolumes - number of failed volumes + * cacheCapacity - total cache capacity available at the datanode + * cacheUsed - amount of cache used */ message HeartbeatRequestProto { required DatanodeRegistrationProto registration = 1; // Datanode info @@ -172,6 +190,8 @@ message HeartbeatRequestProto { optional uint32 xmitsInProgress = 3 [ default = 0 ]; optional uint32 xceiverCount = 4 [ default = 0 ]; optional uint32 failedVolumes = 5 [ default = 0 ]; + optional uint64 cacheCapacity = 6 [ default = 0 ]; + optional uint64 cacheUsed = 7 [default = 0 ]; } message StorageReportProto { @@ -209,9 +229,11 @@ message HeartbeatResponseProto { /** * registration - datanode registration information * blockPoolID - block pool ID of the reported blocks - * blocks - each block is represented as two longs in the array. + * blocks - each block is represented as multiple longs in the array. * first long represents block ID * second long represents length + * third long represents gen stamp + * fourth long (if under construction) represents replica state */ message BlockReportRequestProto { required DatanodeRegistrationProto registration = 1; @@ -234,6 +256,21 @@ message BlockReportResponseProto { optional DatanodeCommandProto cmd = 1; } +/** + * registration - datanode registration information + * blockPoolId - block pool ID of the reported blocks + * blocks - representation of blocks as longs for efficiency reasons + */ +message CacheReportRequestProto { + required DatanodeRegistrationProto registration = 1; + required string blockPoolId = 2; + repeated uint64 blocks = 3 [packed=true]; +} + +message CacheReportResponseProto { + optional DatanodeCommandProto cmd = 1; +} + /** * Data structure to send received or deleted block information * from datanode to namenode. @@ -351,6 +388,11 @@ service DatanodeProtocolService { */ rpc blockReport(BlockReportRequestProto) returns(BlockReportResponseProto); + /** + * Report cached blocks at a datanode to the namenode + */ + rpc cacheReport(CacheReportRequestProto) returns(CacheReportResponseProto); + /** * Incremental block report from the DN. This contains info about recently * received and deleted blocks, as well as when blocks start being diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/hdfs.proto b/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/hdfs.proto index ae271f9623c..b903008a2d7 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/hdfs.proto +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/proto/hdfs.proto @@ -86,6 +86,8 @@ message DatanodeInfoProto { } optional AdminState adminState = 10 [default = NORMAL]; + optional uint64 cacheCapacity = 11 [default = 0]; + optional uint64 cacheUsed = 12 [default = 0]; } /** @@ -144,6 +146,7 @@ message LocatedBlockProto { // their locations are not part of this object required hadoop.common.TokenProto blockToken = 5; + repeated bool isCached = 6 [packed=true]; // if a location in locs is cached repeated StorageTypeProto storageTypes = 7; repeated string storageIDs = 8; } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml b/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml index 1d4ee630b7f..24f0b03c0b1 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml +++ b/hadoop-hdfs-project/hadoop-hdfs/src/main/resources/hdfs-default.xml @@ -1475,6 +1475,102 @@ + + dfs.namenode.path.based.cache.block.map.allocation.percent + 0.25 + + The percentage of the Java heap which we will allocate to the cached blocks + map. The cached blocks map is a hash map which uses chained hashing. + Smaller maps may be accessed more slowly if the number of cached blocks is + large; larger maps will consume more memory. + + + + + dfs.datanode.max.locked.memory + 0 + + The amount of memory in bytes to use for caching of block replicas in + memory on the datanode. The datanode's maximum locked memory soft ulimit + (RLIMIT_MEMLOCK) must be set to at least this value, else the datanode + will abort on startup. + + By default, this parameter is set to 0, which disables in-memory caching. + + If the native libraries are not available to the DataNode, this + configuration has no effect. + + + + + dfs.namenode.list.cache.directives.num.responses + 100 + + This value controls the number of cache directives that the NameNode will + send over the wire in response to a listDirectives RPC. + + + + + dfs.namenode.list.cache.pools.num.responses + 100 + + This value controls the number of cache pools that the NameNode will + send over the wire in response to a listPools RPC. + + + + + dfs.namenode.path.based.cache.refresh.interval.ms + 300000 + + The amount of milliseconds between subsequent path cache rescans. Path + cache rescans are when we calculate which blocks should be cached, and on + what datanodes. + + By default, this parameter is set to 300000, which is five minutes. + + + + + dfs.namenode.path.based.cache.retry.interval.ms + 60000 + + When the NameNode needs to uncache something that is cached, or cache + something that is not cached, it must direct the DataNodes to do so by + sending a DNA_CACHE or DNA_UNCACHE command in response to a DataNode + heartbeat. This parameter controls how frequently the NameNode will + resend these commands. + + + + + dfs.datanode.fsdatasetcache.max.threads.per.volume + 4 + + The maximum number of threads per volume to use for caching new data + on the datanode. These threads consume both I/O and CPU. This can affect + normal datanode operations. + + + + + dfs.cachereport.intervalMsec + 10000 + + Determines cache reporting interval in milliseconds. After this amount of + time, the DataNode sends a full report of its cache state to the NameNode. + The NameNode uses the cache report to update its map of cached blocks to + DataNode locations. + + This configuration has no effect if in-memory caching has been disabled by + setting dfs.datanode.max.locked.memory to 0 (which is the default). + + If the native libraries are not available to the DataNode, this + configuration has no effect. + + + dfs.namenode.edit.log.autoroll.multiplier.threshold 2.0 diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/site/apt/CentralizedCacheManagement.apt.vm b/hadoop-hdfs-project/hadoop-hdfs/src/site/apt/CentralizedCacheManagement.apt.vm new file mode 100644 index 00000000000..30ddf68a52f --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/site/apt/CentralizedCacheManagement.apt.vm @@ -0,0 +1,301 @@ +~~ Licensed under the Apache License, Version 2.0 (the "License"); +~~ you may not use this file except in compliance with the License. +~~ You may obtain a copy of the License at +~~ +~~ http://www.apache.org/licenses/LICENSE-2.0 +~~ +~~ Unless required by applicable law or agreed to in writing, software +~~ distributed under the License is distributed on an "AS IS" BASIS, +~~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +~~ See the License for the specific language governing permissions and +~~ limitations under the License. See accompanying LICENSE file. + + --- + Hadoop Distributed File System-${project.version} - Centralized Cache Management in HDFS + --- + --- + ${maven.build.timestamp} + +Centralized Cache Management in HDFS + + \[ {{{./index.html}Go Back}} \] + +%{toc|section=1|fromDepth=2|toDepth=4} + +* {Background} + + Normally, HDFS relies on the operating system to cache data it reads from disk. + However, HDFS can also be configured to use centralized cache management. Under + centralized cache management, the HDFS NameNode itself decides which blocks + should be cached, and where they should be cached. + + Centralized cache management has several advantages. First of all, it + prevents frequently used block files from being evicted from memory. This is + particularly important when the size of the working set exceeds the size of + main memory, which is true for many big data applications. Secondly, when + HDFS decides what should be cached, it can let clients know about this + information through the getFileBlockLocations API. Finally, when the DataNode + knows a block is locked into memory, it can provide access to that block via + mmap. + +* {Use Cases} + + Centralized cache management is most useful for files which are accessed very + often. For example, a "fact table" in Hive which is often used in joins is a + good candidate for caching. On the other hand, when running a classic + "word count" MapReduce job which counts the number of words in each + document, there may not be any good candidates for caching, since all the + files may be accessed exactly once. + +* {Architecture} + +[images/caching.png] Caching Architecture + + With centralized cache management, the NameNode coordinates all caching + across the cluster. It receives cache information from each DataNode via the + cache report, a periodic message that describes all the blocks IDs cached on + a given DataNode. The NameNode will reply to DataNode heartbeat messages + with commands telling it which blocks to cache and which to uncache. + + The NameNode stores a set of path cache directives, which tell it which files + to cache. The NameNode also stores a set of cache pools, which are groups of + cache directives. These directives and pools are persisted to the edit log + and fsimage, and will be loaded if the cluster is restarted. + + Periodically, the NameNode rescans the namespace, to see which blocks need to + be cached based on the current set of path cache directives. Rescans are also + triggered by relevant user actions, such as adding or removing a cache + directive or removing a cache pool. + + Cache directives also may specific a numeric cache replication, which is the + number of replicas to cache. This number may be equal to or smaller than the + file's block replication. If multiple cache directives cover the same file + with different cache replication settings, then the highest cache replication + setting is applied. + + We do not currently cache blocks which are under construction, corrupt, or + otherwise incomplete. If a cache directive covers a symlink, the symlink + target is not cached. + + Caching is currently done on a per-file basis, although we would like to add + block-level granularity in the future. + +* {Interface} + + The NameNode stores a list of "cache directives." These directives contain a + path as well as the number of times blocks in that path should be replicated. + + Paths can be either directories or files. If the path specifies a file, that + file is cached. If the path specifies a directory, all the files in the + directory will be cached. However, this process is not recursive-- only the + direct children of the directory will be cached. + +** {hdfs cacheadmin Shell} + + Path cache directives can be created by the <<>> command and removed via the <<>> command. To list the current path cache directives, use + <<>>. Each path cache directive has a + unique 64-bit ID number which will not be reused if it is deleted. To remove + all path cache directives with a specified path, use <<>>. + + Directives are grouped into "cache pools." Each cache pool gets a share of + the cluster's resources. Additionally, cache pools are used for + authentication. Cache pools have a mode, user, and group, similar to regular + files. The same authentication rules are applied as for normal files. So, for + example, if the mode is 0777, any user can add or remove directives from the + cache pool. If the mode is 0644, only the owner can write to the cache pool, + but anyone can read from it. And so forth. + + Cache pools are identified by name. They can be created by the <<>> command, modified by the <<>> command, and removed via the <<>> command. To list the current cache pools, use <<>> + +*** {addDirective} + + Usage: << -replication -pool >>> + + Add a new cache directive. + +*--+--+ +\ | A path to cache. The path can be a directory or a file. +*--+--+ +\ | The cache replication factor to use. Defaults to 1. +*--+--+ +\ | The pool to which the directive will be added. You must have write permission on the cache pool in order to add new directives. +*--+--+ + +*** {removeDirective} + + Usage: << >>> + + Remove a cache directive. + +*--+--+ +\ | The id of the cache directive to remove. You must have write permission on the pool of the directive in order to remove it. To see a list of cachedirective IDs, use the -listDirectives command. +*--+--+ + +*** {removeDirectives} + + Usage: << >>> + + Remove every cache directive with the specified path. + +*--+--+ +\ | The path of the cache directives to remove. You must have write permission on the pool of the directive in order to remove it. To see a list of cache directives, use the -listDirectives command. +*--+--+ + +*** {listDirectives} + + Usage: <<] [-pool ] >>> + + List cache directives. + +*--+--+ +\ | List only cache directives with this path. Note that if there is a cache directive for in a cache pool that we don't have read access for, it will not be listed. +*--+--+ +\ | List only path cache directives in that pool. +*--+--+ + +*** {addPool} + + Usage: << [-owner ] [-group ] [-mode ] [-weight ] >>> + + Add a new cache pool. + +*--+--+ +\ | Name of the new pool. +*--+--+ +\ | Username of the owner of the pool. Defaults to the current user. +*--+--+ +\ | Group of the pool. Defaults to the primary group name of the current user. +*--+--+ +\ | UNIX-style permissions for the pool. Permissions are specified in octal, e.g. 0755. By default, this is set to 0755. +*--+--+ +\ | Weight of the pool. This is a relative measure of the importance of the pool used during cache resource management. By default, it is set to 100. +*--+--+ + +*** {modifyPool} + + Usage: << [-owner ] [-group ] [-mode ] [-weight ] >>> + + Modifies the metadata of an existing cache pool. + +*--+--+ +\ | Name of the pool to modify. +*--+--+ +\ | Username of the owner of the pool. +*--+--+ +\ | Groupname of the group of the pool. +*--+--+ +\ | Unix-style permissions of the pool in octal. +*--+--+ +\ | Weight of the pool. +*--+--+ + +*** {removePool} + + Usage: << >>> + + Remove a cache pool. This also uncaches paths associated with the pool. + +*--+--+ +\ | Name of the cache pool to remove. +*--+--+ + +*** {listPools} + + Usage: <<>> + + Display information about one or more cache pools, e.g. name, owner, group, + permissions, etc. + +*--+--+ +\ | If specified, list only the named cache pool. +*--+--+ + +*** {help} + + Usage: << >>> + + Get detailed help about a command. + +*--+--+ +\ | The command for which to get detailed help. If no command is specified, print detailed help for all commands. +*--+--+ + +* {Configuration} + +** {Native Libraries} + + In order to lock block files into memory, the DataNode relies on native JNI + code found in <<>>. Be sure to + {{{../hadoop-common/NativeLibraries.html}enable JNI}} if you are using HDFS + centralized cache management. + +** {Configuration Properties} + +*** Required + + Be sure to configure the following: + + * dfs.datanode.max.locked.memory + + The DataNode will treat this as the maximum amount of memory it can use for + its cache. When setting this value, please remember that you will need space + in memory for other things, such as the Java virtual machine (JVM) itself + and the operating system's page cache. + +*** Optional + + The following properties are not required, but may be specified for tuning: + + * dfs.namenode.path.based.cache.refresh.interval.ms + + The NameNode will use this as the amount of milliseconds between subsequent + path cache rescans. This calculates the blocks to cache and each DataNode + containing a replica of the block that should cache it. + + By default, this parameter is set to 300000, which is five minutes. + + * dfs.datanode.fsdatasetcache.max.threads.per.volume + + The DataNode will use this as the maximum number of threads per volume to + use for caching new data. + + By default, this parameter is set to 4. + + * dfs.cachereport.intervalMsec + + The DataNode will use this as the amount of milliseconds between sending a + full report of its cache state to the NameNode. + + By default, this parameter is set to 10000, which is 10 seconds. + + * dfs.namenode.path.based.cache.block.map.allocation.percent + + The percentage of the Java heap which we will allocate to the cached blocks + map. The cached blocks map is a hash map which uses chained hashing. + Smaller maps may be accessed more slowly if the number of cached blocks is + large; larger maps will consume more memory. The default is 0.25 percent. + +** {OS Limits} + + If you get the error "Cannot start datanode because the configured max + locked memory size... is more than the datanode's available RLIMIT_MEMLOCK + ulimit," that means that the operating system is imposing a lower limit + on the amount of memory that you can lock than what you have configured. To + fix this, you must adjust the ulimit -l value that the DataNode runs with. + Usually, this value is configured in <<>>. + However, it will vary depending on what operating system and distribution + you are using. + + You will know that you have correctly configured this value when you can run + <<>> from the shell and get back either a higher value than what + you have configured with <<>>, or the string + "unlimited," indicating that there is no limit. Note that it's typical for + <<>> to output the memory lock limit in KB, but + dfs.datanode.max.locked.memory must be specified in bytes. diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/site/resources/images/caching.png b/hadoop-hdfs-project/hadoop-hdfs/src/site/resources/images/caching.png new file mode 100644 index 0000000000000000000000000000000000000000..dbd0bd709c9e8291643bf91fda430ccba11d9a65 GIT binary patch literal 27615 zcmbTdWmuF^8!kGG0}MzEO6LI54btHNA`%kPDc#`^(#p^cf|Rs$w;(Asq?9NjAq)+I zbi;oAzP*uu`Bn zKnb0<-!~A*u}JButhV>uZacBDlb+9hdt%IBnvg(#*K@ZBs)rxPpSw-uCO-GzrgpOH zjY?tXtUXrd(o-sYMDmZ1?$lKe5B;pM@)b|g!{!TQW=p3?6$4&GW8wV(J-`l6Cg z6{2}Q>qjyUb{viPWY^~y)SqQj-HsA;?r+q~@YkQ2I{p#%tKMkJJ{h9~O!~k2i;7ye zqP#Dr)-MrtyvV+P(n|RXx1Z`rT&8zT>BGSnlV99kOqm3lQlEg`M~AzH*oty(Ul}2JK^n(K3t$rXq4{1{MST zhfJ!%5x@@`q~N^7>b!lN#5^?SW04i5QkbPvuKYG-)>0Zl;~>AowaMS7o`T0nL(*5} zWO^ah3~QKg1`s*IcU7xnQ-tF^2gDm@G5z|G%;#Z*NwYtGv%unNDa_g9-S{^ACk|wJ z`2vW8GgD1vD1gqyG*B8nVaSh!i;o#xH8rDRC{r_W&VNi)AD0lks>+V`*Afau&1;H%5KHnA3Ui5T23SDzr#kTCy7!-|LJi~H*#e}%nE98f$DiH!?MR3W?P&FU zD%bBgzCB~eTdpY~8ABCC#>dx@jP`wXK$$fsSGQ7M16}N+_8bQE;2wt?f;(-`Zac{1 z1wo*|8*-@pkXwww`zKwgL^G5$r-+CWNx!uC(K-Fn?^hCrkNDKF;1B0Hb$VrDb@udT@RS zxG*%|c7z%&?F`u^=4IOCTZczULFCfL3@k`A#_WBme!yrZuw-%wUdKLw=4al99c0In ztm~e`?&C>RODUqvRDJd2MNqk|)Hp|^&;Xf@XtqL<|5(59XcVXDJ4PRu!BOMc5PdIO z)jnm@`LwF*GxuwQH{{dZ}orHoH% zRoDqPSax#erRjTPY`LTpqZx2D_`l8D{LJ)tMO=gBU?zZg<~rJZbF{MVvi$RPOgoN> ze_LX;cvnBuZooMB5d})4Z<@e;&Kwi>+v~j55TkZ4#*K2-y-XSsG+*o?{J1>jT}WTw zric_2-E2arMg*3HBqb@pwMzs`*8H+<_vNKim7E_=l^7gz3G1A5%claAOhu+nREByI z;t~9uu3w;#Er-{2A5g08#v1gAN;{&|r+;SxS6Iv^ZOiQDUR+Mincf;dgz0?_?Z&r` za&r9|a7EI%oh|o_TKMv9|3P!G1(Vghz`fSu;k#Wp`B3%@ZHmw+kQ%5FtB;Ps$mCt1Y`}!!V}(832)VV zxsgCuSBiKWb>hN}Prh9T(9k@l>Q%|^#=7P0x^U1zYKr#3`jMGqdF1t`;vb}Fr<}#U z_4mKHv4ubQz0oIYxNnK`iG>yKcnsA=SFAz178&B6Z7UHEmdq zWowJ0)ArSJg`RxFx++h4w?utc3qSTfn;+V56Kr{75E^rKxGOmGWu$qyeCOa6T)94 z(9aY2$Q|$5=6mc9Sp%#m-(aMz^_Eo9kzQWO-mKb=i=+1!npCk_^JRwV!B0?dzr>2y zrhmpi8Quw@vv}$(+9)EwTdy{Pcj_)XvN0d9@>S4T+gb652w8YwPsCeUmCzEUS3)Sm zhrhC>jjh|xqJZ&+Nkez$FW=NrrZ+#pX=Q}9Xb-my^&{4qV2?e~CK1k)%zSkYo3N%s z`JsVJyb#}8WT_P}wQlRTQ!x0JeAyyc-9tyTh?iudsKi?c3xYb7B(@U`?`1c`{o-kw8C0;fUwEi3q!OeCWb`_@)U7 zb7nLmp(@M?yi7^6fQ1>gsKM-5)=u=H8$x3%Ojjf+h{1S-23sEp%-Cp-W#Z2i(S!sw z(?Ko7>tf%i$nGTGEmaaogmxMX#I(x@}00zxvw_8oMOD7A6_pPzMJ*+@_=}Wn^YcN(J*3UByk`@bp|5cG1 z>ZiD1Au>pwgEJVdQ&fqlbTHG71x1Pen(XN@em}4muR=fl^gPqYb1Z*5yZ_6}iR5_g z*S?oCcu4^qGa-Yt3Un(`PxrXY1x4+_g-YG$`y)OhR=kb7)0JeRv#Ewv7Qw9*1l!I1 z^=Avr!R-wuVt#;118bt$|m2t4!BEpB)-rap7}Ht z8tcYN_SLdRr&@>Yuu?6V_0JYe8vpicO8NdCmEh^mppuzA?W*SzlsbxIwnWnSHYQes zk89^##{M)6XaCK-`HGE#~5WIQcZer`Ia*5Q(QL^4$@*2h=T zpj^=C&aHyoMl#McUYSJ{*EC%)=IF9Kucni9(jf`7E2%=S{P`8t$V1lpcm9Ed;6$kSmV<70m+MlZT(WD;-0 z!vX?9z#zY<_OD7Bj!kh!jrHh1?jKADxatcgsQ#`fy|Qa1V@-zPeF}>8Perz}2SI{T zjo$QF@xGBe_?dCMmjp-g+nO+pF~NLQZI&vJ^XIG?1M;lBt*`?f-vEvd7vBeW_nR`#7X_DUao!R39^Jf{ z@_pLsIaQd75}`E1-^cUfIs$$;QE5zJIy1( z%nV=yajj#*YSIglgcY$cFPKVl_hMHEp5H$7Of{y$n7K85RtQ#y2TAXPV?dAMat}y^ zGtmV|TjmieugjMSh?y04`y$kc2F#KHgVCaOjYit)Zyvzd&LyeaC>M$l5pJ2M(s3Eb z3(Hoz5%m4FPUE8Z%BgN|-)&3Bg`Q{O8%jRv-qV-aAlXriG?i)#lSAyw&UGY9`n--a&{L%N)x%|7Wa;}y}?1w(y`8%SZ0;`qnB z`YX2|vxmZD?n>5*U-`PXH31?Sd4`PlnUBw8zUsU}b{ACFu#%ZIA*YM}&P~4^V3yXn ze*AI8+Dff!Mq?M63K1gHr5q`xQ-Nq1%=OO%AiM}4) z0#Ck_)BF#@9vBo9*ux1U@Z+kXxCeaz{nGrSy@daE7<%P{Wx+Zl{K}@S-Qt4Uy7P*$ z`j=D6P6OiakgJAiU9#l>+o&-%*o3Alp8#EHf=8i~dEDv2@|n_W=s-E}cVQc0*;U^0@#iri zf7K#sFI*_3ov<-x_TV9Ob~0Iza;<@7vjiWHm*snFke)wY<&#lbj&%M=JI#LElwVX z{K|*K%HWhpCLC=vo|f+;vf_!(Y9}TB3yQ!>ZIF0z>BMOSk9mFT*%HlZVmZ(9Gvhq- z4aP;=`aXojS@3h&X!E_utvPCPsJnN?zte%!5}h~cT`k9{;xT>IJ5d<(aoj9u;qIXm zcjHbLj_Oa&ygH}Jg+0bwm)?H%Ujr3cZyC%V4HwxOwQE4S15esb)fF}rCL6~n@)s*s z8k!2|H9pBhf_R8xkf}P;^ue4-;?4gu)tOpE!insz!a(I;5}>z z-$7>`R`gS8I2yg-oI-WveA9$S!2Zq^ddlO413-NK(sZ)A=8$R2*ZKPM=$1&vd`e6z z$D*mEz>v1xke_QxGYC{B7oCxHQmaDy_Fh$41%B@6?jF>p6JI@?8uO%&YaRJ^#JknM zexZEcRhqssksK6~DS<)j%>2n0URy8ac}f0Hn4(CrM~UPv?!nK+6dJNv$k`|`blnH?MYz=(Ww)6s+)81%})No`zx3L z{YxE;u&yoIlXhs2CLyOcK9i`ELZ(P#{)HfZts=nt4xM`-nH|kZ(N@PMEeSPoGHf6Gv|p)>Mw>Qr*kr7;dUee5x`{R1t0jEwNl~_}V3_Q%*mQ}>q`!XQY1Z?JfmLfO0%OQYTsV9edp5jvhsR%>*vLXu7s%i`9rZ8 z>&g7>O2K3X&U~Wst{+4wP*kjdZp+C~jWZApk2lR_FV)L|n8;mdSZvBoLNLJ%HlMVL zE7%iFZ{^t*fUe>+Y%mj-AMJ?$VSJm{bA6XGNDECaN3e_TS@3>=h6rF<+yM}}fb&cK zo(92G+K3A+2%kKi!Ksz&3P{6AL|*#N{XklOa7K-zc?dC#>=p))?vKbOkDunu2>5fy z4&}y>pC1mgf0MU;OGIAj9g#s#4~!u}^@ON#yEa9Sdm#L1-eB3j+=vL8eV@VEm_~~H z`Kaljyzh!|%2Sbsy5&s%y{R%Mu(@PCWkIXu*9Qb-+s4%###7%CW)z9L*F_+5v9lKh zB!HXwss*1q_s@w(l;|NFYipw~p%4S|WP+mtq#oBVE);^G3^SD_;G8At*w)HB*TexU zuwF{cN6hR|hHwHP83byLrDXCOeVaPFs9PG1rn8scdrw4F%O8#FXJ&Fle;*=H5S!W2 zVJkSo=KoavhX^*fugPV8mP!^Zo8tdxAq)W%(2MS;0t|7H3$__(=iNKSPukjx=fKcI zsG7-6i5>$MRr}15x-v!Q{VGMkZDJ&2RhLvmHw>D(t=&Hw_fu}}SV^Jila^UvpLWd? zwlpW4p^yW#nV-Qw>+nyK`Dz3TI%%AqHzEc+$1SjF%E=foyg27#Ig0NTV}AXBJy!P< zg~;Ldn-fbBAfw+!->JO@z^_2tTP_Y?yy)A&qd(5(mRK8eojqyDCLEmbhXxT9g2R4` z9rxwxW^9Kyv8OoQNtZ#i4s!D=u0mToX)4w)lN8tFOt4R6$n?J`tK+brmQj4>`5K&1 z`Jh5{ONhBm_vHt%>kzekWIuhwss`0(zmR5i@gLrqzbx8X`I%&pO-7x;BWMJRSMwli zcI@n8Gt*Ui=HtF6KNUo23$pKl&TGsB`{BFjvJkU(hVrYGc=_yb*r`7JId$P9*bpJk z85kD9JuaVrUHaszd9eMChL-z?euaqi$tsKEnpe$)BIxJA0S*HSwqki~(g-a6>W1Rz z0kgw=0J&XT-06tsqSabY^WdIm`Lfgp_qj^6pE}-wgECb}#beC1sEx5}<}{O|j(=Mu z1^^SD*Cyf{<=@y`CH6HjE>LX5pe!HZH^bbHGsu0Mia)Q;HLOK~EZD{4Y8hD%6fL!^ zBx?4uX+-yCl7%ruf1UMkvTW9!4#jDN2t$$uPXKyh0zgFOFK2T^Av) zLn-`w1Pm=Ukw?=`R3|LSu9vNL^Lq*;PvtY$1@BA%E-fM0e-XU#4&D4qm?mkqucm@p zweEbbNQvR~LibYT>$W;~8*n@?z!J50FLufs&ig)7O;yT4J`~wQ%QL~A&FJfvlJ6%z zfRejl&kn|4EA4nHCp7{-8kV{BEn!mG?S`z7n6xSxslE z9?ztX*(4Dw0Ss@gOpz2mBc_u$Dis047;Yu0=>#IuP9s}?G&=_M2J~trOLPu1y9i9> zbL&1PNs{RqP=Uu7PH$rW^gZ`&9k#{!5AS0tkJB{P?3eDOUui0+dyjrP67WcimJwyD zz7+D+NH49zl=B3IboZG~nEO2zZPf9Qa-g%K9bLF@9$0W!Uhr!Yg|!RqA*APFdeS zLF8fxYxZ779D3#h6pTRC8$CH*6N1x}{vSh<8vD%r>@pu^HB<5tVm5*lPWS6eW~&eh zp+9$J)9wSf7GQWEI1DCnnec_M+}jD`xi?=HlP&!mnLubx_m0=HIs|ZN2OeJqzk0lI zB}c*Udq(D_iEOEaBnc22&I)ze4_AajH(ph5)Y?tr!iV4r;%opT*|T+AT1P7|i_3w7 z7s9?_{_%+1T%8z)16arzEjzLaPmG$$2aZrd;c<2>_|5SSH}@{dRh`Ed)oDqWNgx3f z>7~x8?+Y7qZJdJ9IH#N1H#c@#%-f@koCfM&xMyzoSC@1)rs(H2i0Itv#Yo;r0MO#B zd2p@S#w}x=@)3+6nm3(f<#qZu*?$u^~Lfh_C;C0zn}VZDSA^Yo7{Wm!Kuh zKytlU9~4?7Ok^!yJWZRZc>(-LMiGbr>c4s5x6Ht26(R#v{ZCCWa325XzjApUwvVmj ziY6uuu^#SjPrL8hTR)j=h)7W@T1&Nmhvi4s3(XPg+GzBFLJUXKPQ7x;K=$fkf;&{n z)-jg;FT^)OM~iP5cT1x*Wn{X162B#{h|lkcExAg2p$23Kg)`qw$**pD+i#nv9{PKH zJT49Y#_Ddco~AgTJb$y|75~o+4I~y65^~RP%xcG4us><_+NaVDo@fEti_2LLdW82OqTPzrMLvKGo^u7@bY(90U z5fQ<7DfXiM)zfh60q5;=@90alH)a58JVu&&%<0go+tPzkkkN)UpUt&HUd2XiRAAJ7 z1RPGg>L=38^De_}n5Vi=Hp!ZQk<7k3MKJ)D88S&w)Vr_c^-!MSPftZN>MNv3HTQpt3lD+zLJ?wUwCULA zk}*M?yjd%kEZTMNM~gTz#S+6eyhbK`jC-b=x?uB(o+KtPW49$?nA8xD`5Flri%;f1 z_SNj~8+;&q6d7nJ5{8-2(ip8g_7v$bS990&AtPuCYnrjsLrS^trbGX{N0gYkVy(4? zhK?$e13_Pk=kP|ulgePlhX~V-QNGiw4oUSO8$Tf8we3Hw z7#EgaU-jts9sTtnRT$A1`rqZ-^m~TmWO(v!tac)`3Maq`MRTtbc%N!`3n;D(5EHbUhMT2|@sV0azha z;0EcwK_m&rtwiV-!;B(*xF9LZ|I;7{*rd5DU>MYU4D{a*;DGbP`ftMs_;2ZZfRFi) zllhNNLcmE)&u46JdoPX;l*TNH-(mbpDN=7gt;qH141t%s6mNM?jP5S-mky-V_9K@3 z++bq`O98_H{s9MylFAtOcc&DkE&m)^xIWxi|3I$z^y7|H{Dd^^sV+5VRSzR<)vM#M zkk6g|?$#HL^i{lGOu8ZZFeWsHFPRkSdcGK*Gd?KXw#?)F-&SDIf5!nI`{UJ%ofX@R zyLL7(s{87Rzhc*Y$P-HTGGq^a4~4V1JUQnpN+CQ7j<`gcR6=M3O(laZX9igfTdek!-^fZ_L-M%i?#YU z-wo18A9;-0_Ny1PiY5eN<@+;J#%6@rU zk|`Kf_5GsT4+k)+)bCpBbPkf*&yJ*51KLsN#sR5@dE!hX`rBWASl@mBj!Flsap zlgJkpf9s$b0t7L6ZWt$DCzB4xAhIm2ByqQM=X>eczVFzTR`PwFI=9hx0ZX_qlOwhD zKhT@VTLj~1-&FVCcIZR8d5nD+cbzGZVbBNJ%3)77cq5kP?xPT69MTzYc8u>sB*L?o z&jS9QK6V9DU5j?MGyhreQMhq@Nso28mzA|py8j$L?DZ&tgZEMu)r*o*J4hU7jYsjo z2E@K!SdA!*%z#mo#a?PMT5XS3wxkQ2w$NIW9gln@VJG?G|6 zF3NzzfHNS*0V^T;?NJR0I_}!3!r_5!rn8Zl zw{CAOB)G3GOb9WQNTNFO_pqxy1_Ss^3F!FnUSFCn3X?!re&mmJ-n23dMZ`luH%p@D zgE3Vkm$zrQdos!DS#0>RuHHu+D8vGh=>qw&T2jKyRtz4Hb)qzKQHE?^@F8Vi2gsC` zG#w-73n#;sEeSXMB-F^FiL@glHc&E-d{0U6LS)}KG6VD281j`barw#A2KJtd_mU|- z#6C+!FLFv7$F1eUya^TK(laARu z4|AW|O7-m7B9Zu#$l)Wgr||JR(~D0ysM%1g_W%?H=OOOt*iEHwHa!bkXvvKV!4c9d zd~{Q`>X5997m4FL`v)G7t-uX9vp@TkA%raWKULQQ`=qIYb7Qmi9BNuA2kgGrt733V zSkx?ukHt+b;28**{O-x^=E-xXf0y{ZzY?MmxorS9^E~i;?LIvOq^u3s;0n5AZpWcf zx?|S?k(Tro;67Cvj%uMVh?c!HI}v{bxB3f2v;j@H6H5;s=E)jz3_EDgVcf*>an-Zd zYnJiAzAPw&Wc3Zjy>`jty-3E-*g@n%A8=cvQIHs!R5bCx*`wR7chYtf+3V~+4YqH_ z8%e`sRKEJ*AR_S~rEt51L`tMv&SbRuO5i1vXSqCa?kD_2&PU?mI2=VTTb@aV4Eg|jxoaD-XF5oKVTnwMA^_ExRSy#=td+=xoaPH ztTrqzxL^?dsLdAiAs3M_q`+6Sa<=l_=dqv>n#`L=MP+(Y44Zn&j_WCNc2zo6;Arf3_NGy~24?{EnO z%Kz2p|9$cQE9U;|^1pooZWdsun-)(ewAVs4=9f+OeV%Yufysfn04&h(0AuA9bn6Og zV`_QXsSk`-r0?bGb5*|yNyIzxE;z`hL!4Jyo!bjar4yWCfT#}qO?>0oss6j9n3zY~ z2jqMpT2r~fnhyj!gMSS%Ez5)X;~^_RrUW8l`@;>z(dTx0)bm}LJ?4=-W#2zajFxvj z$^3h>3BDGqyT+27;8bo2P#V}HD|A25{KTX>9N`_N@KiL404QY-uo)TTc$d80D)CTC z;V)$raBB}@H(7D|+h4J7Puo3~4EK(@OTF{ZB8b>yf8@=7n7>EB3{?;8?Cw&1TfAuD5y(qskx8Bo~A zPjivtZ2IJL&(6OdG|ZlU8zfA(`)Y2NflR=)2*!N%{g;*_@W#g~?@mpkiYXNS=>thc zr{-R*!4^ZCbw`w3pHfBr6MwOrwtV@~X_Ub;NIo%>`mZ_mmvUu&46}XS8zX}!q-C1D z|C%~rth`w;<@}P3$&w@aH`>1bPvT!ryG&y!5?C^5G)MkZX?z67-#dP#+UlUz?DG@P z2S6d{DkkRP%Np7IGE zQ24rLoEq{t+N>0GIO%w5bN6qZK&whmXx2`_11f2uLt)}u|1^W3uUJ%8$Q_EIY-pv; zJ6*SbD-}q*;1tt(pZk^2`fBbV_4U(#)o$e$gLT~9_(J4pNcA0wTweTBW&YOq?t<@! z_>FY`E5!BhOL^>A(S)wR(3T`7XJMXtF1ho;f5q*^=|&qp*x6%PqqgcKsh%U5$CEQC zbbz*Brh0ak41*@=n&S=H#!9l|mEDBW8P$^FG7U%K2Gc9^MVH?%?tymi9nDMd9hZh^ z&wdw+^wet3j&tfYSRD`GF0V0fYid!WysOGd!^=+m_~-mBzhz;k(`hkHbauSBJHJZk z#{J}eyX@(4cT~DGz?~I#kxoCBqv8^HxeD$QF*fgDllZyC2y3%Jk_IDQ6FrCbj&%KD zN#y$_aQbL{SR()nblT#^gwZm1bivYe;QxM2oC1|=G|%;OU#LIKbFsinc$FEpJ4{IjfYcR<*5&1 zPRFOopi?P7syK6uu(a)zlA9L?G=t@79H~ZH`d(Ty2%HxjKh2Ix(3n1Pm4_!_8Lln) zr1vF@#MKp?G>D5Eg%q`n8loLg7|IRrpBMF%dje{DRdd;tm&NZMe>%D+HjR_EI^vJr+FDrX*QAK_&*+;D%Z<*ZGZ{J! z1p38ZU3T=(c!%q2@T7a_y~{bF8NAUgaW7K6G-Z23(NhrK^qgFv9LRS1e+UbVD)NEG=QCUlLg|-#lmNQ&l1oyl{2qQJgEFU zNpC4{hhc&39xyj5?=~LXz44ti(L|q_t|6<-hwSFSdFWErpkHap13Nys zvAGH+?bps+i9EP3@#-PBS^-TLIdmAHANB(MPi+U)+Yg}{AKkfCMGW{a@gM>t8Q1L| zNJwO8u5CH*Z!crr3w@FFd$4*u$ODK8`cLA_%Qd=3Fbk{;;K*i1APa?zR?iss>=r0Y zcmD~MY9jzWBl?en-6A#$QTdByG+qzxtFzOZWi-A_2Mv+Q@&9}%zy^P!>B8Y!i}lCK zlCGA(Vx%~e+1Q2odLHuUfTV#h()$s00Hk}92+|F?AH+y*^MjrV1U8SyJBa5CwkoKu z8s6;~cAFEncNe~G2KIV;nDwASOIZ93O)>2vcqFYDA&EWla~qIB?QUpcoF{F zZRqokjq@YeM!rI1FcrCrH9#4*RQs$kzNaFtvp1Ap>LizfLH!0`cYjal`&-U(J+T3j zLWBJ{Blwk+ZPR<*jRU3!&^P+)ILe`(9XY_FndsZI0UAY=v9{0bN?XVj64_r}gSBgs zFYpE0-gk7?3ymtsP@ThIynA-TaionjAPztV~AX9RB*2bP4Sm5>-JtIE0r}0usLx%ZU*|D{V=SP z7FiBX#FD7@cOL0EdEB*q7Q(`xGHWv3hwmQ8@W9W=#8;z8EDJB`m))<+Ko6FEHgH`0 zfxLL{*2~LSW3|gx92GO+qni=8&6j+6{?mJ!;zKG@{q{RwzO~c3(sY83GIi5Wt~T9v zPfIelwbNDI+svgdi!XOokUjZZ+?BEkS(MY*nmN9;ALTp7;-<^qF^UwB8B~=E-E!gR zB57r>c(nDW!!PI^4oe;~8S~aU(~q4j#Qbr~G^2UEy2Y5VCES00N3Z)`g??iIPOo|D ztPFRm(cH0UTxC!0ul?4!wW{0=Y({J8!{tn4Tjx|A2gFXyomwLN-1KzcjmdW z0;v{`a7m#$+Hs~|g9a1lXD7I&<%`43Xdy-5lcfHUC*?qRXuyFlnBMNuncbPu+!9a5 z$gOGhEpKNn1(~raAXokUtzc~5I!1DC_Ki3Z7YZKye!aQRI8;&Qh1f~*U+F{@-<}86 zAW(u(qj-a0nKrikojR3Q?obr+O45?`s?Fw!d?{{OguebMUL!ryMx|*XpT+qD`=-ua z6A<@e);M4mXp<)v&!jX`DQrzCSg^>-_3M$?tFb+FrO-9n*ms zA)uL_p~U$aj6s}wX_St->_p{Jn$j!QDHoRMb#|Cl1wy8hzB5$fk%@HE%y95{#~9c= zd$>+E*-}a!2niTj%Eyb$CBx0MHUUE`HSn=+^GzE(8m}9_T^n4`0F8aE-=>3@q1oyYkbIyED=V{4rF-}=8T zR&YyvkZ%*R@sieAptY@iDA3n*w3+uT#W35Nqy~*s_AUQJ+;To(Bz)FP&4@mN$mI*~ z(bAipQ0Fs#e>|=yD*_1y#3thNiml3Ci&ieYlZA#eN38A~_CvvYMeJkCt;nP=u_a4h zZcBjNCq1-VATG5d=>XnCk9_R=L5tyzyslX_RR<|tx}-{OBVMs^zb^d7y!9Pbg+##f zcSpVSy^<;NZLRHM@zNb7`st!+4ul|f_)3wtF6DfAipRJr0~7)cxdE3`gF*QC1{G!N z35)MWGI!rHxoR<1(kfZH4H$j?iZVX*eWOGdEg|u2QDpmBeQId+y8Gs$mBK^<3(QJ{ zI7@yZ>Xef7a5T#dqmZ5QnHC$IC0c$+kH;UPiK!ZB8Spu!77K{MWHhZbV1onH7p&W{ ztR>NF!aaEs{a19Dx>R9@O;e)^clH|@UiU8y3$Z$57p{VP+l?NsG_-6_!Jyw?-y85I zg}2dKjU)9?tKkGQoHVIwM8jwktVDtjF|iJ!dk%TN38k4r&Xaog=`_LS!QXSQifWa2 zSOfmLge$$8^$5i54l}{5vLe;US;{j_2jt;T#fZ85U2vB+!X8wvq3JeQEW31HT)HF; zbIOoNtzmuADALT~-}{7g>&(YG<0>CYoNzUhukJSujcKLQBJLOecE+sY-{fvk{nu4& z@T_C>EJE4`P-~7N-J5M)Hpweu1UN&4;W(<7b!%bom<8dDPP-537r_fUf_-RHKLy{| zR)lspGoe9D( z9sS)-sCCpfh1n0fd>q*t{s?H5FBnAkrkn(}1ud0>D4W(nsNap#*i_@@#PVWm?zf<& zVDlaclGl7U=!LUBM{E5jsNDU$(T%s(5>C-TfNcuiB{j4Z^ok~JInONN>~RD5L5;k;BC8<3-Y9W>G#;1__}XrUbqTR)86fl%jj7M z)StPZD6Q%4YPJbTN#Lr9)1>;4Dp1!&@AP7ASfcxb#|Jv;B2mJ(w2d*@5#Va<@lXEo z%e0W74+_rNK4%$yuvOXT=ad1n;Wmrj)s={|SLlr)92X1!48YxdS*%ViAt#m-ej@qB z7Y2tZQ{D*vp%AEl5`gv-b}m`k=mT9v6I67^g{7;e2Q#D!*a`N_YjgB${7~Mjfds{j zPJ7f%@QlgApXxuI3pjM1AF9F!F7#R5(F)^~Auq~hnYeP4Z^I4DHq&9g7rw0>%CG73 zeWvo?p8e`Z>Tsc6&ttOnw5j|&-ACA$f3v~J8DYxdluyzo0@NOYv394T<#B8VNq;tU z$mK=FZp!-VSxwz?H|ZM9c#j;pihKiq>T52~srq<~az$cBJ?yM{tj8>#TiG8E6zMWM zMXnP-JXVK~PKfAaVNRl~wGWtwW*W{0mXIIVOe12hAtjm`*fixW?fsKG^JKE%rHbG}Q zQBeCQ2dbr|2gO3>g41gy4SPQNeX}ltt#FA8(=q@~h8&n)<$r7Ds_7U|t zPBl&fQvGC~nt);zq~}7l7Dzu zBW|}0#ov_8RsLi^HN|872*bKS$Hrye_}43IC~#1`zJhZn_LsskyCpZXJr|G8eu*P( zvRb-wu@;s4ESUgW_RUkLxb>-RbAr7u&S9 z^8)qFHY2eitSBe;5QpY6O@e&6`GJ2n(ax^Y`@@oh!D5OB)zfZGs|snl;I6$+N71V% z`2{m}iqT@OhRq}Vb+n)aM%XU4)<@~5vZ{DkSN;KUOQ3e%q}e6Dl>%A32RtwfndEok z8vsmTuI-QAS)2yvJptaa@J3hp345=aFHu=(TDY8T_HE4$@XaBA zBG6@u`-hy+2yEVEHM$mCqbFPKT-6S5vF_Yr=69Hh*2HMNU0`jFMy=5OJ%2mV96gPI zuf{`vnUg9kPI1ZtoMZ*)I#-KzrqiAoA)O7 z=$90v8_D&`*Yu!bkoJ|CA1q94!EGm#hn)PB8^_@K>0a`X*^icviGnd)Qw!w7x*@*j zaMe{9A4KkU_w)JB$IC4>2?&Mz0baAS%2>eYfFqRo+fR_7HLCAb> zzodm=E63c6b+J(D`nz&N^812_MrwsxW-DW&q6jeP&~(!KXS0eue*Vz89&&iPs>D`x zeX2tlBOMJ6^iQaTC$UG-$p?LGv)N(2!p{MLpdpV32CChL0Z!qEuk&#NGIf7<)!iy~ zulWJV)XLADn0qxQtnkNPWCu`sc}>vkW-6gu$rK;i;JwALzYlfkp076ou0zB=wrdA`gVqB%g{*O`a3yW#VQPkYU zoAmr1@t-QH1N883>`~HriP)5$xM3Q!AX=HZZ(Z^Cphg#^v;7U42V`t@Uw%Az+aqlq zp`gze1rF>{?5L-FV?-H~aeQ%m)i^;!_&HPJs~@hU{Q8ci%3M2zMT7TDS=S{Ea5=Ke zED*2!7IC55No;RINEj|21 za>~fHNIe=qFJGumzfwl~iGIywG%r?O0YO`dZk1F@wGJSWs$bY{y5~nM-P$m6Ve{1; zAH=SSLgXilYO~Zh=m6x9Nxq3l??i^c`&OB*jqwAYIMKY(yrW_ zF!I~qTC!ni5{c19v(5Q@2vRg5@t8fQ?hENn=Lk-nT4CjxOHJ)jrp8)r-xuCkkY)dJiQd^!26()DqpV4L&da zGz~?P-(!*!;jX2?U_x7>Oj~C=UDy*w8x9u3=ztp+;7Mg3AgKm(Fwa}mr)z|jOy*CP z)WzIUHU-66i?u_#BRsPyC8Fws@0z9~_pK)$SOnXREf5_A9B**IeoA#19g3ZW9P*FU zZBAN0Xj}mvjV%x{syRjwHcjupL@#+6&_iN({Y!@{ReT^!oC~};b-T998WG$F`!QJV zSL%((b~k{gXM#}!Z@=YkItQOAhI92e8+36yr*r0HEcyB#4L;*u2(-6FzQpG(yH^wt9 zL5xb6DMBQeFwhvlogk}h7RIS}v`rW^AQI^K zf+5{ehc#9Yp+!w|eD8OABN*^+5t~5Um@Ezx!FQX-tt$ zBa^P`x^Al^3G_6#OXSBVG69SDpT&Ng>;Bnhn)yexvqiX!%LfZl>OKvJXA7+Ewz3b@ zRXF2xxZ?Qr+U~K|bIF$Qr<)MSg7X%w-e^63P5T1<$AbNgeYgtjr>5{Yb~#!4wN;xc z!#|e*JfTZisS&jExGfS~t#huYjdybt%RoeM=F@3jFv=TL#xV6gsjM=v4W`lA;4VLB zn~6~Ta6l)#<^H8nEOHfK01`f#&>K0;6GlIjE@$elT;d?BCg)-#xA3K&g+xQ8_1zQq z+kyA_6 z-)Hpxe1F&Xx;}sWuJc@%%QN$w=Q!uw_j%pR>t?awZUCVgavO6Em60p4J>I?k^?Qh? zvx!cSWBG{;PdD`AiM{$ zUj)Mf1|B43*1h;yW1L=$oA1llJB9RIMN<`^rWo=VwOV!1M|Hh4($xS5q9<&O{7>y zt|t#_fWzO;_M-ec$Rg`8m(-9lBhVwFWK;pcKu3MQX+#TQbCvMy;DCsFrVYlcXM&yep~yJ#bR zWJ~J*L|)PY#$*Q@C==k)Hcraj%$fXpj(iJjdv!Q+APaKy+<|__b=ha+uCPUvjmxOK zZV0LM^XU+(Wd14MvMJCgGm-z%Q72cdbQK6Md}{xIdaRlP4-}(D8M6V8l?sTi%jH0B z@@-xE^eT}NVxJDoAw@klAq%>-4T;v!;9+bsCa(wu=3UiKlg?61511!Lo~=9E;dk1q z*@qkC$pnvBupC*+1YG7i8BeovWrm&bN;r1MxSl>I&f-J(s=F@|+}x;0I*C0Un+-^< z2^@_#QY$leIqJClT>$7r6|;Hq`S)zi)-0cF2=F_ok%N}>ipdF*s-Y{(WtM0kdm2r} z*k$O3lWv8Juytj>OU#TA_`6+<{5tJ|xfO@Ml-n7^X@8TSB#+px+W1ni>y)zth&*c% zmS8(}6}#(B#r8nKlq5Fx4wf=?IrE(-S;i~dV-C4JclZX)vUHf|%eD->OGlSB0yB7v zoX;FW$(u?oS>m(TU@DVJ2M`hu9Ep2vR;TwWQIx;$Wu0X!TL0NNon;!1H6PYZyf`1Q z`xw3goqToG-!C&+-@rMcKYb?P(rkb+l0&@p4lN}Bd?t)yJ|>9X8qrEP2ynGNO12W2 zX-^Qe)b8ratldgM6Qd5yYi9~3EC1ZU^Lhkr7i>;U9_izoE5=@&KUu`V(oq}rqr~rP z6(~MZ`rcl---J)|S=`6v<+POB=BmCsA&g&fP_MZHt1aZgQa(wMh?L;EI;@DDc9Xey z^mU`BGeI!nGoyrZ^=_AB{Z^E_4N(Mt*5hf+_Ddj3_VyxSjkIv|Xd~i!)6}>iu1!^C znQ2UJ)&FQ=@*ut3?~z|~5sZyA-*7Y|e67w|^>8)cn~nVn#3jb_-p_=8jC@M+L8gx= zDTMSxMPVOyZoGF;T`TVoTE1fp7iRT8i0+a=EgYCPjQ9`gD?lrbCpPk)6K%)P4coi4 z{66)EgXp!RMaxOA3_>IGIb|a_L^VmWlYc&O>(F*|B#nogJB{Sk!j9X{I2>~h_}(n3 zp50q91l~za9Mx;veD4Ss?I=A!8e;r#-Wdkm4#E?U>$ZO*YrCqxYcVH97JAD|Fgbdt_a*p+&r#IDiw-5b-!!4F@5EUFgyr9^73hdXb1 zXL_HkOOpDC9msl9mT+`Mvth%bH6DiEHOECAuIu@Ww`-{JMQvy7*D~GT{A9GKt^3SR zl_w;%dFPYz%8%>(J$`0!nrR>1Y*J-%`Rk9F(|h7clLj*+;=3|J^Oq2*qZ(eF-dm*I zSzH}@D<4Ozx;1H<5yxrkpX~kH!roF=nJZ|oj9*T;MvU9yE+qv*P5s$d8eG8dvii@W zrQSVIJeQk3X@6oOi6x5zc`Z74EgXF^+TdF+FP*Tw2afNUPqA@h49`sWU3hIPE$nQi zd2`7^mz%Wl&OaWfGU)13E8uidm(D1rhE40+6DoQ^)^l_I;3BFh;rWE82Wj3oYq~IX zw4GETC4~|Aa|14y@-Y1NZEeZQZ`majj+=a_MS;lRhfl1ruc~*ELBjK{beX=t3(RH{ zfPH0H)pAj!)piic%(4bZ3czD2jWG^qxc>{49`p+PIyW$<3l8Zhw(5&OERyvlnHk=uvrcVCpda z!&zm;HW3Yrp0KXY@&m)D{YS(ItQ?whioYYZ(e%`6S%c z+4)G})g3B|A=(+|aCMSqa!=8~Ak5U35VBpi5y%`Kz~2Ho8(u5Rp~n^M9ML?$Z2i9M z@=QWIwET~8r;tHw%=3%Si4zfdB(%yeUbR_;p`6WT?;e$Xx7)Tr+D6E|PdKL(t1YIg zZ}!E^5?DwMWjsD5S;c$AHDATvppeq&aSuZ*F8>d;)Ceu7ODnZ69@v;%Jr`FMKomn% z?OIhnC;s?jz>Cav`3NkxxNVWm5_@FG)>r2B+hUskg|SGIYj}i8Z?GZv0HL{g!#?(;;K*rG(7Rb?7Udp3@ z`TE0?Gc*TwZQuYmyD4o>>&J~3TCMfKHZDCk=bi45{^XH}4H+Q`@JhrpcFD@k#U92@ zC?!SG3&dg-@gMvQqvWkSvXTXbHVveqlCyqndxQ5M??0?K-f{8w|ImacCYvjbZ}@4e zF@z%P@W;3?cF9}wYYnw?%V>U;lYGO*oMKgsS?bZ8bE^y1Wf@vfd&Gc$_XZ}w0-WvU zONN1aWw>~L|0_alacO~He{`Ugg1Y5Yi8-)!!mui?yAiwL<>%~kOO5rVVP@jG;vSN4ZV+_1tlrb^9=VkLnJn>6$2_a3g#L?fZ;I zwoi#ZuezUx2%9h%+`njhp#rIx z(m)WwKR1G`SyU~Cm2|JnoK?+d=Pb|)2$)gBC$u#LLdMrMwm796 zH*rw5jt_KJy?fWX^mKGIO>)dPW&3kSM_Omq#WSZbnj}rb(gtNuMhZL`ZF)Kx?@K;? zyT?9w6!HWa&?DZEl6v!+rE;Ql-p_*;yQ2bB*pr7zpEH3qz>%KBY`>fI`?y^?cg$P2 z7}l^ULd8JNvFD!L{0IMg6uvyRKVL*-0FmP%YCt6rwf84VN;K^B2^UozEDO5`3d+>8>D&!a!4G3)~?ANvt`H>S#%3hO! zI8|ZRQHg#N7CIZu^NH^}_X{|r>1ns*Yu}#8;TR4OP zYxX(-F!EvG<}#`+X?Fti~w@=J|WsUPNqNF>eELSjd>e( zE{E-EXlP5F{$7G>%S&Q8wx_$^&xUV!Pz5?qHO0N+Tv z|LMogJ77mfGA-m9rP}eTBf$kc0fW_~E7az77t}2%;e{k?uFn6TZg}W`_ynUgX*}0BMfg0Ax)G_}9q|fXM&b$WQ%kWaRvB`>!`KfE|G#H{c>$YUBo7 z|6c?6`+j@F=E2t1v>3@+DRC=~7-&(=-aUL_1|MEH9-jK-L{3ibRDm3MUrsnbh~$3? z@l|P|#~3{YO{b@ipQ?1mQ#oD&0OaYc!1n7U(c->og@0mJfJHbZ(_)O?W45%30f(^) zO8igvYfQ883vWz8n0jHg%~@?es4twJ0y-JD0%L|RvNfw{fFDSbxi>gy4|I^YHhJ7z z@VLJ_9S7_ylX>DH6*5yPWj(BGXuBRF!OC(vx1k_TIve6qlQl9g&bMKf*A+C~KJ1)d z-#}UiDrB8|jo6e~jz^=%{qHodq?0)>WCoEwI4y8aXF0V<@`MfqtiVkzuu-Kn9}*XH zBRvzoH*^j2n5^U_8@4(J_DO_IpzuqC71+p+z%!{wPrYQqf_c31kY7L0FoOmVa|(z6 zX0wAi5aN6EQ!?mJ5+Z9otRZlUQaE7YHI9de8w~6R6HKe16|pZRkDmHK&-(n{vD)cc zMO%Rb<}*-zaR48I1Sr3k1JcXU7+$+rQc>$^nVk1F{SB|{8C z4Jr3`qW~}Om2JzxXJ*RBG-k{Y{xAoC*&}?QfZY$rAoxJl5dbmfi7lBiVS{SsA)n4b znN1Ov?^B5s0AHQ05KzoX!jz!t%~JvtmOD+y{Yvix8X!_!!wvcO9SCr5la3?dTJJ!s zo{p+7X7b_6m~^f z4F9|qc_S)O=d*hfAGmt$6d`U#O_Gj9ZzZL9En z__laukVfWx!W+rJ4&p3^GJoZvhquks7Iu>V@7K=o0?kGf8Kx^5`UT3Oa|b8MgOin7 zREuy}(B)rSVI@6$e8fFfXy(BYmBHX=eovd@5!>;nkA}B1je6+mJAOL41WN&Dp-E-wDetXofY4^j)?nB^w~Z_g*3$6F>QMwn1zQ=G_$mU>o2PP6~^ z?jX$EI*6Fq17G=+@AKMoWkXYDhqC}O^t)`UiPO5;f4oQ*-v9e&vfFv|0U>vLN)U}) z)ci(d<2>Jr3V{lXdNvqM)_w_!R!YzNZE{kGqAMrDBSuJ_u4EvUxCmGCNnA zuhe|!g^^dI=SoZSgN|cte|-q)6s?m1z&nNUxn43Po5>Hz zxWEw8A(g>2zA#q_q61NU!x(q76AYSnJ2nd)7xltXFQ(B~n`b*VB`K4q3s|6l_oVCX z&wPpcO?CW-E(yJ`L2J}Qk)zfX+l}($k)pgN*qb+|>dle?vaXfan68HD^!l^%hrM(Z zwe5RRevKcWiJZ8eRAjZ4$wW$Jn$!(%&AD20BEno zW#)CwJ+;p~Xyj6di3Myf|0}dJIGr`Vh6* zju-X9sZsY|LLczWd64ba<6HAWjp`9w(Ds@9bS*ymV42%cieLwUFApTXyzf|xH}aca zP^dqzx45vL9O?Off3vB4b34P`WiK+vAP@5!PLZ{92DE4Q%?1cBlhF+MOj_j`sNm?D z4Ny{uc6jy|j$9J!;={b_?+xL(^SeqMj@NTB#`i(igc9M-$R=&EUZiZGb91iYlIw1} zdqr}}c=%SIQE0>ceTfvH#s|>n6jp#=^HQ(BtX4sS zXt6|G;`6(jEf#G{V%*5v9)dCS5k>v}Yj_e5bh4)V-OZd=i})?fsZI{IzCdR~Q<4@7 z^`}&SiHLNHN|dL2y+x>xD@yq?*PPZ`E5se@DL*uCu~p3vFzo(S>2@OoKaC6!rk1iF z-lmkCpB*;qz6VXIR(u)=m@2fGE!am*?R;P5#(f#LvBD%upmj1Cn-r^90doA0zJq|#QF>jHgJ-IInb29Z_q-OXG z)4zCdN|dFO;Afiw${wt==H#UefB32==7C_*npw>2zTB`tn%J6v6&gm0Ko#+asOLo~ zJE%{J!WOlmLs)|nu&V=QDF+sRG5^ifw&mR`KSVqcu1qBm7pG_S1)7>6+t9Xo?O8@M ziya_vBpSefna%7@t*_OM3jwMR(<(wc(rV6Ug3hM^HU|1lGax$T>GNi1-q?Id z%DqIYb<#t)=pI;e=-auwcw~v1nCT#Y1@3i8Ew57StB44}*2}p~!tsI+lD-7HO#OZ; z)TZ*t+SK{Z4m}6g`4yW>^ZG!N|HxfU@dVkN&}d^m*0x+`sj$B*l}6oE?3Cp6+KBgP zY~5FkufojOCw5t-7aZ-S-D_g zv>Fanc3gn$3r}F>GG(|!{*K=2Oi1NtQJ~~=tcA#DX{UBK!k9s(H_sk!cN!U*ax~AMr)s1M>nIk*!`!9jQ_~+#E)B3rkZE$ zp1l84mUbuo!11pzn|B6rmNXAy>)2BvJfm{#hF_)W+CC{N5e_?nY<@*sTX$=XiBS8@ z!xXtIm-*DSTe+F;4eqSHKxEDCF4r*N&=t|h#;x_+C65>XzJ)-0Va9x*p`sfqut8+P}_x=&v^bPFPNwI9B z83uAZF}?0GHJ}frNrBg6Qg6&(ySOKH^h+$2qcSZbU?%i*vi~ALvQqmyB(i-*HVi2K zouyNN`1fP-kP(;*^PShMz@GiY`9rLPKKg-!;628_s)OP+4KyVzaZmJ7Q5bgb@;LqM z`f)Gqzn`(tQGd=IvYlyoXaJhdybv`2eR2vXwvPa>kXFyO(4sf`s9g}pxnA8xY)4JZ zj-5>GE7|gKc?KN}-LLm2{+`R-22721vR7s;;MC={uEFfTunSmiPemlz$bj=3zt_h> zXX)tj7yMQIg7DU)`h0d8(SSnXih#2b*dD0UC2dE}GwOv)zwrr$nJm}vej#S5pT-2$ ze8C`0oVUMYD1g-4iJdC@x#?)YEAhUex!*(52RD=nQw6m~L;5-T{$!Mrd6Np5SEEnZ z#!IstCAZ~c#Av8xhV+&dKkrYv0xa_r8yr`~bLll$@w>SG32J>a_>EtlBW3pAWd^#g zdb>IeXSMe{R^UOt`A4?`+T#OM3{;AgdiAw_&{DmPPy@g7`z+w)JZVcuzI*FT}^dl9h>~9j8(&(5+v~H zc_1^%a9_E{$tb7qH;-&f5+Yk>Lke}hc>5br_R*h=ao^qB0Zj7|Sq%2`uM?oO-0d`* z);HDX7BBh=_u}KxQ&a^#U-Q*LQB17tzz18}YMF*jA$|GYYZ460Ti6XqV2x;4T%yri z*>);*Yi__s40Z^Uryh}7f?Y5Z(HLx@k#qY}9WhK7jd1xoV}1P*|1mX>5zp4m_PrlA zqr%7yBk--_pL;ivNhDk8*Or>d)T8Q)+yTm<(ox4R^J)-|Ct@s+ov{G#&R>$PGMpI1 zjW>l=OW`~Qv7EhpR5e{8)x04yFBD6CrLo4shSa`>MkzG&+1m<1v$sU3u5^vx1FRPp%0EcpJP^aalXr;WMKbE?`PsfT-<=K z<0p^jZRs^npDNSB0b03qFR_{gnAqjl#JRh`AtAM_16t~?D=2~ZNT0wl|1NRYiE}>E zfOjAYQjuy{tk5W3=$^*3JO&&_7AFrPo;WE#)UdA7z<@_@pz=m}v5&+IF?RUIIPJ;% z(s$-+F0-sR9Iltosy$;{Q(V06fByX)Nj$c)7ylCp;N@0cM(R`{HHUBO9F@dak6U>K zXG=Lmu3WwKO%bT(N`WX*zfoxr_%i5egyrU(@!fqF-v0g10K3gXNKtmK;QdUc>!ske zAdk`+n@twFXOut{iu6653S8wgDTP}LJ}u$OXVgW}gop$Q*J)iA zKwsuMS`5Rjp36o>jBkPg^1t6aj6Nx2dYIh-yY}c@PW1({63GMY9`^fD)*aaKm@6f> z`felN&(4H+bQy!Oj6q!=zJJg^xCgo)5IZO6IA%e~y3ZCveO`1vAT|@RxTlLu3=7Mx zNfjD@021iDyjsU|<;%7~~y3KA5^X{66lz_xCUZ8jrNItJFM= z00Apfh0gK_88Z7ydR-PF(;Fkgzk_ayu8EqxyWsbmV5JHa>nRWE6Q3==Qg{ZQv7tmK zerZ316}HmK+v5p21KM5bzeu?}*yGGW6{`w9ZwJ(ePJzd=vtTycsHp0%^Eq-*aRpUN z=zx3eZblFCvFT>Pqdz-K9_Y}v9SaQ^Nyv@x4a(XqaQhy^%5RMYhj5QJ1&<1>F4Ll?tX}x zgGy1(Qu)|G;IF@A_2&#TkzFPJjG@POvw>1a0Gt2{))XPaE&q`OD7%j51-a66Z0Ia> z6HbJSFlz;Dp72#(3y^QEpTsDY4rWV`-0?+L6MY( z*c^>%{D=Zi9y7O(8>(YygkNL}GpqH^Xv{st)&X@L606o*5X5)xu4Yue;)@cr(LEoP z7h&Uh2$Ja~RNYT@K+XY*0y`bu&?hos`_wH8{QQp>|=NgVL?A=RRJoCy$08;0(L!gZ0`1j;KbCt#AXReIz7zTkjRoASgZgzq^ z@6XK^UVh)eXgSys{j5|pXRs5qQ!(LKDDl1_hWfjEkq(6Td8$Drt?fztVf3H<=}TwS zzxuSiM{*;-Xu}?jtf-lpuF5ZU$&G@te^!1p`?@WCZ#mTrm3uaCM7ghMtIGWE>xX>b zhhzsbxERumL-~WQ!7X&#QCHG&M+T>R-ZP1lWj*@t*jiNo#Dq<;<*C?5a(r9epU& z31O+y=Vlr%^@HZ=Nc286&uDSy##>M89Rc}I)vB4e@hP(ac?@{T;7qP4OnzBbL@^f5 zabu6h;C%hbUEsfltm}C^{?d6_AEhWit#&%YtN93*vaz8!-N~eDg(7dCo=i>*6eKhh z8H2L*c;o#q{=CWV@yxKcbl#_|(<3vYangvUKG|~H2}&2*da3WB^aM=#_qK{Ap}zU0 zTBiABFh9m_=z8e~&3m+y_o@G`c(E-=VBNlb77kK7=rXUIm$293x-BWq()HryclZ6{ z2*M#>vTY5!b>n2kmb2TjA%yVVDgt~lZllt0SPlHwg~)Id9Jx~05}hAs*~>o4M)$-#q}Rn7FU&G>_o7h@ zy1TNF_yCkG5#ckBM)giz;n}oLoM;ii3fnu-g0d55*YK5l7yj-c>L!xw29qy0T?mEJ zjHZ^>8CGKp%%bqXAE0K>Zu=n}D}W;3@_z$jlRDHO<0u4J1S{v*e(Mox*l9yz8q$X9 z$nCbSLA{ZEjYO4=nuTO3-)q_mEilRI86AB2s)jD4qUNQWT&Tfl!`)G>8!WO=53$1Q z_X~?0HiMj_g6gEU1zt@n$_qdlN8Zp5dI{b!{^x?)5Ovv^IL@mdx zqn4N}DHl*Nm=A7z!XA3JX20}sNI;0L^P#x00(i)CB;3zwmnN-WuAD8Zkj9l;I*z1Y zEmXMEffib-W6pizoZ*H_&~5cT{4w{&+onhArJL&_#BamIqzI+>e5dZk$sQa5^hXig znB8$Fly*py%UL8+AmJVT+YWuRH8ZWr=Dbr(p8 literal 0 HcmV?d00001 diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/TestCacheAdminCLI.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/TestCacheAdminCLI.java new file mode 100644 index 00000000000..f25c4fe01ab --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/TestCacheAdminCLI.java @@ -0,0 +1,141 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ + +package org.apache.hadoop.cli; + +import static org.junit.Assert.assertTrue; + +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.cli.util.CLICommand; +import org.apache.hadoop.cli.util.CLICommandCacheAdmin; +import org.apache.hadoop.cli.util.CLICommandTypes; +import org.apache.hadoop.cli.util.CLITestCmd; +import org.apache.hadoop.cli.util.CacheAdminCmdExecutor; +import org.apache.hadoop.cli.util.CommandExecutor; +import org.apache.hadoop.cli.util.CommandExecutor.Result; +import org.apache.hadoop.fs.FileSystem; +import org.apache.hadoop.hdfs.DFSConfigKeys; +import org.apache.hadoop.hdfs.DistributedFileSystem; +import org.apache.hadoop.hdfs.HDFSPolicyProvider; +import org.apache.hadoop.hdfs.MiniDFSCluster; +import org.apache.hadoop.hdfs.tools.CacheAdmin; +import org.apache.hadoop.security.authorize.PolicyProvider; +import org.junit.After; +import org.junit.Before; +import org.junit.Test; +import org.xml.sax.SAXException; + +public class TestCacheAdminCLI extends CLITestHelper { + + public static final Log LOG = LogFactory.getLog(TestCacheAdminCLI.class); + + protected MiniDFSCluster dfsCluster = null; + protected FileSystem fs = null; + protected String namenode = null; + + @Before + @Override + public void setUp() throws Exception { + super.setUp(); + conf.setClass(PolicyProvider.POLICY_PROVIDER_CONFIG, + HDFSPolicyProvider.class, PolicyProvider.class); + + // Many of the tests expect a replication value of 1 in the output + conf.setInt(DFSConfigKeys.DFS_REPLICATION_KEY, 1); + + dfsCluster = new MiniDFSCluster.Builder(conf).numDataNodes(3).build(); + + dfsCluster.waitClusterUp(); + namenode = conf.get(DFSConfigKeys.FS_DEFAULT_NAME_KEY, "file:///"); + username = System.getProperty("user.name"); + + fs = dfsCluster.getFileSystem(); + assertTrue("Not a HDFS: "+fs.getUri(), + fs instanceof DistributedFileSystem); + } + + @After + @Override + public void tearDown() throws Exception { + if (fs != null) { + fs.close(); + } + if (dfsCluster != null) { + dfsCluster.shutdown(); + } + Thread.sleep(2000); + super.tearDown(); + } + + @Override + protected String getTestFile() { + return "testCacheAdminConf.xml"; + } + + @Override + protected TestConfigFileParser getConfigParser() { + return new TestConfigFileParserCacheAdmin(); + } + + private class TestConfigFileParserCacheAdmin extends + CLITestHelper.TestConfigFileParser { + @Override + public void endElement(String uri, String localName, String qName) + throws SAXException { + if (qName.equals("cache-admin-command")) { + if (testCommands != null) { + testCommands.add(new CLITestCmdCacheAdmin(charString, + new CLICommandCacheAdmin())); + } else if (cleanupCommands != null) { + cleanupCommands.add(new CLITestCmdCacheAdmin(charString, + new CLICommandCacheAdmin())); + } + } else { + super.endElement(uri, localName, qName); + } + } + } + + private class CLITestCmdCacheAdmin extends CLITestCmd { + + public CLITestCmdCacheAdmin(String str, CLICommandTypes type) { + super(str, type); + } + + @Override + public CommandExecutor getExecutor(String tag) + throws IllegalArgumentException { + if (getType() instanceof CLICommandCacheAdmin) { + return new CacheAdminCmdExecutor(tag, new CacheAdmin(conf)); + } + return super.getExecutor(tag); + } + } + + @Override + protected Result execute(CLICommand cmd) throws Exception { + return cmd.getExecutor("").executeCommand(cmd.getCmd()); + } + + @Test + @Override + public void testAll () { + super.testAll(); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CLICommandCacheAdmin.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CLICommandCacheAdmin.java new file mode 100644 index 00000000000..e9bf182c992 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CLICommandCacheAdmin.java @@ -0,0 +1,21 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + *

+ * http://www.apache.org/licenses/LICENSE-2.0 + *

+ * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.cli.util; + +public class CLICommandCacheAdmin implements CLICommandTypes { +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CacheAdminCmdExecutor.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CacheAdminCmdExecutor.java new file mode 100644 index 00000000000..922020faf84 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/cli/util/CacheAdminCmdExecutor.java @@ -0,0 +1,37 @@ +/* + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.cli.util; + +import org.apache.hadoop.hdfs.tools.CacheAdmin; +import org.apache.hadoop.util.ToolRunner; + +public class CacheAdminCmdExecutor extends CommandExecutor { + protected String namenode = null; + protected CacheAdmin admin = null; + + public CacheAdminCmdExecutor(String namenode, CacheAdmin admin) { + this.namenode = namenode; + this.admin = admin; + } + + @Override + protected void execute(final String cmd) throws Exception { + String[] args = getCommandAsArgs(cmd, "NAMENODE", this.namenode); + ToolRunner.run(admin, args); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/DFSTestUtil.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/DFSTestUtil.java index 9a453cc54c2..dbd5771d633 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/DFSTestUtil.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/DFSTestUtil.java @@ -850,7 +850,7 @@ public class DFSTestUtil { DFSConfigKeys.DFS_DATANODE_HTTP_DEFAULT_PORT, DFSConfigKeys.DFS_DATANODE_HTTPS_DEFAULT_PORT, DFSConfigKeys.DFS_DATANODE_IPC_DEFAULT_PORT, - 1, 2, 3, 4, 5, 6, "local", adminState); + 1l, 2l, 3l, 4l, 0l, 0l, 5, 6, "local", adminState); } public static DatanodeDescriptor getDatanodeDescriptor(String ipAddr, @@ -1060,6 +1060,27 @@ public class DFSTestUtil { locatedBlocks = DFSClientAdapter.callGetBlockLocations( cluster.getNameNodeRpc(nnIndex), filePath, 0L, bytes.length); } while (locatedBlocks.isUnderConstruction()); + // OP_ADD_CACHE_POOL + filesystem.addCachePool(new CachePoolInfo("pool1")); + // OP_MODIFY_CACHE_POOL + filesystem.modifyCachePool(new CachePoolInfo("pool1").setLimit(99l)); + // OP_ADD_PATH_BASED_CACHE_DIRECTIVE + long id = filesystem.addCacheDirective( + new CacheDirectiveInfo.Builder(). + setPath(new Path("/path")). + setReplication((short)1). + setPool("pool1"). + build(), EnumSet.of(CacheFlag.FORCE)); + // OP_MODIFY_PATH_BASED_CACHE_DIRECTIVE + filesystem.modifyCacheDirective( + new CacheDirectiveInfo.Builder(). + setId(id). + setReplication((short)2). + build(), EnumSet.of(CacheFlag.FORCE)); + // OP_REMOVE_PATH_BASED_CACHE_DIRECTIVE + filesystem.removeCacheDirective(id); + // OP_REMOVE_CACHE_POOL + filesystem.removeCachePool("pool1"); } public static void abortStream(DFSOutputStream out) throws IOException { diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/LogVerificationAppender.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/LogVerificationAppender.java index d6698b88c4b..10ef47bbbc3 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/LogVerificationAppender.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/LogVerificationAppender.java @@ -61,4 +61,15 @@ public class LogVerificationAppender extends AppenderSkeleton { } return count; } + + public int countLinesWithMessage(final String text) { + int count = 0; + for (LoggingEvent e: getLog()) { + String msg = e.getRenderedMessage(); + if (msg != null && msg.contains(text)) { + count++; + } + } + return count; + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDFSUtil.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDFSUtil.java index f2e8cf0990c..3a0134ed393 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDFSUtil.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDFSUtil.java @@ -30,6 +30,7 @@ import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_SECONDARY_HTTP_A import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_SERVICE_RPC_ADDRESS_KEY; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMESERVICES; import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMESERVICE_ID; +import static org.apache.hadoop.test.GenericTestUtils.assertExceptionContains; import static org.hamcrest.CoreMatchers.not; import static org.junit.Assert.assertArrayEquals; import static org.junit.Assert.assertEquals; @@ -725,4 +726,42 @@ public class TestDFSUtil { DFSConfigKeys.DFS_WEB_AUTHENTICATION_KERBEROS_KEYTAB_KEY, DFSUtil.getSpnegoKeytabKey(conf, defaultKey)); } + + @Test(timeout=1000) + public void testDurationToString() throws Exception { + assertEquals("000:00:00:00.000", DFSUtil.durationToString(0)); + assertEquals("001:01:01:01.000", + DFSUtil.durationToString(((24*60*60)+(60*60)+(60)+1)*1000)); + assertEquals("000:23:59:59.999", + DFSUtil.durationToString(((23*60*60)+(59*60)+(59))*1000+999)); + assertEquals("-001:01:01:01.000", + DFSUtil.durationToString(-((24*60*60)+(60*60)+(60)+1)*1000)); + assertEquals("-000:23:59:59.574", + DFSUtil.durationToString(-(((23*60*60)+(59*60)+(59))*1000+574))); + } + + @Test(timeout=5000) + public void testRelativeTimeConversion() throws Exception { + try { + DFSUtil.parseRelativeTime("1"); + } catch (IOException e) { + assertExceptionContains("too short", e); + } + try { + DFSUtil.parseRelativeTime("1z"); + } catch (IOException e) { + assertExceptionContains("unknown time unit", e); + } + try { + DFSUtil.parseRelativeTime("yyz"); + } catch (IOException e) { + assertExceptionContains("is not a number", e); + } + assertEquals(61*1000, DFSUtil.parseRelativeTime("61s")); + assertEquals(61*60*1000, DFSUtil.parseRelativeTime("61m")); + assertEquals(0, DFSUtil.parseRelativeTime("0s")); + assertEquals(25*60*60*1000, DFSUtil.parseRelativeTime("25h")); + assertEquals(4*24*60*60*1000l, DFSUtil.parseRelativeTime("4d")); + assertEquals(999*24*60*60*1000l, DFSUtil.parseRelativeTime("999d")); + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDatanodeConfig.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDatanodeConfig.java index dbec01c7b86..9a331069135 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDatanodeConfig.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/TestDatanodeConfig.java @@ -32,6 +32,8 @@ import org.apache.hadoop.conf.Configuration; import org.apache.hadoop.fs.FileUtil; import org.apache.hadoop.hdfs.server.common.HdfsServerConstants.StartupOption; import org.apache.hadoop.hdfs.server.datanode.DataNode; +import org.apache.hadoop.io.nativeio.NativeIO; +import org.apache.hadoop.test.GenericTestUtils; import org.junit.AfterClass; import org.junit.BeforeClass; import org.junit.Test; @@ -109,4 +111,39 @@ public class TestDatanodeConfig { throw new IOException("Bad URI", e); } } + + @Test(timeout=60000) + public void testMemlockLimit() throws Exception { + assumeTrue(NativeIO.isAvailable()); + final long memlockLimit = + NativeIO.POSIX.getCacheManipulator().getMemlockLimit(); + + // Can't increase the memlock limit past the maximum. + assumeTrue(memlockLimit != Long.MAX_VALUE); + + Configuration conf = cluster.getConfiguration(0); + long prevLimit = conf. + getLong(DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_DEFAULT); + try { + // Try starting the DN with limit configured to the ulimit + conf.setLong(DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + memlockLimit); + DataNode dn = null; + dn = DataNode.createDataNode(new String[]{}, conf); + dn.shutdown(); + // Try starting the DN with a limit > ulimit + conf.setLong(DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + memlockLimit+1); + try { + dn = DataNode.createDataNode(new String[]{}, conf); + } catch (RuntimeException e) { + GenericTestUtils.assertExceptionContains( + "more than the datanode's available RLIMIT_MEMLOCK", e); + } + } finally { + conf.setLong(DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + prevLimit); + } + } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/protocolPB/TestPBHelper.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/protocolPB/TestPBHelper.java index 0064fd42b5c..4c02da18d85 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/protocolPB/TestPBHelper.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/protocolPB/TestPBHelper.java @@ -440,7 +440,7 @@ public class TestPBHelper { }; LocatedBlock lb = new LocatedBlock( new ExtendedBlock("bp12", 12345, 10, 53), - dnInfos, storageIDs, media, 5, false); + dnInfos, storageIDs, media, 5, false, new DatanodeInfo[]{}); lb.setBlockToken(new Token( "identifier".getBytes(), "password".getBytes(), new Text("kind"), new Text("service"))); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestBlockManager.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestBlockManager.java index 4f69c5d499f..e632ed1ca97 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestBlockManager.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestBlockManager.java @@ -107,7 +107,7 @@ public class TestBlockManager { 2 * HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 2 * HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L); dn.updateHeartbeat( - BlockManagerTestUtil.getStorageReportsForDatanode(dn), 0, 0); + BlockManagerTestUtil.getStorageReportsForDatanode(dn), 0L, 0L, 0, 0); bm.getDatanodeManager().checkIfClusterIsNowMultiRack(dn); } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestCachedBlocksList.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestCachedBlocksList.java new file mode 100644 index 00000000000..45545ebfbb0 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestCachedBlocksList.java @@ -0,0 +1,154 @@ +/* + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.blockmanagement; + +import java.util.Arrays; +import java.util.Iterator; +import java.util.Random; + +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.hdfs.protocol.DatanodeID; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList; +import org.apache.hadoop.hdfs.server.namenode.CachedBlock; +import org.junit.Assert; +import org.junit.Test; + +public class TestCachedBlocksList { + public static final Log LOG = LogFactory.getLog(TestCachedBlocksList.class); + + @Test(timeout=60000) + public void testSingleList() { + DatanodeDescriptor dn = new DatanodeDescriptor( + new DatanodeID("127.0.0.1", "localhost", "abcd", + 5000, 5001, 5002, 5003)); + CachedBlock[] blocks = new CachedBlock[] { + new CachedBlock(0L, (short)1, true), + new CachedBlock(1L, (short)1, true), + new CachedBlock(2L, (short)1, true), + }; + // check that lists are empty + Assert.assertTrue("expected pending cached list to start off empty.", + !dn.getPendingCached().iterator().hasNext()); + Assert.assertTrue("expected cached list to start off empty.", + !dn.getCached().iterator().hasNext()); + Assert.assertTrue("expected pending uncached list to start off empty.", + !dn.getPendingUncached().iterator().hasNext()); + // add a block to the back + Assert.assertTrue(dn.getCached().add(blocks[0])); + Assert.assertTrue("expected pending cached list to still be empty.", + !dn.getPendingCached().iterator().hasNext()); + Assert.assertEquals("failed to insert blocks[0]", blocks[0], + dn.getCached().iterator().next()); + Assert.assertTrue("expected pending uncached list to still be empty.", + !dn.getPendingUncached().iterator().hasNext()); + // add another block to the back + Assert.assertTrue(dn.getCached().add(blocks[1])); + Iterator iter = dn.getCached().iterator(); + Assert.assertEquals(blocks[0], iter.next()); + Assert.assertEquals(blocks[1], iter.next()); + Assert.assertTrue(!iter.hasNext()); + // add a block to the front + Assert.assertTrue(dn.getCached().addFirst(blocks[2])); + iter = dn.getCached().iterator(); + Assert.assertEquals(blocks[2], iter.next()); + Assert.assertEquals(blocks[0], iter.next()); + Assert.assertEquals(blocks[1], iter.next()); + Assert.assertTrue(!iter.hasNext()); + // remove a block from the middle + Assert.assertTrue(dn.getCached().remove(blocks[0])); + iter = dn.getCached().iterator(); + Assert.assertEquals(blocks[2], iter.next()); + Assert.assertEquals(blocks[1], iter.next()); + Assert.assertTrue(!iter.hasNext()); + // remove all blocks + dn.getCached().clear(); + Assert.assertTrue("expected cached list to be empty after clear.", + !dn.getPendingCached().iterator().hasNext()); + } + + private void testAddElementsToList(CachedBlocksList list, + CachedBlock[] blocks) { + Assert.assertTrue("expected list to start off empty.", + !list.iterator().hasNext()); + for (CachedBlock block : blocks) { + Assert.assertTrue(list.add(block)); + } + } + + private void testRemoveElementsFromList(Random r, + CachedBlocksList list, CachedBlock[] blocks) { + int i = 0; + for (Iterator iter = list.iterator(); iter.hasNext(); ) { + Assert.assertEquals(blocks[i], iter.next()); + i++; + } + if (r.nextBoolean()) { + LOG.info("Removing via iterator"); + for (Iterator iter = list.iterator(); iter.hasNext() ;) { + iter.next(); + iter.remove(); + } + } else { + LOG.info("Removing in pseudo-random order"); + CachedBlock[] remainingBlocks = Arrays.copyOf(blocks, blocks.length); + for (int removed = 0; removed < remainingBlocks.length; ) { + int toRemove = r.nextInt(remainingBlocks.length); + if (remainingBlocks[toRemove] != null) { + Assert.assertTrue(list.remove(remainingBlocks[toRemove])); + remainingBlocks[toRemove] = null; + removed++; + } + } + } + Assert.assertTrue("expected list to be empty after everything " + + "was removed.", !list.iterator().hasNext()); + } + + @Test(timeout=60000) + public void testMultipleLists() { + DatanodeDescriptor[] datanodes = new DatanodeDescriptor[] { + new DatanodeDescriptor( + new DatanodeID("127.0.0.1", "localhost", "abcd", + 5000, 5001, 5002, 5003)), + new DatanodeDescriptor( + new DatanodeID("127.0.1.1", "localhost", "efgh", + 6000, 6001, 6002, 6003)), + }; + CachedBlocksList[] lists = new CachedBlocksList[] { + datanodes[0].getPendingCached(), + datanodes[0].getCached(), + datanodes[1].getPendingCached(), + datanodes[1].getCached(), + datanodes[1].getPendingUncached(), + }; + final int NUM_BLOCKS = 8000; + CachedBlock[] blocks = new CachedBlock[NUM_BLOCKS]; + for (int i = 0; i < NUM_BLOCKS; i++) { + blocks[i] = new CachedBlock(i, (short)i, true); + } + Random r = new Random(654); + for (CachedBlocksList list : lists) { + testAddElementsToList(list, blocks); + } + for (CachedBlocksList list : lists) { + testRemoveElementsFromList(r, list, blocks); + } + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestOverReplicatedBlocks.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestOverReplicatedBlocks.java index 47f8730268b..1c3f75a68d4 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestOverReplicatedBlocks.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestOverReplicatedBlocks.java @@ -106,7 +106,7 @@ public class TestOverReplicatedBlocks { datanode.getStorageInfos()[0].setUtilizationForTesting(100L, 100L, 0, 100L); datanode.updateHeartbeat( BlockManagerTestUtil.getStorageReportsForDatanode(datanode), - 0, 0); + 0L, 0L, 0, 0); } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicy.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicy.java index 3efeba2e4fc..391e9ffa11f 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicy.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicy.java @@ -87,12 +87,12 @@ public class TestReplicationPolicy { private static void updateHeartbeatWithUsage(DatanodeDescriptor dn, long capacity, long dfsUsed, long remaining, long blockPoolUsed, - int xceiverCount, int volFailures) { + long dnCacheCapacity, long dnCacheUsed, int xceiverCount, int volFailures) { dn.getStorageInfos()[0].setUtilizationForTesting( capacity, dfsUsed, remaining, blockPoolUsed); dn.updateHeartbeat( BlockManagerTestUtil.getStorageReportsForDatanode(dn), - xceiverCount, volFailures); + dnCacheCapacity, dnCacheUsed, xceiverCount, volFailures); } @BeforeClass @@ -133,7 +133,7 @@ public class TestReplicationPolicy { for (int i=0; i < NUM_OF_DATANODES; i++) { updateHeartbeatWithUsage(dataNodes[i], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0, 0); + 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } } @@ -157,7 +157,8 @@ public class TestReplicationPolicy { public void testChooseTarget1() throws Exception { updateHeartbeatWithUsage(dataNodes[0], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 4, 0); // overloaded + HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, + 0L, 0L, 4, 0); // overloaded DatanodeStorageInfo[] targets; targets = chooseTarget(0); @@ -187,7 +188,7 @@ public class TestReplicationPolicy { updateHeartbeatWithUsage(dataNodes[0], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0, 0); + HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } private static DatanodeStorageInfo[] chooseTarget(int numOfReplicas) { @@ -310,7 +311,8 @@ public class TestReplicationPolicy { // make data node 0 to be not qualified to choose updateHeartbeatWithUsage(dataNodes[0], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, 0L, 0, 0); // no space + (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, 0L, + 0L, 0L, 0, 0); // no space DatanodeStorageInfo[] targets; targets = chooseTarget(0); @@ -343,7 +345,7 @@ public class TestReplicationPolicy { updateHeartbeatWithUsage(dataNodes[0], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0, 0); + HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } /** @@ -360,7 +362,7 @@ public class TestReplicationPolicy { for(int i=0; i<2; i++) { updateHeartbeatWithUsage(dataNodes[i], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, 0L, 0, 0); + (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } DatanodeStorageInfo[] targets; @@ -388,7 +390,7 @@ public class TestReplicationPolicy { for(int i=0; i<2; i++) { updateHeartbeatWithUsage(dataNodes[i], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0, 0); + HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } } @@ -450,7 +452,7 @@ public class TestReplicationPolicy { for(int i=0; i<2; i++) { updateHeartbeatWithUsage(dataNodes[i], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, 0L, 0, 0); + (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } final LogVerificationAppender appender = new LogVerificationAppender(); @@ -475,7 +477,7 @@ public class TestReplicationPolicy { for(int i=0; i<2; i++) { updateHeartbeatWithUsage(dataNodes[i], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0, 0); + HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } } diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicyWithNodeGroup.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicyWithNodeGroup.java index 283c36dd867..23209f0e28b 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicyWithNodeGroup.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/blockmanagement/TestReplicationPolicyWithNodeGroup.java @@ -17,6 +17,10 @@ */ package org.apache.hadoop.hdfs.server.blockmanagement; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertFalse; +import static org.junit.Assert.assertTrue; + import java.io.File; import java.util.ArrayList; import java.util.Arrays; @@ -26,7 +30,6 @@ import java.util.List; import java.util.Map; import java.util.Set; -import junit.framework.TestCase; import org.apache.hadoop.conf.Configuration; import org.apache.hadoop.fs.CommonConfigurationKeysPublic; import org.apache.hadoop.fs.FileSystem; @@ -44,7 +47,7 @@ import org.junit.After; import org.junit.Before; import org.junit.Test; -public class TestReplicationPolicyWithNodeGroup extends TestCase { +public class TestReplicationPolicyWithNodeGroup { private static final int BLOCK_SIZE = 1024; private static final int NUM_OF_DATANODES = 8; private static final int NUM_OF_DATANODES_BOUNDARY = 6; @@ -145,19 +148,20 @@ public class TestReplicationPolicyWithNodeGroup extends TestCase { private static void updateHeartbeatWithUsage(DatanodeDescriptor dn, long capacity, long dfsUsed, long remaining, long blockPoolUsed, - int xceiverCount, int volFailures) { + long dnCacheCapacity, long dnCacheUsed, int xceiverCount, + int volFailures) { dn.getStorageInfos()[0].setUtilizationForTesting( capacity, dfsUsed, remaining, blockPoolUsed); dn.updateHeartbeat( BlockManagerTestUtil.getStorageReportsForDatanode(dn), - xceiverCount, volFailures); + dnCacheCapacity, dnCacheUsed, xceiverCount, volFailures); } private static void setupDataNodeCapacity() { for(int i=0; i chosenNodes = new ArrayList(); @@ -483,6 +495,7 @@ public class TestReplicationPolicyWithNodeGroup extends TestCase { * the rest replicas can be placed randomly, * @throws Exception */ + @Test public void testRereplicate2() throws Exception { setupDataNodeCapacity(); List chosenNodes = new ArrayList(); @@ -510,6 +523,7 @@ public class TestReplicationPolicyWithNodeGroup extends TestCase { * the rest replicas can be placed randomly, * @throws Exception */ + @Test public void testRereplicate3() throws Exception { setupDataNodeCapacity(); List chosenNodes = new ArrayList(); @@ -615,11 +629,11 @@ public class TestReplicationPolicyWithNodeGroup extends TestCase { updateHeartbeatWithUsage(dataNodes[0], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, (HdfsConstants.MIN_BLOCKS_FOR_WRITE-1)*BLOCK_SIZE, - 0L, 0, 0); + 0L, 0L, 0L, 0, 0); updateHeartbeatWithUsage(dataNodesInBoundaryCase[i], 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, - 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0, 0); + 2*HdfsConstants.MIN_BLOCKS_FOR_WRITE*BLOCK_SIZE, 0L, 0L, 0L, 0, 0); } DatanodeStorageInfo[] targets; @@ -650,7 +664,7 @@ public class TestReplicationPolicyWithNodeGroup extends TestCase { for(int i=0; i chosenNodes = new ArrayList(); chosenNodes.add(storagesInBoundaryCase[0]); @@ -688,7 +702,7 @@ public class TestReplicationPolicyWithNodeGroup extends TestCase { for(int i=0; i live = new ArrayList(); live.add(dnDesc1); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/SimulatedFSDataset.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/SimulatedFSDataset.java index c52007c95f0..a2e95a4d673 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/SimulatedFSDataset.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/SimulatedFSDataset.java @@ -18,13 +18,13 @@ package org.apache.hadoop.hdfs.server.datanode; import java.io.File; -import java.io.FileInputStream; import java.io.IOException; import java.io.InputStream; import java.io.OutputStream; import java.util.ArrayList; import java.util.Collections; import java.util.HashMap; +import java.util.LinkedList; import java.util.List; import java.util.Map; @@ -491,6 +491,11 @@ public class SimulatedFSDataset implements FsDatasetSpi { return Collections.singletonMap(new DatanodeStorage(storage.storageUuid), getBlockReport(bpid)); } + @Override // FsDatasetSpi + public List getCacheReport(String bpid) { + return new LinkedList(); + } + @Override // FSDatasetMBean public long getCapacity() { return storage.getCapacity(); @@ -516,6 +521,31 @@ public class SimulatedFSDataset implements FsDatasetSpi { return storage.getNumFailedVolumes(); } + @Override // FSDatasetMBean + public long getCacheUsed() { + return 0l; + } + + @Override // FSDatasetMBean + public long getCacheCapacity() { + return 0l; + } + + @Override // FSDatasetMBean + public long getNumBlocksCached() { + return 0l; + } + + @Override + public long getNumBlocksFailedToCache() { + return 0l; + } + + @Override + public long getNumBlocksFailedToUncache() { + return 0l; + } + @Override // FsDatasetSpi public synchronized long getLength(ExtendedBlock b) throws IOException { final Map map = getMap(b.getBlockPoolId()); @@ -585,6 +615,18 @@ public class SimulatedFSDataset implements FsDatasetSpi { } } + @Override // FSDatasetSpi + public void cache(String bpid, long[] cacheBlks) { + throw new UnsupportedOperationException( + "SimulatedFSDataset does not support cache operation!"); + } + + @Override // FSDatasetSpi + public void uncache(String bpid, long[] uncacheBlks) { + throw new UnsupportedOperationException( + "SimulatedFSDataset does not support uncache operation!"); + } + private BInfo getBInfo(final ExtendedBlock b) { final Map map = blockMap.get(b.getBlockPoolId()); return map == null? null: map.get(b.getLocalBlock()); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBPOfferService.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBPOfferService.java index 2d4d0a774f8..d0544ed30be 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBPOfferService.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBPOfferService.java @@ -128,6 +128,8 @@ public class TestBPOfferService { .when(mock).sendHeartbeat( Mockito.any(DatanodeRegistration.class), Mockito.any(StorageReport[].class), + Mockito.anyLong(), + Mockito.anyLong(), Mockito.anyInt(), Mockito.anyInt(), Mockito.anyInt()); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBlockRecovery.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBlockRecovery.java index edf27a5b12b..d4863c3b59c 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBlockRecovery.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestBlockRecovery.java @@ -154,6 +154,8 @@ public class TestBlockRecovery { when(namenode.sendHeartbeat( Mockito.any(DatanodeRegistration.class), Mockito.any(StorageReport[].class), + Mockito.anyLong(), + Mockito.anyLong(), Mockito.anyInt(), Mockito.anyInt(), Mockito.anyInt())) diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestCachingStrategy.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestCachingStrategy.java index 5a2a52a7883..fda2927efa6 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestCachingStrategy.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestCachingStrategy.java @@ -17,6 +17,7 @@ */ package org.apache.hadoop.hdfs.server.datanode; +import java.io.FileDescriptor; import java.io.IOException; import java.util.Arrays; import java.util.Map; @@ -36,7 +37,8 @@ import org.apache.hadoop.hdfs.protocol.ExtendedBlock; import org.apache.hadoop.hdfs.server.namenode.EditLogFileOutputStream; import org.apache.hadoop.io.IOUtils; import org.apache.hadoop.io.nativeio.NativeIO; -import org.apache.hadoop.io.nativeio.NativeIO.POSIX.CacheTracker; +import org.apache.hadoop.io.nativeio.NativeIO.POSIX.CacheManipulator; +import org.apache.hadoop.io.nativeio.NativeIOException; import org.junit.Assert; import org.junit.BeforeClass; import org.junit.Test; @@ -54,7 +56,7 @@ public class TestCachingStrategy { EditLogFileOutputStream.setShouldSkipFsyncForTesting(true); // Track calls to posix_fadvise. - NativeIO.POSIX.cacheTracker = tracker; + NativeIO.POSIX.setCacheManipulator(tracker); // Normally, we wait for a few megabytes of data to be read or written // before dropping the cache. This is to avoid an excessive number of @@ -106,12 +108,13 @@ public class TestCachingStrategy { } } - private static class TestRecordingCacheTracker implements CacheTracker { + private static class TestRecordingCacheTracker extends CacheManipulator { private final Map map = new TreeMap(); @Override - synchronized public void fadvise(String name, - long offset, long len, int flags) { + public void posixFadviseIfPossible(String name, + FileDescriptor fd, long offset, long len, int flags) + throws NativeIOException { if ((len < 0) || (len > Integer.MAX_VALUE)) { throw new RuntimeException("invalid length of " + len + " passed to posixFadviseIfPossible"); @@ -126,6 +129,7 @@ public class TestCachingStrategy { map.put(name, stats); } stats.fadvise((int)offset, (int)len, flags); + super.posixFadviseIfPossible(name, fd, offset, len, flags); } synchronized void clear() { diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestFsDatasetCache.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestFsDatasetCache.java new file mode 100644 index 00000000000..c0a93c4aef1 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestFsDatasetCache.java @@ -0,0 +1,522 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.datanode; + +import static org.apache.hadoop.test.MetricsAsserts.getMetrics; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertTrue; +import static org.junit.Assume.assumeTrue; +import static org.mockito.Matchers.any; +import static org.mockito.Matchers.anyInt; +import static org.mockito.Matchers.anyLong; +import static org.mockito.Mockito.doReturn; + +import java.io.FileInputStream; +import java.io.IOException; +import java.nio.ByteBuffer; +import java.nio.channels.FileChannel; +import java.util.HashSet; +import java.util.Set; + +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.FSDataOutputStream; +import org.apache.hadoop.fs.FileSystem; +import org.apache.hadoop.fs.HdfsBlockLocation; +import org.apache.hadoop.fs.Path; +import org.apache.hadoop.ha.HAServiceProtocol.HAServiceState; +import org.apache.hadoop.hdfs.DFSConfigKeys; +import org.apache.hadoop.hdfs.DFSTestUtil; +import org.apache.hadoop.hdfs.DistributedFileSystem; +import org.apache.hadoop.hdfs.HdfsConfiguration; +import org.apache.hadoop.hdfs.LogVerificationAppender; +import org.apache.hadoop.hdfs.MiniDFSCluster; +import org.apache.hadoop.hdfs.protocol.Block; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.ExtendedBlock; +import org.apache.hadoop.hdfs.protocolPB.DatanodeProtocolClientSideTranslatorPB; +import org.apache.hadoop.hdfs.server.datanode.fsdataset.FsDatasetSpi; +import org.apache.hadoop.hdfs.server.datanode.fsdataset.impl.FsDatasetCache; +import org.apache.hadoop.hdfs.server.datanode.fsdataset.impl.FsDatasetCache.PageRounder; +import org.apache.hadoop.hdfs.server.namenode.EditLogFileOutputStream; +import org.apache.hadoop.hdfs.server.namenode.FSImage; +import org.apache.hadoop.hdfs.server.namenode.NameNode; +import org.apache.hadoop.hdfs.server.protocol.BlockIdCommand; +import org.apache.hadoop.hdfs.server.protocol.DatanodeCommand; +import org.apache.hadoop.hdfs.server.protocol.DatanodeProtocol; +import org.apache.hadoop.hdfs.server.protocol.DatanodeRegistration; +import org.apache.hadoop.hdfs.server.protocol.HeartbeatResponse; +import org.apache.hadoop.hdfs.server.protocol.NNHAStatusHeartbeat; +import org.apache.hadoop.hdfs.server.protocol.StorageReport; +import org.apache.hadoop.io.nativeio.NativeIO; +import org.apache.hadoop.io.nativeio.NativeIO.POSIX.CacheManipulator; +import org.apache.hadoop.io.nativeio.NativeIO.POSIX.NoMlockCacheManipulator; +import org.apache.hadoop.metrics2.MetricsRecordBuilder; +import org.apache.hadoop.test.GenericTestUtils; +import org.apache.hadoop.test.MetricsAsserts; +import org.apache.log4j.Logger; +import org.junit.After; +import org.junit.Assert; +import org.junit.Before; +import org.junit.Test; +import org.apache.log4j.Level; +import org.apache.log4j.LogManager; + +import com.google.common.base.Supplier; + +public class TestFsDatasetCache { + private static final Log LOG = LogFactory.getLog(TestFsDatasetCache.class); + + // Most Linux installs allow a default of 64KB locked memory + private static final long CACHE_CAPACITY = 64 * 1024; + // mlock always locks the entire page. So we don't need to deal with this + // rounding, use the OS page size for the block size. + private static final long PAGE_SIZE = + NativeIO.POSIX.getCacheManipulator().getOperatingSystemPageSize(); + private static final long BLOCK_SIZE = PAGE_SIZE; + + private static Configuration conf; + private static MiniDFSCluster cluster = null; + private static FileSystem fs; + private static NameNode nn; + private static FSImage fsImage; + private static DataNode dn; + private static FsDatasetSpi fsd; + private static DatanodeProtocolClientSideTranslatorPB spyNN; + private static PageRounder rounder = new PageRounder(); + private static CacheManipulator prevCacheManipulator; + + static { + EditLogFileOutputStream.setShouldSkipFsyncForTesting(false); + LogManager.getLogger(FsDatasetCache.class).setLevel(Level.DEBUG); + } + + @Before + public void setUp() throws Exception { + assumeTrue(!Path.WINDOWS); + conf = new HdfsConfiguration(); + conf.setLong( + DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS, 100); + conf.setLong(DFSConfigKeys.DFS_CACHEREPORT_INTERVAL_MSEC_KEY, 500); + conf.setLong(DFSConfigKeys.DFS_BLOCK_SIZE_KEY, BLOCK_SIZE); + conf.setLong(DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + CACHE_CAPACITY); + conf.setLong(DFSConfigKeys.DFS_HEARTBEAT_INTERVAL_KEY, 1); + + prevCacheManipulator = NativeIO.POSIX.getCacheManipulator(); + NativeIO.POSIX.setCacheManipulator(new NoMlockCacheManipulator()); + + cluster = new MiniDFSCluster.Builder(conf) + .numDataNodes(1).build(); + cluster.waitActive(); + + fs = cluster.getFileSystem(); + nn = cluster.getNameNode(); + fsImage = nn.getFSImage(); + dn = cluster.getDataNodes().get(0); + fsd = dn.getFSDataset(); + + spyNN = DataNodeTestUtils.spyOnBposToNN(dn, nn); + + } + + @After + public void tearDown() throws Exception { + if (fs != null) { + fs.close(); + } + if (cluster != null) { + cluster.shutdown(); + } + // Restore the original CacheManipulator + NativeIO.POSIX.setCacheManipulator(prevCacheManipulator); + } + + private static void setHeartbeatResponse(DatanodeCommand[] cmds) + throws IOException { + HeartbeatResponse response = new HeartbeatResponse( + cmds, + new NNHAStatusHeartbeat(HAServiceState.ACTIVE, + fsImage.getLastAppliedOrWrittenTxId())); + doReturn(response).when(spyNN).sendHeartbeat( + (DatanodeRegistration) any(), + (StorageReport[]) any(), anyLong(), anyLong(), + anyInt(), anyInt(), anyInt()); + } + + private static DatanodeCommand[] cacheBlock(HdfsBlockLocation loc) { + return cacheBlocks(new HdfsBlockLocation[] {loc}); + } + + private static DatanodeCommand[] cacheBlocks(HdfsBlockLocation[] locs) { + return new DatanodeCommand[] { + getResponse(locs, DatanodeProtocol.DNA_CACHE) + }; + } + + private static DatanodeCommand[] uncacheBlock(HdfsBlockLocation loc) { + return uncacheBlocks(new HdfsBlockLocation[] {loc}); + } + + private static DatanodeCommand[] uncacheBlocks(HdfsBlockLocation[] locs) { + return new DatanodeCommand[] { + getResponse(locs, DatanodeProtocol.DNA_UNCACHE) + }; + } + + /** + * Creates a cache or uncache DatanodeCommand from an array of locations + */ + private static DatanodeCommand getResponse(HdfsBlockLocation[] locs, + int action) { + String bpid = locs[0].getLocatedBlock().getBlock().getBlockPoolId(); + long[] blocks = new long[locs.length]; + for (int i=0; i() { + private int tries = 0; + + @Override + public Boolean get() { + long curCacheUsed = fsd.getCacheUsed(); + long curBlocks = fsd.getNumBlocksCached(); + if ((curCacheUsed != expectedCacheUsed) || + (curBlocks != expectedBlocks)) { + if (tries++ > 10) { + LOG.info("verifyExpectedCacheUsage: have " + + curCacheUsed + "/" + expectedCacheUsed + " bytes cached; " + + curBlocks + "/" + expectedBlocks + " blocks cached. " + + "memlock limit = " + + NativeIO.POSIX.getCacheManipulator().getMemlockLimit() + + ". Waiting..."); + } + return false; + } + return true; + } + }, 100, 60000); + return expectedCacheUsed; + } + + private void testCacheAndUncacheBlock() throws Exception { + LOG.info("beginning testCacheAndUncacheBlock"); + final int NUM_BLOCKS = 5; + + verifyExpectedCacheUsage(0, 0); + assertEquals(0, fsd.getNumBlocksCached()); + + // Write a test file + final Path testFile = new Path("/testCacheBlock"); + final long testFileLen = BLOCK_SIZE*NUM_BLOCKS; + DFSTestUtil.createFile(fs, testFile, testFileLen, (short)1, 0xABBAl); + + // Get the details of the written file + HdfsBlockLocation[] locs = + (HdfsBlockLocation[])fs.getFileBlockLocations(testFile, 0, testFileLen); + assertEquals("Unexpected number of blocks", NUM_BLOCKS, locs.length); + final long[] blockSizes = getBlockSizes(locs); + + // Check initial state + final long cacheCapacity = fsd.getCacheCapacity(); + long cacheUsed = fsd.getCacheUsed(); + long current = 0; + assertEquals("Unexpected cache capacity", CACHE_CAPACITY, cacheCapacity); + assertEquals("Unexpected amount of cache used", current, cacheUsed); + + MetricsRecordBuilder dnMetrics; + long numCacheCommands = 0; + long numUncacheCommands = 0; + + // Cache each block in succession, checking each time + for (int i=0; i numCacheCommands); + numCacheCommands = cmds; + } + + // Uncache each block in succession, again checking each time + for (int i=0; i numUncacheCommands); + numUncacheCommands = cmds; + } + LOG.info("finishing testCacheAndUncacheBlock"); + } + + @Test(timeout=600000) + public void testCacheAndUncacheBlockSimple() throws Exception { + testCacheAndUncacheBlock(); + } + + /** + * Run testCacheAndUncacheBlock with some failures injected into the mlock + * call. This tests the ability of the NameNode to resend commands. + */ + @Test(timeout=600000) + public void testCacheAndUncacheBlockWithRetries() throws Exception { + // We don't have to save the previous cacheManipulator + // because it will be reinstalled by the @After function. + NativeIO.POSIX.setCacheManipulator(new NoMlockCacheManipulator() { + private final Set seenIdentifiers = new HashSet(); + + @Override + public void mlock(String identifier, + ByteBuffer mmap, long length) throws IOException { + if (seenIdentifiers.contains(identifier)) { + // mlock succeeds the second time. + LOG.info("mlocking " + identifier); + return; + } + seenIdentifiers.add(identifier); + throw new IOException("injecting IOException during mlock of " + + identifier); + } + }); + testCacheAndUncacheBlock(); + } + + @Test(timeout=600000) + public void testFilesExceedMaxLockedMemory() throws Exception { + LOG.info("beginning testFilesExceedMaxLockedMemory"); + + // Create some test files that will exceed total cache capacity + final int numFiles = 5; + final long fileSize = CACHE_CAPACITY / (numFiles-1); + + final Path[] testFiles = new Path[numFiles]; + final HdfsBlockLocation[][] fileLocs = new HdfsBlockLocation[numFiles][]; + final long[] fileSizes = new long[numFiles]; + for (int i=0; i() { + @Override + public Boolean get() { + int lines = appender.countLinesWithMessage( + "more bytes in the cache: " + + DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY); + return lines > 0; + } + }, 500, 30000); + // Also check the metrics for the failure + assertTrue("Expected more than 0 failed cache attempts", + fsd.getNumBlocksFailedToCache() > 0); + + // Uncache the n-1 files + for (int i=0; i() { + @Override + public Boolean get() { + return fsd.getNumBlocksFailedToUncache() > 0; + } + }, 100, 10000); + } + + @Test(timeout=60000) + public void testPageRounder() throws Exception { + // Write a small file + Path fileName = new Path("/testPageRounder"); + final int smallBlocks = 512; // This should be smaller than the page size + assertTrue("Page size should be greater than smallBlocks!", + PAGE_SIZE > smallBlocks); + final int numBlocks = 5; + final int fileLen = smallBlocks * numBlocks; + FSDataOutputStream out = + fs.create(fileName, false, 4096, (short)1, smallBlocks); + out.write(new byte[fileLen]); + out.close(); + HdfsBlockLocation[] locs = (HdfsBlockLocation[])fs.getFileBlockLocations( + fileName, 0, fileLen); + // Cache the file and check the sizes match the page size + setHeartbeatResponse(cacheBlocks(locs)); + verifyExpectedCacheUsage(PAGE_SIZE * numBlocks, numBlocks); + // Uncache and check that it decrements by the page size too + setHeartbeatResponse(uncacheBlocks(locs)); + verifyExpectedCacheUsage(0, 0); + } + + @Test(timeout=60000) + public void testUncacheQuiesces() throws Exception { + // Create a file + Path fileName = new Path("/testUncacheQuiesces"); + int fileLen = 4096; + DFSTestUtil.createFile(fs, fileName, fileLen, (short)1, 0xFDFD); + // Cache it + DistributedFileSystem dfs = cluster.getFileSystem(); + dfs.addCachePool(new CachePoolInfo("pool")); + dfs.addCacheDirective(new CacheDirectiveInfo.Builder() + .setPool("pool").setPath(fileName).setReplication((short)3).build()); + GenericTestUtils.waitFor(new Supplier() { + @Override + public Boolean get() { + MetricsRecordBuilder dnMetrics = getMetrics(dn.getMetrics().name()); + long blocksCached = + MetricsAsserts.getLongCounter("BlocksCached", dnMetrics); + return blocksCached > 0; + } + }, 1000, 30000); + // Uncache it + dfs.removeCacheDirective(1); + GenericTestUtils.waitFor(new Supplier() { + @Override + public Boolean get() { + MetricsRecordBuilder dnMetrics = getMetrics(dn.getMetrics().name()); + long blocksUncached = + MetricsAsserts.getLongCounter("BlocksUncached", dnMetrics); + return blocksUncached > 0; + } + }, 1000, 30000); + // Make sure that no additional messages were sent + Thread.sleep(10000); + MetricsRecordBuilder dnMetrics = getMetrics(dn.getMetrics().name()); + MetricsAsserts.assertCounter("BlocksCached", 1l, dnMetrics); + MetricsAsserts.assertCounter("BlocksUncached", 1l, dnMetrics); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestStorageReport.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestStorageReport.java index e84f9291c50..b0c89d9397c 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestStorageReport.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/datanode/TestStorageReport.java @@ -101,7 +101,7 @@ public class TestStorageReport { Mockito.verify(nnSpy).sendHeartbeat( any(DatanodeRegistration.class), captor.capture(), - anyInt(), anyInt(), anyInt()); + anyLong(), anyLong(), anyInt(), anyInt(), anyInt()); StorageReport[] reports = captor.getValue(); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NNThroughputBenchmark.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NNThroughputBenchmark.java index 55bcca737bc..b32aecdb6a5 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NNThroughputBenchmark.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NNThroughputBenchmark.java @@ -956,8 +956,8 @@ public class NNThroughputBenchmark implements Tool { // TODO:FEDERATION currently a single block pool is supported StorageReport[] rep = { new StorageReport(storage, false, DF_CAPACITY, DF_USED, DF_CAPACITY - DF_USED, DF_USED) }; - DatanodeCommand[] cmds = nameNodeProto.sendHeartbeat(dnRegistration, - rep, 0, 0, 0).getCommands(); + DatanodeCommand[] cmds = nameNodeProto.sendHeartbeat(dnRegistration, rep, + 0L, 0L, 0, 0, 0).getCommands(); if(cmds != null) { for (DatanodeCommand cmd : cmds ) { if(LOG.isDebugEnabled()) { @@ -1004,7 +1004,7 @@ public class NNThroughputBenchmark implements Tool { StorageReport[] rep = { new StorageReport(storage, false, DF_CAPACITY, DF_USED, DF_CAPACITY - DF_USED, DF_USED) }; DatanodeCommand[] cmds = nameNodeProto.sendHeartbeat(dnRegistration, - rep, 0, 0, 0).getCommands(); + rep, 0L, 0L, 0, 0, 0).getCommands(); if (cmds != null) { for (DatanodeCommand cmd : cmds) { if (cmd.getAction() == DatanodeProtocol.DNA_TRANSFER) { diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NameNodeAdapter.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NameNodeAdapter.java index 0ebf929c2bc..2b29ac41395 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NameNodeAdapter.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/NameNodeAdapter.java @@ -114,7 +114,7 @@ public class NameNodeAdapter { DatanodeDescriptor dd, FSNamesystem namesystem) throws IOException { return namesystem.handleHeartbeat(nodeReg, BlockManagerTestUtil.getStorageReportsForDatanode(dd), - 0, 0, 0); + dd.getCacheCapacity(), dd.getCacheRemaining(), 0, 0, 0); } public static boolean setReplication(final FSNamesystem ns, diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestCacheDirectives.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestCacheDirectives.java new file mode 100644 index 00000000000..d47c275771f --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestCacheDirectives.java @@ -0,0 +1,1393 @@ +/** + * Licensed to the Apache Software Foundation (ASF) under one + * or more contributor license agreements. See the NOTICE file + * distributed with this work for additional information + * regarding copyright ownership. The ASF licenses this file + * to you under the Apache License, Version 2.0 (the + * "License"); you may not use this file except in compliance + * with the License. You may obtain a copy of the License at + * + * http://www.apache.org/licenses/LICENSE-2.0 + * + * Unless required by applicable law or agreed to in writing, software + * distributed under the License is distributed on an "AS IS" BASIS, + * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + * See the License for the specific language governing permissions and + * limitations under the License. + */ +package org.apache.hadoop.hdfs.server.namenode; + +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_BLOCK_SIZE_KEY; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_CACHEREPORT_INTERVAL_MSEC_KEY; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_HEARTBEAT_INTERVAL_KEY; +import static org.apache.hadoop.hdfs.DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS; +import static org.apache.hadoop.hdfs.protocol.CachePoolInfo.RELATIVE_EXPIRY_NEVER; +import static org.apache.hadoop.test.GenericTestUtils.assertExceptionContains; +import static org.junit.Assert.assertEquals; +import static org.junit.Assert.assertFalse; +import static org.junit.Assert.assertNotNull; +import static org.junit.Assert.assertNull; +import static org.junit.Assert.assertTrue; +import static org.junit.Assert.fail; + +import java.io.IOException; +import java.security.PrivilegedExceptionAction; +import java.util.ArrayList; +import java.util.Date; +import java.util.EnumSet; +import java.util.Iterator; +import java.util.LinkedList; +import java.util.List; + +import org.apache.commons.lang.time.DateUtils; +import org.apache.commons.logging.Log; +import org.apache.commons.logging.LogFactory; +import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.BlockLocation; +import org.apache.hadoop.fs.CacheFlag; +import org.apache.hadoop.fs.FileStatus; +import org.apache.hadoop.fs.FileSystem; +import org.apache.hadoop.fs.FileSystemTestHelper; +import org.apache.hadoop.fs.InvalidRequestException; +import org.apache.hadoop.fs.Path; +import org.apache.hadoop.fs.RemoteIterator; +import org.apache.hadoop.fs.permission.FsPermission; +import org.apache.hadoop.hdfs.DFSConfigKeys; +import org.apache.hadoop.hdfs.DFSTestUtil; +import org.apache.hadoop.hdfs.DistributedFileSystem; +import org.apache.hadoop.hdfs.HdfsConfiguration; +import org.apache.hadoop.hdfs.LogVerificationAppender; +import org.apache.hadoop.hdfs.MiniDFSCluster; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo.Expiration; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveIterator; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveStats; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; +import org.apache.hadoop.hdfs.protocol.CachePoolStats; +import org.apache.hadoop.hdfs.protocol.DatanodeInfo; +import org.apache.hadoop.hdfs.protocol.HdfsConstants.DatanodeReportType; +import org.apache.hadoop.hdfs.server.blockmanagement.CacheReplicationMonitor; +import org.apache.hadoop.hdfs.server.blockmanagement.DatanodeDescriptor.CachedBlocksList.Type; +import org.apache.hadoop.hdfs.server.datanode.DataNode; +import org.apache.hadoop.hdfs.server.protocol.NamenodeProtocols; +import org.apache.hadoop.io.nativeio.NativeIO; +import org.apache.hadoop.io.nativeio.NativeIO.POSIX.CacheManipulator; +import org.apache.hadoop.io.nativeio.NativeIO.POSIX.NoMlockCacheManipulator; +import org.apache.hadoop.security.AccessControlException; +import org.apache.hadoop.security.UserGroupInformation; +import org.apache.hadoop.test.GenericTestUtils; +import org.apache.hadoop.util.GSet; +import org.apache.log4j.Level; +import org.apache.log4j.LogManager; +import org.apache.log4j.Logger; +import org.junit.After; +import org.junit.Assert; +import org.junit.Before; +import org.junit.Test; + +import com.google.common.base.Supplier; + +public class TestCacheDirectives { + static final Log LOG = LogFactory.getLog(TestCacheDirectives.class); + + private static final UserGroupInformation unprivilegedUser = + UserGroupInformation.createRemoteUser("unprivilegedUser"); + + static private Configuration conf; + static private MiniDFSCluster cluster; + static private DistributedFileSystem dfs; + static private NamenodeProtocols proto; + static private NameNode namenode; + static private CacheManipulator prevCacheManipulator; + + static { + NativeIO.POSIX.setCacheManipulator(new NoMlockCacheManipulator()); + EditLogFileOutputStream.setShouldSkipFsyncForTesting(false); + } + + private static final long BLOCK_SIZE = 4096; + private static final int NUM_DATANODES = 4; + // Most Linux installs will allow non-root users to lock 64KB. + // In this test though, we stub out mlock so this doesn't matter. + private static final long CACHE_CAPACITY = 64 * 1024 / NUM_DATANODES; + + private static HdfsConfiguration createCachingConf() { + HdfsConfiguration conf = new HdfsConfiguration(); + conf.setLong(DFS_BLOCK_SIZE_KEY, BLOCK_SIZE); + conf.setLong(DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, CACHE_CAPACITY); + conf.setLong(DFS_HEARTBEAT_INTERVAL_KEY, 1); + conf.setLong(DFS_CACHEREPORT_INTERVAL_MSEC_KEY, 1000); + conf.setLong(DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS, 1000); + // set low limits here for testing purposes + conf.setInt(DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES, 2); + conf.setInt(DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES, + 2); + + return conf; + } + + @Before + public void setup() throws Exception { + conf = createCachingConf(); + cluster = + new MiniDFSCluster.Builder(conf).numDataNodes(NUM_DATANODES).build(); + cluster.waitActive(); + dfs = cluster.getFileSystem(); + proto = cluster.getNameNodeRpc(); + namenode = cluster.getNameNode(); + prevCacheManipulator = NativeIO.POSIX.getCacheManipulator(); + NativeIO.POSIX.setCacheManipulator(new NoMlockCacheManipulator()); + LogManager.getLogger(CacheReplicationMonitor.class.getName()).setLevel( + Level.TRACE); + LogManager.getLogger(CacheManager.class.getName()).setLevel( + Level.TRACE); + } + + @After + public void teardown() throws Exception { + if (cluster != null) { + cluster.shutdown(); + } + // Restore the original CacheManipulator + NativeIO.POSIX.setCacheManipulator(prevCacheManipulator); + } + + @Test(timeout=60000) + public void testBasicPoolOperations() throws Exception { + final String poolName = "pool1"; + CachePoolInfo info = new CachePoolInfo(poolName). + setOwnerName("bob").setGroupName("bobgroup"). + setMode(new FsPermission((short)0755)).setLimit(150l); + + // Add a pool + dfs.addCachePool(info); + + // Do some bad addCachePools + try { + dfs.addCachePool(info); + fail("added the pool with the same name twice"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("pool1 already exists", ioe); + } + try { + dfs.addCachePool(new CachePoolInfo("")); + fail("added empty pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + dfs.addCachePool(null); + fail("added null pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("CachePoolInfo is null", ioe); + } + try { + proto.addCachePool(new CachePoolInfo("")); + fail("added empty pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + proto.addCachePool(null); + fail("added null pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("CachePoolInfo is null", ioe); + } + + // Modify the pool + info.setOwnerName("jane").setGroupName("janegroup") + .setMode(new FsPermission((short)0700)).setLimit(314l); + dfs.modifyCachePool(info); + + // Do some invalid modify pools + try { + dfs.modifyCachePool(new CachePoolInfo("fool")); + fail("modified non-existent cache pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("fool does not exist", ioe); + } + try { + dfs.modifyCachePool(new CachePoolInfo("")); + fail("modified empty pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + dfs.modifyCachePool(null); + fail("modified null pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("CachePoolInfo is null", ioe); + } + try { + proto.modifyCachePool(new CachePoolInfo("")); + fail("modified empty pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + proto.modifyCachePool(null); + fail("modified null pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("CachePoolInfo is null", ioe); + } + + // Remove the pool + dfs.removeCachePool(poolName); + // Do some bad removePools + try { + dfs.removeCachePool("pool99"); + fail("expected to get an exception when " + + "removing a non-existent pool."); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("Cannot remove " + + "non-existent cache pool", ioe); + } + try { + dfs.removeCachePool(poolName); + fail("expected to get an exception when " + + "removing a non-existent pool."); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("Cannot remove " + + "non-existent cache pool", ioe); + } + try { + dfs.removeCachePool(""); + fail("removed empty pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + dfs.removeCachePool(null); + fail("removed null pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + proto.removeCachePool(""); + fail("removed empty pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + try { + proto.removeCachePool(null); + fail("removed null pool"); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("invalid empty cache pool name", + ioe); + } + + info = new CachePoolInfo("pool2"); + dfs.addCachePool(info); + } + + @Test(timeout=60000) + public void testCreateAndModifyPools() throws Exception { + String poolName = "pool1"; + String ownerName = "abc"; + String groupName = "123"; + FsPermission mode = new FsPermission((short)0755); + long limit = 150; + dfs.addCachePool(new CachePoolInfo(poolName). + setOwnerName(ownerName).setGroupName(groupName). + setMode(mode).setLimit(limit)); + + RemoteIterator iter = dfs.listCachePools(); + CachePoolInfo info = iter.next().getInfo(); + assertEquals(poolName, info.getPoolName()); + assertEquals(ownerName, info.getOwnerName()); + assertEquals(groupName, info.getGroupName()); + + ownerName = "def"; + groupName = "456"; + mode = new FsPermission((short)0700); + limit = 151; + dfs.modifyCachePool(new CachePoolInfo(poolName). + setOwnerName(ownerName).setGroupName(groupName). + setMode(mode).setLimit(limit)); + + iter = dfs.listCachePools(); + info = iter.next().getInfo(); + assertEquals(poolName, info.getPoolName()); + assertEquals(ownerName, info.getOwnerName()); + assertEquals(groupName, info.getGroupName()); + assertEquals(mode, info.getMode()); + assertEquals(limit, (long)info.getLimit()); + + dfs.removeCachePool(poolName); + iter = dfs.listCachePools(); + assertFalse("expected no cache pools after deleting pool", iter.hasNext()); + + proto.listCachePools(null); + + try { + proto.removeCachePool("pool99"); + fail("expected to get an exception when " + + "removing a non-existent pool."); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("Cannot remove non-existent", + ioe); + } + try { + proto.removeCachePool(poolName); + fail("expected to get an exception when " + + "removing a non-existent pool."); + } catch (IOException ioe) { + GenericTestUtils.assertExceptionContains("Cannot remove non-existent", + ioe); + } + + iter = dfs.listCachePools(); + assertFalse("expected no cache pools after deleting pool", iter.hasNext()); + } + + private static void validateListAll( + RemoteIterator iter, + Long... ids) throws Exception { + for (Long id: ids) { + assertTrue("Unexpectedly few elements", iter.hasNext()); + assertEquals("Unexpected directive ID", id, + iter.next().getInfo().getId()); + } + assertFalse("Unexpectedly many list elements", iter.hasNext()); + } + + private static long addAsUnprivileged( + final CacheDirectiveInfo directive) throws Exception { + return unprivilegedUser + .doAs(new PrivilegedExceptionAction() { + @Override + public Long run() throws IOException { + DistributedFileSystem myDfs = + (DistributedFileSystem) FileSystem.get(conf); + return myDfs.addCacheDirective(directive); + } + }); + } + + @Test(timeout=60000) + public void testAddRemoveDirectives() throws Exception { + proto.addCachePool(new CachePoolInfo("pool1"). + setMode(new FsPermission((short)0777))); + proto.addCachePool(new CachePoolInfo("pool2"). + setMode(new FsPermission((short)0777))); + proto.addCachePool(new CachePoolInfo("pool3"). + setMode(new FsPermission((short)0777))); + proto.addCachePool(new CachePoolInfo("pool4"). + setMode(new FsPermission((short)0))); + + CacheDirectiveInfo alpha = new CacheDirectiveInfo.Builder(). + setPath(new Path("/alpha")). + setPool("pool1"). + build(); + CacheDirectiveInfo beta = new CacheDirectiveInfo.Builder(). + setPath(new Path("/beta")). + setPool("pool2"). + build(); + CacheDirectiveInfo delta = new CacheDirectiveInfo.Builder(). + setPath(new Path("/delta")). + setPool("pool1"). + build(); + + long alphaId = addAsUnprivileged(alpha); + long alphaId2 = addAsUnprivileged(alpha); + assertFalse("Expected to get unique directives when re-adding an " + + "existing CacheDirectiveInfo", + alphaId == alphaId2); + long betaId = addAsUnprivileged(beta); + + try { + addAsUnprivileged(new CacheDirectiveInfo.Builder(). + setPath(new Path("/unicorn")). + setPool("no_such_pool"). + build()); + fail("expected an error when adding to a non-existent pool."); + } catch (InvalidRequestException ioe) { + GenericTestUtils.assertExceptionContains("Unknown pool", ioe); + } + + try { + addAsUnprivileged(new CacheDirectiveInfo.Builder(). + setPath(new Path("/blackhole")). + setPool("pool4"). + build()); + fail("expected an error when adding to a pool with " + + "mode 0 (no permissions for anyone)."); + } catch (AccessControlException e) { + GenericTestUtils. + assertExceptionContains("Permission denied while accessing pool", e); + } + + try { + addAsUnprivileged(new CacheDirectiveInfo.Builder(). + setPath(new Path("/illegal:path/")). + setPool("pool1"). + build()); + fail("expected an error when adding a malformed path " + + "to the cache directives."); + } catch (IllegalArgumentException e) { + GenericTestUtils.assertExceptionContains("is not a valid DFS filename", e); + } + + try { + addAsUnprivileged(new CacheDirectiveInfo.Builder(). + setPath(new Path("/emptypoolname")). + setReplication((short)1). + setPool(""). + build()); + fail("expected an error when adding a cache " + + "directive with an empty pool name."); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("Invalid empty pool name", e); + } + + long deltaId = addAsUnprivileged(delta); + + // We expect the following to succeed, because DistributedFileSystem + // qualifies the path. + long relativeId = addAsUnprivileged( + new CacheDirectiveInfo.Builder(). + setPath(new Path("relative")). + setPool("pool1"). + build()); + + RemoteIterator iter; + iter = dfs.listCacheDirectives(null); + validateListAll(iter, alphaId, alphaId2, betaId, deltaId, relativeId ); + iter = dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder().setPool("pool3").build()); + assertFalse(iter.hasNext()); + iter = dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder().setPool("pool1").build()); + validateListAll(iter, alphaId, alphaId2, deltaId, relativeId ); + iter = dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder().setPool("pool2").build()); + validateListAll(iter, betaId); + + dfs.removeCacheDirective(betaId); + iter = dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder().setPool("pool2").build()); + assertFalse(iter.hasNext()); + + try { + dfs.removeCacheDirective(betaId); + fail("expected an error when removing a non-existent ID"); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("No directive with ID", e); + } + + try { + proto.removeCacheDirective(-42l); + fail("expected an error when removing a negative ID"); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains( + "Invalid negative ID", e); + } + try { + proto.removeCacheDirective(43l); + fail("expected an error when removing a non-existent ID"); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("No directive with ID", e); + } + + dfs.removeCacheDirective(alphaId); + dfs.removeCacheDirective(alphaId2); + dfs.removeCacheDirective(deltaId); + + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(). + setId(relativeId). + setReplication((short)555). + build()); + iter = dfs.listCacheDirectives(null); + assertTrue(iter.hasNext()); + CacheDirectiveInfo modified = iter.next().getInfo(); + assertEquals(relativeId, modified.getId().longValue()); + assertEquals((short)555, modified.getReplication().shortValue()); + dfs.removeCacheDirective(relativeId); + iter = dfs.listCacheDirectives(null); + assertFalse(iter.hasNext()); + + // Verify that PBCDs with path "." work correctly + CacheDirectiveInfo directive = + new CacheDirectiveInfo.Builder().setPath(new Path(".")) + .setPool("pool1").build(); + long id = dfs.addCacheDirective(directive); + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder( + directive).setId(id).setReplication((short)2).build()); + dfs.removeCacheDirective(id); + } + + @Test(timeout=60000) + public void testCacheManagerRestart() throws Exception { + // Create and validate a pool + final String pool = "poolparty"; + String groupName = "partygroup"; + FsPermission mode = new FsPermission((short)0777); + long limit = 747; + dfs.addCachePool(new CachePoolInfo(pool) + .setGroupName(groupName) + .setMode(mode) + .setLimit(limit)); + RemoteIterator pit = dfs.listCachePools(); + assertTrue("No cache pools found", pit.hasNext()); + CachePoolInfo info = pit.next().getInfo(); + assertEquals(pool, info.getPoolName()); + assertEquals(groupName, info.getGroupName()); + assertEquals(mode, info.getMode()); + assertEquals(limit, (long)info.getLimit()); + assertFalse("Unexpected # of cache pools found", pit.hasNext()); + + // Create some cache entries + int numEntries = 10; + String entryPrefix = "/party-"; + long prevId = -1; + final Date expiry = new Date(); + for (int i=0; i dit + = dfs.listCacheDirectives(null); + for (int i=0; i() { + @Override + public Boolean get() { + int numCachedBlocks = 0, numCachedReplicas = 0; + namesystem.readLock(); + try { + GSet cachedBlocks = + cacheManager.getCachedBlocks(); + if (cachedBlocks != null) { + for (Iterator iter = cachedBlocks.iterator(); + iter.hasNext(); ) { + CachedBlock cachedBlock = iter.next(); + numCachedBlocks++; + numCachedReplicas += cachedBlock.getDatanodes(Type.CACHED).size(); + } + } + } finally { + namesystem.readUnlock(); + } + if (expectedCachedBlocks == -1 || + numCachedBlocks == expectedCachedBlocks) { + if (expectedCachedReplicas == -1 || + numCachedReplicas == expectedCachedReplicas) { + return true; + } + } + LOG.info(logString + " cached blocks: have " + numCachedBlocks + + " / " + expectedCachedBlocks + ". " + + "cached replicas: have " + numCachedReplicas + + " / " + expectedCachedReplicas); + return false; + } + }, 500, 60000); + } + + private static void waitForCacheDirectiveStats(final DistributedFileSystem dfs, + final long targetBytesNeeded, final long targetBytesCached, + final long targetFilesNeeded, final long targetFilesCached, + final CacheDirectiveInfo filter, final String infoString) + throws Exception { + LOG.info("Polling listCacheDirectives " + + ((filter == null) ? "ALL" : filter.toString()) + " for " + + targetBytesNeeded + " targetBytesNeeded, " + + targetBytesCached + " targetBytesCached, " + + targetFilesNeeded + " targetFilesNeeded, " + + targetFilesCached + " targetFilesCached"); + GenericTestUtils.waitFor(new Supplier() { + @Override + public Boolean get() { + RemoteIterator iter = null; + CacheDirectiveEntry entry = null; + try { + iter = dfs.listCacheDirectives(filter); + entry = iter.next(); + } catch (IOException e) { + fail("got IOException while calling " + + "listCacheDirectives: " + e.getMessage()); + } + Assert.assertNotNull(entry); + CacheDirectiveStats stats = entry.getStats(); + if ((targetBytesNeeded == stats.getBytesNeeded()) && + (targetBytesCached == stats.getBytesCached()) && + (targetFilesNeeded == stats.getFilesNeeded()) && + (targetFilesCached == stats.getFilesCached())) { + return true; + } else { + LOG.info(infoString + ": " + + "filesNeeded: " + + stats.getFilesNeeded() + "/" + targetFilesNeeded + + ", filesCached: " + + stats.getFilesCached() + "/" + targetFilesCached + + ", bytesNeeded: " + + stats.getBytesNeeded() + "/" + targetBytesNeeded + + ", bytesCached: " + + stats.getBytesCached() + "/" + targetBytesCached); + return false; + } + } + }, 500, 60000); + } + + private static void waitForCachePoolStats(final DistributedFileSystem dfs, + final long targetBytesNeeded, final long targetBytesCached, + final long targetFilesNeeded, final long targetFilesCached, + final CachePoolInfo pool, final String infoString) + throws Exception { + LOG.info("Polling listCachePools " + pool.toString() + " for " + + targetBytesNeeded + " targetBytesNeeded, " + + targetBytesCached + " targetBytesCached, " + + targetFilesNeeded + " targetFilesNeeded, " + + targetFilesCached + " targetFilesCached"); + GenericTestUtils.waitFor(new Supplier() { + @Override + public Boolean get() { + RemoteIterator iter = null; + try { + iter = dfs.listCachePools(); + } catch (IOException e) { + fail("got IOException while calling " + + "listCachePools: " + e.getMessage()); + } + while (true) { + CachePoolEntry entry = null; + try { + if (!iter.hasNext()) { + break; + } + entry = iter.next(); + } catch (IOException e) { + fail("got IOException while iterating through " + + "listCachePools: " + e.getMessage()); + } + if (entry == null) { + break; + } + if (!entry.getInfo().getPoolName().equals(pool.getPoolName())) { + continue; + } + CachePoolStats stats = entry.getStats(); + if ((targetBytesNeeded == stats.getBytesNeeded()) && + (targetBytesCached == stats.getBytesCached()) && + (targetFilesNeeded == stats.getFilesNeeded()) && + (targetFilesCached == stats.getFilesCached())) { + return true; + } else { + LOG.info(infoString + ": " + + "filesNeeded: " + + stats.getFilesNeeded() + "/" + targetFilesNeeded + + ", filesCached: " + + stats.getFilesCached() + "/" + targetFilesCached + + ", bytesNeeded: " + + stats.getBytesNeeded() + "/" + targetBytesNeeded + + ", bytesCached: " + + stats.getBytesCached() + "/" + targetBytesCached); + return false; + } + } + return false; + } + }, 500, 60000); + } + + private static void checkNumCachedReplicas(final DistributedFileSystem dfs, + final List paths, final int expectedBlocks, + final int expectedReplicas) + throws Exception { + int numCachedBlocks = 0; + int numCachedReplicas = 0; + for (Path p: paths) { + final FileStatus f = dfs.getFileStatus(p); + final long len = f.getLen(); + final long blockSize = f.getBlockSize(); + // round it up to full blocks + final long numBlocks = (len + blockSize - 1) / blockSize; + BlockLocation[] locs = dfs.getFileBlockLocations(p, 0, len); + assertEquals("Unexpected number of block locations for path " + p, + numBlocks, locs.length); + for (BlockLocation l: locs) { + if (l.getCachedHosts().length > 0) { + numCachedBlocks++; + } + numCachedReplicas += l.getCachedHosts().length; + } + } + LOG.info("Found " + numCachedBlocks + " of " + expectedBlocks + " blocks"); + LOG.info("Found " + numCachedReplicas + " of " + expectedReplicas + + " replicas"); + assertEquals("Unexpected number of cached blocks", expectedBlocks, + numCachedBlocks); + assertEquals("Unexpected number of cached replicas", expectedReplicas, + numCachedReplicas); + } + + @Test(timeout=120000) + public void testWaitForCachedReplicas() throws Exception { + FileSystemTestHelper helper = new FileSystemTestHelper(); + GenericTestUtils.waitFor(new Supplier() { + @Override + public Boolean get() { + return ((namenode.getNamesystem().getCacheCapacity() == + (NUM_DATANODES * CACHE_CAPACITY)) && + (namenode.getNamesystem().getCacheUsed() == 0)); + } + }, 500, 60000); + + // Send a cache report referring to a bogus block. It is important that + // the NameNode be robust against this. + NamenodeProtocols nnRpc = namenode.getRpcServer(); + DataNode dn0 = cluster.getDataNodes().get(0); + String bpid = cluster.getNamesystem().getBlockPoolId(); + LinkedList bogusBlockIds = new LinkedList (); + bogusBlockIds.add(999999L); + nnRpc.cacheReport(dn0.getDNRegistrationForBP(bpid), bpid, bogusBlockIds); + + Path rootDir = helper.getDefaultWorkingDirectory(dfs); + // Create the pool + final String pool = "friendlyPool"; + nnRpc.addCachePool(new CachePoolInfo("friendlyPool")); + // Create some test files + final int numFiles = 2; + final int numBlocksPerFile = 2; + final List paths = new ArrayList(numFiles); + for (int i=0; i entries = + new CacheDirectiveIterator(nnRpc, null); + for (int i=0; i paths = new LinkedList(); + paths.add(new Path("/foo/bar")); + paths.add(new Path("/foo/baz")); + paths.add(new Path("/foo2/bar2")); + paths.add(new Path("/foo2/baz2")); + dfs.mkdir(new Path("/foo"), FsPermission.getDirDefault()); + dfs.mkdir(new Path("/foo2"), FsPermission.getDirDefault()); + final int numBlocksPerFile = 2; + for (Path path : paths) { + FileSystemTestHelper.createFile(dfs, path, numBlocksPerFile, + (int)BLOCK_SIZE, (short)3, false); + } + waitForCachedBlocks(namenode, 0, 0, + "testWaitForCachedReplicasInDirectory:0"); + + // cache entire directory + long id = dfs.addCacheDirective( + new CacheDirectiveInfo.Builder(). + setPath(new Path("/foo")). + setReplication((short)2). + setPool(pool). + build()); + waitForCachedBlocks(namenode, 4, 8, + "testWaitForCachedReplicasInDirectory:1:blocks"); + // Verify that listDirectives gives the stats we want. + waitForCacheDirectiveStats(dfs, + 4 * numBlocksPerFile * BLOCK_SIZE, 4 * numBlocksPerFile * BLOCK_SIZE, + 2, 2, + new CacheDirectiveInfo.Builder(). + setPath(new Path("/foo")). + build(), + "testWaitForCachedReplicasInDirectory:1:directive"); + waitForCachePoolStats(dfs, + 4 * numBlocksPerFile * BLOCK_SIZE, 4 * numBlocksPerFile * BLOCK_SIZE, + 2, 2, + poolInfo, "testWaitForCachedReplicasInDirectory:1:pool"); + + long id2 = dfs.addCacheDirective( + new CacheDirectiveInfo.Builder(). + setPath(new Path("/foo/bar")). + setReplication((short)4). + setPool(pool). + build()); + // wait for an additional 2 cached replicas to come up + waitForCachedBlocks(namenode, 4, 10, + "testWaitForCachedReplicasInDirectory:2:blocks"); + // the directory directive's stats are unchanged + waitForCacheDirectiveStats(dfs, + 4 * numBlocksPerFile * BLOCK_SIZE, 4 * numBlocksPerFile * BLOCK_SIZE, + 2, 2, + new CacheDirectiveInfo.Builder(). + setPath(new Path("/foo")). + build(), + "testWaitForCachedReplicasInDirectory:2:directive-1"); + // verify /foo/bar's stats + waitForCacheDirectiveStats(dfs, + 4 * numBlocksPerFile * BLOCK_SIZE, + // only 3 because the file only has 3 replicas, not 4 as requested. + 3 * numBlocksPerFile * BLOCK_SIZE, + 1, + // only 0 because the file can't be fully cached + 0, + new CacheDirectiveInfo.Builder(). + setPath(new Path("/foo/bar")). + build(), + "testWaitForCachedReplicasInDirectory:2:directive-2"); + waitForCachePoolStats(dfs, + (4+4) * numBlocksPerFile * BLOCK_SIZE, + (4+3) * numBlocksPerFile * BLOCK_SIZE, + 3, 2, + poolInfo, "testWaitForCachedReplicasInDirectory:2:pool"); + // remove and watch numCached go to 0 + dfs.removeCacheDirective(id); + dfs.removeCacheDirective(id2); + waitForCachedBlocks(namenode, 0, 0, + "testWaitForCachedReplicasInDirectory:3:blocks"); + waitForCachePoolStats(dfs, + 0, 0, + 0, 0, + poolInfo, "testWaitForCachedReplicasInDirectory:3:pool"); + } + + /** + * Tests stepping the cache replication factor up and down, checking the + * number of cached replicas and blocks as well as the advertised locations. + * @throws Exception + */ + @Test(timeout=120000) + public void testReplicationFactor() throws Exception { + // Create the pool + final String pool = "friendlyPool"; + dfs.addCachePool(new CachePoolInfo(pool)); + // Create some test files + final List paths = new LinkedList(); + paths.add(new Path("/foo/bar")); + paths.add(new Path("/foo/baz")); + paths.add(new Path("/foo2/bar2")); + paths.add(new Path("/foo2/baz2")); + dfs.mkdir(new Path("/foo"), FsPermission.getDirDefault()); + dfs.mkdir(new Path("/foo2"), FsPermission.getDirDefault()); + final int numBlocksPerFile = 2; + for (Path path : paths) { + FileSystemTestHelper.createFile(dfs, path, numBlocksPerFile, + (int)BLOCK_SIZE, (short)3, false); + } + waitForCachedBlocks(namenode, 0, 0, "testReplicationFactor:0"); + checkNumCachedReplicas(dfs, paths, 0, 0); + // cache directory + long id = dfs.addCacheDirective( + new CacheDirectiveInfo.Builder(). + setPath(new Path("/foo")). + setReplication((short)1). + setPool(pool). + build()); + waitForCachedBlocks(namenode, 4, 4, "testReplicationFactor:1"); + checkNumCachedReplicas(dfs, paths, 4, 4); + // step up the replication factor + for (int i=2; i<=3; i++) { + dfs.modifyCacheDirective( + new CacheDirectiveInfo.Builder(). + setId(id). + setReplication((short)i). + build()); + waitForCachedBlocks(namenode, 4, 4*i, "testReplicationFactor:2"); + checkNumCachedReplicas(dfs, paths, 4, 4*i); + } + // step it down + for (int i=2; i>=1; i--) { + dfs.modifyCacheDirective( + new CacheDirectiveInfo.Builder(). + setId(id). + setReplication((short)i). + build()); + waitForCachedBlocks(namenode, 4, 4*i, "testReplicationFactor:3"); + checkNumCachedReplicas(dfs, paths, 4, 4*i); + } + // remove and watch numCached go to 0 + dfs.removeCacheDirective(id); + waitForCachedBlocks(namenode, 0, 0, "testReplicationFactor:4"); + checkNumCachedReplicas(dfs, paths, 0, 0); + } + + @Test(timeout=60000) + public void testListCachePoolPermissions() throws Exception { + final UserGroupInformation myUser = UserGroupInformation + .createRemoteUser("myuser"); + final DistributedFileSystem myDfs = + (DistributedFileSystem)DFSTestUtil.getFileSystemAs(myUser, conf); + final String poolName = "poolparty"; + dfs.addCachePool(new CachePoolInfo(poolName) + .setMode(new FsPermission((short)0700))); + // Should only see partial info + RemoteIterator it = myDfs.listCachePools(); + CachePoolInfo info = it.next().getInfo(); + assertFalse(it.hasNext()); + assertEquals("Expected pool name", poolName, info.getPoolName()); + assertNull("Unexpected owner name", info.getOwnerName()); + assertNull("Unexpected group name", info.getGroupName()); + assertNull("Unexpected mode", info.getMode()); + assertNull("Unexpected limit", info.getLimit()); + // Modify the pool so myuser is now the owner + final long limit = 99; + dfs.modifyCachePool(new CachePoolInfo(poolName) + .setOwnerName(myUser.getShortUserName()) + .setLimit(limit)); + // Should see full info + it = myDfs.listCachePools(); + info = it.next().getInfo(); + assertFalse(it.hasNext()); + assertEquals("Expected pool name", poolName, info.getPoolName()); + assertEquals("Mismatched owner name", myUser.getShortUserName(), + info.getOwnerName()); + assertNotNull("Expected group name", info.getGroupName()); + assertEquals("Mismatched mode", (short) 0700, + info.getMode().toShort()); + assertEquals("Mismatched limit", limit, (long)info.getLimit()); + } + + @Test(timeout=120000) + public void testExpiry() throws Exception { + String pool = "pool1"; + dfs.addCachePool(new CachePoolInfo(pool)); + Path p = new Path("/mypath"); + DFSTestUtil.createFile(dfs, p, BLOCK_SIZE*2, (short)2, 0x999); + // Expire after test timeout + Date start = new Date(); + Date expiry = DateUtils.addSeconds(start, 120); + final long id = dfs.addCacheDirective(new CacheDirectiveInfo.Builder() + .setPath(p) + .setPool(pool) + .setExpiration(CacheDirectiveInfo.Expiration.newAbsolute(expiry)) + .setReplication((short)2) + .build()); + waitForCachedBlocks(cluster.getNameNode(), 2, 4, "testExpiry:1"); + // Change it to expire sooner + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder().setId(id) + .setExpiration(Expiration.newRelative(0)).build()); + waitForCachedBlocks(cluster.getNameNode(), 0, 0, "testExpiry:2"); + RemoteIterator it = dfs.listCacheDirectives(null); + CacheDirectiveEntry ent = it.next(); + assertFalse(it.hasNext()); + Date entryExpiry = new Date(ent.getInfo().getExpiration().getMillis()); + assertTrue("Directive should have expired", + entryExpiry.before(new Date())); + // Change it back to expire later + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder().setId(id) + .setExpiration(Expiration.newRelative(120000)).build()); + waitForCachedBlocks(cluster.getNameNode(), 2, 4, "testExpiry:3"); + it = dfs.listCacheDirectives(null); + ent = it.next(); + assertFalse(it.hasNext()); + entryExpiry = new Date(ent.getInfo().getExpiration().getMillis()); + assertTrue("Directive should not have expired", + entryExpiry.after(new Date())); + // Verify that setting a negative TTL throws an error + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder().setId(id) + .setExpiration(Expiration.newRelative(-1)).build()); + } catch (InvalidRequestException e) { + GenericTestUtils + .assertExceptionContains("Cannot set a negative expiration", e); + } + } + + @Test(timeout=120000) + public void testLimit() throws Exception { + try { + dfs.addCachePool(new CachePoolInfo("poolofnegativity").setLimit(-99l)); + fail("Should not be able to set a negative limit"); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("negative", e); + } + final String destiny = "poolofdestiny"; + final Path path1 = new Path("/destiny"); + DFSTestUtil.createFile(dfs, path1, 2*BLOCK_SIZE, (short)1, 0x9494); + // Start off with a limit that is too small + final CachePoolInfo poolInfo = new CachePoolInfo(destiny) + .setLimit(2*BLOCK_SIZE-1); + dfs.addCachePool(poolInfo); + final CacheDirectiveInfo info1 = new CacheDirectiveInfo.Builder() + .setPool(destiny).setPath(path1).build(); + try { + dfs.addCacheDirective(info1); + fail("Should not be able to cache when there is no more limit"); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("remaining capacity", e); + } + // Raise the limit up to fit and it should work this time + poolInfo.setLimit(2*BLOCK_SIZE); + dfs.modifyCachePool(poolInfo); + long id1 = dfs.addCacheDirective(info1); + waitForCachePoolStats(dfs, + 2*BLOCK_SIZE, 2*BLOCK_SIZE, + 1, 1, + poolInfo, "testLimit:1"); + // Adding another file, it shouldn't be cached + final Path path2 = new Path("/failure"); + DFSTestUtil.createFile(dfs, path2, BLOCK_SIZE, (short)1, 0x9495); + try { + dfs.addCacheDirective(new CacheDirectiveInfo.Builder() + .setPool(destiny).setPath(path2).build(), + EnumSet.noneOf(CacheFlag.class)); + fail("Should not be able to add another cached file"); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("remaining capacity", e); + } + // Bring the limit down, the first file should get uncached + poolInfo.setLimit(BLOCK_SIZE); + dfs.modifyCachePool(poolInfo); + waitForCachePoolStats(dfs, + 2*BLOCK_SIZE, 0, + 1, 0, + poolInfo, "testLimit:2"); + RemoteIterator it = dfs.listCachePools(); + assertTrue("Expected a cache pool", it.hasNext()); + CachePoolStats stats = it.next().getStats(); + assertEquals("Overlimit bytes should be difference of needed and limit", + BLOCK_SIZE, stats.getBytesOverlimit()); + // Moving a directive to a pool without enough limit should fail + CachePoolInfo inadequate = + new CachePoolInfo("poolofinadequacy").setLimit(BLOCK_SIZE); + dfs.addCachePool(inadequate); + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(info1) + .setId(id1).setPool(inadequate.getPoolName()).build(), + EnumSet.noneOf(CacheFlag.class)); + } catch(InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("remaining capacity", e); + } + // Succeeds when force=true + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(info1).setId(id1) + .setPool(inadequate.getPoolName()).build(), + EnumSet.of(CacheFlag.FORCE)); + // Also can add with force=true + dfs.addCacheDirective( + new CacheDirectiveInfo.Builder().setPool(inadequate.getPoolName()) + .setPath(path1).build(), EnumSet.of(CacheFlag.FORCE)); + } + + @Test(timeout=30000) + public void testMaxRelativeExpiry() throws Exception { + // Test that negative and really big max expirations can't be set during add + try { + dfs.addCachePool(new CachePoolInfo("failpool").setMaxRelativeExpiryMs(-1l)); + fail("Added a pool with a negative max expiry."); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("negative", e); + } + try { + dfs.addCachePool(new CachePoolInfo("failpool") + .setMaxRelativeExpiryMs(Long.MAX_VALUE - 1)); + fail("Added a pool with too big of a max expiry."); + } catch (InvalidRequestException e) { + GenericTestUtils.assertExceptionContains("too big", e); + } + // Test that setting a max relative expiry on a pool works + CachePoolInfo coolPool = new CachePoolInfo("coolPool"); + final long poolExpiration = 1000 * 60 * 10l; + dfs.addCachePool(coolPool.setMaxRelativeExpiryMs(poolExpiration)); + RemoteIterator poolIt = dfs.listCachePools(); + CachePoolInfo listPool = poolIt.next().getInfo(); + assertFalse("Should only be one pool", poolIt.hasNext()); + assertEquals("Expected max relative expiry to match set value", + poolExpiration, listPool.getMaxRelativeExpiryMs().longValue()); + // Test that negative and really big max expirations can't be modified + try { + dfs.addCachePool(coolPool.setMaxRelativeExpiryMs(-1l)); + fail("Added a pool with a negative max expiry."); + } catch (InvalidRequestException e) { + assertExceptionContains("negative", e); + } + try { + dfs.modifyCachePool(coolPool + .setMaxRelativeExpiryMs(CachePoolInfo.RELATIVE_EXPIRY_NEVER+1)); + fail("Added a pool with too big of a max expiry."); + } catch (InvalidRequestException e) { + assertExceptionContains("too big", e); + } + // Test that adding a directives without an expiration uses the pool's max + CacheDirectiveInfo defaultExpiry = new CacheDirectiveInfo.Builder() + .setPath(new Path("/blah")) + .setPool(coolPool.getPoolName()) + .build(); + dfs.addCacheDirective(defaultExpiry); + RemoteIterator dirIt = + dfs.listCacheDirectives(defaultExpiry); + CacheDirectiveInfo listInfo = dirIt.next().getInfo(); + assertFalse("Should only have one entry in listing", dirIt.hasNext()); + long listExpiration = listInfo.getExpiration().getAbsoluteMillis() + - new Date().getTime(); + assertTrue("Directive expiry should be approximately the pool's max expiry", + Math.abs(listExpiration - poolExpiration) < 10*1000); + // Test that the max is enforced on add for relative and absolute + CacheDirectiveInfo.Builder builder = new CacheDirectiveInfo.Builder() + .setPath(new Path("/lolcat")) + .setPool(coolPool.getPoolName()); + try { + dfs.addCacheDirective(builder + .setExpiration(Expiration.newRelative(poolExpiration+1)) + .build()); + fail("Added a directive that exceeds pool's max relative expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("exceeds the max relative expiration", e); + } + try { + dfs.addCacheDirective(builder + .setExpiration(Expiration.newAbsolute( + new Date().getTime() + poolExpiration + (10*1000))) + .build()); + fail("Added a directive that exceeds pool's max relative expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("exceeds the max relative expiration", e); + } + // Test that max is enforced on modify for relative and absolute Expirations + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(defaultExpiry) + .setId(listInfo.getId()) + .setExpiration(Expiration.newRelative(poolExpiration+1)) + .build()); + fail("Modified a directive to exceed pool's max relative expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("exceeds the max relative expiration", e); + } + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(defaultExpiry) + .setId(listInfo.getId()) + .setExpiration(Expiration.newAbsolute( + new Date().getTime() + poolExpiration + (10*1000))) + .build()); + fail("Modified a directive to exceed pool's max relative expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("exceeds the max relative expiration", e); + } + // Test some giant limit values with add + try { + dfs.addCacheDirective(builder + .setExpiration(Expiration.newRelative( + Long.MAX_VALUE)) + .build()); + fail("Added a directive with a gigantic max value"); + } catch (IllegalArgumentException e) { + assertExceptionContains("is too far in the future", e); + } + try { + dfs.addCacheDirective(builder + .setExpiration(Expiration.newAbsolute( + Long.MAX_VALUE)) + .build()); + fail("Added a directive with a gigantic max value"); + } catch (InvalidRequestException e) { + assertExceptionContains("is too far in the future", e); + } + // Test some giant limit values with modify + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(defaultExpiry) + .setId(listInfo.getId()) + .setExpiration(Expiration.NEVER) + .build()); + fail("Modified a directive to exceed pool's max relative expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("exceeds the max relative expiration", e); + } + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(defaultExpiry) + .setId(listInfo.getId()) + .setExpiration(Expiration.newAbsolute( + Long.MAX_VALUE)) + .build()); + fail("Modified a directive to exceed pool's max relative expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("is too far in the future", e); + } + // Test that the max is enforced on modify correctly when changing pools + CachePoolInfo destPool = new CachePoolInfo("destPool"); + dfs.addCachePool(destPool.setMaxRelativeExpiryMs(poolExpiration / 2)); + try { + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(defaultExpiry) + .setId(listInfo.getId()) + .setPool(destPool.getPoolName()) + .build()); + fail("Modified a directive to a pool with a lower max expiration"); + } catch (InvalidRequestException e) { + assertExceptionContains("exceeds the max relative expiration", e); + } + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder(defaultExpiry) + .setId(listInfo.getId()) + .setPool(destPool.getPoolName()) + .setExpiration(Expiration.newRelative(poolExpiration / 2)) + .build()); + dirIt = dfs.listCacheDirectives(new CacheDirectiveInfo.Builder() + .setPool(destPool.getPoolName()) + .build()); + listInfo = dirIt.next().getInfo(); + listExpiration = listInfo.getExpiration().getAbsoluteMillis() + - new Date().getTime(); + assertTrue("Unexpected relative expiry " + listExpiration + + " expected approximately " + poolExpiration/2, + Math.abs(poolExpiration/2 - listExpiration) < 10*1000); + // Test that cache pool and directive expiry can be modified back to never + dfs.modifyCachePool(destPool + .setMaxRelativeExpiryMs(CachePoolInfo.RELATIVE_EXPIRY_NEVER)); + poolIt = dfs.listCachePools(); + listPool = poolIt.next().getInfo(); + while (!listPool.getPoolName().equals(destPool.getPoolName())) { + listPool = poolIt.next().getInfo(); + } + assertEquals("Expected max relative expiry to match set value", + CachePoolInfo.RELATIVE_EXPIRY_NEVER, + listPool.getMaxRelativeExpiryMs().longValue()); + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder() + .setId(listInfo.getId()) + .setExpiration(Expiration.newRelative(RELATIVE_EXPIRY_NEVER)) + .build()); + // Test modifying close to the limit + dfs.modifyCacheDirective(new CacheDirectiveInfo.Builder() + .setId(listInfo.getId()) + .setExpiration(Expiration.newRelative(RELATIVE_EXPIRY_NEVER - 1)) + .build()); + } + + @Test(timeout=60000) + public void testExceedsCapacity() throws Exception { + // Create a giant file + final Path fileName = new Path("/exceeds"); + final long fileLen = CACHE_CAPACITY * (NUM_DATANODES*2); + int numCachedReplicas = (int) ((CACHE_CAPACITY*NUM_DATANODES)/BLOCK_SIZE); + DFSTestUtil.createFile(dfs, fileName, fileLen, (short) NUM_DATANODES, + 0xFADED); + // Set up a log appender watcher + final LogVerificationAppender appender = new LogVerificationAppender(); + final Logger logger = Logger.getRootLogger(); + logger.addAppender(appender); + dfs.addCachePool(new CachePoolInfo("pool")); + dfs.addCacheDirective(new CacheDirectiveInfo.Builder().setPool("pool") + .setPath(fileName).setReplication((short) 1).build()); + waitForCachedBlocks(namenode, -1, numCachedReplicas, + "testExceeds:1"); + // Check that no DNs saw an excess CACHE message + int lines = appender.countLinesWithMessage( + "more bytes in the cache: " + + DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY); + assertEquals("Namenode should not send extra CACHE commands", 0, lines); + // Try creating a file with giant-sized blocks that exceed cache capacity + dfs.delete(fileName, false); + DFSTestUtil.createFile(dfs, fileName, 4096, fileLen, CACHE_CAPACITY * 2, + (short) 1, 0xFADED); + // Nothing will get cached, so just force sleep for a bit + Thread.sleep(4000); + // Still should not see any excess commands + lines = appender.countLinesWithMessage( + "more bytes in the cache: " + + DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY); + assertEquals("Namenode should not send extra CACHE commands", 0, lines); + } +} diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestDeadDatanode.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestDeadDatanode.java index 93774c276f2..256f30ac4dc 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestDeadDatanode.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestDeadDatanode.java @@ -143,7 +143,8 @@ public class TestDeadDatanode { StorageReport[] rep = { new StorageReport( new DatanodeStorage(reg.getDatanodeUuid()), false, 0, 0, 0, 0) }; - DatanodeCommand[] cmd = dnp.sendHeartbeat(reg, rep, 0, 0, 0).getCommands(); + DatanodeCommand[] cmd = dnp.sendHeartbeat(reg, rep, 0L, 0L, 0, 0, 0) + .getCommands(); assertEquals(1, cmd.length); assertEquals(cmd[0].getAction(), RegisterCommand.REGISTER .getAction()); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNameNodeMXBean.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNameNodeMXBean.java index 7538be09eb0..d459d30dc55 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNameNodeMXBean.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNameNodeMXBean.java @@ -31,7 +31,10 @@ import javax.management.ObjectName; import org.apache.hadoop.conf.Configuration; import org.apache.hadoop.fs.FileUtil; +import org.apache.hadoop.hdfs.DFSConfigKeys; import org.apache.hadoop.hdfs.MiniDFSCluster; +import org.apache.hadoop.io.nativeio.NativeIO; +import org.apache.hadoop.io.nativeio.NativeIO.POSIX.NoMlockCacheManipulator; import org.apache.hadoop.util.VersionInfo; import org.junit.Test; import org.mortbay.util.ajax.JSON; @@ -46,10 +49,16 @@ public class TestNameNodeMXBean { */ private static final double DELTA = 0.000001; + static { + NativeIO.POSIX.setCacheManipulator(new NoMlockCacheManipulator()); + } + @SuppressWarnings({ "unchecked" }) @Test public void testNameNodeMXBeanInfo() throws Exception { Configuration conf = new Configuration(); + conf.setLong(DFSConfigKeys.DFS_DATANODE_MAX_LOCKED_MEMORY_KEY, + NativeIO.POSIX.getCacheManipulator().getMemlockLimit()); MiniDFSCluster cluster = null; try { @@ -171,6 +180,10 @@ public class TestNameNodeMXBean { } assertEquals(1, statusMap.get("active").size()); assertEquals(1, statusMap.get("failed").size()); + assertEquals(0L, mbs.getAttribute(mxbeanName, "CacheUsed")); + assertEquals(NativeIO.POSIX.getCacheManipulator().getMemlockLimit() * + cluster.getDataNodes().size(), + mbs.getAttribute(mxbeanName, "CacheCapacity")); } finally { if (cluster != null) { for (URI dir : cluster.getNameDirs(0)) { diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNamenodeRetryCache.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNamenodeRetryCache.java index 65032f29b3c..6aa1276036c 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNamenodeRetryCache.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/TestNamenodeRetryCache.java @@ -414,7 +414,7 @@ public class TestNamenodeRetryCache { LightWeightCache cacheSet = (LightWeightCache) namesystem.getRetryCache().getCacheSet(); - assertEquals(14, cacheSet.size()); + assertEquals(20, cacheSet.size()); Map oldEntries = new HashMap(); @@ -433,7 +433,7 @@ public class TestNamenodeRetryCache { assertTrue(namesystem.hasRetryCache()); cacheSet = (LightWeightCache) namesystem .getRetryCache().getCacheSet(); - assertEquals(14, cacheSet.size()); + assertEquals(20, cacheSet.size()); iter = cacheSet.iterator(); while (iter.hasNext()) { CacheEntry entry = iter.next(); diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestHAStateTransitions.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestHAStateTransitions.java index 4954838bd05..2873bc6cfe2 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestHAStateTransitions.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestHAStateTransitions.java @@ -27,6 +27,7 @@ import java.io.File; import java.io.FileOutputStream; import java.io.IOException; import java.net.URI; +import java.util.LinkedList; import java.util.concurrent.locks.ReentrantReadWriteLock; import org.apache.commons.logging.Log; @@ -59,6 +60,8 @@ import org.junit.Assert; import org.junit.Test; import org.mockito.Mockito; +import com.google.common.util.concurrent.Uninterruptibles; + /** * Tests state transition from active->standby, and manual failover * and failback between two namenodes. @@ -124,6 +127,17 @@ public class TestHAStateTransitions { } } + private void addCrmThreads(MiniDFSCluster cluster, + LinkedList crmThreads) { + for (int nn = 0; nn <= 1; nn++) { + Thread thread = cluster.getNameNode(nn).getNamesystem(). + getCacheManager().getCacheReplicationMonitor(); + if (thread != null) { + crmThreads.add(thread); + } + } + } + /** * Test that transitioning a service to the state that it is already * in is a nop, specifically, an exception is not thrown. @@ -131,19 +145,30 @@ public class TestHAStateTransitions { @Test public void testTransitionToCurrentStateIsANop() throws Exception { Configuration conf = new Configuration(); + conf.setLong(DFSConfigKeys.DFS_NAMENODE_PATH_BASED_CACHE_REFRESH_INTERVAL_MS, 1L); MiniDFSCluster cluster = new MiniDFSCluster.Builder(conf) .nnTopology(MiniDFSNNTopology.simpleHATopology()) .numDataNodes(1) .build(); + LinkedList crmThreads = new LinkedList(); try { cluster.waitActive(); + addCrmThreads(cluster, crmThreads); cluster.transitionToActive(0); + addCrmThreads(cluster, crmThreads); cluster.transitionToActive(0); + addCrmThreads(cluster, crmThreads); cluster.transitionToStandby(0); + addCrmThreads(cluster, crmThreads); cluster.transitionToStandby(0); + addCrmThreads(cluster, crmThreads); } finally { cluster.shutdown(); } + // Verify that all cacheReplicationMonitor threads shut down + for (Thread thread : crmThreads) { + Uninterruptibles.joinUninterruptibly(thread); + } } /** diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestRetryCacheWithHA.java b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestRetryCacheWithHA.java index e26790311b9..3e7fa9c2d92 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestRetryCacheWithHA.java +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/java/org/apache/hadoop/hdfs/server/namenode/ha/TestRetryCacheWithHA.java @@ -29,6 +29,7 @@ import java.net.URI; import java.net.UnknownHostException; import java.util.EnumSet; import java.util.HashMap; +import java.util.HashSet; import java.util.Iterator; import java.util.Map; import java.util.Random; @@ -37,11 +38,13 @@ import java.util.concurrent.atomic.AtomicBoolean; import org.apache.commons.logging.Log; import org.apache.commons.logging.LogFactory; import org.apache.hadoop.conf.Configuration; +import org.apache.hadoop.fs.CacheFlag; import org.apache.hadoop.fs.CreateFlag; import org.apache.hadoop.fs.FSDataOutputStream; import org.apache.hadoop.fs.FileStatus; import org.apache.hadoop.fs.Options.Rename; import org.apache.hadoop.fs.Path; +import org.apache.hadoop.fs.RemoteIterator; import org.apache.hadoop.fs.permission.FsPermission; import org.apache.hadoop.hdfs.DFSClient; import org.apache.hadoop.hdfs.DFSConfigKeys; @@ -53,12 +56,16 @@ import org.apache.hadoop.hdfs.MiniDFSNNTopology; import org.apache.hadoop.hdfs.NameNodeProxies; import org.apache.hadoop.hdfs.client.HdfsDataOutputStream; import org.apache.hadoop.hdfs.client.HdfsDataOutputStream.SyncFlag; +import org.apache.hadoop.hdfs.protocol.CachePoolEntry; +import org.apache.hadoop.hdfs.protocol.CachePoolInfo; import org.apache.hadoop.hdfs.protocol.ClientProtocol; import org.apache.hadoop.hdfs.protocol.DatanodeInfo; import org.apache.hadoop.hdfs.protocol.ExtendedBlock; import org.apache.hadoop.hdfs.protocol.HdfsFileStatus; import org.apache.hadoop.hdfs.protocol.LocatedBlock; import org.apache.hadoop.hdfs.protocol.LocatedBlocks; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveEntry; +import org.apache.hadoop.hdfs.protocol.CacheDirectiveInfo; import org.apache.hadoop.hdfs.server.blockmanagement.BlockInfoUnderConstruction; import org.apache.hadoop.hdfs.server.namenode.FSNamesystem; import org.apache.hadoop.hdfs.server.namenode.INodeFile; @@ -82,6 +89,7 @@ public class TestRetryCacheWithHA { private static final int BlockSize = 1024; private static final short DataNodes = 3; private static final int CHECKTIMES = 10; + private static final int ResponseSize = 3; private MiniDFSCluster cluster; private DistributedFileSystem dfs; @@ -116,6 +124,8 @@ public class TestRetryCacheWithHA { @Before public void setup() throws Exception { conf.setLong(DFSConfigKeys.DFS_BLOCK_SIZE_KEY, BlockSize); + conf.setInt(DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_DIRECTIVES_NUM_RESPONSES, ResponseSize); + conf.setInt(DFSConfigKeys.DFS_NAMENODE_LIST_CACHE_POOLS_NUM_RESPONSES, ResponseSize); cluster = new MiniDFSCluster.Builder(conf) .nnTopology(MiniDFSNNTopology.simpleHATopology()) .numDataNodes(DataNodes).build(); @@ -147,7 +157,7 @@ public class TestRetryCacheWithHA { FSNamesystem fsn0 = cluster.getNamesystem(0); LightWeightCache cacheSet = (LightWeightCache) fsn0.getRetryCache().getCacheSet(); - assertEquals(14, cacheSet.size()); + assertEquals(20, cacheSet.size()); Map oldEntries = new HashMap(); @@ -168,7 +178,7 @@ public class TestRetryCacheWithHA { FSNamesystem fsn1 = cluster.getNamesystem(1); cacheSet = (LightWeightCache) fsn1 .getRetryCache().getCacheSet(); - assertEquals(14, cacheSet.size()); + assertEquals(20, cacheSet.size()); iter = cacheSet.iterator(); while (iter.hasNext()) { CacheEntry entry = iter.next(); @@ -734,6 +744,263 @@ public class TestRetryCacheWithHA { } } + /** addCacheDirective */ + class AddCacheDirectiveInfoOp extends AtMostOnceOp { + private CacheDirectiveInfo directive; + private Long result; + + AddCacheDirectiveInfoOp(DFSClient client, + CacheDirectiveInfo directive) { + super("addCacheDirective", client); + this.directive = directive; + } + + @Override + void prepare() throws Exception { + dfs.addCachePool(new CachePoolInfo(directive.getPool())); + } + + @Override + void invoke() throws Exception { + result = client.addCacheDirective(directive, EnumSet.of(CacheFlag.FORCE)); + } + + @Override + boolean checkNamenodeBeforeReturn() throws Exception { + for (int i = 0; i < CHECKTIMES; i++) { + RemoteIterator iter = + dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder(). + setPool(directive.getPool()). + setPath(directive.getPath()). + build()); + if (iter.hasNext()) { + return true; + } + Thread.sleep(1000); + } + return false; + } + + @Override + Object getResult() { + return result; + } + } + + /** modifyCacheDirective */ + class ModifyCacheDirectiveInfoOp extends AtMostOnceOp { + private final CacheDirectiveInfo directive; + private final short newReplication; + private long id; + + ModifyCacheDirectiveInfoOp(DFSClient client, + CacheDirectiveInfo directive, short newReplication) { + super("modifyCacheDirective", client); + this.directive = directive; + this.newReplication = newReplication; + } + + @Override + void prepare() throws Exception { + dfs.addCachePool(new CachePoolInfo(directive.getPool())); + id = client.addCacheDirective(directive, EnumSet.of(CacheFlag.FORCE)); + } + + @Override + void invoke() throws Exception { + client.modifyCacheDirective( + new CacheDirectiveInfo.Builder(). + setId(id). + setReplication(newReplication). + build(), EnumSet.of(CacheFlag.FORCE)); + } + + @Override + boolean checkNamenodeBeforeReturn() throws Exception { + for (int i = 0; i < CHECKTIMES; i++) { + RemoteIterator iter = + dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder(). + setPool(directive.getPool()). + setPath(directive.getPath()). + build()); + while (iter.hasNext()) { + CacheDirectiveInfo result = iter.next().getInfo(); + if ((result.getId() == id) && + (result.getReplication().shortValue() == newReplication)) { + return true; + } + } + Thread.sleep(1000); + } + return false; + } + + @Override + Object getResult() { + return null; + } + } + + /** removeCacheDirective */ + class RemoveCacheDirectiveInfoOp extends AtMostOnceOp { + private CacheDirectiveInfo directive; + private long id; + + RemoveCacheDirectiveInfoOp(DFSClient client, String pool, + String path) { + super("removeCacheDirective", client); + this.directive = new CacheDirectiveInfo.Builder(). + setPool(pool). + setPath(new Path(path)). + build(); + } + + @Override + void prepare() throws Exception { + dfs.addCachePool(new CachePoolInfo(directive.getPool())); + id = dfs.addCacheDirective(directive, EnumSet.of(CacheFlag.FORCE)); + } + + @Override + void invoke() throws Exception { + client.removeCacheDirective(id); + } + + @Override + boolean checkNamenodeBeforeReturn() throws Exception { + for (int i = 0; i < CHECKTIMES; i++) { + RemoteIterator iter = + dfs.listCacheDirectives( + new CacheDirectiveInfo.Builder(). + setPool(directive.getPool()). + setPath(directive.getPath()). + build()); + if (!iter.hasNext()) { + return true; + } + Thread.sleep(1000); + } + return false; + } + + @Override + Object getResult() { + return null; + } + } + + /** addCachePool */ + class AddCachePoolOp extends AtMostOnceOp { + private String pool; + + AddCachePoolOp(DFSClient client, String pool) { + super("addCachePool", client); + this.pool = pool; + } + + @Override + void prepare() throws Exception { + } + + @Override + void invoke() throws Exception { + client.addCachePool(new CachePoolInfo(pool)); + } + + @Override + boolean checkNamenodeBeforeReturn() throws Exception { + for (int i = 0; i < CHECKTIMES; i++) { + RemoteIterator iter = dfs.listCachePools(); + if (iter.hasNext()) { + return true; + } + Thread.sleep(1000); + } + return false; + } + + @Override + Object getResult() { + return null; + } + } + + /** modifyCachePool */ + class ModifyCachePoolOp extends AtMostOnceOp { + String pool; + + ModifyCachePoolOp(DFSClient client, String pool) { + super("modifyCachePool", client); + this.pool = pool; + } + + @Override + void prepare() throws Exception { + client.addCachePool(new CachePoolInfo(pool).setLimit(10l)); + } + + @Override + void invoke() throws Exception { + client.modifyCachePool(new CachePoolInfo(pool).setLimit(99l)); + } + + @Override + boolean checkNamenodeBeforeReturn() throws Exception { + for (int i = 0; i < CHECKTIMES; i++) { + RemoteIterator iter = dfs.listCachePools(); + if (iter.hasNext() && (long)iter.next().getInfo().getLimit() == 99) { + return true; + } + Thread.sleep(1000); + } + return false; + } + + @Override + Object getResult() { + return null; + } + } + + /** removeCachePool */ + class RemoveCachePoolOp extends AtMostOnceOp { + private String pool; + + RemoveCachePoolOp(DFSClient client, String pool) { + super("removeCachePool", client); + this.pool = pool; + } + + @Override + void prepare() throws Exception { + client.addCachePool(new CachePoolInfo(pool)); + } + + @Override + void invoke() throws Exception { + client.removeCachePool(pool); + } + + @Override + boolean checkNamenodeBeforeReturn() throws Exception { + for (int i = 0; i < CHECKTIMES; i++) { + RemoteIterator iter = dfs.listCachePools(); + if (!iter.hasNext()) { + return true; + } + Thread.sleep(1000); + } + return false; + } + + @Override + Object getResult() { + return null; + } + } + @Test (timeout=60000) public void testCreateSnapshot() throws Exception { final DFSClient client = genClientWithDummyHandler(); @@ -811,6 +1078,58 @@ public class TestRetryCacheWithHA { testClientRetryWithFailover(op); } + @Test (timeout=60000) + public void testAddCacheDirectiveInfo() throws Exception { + DFSClient client = genClientWithDummyHandler(); + AtMostOnceOp op = new AddCacheDirectiveInfoOp(client, + new CacheDirectiveInfo.Builder(). + setPool("pool"). + setPath(new Path("/path")). + build()); + testClientRetryWithFailover(op); + } + + @Test (timeout=60000) + public void testModifyCacheDirectiveInfo() throws Exception { + DFSClient client = genClientWithDummyHandler(); + AtMostOnceOp op = new ModifyCacheDirectiveInfoOp(client, + new CacheDirectiveInfo.Builder(). + setPool("pool"). + setPath(new Path("/path")). + setReplication((short)1).build(), + (short)555); + testClientRetryWithFailover(op); + } + + @Test (timeout=60000) + public void testRemoveCacheDescriptor() throws Exception { + DFSClient client = genClientWithDummyHandler(); + AtMostOnceOp op = new RemoveCacheDirectiveInfoOp(client, "pool", + "/path"); + testClientRetryWithFailover(op); + } + + @Test (timeout=60000) + public void testAddCachePool() throws Exception { + DFSClient client = genClientWithDummyHandler(); + AtMostOnceOp op = new AddCachePoolOp(client, "pool"); + testClientRetryWithFailover(op); + } + + @Test (timeout=60000) + public void testModifyCachePool() throws Exception { + DFSClient client = genClientWithDummyHandler(); + AtMostOnceOp op = new ModifyCachePoolOp(client, "pool"); + testClientRetryWithFailover(op); + } + + @Test (timeout=60000) + public void testRemoveCachePool() throws Exception { + DFSClient client = genClientWithDummyHandler(); + AtMostOnceOp op = new RemoveCachePoolOp(client, "pool"); + testClientRetryWithFailover(op); + } + /** * When NN failover happens, if the client did not receive the response and * send a retry request to the other NN, the same response should be recieved @@ -863,4 +1182,92 @@ public class TestRetryCacheWithHA { + results.get(op.name)); } } + + /** + * Add a list of cache pools, list cache pools, + * switch active NN, and list cache pools again. + */ + @Test (timeout=60000) + public void testListCachePools() throws Exception { + final int poolCount = 7; + HashSet poolNames = new HashSet(poolCount); + for (int i=0; i poolNames = new HashSet(poolCount); + Path path = new Path("/p"); + for (int i=0; i poolNames, int active) throws Exception { + HashSet tmpNames = (HashSet)poolNames.clone(); + RemoteIterator pools = dfs.listCachePools(); + int poolCount = poolNames.size(); + for (int i=0; i poolNames, int active) throws Exception { + HashSet tmpNames = (HashSet)poolNames.clone(); + RemoteIterator directives = dfs.listCacheDirectives(null); + int poolCount = poolNames.size(); + for (int i=0; iZL_`(83oC5pt?^dhLZ+hx(Ewi87yX9`gp?ooF(6iAdQ}Wyi z7t_u^SIQEK=Wa_9-kLK`cphJ$luidMzhcua~r_&=H&PtEgXz@0< zHP3pFtHG^ngXH{0EA#4VG^elJUSuy^@Xm^Y{F1za@|kn8W@X#5Gi~KIFx#?br)T1y z4dMgJKJ%V}g$p+~O}z9?*;qFsM|Ed@TxzBi07kB%AJ3i**0Zf;@6E?>s6>W=MYEvm zT^qDYhF20Jb5UdidfdRDQo!NRvO3=Id{Jm+e96lWUNdr%iR zT70dQ*CZtL9t4w9YbGQ%0}@FL1Gwk-z~N}4b3revZG_PF8fLcCx(%%p&B89A8IaVg~M0wb9mNkK5@3K zR@n*@P2~0Fe(b@=+eRsrh#%uB(vMrbd}|W#9L=<$v#af>GLd(Vk%mBzGhz?B44nYD znlE0Qjp6Rxgvvo6_@JN&b`eS6r>@NLOv=$#QCMa8%44vkxpER?t+sI)5Qv>hI>!fO+`~I ziEdT~XIr*6DZ~_IGWn=@ZU1+3_iceZg>)ivPjrsoFOa8(Bh&a*M5Yyh*bFFC0jsuD zUsOmp$~5v(0V2=USWXL`>7)~R9#(vGeYfCA>yO7sd3uP2ia;Tr`_`<>qS9uNVJiJ( zv2>9ni=xQ*c}yci5VBw_D2fQd{-6_K{SRf;FgfdLE}I8nWeqhdEJ&LuveGi<9??V? zr405}6j`=w)vYxOB?3q%TE%Bld)%7)B1IW&(C}zo_t`>`qRepbMUh2ekv(EXmU~$F zS7F9rBU%M8Ex&U4ra;bOgNDbuYKI*X$TP!{Y5Zs!MU#)%3@DWR6WhV0kZzQ0@=*cI z8%j@s;F(1_F_%vc#uQx;Ja6>JW1>8diG_+lA)ZP1YW@^OHk%An>0M-@Ebf$KQ4|@! z*J)%3LKch#MG+y`A9NzD|B0*`zVP=HiKodN`6)|^skgs<^2ojZRC-s>9~paL_fX~x z@LwXT31Zl3>Gjvw)i`VWp(f{M>3$BsUlKq-N~xYoO5VpAA%`_oGmOrtc6chSb(+Jg zS@AuNKLb2|t55R=9|@(coC`G(wx|-`SMmdBf%T8PU=h;2t^!yxJ7?62B7Bp20fwjT z$J&FBgn0u5B6gGochpn1qvBp<`}t!7-WrT)bkMX|2VV+T=5ts6x@&FoCbEC9)(7)D zaDa7>S%SYK%k7SO&F-qyjvaIbFOvnF?{9VLv^|1vA@nvFAe^w7uHjdH7W*)ddk+Jd z<4Th1tKA`~h|nrCq-f!*tWu_YlCp%~xsVS=x64&W4z?uVlZDpxH1T(G64%n&UfPo0 z)0E01C5dk))@qRNT-s)DB*bY{b3 znVBH6*&JuQQg(LdbT^!GnKXA|psMV`x;t}$Mma-hkYP+<6Irq{^U^05vZ@*A8k?CL znV1`x#Tznk8XB4F833UngFxP*9}ip1-0QYY%w1pTw!adnO^oSPLEOaGs(K6S?(W5D zDpzr7L26NYQGRIw;}X>ewfU1B7&XFxT5e)BRPxL@wNDU7F)*+*aOjWlYA{ zBo)4H6)l?lkx2uaq+-b0q)U?xnL#1^zz$+Nhz0=)LRe|fOoO7yrOV diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/editsStored.xml b/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/editsStored.xml index b9d667b7d66..7c1782fe9e0 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/editsStored.xml +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/editsStored.xml @@ -1,6 +1,6 @@ - -50 + -51 OP_START_LOG_SEGMENT @@ -13,8 +13,8 @@ 2 1 - 1390675042623 - 3d747279912f2511 + 1390942564729 + f270a35a4ebb9984 @@ -24,8 +24,8 @@ 3 2 - 1390675042667 - cc4a64b98b6c8b80 + 1390942564735 + 22391ec22bc0fc20 @@ -37,18 +37,18 @@ 16386 /file_create 1 - 1389983882397 - 1389983882397 + 1390251365583 + 1390251365583 512 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 127.0.0.1 - jing + andrew supergroup 420 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 22 + ff209a09-9745-4242-837f-21c6b95a1b70 + 7 @@ -59,13 +59,13 @@ 0 /file_create 1 - 1389983882685 - 1389983882397 + 1390251365626 + 1390251365583 512 - jing + andrew supergroup 420 @@ -78,9 +78,9 @@ 0 /file_create /file_moved - 1389983882713 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 25 + 1390251365645 + ff209a09-9745-4242-837f-21c6b95a1b70 + 9 @@ -89,9 +89,9 @@ 7 0 /file_moved - 1389983882722 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 26 + 1390251365666 + ff209a09-9745-4242-837f-21c6b95a1b70 + 10 @@ -101,9 +101,9 @@ 0 16387 /directory_mkdir - 1389983882732 + 1390251365693 - jing + andrew supergroup 493 @@ -136,8 +136,8 @@ 12 /directory_mkdir snapshot1 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 31 + ff209a09-9745-4242-837f-21c6b95a1b70 + 15 @@ -147,8 +147,8 @@ /directory_mkdir snapshot1 snapshot2 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 32 + ff209a09-9745-4242-837f-21c6b95a1b70 + 16 @@ -157,8 +157,8 @@ 14 /directory_mkdir snapshot2 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 33 + ff209a09-9745-4242-837f-21c6b95a1b70 + 17 @@ -169,18 +169,18 @@ 16388 /file_create 1 - 1389983883326 - 1389983883326 + 1390251365804 + 1390251365804 512 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 127.0.0.1 - jing + andrew supergroup 420 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 34 + ff209a09-9745-4242-837f-21c6b95a1b70 + 18 @@ -191,13 +191,13 @@ 0 /file_create 1 - 1389983883328 - 1389983883326 + 1390251365815 + 1390251365804 512 - jing + andrew supergroup 420 @@ -253,10 +253,10 @@ 0 /file_create /file_moved - 1389983883464 + 1390251365931 NONE - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 41 + ff209a09-9745-4242-837f-21c6b95a1b70 + 25 @@ -267,18 +267,18 @@ 16389 /file_concat_target 1 - 1389983883506 - 1389983883506 + 1390251365952 + 1390251365952 512 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 127.0.0.1 - jing + andrew supergroup 420 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 43 + ff209a09-9745-4242-837f-21c6b95a1b70 + 27 @@ -383,8 +383,8 @@ 0 /file_concat_target 1 - 1389983884500 - 1389983883506 + 1390251366514 + 1390251365952 512 @@ -404,7 +404,7 @@ 1003 - jing + andrew supergroup 420 @@ -418,18 +418,18 @@ 16390 /file_concat_0 1 - 1389983884503 - 1389983884503 + 1390251366533 + 1390251366533 512 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 127.0.0.1 - jing + andrew supergroup 420 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 56 + ff209a09-9745-4242-837f-21c6b95a1b70 + 40 @@ -534,8 +534,8 @@ 0 /file_concat_0 1 - 1389983884530 - 1389983884503 + 1390251366726 + 1390251366533 512 @@ -555,7 +555,7 @@ 1006 - jing + andrew supergroup 420 @@ -569,18 +569,18 @@ 16391 /file_concat_1 1 - 1389983884533 - 1389983884533 + 1390251366746 + 1390251366746 512 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 127.0.0.1 - jing + andrew supergroup 420 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 68 + ff209a09-9745-4242-837f-21c6b95a1b70 + 52 @@ -685,8 +685,8 @@ 0 /file_concat_1 1 - 1389983884560 - 1389983884533 + 1390251366795 + 1390251366746 512 @@ -706,7 +706,7 @@ 1009 - jing + andrew supergroup 420 @@ -718,13 +718,13 @@ 56 0 /file_concat_target - 1389983884587 + 1390251366802 /file_concat_0 /file_concat_1 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 79 + ff209a09-9745-4242-837f-21c6b95a1b70 + 63 @@ -735,15 +735,15 @@ 16392 /file_symlink /file_concat_target - 1389983884610 - 1389983884610 + 1390251366811 + 1390251366811 - jing + andrew supergroup 511 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 80 + ff209a09-9745-4242-837f-21c6b95a1b70 + 64 @@ -754,18 +754,18 @@ 16393 /hard-lease-recovery-test 1 - 1389983884634 - 1389983884634 + 1390251366819 + 1390251366819 512 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 127.0.0.1 - jing + andrew supergroup 420 - 6ea2f8e1-8436-477e-b691-6daf7146bf79 - 81 + ff209a09-9745-4242-837f-21c6b95a1b70 + 65 @@ -821,7 +821,23 @@ OP_REASSIGN_LEASE 64 - DFSClient_NONMAPREDUCE_-36724706_1 + DFSClient_NONMAPREDUCE_382541401_1 + /hard-lease-recovery-test + HDFS_NameNode + + + + OP_SET_GENSTAMP_V2 + + 65 + 1012 + + + + OP_REASSIGN_LEASE + + 66 + HDFS_NameNode /hard-lease-recovery-test HDFS_NameNode @@ -829,32 +845,97 @@ OP_CLOSE - 65 + 67 0 0 /hard-lease-recovery-test 1 - 1389983888641 - 1389983884634 + 1390251371402 + 1390251366819 512 1073741834 11 - 1011 + 1012 - jing + andrew supergroup 420 + + OP_ADD_CACHE_POOL + + 68 + pool1 + andrew + andrew + 493 + 9223372036854775807 + 2305843009213693951 + ff209a09-9745-4242-837f-21c6b95a1b70 + 73 + + + + OP_MODIFY_CACHE_POOL + + 69 + pool1 + 99 + ff209a09-9745-4242-837f-21c6b95a1b70 + 74 + + + + OP_ADD_CACHE_DIRECTIVE + + 70 + 1 + /path + 1 + pool1 + 2305844399465065912 + ff209a09-9745-4242-837f-21c6b95a1b70 + 75 + + + + OP_MODIFY_CACHE_DIRECTIVE + + 71 + 1 + 2 + ff209a09-9745-4242-837f-21c6b95a1b70 + 76 + + + + OP_REMOVE_CACHE_DIRECTIVE + + 72 + 1 + ff209a09-9745-4242-837f-21c6b95a1b70 + 77 + + + + OP_REMOVE_CACHE_POOL + + 73 + pool1 + ff209a09-9745-4242-837f-21c6b95a1b70 + 78 + + OP_END_LOG_SEGMENT - 66 + 74 diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testCacheAdminConf.xml b/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testCacheAdminConf.xml new file mode 100644 index 00000000000..64de6bf87c4 --- /dev/null +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testCacheAdminConf.xml @@ -0,0 +1,493 @@ + + + + + + + + test + + + + + + Testing basic usage + + + + + + + + SubstringComparator + Usage: bin/hdfs cacheadmin [COMMAND] + + + + + + Testing listing no cache pools + + -listPools + + + + + + SubstringComparator + Found 0 results. + + + + + + Testing adding a cache pool + + -addPool foo + + + -removePool foo + + + + SubstringComparator + Successfully added cache pool foo. + + + + + + Testing modifying a cache pool + + -addPool poolparty -owner alice -group alicegroup -mode 0000 -limit 50 + -modifyPool poolparty -owner bob -group bobgroup -mode 0777 -limit 51 + -listPools + + + -removePool poolparty + + + + SubstringComparator + poolparty bob bobgroup rwxrwxrwx 51 + + + + + + Testing deleting a cache pool + + -addPool foo + -removePool foo + + + + + + SubstringComparator + Successfully removed cache pool foo. + + + + + + Testing listing all cache pools + + -addPool foo -owner bob -group bob -mode 0664 + -addPool bar -owner alice -group alicegroup -mode 0755 + -listPools + + + -removePool foo + -removePool bar + + + + SubstringComparator + Found 2 results. + + + SubstringComparator + bar alice alicegroup rwxr-xr-x unlimited + + + SubstringComparator + foo bob bob rw-rw-r-- unlimited + + + + + + Testing listing a single cache pool + + -addPool foo -owner bob -group bob -mode 0664 + -addPool bar -owner alice -group alicegroup -mode 0755 + -listPools foo + + + -removePool foo + -removePool bar + + + + SubstringComparator + Found 1 result. + + + SubstringComparator + foo bob bob rw-rw-r-- unlimited + + + + + + Testing creating cache paths + + -addPool pool1 + -addDirective -path /foo -pool pool1 -ttl 2d + -addDirective -path /bar -pool pool1 -ttl 24h + -addDirective -path /baz -replication 2 -pool pool1 -ttl 60m + -listDirectives -pool pool1 + + + -removePool pool1 + + + + SubstringComparator + Found 3 entries + + + SubstringComparator + 1 pool1 1 + + + SubstringComparator + 2 pool1 1 + + + SubstringComparator + 3 pool1 2 + + + + + + Testing removing cache paths + + -addPool pool1 + -addDirective -path /foo -pool pool1 + -addDirective -path /bar -pool pool1 + -removePool pool1 + -listDirectives -pool pool1 + + + + + + SubstringComparator + Found 0 entries + + + + + + Testing listing directives filtered by pool + + -addPool pool1 + -addPool pool2 + -addDirective -path /foo -pool pool1 + -addDirective -path /bar -pool pool1 + -addDirective -path /baz -pool pool2 + -addDirective -path /buz -pool pool2 + -listDirectives -pool pool2 + + + -removePool pool1 + -removePool pool2 + + + + SubstringComparator + Found 2 entries + + + SubstringComparator + 8 pool2 1 never /baz + + + SubstringComparator + 9 pool2 1 never /buz + + + + + + Testing listing directives filtered by path + + -addPool pool1 + -addPool pool2 + -addDirective -path /foo -pool pool1 + -addDirective -path /bar -pool pool1 + -addDirective -path /foo -pool pool2 + -addDirective -path /bar -pool pool2 + -listDirectives -path /foo + + + -removePool pool1 + -removePool pool2 + + + + SubstringComparator + Found 2 entries + + + SubstringComparator + 10 pool1 1 never /foo + + + SubstringComparator + 12 pool2 1 never /foo + + + + + + Testing listing directives filtered by path and pool + + -addPool pool1 + -addPool pool2 + -addDirective -path /foo -pool pool1 + -addDirective -path /bar -pool pool1 + -addDirective -path /foo -pool pool2 + -addDirective -path /bar -pool pool2 + -listDirectives -path /foo -pool pool2 + + + -removePool pool1 + -removePool pool2 + + + + SubstringComparator + Found 1 entry + + + SubstringComparator + 16 pool2 1 never /foo + + + + + + Testing removing a directive + + -addPool pool1 + -addDirective -path /foo -pool pool1 + -addDirective -path /bar -pool pool1 + -removeDirective 18 + -listDirectives + + + -removePool pool1 + + + + SubstringComparator + Found 1 entry + + + SubstringComparator + 19 pool1 1 never /bar + + + + + + Testing removing every directive for a path + + -addPool pool1 + -addPool pool2 + -addDirective -path /foo -pool pool1 + -addDirective -path /foo -pool pool1 + -addDirective -path /bar -pool pool1 + -addDirective -path /foo -pool pool2 + -addDirective -path /bar -pool pool2 + -removeDirectives -path ../../foo + -listDirectives + + + -removePool pool1 + -removePool pool2 + + + + SubstringComparator + Found 2 entries + + + SubstringComparator + 22 pool1 1 never /bar + + + SubstringComparator + 24 pool2 1 never /bar + + + + + + Testing modifying directives + + -addPool pool1 + -addPool pool2 + -addDirective -path /foo -pool pool2 + -modifyDirective -id 25 -path /bar2 + -modifyDirective -id 25 -pool pool1 -path /bar3 + -listDirectives -path /bar3 + + + -removePool pool1 + -removePool pool2 + + + + SubstringComparator + Found 1 entry + + + SubstringComparator + 25 pool1 1 never /bar3 + + + + + + Testing the help usage + + -help addPool + + + + + + SubstringComparator + Add a new cache pool. + + + + + + Testing listing cache pool statistics + + -addPool foo -owner bob -group bob -mode 0664 + -addPool bar -owner alice -group alicegroup -mode 0755 + -listPools -stats + + + -removePool foo + -removePool bar + + + + SubstringComparator + Found 2 results. + + + SubstringComparator + bar alice alicegroup rwxr-xr-x unlimited never 0 0 0 0 0 + + + SubstringComparator + foo bob bob rw-rw-r-- unlimited never 0 0 0 0 0 + + + + + + Testing listing cache directive statistics + + -addPool pool1 + -addDirective -path /foo -pool pool1 -ttl 2d + -addDirective -path /bar -pool pool1 -ttl 24h + -addDirective -path /baz -replication 2 -pool pool1 -ttl 60m + -listDirectives -pool pool1 -stats + + + -removePool pool1 + + + + SubstringComparator + Found 3 entries + + + SubstringComparator + /foo 0 0 0 0 + + + SubstringComparator + /bar 0 0 0 0 + + + SubstringComparator + /baz 0 0 0 0 + + + + + + Testing pool max ttl settings + + -addPool pool1 -owner andrew -group andrew + -addPool pool2 -owner andrew -group andrew -maxTtl 999d + -modifyPool pool2 -maxTtl never + -addPool pool3 -owner andrew -group andrew -maxTtl 4h + -listPools + + + -removePool pool1 + + + + SubstringComparator + Found 3 results + + + SubstringComparator + pool1 andrew andrew rwxr-xr-x unlimited never + + + SubstringComparator + pool2 andrew andrew rwxr-xr-x unlimited never + + + SubstringComparator + pool3 andrew andrew rwxr-xr-x unlimited 000:04:00:00.000 + + + + + diff --git a/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testHDFSConf.xml b/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testHDFSConf.xml index b5186ef75d4..b82eb66d7e0 100644 --- a/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testHDFSConf.xml +++ b/hadoop-hdfs-project/hadoop-hdfs/src/test/resources/testHDFSConf.xml @@ -16524,7 +16524,7 @@ - + Verifying clrSpaceQuota operation is not permitted in safemode -fs NAMENODE -mkdir /test diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedChunkedFile.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedChunkedFile.java index 1849c5ece13..70e68292b95 100644 --- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedChunkedFile.java +++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedChunkedFile.java @@ -69,7 +69,7 @@ public class FadvisedChunkedFile extends ChunkedFile { } if (manageOsCache && getEndOffset() - getStartOffset() > 0) { try { - NativeIO.POSIX.posixFadviseIfPossible(identifier, + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible(identifier, fd, getStartOffset(), getEndOffset() - getStartOffset(), NativeIO.POSIX.POSIX_FADV_DONTNEED); diff --git a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedFileRegion.java b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedFileRegion.java index 20b2bf479dc..b9d9a1152e4 100644 --- a/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedFileRegion.java +++ b/hadoop-mapreduce-project/hadoop-mapreduce-client/hadoop-mapreduce-client-shuffle/src/main/java/org/apache/hadoop/mapred/FadvisedFileRegion.java @@ -79,7 +79,7 @@ public class FadvisedFileRegion extends DefaultFileRegion { public void transferSuccessful() { if (manageOsCache && getCount() > 0) { try { - NativeIO.POSIX.posixFadviseIfPossible(identifier, + NativeIO.POSIX.getCacheManipulator().posixFadviseIfPossible(identifier, fd, getPosition(), getCount(), NativeIO.POSIX.POSIX_FADV_DONTNEED); } catch (Throwable t) { diff --git a/hadoop-project/src/site/site.xml b/hadoop-project/src/site/site.xml index 5f4b2682047..4e451e8c260 100644 --- a/hadoop-project/src/site/site.xml +++ b/hadoop-project/src/site/site.xml @@ -80,6 +80,7 @@ +