From 5cee7eced0b691089a875d7e918d4380bac408af Mon Sep 17 00:00:00 2001
From: Andrew Ozz <admin@laptoptips.ca>
Date: Wed, 7 Oct 2020 16:33:25 +0000
Subject: [PATCH] Update jQuery step two: - Add jquery-migrate.js v.3.3.1 to
 core and load it in debug mode when `SCRIPT_DEBUG` is true. - Add
 jquery.min.js, update jquery.js to 3.5.1 non-minified. This should help when
 debugging. - Rebuild jQuery UI 1.12.1 and add it to core. - Fix/adjust tests
 to match the above changes.

See #50564.
Built from https://develop.svn.wordpress.org/trunk@49101


git-svn-id: http://core.svn.wordpress.org/trunk@48863 1a063a9b-81f0-0310-95a4-ce76da25c4cd
---
 wp-includes/js/jquery/jquery-migrate.js       |  1163 +-
 wp-includes/js/jquery/jquery-migrate.min.js   |     4 +-
 wp-includes/js/jquery/jquery.js               | 10877 +++++++++++++++-
 wp-includes/js/jquery/jquery.min.js           |     3 +
 wp-includes/js/jquery/ui/accordion.js         |   610 +
 wp-includes/js/jquery/ui/accordion.min.js     |     6 +-
 wp-includes/js/jquery/ui/autocomplete.js      |   678 +
 wp-includes/js/jquery/ui/autocomplete.min.js  |     6 +-
 wp-includes/js/jquery/ui/button.js            |   385 +
 wp-includes/js/jquery/ui/button.min.js        |     6 +-
 wp-includes/js/jquery/ui/checkboxradio.js     |   283 +
 wp-includes/js/jquery/ui/checkboxradio.min.js |     9 +
 wp-includes/js/jquery/ui/controlgroup.js      |   298 +
 wp-includes/js/jquery/ui/controlgroup.min.js  |     9 +
 wp-includes/js/jquery/ui/core.js              |  1768 +++
 wp-includes/js/jquery/ui/core.min.js          |   111 +-
 wp-includes/js/jquery/ui/datepicker.js        |  2119 +++
 wp-includes/js/jquery/ui/datepicker.min.js    |     6 +-
 wp-includes/js/jquery/ui/dialog.js            |   932 ++
 wp-includes/js/jquery/ui/dialog.min.js        |     6 +-
 wp-includes/js/jquery/ui/draggable.js         |  1244 ++
 wp-includes/js/jquery/ui/draggable.min.js     |     6 +-
 wp-includes/js/jquery/ui/droppable.js         |   496 +
 wp-includes/js/jquery/ui/droppable.min.js     |     6 +-
 wp-includes/js/jquery/ui/effect-blind.js      |    69 +
 wp-includes/js/jquery/ui/effect-blind.min.js  |     6 +-
 wp-includes/js/jquery/ui/effect-bounce.js     |   109 +
 wp-includes/js/jquery/ui/effect-bounce.min.js |     6 +-
 wp-includes/js/jquery/ui/effect-clip.js       |    64 +
 wp-includes/js/jquery/ui/effect-clip.min.js   |     6 +-
 wp-includes/js/jquery/ui/effect-drop.js       |    68 +
 wp-includes/js/jquery/ui/effect-drop.min.js   |     6 +-
 wp-includes/js/jquery/ui/effect-explode.js    |   110 +
 .../js/jquery/ui/effect-explode.min.js        |     6 +-
 wp-includes/js/jquery/ui/effect-fade.js       |    46 +
 wp-includes/js/jquery/ui/effect-fade.min.js   |     6 +-
 wp-includes/js/jquery/ui/effect-fold.js       |    88 +
 wp-includes/js/jquery/ui/effect-fold.min.js   |     6 +-
 wp-includes/js/jquery/ui/effect-highlight.js  |    56 +
 .../js/jquery/ui/effect-highlight.min.js      |     6 +-
 wp-includes/js/jquery/ui/effect-puff.js       |    41 +
 wp-includes/js/jquery/ui/effect-puff.min.js   |     6 +-
 wp-includes/js/jquery/ui/effect-pulsate.js    |    63 +
 .../js/jquery/ui/effect-pulsate.min.js        |     6 +-
 wp-includes/js/jquery/ui/effect-scale.js      |    55 +
 wp-includes/js/jquery/ui/effect-scale.min.js  |     6 +-
 wp-includes/js/jquery/ui/effect-shake.js      |    73 +
 wp-includes/js/jquery/ui/effect-shake.min.js  |     6 +-
 wp-includes/js/jquery/ui/effect-size.js       |   190 +
 wp-includes/js/jquery/ui/effect-size.min.js   |     6 +-
 wp-includes/js/jquery/ui/effect-slide.js      |    75 +
 wp-includes/js/jquery/ui/effect-slide.min.js  |     6 +-
 wp-includes/js/jquery/ui/effect-transfer.js   |    39 +
 .../js/jquery/ui/effect-transfer.min.js       |     6 +-
 wp-includes/js/jquery/ui/effect.js            |  1639 +++
 wp-includes/js/jquery/ui/effect.min.js        |     8 +-
 wp-includes/js/jquery/ui/menu.js              |   668 +
 wp-includes/js/jquery/ui/menu.min.js          |     6 +-
 wp-includes/js/jquery/ui/mouse.js             |   224 +
 wp-includes/js/jquery/ui/mouse.min.js         |     6 +-
 wp-includes/js/jquery/ui/position.min.js      |    11 -
 wp-includes/js/jquery/ui/progressbar.js       |   177 +
 wp-includes/js/jquery/ui/progressbar.min.js   |     6 +-
 wp-includes/js/jquery/ui/resizable.js         |  1198 ++
 wp-includes/js/jquery/ui/resizable.min.js     |     6 +-
 wp-includes/js/jquery/ui/selectable.js        |   309 +
 wp-includes/js/jquery/ui/selectable.min.js    |     6 +-
 wp-includes/js/jquery/ui/selectmenu.js        |   680 +
 wp-includes/js/jquery/ui/selectmenu.min.js    |     6 +-
 wp-includes/js/jquery/ui/slider.js            |   750 ++
 wp-includes/js/jquery/ui/slider.min.js        |     6 +-
 wp-includes/js/jquery/ui/sortable.js          |  1550 +++
 wp-includes/js/jquery/ui/sortable.min.js      |     6 +-
 wp-includes/js/jquery/ui/spinner.js           |   572 +
 wp-includes/js/jquery/ui/spinner.min.js       |     6 +-
 wp-includes/js/jquery/ui/tabs.js              |   919 ++
 wp-includes/js/jquery/ui/tabs.min.js          |     6 +-
 wp-includes/js/jquery/ui/tooltip.js           |   516 +
 wp-includes/js/jquery/ui/tooltip.min.js       |     6 +-
 wp-includes/js/jquery/ui/widget.min.js        |    11 -
 wp-includes/script-loader.php                 |    99 +-
 wp-includes/version.php                       |     2 +-
 82 files changed, 30914 insertions(+), 752 deletions(-)
 create mode 100644 wp-includes/js/jquery/jquery.min.js
 create mode 100644 wp-includes/js/jquery/ui/accordion.js
 create mode 100644 wp-includes/js/jquery/ui/autocomplete.js
 create mode 100644 wp-includes/js/jquery/ui/button.js
 create mode 100644 wp-includes/js/jquery/ui/checkboxradio.js
 create mode 100644 wp-includes/js/jquery/ui/checkboxradio.min.js
 create mode 100644 wp-includes/js/jquery/ui/controlgroup.js
 create mode 100644 wp-includes/js/jquery/ui/controlgroup.min.js
 create mode 100644 wp-includes/js/jquery/ui/core.js
 create mode 100644 wp-includes/js/jquery/ui/datepicker.js
 create mode 100644 wp-includes/js/jquery/ui/dialog.js
 create mode 100644 wp-includes/js/jquery/ui/draggable.js
 create mode 100644 wp-includes/js/jquery/ui/droppable.js
 create mode 100644 wp-includes/js/jquery/ui/effect-blind.js
 create mode 100644 wp-includes/js/jquery/ui/effect-bounce.js
 create mode 100644 wp-includes/js/jquery/ui/effect-clip.js
 create mode 100644 wp-includes/js/jquery/ui/effect-drop.js
 create mode 100644 wp-includes/js/jquery/ui/effect-explode.js
 create mode 100644 wp-includes/js/jquery/ui/effect-fade.js
 create mode 100644 wp-includes/js/jquery/ui/effect-fold.js
 create mode 100644 wp-includes/js/jquery/ui/effect-highlight.js
 create mode 100644 wp-includes/js/jquery/ui/effect-puff.js
 create mode 100644 wp-includes/js/jquery/ui/effect-pulsate.js
 create mode 100644 wp-includes/js/jquery/ui/effect-scale.js
 create mode 100644 wp-includes/js/jquery/ui/effect-shake.js
 create mode 100644 wp-includes/js/jquery/ui/effect-size.js
 create mode 100644 wp-includes/js/jquery/ui/effect-slide.js
 create mode 100644 wp-includes/js/jquery/ui/effect-transfer.js
 create mode 100644 wp-includes/js/jquery/ui/effect.js
 create mode 100644 wp-includes/js/jquery/ui/menu.js
 create mode 100644 wp-includes/js/jquery/ui/mouse.js
 delete mode 100644 wp-includes/js/jquery/ui/position.min.js
 create mode 100644 wp-includes/js/jquery/ui/progressbar.js
 create mode 100644 wp-includes/js/jquery/ui/resizable.js
 create mode 100644 wp-includes/js/jquery/ui/selectable.js
 create mode 100644 wp-includes/js/jquery/ui/selectmenu.js
 create mode 100644 wp-includes/js/jquery/ui/slider.js
 create mode 100644 wp-includes/js/jquery/ui/sortable.js
 create mode 100644 wp-includes/js/jquery/ui/spinner.js
 create mode 100644 wp-includes/js/jquery/ui/tabs.js
 create mode 100644 wp-includes/js/jquery/ui/tooltip.js
 delete mode 100644 wp-includes/js/jquery/ui/widget.min.js

diff --git a/wp-includes/js/jquery/jquery-migrate.js b/wp-includes/js/jquery/jquery-migrate.js
index 6fc343c44e..2e4bde47fb 100644
--- a/wp-includes/js/jquery/jquery-migrate.js
+++ b/wp-includes/js/jquery/jquery-migrate.js
@@ -1,29 +1,84 @@
-/*!
- * jQuery Migrate - v1.4.1 - 2016-05-19
- * Copyright jQuery Foundation and other contributors
- */
-(function( jQuery, window, undefined ) {
-// See http://bugs.jquery.com/ticket/13335
-// "use strict";
-
+/*!
+ * jQuery Migrate - v3.3.1 - 2020-06-25T01:07Z
+ * Copyright OpenJS Foundation and other contributors
+ */
+( function( factory ) {
+	"use strict";
 
-jQuery.migrateVersion = "1.4.1";
-
+	if ( typeof define === "function" && define.amd ) {
 
-var warnedAbout = {};
+		// AMD. Register as an anonymous module.
+		define( [ "jquery" ], function( jQuery ) {
+			return factory( jQuery, window );
+		} );
+	} else if ( typeof module === "object" && module.exports ) {
 
-// List of warnings already given; public read only
-jQuery.migrateWarnings = [];
+		// Node/CommonJS
+		// eslint-disable-next-line no-undef
+		module.exports = factory( require( "jquery" ), window );
+	} else {
 
-// Set to true to prevent console output; migrateWarnings still maintained
-// jQuery.migrateMute = false;
+		// Browser globals
+		factory( jQuery, window );
+	}
+} )( function( jQuery, window ) {
+"use strict";
 
-// Show a message on the console so devs know we're active
-if ( window.console && window.console.log ) {
+jQuery.migrateVersion = "3.3.1";
+
+// Returns 0 if v1 == v2, -1 if v1 < v2, 1 if v1 > v2
+function compareVersions( v1, v2 ) {
+	var i,
+		rVersionParts = /^(\d+)\.(\d+)\.(\d+)/,
+		v1p = rVersionParts.exec( v1 ) || [ ],
+		v2p = rVersionParts.exec( v2 ) || [ ];
+
+	for ( i = 1; i <= 3; i++ ) {
+		if ( +v1p[ i ] > +v2p[ i ] ) {
+			return 1;
+		}
+		if ( +v1p[ i ] < +v2p[ i ] ) {
+			return -1;
+		}
+	}
+	return 0;
+}
+
+function jQueryVersionSince( version ) {
+	return compareVersions( jQuery.fn.jquery, version ) >= 0;
+}
+
+( function() {
+
+	// Support: IE9 only
+	// IE9 only creates console object when dev tools are first opened
+	// IE9 console is a host object, callable but doesn't have .apply()
+	if ( !window.console || !window.console.log ) {
+		return;
+	}
+
+	// Need jQuery 3.0.0+ and no older Migrate loaded
+	if ( !jQuery || !jQueryVersionSince( "3.0.0" ) ) {
+		window.console.log( "JQMIGRATE: jQuery 3.0.0+ REQUIRED" );
+	}
+	if ( jQuery.migrateWarnings ) {
+		window.console.log( "JQMIGRATE: Migrate plugin loaded multiple times" );
+	}
+
+	// Show a message on the console so devs know we're active
 	window.console.log( "JQMIGRATE: Migrate is installed" +
 		( jQuery.migrateMute ? "" : " with logging active" ) +
 		", version " + jQuery.migrateVersion );
-}
+
+} )();
+
+var warnedAbout = {};
+
+// By default each warning is only reported once.
+jQuery.migrateDeduplicateWarnings = true;
+
+// List of warnings already given; public read only
+jQuery.migrateWarnings = [];
 
 // Set to false to disable traces that appear with warnings
 if ( jQuery.migrateTrace === undefined ) {
@@ -36,9 +91,9 @@ jQuery.migrateReset = function() {
 	jQuery.migrateWarnings.length = 0;
 };
 
-function migrateWarn( msg) {
+function migrateWarn( msg ) {
 	var console = window.console;
-	if ( !warnedAbout[ msg ] ) {
+	if ( !jQuery.migrateDeduplicateWarnings || !warnedAbout[ msg ] ) {
 		warnedAbout[ msg ] = true;
 		jQuery.migrateWarnings.push( msg );
 		if ( console && console.warn && !jQuery.migrateMute ) {
@@ -51,209 +106,56 @@ function migrateWarn( msg) {
 }
 
 function migrateWarnProp( obj, prop, value, msg ) {
-	if ( Object.defineProperty ) {
-		// On ES5 browsers (non-oldIE), warn if the code tries to get prop;
-		// allow property to be overwritten in case some other plugin wants it
-		try {
-			Object.defineProperty( obj, prop, {
-				configurable: true,
-				enumerable: true,
-				get: function() {
-					migrateWarn( msg );
-					return value;
-				},
-				set: function( newValue ) {
-					migrateWarn( msg );
-					value = newValue;
-				}
-			});
-			return;
-		} catch( err ) {
-			// IE8 is a dope about Object.defineProperty, can't warn there
+	Object.defineProperty( obj, prop, {
+		configurable: true,
+		enumerable: true,
+		get: function() {
+			migrateWarn( msg );
+			return value;
+		},
+		set: function( newValue ) {
+			migrateWarn( msg );
+			value = newValue;
 		}
-	}
-
-	// Non-ES5 (or broken) browser; just set the property
-	jQuery._definePropertyBroken = true;
-	obj[ prop ] = value;
+	} );
 }
 
-if ( document.compatMode === "BackCompat" ) {
-	// jQuery has never supported or tested Quirks Mode
+function migrateWarnFunc( obj, prop, newFunc, msg ) {
+	obj[ prop ] = function() {
+		migrateWarn( msg );
+		return newFunc.apply( this, arguments );
+	};
+}
+
+if ( window.document.compatMode === "BackCompat" ) {
+
+	// JQuery has never supported or tested Quirks Mode
 	migrateWarn( "jQuery is not compatible with Quirks Mode" );
 }
-
 
-var attrFn = jQuery( "<input/>", { size: 1 } ).attr("size") && jQuery.attrFn,
-	oldAttr = jQuery.attr,
-	valueAttrGet = jQuery.attrHooks.value && jQuery.attrHooks.value.get ||
-		function() { return null; },
-	valueAttrSet = jQuery.attrHooks.value && jQuery.attrHooks.value.set ||
-		function() { return undefined; },
-	rnoType = /^(?:input|button)$/i,
-	rnoAttrNodeType = /^[238]$/,
-	rboolean = /^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,
-	ruseDefault = /^(?:checked|selected)$/i;
-
-// jQuery.attrFn
-migrateWarnProp( jQuery, "attrFn", attrFn || {}, "jQuery.attrFn is deprecated" );
-
-jQuery.attr = function( elem, name, value, pass ) {
-	var lowerName = name.toLowerCase(),
-		nType = elem && elem.nodeType;
-
-	if ( pass ) {
-		// Since pass is used internally, we only warn for new jQuery
-		// versions where there isn't a pass arg in the formal params
-		if ( oldAttr.length < 4 ) {
-			migrateWarn("jQuery.fn.attr( props, pass ) is deprecated");
-		}
-		if ( elem && !rnoAttrNodeType.test( nType ) &&
-			(attrFn ? name in attrFn : jQuery.isFunction(jQuery.fn[name])) ) {
-			return jQuery( elem )[ name ]( value );
-		}
-	}
-
-	// Warn if user tries to set `type`, since it breaks on IE 6/7/8; by checking
-	// for disconnected elements we don't warn on $( "<button>", { type: "button" } ).
-	if ( name === "type" && value !== undefined && rnoType.test( elem.nodeName ) && elem.parentNode ) {
-		migrateWarn("Can't change the 'type' of an input or button in IE 6/7/8");
-	}
-
-	// Restore boolHook for boolean property/attribute synchronization
-	if ( !jQuery.attrHooks[ lowerName ] && rboolean.test( lowerName ) ) {
-		jQuery.attrHooks[ lowerName ] = {
-			get: function( elem, name ) {
-				// Align boolean attributes with corresponding properties
-				// Fall back to attribute presence where some booleans are not supported
-				var attrNode,
-					property = jQuery.prop( elem, name );
-				return property === true || typeof property !== "boolean" &&
-					( attrNode = elem.getAttributeNode(name) ) && attrNode.nodeValue !== false ?
-
-					name.toLowerCase() :
-					undefined;
-			},
-			set: function( elem, value, name ) {
-				var propName;
-				if ( value === false ) {
-					// Remove boolean attributes when set to false
-					jQuery.removeAttr( elem, name );
-				} else {
-					// value is true since we know at this point it's type boolean and not false
-					// Set boolean attributes to the same name and set the DOM property
-					propName = jQuery.propFix[ name ] || name;
-					if ( propName in elem ) {
-						// Only set the IDL specifically if it already exists on the element
-						elem[ propName ] = true;
-					}
-
-					elem.setAttribute( name, name.toLowerCase() );
-				}
-				return name;
-			}
-		};
-
-		// Warn only for attributes that can remain distinct from their properties post-1.9
-		if ( ruseDefault.test( lowerName ) ) {
-			migrateWarn( "jQuery.fn.attr('" + lowerName + "') might use property instead of attribute" );
-		}
-	}
-
-	return oldAttr.call( jQuery, elem, name, value );
-};
-
-// attrHooks: value
-jQuery.attrHooks.value = {
-	get: function( elem, name ) {
-		var nodeName = ( elem.nodeName || "" ).toLowerCase();
-		if ( nodeName === "button" ) {
-			return valueAttrGet.apply( this, arguments );
-		}
-		if ( nodeName !== "input" && nodeName !== "option" ) {
-			migrateWarn("jQuery.fn.attr('value') no longer gets properties");
-		}
-		return name in elem ?
-			elem.value :
-			null;
-	},
-	set: function( elem, value ) {
-		var nodeName = ( elem.nodeName || "" ).toLowerCase();
-		if ( nodeName === "button" ) {
-			return valueAttrSet.apply( this, arguments );
-		}
-		if ( nodeName !== "input" && nodeName !== "option" ) {
-			migrateWarn("jQuery.fn.attr('value', val) no longer sets properties");
-		}
-		// Does not return so that setAttribute is also used
-		elem.value = value;
-	}
-};
-
-
-var matched, browser,
+var findProp,
+	class2type = {},
 	oldInit = jQuery.fn.init,
 	oldFind = jQuery.find,
-	oldParseJSON = jQuery.parseJSON,
-	rspaceAngle = /^\s*</,
+
 	rattrHashTest = /\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/,
 	rattrHashGlob = /\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/g,
-	// Note: XSS check is done below after string is trimmed
-	rquickExpr = /^([^<]*)(<[\w\W]+>)([^>]*)$/;
 
-// $(html) "looks like html" rule change
-jQuery.fn.init = function( selector, context, rootjQuery ) {
-	var match, ret;
+	// Support: Android <=4.0 only
+	// Make sure we trim BOM and NBSP
+	rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;
 
-	if ( selector && typeof selector === "string" ) {
-		if ( !jQuery.isPlainObject( context ) &&
-				(match = rquickExpr.exec( jQuery.trim( selector ) )) && match[ 0 ] ) {
+jQuery.fn.init = function( arg1 ) {
+	var args = Array.prototype.slice.call( arguments );
 
-			// This is an HTML string according to the "old" rules; is it still?
-			if ( !rspaceAngle.test( selector ) ) {
-				migrateWarn("$(html) HTML strings must start with '<' character");
-			}
-			if ( match[ 3 ] ) {
-				migrateWarn("$(html) HTML text after last tag is ignored");
-			}
+	if ( typeof arg1 === "string" && arg1 === "#" ) {
 
-			// Consistently reject any HTML-like string starting with a hash (gh-9521)
-			// Note that this may break jQuery 1.6.x code that otherwise would work.
-			if ( match[ 0 ].charAt( 0 ) === "#" ) {
-				migrateWarn("HTML string cannot start with a '#' character");
-				jQuery.error("JQMIGRATE: Invalid selector string (XSS)");
-			}
-
-			// Now process using loose rules; let pre-1.8 play too
-			// Is this a jQuery context? parseHTML expects a DOM element (#178)
-			if ( context && context.context && context.context.nodeType ) {
-				context = context.context;
-			}
-
-			if ( jQuery.parseHTML ) {
-				return oldInit.call( this,
-						jQuery.parseHTML( match[ 2 ], context && context.ownerDocument ||
-							context || document, true ), context, rootjQuery );
-			}
-		}
+		// JQuery( "#" ) is a bogus ID selector, but it returned an empty set before jQuery 3.0
+		migrateWarn( "jQuery( '#' ) is not a valid selector" );
+		args[ 0 ] = [];
 	}
 
-	ret = oldInit.apply( this, arguments );
-
-	// Fill in selector and context properties so .live() works
-	if ( selector && selector.selector !== undefined ) {
-		// A jQuery object, copy its properties
-		ret.selector = selector.selector;
-		ret.context = selector.context;
-
-	} else {
-		ret.selector = typeof selector === "string" ? selector : "";
-		if ( selector ) {
-			ret.context = selector.nodeType? selector : context || document;
-		}
-	}
-
-	return ret;
+	return oldInit.apply( this, args );
 };
 jQuery.fn.init.prototype = jQuery.fn;
 
@@ -267,7 +169,7 @@ jQuery.find = function( selector ) {
 		// The nonstandard and undocumented unquoted-hash was removed in jQuery 1.12.0
 		// First see if qS thinks it's a valid selector, if so avoid a false positive
 		try {
-			document.querySelector( selector );
+			window.document.querySelector( selector );
 		} catch ( err1 ) {
 
 			// Didn't *look* valid to qSA, warn and try quoting what we think is the value
@@ -278,7 +180,7 @@ jQuery.find = function( selector ) {
 			// If the regexp *may* have created an invalid selector, don't update it
 			// Note that there may be false alarms if selector uses jQuery extensions
 			try {
-				document.querySelector( selector );
+				window.document.querySelector( selector );
 				migrateWarn( "Attribute selector with '#' must be quoted: " + args[ 0 ] );
 				args[ 0 ] = selector;
 			} catch ( err2 ) {
@@ -291,95 +193,211 @@ jQuery.find = function( selector ) {
 };
 
 // Copy properties attached to original jQuery.find method (e.g. .attr, .isXML)
-var findProp;
 for ( findProp in oldFind ) {
 	if ( Object.prototype.hasOwnProperty.call( oldFind, findProp ) ) {
 		jQuery.find[ findProp ] = oldFind[ findProp ];
 	}
 }
 
-// Let $.parseJSON(falsy_value) return null
-jQuery.parseJSON = function( json ) {
-	if ( !json ) {
-		migrateWarn("jQuery.parseJSON requires a valid JSON string");
-		return null;
-	}
-	return oldParseJSON.apply( this, arguments );
-};
+// The number of elements contained in the matched element set
+migrateWarnFunc( jQuery.fn, "size", function() {
+	return this.length;
+},
+"jQuery.fn.size() is deprecated and removed; use the .length property" );
 
-jQuery.uaMatch = function( ua ) {
-	ua = ua.toLowerCase();
+migrateWarnFunc( jQuery, "parseJSON", function() {
+	return JSON.parse.apply( null, arguments );
+},
+"jQuery.parseJSON is deprecated; use JSON.parse" );
 
-	var match = /(chrome)[ \/]([\w.]+)/.exec( ua ) ||
-		/(webkit)[ \/]([\w.]+)/.exec( ua ) ||
-		/(opera)(?:.*version|)[ \/]([\w.]+)/.exec( ua ) ||
-		/(msie) ([\w.]+)/.exec( ua ) ||
-		ua.indexOf("compatible") < 0 && /(mozilla)(?:.*? rv:([\w.]+)|)/.exec( ua ) ||
-		[];
+migrateWarnFunc( jQuery, "holdReady", jQuery.holdReady,
+	"jQuery.holdReady is deprecated" );
 
-	return {
-		browser: match[ 1 ] || "",
-		version: match[ 2 ] || "0"
-	};
-};
+migrateWarnFunc( jQuery, "unique", jQuery.uniqueSort,
+	"jQuery.unique is deprecated; use jQuery.uniqueSort" );
 
-// Don't clobber any existing jQuery.browser in case it's different
-if ( !jQuery.browser ) {
-	matched = jQuery.uaMatch( navigator.userAgent );
-	browser = {};
+// Now jQuery.expr.pseudos is the standard incantation
+migrateWarnProp( jQuery.expr, "filters", jQuery.expr.pseudos,
+	"jQuery.expr.filters is deprecated; use jQuery.expr.pseudos" );
+migrateWarnProp( jQuery.expr, ":", jQuery.expr.pseudos,
+	"jQuery.expr[':'] is deprecated; use jQuery.expr.pseudos" );
 
-	if ( matched.browser ) {
-		browser[ matched.browser ] = true;
-		browser.version = matched.version;
-	}
-
-	// Chrome is Webkit, but Webkit is also Safari.
-	if ( browser.chrome ) {
-		browser.webkit = true;
-	} else if ( browser.webkit ) {
-		browser.safari = true;
-	}
-
-	jQuery.browser = browser;
+// Prior to jQuery 3.1.1 there were internal refs so we don't warn there
+if ( jQueryVersionSince( "3.1.1" ) ) {
+	migrateWarnFunc( jQuery, "trim", function( text ) {
+		return text == null ?
+			"" :
+			( text + "" ).replace( rtrim, "" );
+	},
+	"jQuery.trim is deprecated; use String.prototype.trim" );
 }
 
-// Warn if the code tries to get jQuery.browser
-migrateWarnProp( jQuery, "browser", jQuery.browser, "jQuery.browser is deprecated" );
+// Prior to jQuery 3.2 there were internal refs so we don't warn there
+if ( jQueryVersionSince( "3.2.0" ) ) {
+	migrateWarnFunc( jQuery, "nodeName", function( elem, name ) {
+		return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+	},
+	"jQuery.nodeName is deprecated" );
+}
 
-// jQuery.boxModel deprecated in 1.3, jQuery.support.boxModel deprecated in 1.7
-jQuery.boxModel = jQuery.support.boxModel = (document.compatMode === "CSS1Compat");
-migrateWarnProp( jQuery, "boxModel", jQuery.boxModel, "jQuery.boxModel is deprecated" );
-migrateWarnProp( jQuery.support, "boxModel", jQuery.support.boxModel, "jQuery.support.boxModel is deprecated" );
+if ( jQueryVersionSince( "3.3.0" ) ) {
 
-jQuery.sub = function() {
-	function jQuerySub( selector, context ) {
-		return new jQuerySub.fn.init( selector, context );
+	migrateWarnFunc( jQuery, "isNumeric", function( obj ) {
+
+			// As of jQuery 3.0, isNumeric is limited to
+			// strings and numbers (primitives or objects)
+			// that can be coerced to finite numbers (gh-2662)
+			var type = typeof obj;
+			return ( type === "number" || type === "string" ) &&
+
+				// parseFloat NaNs numeric-cast false positives ("")
+				// ...but misinterprets leading-number strings, e.g. hex literals ("0x...")
+				// subtraction forces infinities to NaN
+				!isNaN( obj - parseFloat( obj ) );
+		},
+		"jQuery.isNumeric() is deprecated"
+	);
+
+	// Populate the class2type map
+	jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".
+		split( " " ),
+	function( _, name ) {
+		class2type[ "[object " + name + "]" ] = name.toLowerCase();
+	} );
+
+	migrateWarnFunc( jQuery, "type", function( obj ) {
+		if ( obj == null ) {
+			return obj + "";
+		}
+
+		// Support: Android <=2.3 only (functionish RegExp)
+		return typeof obj === "object" || typeof obj === "function" ?
+			class2type[ Object.prototype.toString.call( obj ) ] || "object" :
+			typeof obj;
+	},
+	"jQuery.type is deprecated" );
+
+	migrateWarnFunc( jQuery, "isFunction",
+		function( obj ) {
+			return typeof obj === "function";
+		},
+		"jQuery.isFunction() is deprecated" );
+
+	migrateWarnFunc( jQuery, "isWindow",
+		function( obj ) {
+			return obj != null && obj === obj.window;
+		},
+		"jQuery.isWindow() is deprecated"
+	);
+
+	migrateWarnFunc( jQuery, "isArray", Array.isArray,
+		"jQuery.isArray is deprecated; use Array.isArray"
+	);
+}
+
+// Support jQuery slim which excludes the ajax module
+if ( jQuery.ajax ) {
+
+var oldAjax = jQuery.ajax;
+
+jQuery.ajax = function( ) {
+	var jQXHR = oldAjax.apply( this, arguments );
+
+	// Be sure we got a jQXHR (e.g., not sync)
+	if ( jQXHR.promise ) {
+		migrateWarnFunc( jQXHR, "success", jQXHR.done,
+			"jQXHR.success is deprecated and removed" );
+		migrateWarnFunc( jQXHR, "error", jQXHR.fail,
+			"jQXHR.error is deprecated and removed" );
+		migrateWarnFunc( jQXHR, "complete", jQXHR.always,
+			"jQXHR.complete is deprecated and removed" );
 	}
-	jQuery.extend( true, jQuerySub, this );
-	jQuerySub.superclass = this;
-	jQuerySub.fn = jQuerySub.prototype = this();
-	jQuerySub.fn.constructor = jQuerySub;
-	jQuerySub.sub = this.sub;
-	jQuerySub.fn.init = function init( selector, context ) {
-		var instance = jQuery.fn.init.call( this, selector, context, rootjQuerySub );
-		return instance instanceof jQuerySub ?
-			instance :
-			jQuerySub( instance );
-	};
-	jQuerySub.fn.init.prototype = jQuerySub.fn;
-	var rootjQuerySub = jQuerySub(document);
-	migrateWarn( "jQuery.sub() is deprecated" );
-	return jQuerySub;
+
+	return jQXHR;
 };
 
-// The number of elements contained in the matched element set
-jQuery.fn.size = function() {
-	migrateWarn( "jQuery.fn.size() is deprecated; use the .length property" );
-	return this.length;
-};
-
+}
 
-var internalSwapCall = false;
+var oldRemoveAttr = jQuery.fn.removeAttr,
+	oldToggleClass = jQuery.fn.toggleClass,
+	rmatchNonSpace = /\S+/g;
+
+jQuery.fn.removeAttr = function( name ) {
+	var self = this;
+
+	jQuery.each( name.match( rmatchNonSpace ), function( _i, attr ) {
+		if ( jQuery.expr.match.bool.test( attr ) ) {
+			migrateWarn( "jQuery.fn.removeAttr no longer sets boolean properties: " + attr );
+			self.prop( attr, false );
+		}
+	} );
+
+	return oldRemoveAttr.apply( this, arguments );
+};
+
+jQuery.fn.toggleClass = function( state ) {
+
+	// Only deprecating no-args or single boolean arg
+	if ( state !== undefined && typeof state !== "boolean" ) {
+		return oldToggleClass.apply( this, arguments );
+	}
+
+	migrateWarn( "jQuery.fn.toggleClass( boolean ) is deprecated" );
+
+	// Toggle entire class name of each element
+	return this.each( function() {
+		var className = this.getAttribute && this.getAttribute( "class" ) || "";
+
+		if ( className ) {
+			jQuery.data( this, "__className__", className );
+		}
+
+		// If the element has a class name or if we're passed `false`,
+		// then remove the whole classname (if there was one, the above saved it).
+		// Otherwise bring back whatever was previously saved (if anything),
+		// falling back to the empty string if nothing was stored.
+		if ( this.setAttribute ) {
+			this.setAttribute( "class",
+				className || state === false ?
+				"" :
+				jQuery.data( this, "__className__" ) || ""
+			);
+		}
+	} );
+};
+
+function camelCase( string ) {
+	return string.replace( /-([a-z])/g, function( _, letter ) {
+		return letter.toUpperCase();
+	} );
+}
+
+var oldFnCss,
+	internalSwapCall = false,
+	ralphaStart = /^[a-z]/,
+
+	// The regex visualized:
+	//
+	//                         /----------\
+	//                        |            |    /-------\
+	//                        |  / Top  \  |   |         |
+	//         /--- Border ---+-| Right  |-+---+- Width -+---\
+	//        |                 | Bottom |                    |
+	//        |                  \ Left /                     |
+	//        |                                               |
+	//        |                              /----------\     |
+	//        |          /-------------\    |            |    |- END
+	//        |         |               |   |  / Top  \  |    |
+	//        |         |  / Margin  \  |   | | Right  | |    |
+	//        |---------+-|           |-+---+-| Bottom |-+----|
+	//        |            \ Padding /         \ Left /       |
+	// BEGIN -|                                               |
+	//        |                /---------\                    |
+	//        |               |           |                   |
+	//        |               |  / Min \  |    / Width  \     |
+	//         \--------------+-|       |-+---|          |---/
+	//                           \ Max /       \ Height /
+	rautoPx = /^(?:Border(?:Top|Right|Bottom|Left)?(?:Width|)|(?:Margin|Padding)?(?:Top|Right|Bottom|Left)?|(?:Min|Max)?(?:Width|Height))$/;
 
 // If this version of jQuery has .swap(), don't false-alarm on internal uses
 if ( jQuery.swap ) {
@@ -396,7 +414,7 @@ if ( jQuery.swap ) {
 				return ret;
 			};
 		}
-	});
+	} );
 }
 
 jQuery.swap = function( elem, options, callback, args ) {
@@ -422,126 +440,182 @@ jQuery.swap = function( elem, options, callback, args ) {
 
 	return ret;
 };
-
 
-// Ensure that $.ajax gets the new parseJSON defined in core.js
-jQuery.ajaxSetup({
-	converters: {
-		"text json": jQuery.parseJSON
+if ( jQueryVersionSince( "3.4.0" ) && typeof Proxy !== "undefined" ) {
+
+	jQuery.cssProps = new Proxy( jQuery.cssProps || {}, {
+		set: function() {
+			migrateWarn( "JQMIGRATE: jQuery.cssProps is deprecated" );
+			return Reflect.set.apply( this, arguments );
+		}
+	} );
+}
+
+// Create a dummy jQuery.cssNumber if missing. It won't be used by jQuery but
+// it will prevent code adding new keys to it unconditionally from crashing.
+if ( !jQuery.cssNumber ) {
+	jQuery.cssNumber = {};
+}
+
+function isAutoPx( prop ) {
+
+	// The first test is used to ensure that:
+	// 1. The prop starts with a lowercase letter (as we uppercase it for the second regex).
+	// 2. The prop is not empty.
+	return ralphaStart.test( prop ) &&
+		rautoPx.test( prop[ 0 ].toUpperCase() + prop.slice( 1 ) );
+}
+
+oldFnCss = jQuery.fn.css;
+
+jQuery.fn.css = function( name, value ) {
+	var camelName,
+		origThis = this;
+	if ( name && typeof name === "object" && !Array.isArray( name ) ) {
+		jQuery.each( name, function( n, v ) {
+			jQuery.fn.css.call( origThis, n, v );
+		} );
 	}
-});
-
-
-var oldFnData = jQuery.fn.data;
-
-jQuery.fn.data = function( name ) {
-	var ret, evt,
-		elem = this[0];
-
-	// Handles 1.7 which has this behavior and 1.8 which doesn't
-	if ( elem && name === "events" && arguments.length === 1 ) {
-		ret = jQuery.data( elem, name );
-		evt = jQuery._data( elem, name );
-		if ( ( ret === undefined || ret === evt ) && evt !== undefined ) {
-			migrateWarn("Use of jQuery.fn.data('events') is deprecated");
-			return evt;
+	if ( typeof value === "number" ) {
+		camelName = camelCase( name );
+		if ( !isAutoPx( camelName ) && !jQuery.cssNumber[ camelName ] ) {
+			migrateWarn( "Number-typed values are deprecated for jQuery.fn.css( \"" +
+				name + "\", value )" );
 		}
 	}
-	return oldFnData.apply( this, arguments );
+
+	return oldFnCss.apply( this, arguments );
 };
-
 
-var rscriptType = /\/(java|ecma)script/i;
+var oldData = jQuery.data;
 
-// Since jQuery.clean is used internally on older versions, we only shim if it's missing
-if ( !jQuery.clean ) {
-	jQuery.clean = function( elems, context, fragment, scripts ) {
-		// Set context per 1.8 logic
-		context = context || document;
-		context = !context.nodeType && context[0] || context;
-		context = context.ownerDocument || context;
+jQuery.data = function( elem, name, value ) {
+	var curData, sameKeys, key;
 
-		migrateWarn("jQuery.clean() is deprecated");
-
-		var i, elem, handleScript, jsTags,
-			ret = [];
-
-		jQuery.merge( ret, jQuery.buildFragment( elems, context ).childNodes );
-
-		// Complex logic lifted directly from jQuery 1.8
-		if ( fragment ) {
-			// Special handling of each script element
-			handleScript = function( elem ) {
-				// Check if we consider it executable
-				if ( !elem.type || rscriptType.test( elem.type ) ) {
-					// Detach the script and store it in the scripts array (if provided) or the fragment
-					// Return truthy to indicate that it has been handled
-					return scripts ?
-						scripts.push( elem.parentNode ? elem.parentNode.removeChild( elem ) : elem ) :
-						fragment.appendChild( elem );
-				}
-			};
-
-			for ( i = 0; (elem = ret[i]) != null; i++ ) {
-				// Check if we're done after handling an executable script
-				if ( !( jQuery.nodeName( elem, "script" ) && handleScript( elem ) ) ) {
-					// Append to fragment and handle embedded scripts
-					fragment.appendChild( elem );
-					if ( typeof elem.getElementsByTagName !== "undefined" ) {
-						// handleScript alters the DOM, so use jQuery.merge to ensure snapshot iteration
-						jsTags = jQuery.grep( jQuery.merge( [], elem.getElementsByTagName("script") ), handleScript );
-
-						// Splice the scripts into ret after their former ancestor and advance our index beyond them
-						ret.splice.apply( ret, [i + 1, 0].concat( jsTags ) );
-						i += jsTags.length;
-					}
-				}
+	// Name can be an object, and each entry in the object is meant to be set as data
+	if ( name && typeof name === "object" && arguments.length === 2 ) {
+		curData = jQuery.hasData( elem ) && oldData.call( this, elem );
+		sameKeys = {};
+		for ( key in name ) {
+			if ( key !== camelCase( key ) ) {
+				migrateWarn( "jQuery.data() always sets/gets camelCased names: " + key );
+				curData[ key ] = name[ key ];
+			} else {
+				sameKeys[ key ] = name[ key ];
 			}
 		}
 
-		return ret;
-	};
-}
-
-var eventAdd = jQuery.event.add,
-	eventRemove = jQuery.event.remove,
-	eventTrigger = jQuery.event.trigger,
-	oldToggle = jQuery.fn.toggle,
-	oldLive = jQuery.fn.live,
-	oldDie = jQuery.fn.die,
-	oldLoad = jQuery.fn.load,
-	ajaxEvents = "ajaxStart|ajaxStop|ajaxSend|ajaxComplete|ajaxError|ajaxSuccess",
-	rajaxEvent = new RegExp( "\\b(?:" + ajaxEvents + ")\\b" ),
-	rhoverHack = /(?:^|\s)hover(\.\S+|)\b/,
-	hoverHack = function( events ) {
-		if ( typeof( events ) !== "string" || jQuery.event.special.hover ) {
-			return events;
-		}
-		if ( rhoverHack.test( events ) ) {
-			migrateWarn("'hover' pseudo-event is deprecated, use 'mouseenter mouseleave'");
-		}
-		return events && events.replace( rhoverHack, "mouseenter$1 mouseleave$1" );
-	};
+		oldData.call( this, elem, sameKeys );
 
-// Event props removed in 1.9, put them back if needed; no practical way to warn them
-if ( jQuery.event.props && jQuery.event.props[ 0 ] !== "attrChange" ) {
-	jQuery.event.props.unshift( "attrChange", "attrName", "relatedNode", "srcElement" );
-}
-
-// Undocumented jQuery.event.handle was "deprecated" in jQuery 1.7
-if ( jQuery.event.dispatch ) {
-	migrateWarnProp( jQuery.event, "handle", jQuery.event.dispatch, "jQuery.event.handle is undocumented and deprecated" );
-}
-
-// Support for 'hover' pseudo-event and ajax event warnings
-jQuery.event.add = function( elem, types, handler, data, selector ){
-	if ( elem !== document && rajaxEvent.test( types ) ) {
-		migrateWarn( "AJAX events should be attached to document: " + types );
+		return name;
 	}
-	eventAdd.call( this, elem, hoverHack( types || "" ), handler, data, selector );
+
+	// If the name is transformed, look for the un-transformed name in the data object
+	if ( name && typeof name === "string" && name !== camelCase( name ) ) {
+		curData = jQuery.hasData( elem ) && oldData.call( this, elem );
+		if ( curData && name in curData ) {
+			migrateWarn( "jQuery.data() always sets/gets camelCased names: " + name );
+			if ( arguments.length > 2 ) {
+				curData[ name ] = value;
+			}
+			return curData[ name ];
+		}
+	}
+
+	return oldData.apply( this, arguments );
 };
-jQuery.event.remove = function( elem, types, handler, selector, mappedTypes ){
-	eventRemove.call( this, elem, hoverHack( types ) || "", handler, selector, mappedTypes );
+
+// Support jQuery slim which excludes the effects module
+if ( jQuery.fx ) {
+
+var intervalValue, intervalMsg,
+	oldTweenRun = jQuery.Tween.prototype.run,
+	linearEasing = function( pct ) {
+		return pct;
+	};
+
+jQuery.Tween.prototype.run = function( ) {
+	if ( jQuery.easing[ this.easing ].length > 1 ) {
+		migrateWarn(
+			"'jQuery.easing." + this.easing.toString() + "' should use only one argument"
+		);
+
+		jQuery.easing[ this.easing ] = linearEasing;
+	}
+
+	oldTweenRun.apply( this, arguments );
+};
+
+intervalValue = jQuery.fx.interval || 13;
+intervalMsg = "jQuery.fx.interval is deprecated";
+
+// Support: IE9, Android <=4.4
+// Avoid false positives on browsers that lack rAF
+// Don't warn if document is hidden, jQuery uses setTimeout (#292)
+if ( window.requestAnimationFrame ) {
+	Object.defineProperty( jQuery.fx, "interval", {
+		configurable: true,
+		enumerable: true,
+		get: function() {
+			if ( !window.document.hidden ) {
+				migrateWarn( intervalMsg );
+			}
+			return intervalValue;
+		},
+		set: function( newValue ) {
+			migrateWarn( intervalMsg );
+			intervalValue = newValue;
+		}
+	} );
+}
+
+}
+
+var oldLoad = jQuery.fn.load,
+	oldEventAdd = jQuery.event.add,
+	originalFix = jQuery.event.fix;
+
+jQuery.event.props = [];
+jQuery.event.fixHooks = {};
+
+migrateWarnProp( jQuery.event.props, "concat", jQuery.event.props.concat,
+	"jQuery.event.props.concat() is deprecated and removed" );
+
+jQuery.event.fix = function( originalEvent ) {
+	var event,
+		type = originalEvent.type,
+		fixHook = this.fixHooks[ type ],
+		props = jQuery.event.props;
+
+	if ( props.length ) {
+		migrateWarn( "jQuery.event.props are deprecated and removed: " + props.join() );
+		while ( props.length ) {
+			jQuery.event.addProp( props.pop() );
+		}
+	}
+
+	if ( fixHook && !fixHook._migrated_ ) {
+		fixHook._migrated_ = true;
+		migrateWarn( "jQuery.event.fixHooks are deprecated and removed: " + type );
+		if ( ( props = fixHook.props ) && props.length ) {
+			while ( props.length ) {
+				jQuery.event.addProp( props.pop() );
+			}
+		}
+	}
+
+	event = originalFix.call( this, originalEvent );
+
+	return fixHook && fixHook.filter ? fixHook.filter( event, originalEvent ) : event;
+};
+
+jQuery.event.add = function( elem, types ) {
+
+	// This misses the multiple-types case but that seems awfully rare
+	if ( elem === window && types === "load" && window.document.readyState === "complete" ) {
+		migrateWarn( "jQuery(window).on('load'...) called after load event occurred" );
+	}
+	return oldEventAdd.apply( this, arguments );
 };
 
 jQuery.each( [ "load", "unload", "error" ], function( _, name ) {
@@ -561,7 +635,7 @@ jQuery.each( [ "load", "unload", "error" ], function( _, name ) {
 
 		args.splice( 0, 0, name );
 		if ( arguments.length ) {
-			return this.bind.apply( this, args );
+			return this.on.apply( this, args );
 		}
 
 		// Use .triggerHandler here because:
@@ -572,181 +646,190 @@ jQuery.each( [ "load", "unload", "error" ], function( _, name ) {
 		return this;
 	};
 
-});
+} );
 
-jQuery.fn.toggle = function( fn, fn2 ) {
+jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup contextmenu" ).split( " " ),
+	function( _i, name ) {
 
-	// Don't mess with animation or css toggles
-	if ( !jQuery.isFunction( fn ) || !jQuery.isFunction( fn2 ) ) {
-		return oldToggle.apply( this, arguments );
-	}
-	migrateWarn("jQuery.fn.toggle(handler, handler...) is deprecated");
+	// Handle event binding
+	jQuery.fn[ name ] = function( data, fn ) {
+		migrateWarn( "jQuery.fn." + name + "() event shorthand is deprecated" );
+		return arguments.length > 0 ?
+			this.on( name, null, data, fn ) :
+			this.trigger( name );
+	};
+} );
 
-	// Save reference to arguments for access in closure
-	var args = arguments,
-		guid = fn.guid || jQuery.guid++,
-		i = 0,
-		toggler = function( event ) {
-			// Figure out which function to execute
-			var lastToggle = ( jQuery._data( this, "lastToggle" + fn.guid ) || 0 ) % i;
-			jQuery._data( this, "lastToggle" + fn.guid, lastToggle + 1 );
-
-			// Make sure that clicks stop
-			event.preventDefault();
-
-			// and execute the function
-			return args[ lastToggle ].apply( this, arguments ) || false;
-		};
-
-	// link all the functions, so any of them can unbind this click handler
-	toggler.guid = guid;
-	while ( i < args.length ) {
-		args[ i++ ].guid = guid;
-	}
-
-	return this.click( toggler );
-};
-
-jQuery.fn.live = function( types, data, fn ) {
-	migrateWarn("jQuery.fn.live() is deprecated");
-	if ( oldLive ) {
-		return oldLive.apply( this, arguments );
-	}
-	jQuery( this.context ).on( types, this.selector, data, fn );
-	return this;
-};
-
-jQuery.fn.die = function( types, fn ) {
-	migrateWarn("jQuery.fn.die() is deprecated");
-	if ( oldDie ) {
-		return oldDie.apply( this, arguments );
-	}
-	jQuery( this.context ).off( types, this.selector || "**", fn );
-	return this;
-};
-
-// Turn global events into document-triggered events
-jQuery.event.trigger = function( event, data, elem, onlyHandlers  ){
-	if ( !elem && !rajaxEvent.test( event ) ) {
-		migrateWarn( "Global events are undocumented and deprecated" );
-	}
-	return eventTrigger.call( this,  event, data, elem || document, onlyHandlers  );
-};
-jQuery.each( ajaxEvents.split("|"),
-	function( _, name ) {
-		jQuery.event.special[ name ] = {
-			setup: function() {
-				var elem = this;
-
-				// The document needs no shimming; must be !== for oldIE
-				if ( elem !== document ) {
-					jQuery.event.add( document, name + "." + jQuery.guid, function() {
-						jQuery.event.trigger( name, Array.prototype.slice.call( arguments, 1 ), elem, true );
-					});
-					jQuery._data( this, name, jQuery.guid++ );
-				}
-				return false;
-			},
-			teardown: function() {
-				if ( this !== document ) {
-					jQuery.event.remove( document, name + "." + jQuery._data( this, name ) );
-				}
-				return false;
-			}
-		};
-	}
-);
+// Trigger "ready" event only once, on document ready
+jQuery( function() {
+	jQuery( window.document ).triggerHandler( "ready" );
+} );
 
 jQuery.event.special.ready = {
 	setup: function() {
-		if ( this === document ) {
+		if ( this === window.document ) {
 			migrateWarn( "'ready' event is deprecated" );
 		}
 	}
 };
-
-var oldSelf = jQuery.fn.andSelf || jQuery.fn.addBack,
-	oldFnFind = jQuery.fn.find;
+
+jQuery.fn.extend( {
+
+	bind: function( types, data, fn ) {
+		migrateWarn( "jQuery.fn.bind() is deprecated" );
+		return this.on( types, null, data, fn );
+	},
+	unbind: function( types, fn ) {
+		migrateWarn( "jQuery.fn.unbind() is deprecated" );
+		return this.off( types, null, fn );
+	},
+	delegate: function( selector, types, data, fn ) {
+		migrateWarn( "jQuery.fn.delegate() is deprecated" );
+		return this.on( types, selector, data, fn );
+	},
+	undelegate: function( selector, types, fn ) {
+		migrateWarn( "jQuery.fn.undelegate() is deprecated" );
+		return arguments.length === 1 ?
+			this.off( selector, "**" ) :
+			this.off( types, selector || "**", fn );
+	},
+	hover: function( fnOver, fnOut ) {
+		migrateWarn( "jQuery.fn.hover() is deprecated" );
+		return this.on( "mouseenter", fnOver ).on( "mouseleave", fnOut || fnOver );
+	}
+} );
+
+var rxhtmlTag = /<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,
+	origHtmlPrefilter = jQuery.htmlPrefilter,
+	makeMarkup = function( html ) {
+		var doc = window.document.implementation.createHTMLDocument( "" );
+		doc.body.innerHTML = html;
+		return doc.body && doc.body.innerHTML;
+	},
+	warnIfChanged = function( html ) {
+		var changed = html.replace( rxhtmlTag, "<$1></$2>" );
+		if ( changed !== html && makeMarkup( html ) !== makeMarkup( changed ) ) {
+			migrateWarn( "HTML tags must be properly nested and closed: " + html );
+		}
+	};
+
+jQuery.UNSAFE_restoreLegacyHtmlPrefilter = function() {
+	jQuery.htmlPrefilter = function( html ) {
+		warnIfChanged( html );
+		return html.replace( rxhtmlTag, "<$1></$2>" );
+	};
+};
+
+jQuery.htmlPrefilter = function( html ) {
+	warnIfChanged( html );
+	return origHtmlPrefilter( html );
+};
+
+var oldOffset = jQuery.fn.offset;
+
+jQuery.fn.offset = function() {
+	var elem = this[ 0 ];
+
+	if ( elem && ( !elem.nodeType || !elem.getBoundingClientRect ) ) {
+		migrateWarn( "jQuery.fn.offset() requires a valid DOM element" );
+		return arguments.length ? this : undefined;
+	}
+
+	return oldOffset.apply( this, arguments );
+};
+
+// Support jQuery slim which excludes the ajax module
+// The jQuery.param patch is about respecting `jQuery.ajaxSettings.traditional`
+// so it doesn't make sense for the slim build.
+if ( jQuery.ajax ) {
+
+var oldParam = jQuery.param;
+
+jQuery.param = function( data, traditional ) {
+	var ajaxTraditional = jQuery.ajaxSettings && jQuery.ajaxSettings.traditional;
+
+	if ( traditional === undefined && ajaxTraditional ) {
+
+		migrateWarn( "jQuery.param() no longer uses jQuery.ajaxSettings.traditional" );
+		traditional = ajaxTraditional;
+	}
+
+	return oldParam.call( this, data, traditional );
+};
+
+}
+
+var oldSelf = jQuery.fn.andSelf || jQuery.fn.addBack;
 
 jQuery.fn.andSelf = function() {
-	migrateWarn("jQuery.fn.andSelf() replaced by jQuery.fn.addBack()");
+	migrateWarn( "jQuery.fn.andSelf() is deprecated and removed, use jQuery.fn.addBack()" );
 	return oldSelf.apply( this, arguments );
 };
 
-jQuery.fn.find = function( selector ) {
-	var ret = oldFnFind.apply( this, arguments );
-	ret.context = this.context;
-	ret.selector = this.selector ? this.selector + " " + selector : selector;
-	return ret;
-};
-
+// Support jQuery slim which excludes the deferred module in jQuery 4.0+
+if ( jQuery.Deferred ) {
 
-// jQuery 1.6 did not support Callbacks, do not warn there
-if ( jQuery.Callbacks ) {
+var oldDeferred = jQuery.Deferred,
+	tuples = [
 
-	var oldDeferred = jQuery.Deferred,
-		tuples = [
-			// action, add listener, callbacks, .then handlers, final state
-			[ "resolve", "done", jQuery.Callbacks("once memory"),
-				jQuery.Callbacks("once memory"), "resolved" ],
-			[ "reject", "fail", jQuery.Callbacks("once memory"),
-				jQuery.Callbacks("once memory"), "rejected" ],
-			[ "notify", "progress", jQuery.Callbacks("memory"),
-				jQuery.Callbacks("memory") ]
-		];
+		// Action, add listener, callbacks, .then handlers, final state
+		[ "resolve", "done", jQuery.Callbacks( "once memory" ),
+			jQuery.Callbacks( "once memory" ), "resolved" ],
+		[ "reject", "fail", jQuery.Callbacks( "once memory" ),
+			jQuery.Callbacks( "once memory" ), "rejected" ],
+		[ "notify", "progress", jQuery.Callbacks( "memory" ),
+			jQuery.Callbacks( "memory" ) ]
+	];
 
-	jQuery.Deferred = function( func ) {
-		var deferred = oldDeferred(),
-			promise = deferred.promise();
+jQuery.Deferred = function( func ) {
+	var deferred = oldDeferred(),
+		promise = deferred.promise();
 
-		deferred.pipe = promise.pipe = function( /* fnDone, fnFail, fnProgress */ ) {
-			var fns = arguments;
+	deferred.pipe = promise.pipe = function( /* fnDone, fnFail, fnProgress */ ) {
+		var fns = arguments;
 
-			migrateWarn( "deferred.pipe() is deprecated" );
+		migrateWarn( "deferred.pipe() is deprecated" );
 
-			return jQuery.Deferred(function( newDefer ) {
-				jQuery.each( tuples, function( i, tuple ) {
-					var fn = jQuery.isFunction( fns[ i ] ) && fns[ i ];
-					// deferred.done(function() { bind to newDefer or newDefer.resolve })
-					// deferred.fail(function() { bind to newDefer or newDefer.reject })
-					// deferred.progress(function() { bind to newDefer or newDefer.notify })
-					deferred[ tuple[1] ](function() {
-						var returned = fn && fn.apply( this, arguments );
-						if ( returned && jQuery.isFunction( returned.promise ) ) {
-							returned.promise()
-								.done( newDefer.resolve )
-								.fail( newDefer.reject )
-								.progress( newDefer.notify );
-						} else {
-							newDefer[ tuple[ 0 ] + "With" ](
-								this === promise ? newDefer.promise() : this,
-								fn ? [ returned ] : arguments
-							);
-						}
-					});
-				});
-				fns = null;
-			}).promise();
+		return jQuery.Deferred( function( newDefer ) {
+			jQuery.each( tuples, function( i, tuple ) {
+				var fn = typeof fns[ i ] === "function" && fns[ i ];
 
-		};
+				// Deferred.done(function() { bind to newDefer or newDefer.resolve })
+				// deferred.fail(function() { bind to newDefer or newDefer.reject })
+				// deferred.progress(function() { bind to newDefer or newDefer.notify })
+				deferred[ tuple[ 1 ] ]( function() {
+					var returned = fn && fn.apply( this, arguments );
+					if ( returned && typeof returned.promise === "function" ) {
+						returned.promise()
+							.done( newDefer.resolve )
+							.fail( newDefer.reject )
+							.progress( newDefer.notify );
+					} else {
+						newDefer[ tuple[ 0 ] + "With" ](
+							this === promise ? newDefer.promise() : this,
+							fn ? [ returned ] : arguments
+						);
+					}
+				} );
+			} );
+			fns = null;
+		} ).promise();
 
-		deferred.isResolved = function() {
-			migrateWarn( "deferred.isResolved is deprecated" );
-			return deferred.state() === "resolved";
-		};
-
-		deferred.isRejected = function() {
-			migrateWarn( "deferred.isRejected is deprecated" );
-			return deferred.state() === "rejected";
-		};
-
-		if ( func ) {
-			func.call( deferred, deferred );
-		}
-
-		return deferred;
 	};
 
-}
-
-})( jQuery, window );
+	if ( func ) {
+		func.call( deferred, deferred );
+	}
+
+	return deferred;
+};
+
+// Preserve handler of uncaught exceptions in promise chains
+jQuery.Deferred.exceptionHook = oldDeferred.exceptionHook;
+
+}
+
+return jQuery;
+} );
diff --git a/wp-includes/js/jquery/jquery-migrate.min.js b/wp-includes/js/jquery/jquery-migrate.min.js
index 2e84fcb91a..bedaa31456 100644
--- a/wp-includes/js/jquery/jquery-migrate.min.js
+++ b/wp-includes/js/jquery/jquery-migrate.min.js
@@ -1,2 +1,2 @@
-/*! jQuery Migrate v1.4.1 | (c) jQuery Foundation and other contributors | jquery.org/license */
-"undefined"==typeof jQuery.migrateMute&&(jQuery.migrateMute=!0),function(a,b,c){function d(c){var d=b.console;f[c]||(f[c]=!0,a.migrateWarnings.push(c),d&&d.warn&&!a.migrateMute&&(d.warn("JQMIGRATE: "+c),a.migrateTrace&&d.trace&&d.trace()))}function e(b,c,e,f){if(Object.defineProperty)try{return void Object.defineProperty(b,c,{configurable:!0,enumerable:!0,get:function(){return d(f),e},set:function(a){d(f),e=a}})}catch(g){}a._definePropertyBroken=!0,b[c]=e}a.migrateVersion="1.4.1";var f={};a.migrateWarnings=[],b.console&&b.console.log&&b.console.log("JQMIGRATE: Migrate is installed"+(a.migrateMute?"":" with logging active")+", version "+a.migrateVersion),a.migrateTrace===c&&(a.migrateTrace=!0),a.migrateReset=function(){f={},a.migrateWarnings.length=0},"BackCompat"===document.compatMode&&d("jQuery is not compatible with Quirks Mode");var g=a("<input/>",{size:1}).attr("size")&&a.attrFn,h=a.attr,i=a.attrHooks.value&&a.attrHooks.value.get||function(){return null},j=a.attrHooks.value&&a.attrHooks.value.set||function(){return c},k=/^(?:input|button)$/i,l=/^[238]$/,m=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,n=/^(?:checked|selected)$/i;e(a,"attrFn",g||{},"jQuery.attrFn is deprecated"),a.attr=function(b,e,f,i){var j=e.toLowerCase(),o=b&&b.nodeType;return i&&(h.length<4&&d("jQuery.fn.attr( props, pass ) is deprecated"),b&&!l.test(o)&&(g?e in g:a.isFunction(a.fn[e])))?a(b)[e](f):("type"===e&&f!==c&&k.test(b.nodeName)&&b.parentNode&&d("Can't change the 'type' of an input or button in IE 6/7/8"),!a.attrHooks[j]&&m.test(j)&&(a.attrHooks[j]={get:function(b,d){var e,f=a.prop(b,d);return f===!0||"boolean"!=typeof f&&(e=b.getAttributeNode(d))&&e.nodeValue!==!1?d.toLowerCase():c},set:function(b,c,d){var e;return c===!1?a.removeAttr(b,d):(e=a.propFix[d]||d,e in b&&(b[e]=!0),b.setAttribute(d,d.toLowerCase())),d}},n.test(j)&&d("jQuery.fn.attr('"+j+"') might use property instead of attribute")),h.call(a,b,e,f))},a.attrHooks.value={get:function(a,b){var c=(a.nodeName||"").toLowerCase();return"button"===c?i.apply(this,arguments):("input"!==c&&"option"!==c&&d("jQuery.fn.attr('value') no longer gets properties"),b in a?a.value:null)},set:function(a,b){var c=(a.nodeName||"").toLowerCase();return"button"===c?j.apply(this,arguments):("input"!==c&&"option"!==c&&d("jQuery.fn.attr('value', val) no longer sets properties"),void(a.value=b))}};var o,p,q=a.fn.init,r=a.find,s=a.parseJSON,t=/^\s*</,u=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/,v=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/g,w=/^([^<]*)(<[\w\W]+>)([^>]*)$/;a.fn.init=function(b,e,f){var g,h;return b&&"string"==typeof b&&!a.isPlainObject(e)&&(g=w.exec(a.trim(b)))&&g[0]&&(t.test(b)||d("$(html) HTML strings must start with '<' character"),g[3]&&d("$(html) HTML text after last tag is ignored"),"#"===g[0].charAt(0)&&(d("HTML string cannot start with a '#' character"),a.error("JQMIGRATE: Invalid selector string (XSS)")),e&&e.context&&e.context.nodeType&&(e=e.context),a.parseHTML)?q.call(this,a.parseHTML(g[2],e&&e.ownerDocument||e||document,!0),e,f):(h=q.apply(this,arguments),b&&b.selector!==c?(h.selector=b.selector,h.context=b.context):(h.selector="string"==typeof b?b:"",b&&(h.context=b.nodeType?b:e||document)),h)},a.fn.init.prototype=a.fn,a.find=function(a){var b=Array.prototype.slice.call(arguments);if("string"==typeof a&&u.test(a))try{document.querySelector(a)}catch(c){a=a.replace(v,function(a,b,c,d){return"["+b+c+'"'+d+'"]'});try{document.querySelector(a),d("Attribute selector with '#' must be quoted: "+b[0]),b[0]=a}catch(e){d("Attribute selector with '#' was not fixed: "+b[0])}}return r.apply(this,b)};var x;for(x in r)Object.prototype.hasOwnProperty.call(r,x)&&(a.find[x]=r[x]);a.parseJSON=function(a){return a?s.apply(this,arguments):(d("jQuery.parseJSON requires a valid JSON string"),null)},a.uaMatch=function(a){a=a.toLowerCase();var b=/(chrome)[ \/]([\w.]+)/.exec(a)||/(webkit)[ \/]([\w.]+)/.exec(a)||/(opera)(?:.*version|)[ \/]([\w.]+)/.exec(a)||/(msie) ([\w.]+)/.exec(a)||a.indexOf("compatible")<0&&/(mozilla)(?:.*? rv:([\w.]+)|)/.exec(a)||[];return{browser:b[1]||"",version:b[2]||"0"}},a.browser||(o=a.uaMatch(navigator.userAgent),p={},o.browser&&(p[o.browser]=!0,p.version=o.version),p.chrome?p.webkit=!0:p.webkit&&(p.safari=!0),a.browser=p),e(a,"browser",a.browser,"jQuery.browser is deprecated"),a.boxModel=a.support.boxModel="CSS1Compat"===document.compatMode,e(a,"boxModel",a.boxModel,"jQuery.boxModel is deprecated"),e(a.support,"boxModel",a.support.boxModel,"jQuery.support.boxModel is deprecated"),a.sub=function(){function b(a,c){return new b.fn.init(a,c)}a.extend(!0,b,this),b.superclass=this,b.fn=b.prototype=this(),b.fn.constructor=b,b.sub=this.sub,b.fn.init=function(d,e){var f=a.fn.init.call(this,d,e,c);return f instanceof b?f:b(f)},b.fn.init.prototype=b.fn;var c=b(document);return d("jQuery.sub() is deprecated"),b},a.fn.size=function(){return d("jQuery.fn.size() is deprecated; use the .length property"),this.length};var y=!1;a.swap&&a.each(["height","width","reliableMarginRight"],function(b,c){var d=a.cssHooks[c]&&a.cssHooks[c].get;d&&(a.cssHooks[c].get=function(){var a;return y=!0,a=d.apply(this,arguments),y=!1,a})}),a.swap=function(a,b,c,e){var f,g,h={};y||d("jQuery.swap() is undocumented and deprecated");for(g in b)h[g]=a.style[g],a.style[g]=b[g];f=c.apply(a,e||[]);for(g in b)a.style[g]=h[g];return f},a.ajaxSetup({converters:{"text json":a.parseJSON}});var z=a.fn.data;a.fn.data=function(b){var e,f,g=this[0];return!g||"events"!==b||1!==arguments.length||(e=a.data(g,b),f=a._data(g,b),e!==c&&e!==f||f===c)?z.apply(this,arguments):(d("Use of jQuery.fn.data('events') is deprecated"),f)};var A=/\/(java|ecma)script/i;a.clean||(a.clean=function(b,c,e,f){c=c||document,c=!c.nodeType&&c[0]||c,c=c.ownerDocument||c,d("jQuery.clean() is deprecated");var g,h,i,j,k=[];if(a.merge(k,a.buildFragment(b,c).childNodes),e)for(i=function(a){return!a.type||A.test(a.type)?f?f.push(a.parentNode?a.parentNode.removeChild(a):a):e.appendChild(a):void 0},g=0;null!=(h=k[g]);g++)a.nodeName(h,"script")&&i(h)||(e.appendChild(h),"undefined"!=typeof h.getElementsByTagName&&(j=a.grep(a.merge([],h.getElementsByTagName("script")),i),k.splice.apply(k,[g+1,0].concat(j)),g+=j.length));return k});var B=a.event.add,C=a.event.remove,D=a.event.trigger,E=a.fn.toggle,F=a.fn.live,G=a.fn.die,H=a.fn.load,I="ajaxStart|ajaxStop|ajaxSend|ajaxComplete|ajaxError|ajaxSuccess",J=new RegExp("\\b(?:"+I+")\\b"),K=/(?:^|\s)hover(\.\S+|)\b/,L=function(b){return"string"!=typeof b||a.event.special.hover?b:(K.test(b)&&d("'hover' pseudo-event is deprecated, use 'mouseenter mouseleave'"),b&&b.replace(K,"mouseenter$1 mouseleave$1"))};a.event.props&&"attrChange"!==a.event.props[0]&&a.event.props.unshift("attrChange","attrName","relatedNode","srcElement"),a.event.dispatch&&e(a.event,"handle",a.event.dispatch,"jQuery.event.handle is undocumented and deprecated"),a.event.add=function(a,b,c,e,f){a!==document&&J.test(b)&&d("AJAX events should be attached to document: "+b),B.call(this,a,L(b||""),c,e,f)},a.event.remove=function(a,b,c,d,e){C.call(this,a,L(b)||"",c,d,e)},a.each(["load","unload","error"],function(b,c){a.fn[c]=function(){var a=Array.prototype.slice.call(arguments,0);return"load"===c&&"string"==typeof a[0]?H.apply(this,a):(d("jQuery.fn."+c+"() is deprecated"),a.splice(0,0,c),arguments.length?this.bind.apply(this,a):(this.triggerHandler.apply(this,a),this))}}),a.fn.toggle=function(b,c){if(!a.isFunction(b)||!a.isFunction(c))return E.apply(this,arguments);d("jQuery.fn.toggle(handler, handler...) is deprecated");var e=arguments,f=b.guid||a.guid++,g=0,h=function(c){var d=(a._data(this,"lastToggle"+b.guid)||0)%g;return a._data(this,"lastToggle"+b.guid,d+1),c.preventDefault(),e[d].apply(this,arguments)||!1};for(h.guid=f;g<e.length;)e[g++].guid=f;return this.click(h)},a.fn.live=function(b,c,e){return d("jQuery.fn.live() is deprecated"),F?F.apply(this,arguments):(a(this.context).on(b,this.selector,c,e),this)},a.fn.die=function(b,c){return d("jQuery.fn.die() is deprecated"),G?G.apply(this,arguments):(a(this.context).off(b,this.selector||"**",c),this)},a.event.trigger=function(a,b,c,e){return c||J.test(a)||d("Global events are undocumented and deprecated"),D.call(this,a,b,c||document,e)},a.each(I.split("|"),function(b,c){a.event.special[c]={setup:function(){var b=this;return b!==document&&(a.event.add(document,c+"."+a.guid,function(){a.event.trigger(c,Array.prototype.slice.call(arguments,1),b,!0)}),a._data(this,c,a.guid++)),!1},teardown:function(){return this!==document&&a.event.remove(document,c+"."+a._data(this,c)),!1}}}),a.event.special.ready={setup:function(){this===document&&d("'ready' event is deprecated")}};var M=a.fn.andSelf||a.fn.addBack,N=a.fn.find;if(a.fn.andSelf=function(){return d("jQuery.fn.andSelf() replaced by jQuery.fn.addBack()"),M.apply(this,arguments)},a.fn.find=function(a){var b=N.apply(this,arguments);return b.context=this.context,b.selector=this.selector?this.selector+" "+a:a,b},a.Callbacks){var O=a.Deferred,P=[["resolve","done",a.Callbacks("once memory"),a.Callbacks("once memory"),"resolved"],["reject","fail",a.Callbacks("once memory"),a.Callbacks("once memory"),"rejected"],["notify","progress",a.Callbacks("memory"),a.Callbacks("memory")]];a.Deferred=function(b){var c=O(),e=c.promise();return c.pipe=e.pipe=function(){var b=arguments;return d("deferred.pipe() is deprecated"),a.Deferred(function(d){a.each(P,function(f,g){var h=a.isFunction(b[f])&&b[f];c[g[1]](function(){var b=h&&h.apply(this,arguments);b&&a.isFunction(b.promise)?b.promise().done(d.resolve).fail(d.reject).progress(d.notify):d[g[0]+"With"](this===e?d.promise():this,h?[b]:arguments)})}),b=null}).promise()},c.isResolved=function(){return d("deferred.isResolved is deprecated"),"resolved"===c.state()},c.isRejected=function(){return d("deferred.isRejected is deprecated"),"rejected"===c.state()},b&&b.call(c,c),c}}}(jQuery,window);
\ No newline at end of file
+/*! jQuery Migrate v3.3.1 | (c) OpenJS Foundation and other contributors | jquery.org/license */
+"undefined"==typeof jQuery.migrateMute&&(jQuery.migrateMute=!0),function(t){"use strict";"function"==typeof define&&define.amd?define(["jquery"],function(e){return t(e,window)}):"object"==typeof module&&module.exports?module.exports=t(require("jquery"),window):t(jQuery,window)}(function(s,n){"use strict";function e(e){return 0<=function(e,t){var r,n=/^(\d+)\.(\d+)\.(\d+)/,i=n.exec(e)||[],o=n.exec(t)||[];for(r=1;r<=3;r++){if(+i[r]>+o[r])return 1;if(+i[r]<+o[r])return-1}return 0}(s.fn.jquery,e)}s.migrateVersion="3.3.1",n.console&&n.console.log&&(s&&e("3.0.0")||n.console.log("JQMIGRATE: jQuery 3.0.0+ REQUIRED"),s.migrateWarnings&&n.console.log("JQMIGRATE: Migrate plugin loaded multiple times"),n.console.log("JQMIGRATE: Migrate is installed"+(s.migrateMute?"":" with logging active")+", version "+s.migrateVersion));var r={};function u(e){var t=n.console;s.migrateDeduplicateWarnings&&r[e]||(r[e]=!0,s.migrateWarnings.push(e),t&&t.warn&&!s.migrateMute&&(t.warn("JQMIGRATE: "+e),s.migrateTrace&&t.trace&&t.trace()))}function t(e,t,r,n){Object.defineProperty(e,t,{configurable:!0,enumerable:!0,get:function(){return u(n),r},set:function(e){u(n),r=e}})}function i(e,t,r,n){e[t]=function(){return u(n),r.apply(this,arguments)}}s.migrateDeduplicateWarnings=!0,s.migrateWarnings=[],void 0===s.migrateTrace&&(s.migrateTrace=!0),s.migrateReset=function(){r={},s.migrateWarnings.length=0},"BackCompat"===n.document.compatMode&&u("jQuery is not compatible with Quirks Mode");var o,a={},c=s.fn.init,d=s.find,l=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/,p=/\[(\s*[-\w]+\s*)([~|^$*]?=)\s*([-\w#]*?#[-\w#]*)\s*\]/g,f=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;for(o in s.fn.init=function(e){var t=Array.prototype.slice.call(arguments);return"string"==typeof e&&"#"===e&&(u("jQuery( '#' ) is not a valid selector"),t[0]=[]),c.apply(this,t)},s.fn.init.prototype=s.fn,s.find=function(t){var r=Array.prototype.slice.call(arguments);if("string"==typeof t&&l.test(t))try{n.document.querySelector(t)}catch(e){t=t.replace(p,function(e,t,r,n){return"["+t+r+'"'+n+'"]'});try{n.document.querySelector(t),u("Attribute selector with '#' must be quoted: "+r[0]),r[0]=t}catch(e){u("Attribute selector with '#' was not fixed: "+r[0])}}return d.apply(this,r)},d)Object.prototype.hasOwnProperty.call(d,o)&&(s.find[o]=d[o]);if(i(s.fn,"size",function(){return this.length},"jQuery.fn.size() is deprecated and removed; use the .length property"),i(s,"parseJSON",function(){return JSON.parse.apply(null,arguments)},"jQuery.parseJSON is deprecated; use JSON.parse"),i(s,"holdReady",s.holdReady,"jQuery.holdReady is deprecated"),i(s,"unique",s.uniqueSort,"jQuery.unique is deprecated; use jQuery.uniqueSort"),t(s.expr,"filters",s.expr.pseudos,"jQuery.expr.filters is deprecated; use jQuery.expr.pseudos"),t(s.expr,":",s.expr.pseudos,"jQuery.expr[':'] is deprecated; use jQuery.expr.pseudos"),e("3.1.1")&&i(s,"trim",function(e){return null==e?"":(e+"").replace(f,"")},"jQuery.trim is deprecated; use String.prototype.trim"),e("3.2.0")&&i(s,"nodeName",function(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()},"jQuery.nodeName is deprecated"),e("3.3.0")&&(i(s,"isNumeric",function(e){var t=typeof e;return("number"==t||"string"==t)&&!isNaN(e-parseFloat(e))},"jQuery.isNumeric() is deprecated"),s.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){a["[object "+t+"]"]=t.toLowerCase()}),i(s,"type",function(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?a[Object.prototype.toString.call(e)]||"object":typeof e},"jQuery.type is deprecated"),i(s,"isFunction",function(e){return"function"==typeof e},"jQuery.isFunction() is deprecated"),i(s,"isWindow",function(e){return null!=e&&e===e.window},"jQuery.isWindow() is deprecated"),i(s,"isArray",Array.isArray,"jQuery.isArray is deprecated; use Array.isArray")),s.ajax){var y=s.ajax;s.ajax=function(){var e=y.apply(this,arguments);return e.promise&&(i(e,"success",e.done,"jQXHR.success is deprecated and removed"),i(e,"error",e.fail,"jQXHR.error is deprecated and removed"),i(e,"complete",e.always,"jQXHR.complete is deprecated and removed")),e}}var m=s.fn.removeAttr,g=s.fn.toggleClass,h=/\S+/g;function v(e){return e.replace(/-([a-z])/g,function(e,t){return t.toUpperCase()})}s.fn.removeAttr=function(e){var r=this;return s.each(e.match(h),function(e,t){s.expr.match.bool.test(t)&&(u("jQuery.fn.removeAttr no longer sets boolean properties: "+t),r.prop(t,!1))}),m.apply(this,arguments)};var j,Q=!(s.fn.toggleClass=function(t){return void 0!==t&&"boolean"!=typeof t?g.apply(this,arguments):(u("jQuery.fn.toggleClass( boolean ) is deprecated"),this.each(function(){var e=this.getAttribute&&this.getAttribute("class")||"";e&&s.data(this,"__className__",e),this.setAttribute&&this.setAttribute("class",e||!1===t?"":s.data(this,"__className__")||"")}))}),b=/^[a-z]/,w=/^(?:Border(?:Top|Right|Bottom|Left)?(?:Width|)|(?:Margin|Padding)?(?:Top|Right|Bottom|Left)?|(?:Min|Max)?(?:Width|Height))$/;s.swap&&s.each(["height","width","reliableMarginRight"],function(e,t){var r=s.cssHooks[t]&&s.cssHooks[t].get;r&&(s.cssHooks[t].get=function(){var e;return Q=!0,e=r.apply(this,arguments),Q=!1,e})}),s.swap=function(e,t,r,n){var i,o,a={};for(o in Q||u("jQuery.swap() is undocumented and deprecated"),t)a[o]=e.style[o],e.style[o]=t[o];for(o in i=r.apply(e,n||[]),t)e.style[o]=a[o];return i},e("3.4.0")&&"undefined"!=typeof Proxy&&(s.cssProps=new Proxy(s.cssProps||{},{set:function(){return u("JQMIGRATE: jQuery.cssProps is deprecated"),Reflect.set.apply(this,arguments)}})),s.cssNumber||(s.cssNumber={}),j=s.fn.css,s.fn.css=function(e,t){var r,n=this;return e&&"object"==typeof e&&!Array.isArray(e)&&s.each(e,function(e,t){s.fn.css.call(n,e,t)}),"number"==typeof t&&(function(e){return b.test(e)&&w.test(e[0].toUpperCase()+e.slice(1))}(r=v(e))||s.cssNumber[r]||u('Number-typed values are deprecated for jQuery.fn.css( "'+e+'", value )')),j.apply(this,arguments)};var x=s.data;if(s.data=function(e,t,r){var n,i,o;if(t&&"object"==typeof t&&2===arguments.length){for(o in n=s.hasData(e)&&x.call(this,e),i={},t)o!==v(o)?(u("jQuery.data() always sets/gets camelCased names: "+o),n[o]=t[o]):i[o]=t[o];return x.call(this,e,i),t}return t&&"string"==typeof t&&t!==v(t)&&(n=s.hasData(e)&&x.call(this,e))&&t in n?(u("jQuery.data() always sets/gets camelCased names: "+t),2<arguments.length&&(n[t]=r),n[t]):x.apply(this,arguments)},s.fx){var A,k,M=s.Tween.prototype.run,S=function(e){return e};s.Tween.prototype.run=function(){1<s.easing[this.easing].length&&(u("'jQuery.easing."+this.easing.toString()+"' should use only one argument"),s.easing[this.easing]=S),M.apply(this,arguments)},A=s.fx.interval||13,k="jQuery.fx.interval is deprecated",n.requestAnimationFrame&&Object.defineProperty(s.fx,"interval",{configurable:!0,enumerable:!0,get:function(){return n.document.hidden||u(k),A},set:function(e){u(k),A=e}})}var N=s.fn.load,R=s.event.add,H=s.event.fix;s.event.props=[],s.event.fixHooks={},t(s.event.props,"concat",s.event.props.concat,"jQuery.event.props.concat() is deprecated and removed"),s.event.fix=function(e){var t,r=e.type,n=this.fixHooks[r],i=s.event.props;if(i.length){u("jQuery.event.props are deprecated and removed: "+i.join());while(i.length)s.event.addProp(i.pop())}if(n&&!n._migrated_&&(n._migrated_=!0,u("jQuery.event.fixHooks are deprecated and removed: "+r),(i=n.props)&&i.length))while(i.length)s.event.addProp(i.pop());return t=H.call(this,e),n&&n.filter?n.filter(t,e):t},s.event.add=function(e,t){return e===n&&"load"===t&&"complete"===n.document.readyState&&u("jQuery(window).on('load'...) called after load event occurred"),R.apply(this,arguments)},s.each(["load","unload","error"],function(e,t){s.fn[t]=function(){var e=Array.prototype.slice.call(arguments,0);return"load"===t&&"string"==typeof e[0]?N.apply(this,e):(u("jQuery.fn."+t+"() is deprecated"),e.splice(0,0,t),arguments.length?this.on.apply(this,e):(this.triggerHandler.apply(this,e),this))}}),s.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,r){s.fn[r]=function(e,t){return u("jQuery.fn."+r+"() event shorthand is deprecated"),0<arguments.length?this.on(r,null,e,t):this.trigger(r)}}),s(function(){s(n.document).triggerHandler("ready")}),s.event.special.ready={setup:function(){this===n.document&&u("'ready' event is deprecated")}},s.fn.extend({bind:function(e,t,r){return u("jQuery.fn.bind() is deprecated"),this.on(e,null,t,r)},unbind:function(e,t){return u("jQuery.fn.unbind() is deprecated"),this.off(e,null,t)},delegate:function(e,t,r,n){return u("jQuery.fn.delegate() is deprecated"),this.on(t,e,r,n)},undelegate:function(e,t,r){return u("jQuery.fn.undelegate() is deprecated"),1===arguments.length?this.off(e,"**"):this.off(t,e||"**",r)},hover:function(e,t){return u("jQuery.fn.hover() is deprecated"),this.on("mouseenter",e).on("mouseleave",t||e)}});function C(e){var t=n.document.implementation.createHTMLDocument("");return t.body.innerHTML=e,t.body&&t.body.innerHTML}function T(e){var t=e.replace(P,"<$1></$2>");t!==e&&C(e)!==C(t)&&u("HTML tags must be properly nested and closed: "+e)}var P=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([a-z][^\/\0>\x20\t\r\n\f]*)[^>]*)\/>/gi,q=s.htmlPrefilter;s.UNSAFE_restoreLegacyHtmlPrefilter=function(){s.htmlPrefilter=function(e){return T(e),e.replace(P,"<$1></$2>")}},s.htmlPrefilter=function(e){return T(e),q(e)};var D=s.fn.offset;if(s.fn.offset=function(){var e=this[0];return!e||e.nodeType&&e.getBoundingClientRect?D.apply(this,arguments):(u("jQuery.fn.offset() requires a valid DOM element"),arguments.length?this:void 0)},s.ajax){var _=s.param;s.param=function(e,t){var r=s.ajaxSettings&&s.ajaxSettings.traditional;return void 0===t&&r&&(u("jQuery.param() no longer uses jQuery.ajaxSettings.traditional"),t=r),_.call(this,e,t)}}var E=s.fn.andSelf||s.fn.addBack;if(s.fn.andSelf=function(){return u("jQuery.fn.andSelf() is deprecated and removed, use jQuery.fn.addBack()"),E.apply(this,arguments)},s.Deferred){var F=s.Deferred,O=[["resolve","done",s.Callbacks("once memory"),s.Callbacks("once memory"),"resolved"],["reject","fail",s.Callbacks("once memory"),s.Callbacks("once memory"),"rejected"],["notify","progress",s.Callbacks("memory"),s.Callbacks("memory")]];s.Deferred=function(e){var o=F(),a=o.promise();return o.pipe=a.pipe=function(){var i=arguments;return u("deferred.pipe() is deprecated"),s.Deferred(function(n){s.each(O,function(e,t){var r="function"==typeof i[e]&&i[e];o[t[1]](function(){var e=r&&r.apply(this,arguments);e&&"function"==typeof e.promise?e.promise().done(n.resolve).fail(n.reject).progress(n.notify):n[t[0]+"With"](this===a?n.promise():this,r?[e]:arguments)})}),i=null}).promise()},e&&e.call(o,o),o},s.Deferred.exceptionHook=F.exceptionHook}return s});
diff --git a/wp-includes/js/jquery/jquery.js b/wp-includes/js/jquery/jquery.js
index 340ce0a2c9..bce453d6d1 100644
--- a/wp-includes/js/jquery/jquery.js
+++ b/wp-includes/js/jquery/jquery.js
@@ -1,6 +1,10873 @@
-/*! jQuery v1.12.4 | (c) jQuery Foundation | jquery.org/license | WordPress 2019-05-16 */
-!function(a,b){"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){var c=[],d=a.document,e=c.slice,f=c.concat,g=c.push,h=c.indexOf,i={},j=i.toString,k=i.hasOwnProperty,l={},m="1.12.4",n=function(a,b){return new n.fn.init(a,b)},o=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,p=/^-ms-/,q=/-([\da-z])/gi,r=function(a,b){return b.toUpperCase()};n.fn=n.prototype={jquery:m,constructor:n,selector:"",length:0,toArray:function(){return e.call(this)},get:function(a){return null!=a?a<0?this[a+this.length]:this[a]:e.call(this)},pushStack:function(a){var b=n.merge(this.constructor(),a);return b.prevObject=this,b.context=this.context,b},each:function(a){return n.each(this,a)},map:function(a){return this.pushStack(n.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(e.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(a<0?b:0);return this.pushStack(c>=0&&c<b?[this[c]]:[])},end:function(){return this.prevObject||this.constructor()},push:g,sort:c.sort,splice:c.splice},n.extend=n.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||n.isFunction(g)||(g={}),h===i&&(g=this,h--);h<i;h++)if(null!=(e=arguments[h]))for(d in e)a=g[d],c=e[d],"__proto__"!==d&&g!==c&&(j&&c&&(n.isPlainObject(c)||(b=n.isArray(c)))?(b?(b=!1,f=a&&n.isArray(a)?a:[]):f=a&&n.isPlainObject(a)?a:{},g[d]=n.extend(j,f,c)):void 0!==c&&(g[d]=c));return g},n.extend({expando:"jQuery"+(m+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===n.type(a)},isArray:Array.isArray||function(a){return"array"===n.type(a)},isWindow:function(a){return null!=a&&a==a.window},isNumeric:function(a){var b=a&&a.toString();return!n.isArray(a)&&b-parseFloat(b)+1>=0},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},isPlainObject:function(a){var b;if(!a||"object"!==n.type(a)||a.nodeType||n.isWindow(a))return!1;try{if(a.constructor&&!k.call(a,"constructor")&&!k.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}if(!l.ownFirst)for(b in a)return k.call(a,b);for(b in a);return void 0===b||k.call(a,b)},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?i[j.call(a)]||"object":typeof a},globalEval:function(b){b&&n.trim(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(p,"ms-").replace(q,r)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,b){var c,d=0;if(s(a)){for(c=a.length;d<c;d++)if(!1===b.call(a[d],d,a[d]))break}else for(d in a)if(!1===b.call(a[d],d,a[d]))break;return a},trim:function(a){return null==a?"":(a+"").replace(o,"")},makeArray:function(a,b){var c=b||[];return null!=a&&(s(Object(a))?n.merge(c,"string"==typeof a?[a]:a):g.call(c,a)),c},inArray:function(a,b,c){var d;if(b){if(h)return h.call(b,a,c);for(d=b.length,c=c?c<0?Math.max(0,d+c):c:0;c<d;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,b){var c=+b.length,d=0,e=a.length;while(d<c)a[e++]=b[d++];if(c!==c)while(void 0!==b[d])a[e++]=b[d++];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;f<g;f++)(d=!b(a[f],f))!==h&&e.push(a[f]);return e},map:function(a,b,c){var d,e,g=0,h=[];if(s(a))for(d=a.length;g<d;g++)null!=(e=b(a[g],g,c))&&h.push(e);else for(g in a)null!=(e=b(a[g],g,c))&&h.push(e);return f.apply([],h)},guid:1,proxy:function(a,b){var c,d,f;if("string"==typeof b&&(f=a[b],b=a,a=f),n.isFunction(a))return c=e.call(arguments,2),d=function(){return a.apply(b||this,c.concat(e.call(arguments)))},d.guid=a.guid=a.guid||n.guid++,d},now:function(){return+new Date},support:l}),"function"==typeof Symbol&&(n.fn[Symbol.iterator]=c[Symbol.iterator]),n.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(a,b){i["[object "+b+"]"]=b.toLowerCase()});function s(a){var b=!!a&&"length"in a&&a.length,c=n.type(a);return"function"!==c&&!n.isWindow(a)&&("array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a)}var t=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=fa(),z=fa(),A=fa(),B=function(a,b){return a===b&&(l=!0),0},C=1<<31,D={}.hasOwnProperty,E=[],F=E.pop,G=E.push,H=E.push,I=E.slice,J=function(a,b){for(var c=0,d=a.length;c<d;c++)if(a[c]===b)return c;return-1},K="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",L="[\\x20\\t\\r\\n\\f]",M="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",N="\\["+L+"*("+M+")(?:"+L+"*([*^$|!~]?=)"+L+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+M+"))|)"+L+"*\\]",O=":("+M+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+N+")*)|.*)\\)|)",P=new RegExp(L+"+","g"),Q=new RegExp("^"+L+"+|((?:^|[^\\\\])(?:\\\\.)*)"+L+"+$","g"),R=new RegExp("^"+L+"*,"+L+"*"),S=new RegExp("^"+L+"*([>+~]|"+L+")"+L+"*"),T=new RegExp("="+L+"*([^\\]'\"]*?)"+L+"*\\]","g"),U=new RegExp(O),V=new RegExp("^"+M+"$"),W={ID:new RegExp("^#("+M+")"),CLASS:new RegExp("^\\.("+M+")"),TAG:new RegExp("^("+M+"|[*])"),ATTR:new RegExp("^"+N),PSEUDO:new RegExp("^"+O),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+L+"*(even|odd|(([+-]|)(\\d*)n|)"+L+"*(?:([+-]|)"+L+"*(\\d+)|))"+L+"*\\)|)","i"),bool:new RegExp("^(?:"+K+")$","i"),needsContext:new RegExp("^"+L+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+L+"*((?:-\\d)?\\d*)"+L+"*\\)|)(?=[^-]|$)","i")},X=/^(?:input|select|textarea|button)$/i,Y=/^h\d$/i,Z=/^[^{]+\{\s*\[native \w/,$=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,_=/[+~]/,aa=/'|\\/g,ba=new RegExp("\\\\([\\da-f]{1,6}"+L+"?|("+L+")|.)","ig"),ca=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:d<0?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},da=function(){m()};try{H.apply(E=I.call(v.childNodes),v.childNodes),E[v.childNodes.length].nodeType}catch(xa){H={apply:E.length?function(a,b){G.apply(a,I.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function ea(a,b,d,e){var f,h,j,k,l,o,r,s,w=b&&b.ownerDocument,x=b?b.nodeType:9;if(d=d||[],"string"!=typeof a||!a||1!==x&&9!==x&&11!==x)return d;if(!e&&((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,p)){if(11!==x&&(o=$.exec(a)))if(f=o[1]){if(9===x){if(!(j=b.getElementById(f)))return d;if(j.id===f)return d.push(j),d}else if(w&&(j=w.getElementById(f))&&t(b,j)&&j.id===f)return d.push(j),d}else{if(o[2])return H.apply(d,b.getElementsByTagName(a)),d;if((f=o[3])&&c.getElementsByClassName&&b.getElementsByClassName)return H.apply(d,b.getElementsByClassName(f)),d}if(c.qsa&&!A[a+" "]&&(!q||!q.test(a))){if(1!==x)w=b,s=a;else if("object"!==b.nodeName.toLowerCase()){(k=b.getAttribute("id"))?k=k.replace(aa,"\\$&"):b.setAttribute("id",k=u),r=g(a),h=r.length,l=V.test(k)?"#"+k:"[id='"+k+"']";while(h--)r[h]=l+" "+pa(r[h]);s=r.join(","),w=_.test(a)&&na(b.parentNode)||b}if(s)try{return H.apply(d,w.querySelectorAll(s)),d}catch(y){}finally{k===u&&b.removeAttribute("id")}}}return i(a.replace(Q,"$1"),b,d,e)}function fa(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ga(a){return a[u]=!0,a}function ha(a){var b=n.createElement("div");try{return!!a(b)}catch(xa){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ia(a,b){var c=a.split("|"),e=c.length;while(e--)d.attrHandle[c[e]]=b}function ja(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&(~b.sourceIndex||C)-(~a.sourceIndex||C);if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function ka(a){return function(b){return"input"===b.nodeName.toLowerCase()&&b.type===a}}function la(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function ma(a){return ga(function(b){return b=+b,ga(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function na(a){return a&&void 0!==a.getElementsByTagName&&a}c=ea.support={},f=ea.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return!!b&&"HTML"!==b.nodeName},m=ea.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=n.documentElement,p=!f(n),(e=n.defaultView)&&e.top!==e&&(e.addEventListener?e.addEventListener("unload",da,!1):e.attachEvent&&e.attachEvent("onunload",da)),c.attributes=ha(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ha(function(a){return a.appendChild(n.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=Z.test(n.getElementsByClassName),c.getById=ha(function(a){return o.appendChild(a).id=u,!n.getElementsByName||!n.getElementsByName(u).length}),c.getById?(d.find.ID=function(a,b){if(void 0!==b.getElementById&&p){var c=b.getElementById(a);return c?[c]:[]}},d.filter.ID=function(a){var b=a.replace(ba,ca);return function(a){return a.getAttribute("id")===b}}):(delete d.find.ID,d.filter.ID=function(a){var b=a.replace(ba,ca);return function(a){var c=void 0!==a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}}),d.find.TAG=c.getElementsByTagName?function(a,b){return void 0!==b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){if(void 0!==b.getElementsByClassName&&p)return b.getElementsByClassName(a)},r=[],q=[],(c.qsa=Z.test(n.querySelectorAll))&&(ha(function(a){o.appendChild(a).innerHTML="<a id='"+u+"'></a><select id='"+u+"-\r\\' msallowcapture=''><option selected=''></option></select>",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+L+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+L+"*(?:value|"+K+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ha(function(a){var b=n.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+L+"*[*^$|!~]?="),a.querySelectorAll(":enabled").length||q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=Z.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ha(function(a){c.disconnectedMatch=s.call(a,"div"),s.call(a,"[s!='']:x"),r.push("!=",O)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=Z.test(o.compareDocumentPosition),t=b||Z.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d||(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===n||a.ownerDocument===v&&t(v,a)?-1:b===n||b.ownerDocument===v&&t(v,b)?1:k?J(k,a)-J(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,g=[a],h=[b];if(!e||!f)return a===n?-1:b===n?1:e?-1:f?1:k?J(k,a)-J(k,b):0;if(e===f)return ja(a,b);c=a;while(c=c.parentNode)g.unshift(c);c=b;while(c=c.parentNode)h.unshift(c);while(g[d]===h[d])d++;return d?ja(g[d],h[d]):g[d]===v?-1:h[d]===v?1:0},n):n},ea.matches=function(a,b){return ea(a,null,null,b)},ea.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(T,"='$1']"),c.matchesSelector&&p&&!A[b+" "]&&(!r||!r.test(b))&&(!q||!q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(xa){}return ea(b,n,null,[a]).length>0},ea.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},ea.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&D.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},ea.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},ea.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=ea.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=ea.selectors={cacheLength:50,createPseudo:ga,match:W,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(ba,ca),a[3]=(a[3]||a[4]||a[5]||"").replace(ba,ca),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||ea.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&ea.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return W.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&U.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(ba,ca).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+L+")"+a+"("+L+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||void 0!==a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=ea.attr(d,a);return null==e?"!="===b:!b||(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(P," ")+" ").indexOf(c)>-1:"|="===b&&(e===c||e.slice(0,c.length+1)===c+"-"))}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h,t=!1;if(q){if(f){while(p){m=b;while(m=m[p])if(h?m.nodeName.toLowerCase()===r:1===m.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){m=q,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n&&j[2],m=n&&q.childNodes[n];while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if(1===m.nodeType&&++t&&m===b){k[a]=[w,n,t];break}}else if(s&&(m=b,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n),!1===t)while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if((h?m.nodeName.toLowerCase()===r:1===m.nodeType)&&++t&&(s&&(l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),k[a]=[w,t]),m===b))break;return(t-=e)===d||t%d==0&&t/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||ea.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ga(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=J(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ga(function(a){var b=[],c=[],d=h(a.replace(Q,"$1"));return d[u]?ga(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ga(function(a){return function(b){return ea(a,b).length>0}}),contains:ga(function(a){return a=a.replace(ba,ca),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ga(function(a){return V.test(a||"")||ea.error("unsupported lang: "+a),a=a.replace(ba,ca).toLowerCase(),function(b){var c;do{if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return(c=c.toLowerCase())===a||0===c.indexOf(a+"-")}while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:function(a){return!1===a.disabled},disabled:function(a){return!0===a.disabled},checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,!0===a.selected},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return Y.test(a.nodeName)},input:function(a){return X.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:ma(function(){return[0]}),last:ma(function(a,b){return[b-1]}),eq:ma(function(a,b,c){return[c<0?c+b:c]}),even:ma(function(a,b){for(var c=0;c<b;c+=2)a.push(c);return a}),odd:ma(function(a,b){for(var c=1;c<b;c+=2)a.push(c);return a}),lt:ma(function(a,b,c){for(var d=c<0?c+b:c;--d>=0;)a.push(d);return a}),gt:ma(function(a,b,c){for(var d=c<0?c+b:c;++d<b;)a.push(d);return a})}},d.pseudos.nth=d.pseudos.eq;for(b in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})d.pseudos[b]=ka(b);for(b in{submit:!0,reset:!0})d.pseudos[b]=la(b);function oa(){}oa.prototype=d.filters=d.pseudos,d.setFilters=new oa,g=ea.tokenize=function(a,b){var c,e,f,g,h,i,j,k=z[a+" "];if(k)return b?0:k.slice(0);h=a,i=[],j=d.preFilter;while(h){c&&!(e=R.exec(h))||(e&&(h=h.slice(e[0].length)||h),i.push(f=[])),c=!1,(e=S.exec(h))&&(c=e.shift(),f.push({value:c,type:e[0].replace(Q," ")}),h=h.slice(c.length));for(g in d.filter)!(e=W[g].exec(h))||j[g]&&!(e=j[g](e))||(c=e.shift(),f.push({value:c,type:g,matches:e}),h=h.slice(c.length));if(!c)break}return b?h.length:h?ea.error(a):z(a,i).slice(0)};function pa(a){for(var b=0,c=a.length,d="";b<c;b++)d+=a[b].value;return d}function qa(a,b,c){var d=b.dir,e=c&&"parentNode"===d,f=x++;return b.first?function(b,c,f){while(b=b[d])if(1===b.nodeType||e)return a(b,c,f)}:function(b,c,g){var h,i,j,k=[w,f];if(g){while(b=b[d])if((1===b.nodeType||e)&&a(b,c,g))return!0}else while(b=b[d])if(1===b.nodeType||e){if(j=b[u]||(b[u]={}),i=j[b.uniqueID]||(j[b.uniqueID]={}),(h=i[d])&&h[0]===w&&h[1]===f)return k[2]=h[2];if(i[d]=k,k[2]=a(b,c,g))return!0}}}function ra(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function sa(a,b,c){for(var d=0,e=b.length;d<e;d++)ea(a,b[d],c);return c}function ta(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;h<i;h++)(f=a[h])&&(c&&!c(f,d,e)||(g.push(f),j&&b.push(h)));return g}function ua(a,b,c,d,e,f){return d&&!d[u]&&(d=ua(d)),e&&!e[u]&&(e=ua(e,f)),ga(function(f,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=f||sa(b||"*",h.nodeType?[h]:h,[]),q=!a||!f&&b?p:ta(p,m,a,h,i),r=c?e||(f?a:o||d)?[]:g:q;if(c&&c(q,r,h,i),d){j=ta(r,n),d(j,[],h,i),k=j.length;while(k--)(l=j[k])&&(r[n[k]]=!(q[n[k]]=l))}if(f){if(e||a){if(e){j=[],k=r.length;while(k--)(l=r[k])&&j.push(q[k]=l);e(null,r=[],j,i)}k=r.length;while(k--)(l=r[k])&&(j=e?J(f,l):m[k])>-1&&(f[j]=!(g[j]=l))}}else r=ta(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):H.apply(g,r)})}function va(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=qa(function(a){return a===b},h,!0),l=qa(function(a){return J(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];i<f;i++)if(c=d.relative[a[i].type])m=[qa(ra(m),c)];else{if(c=d.filter[a[i].type].apply(null,a[i].matches),c[u]){for(e=++i;e<f;e++)if(d.relative[a[e].type])break;return ua(i>1&&ra(m),i>1&&pa(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(Q,"$1"),c,i<e&&va(a.slice(i,e)),e<f&&va(a=a.slice(e)),e<f&&pa(a))}m.push(c)}return ra(m)}function wa(a,b){var c=b.length>0,e=a.length>0,f=function(f,g,h,i,k){var l,o,q,r=0,s="0",t=f&&[],u=[],v=j,x=f||e&&d.find.TAG("*",k),y=w+=null==v?1:Math.random()||.1,z=x.length;for(k&&(j=g===n||g||k);s!==z&&null!=(l=x[s]);s++){if(e&&l){o=0,g||l.ownerDocument===n||(m(l),h=!p);while(q=a[o++])if(q(l,g||n,h)){i.push(l);break}k&&(w=y)}c&&((l=!q&&l)&&r--,f&&t.push(l))}if(r+=s,c&&s!==r){o=0;while(q=b[o++])q(t,u,g,h);if(f){if(r>0)while(s--)t[s]||u[s]||(u[s]=F.call(i));u=ta(u)}H.apply(i,u),k&&!f&&u.length>0&&r+b.length>1&&ea.uniqueSort(i)}return k&&(w=y,j=v),t};return c?ga(f):f}return h=ea.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=va(b[c]),f[u]?d.push(f):e.push(f);f=A(a,wa(e,d)),f.selector=a}return f},i=ea.select=function(a,b,e,f){var i,j,k,l,m,n="function"==typeof a&&a,o=!f&&g(a=n.selector||a);if(e=e||[],1===o.length){if(j=o[0]=o[0].slice(0),j.length>2&&"ID"===(k=j[0]).type&&c.getById&&9===b.nodeType&&p&&d.relative[j[1].type]){if(!(b=(d.find.ID(k.matches[0].replace(ba,ca),b)||[])[0]))return e;n&&(b=b.parentNode),a=a.slice(j.shift().value.length)}i=W.needsContext.test(a)?0:j.length;while(i--){if(k=j[i],d.relative[l=k.type])break;if((m=d.find[l])&&(f=m(k.matches[0].replace(ba,ca),_.test(j[0].type)&&na(b.parentNode)||b))){if(j.splice(i,1),!(a=f.length&&pa(j)))return H.apply(e,f),e;break}}}return(n||h(a,o))(f,b,!p,e,!b||_.test(a)&&na(b.parentNode)||b),e},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ha(function(a){return 1&a.compareDocumentPosition(n.createElement("div"))}),ha(function(a){return a.innerHTML="<a href='#'></a>","#"===a.firstChild.getAttribute("href")})||ia("type|href|height|width",function(a,b,c){if(!c)return a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ha(function(a){return a.innerHTML="<input/>",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ia("value",function(a,b,c){if(!c&&"input"===a.nodeName.toLowerCase())return a.defaultValue}),ha(function(a){return null==a.getAttribute("disabled")})||ia(K,function(a,b,c){var d;if(!c)return!0===a[b]?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),ea}(a);n.find=t,n.expr=t.selectors,n.expr[":"]=n.expr.pseudos,n.uniqueSort=n.unique=t.uniqueSort,n.text=t.getText,n.isXMLDoc=t.isXML,n.contains=t.contains;var u=function(a,b,c){var d=[],e=void 0!==c;while((a=a[b])&&9!==a.nodeType)if(1===a.nodeType){if(e&&n(a).is(c))break;d.push(a)}return d},v=function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c},w=n.expr.match.needsContext,x=/^<([\w-]+)\s*\/?>(?:<\/\1>|)$/,y=/^.[^:#\[\.,]*$/;function z(a,b,c){if(n.isFunction(b))return n.grep(a,function(a,d){return!!b.call(a,d,a)!==c});if(b.nodeType)return n.grep(a,function(a){return a===b!==c});if("string"==typeof b){if(y.test(b))return n.filter(b,a,c);b=n.filter(b,a)}return n.grep(a,function(a){return n.inArray(a,b)>-1!==c})}n.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?n.find.matchesSelector(d,a)?[d]:[]:n.find.matches(a,n.grep(b,function(a){return 1===a.nodeType}))},n.fn.extend({find:function(a){var b,c=[],d=this,e=d.length;if("string"!=typeof a)return this.pushStack(n(a).filter(function(){for(b=0;b<e;b++)if(n.contains(d[b],this))return!0}));for(b=0;b<e;b++)n.find(a,d[b],c);return c=this.pushStack(e>1?n.unique(c):c),c.selector=this.selector?this.selector+" "+a:a,c},filter:function(a){return this.pushStack(z(this,a||[],!1))},not:function(a){return this.pushStack(z(this,a||[],!0))},is:function(a){return!!z(this,"string"==typeof a&&w.test(a)?n(a):a||[],!1).length}});var A,B=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/;(n.fn.init=function(a,b,c){var e,f;if(!a)return this;if(c=c||A,"string"==typeof a){if(!(e="<"===a.charAt(0)&&">"===a.charAt(a.length-1)&&a.length>=3?[null,a,null]:B.exec(a))||!e[1]&&b)return!b||b.jquery?(b||c).find(a):this.constructor(b).find(a);if(e[1]){if(b=b instanceof n?b[0]:b,n.merge(this,n.parseHTML(e[1],b&&b.nodeType?b.ownerDocument||b:d,!0)),x.test(e[1])&&n.isPlainObject(b))for(e in b)n.isFunction(this[e])?this[e](b[e]):this.attr(e,b[e]);return this}if((f=d.getElementById(e[2]))&&f.parentNode){if(f.id!==e[2])return A.find(a);this.length=1,this[0]=f}return this.context=d,this.selector=a,this}return a.nodeType?(this.context=this[0]=a,this.length=1,this):n.isFunction(a)?void 0!==c.ready?c.ready(a):a(n):(void 0!==a.selector&&(this.selector=a.selector,this.context=a.context),n.makeArray(a,this))}).prototype=n.fn,A=n(d);var C=/^(?:parents|prev(?:Until|All))/,D={children:!0,contents:!0,next:!0,prev:!0};n.fn.extend({has:function(a){var b,c=n(a,this),d=c.length;return this.filter(function(){for(b=0;b<d;b++)if(n.contains(this,c[b]))return!0})},closest:function(a,b){for(var c,d=0,e=this.length,f=[],g=w.test(a)||"string"!=typeof a?n(a,b||this.context):0;d<e;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&n.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?n.uniqueSort(f):f)},index:function(a){return a?"string"==typeof a?n.inArray(this[0],n(a)):n.inArray(a.jquery?a[0]:a,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(n.uniqueSort(n.merge(this.get(),n(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function E(a,b){do{a=a[b]}while(a&&1!==a.nodeType);return a}n.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return u(a,"parentNode")},parentsUntil:function(a,b,c){return u(a,"parentNode",c)},next:function(a){return E(a,"nextSibling")},prev:function(a){return E(a,"previousSibling")},nextAll:function(a){return u(a,"nextSibling")},prevAll:function(a){return u(a,"previousSibling")},nextUntil:function(a,b,c){return u(a,"nextSibling",c)},prevUntil:function(a,b,c){return u(a,"previousSibling",c)},siblings:function(a){return v((a.parentNode||{}).firstChild,a)},children:function(a){return v(a.firstChild)},contents:function(a){return n.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:n.merge([],a.childNodes)}},function(a,b){n.fn[a]=function(c,d){var e=n.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=n.filter(d,e)),this.length>1&&(D[a]||(e=n.uniqueSort(e)),C.test(a)&&(e=e.reverse())),this.pushStack(e)}});var F=/\S+/g;function G(a){var b={};return n.each(a.match(F)||[],function(a,c){b[c]=!0}),b}n.Callbacks=function(a){a="string"==typeof a?G(a):n.extend({},a);var b,c,d,e,f=[],g=[],h=-1,i=function(){for(e=a.once,d=b=!0;g.length;h=-1){c=g.shift();while(++h<f.length)!1===f[h].apply(c[0],c[1])&&a.stopOnFalse&&(h=f.length,c=!1)}a.memory||(c=!1),b=!1,e&&(f=c?[]:"")},j={add:function(){return f&&(c&&!b&&(h=f.length-1,g.push(c)),function b(c){n.each(c,function(c,d){n.isFunction(d)?a.unique&&j.has(d)||f.push(d):d&&d.length&&"string"!==n.type(d)&&b(d)})}(arguments),c&&!b&&i()),this},remove:function(){return n.each(arguments,function(a,b){var c;while((c=n.inArray(b,f,c))>-1)f.splice(c,1),c<=h&&h--}),this},has:function(a){return a?n.inArray(a,f)>-1:f.length>0},empty:function(){return f&&(f=[]),this},disable:function(){return e=g=[],f=c="",this},disabled:function(){return!f},lock:function(){return e=!0,c||j.disable(),this},locked:function(){return!!e},fireWith:function(a,c){return e||(c=c||[],c=[a,c.slice?c.slice():c],g.push(c),b||i()),this},fire:function(){return j.fireWith(this,arguments),this},fired:function(){return!!d}};return j},n.extend({Deferred:function(a){var b=[["resolve","done",n.Callbacks("once memory"),"resolved"],["reject","fail",n.Callbacks("once memory"),"rejected"],["notify","progress",n.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return n.Deferred(function(c){n.each(b,function(b,f){var g=n.isFunction(a[b])&&a[b];e[f[1]](function(){var a=g&&g.apply(this,arguments);a&&n.isFunction(a.promise)?a.promise().progress(c.notify).done(c.resolve).fail(c.reject):c[f[0]+"With"](this===d?c.promise():this,g?[a]:arguments)})}),a=null}).promise()},promise:function(a){return null!=a?n.extend(a,d):d}},e={};return d.pipe=d.then,n.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[1^a][2].disable,b[2][2].lock),e[f[0]]=function(){return e[f[0]+"With"](this===e?d:this,arguments),this},e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=e.call(arguments),d=c.length,f=1!==d||a&&n.isFunction(a.promise)?d:0,g=1===f?a:n.Deferred(),h=function(a,b,c){return function(d){b[a]=this,c[a]=arguments.length>1?e.call(arguments):d,c===i?g.notifyWith(b,c):--f||g.resolveWith(b,c)}},i,j,k;if(d>1)for(i=new Array(d),j=new Array(d),k=new Array(d);b<d;b++)c[b]&&n.isFunction(c[b].promise)?c[b].promise().progress(h(b,j,i)).done(h(b,k,c)).fail(g.reject):--f;return f||g.resolveWith(k,c),g.promise()}});var H;n.fn.ready=function(a){return n.ready.promise().done(a),this},n.extend({isReady:!1,readyWait:1,holdReady:function(a){a?n.readyWait++:n.ready(!0)},ready:function(a){(!0===a?--n.readyWait:n.isReady)||(n.isReady=!0,!0!==a&&--n.readyWait>0||(H.resolveWith(d,[n]),n.fn.triggerHandler&&(n(d).triggerHandler("ready"),n(d).off("ready"))))}});function I(){d.addEventListener?(d.removeEventListener("DOMContentLoaded",J),a.removeEventListener("load",J)):(d.detachEvent("onreadystatechange",J),a.detachEvent("onload",J))}function J(){(d.addEventListener||"load"===a.event.type||"complete"===d.readyState)&&(I(),n.ready())}n.ready.promise=function(b){if(!H)if(H=n.Deferred(),"complete"===d.readyState||"loading"!==d.readyState&&!d.documentElement.doScroll)a.setTimeout(n.ready);else if(d.addEventListener)d.addEventListener("DOMContentLoaded",J),a.addEventListener("load",J);else{d.attachEvent("onreadystatechange",J),a.attachEvent("onload",J);var c=!1;try{c=null==a.frameElement&&d.documentElement}catch(e){}c&&c.doScroll&&function b(){if(!n.isReady){try{c.doScroll("left")}catch(e){return a.setTimeout(b,50)}I(),n.ready()}}()}return H.promise(b)},n.ready.promise();var K;for(K in n(l))break;l.ownFirst="0"===K,l.inlineBlockNeedsLayout=!1,n(function(){var a,b,c,e;(c=d.getElementsByTagName("body")[0])&&c.style&&(b=d.createElement("div"),e=d.createElement("div"),e.style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",c.appendChild(e).appendChild(b),void 0!==b.style.zoom&&(b.style.cssText="display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1",l.inlineBlockNeedsLayout=a=3===b.offsetWidth,a&&(c.style.zoom=1)),c.removeChild(e))}),function(){var a=d.createElement("div");l.deleteExpando=!0;try{delete a.test}catch(b){l.deleteExpando=!1}a=null}();var L=function(a){var b=n.noData[(a.nodeName+" ").toLowerCase()],c=+a.nodeType||1;return(1===c||9===c)&&(!b||!0!==b&&a.getAttribute("classid")===b)},M=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,N=/([A-Z])/g;function O(a,b,c){if(void 0===c&&1===a.nodeType){var d="data-"+b.replace(N,"-$1").toLowerCase();if("string"==typeof(c=a.getAttribute(d))){try{c="true"===c||"false"!==c&&("null"===c?null:+c+""===c?+c:M.test(c)?n.parseJSON(c):c)}catch(e){}n.data(a,b,c)}else c=void 0}return c}function P(a){var b
-;for(b in a)if(("data"!==b||!n.isEmptyObject(a[b]))&&"toJSON"!==b)return!1;return!0}function Q(a,b,d,e){if(L(a)){var f,g,h=n.expando,i=a.nodeType,j=i?n.cache:a,k=i?a[h]:a[h]&&h;if(k&&j[k]&&(e||j[k].data)||void 0!==d||"string"!=typeof b)return k||(k=i?a[h]=c.pop()||n.guid++:h),j[k]||(j[k]=i?{}:{toJSON:n.noop}),"object"!=typeof b&&"function"!=typeof b||(e?j[k]=n.extend(j[k],b):j[k].data=n.extend(j[k].data,b)),g=j[k],e||(g.data||(g.data={}),g=g.data),void 0!==d&&(g[n.camelCase(b)]=d),"string"==typeof b?null==(f=g[b])&&(f=g[n.camelCase(b)]):f=g,f}}function R(a,b,c){if(L(a)){var d,e,f=a.nodeType,g=f?n.cache:a,h=f?a[n.expando]:n.expando;if(g[h]){if(b&&(d=c?g[h]:g[h].data)){n.isArray(b)?b=b.concat(n.map(b,n.camelCase)):b in d?b=[b]:(b=n.camelCase(b),b=b in d?[b]:b.split(" ")),e=b.length;while(e--)delete d[b[e]];if(c?!P(d):!n.isEmptyObject(d))return}(c||(delete g[h].data,P(g[h])))&&(f?n.cleanData([a],!0):l.deleteExpando||g!=g.window?delete g[h]:g[h]=void 0)}}}n.extend({cache:{},noData:{"applet ":!0,"embed ":!0,"object ":"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"},hasData:function(a){return!!(a=a.nodeType?n.cache[a[n.expando]]:a[n.expando])&&!P(a)},data:function(a,b,c){return Q(a,b,c)},removeData:function(a,b){return R(a,b)},_data:function(a,b,c){return Q(a,b,c,!0)},_removeData:function(a,b){return R(a,b,!0)}}),n.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=n.data(f),1===f.nodeType&&!n._data(f,"parsedAttrs"))){c=g.length;while(c--)g[c]&&(d=g[c].name,0===d.indexOf("data-")&&(d=n.camelCase(d.slice(5)),O(f,d,e[d])));n._data(f,"parsedAttrs",!0)}return e}return"object"==typeof a?this.each(function(){n.data(this,a)}):arguments.length>1?this.each(function(){n.data(this,a,b)}):f?O(f,a,n.data(f,a)):void 0},removeData:function(a){return this.each(function(){n.removeData(this,a)})}}),n.extend({queue:function(a,b,c){var d;if(a)return b=(b||"fx")+"queue",d=n._data(a,b),c&&(!d||n.isArray(c)?d=n._data(a,b,n.makeArray(c)):d.push(c)),d||[]},dequeue:function(a,b){b=b||"fx";var c=n.queue(a,b),d=c.length,e=c.shift(),f=n._queueHooks(a,b),g=function(){n.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return n._data(a,c)||n._data(a,c,{empty:n.Callbacks("once memory").add(function(){n._removeData(a,b+"queue"),n._removeData(a,c)})})}}),n.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length<c?n.queue(this[0],a):void 0===b?this:this.each(function(){var c=n.queue(this,a,b);n._queueHooks(this,a),"fx"===a&&"inprogress"!==c[0]&&n.dequeue(this,a)})},dequeue:function(a){return this.each(function(){n.dequeue(this,a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,b){var c,d=1,e=n.Deferred(),f=this,g=this.length,h=function(){--d||e.resolveWith(f,[f])};"string"!=typeof a&&(b=a,a=void 0),a=a||"fx";while(g--)(c=n._data(f[g],a+"queueHooks"))&&c.empty&&(d++,c.empty.add(h));return h(),e.promise(b)}}),function(){var a;l.shrinkWrapBlocks=function(){if(null!=a)return a;a=!1;var b,c,e;return(c=d.getElementsByTagName("body")[0])&&c.style?(b=d.createElement("div"),e=d.createElement("div"),e.style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",c.appendChild(e).appendChild(b),void 0!==b.style.zoom&&(b.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:1px;width:1px;zoom:1",b.appendChild(d.createElement("div")).style.width="5px",a=3!==b.offsetWidth),c.removeChild(e),a):void 0}}();var S=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,T=new RegExp("^(?:([+-])=|)("+S+")([a-z%]*)$","i"),U=["Top","Right","Bottom","Left"],V=function(a,b){return a=b||a,"none"===n.css(a,"display")||!n.contains(a.ownerDocument,a)};function W(a,b,c,d){var e,f=1,g=20,h=d?function(){return d.cur()}:function(){return n.css(a,b,"")},i=h(),j=c&&c[3]||(n.cssNumber[b]?"":"px"),k=(n.cssNumber[b]||"px"!==j&&+i)&&T.exec(n.css(a,b));if(k&&k[3]!==j){j=j||k[3],c=c||[],k=+i||1;do{f=f||".5",k/=f,n.style(a,b,k+j)}while(f!==(f=h()/i)&&1!==f&&--g)}return c&&(k=+k||+i||0,e=c[1]?k+(c[1]+1)*c[2]:+c[2],d&&(d.unit=j,d.start=k,d.end=e)),e}var X=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===n.type(c)){e=!0;for(h in c)X(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,n.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(n(a),c)})),b))for(;h<i;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f},Y=/^(?:checkbox|radio)$/i,Z=/<([\w:-]+)/,$=/^$|\/(?:java|ecma)script/i,_=/^\s+/,aa="abbr|article|aside|audio|bdi|canvas|data|datalist|details|dialog|figcaption|figure|footer|header|hgroup|main|mark|meter|nav|output|picture|progress|section|summary|template|time|video";function ba(a){var b=aa.split("|"),c=a.createDocumentFragment();if(c.createElement)while(b.length)c.createElement(b.pop());return c}!function(){var a=d.createElement("div"),b=d.createDocumentFragment(),c=d.createElement("input");a.innerHTML="  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",l.leadingWhitespace=3===a.firstChild.nodeType,l.tbody=!a.getElementsByTagName("tbody").length,l.htmlSerialize=!!a.getElementsByTagName("link").length,l.html5Clone="<:nav></:nav>"!==d.createElement("nav").cloneNode(!0).outerHTML,c.type="checkbox",c.checked=!0,b.appendChild(c),l.appendChecked=c.checked,a.innerHTML="<textarea>x</textarea>",l.noCloneChecked=!!a.cloneNode(!0).lastChild.defaultValue,b.appendChild(a),c=d.createElement("input"),c.setAttribute("type","radio"),c.setAttribute("checked","checked"),c.setAttribute("name","t"),a.appendChild(c),l.checkClone=a.cloneNode(!0).cloneNode(!0).lastChild.checked,l.noCloneEvent=!!a.addEventListener,a[n.expando]=1,l.attributes=!a.getAttribute(n.expando)}();var ca={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],area:[1,"<map>","</map>"],param:[1,"<object>","</object>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:l.htmlSerialize?[0,"",""]:[1,"X<div>","</div>"]};ca.optgroup=ca.option,ca.tbody=ca.tfoot=ca.colgroup=ca.caption=ca.thead,ca.th=ca.td;function da(a,b){var c,d,e=0,f=void 0!==a.getElementsByTagName?a.getElementsByTagName(b||"*"):void 0!==a.querySelectorAll?a.querySelectorAll(b||"*"):void 0;if(!f)for(f=[],c=a.childNodes||a;null!=(d=c[e]);e++)!b||n.nodeName(d,b)?f.push(d):n.merge(f,da(d,b));return void 0===b||b&&n.nodeName(a,b)?n.merge([a],f):f}function ea(a,b){for(var c,d=0;null!=(c=a[d]);d++)n._data(c,"globalEval",!b||n._data(b[d],"globalEval"))}var fa=/<|&#?\w+;/,ga=/<tbody/i;function ha(a){Y.test(a.type)&&(a.defaultChecked=a.checked)}function ia(a,b,c,d,e){for(var f,g,h,i,j,k,m,o=a.length,p=ba(b),q=[],r=0;r<o;r++)if((g=a[r])||0===g)if("object"===n.type(g))n.merge(q,g.nodeType?[g]:g);else if(fa.test(g)){i=i||p.appendChild(b.createElement("div")),j=(Z.exec(g)||["",""])[1].toLowerCase(),m=ca[j]||ca._default,i.innerHTML=m[1]+n.htmlPrefilter(g)+m[2],f=m[0];while(f--)i=i.lastChild;if(!l.leadingWhitespace&&_.test(g)&&q.push(b.createTextNode(_.exec(g)[0])),!l.tbody){g="table"!==j||ga.test(g)?"<table>"!==m[1]||ga.test(g)?0:i:i.firstChild,f=g&&g.childNodes.length;while(f--)n.nodeName(k=g.childNodes[f],"tbody")&&!k.childNodes.length&&g.removeChild(k)}n.merge(q,i.childNodes),i.textContent="";while(i.firstChild)i.removeChild(i.firstChild);i=p.lastChild}else q.push(b.createTextNode(g));i&&p.removeChild(i),l.appendChecked||n.grep(da(q,"input"),ha),r=0;while(g=q[r++])if(d&&n.inArray(g,d)>-1)e&&e.push(g);else if(h=n.contains(g.ownerDocument,g),i=da(p.appendChild(g),"script"),h&&ea(i),c){f=0;while(g=i[f++])$.test(g.type||"")&&c.push(g)}return i=null,p}!function(){var b,c,e=d.createElement("div");for(b in{submit:!0,change:!0,focusin:!0})c="on"+b,(l[b]=c in a)||(e.setAttribute(c,"t"),l[b]=!1===e.attributes[c].expando);e=null}();var ja=/^(?:input|select|textarea)$/i,ka=/^key/,la=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,ma=/^(?:focusinfocus|focusoutblur)$/,na=/^([^.]*)(?:\.(.+)|)/;function oa(){return!0}function pa(){return!1}function qa(){try{return d.activeElement}catch(a){}}function ra(a,b,c,d,e,f){var g,h;if("object"==typeof b){"string"!=typeof c&&(d=d||c,c=void 0);for(h in b)ra(a,h,c,d,b[h],f);return a}if(null==d&&null==e?(e=c,d=c=void 0):null==e&&("string"==typeof c?(e=d,d=void 0):(e=d,d=c,c=void 0)),!1===e)e=pa;else if(!e)return a;return 1===f&&(g=e,e=function(a){return n().off(a),g.apply(this,arguments)},e.guid=g.guid||(g.guid=n.guid++)),a.each(function(){n.event.add(this,b,e,d,c)})}n.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,o,p,q,r=n._data(a);if(r){c.handler&&(i=c,c=i.handler,e=i.selector),c.guid||(c.guid=n.guid++),(g=r.events)||(g=r.events={}),(k=r.handle)||(k=r.handle=function(a){return void 0===n||a&&n.event.triggered===a.type?void 0:n.event.dispatch.apply(k.elem,arguments)},k.elem=a),b=(b||"").match(F)||[""],h=b.length;while(h--)f=na.exec(b[h])||[],o=q=f[1],p=(f[2]||"").split(".").sort(),o&&(j=n.event.special[o]||{},o=(e?j.delegateType:j.bindType)||o,j=n.event.special[o]||{},l=n.extend({type:o,origType:q,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&n.expr.match.needsContext.test(e),namespace:p.join(".")},i),(m=g[o])||(m=g[o]=[],m.delegateCount=0,j.setup&&!1!==j.setup.call(a,d,p,k)||(a.addEventListener?a.addEventListener(o,k,!1):a.attachEvent&&a.attachEvent("on"+o,k))),j.add&&(j.add.call(a,l),l.handler.guid||(l.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,l):m.push(l),n.event.global[o]=!0);a=null}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,o,p,q,r=n.hasData(a)&&n._data(a);if(r&&(k=r.events)){b=(b||"").match(F)||[""],j=b.length;while(j--)if(h=na.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o){l=n.event.special[o]||{},o=(d?l.delegateType:l.bindType)||o,m=k[o]||[],h=h[2]&&new RegExp("(^|\\.)"+p.join("\\.(?:.*\\.|)")+"(\\.|$)"),i=f=m.length;while(f--)g=m[f],!e&&q!==g.origType||c&&c.guid!==g.guid||h&&!h.test(g.namespace)||d&&d!==g.selector&&("**"!==d||!g.selector)||(m.splice(f,1),g.selector&&m.delegateCount--,l.remove&&l.remove.call(a,g));i&&!m.length&&(l.teardown&&!1!==l.teardown.call(a,p,r.handle)||n.removeEvent(a,o,r.handle),delete k[o])}else for(o in k)n.event.remove(a,o+b[j],c,d,!0);n.isEmptyObject(k)&&(delete r.handle,n._removeData(a,"events"))}},trigger:function(b,c,e,f){var g,h,i,j,l,m,o,p=[e||d],q=k.call(b,"type")?b.type:b,r=k.call(b,"namespace")?b.namespace.split("."):[];if(i=m=e=e||d,3!==e.nodeType&&8!==e.nodeType&&!ma.test(q+n.event.triggered)&&(q.indexOf(".")>-1&&(r=q.split("."),q=r.shift(),r.sort()),h=q.indexOf(":")<0&&"on"+q,b=b[n.expando]?b:new n.Event(q,"object"==typeof b&&b),b.isTrigger=f?2:3,b.namespace=r.join("."),b.rnamespace=b.namespace?new RegExp("(^|\\.)"+r.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=e),c=null==c?[b]:n.makeArray(c,[b]),l=n.event.special[q]||{},f||!l.trigger||!1!==l.trigger.apply(e,c))){if(!f&&!l.noBubble&&!n.isWindow(e)){for(j=l.delegateType||q,ma.test(j+q)||(i=i.parentNode);i;i=i.parentNode)p.push(i),m=i;m===(e.ownerDocument||d)&&p.push(m.defaultView||m.parentWindow||a)}o=0;while((i=p[o++])&&!b.isPropagationStopped())b.type=o>1?j:l.bindType||q,g=(n._data(i,"events")||{})[b.type]&&n._data(i,"handle"),g&&g.apply(i,c),(g=h&&i[h])&&g.apply&&L(i)&&(b.result=g.apply(i,c),!1===b.result&&b.preventDefault());if(b.type=q,!f&&!b.isDefaultPrevented()&&(!l._default||!1===l._default.apply(p.pop(),c))&&L(e)&&h&&e[q]&&!n.isWindow(e)){m=e[h],m&&(e[h]=null),n.event.triggered=q;try{e[q]()}catch(s){}n.event.triggered=void 0,m&&(e[h]=m)}return b.result}},dispatch:function(a){a=n.event.fix(a);var b,c,d,f,g,h=[],i=e.call(arguments),j=(n._data(this,"events")||{})[a.type]||[],k=n.event.special[a.type]||{};if(i[0]=a,a.delegateTarget=this,!k.preDispatch||!1!==k.preDispatch.call(this,a)){h=n.event.handlers.call(this,a,j),b=0;while((f=h[b++])&&!a.isPropagationStopped()){a.currentTarget=f.elem,c=0;while((g=f.handlers[c++])&&!a.isImmediatePropagationStopped())a.rnamespace&&!a.rnamespace.test(g.namespace)||(a.handleObj=g,a.data=g.data,void 0!==(d=((n.event.special[g.origType]||{}).handle||g.handler).apply(f.elem,i))&&!1===(a.result=d)&&(a.preventDefault(),a.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&("click"!==a.type||isNaN(a.button)||a.button<1))for(;i!=this;i=i.parentNode||this)if(1===i.nodeType&&(!0!==i.disabled||"click"!==a.type)){for(d=[],c=0;c<h;c++)f=b[c],e=f.selector+" ",void 0===d[e]&&(d[e]=f.needsContext?n(e,this).index(i)>-1:n.find(e,this,null,[i]).length),d[e]&&d.push(f);d.length&&g.push({elem:i,handlers:d})}return h<b.length&&g.push({elem:this,handlers:b.slice(h)}),g},fix:function(a){if(a[n.expando])return a;var b,c,e,f=a.type,g=a,h=this.fixHooks[f];h||(this.fixHooks[f]=h=la.test(f)?this.mouseHooks:ka.test(f)?this.keyHooks:{}),e=h.props?this.props.concat(h.props):this.props,a=new n.Event(g),b=e.length;while(b--)c=e[b],a[c]=g[c];return a.target||(a.target=g.srcElement||d),3===a.target.nodeType&&(a.target=a.target.parentNode),a.metaKey=!!a.metaKey,h.filter?h.filter(a,g):a},props:"altKey bubbles cancelable ctrlKey currentTarget detail eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){return null==a.which&&(a.which=null!=b.charCode?b.charCode:b.keyCode),a}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,b){var c,e,f,g=b.button,h=b.fromElement;return null==a.pageX&&null!=b.clientX&&(e=a.target.ownerDocument||d,f=e.documentElement,c=e.body,a.pageX=b.clientX+(f&&f.scrollLeft||c&&c.scrollLeft||0)-(f&&f.clientLeft||c&&c.clientLeft||0),a.pageY=b.clientY+(f&&f.scrollTop||c&&c.scrollTop||0)-(f&&f.clientTop||c&&c.clientTop||0)),!a.relatedTarget&&h&&(a.relatedTarget=h===a.target?b.toElement:h),a.which||void 0===g||(a.which=1&g?1:2&g?3:4&g?2:0),a}},special:{load:{noBubble:!0},focus:{trigger:function(){if(this!==qa()&&this.focus)try{return this.focus(),!1}catch(a){}},delegateType:"focusin"},blur:{trigger:function(){if(this===qa()&&this.blur)return this.blur(),!1},delegateType:"focusout"},click:{trigger:function(){if(n.nodeName(this,"input")&&"checkbox"===this.type&&this.click)return this.click(),!1},_default:function(a){return n.nodeName(a.target,"a")}},beforeunload:{postDispatch:function(a){void 0!==a.result&&a.originalEvent&&(a.originalEvent.returnValue=a.result)}}},simulate:function(a,b,c){var d=n.extend(new n.Event,c,{type:a,isSimulated:!0});n.event.trigger(d,null,b),d.isDefaultPrevented()&&c.preventDefault()}},n.removeEvent=d.removeEventListener?function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c)}:function(a,b,c){var d="on"+b;a.detachEvent&&(void 0===a[d]&&(a[d]=null),a.detachEvent(d,c))},n.Event=function(a,b){if(!(this instanceof n.Event))return new n.Event(a,b);a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||void 0===a.defaultPrevented&&!1===a.returnValue?oa:pa):this.type=a,b&&n.extend(this,b),this.timeStamp=a&&a.timeStamp||n.now(),this[n.expando]=!0},n.Event.prototype={constructor:n.Event,isDefaultPrevented:pa,isPropagationStopped:pa,isImmediatePropagationStopped:pa,preventDefault:function(){var a=this.originalEvent;this.isDefaultPrevented=oa,a&&(a.preventDefault?a.preventDefault():a.returnValue=!1)},stopPropagation:function(){var a=this.originalEvent;this.isPropagationStopped=oa,a&&!this.isSimulated&&(a.stopPropagation&&a.stopPropagation(),a.cancelBubble=!0)},stopImmediatePropagation:function(){var a=this.originalEvent;this.isImmediatePropagationStopped=oa,a&&a.stopImmediatePropagation&&a.stopImmediatePropagation(),this.stopPropagation()}},n.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(a,b){n.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c,d=this,e=a.relatedTarget,f=a.handleObj;return e&&(e===d||n.contains(d,e))||(a.type=f.origType,c=f.handler.apply(this,arguments),a.type=b),c}}}),l.submit||(n.event.special.submit={setup:function(){if(n.nodeName(this,"form"))return!1;n.event.add(this,"click._submit keypress._submit",function(a){var b=a.target,c=n.nodeName(b,"input")||n.nodeName(b,"button")?n.prop(b,"form"):void 0;c&&!n._data(c,"submit")&&(n.event.add(c,"submit._submit",function(a){a._submitBubble=!0}),n._data(c,"submit",!0))})},postDispatch:function(a){a._submitBubble&&(delete a._submitBubble,this.parentNode&&!a.isTrigger&&n.event.simulate("submit",this.parentNode,a))},teardown:function(){if(n.nodeName(this,"form"))return!1;n.event.remove(this,"._submit")}}),l.change||(n.event.special.change={setup:function(){if(ja.test(this.nodeName))return"checkbox"!==this.type&&"radio"!==this.type||(n.event.add(this,"propertychange._change",function(a){"checked"===a.originalEvent.propertyName&&(this._justChanged=!0)}),n.event.add(this,"click._change",function(a){this._justChanged&&!a.isTrigger&&(this._justChanged=!1),n.event.simulate("change",this,a)})),!1;n.event.add(this,"beforeactivate._change",function(a){var b=a.target;ja.test(b.nodeName)&&!n._data(b,"change")&&(n.event.add(b,"change._change",function(a){!this.parentNode||a.isSimulated||a.isTrigger||n.event.simulate("change",this.parentNode,a)}),n._data(b,"change",!0))})},handle:function(a){var b=a.target;if(this!==b||a.isSimulated||a.isTrigger||"radio"!==b.type&&"checkbox"!==b.type)return a.handleObj.handler.apply(this,arguments)},teardown:function(){return n.event.remove(this,"._change"),!ja.test(this.nodeName)}}),l.focusin||n.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){n.event.simulate(b,a.target,n.event.fix(a))};n.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=n._data(d,b);e||d.addEventListener(a,c,!0),n._data(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=n._data(d,b)-1;e?n._data(d,b,e):(d.removeEventListener(a,c,!0),n._removeData(d,b))}}}),n.fn.extend({on:function(a,b,c,d){return ra(this,a,b,c,d)},one:function(a,b,c,d){return ra(this,a,b,c,d,1)},off:function(a,b,c){var d,e;if(a&&a.preventDefault&&a.handleObj)return d=a.handleObj,n(a.delegateTarget).off(d.namespace?d.origType+"."+d.namespace:d.origType,d.selector,d.handler),this;if("object"==typeof a){for(e in a)this.off(e,b,a[e]);return this}return!1!==b&&"function"!=typeof b||(c=b,b=void 0),!1===c&&(c=pa),this.each(function(){n.event.remove(this,a,c,b)})},trigger:function(a,b){return this.each(function(){n.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];if(c)return n.event.trigger(a,b,c,!0)}});var sa=/ jQuery\d+="(?:null|\d+)"/g,ta=new RegExp("<(?:"+aa+")[\\s/>]","i"),ua=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi,va=/<script|<style|<link/i,wa=/checked\s*(?:[^=]|=\s*.checked.)/i,xa=/^true\/(.*)/,ya=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g,za=ba(d),Aa=za.appendChild(d.createElement("div"));function Ba(a,b){return n.nodeName(a,"table")&&n.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function Ca(a){return a.type=(null!==n.find.attr(a,"type"))+"/"+a.type,a}function Da(a){var b=xa.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function Ea(a,b){if(1===b.nodeType&&n.hasData(a)){var c,d,e,f=n._data(a),g=n._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;d<e;d++)n.event.add(b,c,h[c][d])}g.data&&(g.data=n.extend({},g.data))}}function Fa(a,b){var c,d,e;if(1===b.nodeType){if(c=b.nodeName.toLowerCase(),!l.noCloneEvent&&b[n.expando]){e=n._data(b);for(d in e.events)n.removeEvent(b,d,e.handle);b.removeAttribute(n.expando)}"script"===c&&b.text!==a.text?(Ca(b).text=a.text,Da(b)):"object"===c?(b.parentNode&&(b.outerHTML=a.outerHTML),l.html5Clone&&a.innerHTML&&!n.trim(b.innerHTML)&&(b.innerHTML=a.innerHTML)):"input"===c&&Y.test(a.type)?(b.defaultChecked=b.checked=a.checked,b.value!==a.value&&(b.value=a.value)):"option"===c?b.defaultSelected=b.selected=a.defaultSelected:"input"!==c&&"textarea"!==c||(b.defaultValue=a.defaultValue)}}function Ga(a,b,c,d){b=f.apply([],b);var e,g,h,i,j,k,m=0,o=a.length,p=o-1,q=b[0],r=n.isFunction(q);if(r||o>1&&"string"==typeof q&&!l.checkClone&&wa.test(q))return a.each(function(e){var f=a.eq(e);r&&(b[0]=q.call(this,e,f.html())),Ga(f,b,c,d)});if(o&&(k=ia(b,a[0].ownerDocument,!1,a,d),e=k.firstChild,1===k.childNodes.length&&(k=e),e||d)){for(i=n.map(da(k,"script"),Ca),h=i.length;m<o;m++)g=k,m!==p&&(g=n.clone(g,!0,!0),h&&n.merge(i,da(g,"script"))),c.call(a[m],g,m);if(h)for(j=i[i.length-1].ownerDocument,n.map(i,Da),m=0;m<h;m++)g=i[m],$.test(g.type||"")&&!n._data(g,"globalEval")&&n.contains(j,g)&&(g.src?n._evalUrl&&n._evalUrl(g.src):n.globalEval((g.text||g.textContent||g.innerHTML||"").replace(ya,"")));k=e=null}return a}function Ha(a,b,c){for(var d,e=b?n.filter(b,a):a,f=0;null!=(d=e[f]);f++)c||1!==d.nodeType||n.cleanData(da(d)),d.parentNode&&(c&&n.contains(d.ownerDocument,d)&&ea(da(d,"script")),d.parentNode.removeChild(d));return a}n.extend({htmlPrefilter:function(a){return a.replace(ua,"<$1></$2>")},clone:function(a,b,c){var d,e,f,g,h,i=n.contains(a.ownerDocument,a);if(l.html5Clone||n.isXMLDoc(a)||!ta.test("<"+a.nodeName+">")?f=a.cloneNode(!0):(Aa.innerHTML=a.outerHTML,Aa.removeChild(f=Aa.firstChild)),!(l.noCloneEvent&&l.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||n.isXMLDoc(a)))for(d=da(f),h=da(a),g=0;null!=(e=h[g]);++g)d[g]&&Fa(e,d[g]);if(b)if(c)for(h=h||da(a),d=d||da(f),g=0;null!=(e=h[g]);g++)Ea(e,d[g]);else Ea(a,f);return d=da(f,"script"),d.length>0&&ea(d,!i&&da(a,"script")),d=h=e=null,f},cleanData:function(a,b){for(var d,e,f,g,h=0,i=n.expando,j=n.cache,k=l.attributes,m=n.event.special;null!=(d=a[h]);h++)if((b||L(d))&&(f=d[i],g=f&&j[f])){if(g.events)for(e in g.events)m[e]?n.event.remove(d,e):n.removeEvent(d,e,g.handle);j[f]&&(delete j[f],k||void 0===d.removeAttribute?d[i]=void 0:d.removeAttribute(i),c.push(f))}}}),n.fn.extend({domManip:Ga,detach:function(a){return Ha(this,a,!0)},remove:function(a){return Ha(this,a)},text:function(a){return X(this,function(a){return void 0===a?n.text(this):this.empty().append((this[0]&&this[0].ownerDocument||d).createTextNode(a))},null,a,arguments.length)},append:function(){return Ga(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){Ba(this,a).appendChild(a)}})},prepend:function(){return Ga(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=Ba(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return Ga(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return Ga(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},empty:function(){for(var a,b=0;null!=(a=this[b]);b++){1===a.nodeType&&n.cleanData(da(a,!1));while(a.firstChild)a.removeChild(a.firstChild);a.options&&n.nodeName(a,"select")&&(a.options.length=0)}return this},clone:function(a,b){return a=null!=a&&a,b=null==b?a:b,this.map(function(){return n.clone(this,a,b)})},html:function(a){return X(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a)return 1===b.nodeType?b.innerHTML.replace(sa,""):void 0;if("string"==typeof a&&!va.test(a)&&(l.htmlSerialize||!ta.test(a))&&(l.leadingWhitespace||!_.test(a))&&!ca[(Z.exec(a)||["",""])[1].toLowerCase()]){a=n.htmlPrefilter(a);try{for(;c<d;c++)b=this[c]||{},1===b.nodeType&&(n.cleanData(da(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=[];return Ga(this,arguments,function(b){var c=this.parentNode;n.inArray(this,a)<0&&(n.cleanData(da(this)),c&&c.replaceChild(b,this))},a)}}),n.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){n.fn[a]=function(a){for(var c,d=0,e=[],f=n(a),h=f.length-1;d<=h;d++)c=d===h?this:this.clone(!0),n(f[d])[b](c),g.apply(e,c.get());return this.pushStack(e)}});var Ia,Ja={HTML:"block",BODY:"block"};function Ka(a,b){var c=n(b.createElement(a)).appendTo(b.body),d=n.css(c[0],"display");return c.detach(),d}function La(a){var b=d,c=Ja[a];return c||(c=Ka(a,b),"none"!==c&&c||(Ia=(Ia||n("<iframe frameborder='0' width='0' height='0'/>")).appendTo(b.documentElement),b=(Ia[0].contentWindow||Ia[0].contentDocument).document,b.write(),b.close(),c=Ka(a,b),Ia.detach()),Ja[a]=c),c}var Ma=/^margin/,Na=new RegExp("^("+S+")(?!px)[a-z%]+$","i"),Oa=function(a,b,c,d){var e,f,g={};for(f in b)g[f]=a.style[f],a.style[f]=b[f];e=c.apply(a,d||[]);for(f in b)a.style[f]=g[f];return e},Pa=d.documentElement;!function(){var b,c,e,f,g,h,i=d.createElement("div"),j=d.createElement("div");function k(){var k,l,m=d.documentElement;m.appendChild(i),j.style.cssText="-webkit-box-sizing:border-box;box-sizing:border-box;position:relative;display:block;margin:auto;border:1px;padding:1px;top:1%;width:50%",b=e=h=!1,c=g=!0,a.getComputedStyle&&(l=a.getComputedStyle(j),b="1%"!==(l||{}).top,h="2px"===(l||{}).marginLeft,e="4px"===(l||{width:"4px"}).width,j.style.marginRight="50%",c="4px"===(l||{marginRight:"4px"}).marginRight,k=j.appendChild(d.createElement("div")),k.style.cssText=j.style.cssText="-webkit-box-sizing:content-box;-moz-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:0",k.style.marginRight=k.style.width="0",j.style.width="1px",g=!parseFloat((a.getComputedStyle(k)||{}).marginRight),j.removeChild(k)),j.style.display="none",f=0===j.getClientRects().length,f&&(j.style.display="",j.innerHTML="<table><tr><td></td><td>t</td></tr></table>",j.childNodes[0].style.borderCollapse="separate",k=j.getElementsByTagName("td"),k[0].style.cssText="margin:0;border:0;padding:0;display:none",(f=0===k[0].offsetHeight)&&(k[0].style.display="",k[1].style.display="none",f=0===k[0].offsetHeight)),m.removeChild(i)}j.style&&(j.style.cssText="float:left;opacity:.5",l.opacity="0.5"===j.style.opacity,l.cssFloat=!!j.style.cssFloat,j.style.backgroundClip="content-box",j.cloneNode(!0).style.backgroundClip="",l.clearCloneStyle="content-box"===j.style.backgroundClip,i=d.createElement("div"),i.style.cssText="border:0;width:8px;height:0;top:0;left:-9999px;padding:0;margin-top:1px;position:absolute",j.innerHTML="",i.appendChild(j),l.boxSizing=""===j.style.boxSizing||""===j.style.MozBoxSizing||""===j.style.WebkitBoxSizing,n.extend(l,{reliableHiddenOffsets:function(){return null==b&&k(),f},boxSizingReliable:function(){return null==b&&k(),e},pixelMarginRight:function(){return null==b&&k(),c},pixelPosition:function(){return null==b&&k(),b},reliableMarginRight:function(){return null==b&&k(),g},reliableMarginLeft:function(){return null==b&&k(),h}}))}();var Qa,Ra,Sa=/^(top|right|bottom|left)$/;a.getComputedStyle?(Qa=function(b){var c=b.ownerDocument.defaultView;return c&&c.opener||(c=a),c.getComputedStyle(b)},Ra=function(a,b,c){var d,e,f,g,h=a.style;return c=c||Qa(a),g=c?c.getPropertyValue(b)||c[b]:void 0,""!==g&&void 0!==g||n.contains(a.ownerDocument,a)||(g=n.style(a,b)),c&&!l.pixelMarginRight()&&Na.test(g)&&Ma.test(b)&&(d=h.width,e=h.minWidth,f=h.maxWidth,h.minWidth=h.maxWidth=h.width=g,g=c.width,h.width=d,h.minWidth=e,h.maxWidth=f),void 0===g?g:g+""}):Pa.currentStyle&&(Qa=function(a){return a.currentStyle},Ra=function(a,b,c){var d,e,f,g,h=a.style;return c=c||Qa(a),g=c?c[b]:void 0,null==g&&h&&h[b]&&(g=h[b]),Na.test(g)&&!Sa.test(b)&&(d=h.left,e=a.runtimeStyle,f=e&&e.left,f&&(e.left=a.currentStyle.left),h.left="fontSize"===b?"1em":g,g=h.pixelLeft+"px",h.left=d,f&&(e.left=f)),void 0===g?g:g+""||"auto"});function Ta(a,b){return{get:function(){return a()?void delete this.get:(this.get=b).apply(this,arguments)}}}var Ua=/alpha\([^)]*\)/i,Va=/opacity\s*=\s*([^)]*)/i,Wa=/^(none|table(?!-c[ea]).+)/,Xa=new RegExp("^("+S+")(.*)$","i"),Ya={position:"absolute",visibility:"hidden",display:"block"},Za={letterSpacing:"0",fontWeight:"400"},$a=["Webkit","O","Moz","ms"],_a=d.createElement("div").style;function ab(a){if(a in _a)return a;var b=a.charAt(0).toUpperCase()+a.slice(1),c=$a.length;while(c--)if((a=$a[c]+b)in _a)return a}function bb(a,b){for(var c,d,e,f=[],g=0,h=a.length;g<h;g++)d=a[g],d.style&&(f[g]=n._data(d,"olddisplay"),c=d.style.display,b?(f[g]||"none"!==c||(d.style.display=""),""===d.style.display&&V(d)&&(f[g]=n._data(d,"olddisplay",La(d.nodeName)))):(e=V(d),(c&&"none"!==c||!e)&&n._data(d,"olddisplay",e?c:n.css(d,"display"))));for(g=0;g<h;g++)d=a[g],d.style&&(b&&"none"!==d.style.display&&""!==d.style.display||(d.style.display=b?f[g]||"":"none"));return a}function cb(a,b,c){var d=Xa.exec(b);return d?Math.max(0,d[1]-(c||0))+(d[2]||"px"):b}function db(a,b,c,d,e){for(var f=c===(d?"border":"content")?4:"width"===b?1:0,g=0;f<4;f+=2)"margin"===c&&(g+=n.css(a,c+U[f],!0,e)),d?("content"===c&&(g-=n.css(a,"padding"+U[f],!0,e)),"margin"!==c&&(g-=n.css(a,"border"+U[f]+"Width",!0,e))):(g+=n.css(a,"padding"+U[f],!0,e),"padding"!==c&&(g+=n.css(a,"border"+U[f]+"Width",!0,e)));return g}function eb(a,b,c){var d=!0,e="width"===b?a.offsetWidth:a.offsetHeight,f=Qa(a),g=l.boxSizing&&"border-box"===n.css(a,"boxSizing",!1,f);if(e<=0||null==e){if(e=Ra(a,b,f),(e<0||null==e)&&(e=a.style[b]),Na.test(e))return e;d=g&&(l.boxSizingReliable()||e===a.style[b]),e=parseFloat(e)||0}return e+db(a,b,c||(g?"border":"content"),d,f)+"px"}n.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=Ra(a,"opacity");return""===c?"1":c}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{float:l.cssFloat?"cssFloat":"styleFloat"},style:function(a,b,c,d){if(a&&3!==a.nodeType&&8!==a.nodeType&&a.style){var e,f,g,h=n.camelCase(b),i=a.style;if(b=n.cssProps[h]||(n.cssProps[h]=ab(h)||h),g=n.cssHooks[b]||n.cssHooks[h],void 0===c)return g&&"get"in g&&void 0!==(e=g.get(a,!1,d))?e:i[b];if(f=typeof c,"string"===f&&(e=T.exec(c))&&e[1]&&(c=W(a,b,e),f="number"),null!=c&&c===c&&("number"===f&&(c+=e&&e[3]||(n.cssNumber[h]?"":"px")),l.clearCloneStyle||""!==c||0!==b.indexOf("background")||(i[b]="inherit"),!(g&&"set"in g&&void 0===(c=g.set(a,c,d)))))try{i[b]=c}catch(j){}}},css:function(a,b,c,d){var e,f,g,h=n.camelCase(b);return b=n.cssProps[h]||(n.cssProps[h]=ab(h)||h),g=n.cssHooks[b]||n.cssHooks[h],g&&"get"in g&&(f=g.get(a,!0,c)),void 0===f&&(f=Ra(a,b,d)),"normal"===f&&b in Za&&(f=Za[b]),""===c||c?(e=parseFloat(f),!0===c||isFinite(e)?e||0:f):f}}),n.each(["height","width"],function(a,b){n.cssHooks[b]={get:function(a,c,d){if(c)return Wa.test(n.css(a,"display"))&&0===a.offsetWidth?Oa(a,Ya,function(){return eb(a,b,d)}):eb(a,b,d)},set:function(a,c,d){var e=d&&Qa(a);return cb(a,c,d?db(a,b,d,l.boxSizing&&"border-box"===n.css(a,"boxSizing",!1,e),e):0)}}}),l.opacity||(n.cssHooks.opacity={get:function(a,b){return Va.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?.01*parseFloat(RegExp.$1)+"":b?"1":""},set:function(a,b){var c=a.style,d=a.currentStyle,e=n.isNumeric(b)?"alpha(opacity="+100*b+")":"",f=d&&d.filter||c.filter||"";c.zoom=1,(b>=1||""===b)&&""===n.trim(f.replace(Ua,""))&&c.removeAttribute&&(c.removeAttribute("filter"),""===b||d&&!d.filter)||(c.filter=Ua.test(f)?f.replace(Ua,e):f+" "+e)}}),n.cssHooks.marginRight=Ta(l.reliableMarginRight,function(a,b){if(b)return Oa(a,{display:"inline-block"},Ra,[a,"marginRight"])}),n.cssHooks.marginLeft=Ta(l.reliableMarginLeft,function(a,b){if(b)return(parseFloat(Ra(a,"marginLeft"))||(n.contains(a.ownerDocument,a)?a.getBoundingClientRect().left-Oa(a,{marginLeft:0},function(){return a.getBoundingClientRect().left}):0))+"px"}),n.each({
-margin:"",padding:"",border:"Width"},function(a,b){n.cssHooks[a+b]={expand:function(c){for(var d=0,e={},f="string"==typeof c?c.split(" "):[c];d<4;d++)e[a+U[d]+b]=f[d]||f[d-2]||f[0];return e}},Ma.test(a)||(n.cssHooks[a+b].set=cb)}),n.fn.extend({css:function(a,b){return X(this,function(a,b,c){var d,e,f={},g=0;if(n.isArray(b)){for(d=Qa(a),e=b.length;g<e;g++)f[b[g]]=n.css(a,b[g],!1,d);return f}return void 0!==c?n.style(a,b,c):n.css(a,b)},a,b,arguments.length>1)},show:function(){return bb(this,!0)},hide:function(){return bb(this)},toggle:function(a){return"boolean"==typeof a?a?this.show():this.hide():this.each(function(){V(this)?n(this).show():n(this).hide()})}});function fb(a,b,c,d,e){return new fb.prototype.init(a,b,c,d,e)}n.Tween=fb,fb.prototype={constructor:fb,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||n.easing._default,this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(n.cssNumber[c]?"":"px")},cur:function(){var a=fb.propHooks[this.prop];return a&&a.get?a.get(this):fb.propHooks._default.get(this)},run:function(a){var b,c=fb.propHooks[this.prop];return this.options.duration?this.pos=b=n.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):this.pos=b=a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):fb.propHooks._default.set(this),this}},fb.prototype.init.prototype=fb.prototype,fb.propHooks={_default:{get:function(a){var b;return 1!==a.elem.nodeType||null!=a.elem[a.prop]&&null==a.elem.style[a.prop]?a.elem[a.prop]:(b=n.css(a.elem,a.prop,""),b&&"auto"!==b?b:0)},set:function(a){n.fx.step[a.prop]?n.fx.step[a.prop](a):1!==a.elem.nodeType||null==a.elem.style[n.cssProps[a.prop]]&&!n.cssHooks[a.prop]?a.elem[a.prop]=a.now:n.style(a.elem,a.prop,a.now+a.unit)}}},fb.propHooks.scrollTop=fb.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},n.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},_default:"swing"},n.fx=fb.prototype.init,n.fx.step={};var gb,hb,ib=/^(?:toggle|show|hide)$/,jb=/queueHooks$/;function kb(){return a.setTimeout(function(){gb=void 0}),gb=n.now()}function lb(a,b){var c,d={height:a},e=0;for(b=b?1:0;e<4;e+=2-b)c=U[e],d["margin"+c]=d["padding"+c]=a;return b&&(d.opacity=d.width=a),d}function mb(a,b,c){for(var d,e=(pb.tweeners[b]||[]).concat(pb.tweeners["*"]),f=0,g=e.length;f<g;f++)if(d=e[f].call(c,b,a))return d}function nb(a,b,c){var d,e,f,g,h,i,j,k,m=this,o={},p=a.style,q=a.nodeType&&V(a),r=n._data(a,"fxshow");c.queue||(h=n._queueHooks(a,"fx"),null==h.unqueued&&(h.unqueued=0,i=h.empty.fire,h.empty.fire=function(){h.unqueued||i()}),h.unqueued++,m.always(function(){m.always(function(){h.unqueued--,n.queue(a,"fx").length||h.empty.fire()})})),1===a.nodeType&&("height"in b||"width"in b)&&(c.overflow=[p.overflow,p.overflowX,p.overflowY],j=n.css(a,"display"),"inline"===(k="none"===j?n._data(a,"olddisplay")||La(a.nodeName):j)&&"none"===n.css(a,"float")&&(l.inlineBlockNeedsLayout&&"inline"!==La(a.nodeName)?p.zoom=1:p.display="inline-block")),c.overflow&&(p.overflow="hidden",l.shrinkWrapBlocks()||m.always(function(){p.overflow=c.overflow[0],p.overflowX=c.overflow[1],p.overflowY=c.overflow[2]}));for(d in b)if(e=b[d],ib.exec(e)){if(delete b[d],f=f||"toggle"===e,e===(q?"hide":"show")){if("show"!==e||!r||void 0===r[d])continue;q=!0}o[d]=r&&r[d]||n.style(a,d)}else j=void 0;if(n.isEmptyObject(o))"inline"===("none"===j?La(a.nodeName):j)&&(p.display=j);else{r?"hidden"in r&&(q=r.hidden):r=n._data(a,"fxshow",{}),f&&(r.hidden=!q),q?n(a).show():m.done(function(){n(a).hide()}),m.done(function(){var b;n._removeData(a,"fxshow");for(b in o)n.style(a,b,o[b])});for(d in o)g=mb(q?r[d]:0,d,m),d in r||(r[d]=g.start,q&&(g.end=g.start,g.start="width"===d||"height"===d?1:0))}}function ob(a,b){var c,d,e,f,g;for(c in a)if(d=n.camelCase(c),e=b[d],f=a[c],n.isArray(f)&&(e=f[1],f=a[c]=f[0]),c!==d&&(a[d]=f,delete a[c]),(g=n.cssHooks[d])&&"expand"in g){f=g.expand(f),delete a[d];for(c in f)c in a||(a[c]=f[c],b[c]=e)}else b[d]=e}function pb(a,b,c){var d,e,f=0,g=pb.prefilters.length,h=n.Deferred().always(function(){delete i.elem}),i=function(){if(e)return!1;for(var b=gb||kb(),c=Math.max(0,j.startTime+j.duration-b),d=c/j.duration||0,f=1-d,g=0,i=j.tweens.length;g<i;g++)j.tweens[g].run(f);return h.notifyWith(a,[j,f,c]),f<1&&i?c:(h.resolveWith(a,[j]),!1)},j=h.promise({elem:a,props:n.extend({},b),opts:n.extend(!0,{specialEasing:{},easing:n.easing._default},c),originalProperties:b,originalOptions:c,startTime:gb||kb(),duration:c.duration,tweens:[],createTween:function(b,c){var d=n.Tween(a,j.opts,b,c,j.opts.specialEasing[b]||j.opts.easing);return j.tweens.push(d),d},stop:function(b){var c=0,d=b?j.tweens.length:0;if(e)return this;for(e=!0;c<d;c++)j.tweens[c].run(1);return b?(h.notifyWith(a,[j,1,0]),h.resolveWith(a,[j,b])):h.rejectWith(a,[j,b]),this}}),k=j.props;for(ob(k,j.opts.specialEasing);f<g;f++)if(d=pb.prefilters[f].call(j,a,k,j.opts))return n.isFunction(d.stop)&&(n._queueHooks(j.elem,j.opts.queue).stop=n.proxy(d.stop,d)),d;return n.map(k,mb,j),n.isFunction(j.opts.start)&&j.opts.start.call(a,j),n.fx.timer(n.extend(i,{elem:a,anim:j,queue:j.opts.queue})),j.progress(j.opts.progress).done(j.opts.done,j.opts.complete).fail(j.opts.fail).always(j.opts.always)}n.Animation=n.extend(pb,{tweeners:{"*":[function(a,b){var c=this.createTween(a,b);return W(c.elem,a,T.exec(b),c),c}]},tweener:function(a,b){n.isFunction(a)?(b=a,a=["*"]):a=a.match(F);for(var c,d=0,e=a.length;d<e;d++)c=a[d],pb.tweeners[c]=pb.tweeners[c]||[],pb.tweeners[c].unshift(b)},prefilters:[nb],prefilter:function(a,b){b?pb.prefilters.unshift(a):pb.prefilters.push(a)}}),n.speed=function(a,b,c){var d=a&&"object"==typeof a?n.extend({},a):{complete:c||!c&&b||n.isFunction(a)&&a,duration:a,easing:c&&b||b&&!n.isFunction(b)&&b};return d.duration=n.fx.off?0:"number"==typeof d.duration?d.duration:d.duration in n.fx.speeds?n.fx.speeds[d.duration]:n.fx.speeds._default,null!=d.queue&&!0!==d.queue||(d.queue="fx"),d.old=d.complete,d.complete=function(){n.isFunction(d.old)&&d.old.call(this),d.queue&&n.dequeue(this,d.queue)},d},n.fn.extend({fadeTo:function(a,b,c,d){return this.filter(V).css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=n.isEmptyObject(a),f=n.speed(b,c,d),g=function(){var b=pb(this,n.extend({},a),f);(e||n._data(this,"finish"))&&b.stop(!0)};return g.finish=g,e||!1===f.queue?this.each(g):this.queue(f.queue,g)},stop:function(a,b,c){var d=function(a){var b=a.stop;delete a.stop,b(c)};return"string"!=typeof a&&(c=b,b=a,a=void 0),b&&!1!==a&&this.queue(a||"fx",[]),this.each(function(){var b=!0,e=null!=a&&a+"queueHooks",f=n.timers,g=n._data(this);if(e)g[e]&&g[e].stop&&d(g[e]);else for(e in g)g[e]&&g[e].stop&&jb.test(e)&&d(g[e]);for(e=f.length;e--;)f[e].elem!==this||null!=a&&f[e].queue!==a||(f[e].anim.stop(c),b=!1,f.splice(e,1));!b&&c||n.dequeue(this,a)})},finish:function(a){return!1!==a&&(a=a||"fx"),this.each(function(){var b,c=n._data(this),d=c[a+"queue"],e=c[a+"queueHooks"],f=n.timers,g=d?d.length:0;for(c.finish=!0,n.queue(this,a,[]),e&&e.stop&&e.stop.call(this,!0),b=f.length;b--;)f[b].elem===this&&f[b].queue===a&&(f[b].anim.stop(!0),f.splice(b,1));for(b=0;b<g;b++)d[b]&&d[b].finish&&d[b].finish.call(this);delete c.finish})}}),n.each(["toggle","show","hide"],function(a,b){var c=n.fn[b];n.fn[b]=function(a,d,e){return null==a||"boolean"==typeof a?c.apply(this,arguments):this.animate(lb(b,!0),a,d,e)}}),n.each({slideDown:lb("show"),slideUp:lb("hide"),slideToggle:lb("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){n.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),n.timers=[],n.fx.tick=function(){var a,b=n.timers,c=0;for(gb=n.now();c<b.length;c++)(a=b[c])()||b[c]!==a||b.splice(c--,1);b.length||n.fx.stop(),gb=void 0},n.fx.timer=function(a){n.timers.push(a),a()?n.fx.start():n.timers.pop()},n.fx.interval=13,n.fx.start=function(){hb||(hb=a.setInterval(n.fx.tick,n.fx.interval))},n.fx.stop=function(){a.clearInterval(hb),hb=null},n.fx.speeds={slow:600,fast:200,_default:400},n.fn.delay=function(b,c){return b=n.fx?n.fx.speeds[b]||b:b,c=c||"fx",this.queue(c,function(c,d){var e=a.setTimeout(c,b);d.stop=function(){a.clearTimeout(e)}})},function(){var a,b=d.createElement("input"),c=d.createElement("div"),e=d.createElement("select"),f=e.appendChild(d.createElement("option"));c=d.createElement("div"),c.setAttribute("className","t"),c.innerHTML="  <link/><table></table><a href='/a'>a</a><input type='checkbox'/>",a=c.getElementsByTagName("a")[0],b.setAttribute("type","checkbox"),c.appendChild(b),a=c.getElementsByTagName("a")[0],a.style.cssText="top:1px",l.getSetAttribute="t"!==c.className,l.style=/top/.test(a.getAttribute("style")),l.hrefNormalized="/a"===a.getAttribute("href"),l.checkOn=!!b.value,l.optSelected=f.selected,l.enctype=!!d.createElement("form").enctype,e.disabled=!0,l.optDisabled=!f.disabled,b=d.createElement("input"),b.setAttribute("value",""),l.input=""===b.getAttribute("value"),b.value="t",b.setAttribute("type","radio"),l.radioValue="t"===b.value}();var qb=/\r/g,rb=/[\x20\t\r\n\f]+/g;n.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=n.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,n(this).val()):a,null==e?e="":"number"==typeof e?e+="":n.isArray(e)&&(e=n.map(e,function(a){return null==a?"":a+""})),(b=n.valHooks[this.type]||n.valHooks[this.nodeName.toLowerCase()])&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return(b=n.valHooks[e.type]||n.valHooks[e.nodeName.toLowerCase()])&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(qb,""):null==c?"":c)}}}),n.extend({valHooks:{option:{get:function(a){var b=n.find.attr(a,"value");return null!=b?b:n.trim(n.text(a)).replace(rb," ")}},select:{get:function(a){for(var b,c,d=a.options,e=a.selectedIndex,f="select-one"===a.type||e<0,g=f?null:[],h=f?e+1:d.length,i=e<0?h:f?e:0;i<h;i++)if(c=d[i],(c.selected||i===e)&&(l.optDisabled?!c.disabled:null===c.getAttribute("disabled"))&&(!c.parentNode.disabled||!n.nodeName(c.parentNode,"optgroup"))){if(b=n(c).val(),f)return b;g.push(b)}return g},set:function(a,b){var c,d,e=a.options,f=n.makeArray(b),g=e.length;while(g--)if(d=e[g],n.inArray(n.valHooks.option.get(d),f)>-1)try{d.selected=c=!0}catch(h){d.scrollHeight}else d.selected=!1;return c||(a.selectedIndex=-1),e}}}}),n.each(["radio","checkbox"],function(){n.valHooks[this]={set:function(a,b){if(n.isArray(b))return a.checked=n.inArray(n(a).val(),b)>-1}},l.checkOn||(n.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})});var sb,tb,ub=n.expr.attrHandle,vb=/^(?:checked|selected)$/i,wb=l.getSetAttribute,xb=l.input;n.fn.extend({attr:function(a,b){return X(this,n.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){n.removeAttr(this,a)})}}),n.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return void 0===a.getAttribute?n.prop(a,b,c):(1===f&&n.isXMLDoc(a)||(b=b.toLowerCase(),e=n.attrHooks[b]||(n.expr.match.bool.test(b)?tb:sb)),void 0!==c?null===c?void n.removeAttr(a,b):e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:(a.setAttribute(b,c+""),c):e&&"get"in e&&null!==(d=e.get(a,b))?d:(d=n.find.attr(a,b),null==d?void 0:d))},attrHooks:{type:{set:function(a,b){if(!l.radioValue&&"radio"===b&&n.nodeName(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}},removeAttr:function(a,b){var c,d,e=0,f=b&&b.match(F);if(f&&1===a.nodeType)while(c=f[e++])d=n.propFix[c]||c,n.expr.match.bool.test(c)?xb&&wb||!vb.test(c)?a[d]=!1:a[n.camelCase("default-"+c)]=a[d]=!1:n.attr(a,c,""),a.removeAttribute(wb?c:d)}}),tb={set:function(a,b,c){return!1===b?n.removeAttr(a,c):xb&&wb||!vb.test(c)?a.setAttribute(!wb&&n.propFix[c]||c,c):a[n.camelCase("default-"+c)]=a[c]=!0,c}},n.each(n.expr.match.bool.source.match(/\w+/g),function(a,b){var c=ub[b]||n.find.attr;xb&&wb||!vb.test(b)?ub[b]=function(a,b,d){var e,f;return d||(f=ub[b],ub[b]=e,e=null!=c(a,b,d)?b.toLowerCase():null,ub[b]=f),e}:ub[b]=function(a,b,c){if(!c)return a[n.camelCase("default-"+b)]?b.toLowerCase():null}}),xb&&wb||(n.attrHooks.value={set:function(a,b,c){if(!n.nodeName(a,"input"))return sb&&sb.set(a,b,c);a.defaultValue=b}}),wb||(sb={set:function(a,b,c){var d=a.getAttributeNode(c);if(d||a.setAttributeNode(d=a.ownerDocument.createAttribute(c)),d.value=b+="","value"===c||b===a.getAttribute(c))return b}},ub.id=ub.name=ub.coords=function(a,b,c){var d;if(!c)return(d=a.getAttributeNode(b))&&""!==d.value?d.value:null},n.valHooks.button={get:function(a,b){var c=a.getAttributeNode(b);if(c&&c.specified)return c.value},set:sb.set},n.attrHooks.contenteditable={set:function(a,b,c){sb.set(a,""!==b&&b,c)}},n.each(["width","height"],function(a,b){n.attrHooks[b]={set:function(a,c){if(""===c)return a.setAttribute(b,"auto"),c}}})),l.style||(n.attrHooks.style={get:function(a){return a.style.cssText||void 0},set:function(a,b){return a.style.cssText=b+""}});var yb=/^(?:input|select|textarea|button|object)$/i,zb=/^(?:a|area)$/i;n.fn.extend({prop:function(a,b){return X(this,n.prop,a,b,arguments.length>1)},removeProp:function(a){return a=n.propFix[a]||a,this.each(function(){try{this[a]=void 0,delete this[a]}catch(b){}})}}),n.extend({prop:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return 1===f&&n.isXMLDoc(a)||(b=n.propFix[b]||b,e=n.propHooks[b]),void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){var b=n.find.attr(a,"tabindex");return b?parseInt(b,10):yb.test(a.nodeName)||zb.test(a.nodeName)&&a.href?0:-1}}},propFix:{for:"htmlFor",class:"className"}}),l.hrefNormalized||n.each(["href","src"],function(a,b){n.propHooks[b]={get:function(a){return a.getAttribute(b,4)}}}),l.optSelected||(n.propHooks.selected={get:function(a){var b=a.parentNode;return b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex),null},set:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}}),n.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){n.propFix[this.toLowerCase()]=this}),l.enctype||(n.propFix.enctype="encoding");var Ab=/[\t\r\n\f]/g;function Bb(a){return n.attr(a,"class")||""}n.fn.extend({addClass:function(a){var b,c,d,e,f,g,h,i=0;if(n.isFunction(a))return this.each(function(b){n(this).addClass(a.call(this,b,Bb(this)))});if("string"==typeof a&&a){b=a.match(F)||[];while(c=this[i++])if(e=Bb(c),d=1===c.nodeType&&(" "+e+" ").replace(Ab," ")){g=0;while(f=b[g++])d.indexOf(" "+f+" ")<0&&(d+=f+" ");h=n.trim(d),e!==h&&n.attr(c,"class",h)}}return this},removeClass:function(a){var b,c,d,e,f,g,h,i=0;if(n.isFunction(a))return this.each(function(b){n(this).removeClass(a.call(this,b,Bb(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof a&&a){b=a.match(F)||[];while(c=this[i++])if(e=Bb(c),d=1===c.nodeType&&(" "+e+" ").replace(Ab," ")){g=0;while(f=b[g++])while(d.indexOf(" "+f+" ")>-1)d=d.replace(" "+f+" "," ");h=n.trim(d),e!==h&&n.attr(c,"class",h)}}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):n.isFunction(a)?this.each(function(c){n(this).toggleClass(a.call(this,c,Bb(this),b),b)}):this.each(function(){var b,d,e,f;if("string"===c){d=0,e=n(this),f=a.match(F)||[];while(b=f[d++])e.hasClass(b)?e.removeClass(b):e.addClass(b)}else void 0!==a&&"boolean"!==c||(b=Bb(this),b&&n._data(this,"__className__",b),n.attr(this,"class",b||!1===a?"":n._data(this,"__className__")||""))})},hasClass:function(a){var b,c,d=0;b=" "+a+" ";while(c=this[d++])if(1===c.nodeType&&(" "+Bb(c)+" ").replace(Ab," ").indexOf(b)>-1)return!0;return!1}}),n.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){n.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),n.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var Cb=a.location,Db=n.now(),Eb=/\?/,Fb=/(,)|(\[|{)|(}|])|"(?:[^"\\\r\n]|\\["\\\/bfnrt]|\\u[\da-fA-F]{4})*"\s*:?|true|false|null|-?(?!0\d)\d+(?:\.\d+|)(?:[eE][+-]?\d+|)/g;n.parseJSON=function(b){if(a.JSON&&a.JSON.parse)return a.JSON.parse(b+"");var c,d=null,e=n.trim(b+"");return e&&!n.trim(e.replace(Fb,function(a,b,e,f){return c&&b&&(d=0),0===d?a:(c=e||b,d+=!f-!e,"")}))?Function("return "+e)():n.error("Invalid JSON: "+b)},n.parseXML=function(b){var c,d;if(!b||"string"!=typeof b)return null;try{a.DOMParser?(d=new a.DOMParser,c=d.parseFromString(b,"text/xml")):(c=new a.ActiveXObject("Microsoft.XMLDOM"),c.async="false",c.loadXML(b))}catch(e){c=void 0}return c&&c.documentElement&&!c.getElementsByTagName("parsererror").length||n.error("Invalid XML: "+b),c};var Gb=/#.*$/,Hb=/([?&])_=[^&]*/,Ib=/^(.*?):[ \t]*([^\r\n]*)\r?$/gm,Jb=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,Kb=/^(?:GET|HEAD)$/,Lb=/^\/\//,Mb=/^([\w.+-]+:)(?:\/\/(?:[^\/?#]*@|)([^\/?#:]*)(?::(\d+)|)|)/,Nb={},Ob={},Pb="*/".concat("*"),Qb=Cb.href,Rb=Mb.exec(Qb.toLowerCase())||[];function Sb(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(F)||[];if(n.isFunction(c))while(d=f[e++])"+"===d.charAt(0)?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function Tb(a,b,c,d){var e={},f=a===Ob;function g(h){var i;return e[h]=!0,n.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||f||e[j]?f?!(i=j):void 0:(b.dataTypes.unshift(j),g(j),!1)}),i}return g(b.dataTypes[0])||!e["*"]&&g("*")}function Ub(a,b){var c,d,e=n.ajaxSettings.flatOptions||{};for(d in b)void 0!==b[d]&&((e[d]?a:c||(c={}))[d]=b[d]);return c&&n.extend(!0,a,c),a}function Vb(a,b,c){var d,e,f,g,h=a.contents,i=a.dataTypes;while("*"===i[0])i.shift(),void 0===e&&(e=a.mimeType||b.getResponseHeader("Content-Type"));if(e)for(g in h)if(h[g]&&h[g].test(e)){i.unshift(g);break}if(i[0]in c)f=i[0];else{for(g in c){if(!i[0]||a.converters[g+" "+i[0]]){f=g;break}d||(d=g)}f=f||d}if(f)return f!==i[0]&&i.unshift(f),c[f]}function Wb(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];f=k.shift();while(f)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(!(g=j[i+" "+f]||j["* "+f]))for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){!0===g?g=j[e]:!0!==j[e]&&(f=h[0],k.unshift(h[1]));break}if(!0!==g)if(g&&a.throws)b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}n.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Qb,type:"GET",isLocal:Jb.test(Rb[1]),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":Pb,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":n.parseJSON,"text xml":n.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?Ub(Ub(a,n.ajaxSettings),b):Ub(n.ajaxSettings,a)},ajaxPrefilter:Sb(Nb),ajaxTransport:Sb(Ob),ajax:function(b,c){"object"==typeof b&&(c=b,b=void 0),c=c||{};var d,e,f,g,h,i,j,k,l=n.ajaxSetup({},c),m=l.context||l,o=l.context&&(m.nodeType||m.jquery)?n(m):n.event,p=n.Deferred(),q=n.Callbacks("once memory"),r=l.statusCode||{},s={},t={},u=0,v="canceled",w={readyState:0,getResponseHeader:function(a){var b;if(2===u){if(!k){k={};while(b=Ib.exec(g))k[b[1].toLowerCase()]=b[2]}b=k[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return 2===u?g:null},setRequestHeader:function(a,b){var c=a.toLowerCase();return u||(a=t[c]=t[c]||a,s[a]=b),this},overrideMimeType:function(a){return u||(l.mimeType=a),this},statusCode:function(a){var b;if(a)if(u<2)for(b in a)r[b]=[r[b],a[b]];else w.always(a[w.status]);return this},abort:function(a){var b=a||v;return j&&j.abort(b),x(0,b),this}};if(p.promise(w).complete=q.add,w.success=w.done,w.error=w.fail,l.url=((b||l.url||Qb)+"").replace(Gb,"").replace(Lb,Rb[1]+"//"),l.type=c.method||c.type||l.method||l.type,l.dataTypes=n.trim(l.dataType||"*").toLowerCase().match(F)||[""],null==l.crossDomain&&(d=Mb.exec(l.url.toLowerCase()),l.crossDomain=!(!d||d[1]===Rb[1]&&d[2]===Rb[2]&&(d[3]||("http:"===d[1]?"80":"443"))===(Rb[3]||("http:"===Rb[1]?"80":"443")))),l.data&&l.processData&&"string"!=typeof l.data&&(l.data=n.param(l.data,l.traditional)),Tb(Nb,l,c,w),2===u)return w;i=n.event&&l.global,i&&0==n.active++&&n.event.trigger("ajaxStart"),l.type=l.type.toUpperCase(),l.hasContent=!Kb.test(l.type),f=l.url,l.hasContent||(l.data&&(f=l.url+=(Eb.test(f)?"&":"?")+l.data,delete l.data),!1===l.cache&&(l.url=Hb.test(f)?f.replace(Hb,"$1_="+Db++):f+(Eb.test(f)?"&":"?")+"_="+Db++)),l.ifModified&&(n.lastModified[f]&&w.setRequestHeader("If-Modified-Since",n.lastModified[f]),n.etag[f]&&w.setRequestHeader("If-None-Match",n.etag[f])),(l.data&&l.hasContent&&!1!==l.contentType||c.contentType)&&w.setRequestHeader("Content-Type",l.contentType),w.setRequestHeader("Accept",l.dataTypes[0]&&l.accepts[l.dataTypes[0]]?l.accepts[l.dataTypes[0]]+("*"!==l.dataTypes[0]?", "+Pb+"; q=0.01":""):l.accepts["*"]);for(e in l.headers)w.setRequestHeader(e,l.headers[e]);if(l.beforeSend&&(!1===l.beforeSend.call(m,w,l)||2===u))return w.abort();v="abort";for(e in{success:1,error:1,complete:1})w[e](l[e]);if(j=Tb(Ob,l,c,w)){if(w.readyState=1,i&&o.trigger("ajaxSend",[w,l]),2===u)return w;l.async&&l.timeout>0&&(h=a.setTimeout(function(){w.abort("timeout")},l.timeout));try{u=1,j.send(s,x)}catch(y){if(!(u<2))throw y;x(-1,y)}}else x(-1,"No Transport");function x(b,c,d,e){var k,s,t,v,x,y=c;2!==u&&(u=2,h&&a.clearTimeout(h),j=void 0,g=e||"",w.readyState=b>0?4:0,k=b>=200&&b<300||304===b,d&&(v=Vb(l,w,d)),v=Wb(l,v,w,k),k?(l.ifModified&&(x=w.getResponseHeader("Last-Modified"),x&&(n.lastModified[f]=x),(x=w.getResponseHeader("etag"))&&(n.etag[f]=x)),204===b||"HEAD"===l.type?y="nocontent":304===b?y="notmodified":(y=v.state,s=v.data,t=v.error,k=!t)):(t=y,!b&&y||(y="error",b<0&&(b=0))),w.status=b,w.statusText=(c||y)+"",k?p.resolveWith(m,[s,y,w]):p.rejectWith(m,[w,y,t]),w.statusCode(r),r=void 0,i&&o.trigger(k?"ajaxSuccess":"ajaxError",[w,l,k?s:t]),q.fireWith(m,[w,y]),i&&(o.trigger("ajaxComplete",[w,l]),--n.active||n.event.trigger("ajaxStop")))}return w},getJSON:function(a,b,c){return n.get(a,b,c,"json")},getScript:function(a,b){return n.get(a,void 0,b,"script")}}),n.each(["get","post"],function(a,b){n[b]=function(a,c,d,e){return n.isFunction(c)&&(e=e||d,d=c,c=void 0),n.ajax(n.extend({url:a,type:b,dataType:e,data:c,success:d},n.isPlainObject(a)&&a))}}),n._evalUrl=function(a){return n.ajax({url:a,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,throws:!0})},n.fn.extend({wrapAll:function(a){if(n.isFunction(a))return this.each(function(b){n(this).wrapAll(a.call(this,b))});if(this[0]){var b=n(a,this[0].ownerDocument).eq(0).clone(!0);this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstChild&&1===a.firstChild.nodeType)a=a.firstChild;return a}).append(this)}return this},wrapInner:function(a){return n.isFunction(a)?this.each(function(b){n(this).wrapInner(a.call(this,b))}):this.each(function(){var b=n(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=n.isFunction(a);return this.each(function(c){n(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){n.nodeName(this,"body")||n(this).replaceWith(this.childNodes)}).end()}});function Xb(a){return a.style&&a.style.display||n.css(a,"display")}function Yb(a){if(!n.contains(a.ownerDocument||d,a))return!0;while(a&&1===a.nodeType){if("none"===Xb(a)||"hidden"===a.type)return!0;a=a.parentNode}return!1}n.expr.filters.hidden=function(a){return l.reliableHiddenOffsets()?a.offsetWidth<=0&&a.offsetHeight<=0&&!a.getClientRects().length:Yb(a)},n.expr.filters.visible=function(a){return!n.expr.filters.hidden(a)};var Zb=/%20/g,$b=/\[\]$/,_b=/\r?\n/g,ac=/^(?:submit|button|image|reset|file)$/i,bc=/^(?:input|select|textarea|keygen)/i;function cc(a,b,c,d){var e;if(n.isArray(b))n.each(b,function(b,e){c||$b.test(a)?d(a,e):cc(a+"["+("object"==typeof e&&null!=e?b:"")+"]",e,c,d)});else if(c||"object"!==n.type(b))d(a,b);else for(e in b)cc(a+"["+e+"]",b[e],c,d)}n.param=function(a,b){var c,d=[],e=function(a,b){b=n.isFunction(b)?b():null==b?"":b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};if(void 0===b&&(b=n.ajaxSettings&&n.ajaxSettings.traditional),n.isArray(a)||a.jquery&&!n.isPlainObject(a))n.each(a,function(){e(this.name,this.value)});else for(c in a)cc(c,a[c],b,e);return d.join("&").replace(Zb,"+")},n.fn.extend({serialize:function(){return n.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=n.prop(this,"elements");return a?n.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!n(this).is(":disabled")&&bc.test(this.nodeName)&&!ac.test(a)&&(this.checked||!Y.test(a))}).map(function(a,b){var c=n(this).val();return null==c?null:n.isArray(c)?n.map(c,function(a){return{name:b.name,value:a.replace(_b,"\r\n")}}):{name:b.name,value:c.replace(_b,"\r\n")}}).get()}}),n.ajaxSettings.xhr=void 0!==a.ActiveXObject?function(){return this.isLocal?hc():d.documentMode>8?gc():/^(get|post|head|put|delete|options)$/i.test(this.type)&&gc()||hc()}:gc;var dc=0,ec={},fc=n.ajaxSettings.xhr();a.attachEvent&&a.attachEvent("onunload",function(){for(var a in ec)ec[a](void 0,!0)}),l.cors=!!fc&&"withCredentials"in fc,(fc=l.ajax=!!fc)&&n.ajaxTransport(function(b){if(!b.crossDomain||l.cors){var c;return{send:function(d,e){var f,g=b.xhr(),h=++dc;if(g.open(b.type,b.url,b.async,b.username,b.password),b.xhrFields)for(f in b.xhrFields)g[f]=b.xhrFields[f];b.mimeType&&g.overrideMimeType&&g.overrideMimeType(b.mimeType),b.crossDomain||d["X-Requested-With"]||(d["X-Requested-With"]="XMLHttpRequest");for(f in d)void 0!==d[f]&&g.setRequestHeader(f,d[f]+"");g.send(b.hasContent&&b.data||null),c=function(a,d){var f,i,j;if(c&&(d||4===g.readyState))if(delete ec[h],c=void 0,g.onreadystatechange=n.noop,d)4!==g.readyState&&g.abort();else{j={},f=g.status,"string"==typeof g.responseText&&(j.text=g.responseText);try{i=g.statusText}catch(k){i=""}f||!b.isLocal||b.crossDomain?1223===f&&(f=204):f=j.text?200:404}j&&e(f,i,j,g.getAllResponseHeaders())},b.async?4===g.readyState?a.setTimeout(c):g.onreadystatechange=ec[h]=c:c()},abort:function(){c&&c(void 0,!0)}}}});function gc(){try{return new a.XMLHttpRequest}catch(b){}}function hc(){try{return new a.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}}n.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(a){return n.globalEval(a),a}}}),n.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),n.ajaxTransport("script",function(a){if(a.crossDomain){var b,c=d.head||n("head")[0]||d.documentElement;return{send:function(e,f){b=d.createElement("script"),b.async=!0,a.scriptCharset&&(b.charset=a.scriptCharset),b.src=a.url,b.onload=b.onreadystatechange=function(a,c){(c||!b.readyState||/loaded|complete/.test(b.readyState))&&(b.onload=b.onreadystatechange=null,b.parentNode&&b.parentNode.removeChild(b),b=null,c||f(200,"success"))},c.insertBefore(b,c.firstChild)},abort:function(){b&&b.onload(void 0,!0)}}}});var ic=[],jc=/(=)\?(?=&|$)|\?\?/;n.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=ic.pop()||n.expando+"_"+Db++;return this[a]=!0,a}}),n.ajaxPrefilter("json jsonp",function(b,c,d){var e,f,g,h=!1!==b.jsonp&&(jc.test(b.url)?"url":"string"==typeof b.data&&0===(b.contentType||"").indexOf("application/x-www-form-urlencoded")&&jc.test(b.data)&&"data");if(h||"jsonp"===b.dataTypes[0])return e=b.jsonpCallback=n.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,h?b[h]=b[h].replace(jc,"$1"+e):!1!==b.jsonp&&(b.url+=(Eb.test(b.url)?"&":"?")+b.jsonp+"="+e),b.converters["script json"]=function(){return g||n.error(e+" was not called"),g[0]},b.dataTypes[0]="json",f=a[e],a[e]=function(){g=arguments},d.always(function(){void 0===f?n(a).removeProp(e):a[e]=f,b[e]&&(b.jsonpCallback=c.jsonpCallback,ic.push(e)),g&&n.isFunction(f)&&f(g[0]),g=f=void 0}),"script"}),n.parseHTML=function(a,b,c){if(!a||"string"!=typeof a)return null;"boolean"==typeof b&&(c=b,b=!1),b=b||d;var e=x.exec(a),f=!c&&[];return e?[b.createElement(e[1])]:(e=ia([a],b,f),f&&f.length&&n(f).remove(),n.merge([],e.childNodes))};var kc=n.fn.load;n.fn.load=function(a,b,c){if("string"!=typeof a&&kc)return kc.apply(this,arguments);var d,e,f,g=this,h=a.indexOf(" ");return h>-1&&(d=n.trim(a.slice(h,a.length)),a=a.slice(0,h)),n.isFunction(b)?(c=b,b=void 0):b&&"object"==typeof b&&(e="POST"),g.length>0&&n.ajax({url:a,type:e||"GET",dataType:"html",data:b}).done(function(a){f=arguments,g.html(d?n("<div>").append(n.parseHTML(a)).find(d):a)}).always(c&&function(a,b){g.each(function(){c.apply(this,f||[a.responseText,b,a])})}),this},n.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(a,b){n.fn[b]=function(a){return this.on(b,a)}}),n.expr.filters.animated=function(a){return n.grep(n.timers,function(b){return a===b.elem}).length};function lc(a){return n.isWindow(a)?a:9===a.nodeType&&(a.defaultView||a.parentWindow)}n.offset={setOffset:function(a,b,c){var d,e,f,g,h,i,j,k=n.css(a,"position"),l=n(a),m={};"static"===k&&(a.style.position="relative"),h=l.offset(),f=n.css(a,"top"),i=n.css(a,"left"),j=("absolute"===k||"fixed"===k)&&n.inArray("auto",[f,i])>-1,j?(d=l.position(),g=d.top,e=d.left):(g=parseFloat(f)||0,e=parseFloat(i)||0),n.isFunction(b)&&(b=b.call(a,c,n.extend({},h))),null!=b.top&&(m.top=b.top-h.top+g),null!=b.left&&(m.left=b.left-h.left+e),"using"in b?b.using.call(a,m):l.css(m)}},n.fn.extend({offset:function(a){if(arguments.length)return void 0===a?this:this.each(function(b){n.offset.setOffset(this,a,b)});var b,c,d={top:0,left:0},e=this[0],f=e&&e.ownerDocument;if(f)return b=f.documentElement,n.contains(b,e)?(void 0!==e.getBoundingClientRect&&(d=e.getBoundingClientRect()),c=lc(f),{top:d.top+(c.pageYOffset||b.scrollTop)-(b.clientTop||0),left:d.left+(c.pageXOffset||b.scrollLeft)-(b.clientLeft||0)}):d},position:function(){if(this[0]){var a,b,c={top:0,left:0},d=this[0];return"fixed"===n.css(d,"position")?b=d.getBoundingClientRect():(a=this.offsetParent(),b=this.offset(),n.nodeName(a[0],"html")||(c=a.offset()),c.top+=n.css(a[0],"borderTopWidth",!0),c.left+=n.css(a[0],"borderLeftWidth",!0)),{top:b.top-c.top-n.css(d,"marginTop",!0),left:b.left-c.left-n.css(d,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var a=this.offsetParent;while(a&&!n.nodeName(a,"html")&&"static"===n.css(a,"position"))a=a.offsetParent;return a||Pa})}}),n.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,b){var c=/Y/.test(b);n.fn[a]=function(d){return X(this,function(a,d,e){var f=lc(a);if(void 0===e)return f?b in f?f[b]:f.document.documentElement[d]:a[d];f?f.scrollTo(c?n(f).scrollLeft():e,c?e:n(f).scrollTop()):a[d]=e},a,d,arguments.length,null)}}),n.each(["top","left"],function(a,b){n.cssHooks[b]=Ta(l.pixelPosition,function(a,c){if(c)return c=Ra(a,b),Na.test(c)?n(a).position()[b]+"px":c})}),n.each({Height:"height",Width:"width"},function(a,b){n.each({padding:"inner"+a,content:b,"":"outer"+a},function(c,d){n.fn[d]=function(d,e){var f=arguments.length&&(c||"boolean"!=typeof d),g=c||(!0===d||!0===e?"margin":"border")
-;return X(this,function(b,c,d){var e;return n.isWindow(b)?b.document.documentElement["client"+a]:9===b.nodeType?(e=b.documentElement,Math.max(b.body["scroll"+a],e["scroll"+a],b.body["offset"+a],e["offset"+a],e["client"+a])):void 0===d?n.css(b,c,g):n.style(b,c,d,g)},b,f?d:void 0,f,null)}})}),n.fn.extend({bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return 1===arguments.length?this.off(a,"**"):this.off(b,a||"**",c)}}),n.fn.size=function(){return this.length},n.fn.andSelf=n.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return n});var mc=a.jQuery,nc=a.$;return n.noConflict=function(b){return a.$===n&&(a.$=nc),b&&a.jQuery===n&&(a.jQuery=mc),n},b||(a.jQuery=a.$=n),n});
+/*!
+ * jQuery JavaScript Library v3.5.1
+ * https://jquery.com/
+ *
+ * Includes Sizzle.js
+ * https://sizzlejs.com/
+ *
+ * Copyright JS Foundation and other contributors
+ * Released under the MIT license
+ * https://jquery.org/license
+ *
+ * Date: 2020-05-04T22:49Z
+ */
+( function( global, factory ) {
+
+	"use strict";
+
+	if ( typeof module === "object" && typeof module.exports === "object" ) {
+
+		// For CommonJS and CommonJS-like environments where a proper `window`
+		// is present, execute the factory and get jQuery.
+		// For environments that do not have a `window` with a `document`
+		// (such as Node.js), expose a factory as module.exports.
+		// This accentuates the need for the creation of a real `window`.
+		// e.g. var jQuery = require("jquery")(window);
+		// See ticket #14549 for more info.
+		module.exports = global.document ?
+			factory( global, true ) :
+			function( w ) {
+				if ( !w.document ) {
+					throw new Error( "jQuery requires a window with a document" );
+				}
+				return factory( w );
+			};
+	} else {
+		factory( global );
+	}
+
+// Pass this if window is not defined yet
+} )( typeof window !== "undefined" ? window : this, function( window, noGlobal ) {
+
+// Edge <= 12 - 13+, Firefox <=18 - 45+, IE 10 - 11, Safari 5.1 - 9+, iOS 6 - 9.1
+// throw exceptions when non-strict code (e.g., ASP.NET 4.5) accesses strict mode
+// arguments.callee.caller (trac-13335). But as of jQuery 3.0 (2016), strict mode should be common
+// enough that all such attempts are guarded in a try block.
+"use strict";
+
+var arr = [];
+
+var getProto = Object.getPrototypeOf;
+
+var slice = arr.slice;
+
+var flat = arr.flat ? function( array ) {
+	return arr.flat.call( array );
+} : function( array ) {
+	return arr.concat.apply( [], array );
+};
+
+
+var push = arr.push;
+
+var indexOf = arr.indexOf;
+
+var class2type = {};
+
+var toString = class2type.toString;
+
+var hasOwn = class2type.hasOwnProperty;
+
+var fnToString = hasOwn.toString;
+
+var ObjectFunctionString = fnToString.call( Object );
+
+var support = {};
+
+var isFunction = function isFunction( obj ) {
+
+      // Support: Chrome <=57, Firefox <=52
+      // In some browsers, typeof returns "function" for HTML <object> elements
+      // (i.e., `typeof document.createElement( "object" ) === "function"`).
+      // We don't want to classify *any* DOM node as a function.
+      return typeof obj === "function" && typeof obj.nodeType !== "number";
+  };
+
+
+var isWindow = function isWindow( obj ) {
+		return obj != null && obj === obj.window;
+	};
+
+
+var document = window.document;
+
+
+
+	var preservedScriptAttributes = {
+		type: true,
+		src: true,
+		nonce: true,
+		noModule: true
+	};
+
+	function DOMEval( code, node, doc ) {
+		doc = doc || document;
+
+		var i, val,
+			script = doc.createElement( "script" );
+
+		script.text = code;
+		if ( node ) {
+			for ( i in preservedScriptAttributes ) {
+
+				// Support: Firefox 64+, Edge 18+
+				// Some browsers don't support the "nonce" property on scripts.
+				// On the other hand, just using `getAttribute` is not enough as
+				// the `nonce` attribute is reset to an empty string whenever it
+				// becomes browsing-context connected.
+				// See https://github.com/whatwg/html/issues/2369
+				// See https://html.spec.whatwg.org/#nonce-attributes
+				// The `node.getAttribute` check was added for the sake of
+				// `jQuery.globalEval` so that it can fake a nonce-containing node
+				// via an object.
+				val = node[ i ] || node.getAttribute && node.getAttribute( i );
+				if ( val ) {
+					script.setAttribute( i, val );
+				}
+			}
+		}
+		doc.head.appendChild( script ).parentNode.removeChild( script );
+	}
+
+
+function toType( obj ) {
+	if ( obj == null ) {
+		return obj + "";
+	}
+
+	// Support: Android <=2.3 only (functionish RegExp)
+	return typeof obj === "object" || typeof obj === "function" ?
+		class2type[ toString.call( obj ) ] || "object" :
+		typeof obj;
+}
+/* global Symbol */
+// Defining this global in .eslintrc.json would create a danger of using the global
+// unguarded in another place, it seems safer to define global only for this module
+
+
+
+var
+	version = "3.5.1",
+
+	// Define a local copy of jQuery
+	jQuery = function( selector, context ) {
+
+		// The jQuery object is actually just the init constructor 'enhanced'
+		// Need init if jQuery is called (just allow error to be thrown if not included)
+		return new jQuery.fn.init( selector, context );
+	};
+
+jQuery.fn = jQuery.prototype = {
+
+	// The current version of jQuery being used
+	jquery: version,
+
+	constructor: jQuery,
+
+	// The default length of a jQuery object is 0
+	length: 0,
+
+	toArray: function() {
+		return slice.call( this );
+	},
+
+	// Get the Nth element in the matched element set OR
+	// Get the whole matched element set as a clean array
+	get: function( num ) {
+
+		// Return all the elements in a clean array
+		if ( num == null ) {
+			return slice.call( this );
+		}
+
+		// Return just the one element from the set
+		return num < 0 ? this[ num + this.length ] : this[ num ];
+	},
+
+	// Take an array of elements and push it onto the stack
+	// (returning the new matched element set)
+	pushStack: function( elems ) {
+
+		// Build a new jQuery matched element set
+		var ret = jQuery.merge( this.constructor(), elems );
+
+		// Add the old object onto the stack (as a reference)
+		ret.prevObject = this;
+
+		// Return the newly-formed element set
+		return ret;
+	},
+
+	// Execute a callback for every element in the matched set.
+	each: function( callback ) {
+		return jQuery.each( this, callback );
+	},
+
+	map: function( callback ) {
+		return this.pushStack( jQuery.map( this, function( elem, i ) {
+			return callback.call( elem, i, elem );
+		} ) );
+	},
+
+	slice: function() {
+		return this.pushStack( slice.apply( this, arguments ) );
+	},
+
+	first: function() {
+		return this.eq( 0 );
+	},
+
+	last: function() {
+		return this.eq( -1 );
+	},
+
+	even: function() {
+		return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+			return ( i + 1 ) % 2;
+		} ) );
+	},
+
+	odd: function() {
+		return this.pushStack( jQuery.grep( this, function( _elem, i ) {
+			return i % 2;
+		} ) );
+	},
+
+	eq: function( i ) {
+		var len = this.length,
+			j = +i + ( i < 0 ? len : 0 );
+		return this.pushStack( j >= 0 && j < len ? [ this[ j ] ] : [] );
+	},
+
+	end: function() {
+		return this.prevObject || this.constructor();
+	},
+
+	// For internal use only.
+	// Behaves like an Array's method, not like a jQuery method.
+	push: push,
+	sort: arr.sort,
+	splice: arr.splice
+};
+
+jQuery.extend = jQuery.fn.extend = function() {
+	var options, name, src, copy, copyIsArray, clone,
+		target = arguments[ 0 ] || {},
+		i = 1,
+		length = arguments.length,
+		deep = false;
+
+	// Handle a deep copy situation
+	if ( typeof target === "boolean" ) {
+		deep = target;
+
+		// Skip the boolean and the target
+		target = arguments[ i ] || {};
+		i++;
+	}
+
+	// Handle case when target is a string or something (possible in deep copy)
+	if ( typeof target !== "object" && !isFunction( target ) ) {
+		target = {};
+	}
+
+	// Extend jQuery itself if only one argument is passed
+	if ( i === length ) {
+		target = this;
+		i--;
+	}
+
+	for ( ; i < length; i++ ) {
+
+		// Only deal with non-null/undefined values
+		if ( ( options = arguments[ i ] ) != null ) {
+
+			// Extend the base object
+			for ( name in options ) {
+				copy = options[ name ];
+
+				// Prevent Object.prototype pollution
+				// Prevent never-ending loop
+				if ( name === "__proto__" || target === copy ) {
+					continue;
+				}
+
+				// Recurse if we're merging plain objects or arrays
+				if ( deep && copy && ( jQuery.isPlainObject( copy ) ||
+					( copyIsArray = Array.isArray( copy ) ) ) ) {
+					src = target[ name ];
+
+					// Ensure proper type for the source value
+					if ( copyIsArray && !Array.isArray( src ) ) {
+						clone = [];
+					} else if ( !copyIsArray && !jQuery.isPlainObject( src ) ) {
+						clone = {};
+					} else {
+						clone = src;
+					}
+					copyIsArray = false;
+
+					// Never move original objects, clone them
+					target[ name ] = jQuery.extend( deep, clone, copy );
+
+				// Don't bring in undefined values
+				} else if ( copy !== undefined ) {
+					target[ name ] = copy;
+				}
+			}
+		}
+	}
+
+	// Return the modified object
+	return target;
+};
+
+jQuery.extend( {
+
+	// Unique for each copy of jQuery on the page
+	expando: "jQuery" + ( version + Math.random() ).replace( /\D/g, "" ),
+
+	// Assume jQuery is ready without the ready module
+	isReady: true,
+
+	error: function( msg ) {
+		throw new Error( msg );
+	},
+
+	noop: function() {},
+
+	isPlainObject: function( obj ) {
+		var proto, Ctor;
+
+		// Detect obvious negatives
+		// Use toString instead of jQuery.type to catch host objects
+		if ( !obj || toString.call( obj ) !== "[object Object]" ) {
+			return false;
+		}
+
+		proto = getProto( obj );
+
+		// Objects with no prototype (e.g., `Object.create( null )`) are plain
+		if ( !proto ) {
+			return true;
+		}
+
+		// Objects with prototype are plain iff they were constructed by a global Object function
+		Ctor = hasOwn.call( proto, "constructor" ) && proto.constructor;
+		return typeof Ctor === "function" && fnToString.call( Ctor ) === ObjectFunctionString;
+	},
+
+	isEmptyObject: function( obj ) {
+		var name;
+
+		for ( name in obj ) {
+			return false;
+		}
+		return true;
+	},
+
+	// Evaluates a script in a provided context; falls back to the global one
+	// if not specified.
+	globalEval: function( code, options, doc ) {
+		DOMEval( code, { nonce: options && options.nonce }, doc );
+	},
+
+	each: function( obj, callback ) {
+		var length, i = 0;
+
+		if ( isArrayLike( obj ) ) {
+			length = obj.length;
+			for ( ; i < length; i++ ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
+				}
+			}
+		} else {
+			for ( i in obj ) {
+				if ( callback.call( obj[ i ], i, obj[ i ] ) === false ) {
+					break;
+				}
+			}
+		}
+
+		return obj;
+	},
+
+	// results is for internal usage only
+	makeArray: function( arr, results ) {
+		var ret = results || [];
+
+		if ( arr != null ) {
+			if ( isArrayLike( Object( arr ) ) ) {
+				jQuery.merge( ret,
+					typeof arr === "string" ?
+					[ arr ] : arr
+				);
+			} else {
+				push.call( ret, arr );
+			}
+		}
+
+		return ret;
+	},
+
+	inArray: function( elem, arr, i ) {
+		return arr == null ? -1 : indexOf.call( arr, elem, i );
+	},
+
+	// Support: Android <=4.0 only, PhantomJS 1 only
+	// push.apply(_, arraylike) throws on ancient WebKit
+	merge: function( first, second ) {
+		var len = +second.length,
+			j = 0,
+			i = first.length;
+
+		for ( ; j < len; j++ ) {
+			first[ i++ ] = second[ j ];
+		}
+
+		first.length = i;
+
+		return first;
+	},
+
+	grep: function( elems, callback, invert ) {
+		var callbackInverse,
+			matches = [],
+			i = 0,
+			length = elems.length,
+			callbackExpect = !invert;
+
+		// Go through the array, only saving the items
+		// that pass the validator function
+		for ( ; i < length; i++ ) {
+			callbackInverse = !callback( elems[ i ], i );
+			if ( callbackInverse !== callbackExpect ) {
+				matches.push( elems[ i ] );
+			}
+		}
+
+		return matches;
+	},
+
+	// arg is for internal usage only
+	map: function( elems, callback, arg ) {
+		var length, value,
+			i = 0,
+			ret = [];
+
+		// Go through the array, translating each of the items to their new values
+		if ( isArrayLike( elems ) ) {
+			length = elems.length;
+			for ( ; i < length; i++ ) {
+				value = callback( elems[ i ], i, arg );
+
+				if ( value != null ) {
+					ret.push( value );
+				}
+			}
+
+		// Go through every key on the object,
+		} else {
+			for ( i in elems ) {
+				value = callback( elems[ i ], i, arg );
+
+				if ( value != null ) {
+					ret.push( value );
+				}
+			}
+		}
+
+		// Flatten any nested arrays
+		return flat( ret );
+	},
+
+	// A global GUID counter for objects
+	guid: 1,
+
+	// jQuery.support is not used in Core but other projects attach their
+	// properties to it so it needs to exist.
+	support: support
+} );
+
+if ( typeof Symbol === "function" ) {
+	jQuery.fn[ Symbol.iterator ] = arr[ Symbol.iterator ];
+}
+
+// Populate the class2type map
+jQuery.each( "Boolean Number String Function Array Date RegExp Object Error Symbol".split( " " ),
+function( _i, name ) {
+	class2type[ "[object " + name + "]" ] = name.toLowerCase();
+} );
+
+function isArrayLike( obj ) {
+
+	// Support: real iOS 8.2 only (not reproducible in simulator)
+	// `in` check used to prevent JIT error (gh-2145)
+	// hasOwn isn't used here due to false negatives
+	// regarding Nodelist length in IE
+	var length = !!obj && "length" in obj && obj.length,
+		type = toType( obj );
+
+	if ( isFunction( obj ) || isWindow( obj ) ) {
+		return false;
+	}
+
+	return type === "array" || length === 0 ||
+		typeof length === "number" && length > 0 && ( length - 1 ) in obj;
+}
+var Sizzle =
+/*!
+ * Sizzle CSS Selector Engine v2.3.5
+ * https://sizzlejs.com/
+ *
+ * Copyright JS Foundation and other contributors
+ * Released under the MIT license
+ * https://js.foundation/
+ *
+ * Date: 2020-03-14
+ */
+( function( window ) {
+var i,
+	support,
+	Expr,
+	getText,
+	isXML,
+	tokenize,
+	compile,
+	select,
+	outermostContext,
+	sortInput,
+	hasDuplicate,
+
+	// Local document vars
+	setDocument,
+	document,
+	docElem,
+	documentIsHTML,
+	rbuggyQSA,
+	rbuggyMatches,
+	matches,
+	contains,
+
+	// Instance-specific data
+	expando = "sizzle" + 1 * new Date(),
+	preferredDoc = window.document,
+	dirruns = 0,
+	done = 0,
+	classCache = createCache(),
+	tokenCache = createCache(),
+	compilerCache = createCache(),
+	nonnativeSelectorCache = createCache(),
+	sortOrder = function( a, b ) {
+		if ( a === b ) {
+			hasDuplicate = true;
+		}
+		return 0;
+	},
+
+	// Instance methods
+	hasOwn = ( {} ).hasOwnProperty,
+	arr = [],
+	pop = arr.pop,
+	pushNative = arr.push,
+	push = arr.push,
+	slice = arr.slice,
+
+	// Use a stripped-down indexOf as it's faster than native
+	// https://jsperf.com/thor-indexof-vs-for/5
+	indexOf = function( list, elem ) {
+		var i = 0,
+			len = list.length;
+		for ( ; i < len; i++ ) {
+			if ( list[ i ] === elem ) {
+				return i;
+			}
+		}
+		return -1;
+	},
+
+	booleans = "checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|" +
+		"ismap|loop|multiple|open|readonly|required|scoped",
+
+	// Regular expressions
+
+	// http://www.w3.org/TR/css3-selectors/#whitespace
+	whitespace = "[\\x20\\t\\r\\n\\f]",
+
+	// https://www.w3.org/TR/css-syntax-3/#ident-token-diagram
+	identifier = "(?:\\\\[\\da-fA-F]{1,6}" + whitespace +
+		"?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",
+
+	// Attribute selectors: http://www.w3.org/TR/selectors/#attribute-selectors
+	attributes = "\\[" + whitespace + "*(" + identifier + ")(?:" + whitespace +
+
+		// Operator (capture 2)
+		"*([*^$|!~]?=)" + whitespace +
+
+		// "Attribute values must be CSS identifiers [capture 5]
+		// or strings [capture 3 or capture 4]"
+		"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|(" + identifier + "))|)" +
+		whitespace + "*\\]",
+
+	pseudos = ":(" + identifier + ")(?:\\((" +
+
+		// To reduce the number of selectors needing tokenize in the preFilter, prefer arguments:
+		// 1. quoted (capture 3; capture 4 or capture 5)
+		"('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|" +
+
+		// 2. simple (capture 6)
+		"((?:\\\\.|[^\\\\()[\\]]|" + attributes + ")*)|" +
+
+		// 3. anything else (capture 2)
+		".*" +
+		")\\)|)",
+
+	// Leading and non-escaped trailing whitespace, capturing some non-whitespace characters preceding the latter
+	rwhitespace = new RegExp( whitespace + "+", "g" ),
+	rtrim = new RegExp( "^" + whitespace + "+|((?:^|[^\\\\])(?:\\\\.)*)" +
+		whitespace + "+$", "g" ),
+
+	rcomma = new RegExp( "^" + whitespace + "*," + whitespace + "*" ),
+	rcombinators = new RegExp( "^" + whitespace + "*([>+~]|" + whitespace + ")" + whitespace +
+		"*" ),
+	rdescend = new RegExp( whitespace + "|>" ),
+
+	rpseudo = new RegExp( pseudos ),
+	ridentifier = new RegExp( "^" + identifier + "$" ),
+
+	matchExpr = {
+		"ID": new RegExp( "^#(" + identifier + ")" ),
+		"CLASS": new RegExp( "^\\.(" + identifier + ")" ),
+		"TAG": new RegExp( "^(" + identifier + "|[*])" ),
+		"ATTR": new RegExp( "^" + attributes ),
+		"PSEUDO": new RegExp( "^" + pseudos ),
+		"CHILD": new RegExp( "^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\(" +
+			whitespace + "*(even|odd|(([+-]|)(\\d*)n|)" + whitespace + "*(?:([+-]|)" +
+			whitespace + "*(\\d+)|))" + whitespace + "*\\)|)", "i" ),
+		"bool": new RegExp( "^(?:" + booleans + ")$", "i" ),
+
+		// For use in libraries implementing .is()
+		// We use this for POS matching in `select`
+		"needsContext": new RegExp( "^" + whitespace +
+			"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\(" + whitespace +
+			"*((?:-\\d)?\\d*)" + whitespace + "*\\)|)(?=[^-]|$)", "i" )
+	},
+
+	rhtml = /HTML$/i,
+	rinputs = /^(?:input|select|textarea|button)$/i,
+	rheader = /^h\d$/i,
+
+	rnative = /^[^{]+\{\s*\[native \w/,
+
+	// Easily-parseable/retrievable ID or TAG or CLASS selectors
+	rquickExpr = /^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,
+
+	rsibling = /[+~]/,
+
+	// CSS escapes
+	// http://www.w3.org/TR/CSS21/syndata.html#escaped-characters
+	runescape = new RegExp( "\\\\[\\da-fA-F]{1,6}" + whitespace + "?|\\\\([^\\r\\n\\f])", "g" ),
+	funescape = function( escape, nonHex ) {
+		var high = "0x" + escape.slice( 1 ) - 0x10000;
+
+		return nonHex ?
+
+			// Strip the backslash prefix from a non-hex escape sequence
+			nonHex :
+
+			// Replace a hexadecimal escape sequence with the encoded Unicode code point
+			// Support: IE <=11+
+			// For values outside the Basic Multilingual Plane (BMP), manually construct a
+			// surrogate pair
+			high < 0 ?
+				String.fromCharCode( high + 0x10000 ) :
+				String.fromCharCode( high >> 10 | 0xD800, high & 0x3FF | 0xDC00 );
+	},
+
+	// CSS string/identifier serialization
+	// https://drafts.csswg.org/cssom/#common-serializing-idioms
+	rcssescape = /([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,
+	fcssescape = function( ch, asCodePoint ) {
+		if ( asCodePoint ) {
+
+			// U+0000 NULL becomes U+FFFD REPLACEMENT CHARACTER
+			if ( ch === "\0" ) {
+				return "\uFFFD";
+			}
+
+			// Control characters and (dependent upon position) numbers get escaped as code points
+			return ch.slice( 0, -1 ) + "\\" +
+				ch.charCodeAt( ch.length - 1 ).toString( 16 ) + " ";
+		}
+
+		// Other potentially-special ASCII characters get backslash-escaped
+		return "\\" + ch;
+	},
+
+	// Used for iframes
+	// See setDocument()
+	// Removing the function wrapper causes a "Permission Denied"
+	// error in IE
+	unloadHandler = function() {
+		setDocument();
+	},
+
+	inDisabledFieldset = addCombinator(
+		function( elem ) {
+			return elem.disabled === true && elem.nodeName.toLowerCase() === "fieldset";
+		},
+		{ dir: "parentNode", next: "legend" }
+	);
+
+// Optimize for push.apply( _, NodeList )
+try {
+	push.apply(
+		( arr = slice.call( preferredDoc.childNodes ) ),
+		preferredDoc.childNodes
+	);
+
+	// Support: Android<4.0
+	// Detect silently failing push.apply
+	// eslint-disable-next-line no-unused-expressions
+	arr[ preferredDoc.childNodes.length ].nodeType;
+} catch ( e ) {
+	push = { apply: arr.length ?
+
+		// Leverage slice if possible
+		function( target, els ) {
+			pushNative.apply( target, slice.call( els ) );
+		} :
+
+		// Support: IE<9
+		// Otherwise append directly
+		function( target, els ) {
+			var j = target.length,
+				i = 0;
+
+			// Can't trust NodeList.length
+			while ( ( target[ j++ ] = els[ i++ ] ) ) {}
+			target.length = j - 1;
+		}
+	};
+}
+
+function Sizzle( selector, context, results, seed ) {
+	var m, i, elem, nid, match, groups, newSelector,
+		newContext = context && context.ownerDocument,
+
+		// nodeType defaults to 9, since context defaults to document
+		nodeType = context ? context.nodeType : 9;
+
+	results = results || [];
+
+	// Return early from calls with invalid selector or context
+	if ( typeof selector !== "string" || !selector ||
+		nodeType !== 1 && nodeType !== 9 && nodeType !== 11 ) {
+
+		return results;
+	}
+
+	// Try to shortcut find operations (as opposed to filters) in HTML documents
+	if ( !seed ) {
+		setDocument( context );
+		context = context || document;
+
+		if ( documentIsHTML ) {
+
+			// If the selector is sufficiently simple, try using a "get*By*" DOM method
+			// (excepting DocumentFragment context, where the methods don't exist)
+			if ( nodeType !== 11 && ( match = rquickExpr.exec( selector ) ) ) {
+
+				// ID selector
+				if ( ( m = match[ 1 ] ) ) {
+
+					// Document context
+					if ( nodeType === 9 ) {
+						if ( ( elem = context.getElementById( m ) ) ) {
+
+							// Support: IE, Opera, Webkit
+							// TODO: identify versions
+							// getElementById can match elements by name instead of ID
+							if ( elem.id === m ) {
+								results.push( elem );
+								return results;
+							}
+						} else {
+							return results;
+						}
+
+					// Element context
+					} else {
+
+						// Support: IE, Opera, Webkit
+						// TODO: identify versions
+						// getElementById can match elements by name instead of ID
+						if ( newContext && ( elem = newContext.getElementById( m ) ) &&
+							contains( context, elem ) &&
+							elem.id === m ) {
+
+							results.push( elem );
+							return results;
+						}
+					}
+
+				// Type selector
+				} else if ( match[ 2 ] ) {
+					push.apply( results, context.getElementsByTagName( selector ) );
+					return results;
+
+				// Class selector
+				} else if ( ( m = match[ 3 ] ) && support.getElementsByClassName &&
+					context.getElementsByClassName ) {
+
+					push.apply( results, context.getElementsByClassName( m ) );
+					return results;
+				}
+			}
+
+			// Take advantage of querySelectorAll
+			if ( support.qsa &&
+				!nonnativeSelectorCache[ selector + " " ] &&
+				( !rbuggyQSA || !rbuggyQSA.test( selector ) ) &&
+
+				// Support: IE 8 only
+				// Exclude object elements
+				( nodeType !== 1 || context.nodeName.toLowerCase() !== "object" ) ) {
+
+				newSelector = selector;
+				newContext = context;
+
+				// qSA considers elements outside a scoping root when evaluating child or
+				// descendant combinators, which is not what we want.
+				// In such cases, we work around the behavior by prefixing every selector in the
+				// list with an ID selector referencing the scope context.
+				// The technique has to be used as well when a leading combinator is used
+				// as such selectors are not recognized by querySelectorAll.
+				// Thanks to Andrew Dupont for this technique.
+				if ( nodeType === 1 &&
+					( rdescend.test( selector ) || rcombinators.test( selector ) ) ) {
+
+					// Expand context for sibling selectors
+					newContext = rsibling.test( selector ) && testContext( context.parentNode ) ||
+						context;
+
+					// We can use :scope instead of the ID hack if the browser
+					// supports it & if we're not changing the context.
+					if ( newContext !== context || !support.scope ) {
+
+						// Capture the context ID, setting it first if necessary
+						if ( ( nid = context.getAttribute( "id" ) ) ) {
+							nid = nid.replace( rcssescape, fcssescape );
+						} else {
+							context.setAttribute( "id", ( nid = expando ) );
+						}
+					}
+
+					// Prefix every selector in the list
+					groups = tokenize( selector );
+					i = groups.length;
+					while ( i-- ) {
+						groups[ i ] = ( nid ? "#" + nid : ":scope" ) + " " +
+							toSelector( groups[ i ] );
+					}
+					newSelector = groups.join( "," );
+				}
+
+				try {
+					push.apply( results,
+						newContext.querySelectorAll( newSelector )
+					);
+					return results;
+				} catch ( qsaError ) {
+					nonnativeSelectorCache( selector, true );
+				} finally {
+					if ( nid === expando ) {
+						context.removeAttribute( "id" );
+					}
+				}
+			}
+		}
+	}
+
+	// All others
+	return select( selector.replace( rtrim, "$1" ), context, results, seed );
+}
+
+/**
+ * Create key-value caches of limited size
+ * @returns {function(string, object)} Returns the Object data after storing it on itself with
+ *	property name the (space-suffixed) string and (if the cache is larger than Expr.cacheLength)
+ *	deleting the oldest entry
+ */
+function createCache() {
+	var keys = [];
+
+	function cache( key, value ) {
+
+		// Use (key + " ") to avoid collision with native prototype properties (see Issue #157)
+		if ( keys.push( key + " " ) > Expr.cacheLength ) {
+
+			// Only keep the most recent entries
+			delete cache[ keys.shift() ];
+		}
+		return ( cache[ key + " " ] = value );
+	}
+	return cache;
+}
+
+/**
+ * Mark a function for special use by Sizzle
+ * @param {Function} fn The function to mark
+ */
+function markFunction( fn ) {
+	fn[ expando ] = true;
+	return fn;
+}
+
+/**
+ * Support testing using an element
+ * @param {Function} fn Passed the created element and returns a boolean result
+ */
+function assert( fn ) {
+	var el = document.createElement( "fieldset" );
+
+	try {
+		return !!fn( el );
+	} catch ( e ) {
+		return false;
+	} finally {
+
+		// Remove from its parent by default
+		if ( el.parentNode ) {
+			el.parentNode.removeChild( el );
+		}
+
+		// release memory in IE
+		el = null;
+	}
+}
+
+/**
+ * Adds the same handler for all of the specified attrs
+ * @param {String} attrs Pipe-separated list of attributes
+ * @param {Function} handler The method that will be applied
+ */
+function addHandle( attrs, handler ) {
+	var arr = attrs.split( "|" ),
+		i = arr.length;
+
+	while ( i-- ) {
+		Expr.attrHandle[ arr[ i ] ] = handler;
+	}
+}
+
+/**
+ * Checks document order of two siblings
+ * @param {Element} a
+ * @param {Element} b
+ * @returns {Number} Returns less than 0 if a precedes b, greater than 0 if a follows b
+ */
+function siblingCheck( a, b ) {
+	var cur = b && a,
+		diff = cur && a.nodeType === 1 && b.nodeType === 1 &&
+			a.sourceIndex - b.sourceIndex;
+
+	// Use IE sourceIndex if available on both nodes
+	if ( diff ) {
+		return diff;
+	}
+
+	// Check if b follows a
+	if ( cur ) {
+		while ( ( cur = cur.nextSibling ) ) {
+			if ( cur === b ) {
+				return -1;
+			}
+		}
+	}
+
+	return a ? 1 : -1;
+}
+
+/**
+ * Returns a function to use in pseudos for input types
+ * @param {String} type
+ */
+function createInputPseudo( type ) {
+	return function( elem ) {
+		var name = elem.nodeName.toLowerCase();
+		return name === "input" && elem.type === type;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for buttons
+ * @param {String} type
+ */
+function createButtonPseudo( type ) {
+	return function( elem ) {
+		var name = elem.nodeName.toLowerCase();
+		return ( name === "input" || name === "button" ) && elem.type === type;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for :enabled/:disabled
+ * @param {Boolean} disabled true for :disabled; false for :enabled
+ */
+function createDisabledPseudo( disabled ) {
+
+	// Known :disabled false positives: fieldset[disabled] > legend:nth-of-type(n+2) :can-disable
+	return function( elem ) {
+
+		// Only certain elements can match :enabled or :disabled
+		// https://html.spec.whatwg.org/multipage/scripting.html#selector-enabled
+		// https://html.spec.whatwg.org/multipage/scripting.html#selector-disabled
+		if ( "form" in elem ) {
+
+			// Check for inherited disabledness on relevant non-disabled elements:
+			// * listed form-associated elements in a disabled fieldset
+			//   https://html.spec.whatwg.org/multipage/forms.html#category-listed
+			//   https://html.spec.whatwg.org/multipage/forms.html#concept-fe-disabled
+			// * option elements in a disabled optgroup
+			//   https://html.spec.whatwg.org/multipage/forms.html#concept-option-disabled
+			// All such elements have a "form" property.
+			if ( elem.parentNode && elem.disabled === false ) {
+
+				// Option elements defer to a parent optgroup if present
+				if ( "label" in elem ) {
+					if ( "label" in elem.parentNode ) {
+						return elem.parentNode.disabled === disabled;
+					} else {
+						return elem.disabled === disabled;
+					}
+				}
+
+				// Support: IE 6 - 11
+				// Use the isDisabled shortcut property to check for disabled fieldset ancestors
+				return elem.isDisabled === disabled ||
+
+					// Where there is no isDisabled, check manually
+					/* jshint -W018 */
+					elem.isDisabled !== !disabled &&
+					inDisabledFieldset( elem ) === disabled;
+			}
+
+			return elem.disabled === disabled;
+
+		// Try to winnow out elements that can't be disabled before trusting the disabled property.
+		// Some victims get caught in our net (label, legend, menu, track), but it shouldn't
+		// even exist on them, let alone have a boolean value.
+		} else if ( "label" in elem ) {
+			return elem.disabled === disabled;
+		}
+
+		// Remaining elements are neither :enabled nor :disabled
+		return false;
+	};
+}
+
+/**
+ * Returns a function to use in pseudos for positionals
+ * @param {Function} fn
+ */
+function createPositionalPseudo( fn ) {
+	return markFunction( function( argument ) {
+		argument = +argument;
+		return markFunction( function( seed, matches ) {
+			var j,
+				matchIndexes = fn( [], seed.length, argument ),
+				i = matchIndexes.length;
+
+			// Match elements found at the specified indexes
+			while ( i-- ) {
+				if ( seed[ ( j = matchIndexes[ i ] ) ] ) {
+					seed[ j ] = !( matches[ j ] = seed[ j ] );
+				}
+			}
+		} );
+	} );
+}
+
+/**
+ * Checks a node for validity as a Sizzle context
+ * @param {Element|Object=} context
+ * @returns {Element|Object|Boolean} The input node if acceptable, otherwise a falsy value
+ */
+function testContext( context ) {
+	return context && typeof context.getElementsByTagName !== "undefined" && context;
+}
+
+// Expose support vars for convenience
+support = Sizzle.support = {};
+
+/**
+ * Detects XML nodes
+ * @param {Element|Object} elem An element or a document
+ * @returns {Boolean} True iff elem is a non-HTML XML node
+ */
+isXML = Sizzle.isXML = function( elem ) {
+	var namespace = elem.namespaceURI,
+		docElem = ( elem.ownerDocument || elem ).documentElement;
+
+	// Support: IE <=8
+	// Assume HTML when documentElement doesn't yet exist, such as inside loading iframes
+	// https://bugs.jquery.com/ticket/4833
+	return !rhtml.test( namespace || docElem && docElem.nodeName || "HTML" );
+};
+
+/**
+ * Sets document-related variables once based on the current document
+ * @param {Element|Object} [doc] An element or document object to use to set the document
+ * @returns {Object} Returns the current document
+ */
+setDocument = Sizzle.setDocument = function( node ) {
+	var hasCompare, subWindow,
+		doc = node ? node.ownerDocument || node : preferredDoc;
+
+	// Return early if doc is invalid or already selected
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( doc == document || doc.nodeType !== 9 || !doc.documentElement ) {
+		return document;
+	}
+
+	// Update global variables
+	document = doc;
+	docElem = document.documentElement;
+	documentIsHTML = !isXML( document );
+
+	// Support: IE 9 - 11+, Edge 12 - 18+
+	// Accessing iframe documents after unload throws "permission denied" errors (jQuery #13936)
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( preferredDoc != document &&
+		( subWindow = document.defaultView ) && subWindow.top !== subWindow ) {
+
+		// Support: IE 11, Edge
+		if ( subWindow.addEventListener ) {
+			subWindow.addEventListener( "unload", unloadHandler, false );
+
+		// Support: IE 9 - 10 only
+		} else if ( subWindow.attachEvent ) {
+			subWindow.attachEvent( "onunload", unloadHandler );
+		}
+	}
+
+	// Support: IE 8 - 11+, Edge 12 - 18+, Chrome <=16 - 25 only, Firefox <=3.6 - 31 only,
+	// Safari 4 - 5 only, Opera <=11.6 - 12.x only
+	// IE/Edge & older browsers don't support the :scope pseudo-class.
+	// Support: Safari 6.0 only
+	// Safari 6.0 supports :scope but it's an alias of :root there.
+	support.scope = assert( function( el ) {
+		docElem.appendChild( el ).appendChild( document.createElement( "div" ) );
+		return typeof el.querySelectorAll !== "undefined" &&
+			!el.querySelectorAll( ":scope fieldset div" ).length;
+	} );
+
+	/* Attributes
+	---------------------------------------------------------------------- */
+
+	// Support: IE<8
+	// Verify that getAttribute really returns attributes and not properties
+	// (excepting IE8 booleans)
+	support.attributes = assert( function( el ) {
+		el.className = "i";
+		return !el.getAttribute( "className" );
+	} );
+
+	/* getElement(s)By*
+	---------------------------------------------------------------------- */
+
+	// Check if getElementsByTagName("*") returns only elements
+	support.getElementsByTagName = assert( function( el ) {
+		el.appendChild( document.createComment( "" ) );
+		return !el.getElementsByTagName( "*" ).length;
+	} );
+
+	// Support: IE<9
+	support.getElementsByClassName = rnative.test( document.getElementsByClassName );
+
+	// Support: IE<10
+	// Check if getElementById returns elements by name
+	// The broken getElementById methods don't pick up programmatically-set names,
+	// so use a roundabout getElementsByName test
+	support.getById = assert( function( el ) {
+		docElem.appendChild( el ).id = expando;
+		return !document.getElementsByName || !document.getElementsByName( expando ).length;
+	} );
+
+	// ID filter and find
+	if ( support.getById ) {
+		Expr.filter[ "ID" ] = function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				return elem.getAttribute( "id" ) === attrId;
+			};
+		};
+		Expr.find[ "ID" ] = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var elem = context.getElementById( id );
+				return elem ? [ elem ] : [];
+			}
+		};
+	} else {
+		Expr.filter[ "ID" ] =  function( id ) {
+			var attrId = id.replace( runescape, funescape );
+			return function( elem ) {
+				var node = typeof elem.getAttributeNode !== "undefined" &&
+					elem.getAttributeNode( "id" );
+				return node && node.value === attrId;
+			};
+		};
+
+		// Support: IE 6 - 7 only
+		// getElementById is not reliable as a find shortcut
+		Expr.find[ "ID" ] = function( id, context ) {
+			if ( typeof context.getElementById !== "undefined" && documentIsHTML ) {
+				var node, i, elems,
+					elem = context.getElementById( id );
+
+				if ( elem ) {
+
+					// Verify the id attribute
+					node = elem.getAttributeNode( "id" );
+					if ( node && node.value === id ) {
+						return [ elem ];
+					}
+
+					// Fall back on getElementsByName
+					elems = context.getElementsByName( id );
+					i = 0;
+					while ( ( elem = elems[ i++ ] ) ) {
+						node = elem.getAttributeNode( "id" );
+						if ( node && node.value === id ) {
+							return [ elem ];
+						}
+					}
+				}
+
+				return [];
+			}
+		};
+	}
+
+	// Tag
+	Expr.find[ "TAG" ] = support.getElementsByTagName ?
+		function( tag, context ) {
+			if ( typeof context.getElementsByTagName !== "undefined" ) {
+				return context.getElementsByTagName( tag );
+
+			// DocumentFragment nodes don't have gEBTN
+			} else if ( support.qsa ) {
+				return context.querySelectorAll( tag );
+			}
+		} :
+
+		function( tag, context ) {
+			var elem,
+				tmp = [],
+				i = 0,
+
+				// By happy coincidence, a (broken) gEBTN appears on DocumentFragment nodes too
+				results = context.getElementsByTagName( tag );
+
+			// Filter out possible comments
+			if ( tag === "*" ) {
+				while ( ( elem = results[ i++ ] ) ) {
+					if ( elem.nodeType === 1 ) {
+						tmp.push( elem );
+					}
+				}
+
+				return tmp;
+			}
+			return results;
+		};
+
+	// Class
+	Expr.find[ "CLASS" ] = support.getElementsByClassName && function( className, context ) {
+		if ( typeof context.getElementsByClassName !== "undefined" && documentIsHTML ) {
+			return context.getElementsByClassName( className );
+		}
+	};
+
+	/* QSA/matchesSelector
+	---------------------------------------------------------------------- */
+
+	// QSA and matchesSelector support
+
+	// matchesSelector(:active) reports false when true (IE9/Opera 11.5)
+	rbuggyMatches = [];
+
+	// qSa(:focus) reports false when true (Chrome 21)
+	// We allow this because of a bug in IE8/9 that throws an error
+	// whenever `document.activeElement` is accessed on an iframe
+	// So, we allow :focus to pass through QSA all the time to avoid the IE error
+	// See https://bugs.jquery.com/ticket/13378
+	rbuggyQSA = [];
+
+	if ( ( support.qsa = rnative.test( document.querySelectorAll ) ) ) {
+
+		// Build QSA regex
+		// Regex strategy adopted from Diego Perini
+		assert( function( el ) {
+
+			var input;
+
+			// Select is set to empty string on purpose
+			// This is to test IE's treatment of not explicitly
+			// setting a boolean content attribute,
+			// since its presence should be enough
+			// https://bugs.jquery.com/ticket/12359
+			docElem.appendChild( el ).innerHTML = "<a id='" + expando + "'></a>" +
+				"<select id='" + expando + "-\r\\' msallowcapture=''>" +
+				"<option selected=''></option></select>";
+
+			// Support: IE8, Opera 11-12.16
+			// Nothing should be selected when empty strings follow ^= or $= or *=
+			// The test attribute must be unknown in Opera but "safe" for WinRT
+			// https://msdn.microsoft.com/en-us/library/ie/hh465388.aspx#attribute_section
+			if ( el.querySelectorAll( "[msallowcapture^='']" ).length ) {
+				rbuggyQSA.push( "[*^$]=" + whitespace + "*(?:''|\"\")" );
+			}
+
+			// Support: IE8
+			// Boolean attributes and "value" are not treated correctly
+			if ( !el.querySelectorAll( "[selected]" ).length ) {
+				rbuggyQSA.push( "\\[" + whitespace + "*(?:value|" + booleans + ")" );
+			}
+
+			// Support: Chrome<29, Android<4.4, Safari<7.0+, iOS<7.0+, PhantomJS<1.9.8+
+			if ( !el.querySelectorAll( "[id~=" + expando + "-]" ).length ) {
+				rbuggyQSA.push( "~=" );
+			}
+
+			// Support: IE 11+, Edge 15 - 18+
+			// IE 11/Edge don't find elements on a `[name='']` query in some cases.
+			// Adding a temporary attribute to the document before the selection works
+			// around the issue.
+			// Interestingly, IE 10 & older don't seem to have the issue.
+			input = document.createElement( "input" );
+			input.setAttribute( "name", "" );
+			el.appendChild( input );
+			if ( !el.querySelectorAll( "[name='']" ).length ) {
+				rbuggyQSA.push( "\\[" + whitespace + "*name" + whitespace + "*=" +
+					whitespace + "*(?:''|\"\")" );
+			}
+
+			// Webkit/Opera - :checked should return selected option elements
+			// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+			// IE8 throws error here and will not see later tests
+			if ( !el.querySelectorAll( ":checked" ).length ) {
+				rbuggyQSA.push( ":checked" );
+			}
+
+			// Support: Safari 8+, iOS 8+
+			// https://bugs.webkit.org/show_bug.cgi?id=136851
+			// In-page `selector#id sibling-combinator selector` fails
+			if ( !el.querySelectorAll( "a#" + expando + "+*" ).length ) {
+				rbuggyQSA.push( ".#.+[+~]" );
+			}
+
+			// Support: Firefox <=3.6 - 5 only
+			// Old Firefox doesn't throw on a badly-escaped identifier.
+			el.querySelectorAll( "\\\f" );
+			rbuggyQSA.push( "[\\r\\n\\f]" );
+		} );
+
+		assert( function( el ) {
+			el.innerHTML = "<a href='' disabled='disabled'></a>" +
+				"<select disabled='disabled'><option/></select>";
+
+			// Support: Windows 8 Native Apps
+			// The type and name attributes are restricted during .innerHTML assignment
+			var input = document.createElement( "input" );
+			input.setAttribute( "type", "hidden" );
+			el.appendChild( input ).setAttribute( "name", "D" );
+
+			// Support: IE8
+			// Enforce case-sensitivity of name attribute
+			if ( el.querySelectorAll( "[name=d]" ).length ) {
+				rbuggyQSA.push( "name" + whitespace + "*[*^$|!~]?=" );
+			}
+
+			// FF 3.5 - :enabled/:disabled and hidden elements (hidden elements are still enabled)
+			// IE8 throws error here and will not see later tests
+			if ( el.querySelectorAll( ":enabled" ).length !== 2 ) {
+				rbuggyQSA.push( ":enabled", ":disabled" );
+			}
+
+			// Support: IE9-11+
+			// IE's :disabled selector does not pick up the children of disabled fieldsets
+			docElem.appendChild( el ).disabled = true;
+			if ( el.querySelectorAll( ":disabled" ).length !== 2 ) {
+				rbuggyQSA.push( ":enabled", ":disabled" );
+			}
+
+			// Support: Opera 10 - 11 only
+			// Opera 10-11 does not throw on post-comma invalid pseudos
+			el.querySelectorAll( "*,:x" );
+			rbuggyQSA.push( ",.*:" );
+		} );
+	}
+
+	if ( ( support.matchesSelector = rnative.test( ( matches = docElem.matches ||
+		docElem.webkitMatchesSelector ||
+		docElem.mozMatchesSelector ||
+		docElem.oMatchesSelector ||
+		docElem.msMatchesSelector ) ) ) ) {
+
+		assert( function( el ) {
+
+			// Check to see if it's possible to do matchesSelector
+			// on a disconnected node (IE 9)
+			support.disconnectedMatch = matches.call( el, "*" );
+
+			// This should fail with an exception
+			// Gecko does not error, returns false instead
+			matches.call( el, "[s!='']:x" );
+			rbuggyMatches.push( "!=", pseudos );
+		} );
+	}
+
+	rbuggyQSA = rbuggyQSA.length && new RegExp( rbuggyQSA.join( "|" ) );
+	rbuggyMatches = rbuggyMatches.length && new RegExp( rbuggyMatches.join( "|" ) );
+
+	/* Contains
+	---------------------------------------------------------------------- */
+	hasCompare = rnative.test( docElem.compareDocumentPosition );
+
+	// Element contains another
+	// Purposefully self-exclusive
+	// As in, an element does not contain itself
+	contains = hasCompare || rnative.test( docElem.contains ) ?
+		function( a, b ) {
+			var adown = a.nodeType === 9 ? a.documentElement : a,
+				bup = b && b.parentNode;
+			return a === bup || !!( bup && bup.nodeType === 1 && (
+				adown.contains ?
+					adown.contains( bup ) :
+					a.compareDocumentPosition && a.compareDocumentPosition( bup ) & 16
+			) );
+		} :
+		function( a, b ) {
+			if ( b ) {
+				while ( ( b = b.parentNode ) ) {
+					if ( b === a ) {
+						return true;
+					}
+				}
+			}
+			return false;
+		};
+
+	/* Sorting
+	---------------------------------------------------------------------- */
+
+	// Document order sorting
+	sortOrder = hasCompare ?
+	function( a, b ) {
+
+		// Flag for duplicate removal
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
+		}
+
+		// Sort on method existence if only one input has compareDocumentPosition
+		var compare = !a.compareDocumentPosition - !b.compareDocumentPosition;
+		if ( compare ) {
+			return compare;
+		}
+
+		// Calculate position if both inputs belong to the same document
+		// Support: IE 11+, Edge 17 - 18+
+		// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+		// two documents; shallow comparisons work.
+		// eslint-disable-next-line eqeqeq
+		compare = ( a.ownerDocument || a ) == ( b.ownerDocument || b ) ?
+			a.compareDocumentPosition( b ) :
+
+			// Otherwise we know they are disconnected
+			1;
+
+		// Disconnected nodes
+		if ( compare & 1 ||
+			( !support.sortDetached && b.compareDocumentPosition( a ) === compare ) ) {
+
+			// Choose the first element that is related to our preferred document
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			if ( a == document || a.ownerDocument == preferredDoc &&
+				contains( preferredDoc, a ) ) {
+				return -1;
+			}
+
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			// eslint-disable-next-line eqeqeq
+			if ( b == document || b.ownerDocument == preferredDoc &&
+				contains( preferredDoc, b ) ) {
+				return 1;
+			}
+
+			// Maintain original order
+			return sortInput ?
+				( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+				0;
+		}
+
+		return compare & 4 ? -1 : 1;
+	} :
+	function( a, b ) {
+
+		// Exit early if the nodes are identical
+		if ( a === b ) {
+			hasDuplicate = true;
+			return 0;
+		}
+
+		var cur,
+			i = 0,
+			aup = a.parentNode,
+			bup = b.parentNode,
+			ap = [ a ],
+			bp = [ b ];
+
+		// Parentless nodes are either documents or disconnected
+		if ( !aup || !bup ) {
+
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			/* eslint-disable eqeqeq */
+			return a == document ? -1 :
+				b == document ? 1 :
+				/* eslint-enable eqeqeq */
+				aup ? -1 :
+				bup ? 1 :
+				sortInput ?
+				( indexOf( sortInput, a ) - indexOf( sortInput, b ) ) :
+				0;
+
+		// If the nodes are siblings, we can do a quick check
+		} else if ( aup === bup ) {
+			return siblingCheck( a, b );
+		}
+
+		// Otherwise we need full lists of their ancestors for comparison
+		cur = a;
+		while ( ( cur = cur.parentNode ) ) {
+			ap.unshift( cur );
+		}
+		cur = b;
+		while ( ( cur = cur.parentNode ) ) {
+			bp.unshift( cur );
+		}
+
+		// Walk down the tree looking for a discrepancy
+		while ( ap[ i ] === bp[ i ] ) {
+			i++;
+		}
+
+		return i ?
+
+			// Do a sibling check if the nodes have a common ancestor
+			siblingCheck( ap[ i ], bp[ i ] ) :
+
+			// Otherwise nodes in our document sort first
+			// Support: IE 11+, Edge 17 - 18+
+			// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+			// two documents; shallow comparisons work.
+			/* eslint-disable eqeqeq */
+			ap[ i ] == preferredDoc ? -1 :
+			bp[ i ] == preferredDoc ? 1 :
+			/* eslint-enable eqeqeq */
+			0;
+	};
+
+	return document;
+};
+
+Sizzle.matches = function( expr, elements ) {
+	return Sizzle( expr, null, null, elements );
+};
+
+Sizzle.matchesSelector = function( elem, expr ) {
+	setDocument( elem );
+
+	if ( support.matchesSelector && documentIsHTML &&
+		!nonnativeSelectorCache[ expr + " " ] &&
+		( !rbuggyMatches || !rbuggyMatches.test( expr ) ) &&
+		( !rbuggyQSA     || !rbuggyQSA.test( expr ) ) ) {
+
+		try {
+			var ret = matches.call( elem, expr );
+
+			// IE 9's matchesSelector returns false on disconnected nodes
+			if ( ret || support.disconnectedMatch ||
+
+				// As well, disconnected nodes are said to be in a document
+				// fragment in IE 9
+				elem.document && elem.document.nodeType !== 11 ) {
+				return ret;
+			}
+		} catch ( e ) {
+			nonnativeSelectorCache( expr, true );
+		}
+	}
+
+	return Sizzle( expr, document, null, [ elem ] ).length > 0;
+};
+
+Sizzle.contains = function( context, elem ) {
+
+	// Set document vars if needed
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( ( context.ownerDocument || context ) != document ) {
+		setDocument( context );
+	}
+	return contains( context, elem );
+};
+
+Sizzle.attr = function( elem, name ) {
+
+	// Set document vars if needed
+	// Support: IE 11+, Edge 17 - 18+
+	// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+	// two documents; shallow comparisons work.
+	// eslint-disable-next-line eqeqeq
+	if ( ( elem.ownerDocument || elem ) != document ) {
+		setDocument( elem );
+	}
+
+	var fn = Expr.attrHandle[ name.toLowerCase() ],
+
+		// Don't get fooled by Object.prototype properties (jQuery #13807)
+		val = fn && hasOwn.call( Expr.attrHandle, name.toLowerCase() ) ?
+			fn( elem, name, !documentIsHTML ) :
+			undefined;
+
+	return val !== undefined ?
+		val :
+		support.attributes || !documentIsHTML ?
+			elem.getAttribute( name ) :
+			( val = elem.getAttributeNode( name ) ) && val.specified ?
+				val.value :
+				null;
+};
+
+Sizzle.escape = function( sel ) {
+	return ( sel + "" ).replace( rcssescape, fcssescape );
+};
+
+Sizzle.error = function( msg ) {
+	throw new Error( "Syntax error, unrecognized expression: " + msg );
+};
+
+/**
+ * Document sorting and removing duplicates
+ * @param {ArrayLike} results
+ */
+Sizzle.uniqueSort = function( results ) {
+	var elem,
+		duplicates = [],
+		j = 0,
+		i = 0;
+
+	// Unless we *know* we can detect duplicates, assume their presence
+	hasDuplicate = !support.detectDuplicates;
+	sortInput = !support.sortStable && results.slice( 0 );
+	results.sort( sortOrder );
+
+	if ( hasDuplicate ) {
+		while ( ( elem = results[ i++ ] ) ) {
+			if ( elem === results[ i ] ) {
+				j = duplicates.push( i );
+			}
+		}
+		while ( j-- ) {
+			results.splice( duplicates[ j ], 1 );
+		}
+	}
+
+	// Clear input after sorting to release objects
+	// See https://github.com/jquery/sizzle/pull/225
+	sortInput = null;
+
+	return results;
+};
+
+/**
+ * Utility function for retrieving the text value of an array of DOM nodes
+ * @param {Array|Element} elem
+ */
+getText = Sizzle.getText = function( elem ) {
+	var node,
+		ret = "",
+		i = 0,
+		nodeType = elem.nodeType;
+
+	if ( !nodeType ) {
+
+		// If no nodeType, this is expected to be an array
+		while ( ( node = elem[ i++ ] ) ) {
+
+			// Do not traverse comment nodes
+			ret += getText( node );
+		}
+	} else if ( nodeType === 1 || nodeType === 9 || nodeType === 11 ) {
+
+		// Use textContent for elements
+		// innerText usage removed for consistency of new lines (jQuery #11153)
+		if ( typeof elem.textContent === "string" ) {
+			return elem.textContent;
+		} else {
+
+			// Traverse its children
+			for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+				ret += getText( elem );
+			}
+		}
+	} else if ( nodeType === 3 || nodeType === 4 ) {
+		return elem.nodeValue;
+	}
+
+	// Do not include comment or processing instruction nodes
+
+	return ret;
+};
+
+Expr = Sizzle.selectors = {
+
+	// Can be adjusted by the user
+	cacheLength: 50,
+
+	createPseudo: markFunction,
+
+	match: matchExpr,
+
+	attrHandle: {},
+
+	find: {},
+
+	relative: {
+		">": { dir: "parentNode", first: true },
+		" ": { dir: "parentNode" },
+		"+": { dir: "previousSibling", first: true },
+		"~": { dir: "previousSibling" }
+	},
+
+	preFilter: {
+		"ATTR": function( match ) {
+			match[ 1 ] = match[ 1 ].replace( runescape, funescape );
+
+			// Move the given value to match[3] whether quoted or unquoted
+			match[ 3 ] = ( match[ 3 ] || match[ 4 ] ||
+				match[ 5 ] || "" ).replace( runescape, funescape );
+
+			if ( match[ 2 ] === "~=" ) {
+				match[ 3 ] = " " + match[ 3 ] + " ";
+			}
+
+			return match.slice( 0, 4 );
+		},
+
+		"CHILD": function( match ) {
+
+			/* matches from matchExpr["CHILD"]
+				1 type (only|nth|...)
+				2 what (child|of-type)
+				3 argument (even|odd|\d*|\d*n([+-]\d+)?|...)
+				4 xn-component of xn+y argument ([+-]?\d*n|)
+				5 sign of xn-component
+				6 x of xn-component
+				7 sign of y-component
+				8 y of y-component
+			*/
+			match[ 1 ] = match[ 1 ].toLowerCase();
+
+			if ( match[ 1 ].slice( 0, 3 ) === "nth" ) {
+
+				// nth-* requires argument
+				if ( !match[ 3 ] ) {
+					Sizzle.error( match[ 0 ] );
+				}
+
+				// numeric x and y parameters for Expr.filter.CHILD
+				// remember that false/true cast respectively to 0/1
+				match[ 4 ] = +( match[ 4 ] ?
+					match[ 5 ] + ( match[ 6 ] || 1 ) :
+					2 * ( match[ 3 ] === "even" || match[ 3 ] === "odd" ) );
+				match[ 5 ] = +( ( match[ 7 ] + match[ 8 ] ) || match[ 3 ] === "odd" );
+
+				// other types prohibit arguments
+			} else if ( match[ 3 ] ) {
+				Sizzle.error( match[ 0 ] );
+			}
+
+			return match;
+		},
+
+		"PSEUDO": function( match ) {
+			var excess,
+				unquoted = !match[ 6 ] && match[ 2 ];
+
+			if ( matchExpr[ "CHILD" ].test( match[ 0 ] ) ) {
+				return null;
+			}
+
+			// Accept quoted arguments as-is
+			if ( match[ 3 ] ) {
+				match[ 2 ] = match[ 4 ] || match[ 5 ] || "";
+
+			// Strip excess characters from unquoted arguments
+			} else if ( unquoted && rpseudo.test( unquoted ) &&
+
+				// Get excess from tokenize (recursively)
+				( excess = tokenize( unquoted, true ) ) &&
+
+				// advance to the next closing parenthesis
+				( excess = unquoted.indexOf( ")", unquoted.length - excess ) - unquoted.length ) ) {
+
+				// excess is a negative index
+				match[ 0 ] = match[ 0 ].slice( 0, excess );
+				match[ 2 ] = unquoted.slice( 0, excess );
+			}
+
+			// Return only captures needed by the pseudo filter method (type and argument)
+			return match.slice( 0, 3 );
+		}
+	},
+
+	filter: {
+
+		"TAG": function( nodeNameSelector ) {
+			var nodeName = nodeNameSelector.replace( runescape, funescape ).toLowerCase();
+			return nodeNameSelector === "*" ?
+				function() {
+					return true;
+				} :
+				function( elem ) {
+					return elem.nodeName && elem.nodeName.toLowerCase() === nodeName;
+				};
+		},
+
+		"CLASS": function( className ) {
+			var pattern = classCache[ className + " " ];
+
+			return pattern ||
+				( pattern = new RegExp( "(^|" + whitespace +
+					")" + className + "(" + whitespace + "|$)" ) ) && classCache(
+						className, function( elem ) {
+							return pattern.test(
+								typeof elem.className === "string" && elem.className ||
+								typeof elem.getAttribute !== "undefined" &&
+									elem.getAttribute( "class" ) ||
+								""
+							);
+				} );
+		},
+
+		"ATTR": function( name, operator, check ) {
+			return function( elem ) {
+				var result = Sizzle.attr( elem, name );
+
+				if ( result == null ) {
+					return operator === "!=";
+				}
+				if ( !operator ) {
+					return true;
+				}
+
+				result += "";
+
+				/* eslint-disable max-len */
+
+				return operator === "=" ? result === check :
+					operator === "!=" ? result !== check :
+					operator === "^=" ? check && result.indexOf( check ) === 0 :
+					operator === "*=" ? check && result.indexOf( check ) > -1 :
+					operator === "$=" ? check && result.slice( -check.length ) === check :
+					operator === "~=" ? ( " " + result.replace( rwhitespace, " " ) + " " ).indexOf( check ) > -1 :
+					operator === "|=" ? result === check || result.slice( 0, check.length + 1 ) === check + "-" :
+					false;
+				/* eslint-enable max-len */
+
+			};
+		},
+
+		"CHILD": function( type, what, _argument, first, last ) {
+			var simple = type.slice( 0, 3 ) !== "nth",
+				forward = type.slice( -4 ) !== "last",
+				ofType = what === "of-type";
+
+			return first === 1 && last === 0 ?
+
+				// Shortcut for :nth-*(n)
+				function( elem ) {
+					return !!elem.parentNode;
+				} :
+
+				function( elem, _context, xml ) {
+					var cache, uniqueCache, outerCache, node, nodeIndex, start,
+						dir = simple !== forward ? "nextSibling" : "previousSibling",
+						parent = elem.parentNode,
+						name = ofType && elem.nodeName.toLowerCase(),
+						useCache = !xml && !ofType,
+						diff = false;
+
+					if ( parent ) {
+
+						// :(first|last|only)-(child|of-type)
+						if ( simple ) {
+							while ( dir ) {
+								node = elem;
+								while ( ( node = node[ dir ] ) ) {
+									if ( ofType ?
+										node.nodeName.toLowerCase() === name :
+										node.nodeType === 1 ) {
+
+										return false;
+									}
+								}
+
+								// Reverse direction for :only-* (if we haven't yet done so)
+								start = dir = type === "only" && !start && "nextSibling";
+							}
+							return true;
+						}
+
+						start = [ forward ? parent.firstChild : parent.lastChild ];
+
+						// non-xml :nth-child(...) stores cache data on `parent`
+						if ( forward && useCache ) {
+
+							// Seek `elem` from a previously-cached index
+
+							// ...in a gzip-friendly way
+							node = parent;
+							outerCache = node[ expando ] || ( node[ expando ] = {} );
+
+							// Support: IE <9 only
+							// Defend against cloned attroperties (jQuery gh-1709)
+							uniqueCache = outerCache[ node.uniqueID ] ||
+								( outerCache[ node.uniqueID ] = {} );
+
+							cache = uniqueCache[ type ] || [];
+							nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+							diff = nodeIndex && cache[ 2 ];
+							node = nodeIndex && parent.childNodes[ nodeIndex ];
+
+							while ( ( node = ++nodeIndex && node && node[ dir ] ||
+
+								// Fallback to seeking `elem` from the start
+								( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+								// When found, cache indexes on `parent` and break
+								if ( node.nodeType === 1 && ++diff && node === elem ) {
+									uniqueCache[ type ] = [ dirruns, nodeIndex, diff ];
+									break;
+								}
+							}
+
+						} else {
+
+							// Use previously-cached element index if available
+							if ( useCache ) {
+
+								// ...in a gzip-friendly way
+								node = elem;
+								outerCache = node[ expando ] || ( node[ expando ] = {} );
+
+								// Support: IE <9 only
+								// Defend against cloned attroperties (jQuery gh-1709)
+								uniqueCache = outerCache[ node.uniqueID ] ||
+									( outerCache[ node.uniqueID ] = {} );
+
+								cache = uniqueCache[ type ] || [];
+								nodeIndex = cache[ 0 ] === dirruns && cache[ 1 ];
+								diff = nodeIndex;
+							}
+
+							// xml :nth-child(...)
+							// or :nth-last-child(...) or :nth(-last)?-of-type(...)
+							if ( diff === false ) {
+
+								// Use the same loop as above to seek `elem` from the start
+								while ( ( node = ++nodeIndex && node && node[ dir ] ||
+									( diff = nodeIndex = 0 ) || start.pop() ) ) {
+
+									if ( ( ofType ?
+										node.nodeName.toLowerCase() === name :
+										node.nodeType === 1 ) &&
+										++diff ) {
+
+										// Cache the index of each encountered element
+										if ( useCache ) {
+											outerCache = node[ expando ] ||
+												( node[ expando ] = {} );
+
+											// Support: IE <9 only
+											// Defend against cloned attroperties (jQuery gh-1709)
+											uniqueCache = outerCache[ node.uniqueID ] ||
+												( outerCache[ node.uniqueID ] = {} );
+
+											uniqueCache[ type ] = [ dirruns, diff ];
+										}
+
+										if ( node === elem ) {
+											break;
+										}
+									}
+								}
+							}
+						}
+
+						// Incorporate the offset, then check against cycle size
+						diff -= last;
+						return diff === first || ( diff % first === 0 && diff / first >= 0 );
+					}
+				};
+		},
+
+		"PSEUDO": function( pseudo, argument ) {
+
+			// pseudo-class names are case-insensitive
+			// http://www.w3.org/TR/selectors/#pseudo-classes
+			// Prioritize by case sensitivity in case custom pseudos are added with uppercase letters
+			// Remember that setFilters inherits from pseudos
+			var args,
+				fn = Expr.pseudos[ pseudo ] || Expr.setFilters[ pseudo.toLowerCase() ] ||
+					Sizzle.error( "unsupported pseudo: " + pseudo );
+
+			// The user may use createPseudo to indicate that
+			// arguments are needed to create the filter function
+			// just as Sizzle does
+			if ( fn[ expando ] ) {
+				return fn( argument );
+			}
+
+			// But maintain support for old signatures
+			if ( fn.length > 1 ) {
+				args = [ pseudo, pseudo, "", argument ];
+				return Expr.setFilters.hasOwnProperty( pseudo.toLowerCase() ) ?
+					markFunction( function( seed, matches ) {
+						var idx,
+							matched = fn( seed, argument ),
+							i = matched.length;
+						while ( i-- ) {
+							idx = indexOf( seed, matched[ i ] );
+							seed[ idx ] = !( matches[ idx ] = matched[ i ] );
+						}
+					} ) :
+					function( elem ) {
+						return fn( elem, 0, args );
+					};
+			}
+
+			return fn;
+		}
+	},
+
+	pseudos: {
+
+		// Potentially complex pseudos
+		"not": markFunction( function( selector ) {
+
+			// Trim the selector passed to compile
+			// to avoid treating leading and trailing
+			// spaces as combinators
+			var input = [],
+				results = [],
+				matcher = compile( selector.replace( rtrim, "$1" ) );
+
+			return matcher[ expando ] ?
+				markFunction( function( seed, matches, _context, xml ) {
+					var elem,
+						unmatched = matcher( seed, null, xml, [] ),
+						i = seed.length;
+
+					// Match elements unmatched by `matcher`
+					while ( i-- ) {
+						if ( ( elem = unmatched[ i ] ) ) {
+							seed[ i ] = !( matches[ i ] = elem );
+						}
+					}
+				} ) :
+				function( elem, _context, xml ) {
+					input[ 0 ] = elem;
+					matcher( input, null, xml, results );
+
+					// Don't keep the element (issue #299)
+					input[ 0 ] = null;
+					return !results.pop();
+				};
+		} ),
+
+		"has": markFunction( function( selector ) {
+			return function( elem ) {
+				return Sizzle( selector, elem ).length > 0;
+			};
+		} ),
+
+		"contains": markFunction( function( text ) {
+			text = text.replace( runescape, funescape );
+			return function( elem ) {
+				return ( elem.textContent || getText( elem ) ).indexOf( text ) > -1;
+			};
+		} ),
+
+		// "Whether an element is represented by a :lang() selector
+		// is based solely on the element's language value
+		// being equal to the identifier C,
+		// or beginning with the identifier C immediately followed by "-".
+		// The matching of C against the element's language value is performed case-insensitively.
+		// The identifier C does not have to be a valid language name."
+		// http://www.w3.org/TR/selectors/#lang-pseudo
+		"lang": markFunction( function( lang ) {
+
+			// lang value must be a valid identifier
+			if ( !ridentifier.test( lang || "" ) ) {
+				Sizzle.error( "unsupported lang: " + lang );
+			}
+			lang = lang.replace( runescape, funescape ).toLowerCase();
+			return function( elem ) {
+				var elemLang;
+				do {
+					if ( ( elemLang = documentIsHTML ?
+						elem.lang :
+						elem.getAttribute( "xml:lang" ) || elem.getAttribute( "lang" ) ) ) {
+
+						elemLang = elemLang.toLowerCase();
+						return elemLang === lang || elemLang.indexOf( lang + "-" ) === 0;
+					}
+				} while ( ( elem = elem.parentNode ) && elem.nodeType === 1 );
+				return false;
+			};
+		} ),
+
+		// Miscellaneous
+		"target": function( elem ) {
+			var hash = window.location && window.location.hash;
+			return hash && hash.slice( 1 ) === elem.id;
+		},
+
+		"root": function( elem ) {
+			return elem === docElem;
+		},
+
+		"focus": function( elem ) {
+			return elem === document.activeElement &&
+				( !document.hasFocus || document.hasFocus() ) &&
+				!!( elem.type || elem.href || ~elem.tabIndex );
+		},
+
+		// Boolean properties
+		"enabled": createDisabledPseudo( false ),
+		"disabled": createDisabledPseudo( true ),
+
+		"checked": function( elem ) {
+
+			// In CSS3, :checked should return both checked and selected elements
+			// http://www.w3.org/TR/2011/REC-css3-selectors-20110929/#checked
+			var nodeName = elem.nodeName.toLowerCase();
+			return ( nodeName === "input" && !!elem.checked ) ||
+				( nodeName === "option" && !!elem.selected );
+		},
+
+		"selected": function( elem ) {
+
+			// Accessing this property makes selected-by-default
+			// options in Safari work properly
+			if ( elem.parentNode ) {
+				// eslint-disable-next-line no-unused-expressions
+				elem.parentNode.selectedIndex;
+			}
+
+			return elem.selected === true;
+		},
+
+		// Contents
+		"empty": function( elem ) {
+
+			// http://www.w3.org/TR/selectors/#empty-pseudo
+			// :empty is negated by element (1) or content nodes (text: 3; cdata: 4; entity ref: 5),
+			//   but not by others (comment: 8; processing instruction: 7; etc.)
+			// nodeType < 6 works because attributes (2) do not appear as children
+			for ( elem = elem.firstChild; elem; elem = elem.nextSibling ) {
+				if ( elem.nodeType < 6 ) {
+					return false;
+				}
+			}
+			return true;
+		},
+
+		"parent": function( elem ) {
+			return !Expr.pseudos[ "empty" ]( elem );
+		},
+
+		// Element/input types
+		"header": function( elem ) {
+			return rheader.test( elem.nodeName );
+		},
+
+		"input": function( elem ) {
+			return rinputs.test( elem.nodeName );
+		},
+
+		"button": function( elem ) {
+			var name = elem.nodeName.toLowerCase();
+			return name === "input" && elem.type === "button" || name === "button";
+		},
+
+		"text": function( elem ) {
+			var attr;
+			return elem.nodeName.toLowerCase() === "input" &&
+				elem.type === "text" &&
+
+				// Support: IE<8
+				// New HTML5 attribute values (e.g., "search") appear with elem.type === "text"
+				( ( attr = elem.getAttribute( "type" ) ) == null ||
+					attr.toLowerCase() === "text" );
+		},
+
+		// Position-in-collection
+		"first": createPositionalPseudo( function() {
+			return [ 0 ];
+		} ),
+
+		"last": createPositionalPseudo( function( _matchIndexes, length ) {
+			return [ length - 1 ];
+		} ),
+
+		"eq": createPositionalPseudo( function( _matchIndexes, length, argument ) {
+			return [ argument < 0 ? argument + length : argument ];
+		} ),
+
+		"even": createPositionalPseudo( function( matchIndexes, length ) {
+			var i = 0;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		"odd": createPositionalPseudo( function( matchIndexes, length ) {
+			var i = 1;
+			for ( ; i < length; i += 2 ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		"lt": createPositionalPseudo( function( matchIndexes, length, argument ) {
+			var i = argument < 0 ?
+				argument + length :
+				argument > length ?
+					length :
+					argument;
+			for ( ; --i >= 0; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} ),
+
+		"gt": createPositionalPseudo( function( matchIndexes, length, argument ) {
+			var i = argument < 0 ? argument + length : argument;
+			for ( ; ++i < length; ) {
+				matchIndexes.push( i );
+			}
+			return matchIndexes;
+		} )
+	}
+};
+
+Expr.pseudos[ "nth" ] = Expr.pseudos[ "eq" ];
+
+// Add button/input type pseudos
+for ( i in { radio: true, checkbox: true, file: true, password: true, image: true } ) {
+	Expr.pseudos[ i ] = createInputPseudo( i );
+}
+for ( i in { submit: true, reset: true } ) {
+	Expr.pseudos[ i ] = createButtonPseudo( i );
+}
+
+// Easy API for creating new setFilters
+function setFilters() {}
+setFilters.prototype = Expr.filters = Expr.pseudos;
+Expr.setFilters = new setFilters();
+
+tokenize = Sizzle.tokenize = function( selector, parseOnly ) {
+	var matched, match, tokens, type,
+		soFar, groups, preFilters,
+		cached = tokenCache[ selector + " " ];
+
+	if ( cached ) {
+		return parseOnly ? 0 : cached.slice( 0 );
+	}
+
+	soFar = selector;
+	groups = [];
+	preFilters = Expr.preFilter;
+
+	while ( soFar ) {
+
+		// Comma and first run
+		if ( !matched || ( match = rcomma.exec( soFar ) ) ) {
+			if ( match ) {
+
+				// Don't consume trailing commas as valid
+				soFar = soFar.slice( match[ 0 ].length ) || soFar;
+			}
+			groups.push( ( tokens = [] ) );
+		}
+
+		matched = false;
+
+		// Combinators
+		if ( ( match = rcombinators.exec( soFar ) ) ) {
+			matched = match.shift();
+			tokens.push( {
+				value: matched,
+
+				// Cast descendant combinators to space
+				type: match[ 0 ].replace( rtrim, " " )
+			} );
+			soFar = soFar.slice( matched.length );
+		}
+
+		// Filters
+		for ( type in Expr.filter ) {
+			if ( ( match = matchExpr[ type ].exec( soFar ) ) && ( !preFilters[ type ] ||
+				( match = preFilters[ type ]( match ) ) ) ) {
+				matched = match.shift();
+				tokens.push( {
+					value: matched,
+					type: type,
+					matches: match
+				} );
+				soFar = soFar.slice( matched.length );
+			}
+		}
+
+		if ( !matched ) {
+			break;
+		}
+	}
+
+	// Return the length of the invalid excess
+	// if we're just parsing
+	// Otherwise, throw an error or return tokens
+	return parseOnly ?
+		soFar.length :
+		soFar ?
+			Sizzle.error( selector ) :
+
+			// Cache the tokens
+			tokenCache( selector, groups ).slice( 0 );
+};
+
+function toSelector( tokens ) {
+	var i = 0,
+		len = tokens.length,
+		selector = "";
+	for ( ; i < len; i++ ) {
+		selector += tokens[ i ].value;
+	}
+	return selector;
+}
+
+function addCombinator( matcher, combinator, base ) {
+	var dir = combinator.dir,
+		skip = combinator.next,
+		key = skip || dir,
+		checkNonElements = base && key === "parentNode",
+		doneName = done++;
+
+	return combinator.first ?
+
+		// Check against closest ancestor/preceding element
+		function( elem, context, xml ) {
+			while ( ( elem = elem[ dir ] ) ) {
+				if ( elem.nodeType === 1 || checkNonElements ) {
+					return matcher( elem, context, xml );
+				}
+			}
+			return false;
+		} :
+
+		// Check against all ancestor/preceding elements
+		function( elem, context, xml ) {
+			var oldCache, uniqueCache, outerCache,
+				newCache = [ dirruns, doneName ];
+
+			// We can't set arbitrary data on XML nodes, so they don't benefit from combinator caching
+			if ( xml ) {
+				while ( ( elem = elem[ dir ] ) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						if ( matcher( elem, context, xml ) ) {
+							return true;
+						}
+					}
+				}
+			} else {
+				while ( ( elem = elem[ dir ] ) ) {
+					if ( elem.nodeType === 1 || checkNonElements ) {
+						outerCache = elem[ expando ] || ( elem[ expando ] = {} );
+
+						// Support: IE <9 only
+						// Defend against cloned attroperties (jQuery gh-1709)
+						uniqueCache = outerCache[ elem.uniqueID ] ||
+							( outerCache[ elem.uniqueID ] = {} );
+
+						if ( skip && skip === elem.nodeName.toLowerCase() ) {
+							elem = elem[ dir ] || elem;
+						} else if ( ( oldCache = uniqueCache[ key ] ) &&
+							oldCache[ 0 ] === dirruns && oldCache[ 1 ] === doneName ) {
+
+							// Assign to newCache so results back-propagate to previous elements
+							return ( newCache[ 2 ] = oldCache[ 2 ] );
+						} else {
+
+							// Reuse newcache so results back-propagate to previous elements
+							uniqueCache[ key ] = newCache;
+
+							// A match means we're done; a fail means we have to keep checking
+							if ( ( newCache[ 2 ] = matcher( elem, context, xml ) ) ) {
+								return true;
+							}
+						}
+					}
+				}
+			}
+			return false;
+		};
+}
+
+function elementMatcher( matchers ) {
+	return matchers.length > 1 ?
+		function( elem, context, xml ) {
+			var i = matchers.length;
+			while ( i-- ) {
+				if ( !matchers[ i ]( elem, context, xml ) ) {
+					return false;
+				}
+			}
+			return true;
+		} :
+		matchers[ 0 ];
+}
+
+function multipleContexts( selector, contexts, results ) {
+	var i = 0,
+		len = contexts.length;
+	for ( ; i < len; i++ ) {
+		Sizzle( selector, contexts[ i ], results );
+	}
+	return results;
+}
+
+function condense( unmatched, map, filter, context, xml ) {
+	var elem,
+		newUnmatched = [],
+		i = 0,
+		len = unmatched.length,
+		mapped = map != null;
+
+	for ( ; i < len; i++ ) {
+		if ( ( elem = unmatched[ i ] ) ) {
+			if ( !filter || filter( elem, context, xml ) ) {
+				newUnmatched.push( elem );
+				if ( mapped ) {
+					map.push( i );
+				}
+			}
+		}
+	}
+
+	return newUnmatched;
+}
+
+function setMatcher( preFilter, selector, matcher, postFilter, postFinder, postSelector ) {
+	if ( postFilter && !postFilter[ expando ] ) {
+		postFilter = setMatcher( postFilter );
+	}
+	if ( postFinder && !postFinder[ expando ] ) {
+		postFinder = setMatcher( postFinder, postSelector );
+	}
+	return markFunction( function( seed, results, context, xml ) {
+		var temp, i, elem,
+			preMap = [],
+			postMap = [],
+			preexisting = results.length,
+
+			// Get initial elements from seed or context
+			elems = seed || multipleContexts(
+				selector || "*",
+				context.nodeType ? [ context ] : context,
+				[]
+			),
+
+			// Prefilter to get matcher input, preserving a map for seed-results synchronization
+			matcherIn = preFilter && ( seed || !selector ) ?
+				condense( elems, preMap, preFilter, context, xml ) :
+				elems,
+
+			matcherOut = matcher ?
+
+				// If we have a postFinder, or filtered seed, or non-seed postFilter or preexisting results,
+				postFinder || ( seed ? preFilter : preexisting || postFilter ) ?
+
+					// ...intermediate processing is necessary
+					[] :
+
+					// ...otherwise use results directly
+					results :
+				matcherIn;
+
+		// Find primary matches
+		if ( matcher ) {
+			matcher( matcherIn, matcherOut, context, xml );
+		}
+
+		// Apply postFilter
+		if ( postFilter ) {
+			temp = condense( matcherOut, postMap );
+			postFilter( temp, [], context, xml );
+
+			// Un-match failing elements by moving them back to matcherIn
+			i = temp.length;
+			while ( i-- ) {
+				if ( ( elem = temp[ i ] ) ) {
+					matcherOut[ postMap[ i ] ] = !( matcherIn[ postMap[ i ] ] = elem );
+				}
+			}
+		}
+
+		if ( seed ) {
+			if ( postFinder || preFilter ) {
+				if ( postFinder ) {
+
+					// Get the final matcherOut by condensing this intermediate into postFinder contexts
+					temp = [];
+					i = matcherOut.length;
+					while ( i-- ) {
+						if ( ( elem = matcherOut[ i ] ) ) {
+
+							// Restore matcherIn since elem is not yet a final match
+							temp.push( ( matcherIn[ i ] = elem ) );
+						}
+					}
+					postFinder( null, ( matcherOut = [] ), temp, xml );
+				}
+
+				// Move matched elements from seed to results to keep them synchronized
+				i = matcherOut.length;
+				while ( i-- ) {
+					if ( ( elem = matcherOut[ i ] ) &&
+						( temp = postFinder ? indexOf( seed, elem ) : preMap[ i ] ) > -1 ) {
+
+						seed[ temp ] = !( results[ temp ] = elem );
+					}
+				}
+			}
+
+		// Add elements to results, through postFinder if defined
+		} else {
+			matcherOut = condense(
+				matcherOut === results ?
+					matcherOut.splice( preexisting, matcherOut.length ) :
+					matcherOut
+			);
+			if ( postFinder ) {
+				postFinder( null, results, matcherOut, xml );
+			} else {
+				push.apply( results, matcherOut );
+			}
+		}
+	} );
+}
+
+function matcherFromTokens( tokens ) {
+	var checkContext, matcher, j,
+		len = tokens.length,
+		leadingRelative = Expr.relative[ tokens[ 0 ].type ],
+		implicitRelative = leadingRelative || Expr.relative[ " " ],
+		i = leadingRelative ? 1 : 0,
+
+		// The foundational matcher ensures that elements are reachable from top-level context(s)
+		matchContext = addCombinator( function( elem ) {
+			return elem === checkContext;
+		}, implicitRelative, true ),
+		matchAnyContext = addCombinator( function( elem ) {
+			return indexOf( checkContext, elem ) > -1;
+		}, implicitRelative, true ),
+		matchers = [ function( elem, context, xml ) {
+			var ret = ( !leadingRelative && ( xml || context !== outermostContext ) ) || (
+				( checkContext = context ).nodeType ?
+					matchContext( elem, context, xml ) :
+					matchAnyContext( elem, context, xml ) );
+
+			// Avoid hanging onto element (issue #299)
+			checkContext = null;
+			return ret;
+		} ];
+
+	for ( ; i < len; i++ ) {
+		if ( ( matcher = Expr.relative[ tokens[ i ].type ] ) ) {
+			matchers = [ addCombinator( elementMatcher( matchers ), matcher ) ];
+		} else {
+			matcher = Expr.filter[ tokens[ i ].type ].apply( null, tokens[ i ].matches );
+
+			// Return special upon seeing a positional matcher
+			if ( matcher[ expando ] ) {
+
+				// Find the next relative operator (if any) for proper handling
+				j = ++i;
+				for ( ; j < len; j++ ) {
+					if ( Expr.relative[ tokens[ j ].type ] ) {
+						break;
+					}
+				}
+				return setMatcher(
+					i > 1 && elementMatcher( matchers ),
+					i > 1 && toSelector(
+
+					// If the preceding token was a descendant combinator, insert an implicit any-element `*`
+					tokens
+						.slice( 0, i - 1 )
+						.concat( { value: tokens[ i - 2 ].type === " " ? "*" : "" } )
+					).replace( rtrim, "$1" ),
+					matcher,
+					i < j && matcherFromTokens( tokens.slice( i, j ) ),
+					j < len && matcherFromTokens( ( tokens = tokens.slice( j ) ) ),
+					j < len && toSelector( tokens )
+				);
+			}
+			matchers.push( matcher );
+		}
+	}
+
+	return elementMatcher( matchers );
+}
+
+function matcherFromGroupMatchers( elementMatchers, setMatchers ) {
+	var bySet = setMatchers.length > 0,
+		byElement = elementMatchers.length > 0,
+		superMatcher = function( seed, context, xml, results, outermost ) {
+			var elem, j, matcher,
+				matchedCount = 0,
+				i = "0",
+				unmatched = seed && [],
+				setMatched = [],
+				contextBackup = outermostContext,
+
+				// We must always have either seed elements or outermost context
+				elems = seed || byElement && Expr.find[ "TAG" ]( "*", outermost ),
+
+				// Use integer dirruns iff this is the outermost matcher
+				dirrunsUnique = ( dirruns += contextBackup == null ? 1 : Math.random() || 0.1 ),
+				len = elems.length;
+
+			if ( outermost ) {
+
+				// Support: IE 11+, Edge 17 - 18+
+				// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+				// two documents; shallow comparisons work.
+				// eslint-disable-next-line eqeqeq
+				outermostContext = context == document || context || outermost;
+			}
+
+			// Add elements passing elementMatchers directly to results
+			// Support: IE<9, Safari
+			// Tolerate NodeList properties (IE: "length"; Safari: <number>) matching elements by id
+			for ( ; i !== len && ( elem = elems[ i ] ) != null; i++ ) {
+				if ( byElement && elem ) {
+					j = 0;
+
+					// Support: IE 11+, Edge 17 - 18+
+					// IE/Edge sometimes throw a "Permission denied" error when strict-comparing
+					// two documents; shallow comparisons work.
+					// eslint-disable-next-line eqeqeq
+					if ( !context && elem.ownerDocument != document ) {
+						setDocument( elem );
+						xml = !documentIsHTML;
+					}
+					while ( ( matcher = elementMatchers[ j++ ] ) ) {
+						if ( matcher( elem, context || document, xml ) ) {
+							results.push( elem );
+							break;
+						}
+					}
+					if ( outermost ) {
+						dirruns = dirrunsUnique;
+					}
+				}
+
+				// Track unmatched elements for set filters
+				if ( bySet ) {
+
+					// They will have gone through all possible matchers
+					if ( ( elem = !matcher && elem ) ) {
+						matchedCount--;
+					}
+
+					// Lengthen the array for every element, matched or not
+					if ( seed ) {
+						unmatched.push( elem );
+					}
+				}
+			}
+
+			// `i` is now the count of elements visited above, and adding it to `matchedCount`
+			// makes the latter nonnegative.
+			matchedCount += i;
+
+			// Apply set filters to unmatched elements
+			// NOTE: This can be skipped if there are no unmatched elements (i.e., `matchedCount`
+			// equals `i`), unless we didn't visit _any_ elements in the above loop because we have
+			// no element matchers and no seed.
+			// Incrementing an initially-string "0" `i` allows `i` to remain a string only in that
+			// case, which will result in a "00" `matchedCount` that differs from `i` but is also
+			// numerically zero.
+			if ( bySet && i !== matchedCount ) {
+				j = 0;
+				while ( ( matcher = setMatchers[ j++ ] ) ) {
+					matcher( unmatched, setMatched, context, xml );
+				}
+
+				if ( seed ) {
+
+					// Reintegrate element matches to eliminate the need for sorting
+					if ( matchedCount > 0 ) {
+						while ( i-- ) {
+							if ( !( unmatched[ i ] || setMatched[ i ] ) ) {
+								setMatched[ i ] = pop.call( results );
+							}
+						}
+					}
+
+					// Discard index placeholder values to get only actual matches
+					setMatched = condense( setMatched );
+				}
+
+				// Add matches to results
+				push.apply( results, setMatched );
+
+				// Seedless set matches succeeding multiple successful matchers stipulate sorting
+				if ( outermost && !seed && setMatched.length > 0 &&
+					( matchedCount + setMatchers.length ) > 1 ) {
+
+					Sizzle.uniqueSort( results );
+				}
+			}
+
+			// Override manipulation of globals by nested matchers
+			if ( outermost ) {
+				dirruns = dirrunsUnique;
+				outermostContext = contextBackup;
+			}
+
+			return unmatched;
+		};
+
+	return bySet ?
+		markFunction( superMatcher ) :
+		superMatcher;
+}
+
+compile = Sizzle.compile = function( selector, match /* Internal Use Only */ ) {
+	var i,
+		setMatchers = [],
+		elementMatchers = [],
+		cached = compilerCache[ selector + " " ];
+
+	if ( !cached ) {
+
+		// Generate a function of recursive functions that can be used to check each element
+		if ( !match ) {
+			match = tokenize( selector );
+		}
+		i = match.length;
+		while ( i-- ) {
+			cached = matcherFromTokens( match[ i ] );
+			if ( cached[ expando ] ) {
+				setMatchers.push( cached );
+			} else {
+				elementMatchers.push( cached );
+			}
+		}
+
+		// Cache the compiled function
+		cached = compilerCache(
+			selector,
+			matcherFromGroupMatchers( elementMatchers, setMatchers )
+		);
+
+		// Save selector and tokenization
+		cached.selector = selector;
+	}
+	return cached;
+};
+
+/**
+ * A low-level selection function that works with Sizzle's compiled
+ *  selector functions
+ * @param {String|Function} selector A selector or a pre-compiled
+ *  selector function built with Sizzle.compile
+ * @param {Element} context
+ * @param {Array} [results]
+ * @param {Array} [seed] A set of elements to match against
+ */
+select = Sizzle.select = function( selector, context, results, seed ) {
+	var i, tokens, token, type, find,
+		compiled = typeof selector === "function" && selector,
+		match = !seed && tokenize( ( selector = compiled.selector || selector ) );
+
+	results = results || [];
+
+	// Try to minimize operations if there is only one selector in the list and no seed
+	// (the latter of which guarantees us context)
+	if ( match.length === 1 ) {
+
+		// Reduce context if the leading compound selector is an ID
+		tokens = match[ 0 ] = match[ 0 ].slice( 0 );
+		if ( tokens.length > 2 && ( token = tokens[ 0 ] ).type === "ID" &&
+			context.nodeType === 9 && documentIsHTML && Expr.relative[ tokens[ 1 ].type ] ) {
+
+			context = ( Expr.find[ "ID" ]( token.matches[ 0 ]
+				.replace( runescape, funescape ), context ) || [] )[ 0 ];
+			if ( !context ) {
+				return results;
+
+			// Precompiled matchers will still verify ancestry, so step up a level
+			} else if ( compiled ) {
+				context = context.parentNode;
+			}
+
+			selector = selector.slice( tokens.shift().value.length );
+		}
+
+		// Fetch a seed set for right-to-left matching
+		i = matchExpr[ "needsContext" ].test( selector ) ? 0 : tokens.length;
+		while ( i-- ) {
+			token = tokens[ i ];
+
+			// Abort if we hit a combinator
+			if ( Expr.relative[ ( type = token.type ) ] ) {
+				break;
+			}
+			if ( ( find = Expr.find[ type ] ) ) {
+
+				// Search, expanding context for leading sibling combinators
+				if ( ( seed = find(
+					token.matches[ 0 ].replace( runescape, funescape ),
+					rsibling.test( tokens[ 0 ].type ) && testContext( context.parentNode ) ||
+						context
+				) ) ) {
+
+					// If seed is empty or no tokens remain, we can return early
+					tokens.splice( i, 1 );
+					selector = seed.length && toSelector( tokens );
+					if ( !selector ) {
+						push.apply( results, seed );
+						return results;
+					}
+
+					break;
+				}
+			}
+		}
+	}
+
+	// Compile and execute a filtering function if one is not provided
+	// Provide `match` to avoid retokenization if we modified the selector above
+	( compiled || compile( selector, match ) )(
+		seed,
+		context,
+		!documentIsHTML,
+		results,
+		!context || rsibling.test( selector ) && testContext( context.parentNode ) || context
+	);
+	return results;
+};
+
+// One-time assignments
+
+// Sort stability
+support.sortStable = expando.split( "" ).sort( sortOrder ).join( "" ) === expando;
+
+// Support: Chrome 14-35+
+// Always assume duplicates if they aren't passed to the comparison function
+support.detectDuplicates = !!hasDuplicate;
+
+// Initialize against the default document
+setDocument();
+
+// Support: Webkit<537.32 - Safari 6.0.3/Chrome 25 (fixed in Chrome 27)
+// Detached nodes confoundingly follow *each other*
+support.sortDetached = assert( function( el ) {
+
+	// Should return 1, but returns 4 (following)
+	return el.compareDocumentPosition( document.createElement( "fieldset" ) ) & 1;
+} );
+
+// Support: IE<8
+// Prevent attribute/property "interpolation"
+// https://msdn.microsoft.com/en-us/library/ms536429%28VS.85%29.aspx
+if ( !assert( function( el ) {
+	el.innerHTML = "<a href='#'></a>";
+	return el.firstChild.getAttribute( "href" ) === "#";
+} ) ) {
+	addHandle( "type|href|height|width", function( elem, name, isXML ) {
+		if ( !isXML ) {
+			return elem.getAttribute( name, name.toLowerCase() === "type" ? 1 : 2 );
+		}
+	} );
+}
+
+// Support: IE<9
+// Use defaultValue in place of getAttribute("value")
+if ( !support.attributes || !assert( function( el ) {
+	el.innerHTML = "<input/>";
+	el.firstChild.setAttribute( "value", "" );
+	return el.firstChild.getAttribute( "value" ) === "";
+} ) ) {
+	addHandle( "value", function( elem, _name, isXML ) {
+		if ( !isXML && elem.nodeName.toLowerCase() === "input" ) {
+			return elem.defaultValue;
+		}
+	} );
+}
+
+// Support: IE<9
+// Use getAttributeNode to fetch booleans when getAttribute lies
+if ( !assert( function( el ) {
+	return el.getAttribute( "disabled" ) == null;
+} ) ) {
+	addHandle( booleans, function( elem, name, isXML ) {
+		var val;
+		if ( !isXML ) {
+			return elem[ name ] === true ? name.toLowerCase() :
+				( val = elem.getAttributeNode( name ) ) && val.specified ?
+					val.value :
+					null;
+		}
+	} );
+}
+
+return Sizzle;
+
+} )( window );
+
+
+
+jQuery.find = Sizzle;
+jQuery.expr = Sizzle.selectors;
+
+// Deprecated
+jQuery.expr[ ":" ] = jQuery.expr.pseudos;
+jQuery.uniqueSort = jQuery.unique = Sizzle.uniqueSort;
+jQuery.text = Sizzle.getText;
+jQuery.isXMLDoc = Sizzle.isXML;
+jQuery.contains = Sizzle.contains;
+jQuery.escapeSelector = Sizzle.escape;
+
+
+
+
+var dir = function( elem, dir, until ) {
+	var matched = [],
+		truncate = until !== undefined;
+
+	while ( ( elem = elem[ dir ] ) && elem.nodeType !== 9 ) {
+		if ( elem.nodeType === 1 ) {
+			if ( truncate && jQuery( elem ).is( until ) ) {
+				break;
+			}
+			matched.push( elem );
+		}
+	}
+	return matched;
+};
+
+
+var siblings = function( n, elem ) {
+	var matched = [];
+
+	for ( ; n; n = n.nextSibling ) {
+		if ( n.nodeType === 1 && n !== elem ) {
+			matched.push( n );
+		}
+	}
+
+	return matched;
+};
+
+
+var rneedsContext = jQuery.expr.match.needsContext;
+
+
+
+function nodeName( elem, name ) {
+
+  return elem.nodeName && elem.nodeName.toLowerCase() === name.toLowerCase();
+
+};
+var rsingleTag = ( /^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i );
+
+
+
+// Implement the identical functionality for filter and not
+function winnow( elements, qualifier, not ) {
+	if ( isFunction( qualifier ) ) {
+		return jQuery.grep( elements, function( elem, i ) {
+			return !!qualifier.call( elem, i, elem ) !== not;
+		} );
+	}
+
+	// Single element
+	if ( qualifier.nodeType ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( elem === qualifier ) !== not;
+		} );
+	}
+
+	// Arraylike of elements (jQuery, arguments, Array)
+	if ( typeof qualifier !== "string" ) {
+		return jQuery.grep( elements, function( elem ) {
+			return ( indexOf.call( qualifier, elem ) > -1 ) !== not;
+		} );
+	}
+
+	// Filtered directly for both simple and complex selectors
+	return jQuery.filter( qualifier, elements, not );
+}
+
+jQuery.filter = function( expr, elems, not ) {
+	var elem = elems[ 0 ];
+
+	if ( not ) {
+		expr = ":not(" + expr + ")";
+	}
+
+	if ( elems.length === 1 && elem.nodeType === 1 ) {
+		return jQuery.find.matchesSelector( elem, expr ) ? [ elem ] : [];
+	}
+
+	return jQuery.find.matches( expr, jQuery.grep( elems, function( elem ) {
+		return elem.nodeType === 1;
+	} ) );
+};
+
+jQuery.fn.extend( {
+	find: function( selector ) {
+		var i, ret,
+			len = this.length,
+			self = this;
+
+		if ( typeof selector !== "string" ) {
+			return this.pushStack( jQuery( selector ).filter( function() {
+				for ( i = 0; i < len; i++ ) {
+					if ( jQuery.contains( self[ i ], this ) ) {
+						return true;
+					}
+				}
+			} ) );
+		}
+
+		ret = this.pushStack( [] );
+
+		for ( i = 0; i < len; i++ ) {
+			jQuery.find( selector, self[ i ], ret );
+		}
+
+		return len > 1 ? jQuery.uniqueSort( ret ) : ret;
+	},
+	filter: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], false ) );
+	},
+	not: function( selector ) {
+		return this.pushStack( winnow( this, selector || [], true ) );
+	},
+	is: function( selector ) {
+		return !!winnow(
+			this,
+
+			// If this is a positional/relative selector, check membership in the returned set
+			// so $("p:first").is("p:last") won't return true for a doc with two "p".
+			typeof selector === "string" && rneedsContext.test( selector ) ?
+				jQuery( selector ) :
+				selector || [],
+			false
+		).length;
+	}
+} );
+
+
+// Initialize a jQuery object
+
+
+// A central reference to the root jQuery(document)
+var rootjQuery,
+
+	// A simple way to check for HTML strings
+	// Prioritize #id over <tag> to avoid XSS via location.hash (#9521)
+	// Strict HTML recognition (#11290: must start with <)
+	// Shortcut simple #id case for speed
+	rquickExpr = /^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/,
+
+	init = jQuery.fn.init = function( selector, context, root ) {
+		var match, elem;
+
+		// HANDLE: $(""), $(null), $(undefined), $(false)
+		if ( !selector ) {
+			return this;
+		}
+
+		// Method init() accepts an alternate rootjQuery
+		// so migrate can support jQuery.sub (gh-2101)
+		root = root || rootjQuery;
+
+		// Handle HTML strings
+		if ( typeof selector === "string" ) {
+			if ( selector[ 0 ] === "<" &&
+				selector[ selector.length - 1 ] === ">" &&
+				selector.length >= 3 ) {
+
+				// Assume that strings that start and end with <> are HTML and skip the regex check
+				match = [ null, selector, null ];
+
+			} else {
+				match = rquickExpr.exec( selector );
+			}
+
+			// Match html or make sure no context is specified for #id
+			if ( match && ( match[ 1 ] || !context ) ) {
+
+				// HANDLE: $(html) -> $(array)
+				if ( match[ 1 ] ) {
+					context = context instanceof jQuery ? context[ 0 ] : context;
+
+					// Option to run scripts is true for back-compat
+					// Intentionally let the error be thrown if parseHTML is not present
+					jQuery.merge( this, jQuery.parseHTML(
+						match[ 1 ],
+						context && context.nodeType ? context.ownerDocument || context : document,
+						true
+					) );
+
+					// HANDLE: $(html, props)
+					if ( rsingleTag.test( match[ 1 ] ) && jQuery.isPlainObject( context ) ) {
+						for ( match in context ) {
+
+							// Properties of context are called as methods if possible
+							if ( isFunction( this[ match ] ) ) {
+								this[ match ]( context[ match ] );
+
+							// ...and otherwise set as attributes
+							} else {
+								this.attr( match, context[ match ] );
+							}
+						}
+					}
+
+					return this;
+
+				// HANDLE: $(#id)
+				} else {
+					elem = document.getElementById( match[ 2 ] );
+
+					if ( elem ) {
+
+						// Inject the element directly into the jQuery object
+						this[ 0 ] = elem;
+						this.length = 1;
+					}
+					return this;
+				}
+
+			// HANDLE: $(expr, $(...))
+			} else if ( !context || context.jquery ) {
+				return ( context || root ).find( selector );
+
+			// HANDLE: $(expr, context)
+			// (which is just equivalent to: $(context).find(expr)
+			} else {
+				return this.constructor( context ).find( selector );
+			}
+
+		// HANDLE: $(DOMElement)
+		} else if ( selector.nodeType ) {
+			this[ 0 ] = selector;
+			this.length = 1;
+			return this;
+
+		// HANDLE: $(function)
+		// Shortcut for document ready
+		} else if ( isFunction( selector ) ) {
+			return root.ready !== undefined ?
+				root.ready( selector ) :
+
+				// Execute immediately if ready is not present
+				selector( jQuery );
+		}
+
+		return jQuery.makeArray( selector, this );
+	};
+
+// Give the init function the jQuery prototype for later instantiation
+init.prototype = jQuery.fn;
+
+// Initialize central reference
+rootjQuery = jQuery( document );
+
+
+var rparentsprev = /^(?:parents|prev(?:Until|All))/,
+
+	// Methods guaranteed to produce a unique set when starting from a unique set
+	guaranteedUnique = {
+		children: true,
+		contents: true,
+		next: true,
+		prev: true
+	};
+
+jQuery.fn.extend( {
+	has: function( target ) {
+		var targets = jQuery( target, this ),
+			l = targets.length;
+
+		return this.filter( function() {
+			var i = 0;
+			for ( ; i < l; i++ ) {
+				if ( jQuery.contains( this, targets[ i ] ) ) {
+					return true;
+				}
+			}
+		} );
+	},
+
+	closest: function( selectors, context ) {
+		var cur,
+			i = 0,
+			l = this.length,
+			matched = [],
+			targets = typeof selectors !== "string" && jQuery( selectors );
+
+		// Positional selectors never match, since there's no _selection_ context
+		if ( !rneedsContext.test( selectors ) ) {
+			for ( ; i < l; i++ ) {
+				for ( cur = this[ i ]; cur && cur !== context; cur = cur.parentNode ) {
+
+					// Always skip document fragments
+					if ( cur.nodeType < 11 && ( targets ?
+						targets.index( cur ) > -1 :
+
+						// Don't pass non-elements to Sizzle
+						cur.nodeType === 1 &&
+							jQuery.find.matchesSelector( cur, selectors ) ) ) {
+
+						matched.push( cur );
+						break;
+					}
+				}
+			}
+		}
+
+		return this.pushStack( matched.length > 1 ? jQuery.uniqueSort( matched ) : matched );
+	},
+
+	// Determine the position of an element within the set
+	index: function( elem ) {
+
+		// No argument, return index in parent
+		if ( !elem ) {
+			return ( this[ 0 ] && this[ 0 ].parentNode ) ? this.first().prevAll().length : -1;
+		}
+
+		// Index in selector
+		if ( typeof elem === "string" ) {
+			return indexOf.call( jQuery( elem ), this[ 0 ] );
+		}
+
+		// Locate the position of the desired element
+		return indexOf.call( this,
+
+			// If it receives a jQuery object, the first element is used
+			elem.jquery ? elem[ 0 ] : elem
+		);
+	},
+
+	add: function( selector, context ) {
+		return this.pushStack(
+			jQuery.uniqueSort(
+				jQuery.merge( this.get(), jQuery( selector, context ) )
+			)
+		);
+	},
+
+	addBack: function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	}
+} );
+
+function sibling( cur, dir ) {
+	while ( ( cur = cur[ dir ] ) && cur.nodeType !== 1 ) {}
+	return cur;
+}
+
+jQuery.each( {
+	parent: function( elem ) {
+		var parent = elem.parentNode;
+		return parent && parent.nodeType !== 11 ? parent : null;
+	},
+	parents: function( elem ) {
+		return dir( elem, "parentNode" );
+	},
+	parentsUntil: function( elem, _i, until ) {
+		return dir( elem, "parentNode", until );
+	},
+	next: function( elem ) {
+		return sibling( elem, "nextSibling" );
+	},
+	prev: function( elem ) {
+		return sibling( elem, "previousSibling" );
+	},
+	nextAll: function( elem ) {
+		return dir( elem, "nextSibling" );
+	},
+	prevAll: function( elem ) {
+		return dir( elem, "previousSibling" );
+	},
+	nextUntil: function( elem, _i, until ) {
+		return dir( elem, "nextSibling", until );
+	},
+	prevUntil: function( elem, _i, until ) {
+		return dir( elem, "previousSibling", until );
+	},
+	siblings: function( elem ) {
+		return siblings( ( elem.parentNode || {} ).firstChild, elem );
+	},
+	children: function( elem ) {
+		return siblings( elem.firstChild );
+	},
+	contents: function( elem ) {
+		if ( elem.contentDocument != null &&
+
+			// Support: IE 11+
+			// <object> elements with no `data` attribute has an object
+			// `contentDocument` with a `null` prototype.
+			getProto( elem.contentDocument ) ) {
+
+			return elem.contentDocument;
+		}
+
+		// Support: IE 9 - 11 only, iOS 7 only, Android Browser <=4.3 only
+		// Treat the template element as a regular one in browsers that
+		// don't support it.
+		if ( nodeName( elem, "template" ) ) {
+			elem = elem.content || elem;
+		}
+
+		return jQuery.merge( [], elem.childNodes );
+	}
+}, function( name, fn ) {
+	jQuery.fn[ name ] = function( until, selector ) {
+		var matched = jQuery.map( this, fn, until );
+
+		if ( name.slice( -5 ) !== "Until" ) {
+			selector = until;
+		}
+
+		if ( selector && typeof selector === "string" ) {
+			matched = jQuery.filter( selector, matched );
+		}
+
+		if ( this.length > 1 ) {
+
+			// Remove duplicates
+			if ( !guaranteedUnique[ name ] ) {
+				jQuery.uniqueSort( matched );
+			}
+
+			// Reverse order for parents* and prev-derivatives
+			if ( rparentsprev.test( name ) ) {
+				matched.reverse();
+			}
+		}
+
+		return this.pushStack( matched );
+	};
+} );
+var rnothtmlwhite = ( /[^\x20\t\r\n\f]+/g );
+
+
+
+// Convert String-formatted options into Object-formatted ones
+function createOptions( options ) {
+	var object = {};
+	jQuery.each( options.match( rnothtmlwhite ) || [], function( _, flag ) {
+		object[ flag ] = true;
+	} );
+	return object;
+}
+
+/*
+ * Create a callback list using the following parameters:
+ *
+ *	options: an optional list of space-separated options that will change how
+ *			the callback list behaves or a more traditional option object
+ *
+ * By default a callback list will act like an event callback list and can be
+ * "fired" multiple times.
+ *
+ * Possible options:
+ *
+ *	once:			will ensure the callback list can only be fired once (like a Deferred)
+ *
+ *	memory:			will keep track of previous values and will call any callback added
+ *					after the list has been fired right away with the latest "memorized"
+ *					values (like a Deferred)
+ *
+ *	unique:			will ensure a callback can only be added once (no duplicate in the list)
+ *
+ *	stopOnFalse:	interrupt callings when a callback returns false
+ *
+ */
+jQuery.Callbacks = function( options ) {
+
+	// Convert options from String-formatted to Object-formatted if needed
+	// (we check in cache first)
+	options = typeof options === "string" ?
+		createOptions( options ) :
+		jQuery.extend( {}, options );
+
+	var // Flag to know if list is currently firing
+		firing,
+
+		// Last fire value for non-forgettable lists
+		memory,
+
+		// Flag to know if list was already fired
+		fired,
+
+		// Flag to prevent firing
+		locked,
+
+		// Actual callback list
+		list = [],
+
+		// Queue of execution data for repeatable lists
+		queue = [],
+
+		// Index of currently firing callback (modified by add/remove as needed)
+		firingIndex = -1,
+
+		// Fire callbacks
+		fire = function() {
+
+			// Enforce single-firing
+			locked = locked || options.once;
+
+			// Execute callbacks for all pending executions,
+			// respecting firingIndex overrides and runtime changes
+			fired = firing = true;
+			for ( ; queue.length; firingIndex = -1 ) {
+				memory = queue.shift();
+				while ( ++firingIndex < list.length ) {
+
+					// Run callback and check for early termination
+					if ( list[ firingIndex ].apply( memory[ 0 ], memory[ 1 ] ) === false &&
+						options.stopOnFalse ) {
+
+						// Jump to end and forget the data so .add doesn't re-fire
+						firingIndex = list.length;
+						memory = false;
+					}
+				}
+			}
+
+			// Forget the data if we're done with it
+			if ( !options.memory ) {
+				memory = false;
+			}
+
+			firing = false;
+
+			// Clean up if we're done firing for good
+			if ( locked ) {
+
+				// Keep an empty list if we have data for future add calls
+				if ( memory ) {
+					list = [];
+
+				// Otherwise, this object is spent
+				} else {
+					list = "";
+				}
+			}
+		},
+
+		// Actual Callbacks object
+		self = {
+
+			// Add a callback or a collection of callbacks to the list
+			add: function() {
+				if ( list ) {
+
+					// If we have memory from a past run, we should fire after adding
+					if ( memory && !firing ) {
+						firingIndex = list.length - 1;
+						queue.push( memory );
+					}
+
+					( function add( args ) {
+						jQuery.each( args, function( _, arg ) {
+							if ( isFunction( arg ) ) {
+								if ( !options.unique || !self.has( arg ) ) {
+									list.push( arg );
+								}
+							} else if ( arg && arg.length && toType( arg ) !== "string" ) {
+
+								// Inspect recursively
+								add( arg );
+							}
+						} );
+					} )( arguments );
+
+					if ( memory && !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Remove a callback from the list
+			remove: function() {
+				jQuery.each( arguments, function( _, arg ) {
+					var index;
+					while ( ( index = jQuery.inArray( arg, list, index ) ) > -1 ) {
+						list.splice( index, 1 );
+
+						// Handle firing indexes
+						if ( index <= firingIndex ) {
+							firingIndex--;
+						}
+					}
+				} );
+				return this;
+			},
+
+			// Check if a given callback is in the list.
+			// If no argument is given, return whether or not list has callbacks attached.
+			has: function( fn ) {
+				return fn ?
+					jQuery.inArray( fn, list ) > -1 :
+					list.length > 0;
+			},
+
+			// Remove all callbacks from the list
+			empty: function() {
+				if ( list ) {
+					list = [];
+				}
+				return this;
+			},
+
+			// Disable .fire and .add
+			// Abort any current/pending executions
+			// Clear all callbacks and values
+			disable: function() {
+				locked = queue = [];
+				list = memory = "";
+				return this;
+			},
+			disabled: function() {
+				return !list;
+			},
+
+			// Disable .fire
+			// Also disable .add unless we have memory (since it would have no effect)
+			// Abort any pending executions
+			lock: function() {
+				locked = queue = [];
+				if ( !memory && !firing ) {
+					list = memory = "";
+				}
+				return this;
+			},
+			locked: function() {
+				return !!locked;
+			},
+
+			// Call all callbacks with the given context and arguments
+			fireWith: function( context, args ) {
+				if ( !locked ) {
+					args = args || [];
+					args = [ context, args.slice ? args.slice() : args ];
+					queue.push( args );
+					if ( !firing ) {
+						fire();
+					}
+				}
+				return this;
+			},
+
+			// Call all the callbacks with the given arguments
+			fire: function() {
+				self.fireWith( this, arguments );
+				return this;
+			},
+
+			// To know if the callbacks have already been called at least once
+			fired: function() {
+				return !!fired;
+			}
+		};
+
+	return self;
+};
+
+
+function Identity( v ) {
+	return v;
+}
+function Thrower( ex ) {
+	throw ex;
+}
+
+function adoptValue( value, resolve, reject, noValue ) {
+	var method;
+
+	try {
+
+		// Check for promise aspect first to privilege synchronous behavior
+		if ( value && isFunction( ( method = value.promise ) ) ) {
+			method.call( value ).done( resolve ).fail( reject );
+
+		// Other thenables
+		} else if ( value && isFunction( ( method = value.then ) ) ) {
+			method.call( value, resolve, reject );
+
+		// Other non-thenables
+		} else {
+
+			// Control `resolve` arguments by letting Array#slice cast boolean `noValue` to integer:
+			// * false: [ value ].slice( 0 ) => resolve( value )
+			// * true: [ value ].slice( 1 ) => resolve()
+			resolve.apply( undefined, [ value ].slice( noValue ) );
+		}
+
+	// For Promises/A+, convert exceptions into rejections
+	// Since jQuery.when doesn't unwrap thenables, we can skip the extra checks appearing in
+	// Deferred#then to conditionally suppress rejection.
+	} catch ( value ) {
+
+		// Support: Android 4.0 only
+		// Strict mode functions invoked without .call/.apply get global-object context
+		reject.apply( undefined, [ value ] );
+	}
+}
+
+jQuery.extend( {
+
+	Deferred: function( func ) {
+		var tuples = [
+
+				// action, add listener, callbacks,
+				// ... .then handlers, argument index, [final state]
+				[ "notify", "progress", jQuery.Callbacks( "memory" ),
+					jQuery.Callbacks( "memory" ), 2 ],
+				[ "resolve", "done", jQuery.Callbacks( "once memory" ),
+					jQuery.Callbacks( "once memory" ), 0, "resolved" ],
+				[ "reject", "fail", jQuery.Callbacks( "once memory" ),
+					jQuery.Callbacks( "once memory" ), 1, "rejected" ]
+			],
+			state = "pending",
+			promise = {
+				state: function() {
+					return state;
+				},
+				always: function() {
+					deferred.done( arguments ).fail( arguments );
+					return this;
+				},
+				"catch": function( fn ) {
+					return promise.then( null, fn );
+				},
+
+				// Keep pipe for back-compat
+				pipe: function( /* fnDone, fnFail, fnProgress */ ) {
+					var fns = arguments;
+
+					return jQuery.Deferred( function( newDefer ) {
+						jQuery.each( tuples, function( _i, tuple ) {
+
+							// Map tuples (progress, done, fail) to arguments (done, fail, progress)
+							var fn = isFunction( fns[ tuple[ 4 ] ] ) && fns[ tuple[ 4 ] ];
+
+							// deferred.progress(function() { bind to newDefer or newDefer.notify })
+							// deferred.done(function() { bind to newDefer or newDefer.resolve })
+							// deferred.fail(function() { bind to newDefer or newDefer.reject })
+							deferred[ tuple[ 1 ] ]( function() {
+								var returned = fn && fn.apply( this, arguments );
+								if ( returned && isFunction( returned.promise ) ) {
+									returned.promise()
+										.progress( newDefer.notify )
+										.done( newDefer.resolve )
+										.fail( newDefer.reject );
+								} else {
+									newDefer[ tuple[ 0 ] + "With" ](
+										this,
+										fn ? [ returned ] : arguments
+									);
+								}
+							} );
+						} );
+						fns = null;
+					} ).promise();
+				},
+				then: function( onFulfilled, onRejected, onProgress ) {
+					var maxDepth = 0;
+					function resolve( depth, deferred, handler, special ) {
+						return function() {
+							var that = this,
+								args = arguments,
+								mightThrow = function() {
+									var returned, then;
+
+									// Support: Promises/A+ section 2.3.3.3.3
+									// https://promisesaplus.com/#point-59
+									// Ignore double-resolution attempts
+									if ( depth < maxDepth ) {
+										return;
+									}
+
+									returned = handler.apply( that, args );
+
+									// Support: Promises/A+ section 2.3.1
+									// https://promisesaplus.com/#point-48
+									if ( returned === deferred.promise() ) {
+										throw new TypeError( "Thenable self-resolution" );
+									}
+
+									// Support: Promises/A+ sections 2.3.3.1, 3.5
+									// https://promisesaplus.com/#point-54
+									// https://promisesaplus.com/#point-75
+									// Retrieve `then` only once
+									then = returned &&
+
+										// Support: Promises/A+ section 2.3.4
+										// https://promisesaplus.com/#point-64
+										// Only check objects and functions for thenability
+										( typeof returned === "object" ||
+											typeof returned === "function" ) &&
+										returned.then;
+
+									// Handle a returned thenable
+									if ( isFunction( then ) ) {
+
+										// Special processors (notify) just wait for resolution
+										if ( special ) {
+											then.call(
+												returned,
+												resolve( maxDepth, deferred, Identity, special ),
+												resolve( maxDepth, deferred, Thrower, special )
+											);
+
+										// Normal processors (resolve) also hook into progress
+										} else {
+
+											// ...and disregard older resolution values
+											maxDepth++;
+
+											then.call(
+												returned,
+												resolve( maxDepth, deferred, Identity, special ),
+												resolve( maxDepth, deferred, Thrower, special ),
+												resolve( maxDepth, deferred, Identity,
+													deferred.notifyWith )
+											);
+										}
+
+									// Handle all other returned values
+									} else {
+
+										// Only substitute handlers pass on context
+										// and multiple values (non-spec behavior)
+										if ( handler !== Identity ) {
+											that = undefined;
+											args = [ returned ];
+										}
+
+										// Process the value(s)
+										// Default process is resolve
+										( special || deferred.resolveWith )( that, args );
+									}
+								},
+
+								// Only normal processors (resolve) catch and reject exceptions
+								process = special ?
+									mightThrow :
+									function() {
+										try {
+											mightThrow();
+										} catch ( e ) {
+
+											if ( jQuery.Deferred.exceptionHook ) {
+												jQuery.Deferred.exceptionHook( e,
+													process.stackTrace );
+											}
+
+											// Support: Promises/A+ section 2.3.3.3.4.1
+											// https://promisesaplus.com/#point-61
+											// Ignore post-resolution exceptions
+											if ( depth + 1 >= maxDepth ) {
+
+												// Only substitute handlers pass on context
+												// and multiple values (non-spec behavior)
+												if ( handler !== Thrower ) {
+													that = undefined;
+													args = [ e ];
+												}
+
+												deferred.rejectWith( that, args );
+											}
+										}
+									};
+
+							// Support: Promises/A+ section 2.3.3.3.1
+							// https://promisesaplus.com/#point-57
+							// Re-resolve promises immediately to dodge false rejection from
+							// subsequent errors
+							if ( depth ) {
+								process();
+							} else {
+
+								// Call an optional hook to record the stack, in case of exception
+								// since it's otherwise lost when execution goes async
+								if ( jQuery.Deferred.getStackHook ) {
+									process.stackTrace = jQuery.Deferred.getStackHook();
+								}
+								window.setTimeout( process );
+							}
+						};
+					}
+
+					return jQuery.Deferred( function( newDefer ) {
+
+						// progress_handlers.add( ... )
+						tuples[ 0 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onProgress ) ?
+									onProgress :
+									Identity,
+								newDefer.notifyWith
+							)
+						);
+
+						// fulfilled_handlers.add( ... )
+						tuples[ 1 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onFulfilled ) ?
+									onFulfilled :
+									Identity
+							)
+						);
+
+						// rejected_handlers.add( ... )
+						tuples[ 2 ][ 3 ].add(
+							resolve(
+								0,
+								newDefer,
+								isFunction( onRejected ) ?
+									onRejected :
+									Thrower
+							)
+						);
+					} ).promise();
+				},
+
+				// Get a promise for this deferred
+				// If obj is provided, the promise aspect is added to the object
+				promise: function( obj ) {
+					return obj != null ? jQuery.extend( obj, promise ) : promise;
+				}
+			},
+			deferred = {};
+
+		// Add list-specific methods
+		jQuery.each( tuples, function( i, tuple ) {
+			var list = tuple[ 2 ],
+				stateString = tuple[ 5 ];
+
+			// promise.progress = list.add
+			// promise.done = list.add
+			// promise.fail = list.add
+			promise[ tuple[ 1 ] ] = list.add;
+
+			// Handle state
+			if ( stateString ) {
+				list.add(
+					function() {
+
+						// state = "resolved" (i.e., fulfilled)
+						// state = "rejected"
+						state = stateString;
+					},
+
+					// rejected_callbacks.disable
+					// fulfilled_callbacks.disable
+					tuples[ 3 - i ][ 2 ].disable,
+
+					// rejected_handlers.disable
+					// fulfilled_handlers.disable
+					tuples[ 3 - i ][ 3 ].disable,
+
+					// progress_callbacks.lock
+					tuples[ 0 ][ 2 ].lock,
+
+					// progress_handlers.lock
+					tuples[ 0 ][ 3 ].lock
+				);
+			}
+
+			// progress_handlers.fire
+			// fulfilled_handlers.fire
+			// rejected_handlers.fire
+			list.add( tuple[ 3 ].fire );
+
+			// deferred.notify = function() { deferred.notifyWith(...) }
+			// deferred.resolve = function() { deferred.resolveWith(...) }
+			// deferred.reject = function() { deferred.rejectWith(...) }
+			deferred[ tuple[ 0 ] ] = function() {
+				deferred[ tuple[ 0 ] + "With" ]( this === deferred ? undefined : this, arguments );
+				return this;
+			};
+
+			// deferred.notifyWith = list.fireWith
+			// deferred.resolveWith = list.fireWith
+			// deferred.rejectWith = list.fireWith
+			deferred[ tuple[ 0 ] + "With" ] = list.fireWith;
+		} );
+
+		// Make the deferred a promise
+		promise.promise( deferred );
+
+		// Call given func if any
+		if ( func ) {
+			func.call( deferred, deferred );
+		}
+
+		// All done!
+		return deferred;
+	},
+
+	// Deferred helper
+	when: function( singleValue ) {
+		var
+
+			// count of uncompleted subordinates
+			remaining = arguments.length,
+
+			// count of unprocessed arguments
+			i = remaining,
+
+			// subordinate fulfillment data
+			resolveContexts = Array( i ),
+			resolveValues = slice.call( arguments ),
+
+			// the master Deferred
+			master = jQuery.Deferred(),
+
+			// subordinate callback factory
+			updateFunc = function( i ) {
+				return function( value ) {
+					resolveContexts[ i ] = this;
+					resolveValues[ i ] = arguments.length > 1 ? slice.call( arguments ) : value;
+					if ( !( --remaining ) ) {
+						master.resolveWith( resolveContexts, resolveValues );
+					}
+				};
+			};
+
+		// Single- and empty arguments are adopted like Promise.resolve
+		if ( remaining <= 1 ) {
+			adoptValue( singleValue, master.done( updateFunc( i ) ).resolve, master.reject,
+				!remaining );
+
+			// Use .then() to unwrap secondary thenables (cf. gh-3000)
+			if ( master.state() === "pending" ||
+				isFunction( resolveValues[ i ] && resolveValues[ i ].then ) ) {
+
+				return master.then();
+			}
+		}
+
+		// Multiple arguments are aggregated like Promise.all array elements
+		while ( i-- ) {
+			adoptValue( resolveValues[ i ], updateFunc( i ), master.reject );
+		}
+
+		return master.promise();
+	}
+} );
+
+
+// These usually indicate a programmer mistake during development,
+// warn about them ASAP rather than swallowing them by default.
+var rerrorNames = /^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;
+
+jQuery.Deferred.exceptionHook = function( error, stack ) {
+
+	// Support: IE 8 - 9 only
+	// Console exists when dev tools are open, which can happen at any time
+	if ( window.console && window.console.warn && error && rerrorNames.test( error.name ) ) {
+		window.console.warn( "jQuery.Deferred exception: " + error.message, error.stack, stack );
+	}
+};
+
+
+
+
+jQuery.readyException = function( error ) {
+	window.setTimeout( function() {
+		throw error;
+	} );
+};
+
+
+
+
+// The deferred used on DOM ready
+var readyList = jQuery.Deferred();
+
+jQuery.fn.ready = function( fn ) {
+
+	readyList
+		.then( fn )
+
+		// Wrap jQuery.readyException in a function so that the lookup
+		// happens at the time of error handling instead of callback
+		// registration.
+		.catch( function( error ) {
+			jQuery.readyException( error );
+		} );
+
+	return this;
+};
+
+jQuery.extend( {
+
+	// Is the DOM ready to be used? Set to true once it occurs.
+	isReady: false,
+
+	// A counter to track how many items to wait for before
+	// the ready event fires. See #6781
+	readyWait: 1,
+
+	// Handle when the DOM is ready
+	ready: function( wait ) {
+
+		// Abort if there are pending holds or we're already ready
+		if ( wait === true ? --jQuery.readyWait : jQuery.isReady ) {
+			return;
+		}
+
+		// Remember that the DOM is ready
+		jQuery.isReady = true;
+
+		// If a normal DOM Ready event fired, decrement, and wait if need be
+		if ( wait !== true && --jQuery.readyWait > 0 ) {
+			return;
+		}
+
+		// If there are functions bound, to execute
+		readyList.resolveWith( document, [ jQuery ] );
+	}
+} );
+
+jQuery.ready.then = readyList.then;
+
+// The ready event handler and self cleanup method
+function completed() {
+	document.removeEventListener( "DOMContentLoaded", completed );
+	window.removeEventListener( "load", completed );
+	jQuery.ready();
+}
+
+// Catch cases where $(document).ready() is called
+// after the browser event has already occurred.
+// Support: IE <=9 - 10 only
+// Older IE sometimes signals "interactive" too soon
+if ( document.readyState === "complete" ||
+	( document.readyState !== "loading" && !document.documentElement.doScroll ) ) {
+
+	// Handle it asynchronously to allow scripts the opportunity to delay ready
+	window.setTimeout( jQuery.ready );
+
+} else {
+
+	// Use the handy event callback
+	document.addEventListener( "DOMContentLoaded", completed );
+
+	// A fallback to window.onload, that will always work
+	window.addEventListener( "load", completed );
+}
+
+
+
+
+// Multifunctional method to get and set values of a collection
+// The value/s can optionally be executed if it's a function
+var access = function( elems, fn, key, value, chainable, emptyGet, raw ) {
+	var i = 0,
+		len = elems.length,
+		bulk = key == null;
+
+	// Sets many values
+	if ( toType( key ) === "object" ) {
+		chainable = true;
+		for ( i in key ) {
+			access( elems, fn, i, key[ i ], true, emptyGet, raw );
+		}
+
+	// Sets one value
+	} else if ( value !== undefined ) {
+		chainable = true;
+
+		if ( !isFunction( value ) ) {
+			raw = true;
+		}
+
+		if ( bulk ) {
+
+			// Bulk operations run against the entire set
+			if ( raw ) {
+				fn.call( elems, value );
+				fn = null;
+
+			// ...except when executing function values
+			} else {
+				bulk = fn;
+				fn = function( elem, _key, value ) {
+					return bulk.call( jQuery( elem ), value );
+				};
+			}
+		}
+
+		if ( fn ) {
+			for ( ; i < len; i++ ) {
+				fn(
+					elems[ i ], key, raw ?
+					value :
+					value.call( elems[ i ], i, fn( elems[ i ], key ) )
+				);
+			}
+		}
+	}
+
+	if ( chainable ) {
+		return elems;
+	}
+
+	// Gets
+	if ( bulk ) {
+		return fn.call( elems );
+	}
+
+	return len ? fn( elems[ 0 ], key ) : emptyGet;
+};
+
+
+// Matches dashed string for camelizing
+var rmsPrefix = /^-ms-/,
+	rdashAlpha = /-([a-z])/g;
+
+// Used by camelCase as callback to replace()
+function fcamelCase( _all, letter ) {
+	return letter.toUpperCase();
+}
+
+// Convert dashed to camelCase; used by the css and data modules
+// Support: IE <=9 - 11, Edge 12 - 15
+// Microsoft forgot to hump their vendor prefix (#9572)
+function camelCase( string ) {
+	return string.replace( rmsPrefix, "ms-" ).replace( rdashAlpha, fcamelCase );
+}
+var acceptData = function( owner ) {
+
+	// Accepts only:
+	//  - Node
+	//    - Node.ELEMENT_NODE
+	//    - Node.DOCUMENT_NODE
+	//  - Object
+	//    - Any
+	return owner.nodeType === 1 || owner.nodeType === 9 || !( +owner.nodeType );
+};
+
+
+
+
+function Data() {
+	this.expando = jQuery.expando + Data.uid++;
+}
+
+Data.uid = 1;
+
+Data.prototype = {
+
+	cache: function( owner ) {
+
+		// Check if the owner object already has a cache
+		var value = owner[ this.expando ];
+
+		// If not, create one
+		if ( !value ) {
+			value = {};
+
+			// We can accept data for non-element nodes in modern browsers,
+			// but we should not, see #8335.
+			// Always return an empty object.
+			if ( acceptData( owner ) ) {
+
+				// If it is a node unlikely to be stringify-ed or looped over
+				// use plain assignment
+				if ( owner.nodeType ) {
+					owner[ this.expando ] = value;
+
+				// Otherwise secure it in a non-enumerable property
+				// configurable must be true to allow the property to be
+				// deleted when data is removed
+				} else {
+					Object.defineProperty( owner, this.expando, {
+						value: value,
+						configurable: true
+					} );
+				}
+			}
+		}
+
+		return value;
+	},
+	set: function( owner, data, value ) {
+		var prop,
+			cache = this.cache( owner );
+
+		// Handle: [ owner, key, value ] args
+		// Always use camelCase key (gh-2257)
+		if ( typeof data === "string" ) {
+			cache[ camelCase( data ) ] = value;
+
+		// Handle: [ owner, { properties } ] args
+		} else {
+
+			// Copy the properties one-by-one to the cache object
+			for ( prop in data ) {
+				cache[ camelCase( prop ) ] = data[ prop ];
+			}
+		}
+		return cache;
+	},
+	get: function( owner, key ) {
+		return key === undefined ?
+			this.cache( owner ) :
+
+			// Always use camelCase key (gh-2257)
+			owner[ this.expando ] && owner[ this.expando ][ camelCase( key ) ];
+	},
+	access: function( owner, key, value ) {
+
+		// In cases where either:
+		//
+		//   1. No key was specified
+		//   2. A string key was specified, but no value provided
+		//
+		// Take the "read" path and allow the get method to determine
+		// which value to return, respectively either:
+		//
+		//   1. The entire cache object
+		//   2. The data stored at the key
+		//
+		if ( key === undefined ||
+				( ( key && typeof key === "string" ) && value === undefined ) ) {
+
+			return this.get( owner, key );
+		}
+
+		// When the key is not a string, or both a key and value
+		// are specified, set or extend (existing objects) with either:
+		//
+		//   1. An object of properties
+		//   2. A key and value
+		//
+		this.set( owner, key, value );
+
+		// Since the "set" path can have two possible entry points
+		// return the expected data based on which path was taken[*]
+		return value !== undefined ? value : key;
+	},
+	remove: function( owner, key ) {
+		var i,
+			cache = owner[ this.expando ];
+
+		if ( cache === undefined ) {
+			return;
+		}
+
+		if ( key !== undefined ) {
+
+			// Support array or space separated string of keys
+			if ( Array.isArray( key ) ) {
+
+				// If key is an array of keys...
+				// We always set camelCase keys, so remove that.
+				key = key.map( camelCase );
+			} else {
+				key = camelCase( key );
+
+				// If a key with the spaces exists, use it.
+				// Otherwise, create an array by matching non-whitespace
+				key = key in cache ?
+					[ key ] :
+					( key.match( rnothtmlwhite ) || [] );
+			}
+
+			i = key.length;
+
+			while ( i-- ) {
+				delete cache[ key[ i ] ];
+			}
+		}
+
+		// Remove the expando if there's no more data
+		if ( key === undefined || jQuery.isEmptyObject( cache ) ) {
+
+			// Support: Chrome <=35 - 45
+			// Webkit & Blink performance suffers when deleting properties
+			// from DOM nodes, so set to undefined instead
+			// https://bugs.chromium.org/p/chromium/issues/detail?id=378607 (bug restricted)
+			if ( owner.nodeType ) {
+				owner[ this.expando ] = undefined;
+			} else {
+				delete owner[ this.expando ];
+			}
+		}
+	},
+	hasData: function( owner ) {
+		var cache = owner[ this.expando ];
+		return cache !== undefined && !jQuery.isEmptyObject( cache );
+	}
+};
+var dataPriv = new Data();
+
+var dataUser = new Data();
+
+
+
+//	Implementation Summary
+//
+//	1. Enforce API surface and semantic compatibility with 1.9.x branch
+//	2. Improve the module's maintainability by reducing the storage
+//		paths to a single mechanism.
+//	3. Use the same single mechanism to support "private" and "user" data.
+//	4. _Never_ expose "private" data to user code (TODO: Drop _data, _removeData)
+//	5. Avoid exposing implementation details on user objects (eg. expando properties)
+//	6. Provide a clear path for implementation upgrade to WeakMap in 2014
+
+var rbrace = /^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,
+	rmultiDash = /[A-Z]/g;
+
+function getData( data ) {
+	if ( data === "true" ) {
+		return true;
+	}
+
+	if ( data === "false" ) {
+		return false;
+	}
+
+	if ( data === "null" ) {
+		return null;
+	}
+
+	// Only convert to a number if it doesn't change the string
+	if ( data === +data + "" ) {
+		return +data;
+	}
+
+	if ( rbrace.test( data ) ) {
+		return JSON.parse( data );
+	}
+
+	return data;
+}
+
+function dataAttr( elem, key, data ) {
+	var name;
+
+	// If nothing was found internally, try to fetch any
+	// data from the HTML5 data-* attribute
+	if ( data === undefined && elem.nodeType === 1 ) {
+		name = "data-" + key.replace( rmultiDash, "-$&" ).toLowerCase();
+		data = elem.getAttribute( name );
+
+		if ( typeof data === "string" ) {
+			try {
+				data = getData( data );
+			} catch ( e ) {}
+
+			// Make sure we set the data so it isn't changed later
+			dataUser.set( elem, key, data );
+		} else {
+			data = undefined;
+		}
+	}
+	return data;
+}
+
+jQuery.extend( {
+	hasData: function( elem ) {
+		return dataUser.hasData( elem ) || dataPriv.hasData( elem );
+	},
+
+	data: function( elem, name, data ) {
+		return dataUser.access( elem, name, data );
+	},
+
+	removeData: function( elem, name ) {
+		dataUser.remove( elem, name );
+	},
+
+	// TODO: Now that all calls to _data and _removeData have been replaced
+	// with direct calls to dataPriv methods, these can be deprecated.
+	_data: function( elem, name, data ) {
+		return dataPriv.access( elem, name, data );
+	},
+
+	_removeData: function( elem, name ) {
+		dataPriv.remove( elem, name );
+	}
+} );
+
+jQuery.fn.extend( {
+	data: function( key, value ) {
+		var i, name, data,
+			elem = this[ 0 ],
+			attrs = elem && elem.attributes;
+
+		// Gets all values
+		if ( key === undefined ) {
+			if ( this.length ) {
+				data = dataUser.get( elem );
+
+				if ( elem.nodeType === 1 && !dataPriv.get( elem, "hasDataAttrs" ) ) {
+					i = attrs.length;
+					while ( i-- ) {
+
+						// Support: IE 11 only
+						// The attrs elements can be null (#14894)
+						if ( attrs[ i ] ) {
+							name = attrs[ i ].name;
+							if ( name.indexOf( "data-" ) === 0 ) {
+								name = camelCase( name.slice( 5 ) );
+								dataAttr( elem, name, data[ name ] );
+							}
+						}
+					}
+					dataPriv.set( elem, "hasDataAttrs", true );
+				}
+			}
+
+			return data;
+		}
+
+		// Sets multiple values
+		if ( typeof key === "object" ) {
+			return this.each( function() {
+				dataUser.set( this, key );
+			} );
+		}
+
+		return access( this, function( value ) {
+			var data;
+
+			// The calling jQuery object (element matches) is not empty
+			// (and therefore has an element appears at this[ 0 ]) and the
+			// `value` parameter was not undefined. An empty jQuery object
+			// will result in `undefined` for elem = this[ 0 ] which will
+			// throw an exception if an attempt to read a data cache is made.
+			if ( elem && value === undefined ) {
+
+				// Attempt to get data from the cache
+				// The key will always be camelCased in Data
+				data = dataUser.get( elem, key );
+				if ( data !== undefined ) {
+					return data;
+				}
+
+				// Attempt to "discover" the data in
+				// HTML5 custom data-* attrs
+				data = dataAttr( elem, key );
+				if ( data !== undefined ) {
+					return data;
+				}
+
+				// We tried really hard, but the data doesn't exist.
+				return;
+			}
+
+			// Set the data...
+			this.each( function() {
+
+				// We always store the camelCased key
+				dataUser.set( this, key, value );
+			} );
+		}, null, value, arguments.length > 1, null, true );
+	},
+
+	removeData: function( key ) {
+		return this.each( function() {
+			dataUser.remove( this, key );
+		} );
+	}
+} );
+
+
+jQuery.extend( {
+	queue: function( elem, type, data ) {
+		var queue;
+
+		if ( elem ) {
+			type = ( type || "fx" ) + "queue";
+			queue = dataPriv.get( elem, type );
+
+			// Speed up dequeue by getting out quickly if this is just a lookup
+			if ( data ) {
+				if ( !queue || Array.isArray( data ) ) {
+					queue = dataPriv.access( elem, type, jQuery.makeArray( data ) );
+				} else {
+					queue.push( data );
+				}
+			}
+			return queue || [];
+		}
+	},
+
+	dequeue: function( elem, type ) {
+		type = type || "fx";
+
+		var queue = jQuery.queue( elem, type ),
+			startLength = queue.length,
+			fn = queue.shift(),
+			hooks = jQuery._queueHooks( elem, type ),
+			next = function() {
+				jQuery.dequeue( elem, type );
+			};
+
+		// If the fx queue is dequeued, always remove the progress sentinel
+		if ( fn === "inprogress" ) {
+			fn = queue.shift();
+			startLength--;
+		}
+
+		if ( fn ) {
+
+			// Add a progress sentinel to prevent the fx queue from being
+			// automatically dequeued
+			if ( type === "fx" ) {
+				queue.unshift( "inprogress" );
+			}
+
+			// Clear up the last queue stop function
+			delete hooks.stop;
+			fn.call( elem, next, hooks );
+		}
+
+		if ( !startLength && hooks ) {
+			hooks.empty.fire();
+		}
+	},
+
+	// Not public - generate a queueHooks object, or return the current one
+	_queueHooks: function( elem, type ) {
+		var key = type + "queueHooks";
+		return dataPriv.get( elem, key ) || dataPriv.access( elem, key, {
+			empty: jQuery.Callbacks( "once memory" ).add( function() {
+				dataPriv.remove( elem, [ type + "queue", key ] );
+			} )
+		} );
+	}
+} );
+
+jQuery.fn.extend( {
+	queue: function( type, data ) {
+		var setter = 2;
+
+		if ( typeof type !== "string" ) {
+			data = type;
+			type = "fx";
+			setter--;
+		}
+
+		if ( arguments.length < setter ) {
+			return jQuery.queue( this[ 0 ], type );
+		}
+
+		return data === undefined ?
+			this :
+			this.each( function() {
+				var queue = jQuery.queue( this, type, data );
+
+				// Ensure a hooks for this queue
+				jQuery._queueHooks( this, type );
+
+				if ( type === "fx" && queue[ 0 ] !== "inprogress" ) {
+					jQuery.dequeue( this, type );
+				}
+			} );
+	},
+	dequeue: function( type ) {
+		return this.each( function() {
+			jQuery.dequeue( this, type );
+		} );
+	},
+	clearQueue: function( type ) {
+		return this.queue( type || "fx", [] );
+	},
+
+	// Get a promise resolved when queues of a certain type
+	// are emptied (fx is the type by default)
+	promise: function( type, obj ) {
+		var tmp,
+			count = 1,
+			defer = jQuery.Deferred(),
+			elements = this,
+			i = this.length,
+			resolve = function() {
+				if ( !( --count ) ) {
+					defer.resolveWith( elements, [ elements ] );
+				}
+			};
+
+		if ( typeof type !== "string" ) {
+			obj = type;
+			type = undefined;
+		}
+		type = type || "fx";
+
+		while ( i-- ) {
+			tmp = dataPriv.get( elements[ i ], type + "queueHooks" );
+			if ( tmp && tmp.empty ) {
+				count++;
+				tmp.empty.add( resolve );
+			}
+		}
+		resolve();
+		return defer.promise( obj );
+	}
+} );
+var pnum = ( /[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/ ).source;
+
+var rcssNum = new RegExp( "^(?:([+-])=|)(" + pnum + ")([a-z%]*)$", "i" );
+
+
+var cssExpand = [ "Top", "Right", "Bottom", "Left" ];
+
+var documentElement = document.documentElement;
+
+
+
+	var isAttached = function( elem ) {
+			return jQuery.contains( elem.ownerDocument, elem );
+		},
+		composed = { composed: true };
+
+	// Support: IE 9 - 11+, Edge 12 - 18+, iOS 10.0 - 10.2 only
+	// Check attachment across shadow DOM boundaries when possible (gh-3504)
+	// Support: iOS 10.0-10.2 only
+	// Early iOS 10 versions support `attachShadow` but not `getRootNode`,
+	// leading to errors. We need to check for `getRootNode`.
+	if ( documentElement.getRootNode ) {
+		isAttached = function( elem ) {
+			return jQuery.contains( elem.ownerDocument, elem ) ||
+				elem.getRootNode( composed ) === elem.ownerDocument;
+		};
+	}
+var isHiddenWithinTree = function( elem, el ) {
+
+		// isHiddenWithinTree might be called from jQuery#filter function;
+		// in that case, element will be second argument
+		elem = el || elem;
+
+		// Inline style trumps all
+		return elem.style.display === "none" ||
+			elem.style.display === "" &&
+
+			// Otherwise, check computed style
+			// Support: Firefox <=43 - 45
+			// Disconnected elements can have computed display: none, so first confirm that elem is
+			// in the document.
+			isAttached( elem ) &&
+
+			jQuery.css( elem, "display" ) === "none";
+	};
+
+
+
+function adjustCSS( elem, prop, valueParts, tween ) {
+	var adjusted, scale,
+		maxIterations = 20,
+		currentValue = tween ?
+			function() {
+				return tween.cur();
+			} :
+			function() {
+				return jQuery.css( elem, prop, "" );
+			},
+		initial = currentValue(),
+		unit = valueParts && valueParts[ 3 ] || ( jQuery.cssNumber[ prop ] ? "" : "px" ),
+
+		// Starting value computation is required for potential unit mismatches
+		initialInUnit = elem.nodeType &&
+			( jQuery.cssNumber[ prop ] || unit !== "px" && +initial ) &&
+			rcssNum.exec( jQuery.css( elem, prop ) );
+
+	if ( initialInUnit && initialInUnit[ 3 ] !== unit ) {
+
+		// Support: Firefox <=54
+		// Halve the iteration target value to prevent interference from CSS upper bounds (gh-2144)
+		initial = initial / 2;
+
+		// Trust units reported by jQuery.css
+		unit = unit || initialInUnit[ 3 ];
+
+		// Iteratively approximate from a nonzero starting point
+		initialInUnit = +initial || 1;
+
+		while ( maxIterations-- ) {
+
+			// Evaluate and update our best guess (doubling guesses that zero out).
+			// Finish if the scale equals or crosses 1 (making the old*new product non-positive).
+			jQuery.style( elem, prop, initialInUnit + unit );
+			if ( ( 1 - scale ) * ( 1 - ( scale = currentValue() / initial || 0.5 ) ) <= 0 ) {
+				maxIterations = 0;
+			}
+			initialInUnit = initialInUnit / scale;
+
+		}
+
+		initialInUnit = initialInUnit * 2;
+		jQuery.style( elem, prop, initialInUnit + unit );
+
+		// Make sure we update the tween properties later on
+		valueParts = valueParts || [];
+	}
+
+	if ( valueParts ) {
+		initialInUnit = +initialInUnit || +initial || 0;
+
+		// Apply relative offset (+=/-=) if specified
+		adjusted = valueParts[ 1 ] ?
+			initialInUnit + ( valueParts[ 1 ] + 1 ) * valueParts[ 2 ] :
+			+valueParts[ 2 ];
+		if ( tween ) {
+			tween.unit = unit;
+			tween.start = initialInUnit;
+			tween.end = adjusted;
+		}
+	}
+	return adjusted;
+}
+
+
+var defaultDisplayMap = {};
+
+function getDefaultDisplay( elem ) {
+	var temp,
+		doc = elem.ownerDocument,
+		nodeName = elem.nodeName,
+		display = defaultDisplayMap[ nodeName ];
+
+	if ( display ) {
+		return display;
+	}
+
+	temp = doc.body.appendChild( doc.createElement( nodeName ) );
+	display = jQuery.css( temp, "display" );
+
+	temp.parentNode.removeChild( temp );
+
+	if ( display === "none" ) {
+		display = "block";
+	}
+	defaultDisplayMap[ nodeName ] = display;
+
+	return display;
+}
+
+function showHide( elements, show ) {
+	var display, elem,
+		values = [],
+		index = 0,
+		length = elements.length;
+
+	// Determine new display value for elements that need to change
+	for ( ; index < length; index++ ) {
+		elem = elements[ index ];
+		if ( !elem.style ) {
+			continue;
+		}
+
+		display = elem.style.display;
+		if ( show ) {
+
+			// Since we force visibility upon cascade-hidden elements, an immediate (and slow)
+			// check is required in this first loop unless we have a nonempty display value (either
+			// inline or about-to-be-restored)
+			if ( display === "none" ) {
+				values[ index ] = dataPriv.get( elem, "display" ) || null;
+				if ( !values[ index ] ) {
+					elem.style.display = "";
+				}
+			}
+			if ( elem.style.display === "" && isHiddenWithinTree( elem ) ) {
+				values[ index ] = getDefaultDisplay( elem );
+			}
+		} else {
+			if ( display !== "none" ) {
+				values[ index ] = "none";
+
+				// Remember what we're overwriting
+				dataPriv.set( elem, "display", display );
+			}
+		}
+	}
+
+	// Set the display of the elements in a second loop to avoid constant reflow
+	for ( index = 0; index < length; index++ ) {
+		if ( values[ index ] != null ) {
+			elements[ index ].style.display = values[ index ];
+		}
+	}
+
+	return elements;
+}
+
+jQuery.fn.extend( {
+	show: function() {
+		return showHide( this, true );
+	},
+	hide: function() {
+		return showHide( this );
+	},
+	toggle: function( state ) {
+		if ( typeof state === "boolean" ) {
+			return state ? this.show() : this.hide();
+		}
+
+		return this.each( function() {
+			if ( isHiddenWithinTree( this ) ) {
+				jQuery( this ).show();
+			} else {
+				jQuery( this ).hide();
+			}
+		} );
+	}
+} );
+var rcheckableType = ( /^(?:checkbox|radio)$/i );
+
+var rtagName = ( /<([a-z][^\/\0>\x20\t\r\n\f]*)/i );
+
+var rscriptType = ( /^$|^module$|\/(?:java|ecma)script/i );
+
+
+
+( function() {
+	var fragment = document.createDocumentFragment(),
+		div = fragment.appendChild( document.createElement( "div" ) ),
+		input = document.createElement( "input" );
+
+	// Support: Android 4.0 - 4.3 only
+	// Check state lost if the name is set (#11217)
+	// Support: Windows Web Apps (WWA)
+	// `name` and `type` must use .setAttribute for WWA (#14901)
+	input.setAttribute( "type", "radio" );
+	input.setAttribute( "checked", "checked" );
+	input.setAttribute( "name", "t" );
+
+	div.appendChild( input );
+
+	// Support: Android <=4.1 only
+	// Older WebKit doesn't clone checked state correctly in fragments
+	support.checkClone = div.cloneNode( true ).cloneNode( true ).lastChild.checked;
+
+	// Support: IE <=11 only
+	// Make sure textarea (and checkbox) defaultValue is properly cloned
+	div.innerHTML = "<textarea>x</textarea>";
+	support.noCloneChecked = !!div.cloneNode( true ).lastChild.defaultValue;
+
+	// Support: IE <=9 only
+	// IE <=9 replaces <option> tags with their contents when inserted outside of
+	// the select element.
+	div.innerHTML = "<option></option>";
+	support.option = !!div.lastChild;
+} )();
+
+
+// We have to close these tags to support XHTML (#13200)
+var wrapMap = {
+
+	// XHTML parsers do not magically insert elements in the
+	// same way that tag soup parsers do. So we cannot shorten
+	// this by omitting <tbody> or other required elements.
+	thead: [ 1, "<table>", "</table>" ],
+	col: [ 2, "<table><colgroup>", "</colgroup></table>" ],
+	tr: [ 2, "<table><tbody>", "</tbody></table>" ],
+	td: [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ],
+
+	_default: [ 0, "", "" ]
+};
+
+wrapMap.tbody = wrapMap.tfoot = wrapMap.colgroup = wrapMap.caption = wrapMap.thead;
+wrapMap.th = wrapMap.td;
+
+// Support: IE <=9 only
+if ( !support.option ) {
+	wrapMap.optgroup = wrapMap.option = [ 1, "<select multiple='multiple'>", "</select>" ];
+}
+
+
+function getAll( context, tag ) {
+
+	// Support: IE <=9 - 11 only
+	// Use typeof to avoid zero-argument method invocation on host objects (#15151)
+	var ret;
+
+	if ( typeof context.getElementsByTagName !== "undefined" ) {
+		ret = context.getElementsByTagName( tag || "*" );
+
+	} else if ( typeof context.querySelectorAll !== "undefined" ) {
+		ret = context.querySelectorAll( tag || "*" );
+
+	} else {
+		ret = [];
+	}
+
+	if ( tag === undefined || tag && nodeName( context, tag ) ) {
+		return jQuery.merge( [ context ], ret );
+	}
+
+	return ret;
+}
+
+
+// Mark scripts as having already been evaluated
+function setGlobalEval( elems, refElements ) {
+	var i = 0,
+		l = elems.length;
+
+	for ( ; i < l; i++ ) {
+		dataPriv.set(
+			elems[ i ],
+			"globalEval",
+			!refElements || dataPriv.get( refElements[ i ], "globalEval" )
+		);
+	}
+}
+
+
+var rhtml = /<|&#?\w+;/;
+
+function buildFragment( elems, context, scripts, selection, ignored ) {
+	var elem, tmp, tag, wrap, attached, j,
+		fragment = context.createDocumentFragment(),
+		nodes = [],
+		i = 0,
+		l = elems.length;
+
+	for ( ; i < l; i++ ) {
+		elem = elems[ i ];
+
+		if ( elem || elem === 0 ) {
+
+			// Add nodes directly
+			if ( toType( elem ) === "object" ) {
+
+				// Support: Android <=4.0 only, PhantomJS 1 only
+				// push.apply(_, arraylike) throws on ancient WebKit
+				jQuery.merge( nodes, elem.nodeType ? [ elem ] : elem );
+
+			// Convert non-html into a text node
+			} else if ( !rhtml.test( elem ) ) {
+				nodes.push( context.createTextNode( elem ) );
+
+			// Convert html into DOM nodes
+			} else {
+				tmp = tmp || fragment.appendChild( context.createElement( "div" ) );
+
+				// Deserialize a standard representation
+				tag = ( rtagName.exec( elem ) || [ "", "" ] )[ 1 ].toLowerCase();
+				wrap = wrapMap[ tag ] || wrapMap._default;
+				tmp.innerHTML = wrap[ 1 ] + jQuery.htmlPrefilter( elem ) + wrap[ 2 ];
+
+				// Descend through wrappers to the right content
+				j = wrap[ 0 ];
+				while ( j-- ) {
+					tmp = tmp.lastChild;
+				}
+
+				// Support: Android <=4.0 only, PhantomJS 1 only
+				// push.apply(_, arraylike) throws on ancient WebKit
+				jQuery.merge( nodes, tmp.childNodes );
+
+				// Remember the top-level container
+				tmp = fragment.firstChild;
+
+				// Ensure the created nodes are orphaned (#12392)
+				tmp.textContent = "";
+			}
+		}
+	}
+
+	// Remove wrapper from fragment
+	fragment.textContent = "";
+
+	i = 0;
+	while ( ( elem = nodes[ i++ ] ) ) {
+
+		// Skip elements already in the context collection (trac-4087)
+		if ( selection && jQuery.inArray( elem, selection ) > -1 ) {
+			if ( ignored ) {
+				ignored.push( elem );
+			}
+			continue;
+		}
+
+		attached = isAttached( elem );
+
+		// Append to fragment
+		tmp = getAll( fragment.appendChild( elem ), "script" );
+
+		// Preserve script evaluation history
+		if ( attached ) {
+			setGlobalEval( tmp );
+		}
+
+		// Capture executables
+		if ( scripts ) {
+			j = 0;
+			while ( ( elem = tmp[ j++ ] ) ) {
+				if ( rscriptType.test( elem.type || "" ) ) {
+					scripts.push( elem );
+				}
+			}
+		}
+	}
+
+	return fragment;
+}
+
+
+var
+	rkeyEvent = /^key/,
+	rmouseEvent = /^(?:mouse|pointer|contextmenu|drag|drop)|click/,
+	rtypenamespace = /^([^.]*)(?:\.(.+)|)/;
+
+function returnTrue() {
+	return true;
+}
+
+function returnFalse() {
+	return false;
+}
+
+// Support: IE <=9 - 11+
+// focus() and blur() are asynchronous, except when they are no-op.
+// So expect focus to be synchronous when the element is already active,
+// and blur to be synchronous when the element is not already active.
+// (focus and blur are always synchronous in other supported browsers,
+// this just defines when we can count on it).
+function expectSync( elem, type ) {
+	return ( elem === safeActiveElement() ) === ( type === "focus" );
+}
+
+// Support: IE <=9 only
+// Accessing document.activeElement can throw unexpectedly
+// https://bugs.jquery.com/ticket/13393
+function safeActiveElement() {
+	try {
+		return document.activeElement;
+	} catch ( err ) { }
+}
+
+function on( elem, types, selector, data, fn, one ) {
+	var origFn, type;
+
+	// Types can be a map of types/handlers
+	if ( typeof types === "object" ) {
+
+		// ( types-Object, selector, data )
+		if ( typeof selector !== "string" ) {
+
+			// ( types-Object, data )
+			data = data || selector;
+			selector = undefined;
+		}
+		for ( type in types ) {
+			on( elem, type, selector, data, types[ type ], one );
+		}
+		return elem;
+	}
+
+	if ( data == null && fn == null ) {
+
+		// ( types, fn )
+		fn = selector;
+		data = selector = undefined;
+	} else if ( fn == null ) {
+		if ( typeof selector === "string" ) {
+
+			// ( types, selector, fn )
+			fn = data;
+			data = undefined;
+		} else {
+
+			// ( types, data, fn )
+			fn = data;
+			data = selector;
+			selector = undefined;
+		}
+	}
+	if ( fn === false ) {
+		fn = returnFalse;
+	} else if ( !fn ) {
+		return elem;
+	}
+
+	if ( one === 1 ) {
+		origFn = fn;
+		fn = function( event ) {
+
+			// Can use an empty set, since event contains the info
+			jQuery().off( event );
+			return origFn.apply( this, arguments );
+		};
+
+		// Use same guid so caller can remove using origFn
+		fn.guid = origFn.guid || ( origFn.guid = jQuery.guid++ );
+	}
+	return elem.each( function() {
+		jQuery.event.add( this, types, fn, data, selector );
+	} );
+}
+
+/*
+ * Helper functions for managing events -- not part of the public interface.
+ * Props to Dean Edwards' addEvent library for many of the ideas.
+ */
+jQuery.event = {
+
+	global: {},
+
+	add: function( elem, types, handler, data, selector ) {
+
+		var handleObjIn, eventHandle, tmp,
+			events, t, handleObj,
+			special, handlers, type, namespaces, origType,
+			elemData = dataPriv.get( elem );
+
+		// Only attach events to objects that accept data
+		if ( !acceptData( elem ) ) {
+			return;
+		}
+
+		// Caller can pass in an object of custom data in lieu of the handler
+		if ( handler.handler ) {
+			handleObjIn = handler;
+			handler = handleObjIn.handler;
+			selector = handleObjIn.selector;
+		}
+
+		// Ensure that invalid selectors throw exceptions at attach time
+		// Evaluate against documentElement in case elem is a non-element node (e.g., document)
+		if ( selector ) {
+			jQuery.find.matchesSelector( documentElement, selector );
+		}
+
+		// Make sure that the handler has a unique ID, used to find/remove it later
+		if ( !handler.guid ) {
+			handler.guid = jQuery.guid++;
+		}
+
+		// Init the element's event structure and main handler, if this is the first
+		if ( !( events = elemData.events ) ) {
+			events = elemData.events = Object.create( null );
+		}
+		if ( !( eventHandle = elemData.handle ) ) {
+			eventHandle = elemData.handle = function( e ) {
+
+				// Discard the second event of a jQuery.event.trigger() and
+				// when an event is called after a page has unloaded
+				return typeof jQuery !== "undefined" && jQuery.event.triggered !== e.type ?
+					jQuery.event.dispatch.apply( elem, arguments ) : undefined;
+			};
+		}
+
+		// Handle multiple events separated by a space
+		types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// There *must* be a type, no attaching namespace-only handlers
+			if ( !type ) {
+				continue;
+			}
+
+			// If event changes its type, use the special event handlers for the changed type
+			special = jQuery.event.special[ type ] || {};
+
+			// If selector defined, determine special event api type, otherwise given type
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+
+			// Update special based on newly reset type
+			special = jQuery.event.special[ type ] || {};
+
+			// handleObj is passed to all event handlers
+			handleObj = jQuery.extend( {
+				type: type,
+				origType: origType,
+				data: data,
+				handler: handler,
+				guid: handler.guid,
+				selector: selector,
+				needsContext: selector && jQuery.expr.match.needsContext.test( selector ),
+				namespace: namespaces.join( "." )
+			}, handleObjIn );
+
+			// Init the event handler queue if we're the first
+			if ( !( handlers = events[ type ] ) ) {
+				handlers = events[ type ] = [];
+				handlers.delegateCount = 0;
+
+				// Only use addEventListener if the special events handler returns false
+				if ( !special.setup ||
+					special.setup.call( elem, data, namespaces, eventHandle ) === false ) {
+
+					if ( elem.addEventListener ) {
+						elem.addEventListener( type, eventHandle );
+					}
+				}
+			}
+
+			if ( special.add ) {
+				special.add.call( elem, handleObj );
+
+				if ( !handleObj.handler.guid ) {
+					handleObj.handler.guid = handler.guid;
+				}
+			}
+
+			// Add to the element's handler list, delegates in front
+			if ( selector ) {
+				handlers.splice( handlers.delegateCount++, 0, handleObj );
+			} else {
+				handlers.push( handleObj );
+			}
+
+			// Keep track of which events have ever been used, for event optimization
+			jQuery.event.global[ type ] = true;
+		}
+
+	},
+
+	// Detach an event or set of events from an element
+	remove: function( elem, types, handler, selector, mappedTypes ) {
+
+		var j, origCount, tmp,
+			events, t, handleObj,
+			special, handlers, type, namespaces, origType,
+			elemData = dataPriv.hasData( elem ) && dataPriv.get( elem );
+
+		if ( !elemData || !( events = elemData.events ) ) {
+			return;
+		}
+
+		// Once for each type.namespace in types; type may be omitted
+		types = ( types || "" ).match( rnothtmlwhite ) || [ "" ];
+		t = types.length;
+		while ( t-- ) {
+			tmp = rtypenamespace.exec( types[ t ] ) || [];
+			type = origType = tmp[ 1 ];
+			namespaces = ( tmp[ 2 ] || "" ).split( "." ).sort();
+
+			// Unbind all events (on this namespace, if provided) for the element
+			if ( !type ) {
+				for ( type in events ) {
+					jQuery.event.remove( elem, type + types[ t ], handler, selector, true );
+				}
+				continue;
+			}
+
+			special = jQuery.event.special[ type ] || {};
+			type = ( selector ? special.delegateType : special.bindType ) || type;
+			handlers = events[ type ] || [];
+			tmp = tmp[ 2 ] &&
+				new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" );
+
+			// Remove matching events
+			origCount = j = handlers.length;
+			while ( j-- ) {
+				handleObj = handlers[ j ];
+
+				if ( ( mappedTypes || origType === handleObj.origType ) &&
+					( !handler || handler.guid === handleObj.guid ) &&
+					( !tmp || tmp.test( handleObj.namespace ) ) &&
+					( !selector || selector === handleObj.selector ||
+						selector === "**" && handleObj.selector ) ) {
+					handlers.splice( j, 1 );
+
+					if ( handleObj.selector ) {
+						handlers.delegateCount--;
+					}
+					if ( special.remove ) {
+						special.remove.call( elem, handleObj );
+					}
+				}
+			}
+
+			// Remove generic event handler if we removed something and no more handlers exist
+			// (avoids potential for endless recursion during removal of special event handlers)
+			if ( origCount && !handlers.length ) {
+				if ( !special.teardown ||
+					special.teardown.call( elem, namespaces, elemData.handle ) === false ) {
+
+					jQuery.removeEvent( elem, type, elemData.handle );
+				}
+
+				delete events[ type ];
+			}
+		}
+
+		// Remove data and the expando if it's no longer used
+		if ( jQuery.isEmptyObject( events ) ) {
+			dataPriv.remove( elem, "handle events" );
+		}
+	},
+
+	dispatch: function( nativeEvent ) {
+
+		var i, j, ret, matched, handleObj, handlerQueue,
+			args = new Array( arguments.length ),
+
+			// Make a writable jQuery.Event from the native event object
+			event = jQuery.event.fix( nativeEvent ),
+
+			handlers = (
+					dataPriv.get( this, "events" ) || Object.create( null )
+				)[ event.type ] || [],
+			special = jQuery.event.special[ event.type ] || {};
+
+		// Use the fix-ed jQuery.Event rather than the (read-only) native event
+		args[ 0 ] = event;
+
+		for ( i = 1; i < arguments.length; i++ ) {
+			args[ i ] = arguments[ i ];
+		}
+
+		event.delegateTarget = this;
+
+		// Call the preDispatch hook for the mapped type, and let it bail if desired
+		if ( special.preDispatch && special.preDispatch.call( this, event ) === false ) {
+			return;
+		}
+
+		// Determine handlers
+		handlerQueue = jQuery.event.handlers.call( this, event, handlers );
+
+		// Run delegates first; they may want to stop propagation beneath us
+		i = 0;
+		while ( ( matched = handlerQueue[ i++ ] ) && !event.isPropagationStopped() ) {
+			event.currentTarget = matched.elem;
+
+			j = 0;
+			while ( ( handleObj = matched.handlers[ j++ ] ) &&
+				!event.isImmediatePropagationStopped() ) {
+
+				// If the event is namespaced, then each handler is only invoked if it is
+				// specially universal or its namespaces are a superset of the event's.
+				if ( !event.rnamespace || handleObj.namespace === false ||
+					event.rnamespace.test( handleObj.namespace ) ) {
+
+					event.handleObj = handleObj;
+					event.data = handleObj.data;
+
+					ret = ( ( jQuery.event.special[ handleObj.origType ] || {} ).handle ||
+						handleObj.handler ).apply( matched.elem, args );
+
+					if ( ret !== undefined ) {
+						if ( ( event.result = ret ) === false ) {
+							event.preventDefault();
+							event.stopPropagation();
+						}
+					}
+				}
+			}
+		}
+
+		// Call the postDispatch hook for the mapped type
+		if ( special.postDispatch ) {
+			special.postDispatch.call( this, event );
+		}
+
+		return event.result;
+	},
+
+	handlers: function( event, handlers ) {
+		var i, handleObj, sel, matchedHandlers, matchedSelectors,
+			handlerQueue = [],
+			delegateCount = handlers.delegateCount,
+			cur = event.target;
+
+		// Find delegate handlers
+		if ( delegateCount &&
+
+			// Support: IE <=9
+			// Black-hole SVG <use> instance trees (trac-13180)
+			cur.nodeType &&
+
+			// Support: Firefox <=42
+			// Suppress spec-violating clicks indicating a non-primary pointer button (trac-3861)
+			// https://www.w3.org/TR/DOM-Level-3-Events/#event-type-click
+			// Support: IE 11 only
+			// ...but not arrow key "clicks" of radio inputs, which can have `button` -1 (gh-2343)
+			!( event.type === "click" && event.button >= 1 ) ) {
+
+			for ( ; cur !== this; cur = cur.parentNode || this ) {
+
+				// Don't check non-elements (#13208)
+				// Don't process clicks on disabled elements (#6911, #8165, #11382, #11764)
+				if ( cur.nodeType === 1 && !( event.type === "click" && cur.disabled === true ) ) {
+					matchedHandlers = [];
+					matchedSelectors = {};
+					for ( i = 0; i < delegateCount; i++ ) {
+						handleObj = handlers[ i ];
+
+						// Don't conflict with Object.prototype properties (#13203)
+						sel = handleObj.selector + " ";
+
+						if ( matchedSelectors[ sel ] === undefined ) {
+							matchedSelectors[ sel ] = handleObj.needsContext ?
+								jQuery( sel, this ).index( cur ) > -1 :
+								jQuery.find( sel, this, null, [ cur ] ).length;
+						}
+						if ( matchedSelectors[ sel ] ) {
+							matchedHandlers.push( handleObj );
+						}
+					}
+					if ( matchedHandlers.length ) {
+						handlerQueue.push( { elem: cur, handlers: matchedHandlers } );
+					}
+				}
+			}
+		}
+
+		// Add the remaining (directly-bound) handlers
+		cur = this;
+		if ( delegateCount < handlers.length ) {
+			handlerQueue.push( { elem: cur, handlers: handlers.slice( delegateCount ) } );
+		}
+
+		return handlerQueue;
+	},
+
+	addProp: function( name, hook ) {
+		Object.defineProperty( jQuery.Event.prototype, name, {
+			enumerable: true,
+			configurable: true,
+
+			get: isFunction( hook ) ?
+				function() {
+					if ( this.originalEvent ) {
+							return hook( this.originalEvent );
+					}
+				} :
+				function() {
+					if ( this.originalEvent ) {
+							return this.originalEvent[ name ];
+					}
+				},
+
+			set: function( value ) {
+				Object.defineProperty( this, name, {
+					enumerable: true,
+					configurable: true,
+					writable: true,
+					value: value
+				} );
+			}
+		} );
+	},
+
+	fix: function( originalEvent ) {
+		return originalEvent[ jQuery.expando ] ?
+			originalEvent :
+			new jQuery.Event( originalEvent );
+	},
+
+	special: {
+		load: {
+
+			// Prevent triggered image.load events from bubbling to window.load
+			noBubble: true
+		},
+		click: {
+
+			// Utilize native event to ensure correct state for checkable inputs
+			setup: function( data ) {
+
+				// For mutual compressibility with _default, replace `this` access with a local var.
+				// `|| data` is dead code meant only to preserve the variable through minification.
+				var el = this || data;
+
+				// Claim the first handler
+				if ( rcheckableType.test( el.type ) &&
+					el.click && nodeName( el, "input" ) ) {
+
+					// dataPriv.set( el, "click", ... )
+					leverageNative( el, "click", returnTrue );
+				}
+
+				// Return false to allow normal processing in the caller
+				return false;
+			},
+			trigger: function( data ) {
+
+				// For mutual compressibility with _default, replace `this` access with a local var.
+				// `|| data` is dead code meant only to preserve the variable through minification.
+				var el = this || data;
+
+				// Force setup before triggering a click
+				if ( rcheckableType.test( el.type ) &&
+					el.click && nodeName( el, "input" ) ) {
+
+					leverageNative( el, "click" );
+				}
+
+				// Return non-false to allow normal event-path propagation
+				return true;
+			},
+
+			// For cross-browser consistency, suppress native .click() on links
+			// Also prevent it if we're currently inside a leveraged native-event stack
+			_default: function( event ) {
+				var target = event.target;
+				return rcheckableType.test( target.type ) &&
+					target.click && nodeName( target, "input" ) &&
+					dataPriv.get( target, "click" ) ||
+					nodeName( target, "a" );
+			}
+		},
+
+		beforeunload: {
+			postDispatch: function( event ) {
+
+				// Support: Firefox 20+
+				// Firefox doesn't alert if the returnValue field is not set.
+				if ( event.result !== undefined && event.originalEvent ) {
+					event.originalEvent.returnValue = event.result;
+				}
+			}
+		}
+	}
+};
+
+// Ensure the presence of an event listener that handles manually-triggered
+// synthetic events by interrupting progress until reinvoked in response to
+// *native* events that it fires directly, ensuring that state changes have
+// already occurred before other listeners are invoked.
+function leverageNative( el, type, expectSync ) {
+
+	// Missing expectSync indicates a trigger call, which must force setup through jQuery.event.add
+	if ( !expectSync ) {
+		if ( dataPriv.get( el, type ) === undefined ) {
+			jQuery.event.add( el, type, returnTrue );
+		}
+		return;
+	}
+
+	// Register the controller as a special universal handler for all event namespaces
+	dataPriv.set( el, type, false );
+	jQuery.event.add( el, type, {
+		namespace: false,
+		handler: function( event ) {
+			var notAsync, result,
+				saved = dataPriv.get( this, type );
+
+			if ( ( event.isTrigger & 1 ) && this[ type ] ) {
+
+				// Interrupt processing of the outer synthetic .trigger()ed event
+				// Saved data should be false in such cases, but might be a leftover capture object
+				// from an async native handler (gh-4350)
+				if ( !saved.length ) {
+
+					// Store arguments for use when handling the inner native event
+					// There will always be at least one argument (an event object), so this array
+					// will not be confused with a leftover capture object.
+					saved = slice.call( arguments );
+					dataPriv.set( this, type, saved );
+
+					// Trigger the native event and capture its result
+					// Support: IE <=9 - 11+
+					// focus() and blur() are asynchronous
+					notAsync = expectSync( this, type );
+					this[ type ]();
+					result = dataPriv.get( this, type );
+					if ( saved !== result || notAsync ) {
+						dataPriv.set( this, type, false );
+					} else {
+						result = {};
+					}
+					if ( saved !== result ) {
+
+						// Cancel the outer synthetic event
+						event.stopImmediatePropagation();
+						event.preventDefault();
+						return result.value;
+					}
+
+				// If this is an inner synthetic event for an event with a bubbling surrogate
+				// (focus or blur), assume that the surrogate already propagated from triggering the
+				// native event and prevent that from happening again here.
+				// This technically gets the ordering wrong w.r.t. to `.trigger()` (in which the
+				// bubbling surrogate propagates *after* the non-bubbling base), but that seems
+				// less bad than duplication.
+				} else if ( ( jQuery.event.special[ type ] || {} ).delegateType ) {
+					event.stopPropagation();
+				}
+
+			// If this is a native event triggered above, everything is now in order
+			// Fire an inner synthetic event with the original arguments
+			} else if ( saved.length ) {
+
+				// ...and capture the result
+				dataPriv.set( this, type, {
+					value: jQuery.event.trigger(
+
+						// Support: IE <=9 - 11+
+						// Extend with the prototype to reset the above stopImmediatePropagation()
+						jQuery.extend( saved[ 0 ], jQuery.Event.prototype ),
+						saved.slice( 1 ),
+						this
+					)
+				} );
+
+				// Abort handling of the native event
+				event.stopImmediatePropagation();
+			}
+		}
+	} );
+}
+
+jQuery.removeEvent = function( elem, type, handle ) {
+
+	// This "if" is needed for plain objects
+	if ( elem.removeEventListener ) {
+		elem.removeEventListener( type, handle );
+	}
+};
+
+jQuery.Event = function( src, props ) {
+
+	// Allow instantiation without the 'new' keyword
+	if ( !( this instanceof jQuery.Event ) ) {
+		return new jQuery.Event( src, props );
+	}
+
+	// Event object
+	if ( src && src.type ) {
+		this.originalEvent = src;
+		this.type = src.type;
+
+		// Events bubbling up the document may have been marked as prevented
+		// by a handler lower down the tree; reflect the correct value.
+		this.isDefaultPrevented = src.defaultPrevented ||
+				src.defaultPrevented === undefined &&
+
+				// Support: Android <=2.3 only
+				src.returnValue === false ?
+			returnTrue :
+			returnFalse;
+
+		// Create target properties
+		// Support: Safari <=6 - 7 only
+		// Target should not be a text node (#504, #13143)
+		this.target = ( src.target && src.target.nodeType === 3 ) ?
+			src.target.parentNode :
+			src.target;
+
+		this.currentTarget = src.currentTarget;
+		this.relatedTarget = src.relatedTarget;
+
+	// Event type
+	} else {
+		this.type = src;
+	}
+
+	// Put explicitly provided properties onto the event object
+	if ( props ) {
+		jQuery.extend( this, props );
+	}
+
+	// Create a timestamp if incoming event doesn't have one
+	this.timeStamp = src && src.timeStamp || Date.now();
+
+	// Mark it as fixed
+	this[ jQuery.expando ] = true;
+};
+
+// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding
+// https://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html
+jQuery.Event.prototype = {
+	constructor: jQuery.Event,
+	isDefaultPrevented: returnFalse,
+	isPropagationStopped: returnFalse,
+	isImmediatePropagationStopped: returnFalse,
+	isSimulated: false,
+
+	preventDefault: function() {
+		var e = this.originalEvent;
+
+		this.isDefaultPrevented = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.preventDefault();
+		}
+	},
+	stopPropagation: function() {
+		var e = this.originalEvent;
+
+		this.isPropagationStopped = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.stopPropagation();
+		}
+	},
+	stopImmediatePropagation: function() {
+		var e = this.originalEvent;
+
+		this.isImmediatePropagationStopped = returnTrue;
+
+		if ( e && !this.isSimulated ) {
+			e.stopImmediatePropagation();
+		}
+
+		this.stopPropagation();
+	}
+};
+
+// Includes all common event props including KeyEvent and MouseEvent specific props
+jQuery.each( {
+	altKey: true,
+	bubbles: true,
+	cancelable: true,
+	changedTouches: true,
+	ctrlKey: true,
+	detail: true,
+	eventPhase: true,
+	metaKey: true,
+	pageX: true,
+	pageY: true,
+	shiftKey: true,
+	view: true,
+	"char": true,
+	code: true,
+	charCode: true,
+	key: true,
+	keyCode: true,
+	button: true,
+	buttons: true,
+	clientX: true,
+	clientY: true,
+	offsetX: true,
+	offsetY: true,
+	pointerId: true,
+	pointerType: true,
+	screenX: true,
+	screenY: true,
+	targetTouches: true,
+	toElement: true,
+	touches: true,
+
+	which: function( event ) {
+		var button = event.button;
+
+		// Add which for key events
+		if ( event.which == null && rkeyEvent.test( event.type ) ) {
+			return event.charCode != null ? event.charCode : event.keyCode;
+		}
+
+		// Add which for click: 1 === left; 2 === middle; 3 === right
+		if ( !event.which && button !== undefined && rmouseEvent.test( event.type ) ) {
+			if ( button & 1 ) {
+				return 1;
+			}
+
+			if ( button & 2 ) {
+				return 3;
+			}
+
+			if ( button & 4 ) {
+				return 2;
+			}
+
+			return 0;
+		}
+
+		return event.which;
+	}
+}, jQuery.event.addProp );
+
+jQuery.each( { focus: "focusin", blur: "focusout" }, function( type, delegateType ) {
+	jQuery.event.special[ type ] = {
+
+		// Utilize native event if possible so blur/focus sequence is correct
+		setup: function() {
+
+			// Claim the first handler
+			// dataPriv.set( this, "focus", ... )
+			// dataPriv.set( this, "blur", ... )
+			leverageNative( this, type, expectSync );
+
+			// Return false to allow normal processing in the caller
+			return false;
+		},
+		trigger: function() {
+
+			// Force setup before trigger
+			leverageNative( this, type );
+
+			// Return non-false to allow normal event-path propagation
+			return true;
+		},
+
+		delegateType: delegateType
+	};
+} );
+
+// Create mouseenter/leave events using mouseover/out and event-time checks
+// so that event delegation works in jQuery.
+// Do the same for pointerenter/pointerleave and pointerover/pointerout
+//
+// Support: Safari 7 only
+// Safari sends mouseenter too often; see:
+// https://bugs.chromium.org/p/chromium/issues/detail?id=470258
+// for the description of the bug (it existed in older Chrome versions as well).
+jQuery.each( {
+	mouseenter: "mouseover",
+	mouseleave: "mouseout",
+	pointerenter: "pointerover",
+	pointerleave: "pointerout"
+}, function( orig, fix ) {
+	jQuery.event.special[ orig ] = {
+		delegateType: fix,
+		bindType: fix,
+
+		handle: function( event ) {
+			var ret,
+				target = this,
+				related = event.relatedTarget,
+				handleObj = event.handleObj;
+
+			// For mouseenter/leave call the handler if related is outside the target.
+			// NB: No relatedTarget if the mouse left/entered the browser window
+			if ( !related || ( related !== target && !jQuery.contains( target, related ) ) ) {
+				event.type = handleObj.origType;
+				ret = handleObj.handler.apply( this, arguments );
+				event.type = fix;
+			}
+			return ret;
+		}
+	};
+} );
+
+jQuery.fn.extend( {
+
+	on: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn );
+	},
+	one: function( types, selector, data, fn ) {
+		return on( this, types, selector, data, fn, 1 );
+	},
+	off: function( types, selector, fn ) {
+		var handleObj, type;
+		if ( types && types.preventDefault && types.handleObj ) {
+
+			// ( event )  dispatched jQuery.Event
+			handleObj = types.handleObj;
+			jQuery( types.delegateTarget ).off(
+				handleObj.namespace ?
+					handleObj.origType + "." + handleObj.namespace :
+					handleObj.origType,
+				handleObj.selector,
+				handleObj.handler
+			);
+			return this;
+		}
+		if ( typeof types === "object" ) {
+
+			// ( types-object [, selector] )
+			for ( type in types ) {
+				this.off( type, selector, types[ type ] );
+			}
+			return this;
+		}
+		if ( selector === false || typeof selector === "function" ) {
+
+			// ( types [, fn] )
+			fn = selector;
+			selector = undefined;
+		}
+		if ( fn === false ) {
+			fn = returnFalse;
+		}
+		return this.each( function() {
+			jQuery.event.remove( this, types, fn, selector );
+		} );
+	}
+} );
+
+
+var
+
+	// Support: IE <=10 - 11, Edge 12 - 13 only
+	// In IE/Edge using regex groups here causes severe slowdowns.
+	// See https://connect.microsoft.com/IE/feedback/details/1736512/
+	rnoInnerhtml = /<script|<style|<link/i,
+
+	// checked="checked" or checked
+	rchecked = /checked\s*(?:[^=]|=\s*.checked.)/i,
+	rcleanScript = /^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;
+
+// Prefer a tbody over its parent table for containing new rows
+function manipulationTarget( elem, content ) {
+	if ( nodeName( elem, "table" ) &&
+		nodeName( content.nodeType !== 11 ? content : content.firstChild, "tr" ) ) {
+
+		return jQuery( elem ).children( "tbody" )[ 0 ] || elem;
+	}
+
+	return elem;
+}
+
+// Replace/restore the type attribute of script elements for safe DOM manipulation
+function disableScript( elem ) {
+	elem.type = ( elem.getAttribute( "type" ) !== null ) + "/" + elem.type;
+	return elem;
+}
+function restoreScript( elem ) {
+	if ( ( elem.type || "" ).slice( 0, 5 ) === "true/" ) {
+		elem.type = elem.type.slice( 5 );
+	} else {
+		elem.removeAttribute( "type" );
+	}
+
+	return elem;
+}
+
+function cloneCopyEvent( src, dest ) {
+	var i, l, type, pdataOld, udataOld, udataCur, events;
+
+	if ( dest.nodeType !== 1 ) {
+		return;
+	}
+
+	// 1. Copy private data: events, handlers, etc.
+	if ( dataPriv.hasData( src ) ) {
+		pdataOld = dataPriv.get( src );
+		events = pdataOld.events;
+
+		if ( events ) {
+			dataPriv.remove( dest, "handle events" );
+
+			for ( type in events ) {
+				for ( i = 0, l = events[ type ].length; i < l; i++ ) {
+					jQuery.event.add( dest, type, events[ type ][ i ] );
+				}
+			}
+		}
+	}
+
+	// 2. Copy user data
+	if ( dataUser.hasData( src ) ) {
+		udataOld = dataUser.access( src );
+		udataCur = jQuery.extend( {}, udataOld );
+
+		dataUser.set( dest, udataCur );
+	}
+}
+
+// Fix IE bugs, see support tests
+function fixInput( src, dest ) {
+	var nodeName = dest.nodeName.toLowerCase();
+
+	// Fails to persist the checked state of a cloned checkbox or radio button.
+	if ( nodeName === "input" && rcheckableType.test( src.type ) ) {
+		dest.checked = src.checked;
+
+	// Fails to return the selected option to the default selected state when cloning options
+	} else if ( nodeName === "input" || nodeName === "textarea" ) {
+		dest.defaultValue = src.defaultValue;
+	}
+}
+
+function domManip( collection, args, callback, ignored ) {
+
+	// Flatten any nested arrays
+	args = flat( args );
+
+	var fragment, first, scripts, hasScripts, node, doc,
+		i = 0,
+		l = collection.length,
+		iNoClone = l - 1,
+		value = args[ 0 ],
+		valueIsFunction = isFunction( value );
+
+	// We can't cloneNode fragments that contain checked, in WebKit
+	if ( valueIsFunction ||
+			( l > 1 && typeof value === "string" &&
+				!support.checkClone && rchecked.test( value ) ) ) {
+		return collection.each( function( index ) {
+			var self = collection.eq( index );
+			if ( valueIsFunction ) {
+				args[ 0 ] = value.call( this, index, self.html() );
+			}
+			domManip( self, args, callback, ignored );
+		} );
+	}
+
+	if ( l ) {
+		fragment = buildFragment( args, collection[ 0 ].ownerDocument, false, collection, ignored );
+		first = fragment.firstChild;
+
+		if ( fragment.childNodes.length === 1 ) {
+			fragment = first;
+		}
+
+		// Require either new content or an interest in ignored elements to invoke the callback
+		if ( first || ignored ) {
+			scripts = jQuery.map( getAll( fragment, "script" ), disableScript );
+			hasScripts = scripts.length;
+
+			// Use the original fragment for the last item
+			// instead of the first because it can end up
+			// being emptied incorrectly in certain situations (#8070).
+			for ( ; i < l; i++ ) {
+				node = fragment;
+
+				if ( i !== iNoClone ) {
+					node = jQuery.clone( node, true, true );
+
+					// Keep references to cloned scripts for later restoration
+					if ( hasScripts ) {
+
+						// Support: Android <=4.0 only, PhantomJS 1 only
+						// push.apply(_, arraylike) throws on ancient WebKit
+						jQuery.merge( scripts, getAll( node, "script" ) );
+					}
+				}
+
+				callback.call( collection[ i ], node, i );
+			}
+
+			if ( hasScripts ) {
+				doc = scripts[ scripts.length - 1 ].ownerDocument;
+
+				// Reenable scripts
+				jQuery.map( scripts, restoreScript );
+
+				// Evaluate executable scripts on first document insertion
+				for ( i = 0; i < hasScripts; i++ ) {
+					node = scripts[ i ];
+					if ( rscriptType.test( node.type || "" ) &&
+						!dataPriv.access( node, "globalEval" ) &&
+						jQuery.contains( doc, node ) ) {
+
+						if ( node.src && ( node.type || "" ).toLowerCase()  !== "module" ) {
+
+							// Optional AJAX dependency, but won't run scripts if not present
+							if ( jQuery._evalUrl && !node.noModule ) {
+								jQuery._evalUrl( node.src, {
+									nonce: node.nonce || node.getAttribute( "nonce" )
+								}, doc );
+							}
+						} else {
+							DOMEval( node.textContent.replace( rcleanScript, "" ), node, doc );
+						}
+					}
+				}
+			}
+		}
+	}
+
+	return collection;
+}
+
+function remove( elem, selector, keepData ) {
+	var node,
+		nodes = selector ? jQuery.filter( selector, elem ) : elem,
+		i = 0;
+
+	for ( ; ( node = nodes[ i ] ) != null; i++ ) {
+		if ( !keepData && node.nodeType === 1 ) {
+			jQuery.cleanData( getAll( node ) );
+		}
+
+		if ( node.parentNode ) {
+			if ( keepData && isAttached( node ) ) {
+				setGlobalEval( getAll( node, "script" ) );
+			}
+			node.parentNode.removeChild( node );
+		}
+	}
+
+	return elem;
+}
+
+jQuery.extend( {
+	htmlPrefilter: function( html ) {
+		return html;
+	},
+
+	clone: function( elem, dataAndEvents, deepDataAndEvents ) {
+		var i, l, srcElements, destElements,
+			clone = elem.cloneNode( true ),
+			inPage = isAttached( elem );
+
+		// Fix IE cloning issues
+		if ( !support.noCloneChecked && ( elem.nodeType === 1 || elem.nodeType === 11 ) &&
+				!jQuery.isXMLDoc( elem ) ) {
+
+			// We eschew Sizzle here for performance reasons: https://jsperf.com/getall-vs-sizzle/2
+			destElements = getAll( clone );
+			srcElements = getAll( elem );
+
+			for ( i = 0, l = srcElements.length; i < l; i++ ) {
+				fixInput( srcElements[ i ], destElements[ i ] );
+			}
+		}
+
+		// Copy the events from the original to the clone
+		if ( dataAndEvents ) {
+			if ( deepDataAndEvents ) {
+				srcElements = srcElements || getAll( elem );
+				destElements = destElements || getAll( clone );
+
+				for ( i = 0, l = srcElements.length; i < l; i++ ) {
+					cloneCopyEvent( srcElements[ i ], destElements[ i ] );
+				}
+			} else {
+				cloneCopyEvent( elem, clone );
+			}
+		}
+
+		// Preserve script evaluation history
+		destElements = getAll( clone, "script" );
+		if ( destElements.length > 0 ) {
+			setGlobalEval( destElements, !inPage && getAll( elem, "script" ) );
+		}
+
+		// Return the cloned set
+		return clone;
+	},
+
+	cleanData: function( elems ) {
+		var data, elem, type,
+			special = jQuery.event.special,
+			i = 0;
+
+		for ( ; ( elem = elems[ i ] ) !== undefined; i++ ) {
+			if ( acceptData( elem ) ) {
+				if ( ( data = elem[ dataPriv.expando ] ) ) {
+					if ( data.events ) {
+						for ( type in data.events ) {
+							if ( special[ type ] ) {
+								jQuery.event.remove( elem, type );
+
+							// This is a shortcut to avoid jQuery.event.remove's overhead
+							} else {
+								jQuery.removeEvent( elem, type, data.handle );
+							}
+						}
+					}
+
+					// Support: Chrome <=35 - 45+
+					// Assign undefined instead of using delete, see Data#remove
+					elem[ dataPriv.expando ] = undefined;
+				}
+				if ( elem[ dataUser.expando ] ) {
+
+					// Support: Chrome <=35 - 45+
+					// Assign undefined instead of using delete, see Data#remove
+					elem[ dataUser.expando ] = undefined;
+				}
+			}
+		}
+	}
+} );
+
+jQuery.fn.extend( {
+	detach: function( selector ) {
+		return remove( this, selector, true );
+	},
+
+	remove: function( selector ) {
+		return remove( this, selector );
+	},
+
+	text: function( value ) {
+		return access( this, function( value ) {
+			return value === undefined ?
+				jQuery.text( this ) :
+				this.empty().each( function() {
+					if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+						this.textContent = value;
+					}
+				} );
+		}, null, value, arguments.length );
+	},
+
+	append: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.appendChild( elem );
+			}
+		} );
+	},
+
+	prepend: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.nodeType === 1 || this.nodeType === 11 || this.nodeType === 9 ) {
+				var target = manipulationTarget( this, elem );
+				target.insertBefore( elem, target.firstChild );
+			}
+		} );
+	},
+
+	before: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this );
+			}
+		} );
+	},
+
+	after: function() {
+		return domManip( this, arguments, function( elem ) {
+			if ( this.parentNode ) {
+				this.parentNode.insertBefore( elem, this.nextSibling );
+			}
+		} );
+	},
+
+	empty: function() {
+		var elem,
+			i = 0;
+
+		for ( ; ( elem = this[ i ] ) != null; i++ ) {
+			if ( elem.nodeType === 1 ) {
+
+				// Prevent memory leaks
+				jQuery.cleanData( getAll( elem, false ) );
+
+				// Remove any remaining nodes
+				elem.textContent = "";
+			}
+		}
+
+		return this;
+	},
+
+	clone: function( dataAndEvents, deepDataAndEvents ) {
+		dataAndEvents = dataAndEvents == null ? false : dataAndEvents;
+		deepDataAndEvents = deepDataAndEvents == null ? dataAndEvents : deepDataAndEvents;
+
+		return this.map( function() {
+			return jQuery.clone( this, dataAndEvents, deepDataAndEvents );
+		} );
+	},
+
+	html: function( value ) {
+		return access( this, function( value ) {
+			var elem = this[ 0 ] || {},
+				i = 0,
+				l = this.length;
+
+			if ( value === undefined && elem.nodeType === 1 ) {
+				return elem.innerHTML;
+			}
+
+			// See if we can take a shortcut and just use innerHTML
+			if ( typeof value === "string" && !rnoInnerhtml.test( value ) &&
+				!wrapMap[ ( rtagName.exec( value ) || [ "", "" ] )[ 1 ].toLowerCase() ] ) {
+
+				value = jQuery.htmlPrefilter( value );
+
+				try {
+					for ( ; i < l; i++ ) {
+						elem = this[ i ] || {};
+
+						// Remove element nodes and prevent memory leaks
+						if ( elem.nodeType === 1 ) {
+							jQuery.cleanData( getAll( elem, false ) );
+							elem.innerHTML = value;
+						}
+					}
+
+					elem = 0;
+
+				// If using innerHTML throws an exception, use the fallback method
+				} catch ( e ) {}
+			}
+
+			if ( elem ) {
+				this.empty().append( value );
+			}
+		}, null, value, arguments.length );
+	},
+
+	replaceWith: function() {
+		var ignored = [];
+
+		// Make the changes, replacing each non-ignored context element with the new content
+		return domManip( this, arguments, function( elem ) {
+			var parent = this.parentNode;
+
+			if ( jQuery.inArray( this, ignored ) < 0 ) {
+				jQuery.cleanData( getAll( this ) );
+				if ( parent ) {
+					parent.replaceChild( elem, this );
+				}
+			}
+
+		// Force callback invocation
+		}, ignored );
+	}
+} );
+
+jQuery.each( {
+	appendTo: "append",
+	prependTo: "prepend",
+	insertBefore: "before",
+	insertAfter: "after",
+	replaceAll: "replaceWith"
+}, function( name, original ) {
+	jQuery.fn[ name ] = function( selector ) {
+		var elems,
+			ret = [],
+			insert = jQuery( selector ),
+			last = insert.length - 1,
+			i = 0;
+
+		for ( ; i <= last; i++ ) {
+			elems = i === last ? this : this.clone( true );
+			jQuery( insert[ i ] )[ original ]( elems );
+
+			// Support: Android <=4.0 only, PhantomJS 1 only
+			// .get() because push.apply(_, arraylike) throws on ancient WebKit
+			push.apply( ret, elems.get() );
+		}
+
+		return this.pushStack( ret );
+	};
+} );
+var rnumnonpx = new RegExp( "^(" + pnum + ")(?!px)[a-z%]+$", "i" );
+
+var getStyles = function( elem ) {
+
+		// Support: IE <=11 only, Firefox <=30 (#15098, #14150)
+		// IE throws on elements created in popups
+		// FF meanwhile throws on frame elements through "defaultView.getComputedStyle"
+		var view = elem.ownerDocument.defaultView;
+
+		if ( !view || !view.opener ) {
+			view = window;
+		}
+
+		return view.getComputedStyle( elem );
+	};
+
+var swap = function( elem, options, callback ) {
+	var ret, name,
+		old = {};
+
+	// Remember the old values, and insert the new ones
+	for ( name in options ) {
+		old[ name ] = elem.style[ name ];
+		elem.style[ name ] = options[ name ];
+	}
+
+	ret = callback.call( elem );
+
+	// Revert the old values
+	for ( name in options ) {
+		elem.style[ name ] = old[ name ];
+	}
+
+	return ret;
+};
+
+
+var rboxStyle = new RegExp( cssExpand.join( "|" ), "i" );
+
+
+
+( function() {
+
+	// Executing both pixelPosition & boxSizingReliable tests require only one layout
+	// so they're executed at the same time to save the second computation.
+	function computeStyleTests() {
+
+		// This is a singleton, we need to execute it only once
+		if ( !div ) {
+			return;
+		}
+
+		container.style.cssText = "position:absolute;left:-11111px;width:60px;" +
+			"margin-top:1px;padding:0;border:0";
+		div.style.cssText =
+			"position:relative;display:block;box-sizing:border-box;overflow:scroll;" +
+			"margin:auto;border:1px;padding:1px;" +
+			"width:60%;top:1%";
+		documentElement.appendChild( container ).appendChild( div );
+
+		var divStyle = window.getComputedStyle( div );
+		pixelPositionVal = divStyle.top !== "1%";
+
+		// Support: Android 4.0 - 4.3 only, Firefox <=3 - 44
+		reliableMarginLeftVal = roundPixelMeasures( divStyle.marginLeft ) === 12;
+
+		// Support: Android 4.0 - 4.3 only, Safari <=9.1 - 10.1, iOS <=7.0 - 9.3
+		// Some styles come back with percentage values, even though they shouldn't
+		div.style.right = "60%";
+		pixelBoxStylesVal = roundPixelMeasures( divStyle.right ) === 36;
+
+		// Support: IE 9 - 11 only
+		// Detect misreporting of content dimensions for box-sizing:border-box elements
+		boxSizingReliableVal = roundPixelMeasures( divStyle.width ) === 36;
+
+		// Support: IE 9 only
+		// Detect overflow:scroll screwiness (gh-3699)
+		// Support: Chrome <=64
+		// Don't get tricked when zoom affects offsetWidth (gh-4029)
+		div.style.position = "absolute";
+		scrollboxSizeVal = roundPixelMeasures( div.offsetWidth / 3 ) === 12;
+
+		documentElement.removeChild( container );
+
+		// Nullify the div so it wouldn't be stored in the memory and
+		// it will also be a sign that checks already performed
+		div = null;
+	}
+
+	function roundPixelMeasures( measure ) {
+		return Math.round( parseFloat( measure ) );
+	}
+
+	var pixelPositionVal, boxSizingReliableVal, scrollboxSizeVal, pixelBoxStylesVal,
+		reliableTrDimensionsVal, reliableMarginLeftVal,
+		container = document.createElement( "div" ),
+		div = document.createElement( "div" );
+
+	// Finish early in limited (non-browser) environments
+	if ( !div.style ) {
+		return;
+	}
+
+	// Support: IE <=9 - 11 only
+	// Style of cloned element affects source element cloned (#8908)
+	div.style.backgroundClip = "content-box";
+	div.cloneNode( true ).style.backgroundClip = "";
+	support.clearCloneStyle = div.style.backgroundClip === "content-box";
+
+	jQuery.extend( support, {
+		boxSizingReliable: function() {
+			computeStyleTests();
+			return boxSizingReliableVal;
+		},
+		pixelBoxStyles: function() {
+			computeStyleTests();
+			return pixelBoxStylesVal;
+		},
+		pixelPosition: function() {
+			computeStyleTests();
+			return pixelPositionVal;
+		},
+		reliableMarginLeft: function() {
+			computeStyleTests();
+			return reliableMarginLeftVal;
+		},
+		scrollboxSize: function() {
+			computeStyleTests();
+			return scrollboxSizeVal;
+		},
+
+		// Support: IE 9 - 11+, Edge 15 - 18+
+		// IE/Edge misreport `getComputedStyle` of table rows with width/height
+		// set in CSS while `offset*` properties report correct values.
+		// Behavior in IE 9 is more subtle than in newer versions & it passes
+		// some versions of this test; make sure not to make it pass there!
+		reliableTrDimensions: function() {
+			var table, tr, trChild, trStyle;
+			if ( reliableTrDimensionsVal == null ) {
+				table = document.createElement( "table" );
+				tr = document.createElement( "tr" );
+				trChild = document.createElement( "div" );
+
+				table.style.cssText = "position:absolute;left:-11111px";
+				tr.style.height = "1px";
+				trChild.style.height = "9px";
+
+				documentElement
+					.appendChild( table )
+					.appendChild( tr )
+					.appendChild( trChild );
+
+				trStyle = window.getComputedStyle( tr );
+				reliableTrDimensionsVal = parseInt( trStyle.height ) > 3;
+
+				documentElement.removeChild( table );
+			}
+			return reliableTrDimensionsVal;
+		}
+	} );
+} )();
+
+
+function curCSS( elem, name, computed ) {
+	var width, minWidth, maxWidth, ret,
+
+		// Support: Firefox 51+
+		// Retrieving style before computed somehow
+		// fixes an issue with getting wrong values
+		// on detached elements
+		style = elem.style;
+
+	computed = computed || getStyles( elem );
+
+	// getPropertyValue is needed for:
+	//   .css('filter') (IE 9 only, #12537)
+	//   .css('--customProperty) (#3144)
+	if ( computed ) {
+		ret = computed.getPropertyValue( name ) || computed[ name ];
+
+		if ( ret === "" && !isAttached( elem ) ) {
+			ret = jQuery.style( elem, name );
+		}
+
+		// A tribute to the "awesome hack by Dean Edwards"
+		// Android Browser returns percentage for some values,
+		// but width seems to be reliably pixels.
+		// This is against the CSSOM draft spec:
+		// https://drafts.csswg.org/cssom/#resolved-values
+		if ( !support.pixelBoxStyles() && rnumnonpx.test( ret ) && rboxStyle.test( name ) ) {
+
+			// Remember the original values
+			width = style.width;
+			minWidth = style.minWidth;
+			maxWidth = style.maxWidth;
+
+			// Put in the new values to get a computed value out
+			style.minWidth = style.maxWidth = style.width = ret;
+			ret = computed.width;
+
+			// Revert the changed values
+			style.width = width;
+			style.minWidth = minWidth;
+			style.maxWidth = maxWidth;
+		}
+	}
+
+	return ret !== undefined ?
+
+		// Support: IE <=9 - 11 only
+		// IE returns zIndex value as an integer.
+		ret + "" :
+		ret;
+}
+
+
+function addGetHookIf( conditionFn, hookFn ) {
+
+	// Define the hook, we'll check on the first run if it's really needed.
+	return {
+		get: function() {
+			if ( conditionFn() ) {
+
+				// Hook not needed (or it's not possible to use it due
+				// to missing dependency), remove it.
+				delete this.get;
+				return;
+			}
+
+			// Hook needed; redefine it so that the support test is not executed again.
+			return ( this.get = hookFn ).apply( this, arguments );
+		}
+	};
+}
+
+
+var cssPrefixes = [ "Webkit", "Moz", "ms" ],
+	emptyStyle = document.createElement( "div" ).style,
+	vendorProps = {};
+
+// Return a vendor-prefixed property or undefined
+function vendorPropName( name ) {
+
+	// Check for vendor prefixed names
+	var capName = name[ 0 ].toUpperCase() + name.slice( 1 ),
+		i = cssPrefixes.length;
+
+	while ( i-- ) {
+		name = cssPrefixes[ i ] + capName;
+		if ( name in emptyStyle ) {
+			return name;
+		}
+	}
+}
+
+// Return a potentially-mapped jQuery.cssProps or vendor prefixed property
+function finalPropName( name ) {
+	var final = jQuery.cssProps[ name ] || vendorProps[ name ];
+
+	if ( final ) {
+		return final;
+	}
+	if ( name in emptyStyle ) {
+		return name;
+	}
+	return vendorProps[ name ] = vendorPropName( name ) || name;
+}
+
+
+var
+
+	// Swappable if display is none or starts with table
+	// except "table", "table-cell", or "table-caption"
+	// See here for display values: https://developer.mozilla.org/en-US/docs/CSS/display
+	rdisplayswap = /^(none|table(?!-c[ea]).+)/,
+	rcustomProp = /^--/,
+	cssShow = { position: "absolute", visibility: "hidden", display: "block" },
+	cssNormalTransform = {
+		letterSpacing: "0",
+		fontWeight: "400"
+	};
+
+function setPositiveNumber( _elem, value, subtract ) {
+
+	// Any relative (+/-) values have already been
+	// normalized at this point
+	var matches = rcssNum.exec( value );
+	return matches ?
+
+		// Guard against undefined "subtract", e.g., when used as in cssHooks
+		Math.max( 0, matches[ 2 ] - ( subtract || 0 ) ) + ( matches[ 3 ] || "px" ) :
+		value;
+}
+
+function boxModelAdjustment( elem, dimension, box, isBorderBox, styles, computedVal ) {
+	var i = dimension === "width" ? 1 : 0,
+		extra = 0,
+		delta = 0;
+
+	// Adjustment may not be necessary
+	if ( box === ( isBorderBox ? "border" : "content" ) ) {
+		return 0;
+	}
+
+	for ( ; i < 4; i += 2 ) {
+
+		// Both box models exclude margin
+		if ( box === "margin" ) {
+			delta += jQuery.css( elem, box + cssExpand[ i ], true, styles );
+		}
+
+		// If we get here with a content-box, we're seeking "padding" or "border" or "margin"
+		if ( !isBorderBox ) {
+
+			// Add padding
+			delta += jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+
+			// For "border" or "margin", add border
+			if ( box !== "padding" ) {
+				delta += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+
+			// But still keep track of it otherwise
+			} else {
+				extra += jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+
+		// If we get here with a border-box (content + padding + border), we're seeking "content" or
+		// "padding" or "margin"
+		} else {
+
+			// For "content", subtract padding
+			if ( box === "content" ) {
+				delta -= jQuery.css( elem, "padding" + cssExpand[ i ], true, styles );
+			}
+
+			// For "content" or "padding", subtract border
+			if ( box !== "margin" ) {
+				delta -= jQuery.css( elem, "border" + cssExpand[ i ] + "Width", true, styles );
+			}
+		}
+	}
+
+	// Account for positive content-box scroll gutter when requested by providing computedVal
+	if ( !isBorderBox && computedVal >= 0 ) {
+
+		// offsetWidth/offsetHeight is a rounded sum of content, padding, scroll gutter, and border
+		// Assuming integer scroll gutter, subtract the rest and round down
+		delta += Math.max( 0, Math.ceil(
+			elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+			computedVal -
+			delta -
+			extra -
+			0.5
+
+		// If offsetWidth/offsetHeight is unknown, then we can't determine content-box scroll gutter
+		// Use an explicit zero to avoid NaN (gh-3964)
+		) ) || 0;
+	}
+
+	return delta;
+}
+
+function getWidthOrHeight( elem, dimension, extra ) {
+
+	// Start with computed style
+	var styles = getStyles( elem ),
+
+		// To avoid forcing a reflow, only fetch boxSizing if we need it (gh-4322).
+		// Fake content-box until we know it's needed to know the true value.
+		boxSizingNeeded = !support.boxSizingReliable() || extra,
+		isBorderBox = boxSizingNeeded &&
+			jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+		valueIsBorderBox = isBorderBox,
+
+		val = curCSS( elem, dimension, styles ),
+		offsetProp = "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 );
+
+	// Support: Firefox <=54
+	// Return a confounding non-pixel value or feign ignorance, as appropriate.
+	if ( rnumnonpx.test( val ) ) {
+		if ( !extra ) {
+			return val;
+		}
+		val = "auto";
+	}
+
+
+	// Support: IE 9 - 11 only
+	// Use offsetWidth/offsetHeight for when box sizing is unreliable.
+	// In those cases, the computed value can be trusted to be border-box.
+	if ( ( !support.boxSizingReliable() && isBorderBox ||
+
+		// Support: IE 10 - 11+, Edge 15 - 18+
+		// IE/Edge misreport `getComputedStyle` of table rows with width/height
+		// set in CSS while `offset*` properties report correct values.
+		// Interestingly, in some cases IE 9 doesn't suffer from this issue.
+		!support.reliableTrDimensions() && nodeName( elem, "tr" ) ||
+
+		// Fall back to offsetWidth/offsetHeight when value is "auto"
+		// This happens for inline elements with no explicit setting (gh-3571)
+		val === "auto" ||
+
+		// Support: Android <=4.1 - 4.3 only
+		// Also use offsetWidth/offsetHeight for misreported inline dimensions (gh-3602)
+		!parseFloat( val ) && jQuery.css( elem, "display", false, styles ) === "inline" ) &&
+
+		// Make sure the element is visible & connected
+		elem.getClientRects().length ) {
+
+		isBorderBox = jQuery.css( elem, "boxSizing", false, styles ) === "border-box";
+
+		// Where available, offsetWidth/offsetHeight approximate border box dimensions.
+		// Where not available (e.g., SVG), assume unreliable box-sizing and interpret the
+		// retrieved value as a content box dimension.
+		valueIsBorderBox = offsetProp in elem;
+		if ( valueIsBorderBox ) {
+			val = elem[ offsetProp ];
+		}
+	}
+
+	// Normalize "" and auto
+	val = parseFloat( val ) || 0;
+
+	// Adjust for the element's box model
+	return ( val +
+		boxModelAdjustment(
+			elem,
+			dimension,
+			extra || ( isBorderBox ? "border" : "content" ),
+			valueIsBorderBox,
+			styles,
+
+			// Provide the current computed size to request scroll gutter calculation (gh-3589)
+			val
+		)
+	) + "px";
+}
+
+jQuery.extend( {
+
+	// Add in style property hooks for overriding the default
+	// behavior of getting and setting a style property
+	cssHooks: {
+		opacity: {
+			get: function( elem, computed ) {
+				if ( computed ) {
+
+					// We should always get a number back from opacity
+					var ret = curCSS( elem, "opacity" );
+					return ret === "" ? "1" : ret;
+				}
+			}
+		}
+	},
+
+	// Don't automatically add "px" to these possibly-unitless properties
+	cssNumber: {
+		"animationIterationCount": true,
+		"columnCount": true,
+		"fillOpacity": true,
+		"flexGrow": true,
+		"flexShrink": true,
+		"fontWeight": true,
+		"gridArea": true,
+		"gridColumn": true,
+		"gridColumnEnd": true,
+		"gridColumnStart": true,
+		"gridRow": true,
+		"gridRowEnd": true,
+		"gridRowStart": true,
+		"lineHeight": true,
+		"opacity": true,
+		"order": true,
+		"orphans": true,
+		"widows": true,
+		"zIndex": true,
+		"zoom": true
+	},
+
+	// Add in properties whose names you wish to fix before
+	// setting or getting the value
+	cssProps: {},
+
+	// Get and set the style property on a DOM Node
+	style: function( elem, name, value, extra ) {
+
+		// Don't set styles on text and comment nodes
+		if ( !elem || elem.nodeType === 3 || elem.nodeType === 8 || !elem.style ) {
+			return;
+		}
+
+		// Make sure that we're working with the right name
+		var ret, type, hooks,
+			origName = camelCase( name ),
+			isCustomProp = rcustomProp.test( name ),
+			style = elem.style;
+
+		// Make sure that we're working with the right name. We don't
+		// want to query the value if it is a CSS custom property
+		// since they are user-defined.
+		if ( !isCustomProp ) {
+			name = finalPropName( origName );
+		}
+
+		// Gets hook for the prefixed version, then unprefixed version
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+		// Check if we're setting a value
+		if ( value !== undefined ) {
+			type = typeof value;
+
+			// Convert "+=" or "-=" to relative numbers (#7345)
+			if ( type === "string" && ( ret = rcssNum.exec( value ) ) && ret[ 1 ] ) {
+				value = adjustCSS( elem, name, ret );
+
+				// Fixes bug #9237
+				type = "number";
+			}
+
+			// Make sure that null and NaN values aren't set (#7116)
+			if ( value == null || value !== value ) {
+				return;
+			}
+
+			// If a number was passed in, add the unit (except for certain CSS properties)
+			// The isCustomProp check can be removed in jQuery 4.0 when we only auto-append
+			// "px" to a few hardcoded values.
+			if ( type === "number" && !isCustomProp ) {
+				value += ret && ret[ 3 ] || ( jQuery.cssNumber[ origName ] ? "" : "px" );
+			}
+
+			// background-* props affect original clone's values
+			if ( !support.clearCloneStyle && value === "" && name.indexOf( "background" ) === 0 ) {
+				style[ name ] = "inherit";
+			}
+
+			// If a hook was provided, use that value, otherwise just set the specified value
+			if ( !hooks || !( "set" in hooks ) ||
+				( value = hooks.set( elem, value, extra ) ) !== undefined ) {
+
+				if ( isCustomProp ) {
+					style.setProperty( name, value );
+				} else {
+					style[ name ] = value;
+				}
+			}
+
+		} else {
+
+			// If a hook was provided get the non-computed value from there
+			if ( hooks && "get" in hooks &&
+				( ret = hooks.get( elem, false, extra ) ) !== undefined ) {
+
+				return ret;
+			}
+
+			// Otherwise just get the value from the style object
+			return style[ name ];
+		}
+	},
+
+	css: function( elem, name, extra, styles ) {
+		var val, num, hooks,
+			origName = camelCase( name ),
+			isCustomProp = rcustomProp.test( name );
+
+		// Make sure that we're working with the right name. We don't
+		// want to modify the value if it is a CSS custom property
+		// since they are user-defined.
+		if ( !isCustomProp ) {
+			name = finalPropName( origName );
+		}
+
+		// Try prefixed name followed by the unprefixed name
+		hooks = jQuery.cssHooks[ name ] || jQuery.cssHooks[ origName ];
+
+		// If a hook was provided get the computed value from there
+		if ( hooks && "get" in hooks ) {
+			val = hooks.get( elem, true, extra );
+		}
+
+		// Otherwise, if a way to get the computed value exists, use that
+		if ( val === undefined ) {
+			val = curCSS( elem, name, styles );
+		}
+
+		// Convert "normal" to computed value
+		if ( val === "normal" && name in cssNormalTransform ) {
+			val = cssNormalTransform[ name ];
+		}
+
+		// Make numeric if forced or a qualifier was provided and val looks numeric
+		if ( extra === "" || extra ) {
+			num = parseFloat( val );
+			return extra === true || isFinite( num ) ? num || 0 : val;
+		}
+
+		return val;
+	}
+} );
+
+jQuery.each( [ "height", "width" ], function( _i, dimension ) {
+	jQuery.cssHooks[ dimension ] = {
+		get: function( elem, computed, extra ) {
+			if ( computed ) {
+
+				// Certain elements can have dimension info if we invisibly show them
+				// but it must have a current display style that would benefit
+				return rdisplayswap.test( jQuery.css( elem, "display" ) ) &&
+
+					// Support: Safari 8+
+					// Table columns in Safari have non-zero offsetWidth & zero
+					// getBoundingClientRect().width unless display is changed.
+					// Support: IE <=11 only
+					// Running getBoundingClientRect on a disconnected node
+					// in IE throws an error.
+					( !elem.getClientRects().length || !elem.getBoundingClientRect().width ) ?
+						swap( elem, cssShow, function() {
+							return getWidthOrHeight( elem, dimension, extra );
+						} ) :
+						getWidthOrHeight( elem, dimension, extra );
+			}
+		},
+
+		set: function( elem, value, extra ) {
+			var matches,
+				styles = getStyles( elem ),
+
+				// Only read styles.position if the test has a chance to fail
+				// to avoid forcing a reflow.
+				scrollboxSizeBuggy = !support.scrollboxSize() &&
+					styles.position === "absolute",
+
+				// To avoid forcing a reflow, only fetch boxSizing if we need it (gh-3991)
+				boxSizingNeeded = scrollboxSizeBuggy || extra,
+				isBorderBox = boxSizingNeeded &&
+					jQuery.css( elem, "boxSizing", false, styles ) === "border-box",
+				subtract = extra ?
+					boxModelAdjustment(
+						elem,
+						dimension,
+						extra,
+						isBorderBox,
+						styles
+					) :
+					0;
+
+			// Account for unreliable border-box dimensions by comparing offset* to computed and
+			// faking a content-box to get border and padding (gh-3699)
+			if ( isBorderBox && scrollboxSizeBuggy ) {
+				subtract -= Math.ceil(
+					elem[ "offset" + dimension[ 0 ].toUpperCase() + dimension.slice( 1 ) ] -
+					parseFloat( styles[ dimension ] ) -
+					boxModelAdjustment( elem, dimension, "border", false, styles ) -
+					0.5
+				);
+			}
+
+			// Convert to pixels if value adjustment is needed
+			if ( subtract && ( matches = rcssNum.exec( value ) ) &&
+				( matches[ 3 ] || "px" ) !== "px" ) {
+
+				elem.style[ dimension ] = value;
+				value = jQuery.css( elem, dimension );
+			}
+
+			return setPositiveNumber( elem, value, subtract );
+		}
+	};
+} );
+
+jQuery.cssHooks.marginLeft = addGetHookIf( support.reliableMarginLeft,
+	function( elem, computed ) {
+		if ( computed ) {
+			return ( parseFloat( curCSS( elem, "marginLeft" ) ) ||
+				elem.getBoundingClientRect().left -
+					swap( elem, { marginLeft: 0 }, function() {
+						return elem.getBoundingClientRect().left;
+					} )
+				) + "px";
+		}
+	}
+);
+
+// These hooks are used by animate to expand properties
+jQuery.each( {
+	margin: "",
+	padding: "",
+	border: "Width"
+}, function( prefix, suffix ) {
+	jQuery.cssHooks[ prefix + suffix ] = {
+		expand: function( value ) {
+			var i = 0,
+				expanded = {},
+
+				// Assumes a single number if not a string
+				parts = typeof value === "string" ? value.split( " " ) : [ value ];
+
+			for ( ; i < 4; i++ ) {
+				expanded[ prefix + cssExpand[ i ] + suffix ] =
+					parts[ i ] || parts[ i - 2 ] || parts[ 0 ];
+			}
+
+			return expanded;
+		}
+	};
+
+	if ( prefix !== "margin" ) {
+		jQuery.cssHooks[ prefix + suffix ].set = setPositiveNumber;
+	}
+} );
+
+jQuery.fn.extend( {
+	css: function( name, value ) {
+		return access( this, function( elem, name, value ) {
+			var styles, len,
+				map = {},
+				i = 0;
+
+			if ( Array.isArray( name ) ) {
+				styles = getStyles( elem );
+				len = name.length;
+
+				for ( ; i < len; i++ ) {
+					map[ name[ i ] ] = jQuery.css( elem, name[ i ], false, styles );
+				}
+
+				return map;
+			}
+
+			return value !== undefined ?
+				jQuery.style( elem, name, value ) :
+				jQuery.css( elem, name );
+		}, name, value, arguments.length > 1 );
+	}
+} );
+
+
+function Tween( elem, options, prop, end, easing ) {
+	return new Tween.prototype.init( elem, options, prop, end, easing );
+}
+jQuery.Tween = Tween;
+
+Tween.prototype = {
+	constructor: Tween,
+	init: function( elem, options, prop, end, easing, unit ) {
+		this.elem = elem;
+		this.prop = prop;
+		this.easing = easing || jQuery.easing._default;
+		this.options = options;
+		this.start = this.now = this.cur();
+		this.end = end;
+		this.unit = unit || ( jQuery.cssNumber[ prop ] ? "" : "px" );
+	},
+	cur: function() {
+		var hooks = Tween.propHooks[ this.prop ];
+
+		return hooks && hooks.get ?
+			hooks.get( this ) :
+			Tween.propHooks._default.get( this );
+	},
+	run: function( percent ) {
+		var eased,
+			hooks = Tween.propHooks[ this.prop ];
+
+		if ( this.options.duration ) {
+			this.pos = eased = jQuery.easing[ this.easing ](
+				percent, this.options.duration * percent, 0, 1, this.options.duration
+			);
+		} else {
+			this.pos = eased = percent;
+		}
+		this.now = ( this.end - this.start ) * eased + this.start;
+
+		if ( this.options.step ) {
+			this.options.step.call( this.elem, this.now, this );
+		}
+
+		if ( hooks && hooks.set ) {
+			hooks.set( this );
+		} else {
+			Tween.propHooks._default.set( this );
+		}
+		return this;
+	}
+};
+
+Tween.prototype.init.prototype = Tween.prototype;
+
+Tween.propHooks = {
+	_default: {
+		get: function( tween ) {
+			var result;
+
+			// Use a property on the element directly when it is not a DOM element,
+			// or when there is no matching style property that exists.
+			if ( tween.elem.nodeType !== 1 ||
+				tween.elem[ tween.prop ] != null && tween.elem.style[ tween.prop ] == null ) {
+				return tween.elem[ tween.prop ];
+			}
+
+			// Passing an empty string as a 3rd parameter to .css will automatically
+			// attempt a parseFloat and fallback to a string if the parse fails.
+			// Simple values such as "10px" are parsed to Float;
+			// complex values such as "rotate(1rad)" are returned as-is.
+			result = jQuery.css( tween.elem, tween.prop, "" );
+
+			// Empty strings, null, undefined and "auto" are converted to 0.
+			return !result || result === "auto" ? 0 : result;
+		},
+		set: function( tween ) {
+
+			// Use step hook for back compat.
+			// Use cssHook if its there.
+			// Use .style if available and use plain properties where available.
+			if ( jQuery.fx.step[ tween.prop ] ) {
+				jQuery.fx.step[ tween.prop ]( tween );
+			} else if ( tween.elem.nodeType === 1 && (
+					jQuery.cssHooks[ tween.prop ] ||
+					tween.elem.style[ finalPropName( tween.prop ) ] != null ) ) {
+				jQuery.style( tween.elem, tween.prop, tween.now + tween.unit );
+			} else {
+				tween.elem[ tween.prop ] = tween.now;
+			}
+		}
+	}
+};
+
+// Support: IE <=9 only
+// Panic based approach to setting things on disconnected nodes
+Tween.propHooks.scrollTop = Tween.propHooks.scrollLeft = {
+	set: function( tween ) {
+		if ( tween.elem.nodeType && tween.elem.parentNode ) {
+			tween.elem[ tween.prop ] = tween.now;
+		}
+	}
+};
+
+jQuery.easing = {
+	linear: function( p ) {
+		return p;
+	},
+	swing: function( p ) {
+		return 0.5 - Math.cos( p * Math.PI ) / 2;
+	},
+	_default: "swing"
+};
+
+jQuery.fx = Tween.prototype.init;
+
+// Back compat <1.8 extension point
+jQuery.fx.step = {};
+
+
+
+
+var
+	fxNow, inProgress,
+	rfxtypes = /^(?:toggle|show|hide)$/,
+	rrun = /queueHooks$/;
+
+function schedule() {
+	if ( inProgress ) {
+		if ( document.hidden === false && window.requestAnimationFrame ) {
+			window.requestAnimationFrame( schedule );
+		} else {
+			window.setTimeout( schedule, jQuery.fx.interval );
+		}
+
+		jQuery.fx.tick();
+	}
+}
+
+// Animations created synchronously will run synchronously
+function createFxNow() {
+	window.setTimeout( function() {
+		fxNow = undefined;
+	} );
+	return ( fxNow = Date.now() );
+}
+
+// Generate parameters to create a standard animation
+function genFx( type, includeWidth ) {
+	var which,
+		i = 0,
+		attrs = { height: type };
+
+	// If we include width, step value is 1 to do all cssExpand values,
+	// otherwise step value is 2 to skip over Left and Right
+	includeWidth = includeWidth ? 1 : 0;
+	for ( ; i < 4; i += 2 - includeWidth ) {
+		which = cssExpand[ i ];
+		attrs[ "margin" + which ] = attrs[ "padding" + which ] = type;
+	}
+
+	if ( includeWidth ) {
+		attrs.opacity = attrs.width = type;
+	}
+
+	return attrs;
+}
+
+function createTween( value, prop, animation ) {
+	var tween,
+		collection = ( Animation.tweeners[ prop ] || [] ).concat( Animation.tweeners[ "*" ] ),
+		index = 0,
+		length = collection.length;
+	for ( ; index < length; index++ ) {
+		if ( ( tween = collection[ index ].call( animation, prop, value ) ) ) {
+
+			// We're done with this property
+			return tween;
+		}
+	}
+}
+
+function defaultPrefilter( elem, props, opts ) {
+	var prop, value, toggle, hooks, oldfire, propTween, restoreDisplay, display,
+		isBox = "width" in props || "height" in props,
+		anim = this,
+		orig = {},
+		style = elem.style,
+		hidden = elem.nodeType && isHiddenWithinTree( elem ),
+		dataShow = dataPriv.get( elem, "fxshow" );
+
+	// Queue-skipping animations hijack the fx hooks
+	if ( !opts.queue ) {
+		hooks = jQuery._queueHooks( elem, "fx" );
+		if ( hooks.unqueued == null ) {
+			hooks.unqueued = 0;
+			oldfire = hooks.empty.fire;
+			hooks.empty.fire = function() {
+				if ( !hooks.unqueued ) {
+					oldfire();
+				}
+			};
+		}
+		hooks.unqueued++;
+
+		anim.always( function() {
+
+			// Ensure the complete handler is called before this completes
+			anim.always( function() {
+				hooks.unqueued--;
+				if ( !jQuery.queue( elem, "fx" ).length ) {
+					hooks.empty.fire();
+				}
+			} );
+		} );
+	}
+
+	// Detect show/hide animations
+	for ( prop in props ) {
+		value = props[ prop ];
+		if ( rfxtypes.test( value ) ) {
+			delete props[ prop ];
+			toggle = toggle || value === "toggle";
+			if ( value === ( hidden ? "hide" : "show" ) ) {
+
+				// Pretend to be hidden if this is a "show" and
+				// there is still data from a stopped show/hide
+				if ( value === "show" && dataShow && dataShow[ prop ] !== undefined ) {
+					hidden = true;
+
+				// Ignore all other no-op show/hide data
+				} else {
+					continue;
+				}
+			}
+			orig[ prop ] = dataShow && dataShow[ prop ] || jQuery.style( elem, prop );
+		}
+	}
+
+	// Bail out if this is a no-op like .hide().hide()
+	propTween = !jQuery.isEmptyObject( props );
+	if ( !propTween && jQuery.isEmptyObject( orig ) ) {
+		return;
+	}
+
+	// Restrict "overflow" and "display" styles during box animations
+	if ( isBox && elem.nodeType === 1 ) {
+
+		// Support: IE <=9 - 11, Edge 12 - 15
+		// Record all 3 overflow attributes because IE does not infer the shorthand
+		// from identically-valued overflowX and overflowY and Edge just mirrors
+		// the overflowX value there.
+		opts.overflow = [ style.overflow, style.overflowX, style.overflowY ];
+
+		// Identify a display type, preferring old show/hide data over the CSS cascade
+		restoreDisplay = dataShow && dataShow.display;
+		if ( restoreDisplay == null ) {
+			restoreDisplay = dataPriv.get( elem, "display" );
+		}
+		display = jQuery.css( elem, "display" );
+		if ( display === "none" ) {
+			if ( restoreDisplay ) {
+				display = restoreDisplay;
+			} else {
+
+				// Get nonempty value(s) by temporarily forcing visibility
+				showHide( [ elem ], true );
+				restoreDisplay = elem.style.display || restoreDisplay;
+				display = jQuery.css( elem, "display" );
+				showHide( [ elem ] );
+			}
+		}
+
+		// Animate inline elements as inline-block
+		if ( display === "inline" || display === "inline-block" && restoreDisplay != null ) {
+			if ( jQuery.css( elem, "float" ) === "none" ) {
+
+				// Restore the original display value at the end of pure show/hide animations
+				if ( !propTween ) {
+					anim.done( function() {
+						style.display = restoreDisplay;
+					} );
+					if ( restoreDisplay == null ) {
+						display = style.display;
+						restoreDisplay = display === "none" ? "" : display;
+					}
+				}
+				style.display = "inline-block";
+			}
+		}
+	}
+
+	if ( opts.overflow ) {
+		style.overflow = "hidden";
+		anim.always( function() {
+			style.overflow = opts.overflow[ 0 ];
+			style.overflowX = opts.overflow[ 1 ];
+			style.overflowY = opts.overflow[ 2 ];
+		} );
+	}
+
+	// Implement show/hide animations
+	propTween = false;
+	for ( prop in orig ) {
+
+		// General show/hide setup for this element animation
+		if ( !propTween ) {
+			if ( dataShow ) {
+				if ( "hidden" in dataShow ) {
+					hidden = dataShow.hidden;
+				}
+			} else {
+				dataShow = dataPriv.access( elem, "fxshow", { display: restoreDisplay } );
+			}
+
+			// Store hidden/visible for toggle so `.stop().toggle()` "reverses"
+			if ( toggle ) {
+				dataShow.hidden = !hidden;
+			}
+
+			// Show elements before animating them
+			if ( hidden ) {
+				showHide( [ elem ], true );
+			}
+
+			/* eslint-disable no-loop-func */
+
+			anim.done( function() {
+
+			/* eslint-enable no-loop-func */
+
+				// The final step of a "hide" animation is actually hiding the element
+				if ( !hidden ) {
+					showHide( [ elem ] );
+				}
+				dataPriv.remove( elem, "fxshow" );
+				for ( prop in orig ) {
+					jQuery.style( elem, prop, orig[ prop ] );
+				}
+			} );
+		}
+
+		// Per-property setup
+		propTween = createTween( hidden ? dataShow[ prop ] : 0, prop, anim );
+		if ( !( prop in dataShow ) ) {
+			dataShow[ prop ] = propTween.start;
+			if ( hidden ) {
+				propTween.end = propTween.start;
+				propTween.start = 0;
+			}
+		}
+	}
+}
+
+function propFilter( props, specialEasing ) {
+	var index, name, easing, value, hooks;
+
+	// camelCase, specialEasing and expand cssHook pass
+	for ( index in props ) {
+		name = camelCase( index );
+		easing = specialEasing[ name ];
+		value = props[ index ];
+		if ( Array.isArray( value ) ) {
+			easing = value[ 1 ];
+			value = props[ index ] = value[ 0 ];
+		}
+
+		if ( index !== name ) {
+			props[ name ] = value;
+			delete props[ index ];
+		}
+
+		hooks = jQuery.cssHooks[ name ];
+		if ( hooks && "expand" in hooks ) {
+			value = hooks.expand( value );
+			delete props[ name ];
+
+			// Not quite $.extend, this won't overwrite existing keys.
+			// Reusing 'index' because we have the correct "name"
+			for ( index in value ) {
+				if ( !( index in props ) ) {
+					props[ index ] = value[ index ];
+					specialEasing[ index ] = easing;
+				}
+			}
+		} else {
+			specialEasing[ name ] = easing;
+		}
+	}
+}
+
+function Animation( elem, properties, options ) {
+	var result,
+		stopped,
+		index = 0,
+		length = Animation.prefilters.length,
+		deferred = jQuery.Deferred().always( function() {
+
+			// Don't match elem in the :animated selector
+			delete tick.elem;
+		} ),
+		tick = function() {
+			if ( stopped ) {
+				return false;
+			}
+			var currentTime = fxNow || createFxNow(),
+				remaining = Math.max( 0, animation.startTime + animation.duration - currentTime ),
+
+				// Support: Android 2.3 only
+				// Archaic crash bug won't allow us to use `1 - ( 0.5 || 0 )` (#12497)
+				temp = remaining / animation.duration || 0,
+				percent = 1 - temp,
+				index = 0,
+				length = animation.tweens.length;
+
+			for ( ; index < length; index++ ) {
+				animation.tweens[ index ].run( percent );
+			}
+
+			deferred.notifyWith( elem, [ animation, percent, remaining ] );
+
+			// If there's more to do, yield
+			if ( percent < 1 && length ) {
+				return remaining;
+			}
+
+			// If this was an empty animation, synthesize a final progress notification
+			if ( !length ) {
+				deferred.notifyWith( elem, [ animation, 1, 0 ] );
+			}
+
+			// Resolve the animation and report its conclusion
+			deferred.resolveWith( elem, [ animation ] );
+			return false;
+		},
+		animation = deferred.promise( {
+			elem: elem,
+			props: jQuery.extend( {}, properties ),
+			opts: jQuery.extend( true, {
+				specialEasing: {},
+				easing: jQuery.easing._default
+			}, options ),
+			originalProperties: properties,
+			originalOptions: options,
+			startTime: fxNow || createFxNow(),
+			duration: options.duration,
+			tweens: [],
+			createTween: function( prop, end ) {
+				var tween = jQuery.Tween( elem, animation.opts, prop, end,
+						animation.opts.specialEasing[ prop ] || animation.opts.easing );
+				animation.tweens.push( tween );
+				return tween;
+			},
+			stop: function( gotoEnd ) {
+				var index = 0,
+
+					// If we are going to the end, we want to run all the tweens
+					// otherwise we skip this part
+					length = gotoEnd ? animation.tweens.length : 0;
+				if ( stopped ) {
+					return this;
+				}
+				stopped = true;
+				for ( ; index < length; index++ ) {
+					animation.tweens[ index ].run( 1 );
+				}
+
+				// Resolve when we played the last frame; otherwise, reject
+				if ( gotoEnd ) {
+					deferred.notifyWith( elem, [ animation, 1, 0 ] );
+					deferred.resolveWith( elem, [ animation, gotoEnd ] );
+				} else {
+					deferred.rejectWith( elem, [ animation, gotoEnd ] );
+				}
+				return this;
+			}
+		} ),
+		props = animation.props;
+
+	propFilter( props, animation.opts.specialEasing );
+
+	for ( ; index < length; index++ ) {
+		result = Animation.prefilters[ index ].call( animation, elem, props, animation.opts );
+		if ( result ) {
+			if ( isFunction( result.stop ) ) {
+				jQuery._queueHooks( animation.elem, animation.opts.queue ).stop =
+					result.stop.bind( result );
+			}
+			return result;
+		}
+	}
+
+	jQuery.map( props, createTween, animation );
+
+	if ( isFunction( animation.opts.start ) ) {
+		animation.opts.start.call( elem, animation );
+	}
+
+	// Attach callbacks from options
+	animation
+		.progress( animation.opts.progress )
+		.done( animation.opts.done, animation.opts.complete )
+		.fail( animation.opts.fail )
+		.always( animation.opts.always );
+
+	jQuery.fx.timer(
+		jQuery.extend( tick, {
+			elem: elem,
+			anim: animation,
+			queue: animation.opts.queue
+		} )
+	);
+
+	return animation;
+}
+
+jQuery.Animation = jQuery.extend( Animation, {
+
+	tweeners: {
+		"*": [ function( prop, value ) {
+			var tween = this.createTween( prop, value );
+			adjustCSS( tween.elem, prop, rcssNum.exec( value ), tween );
+			return tween;
+		} ]
+	},
+
+	tweener: function( props, callback ) {
+		if ( isFunction( props ) ) {
+			callback = props;
+			props = [ "*" ];
+		} else {
+			props = props.match( rnothtmlwhite );
+		}
+
+		var prop,
+			index = 0,
+			length = props.length;
+
+		for ( ; index < length; index++ ) {
+			prop = props[ index ];
+			Animation.tweeners[ prop ] = Animation.tweeners[ prop ] || [];
+			Animation.tweeners[ prop ].unshift( callback );
+		}
+	},
+
+	prefilters: [ defaultPrefilter ],
+
+	prefilter: function( callback, prepend ) {
+		if ( prepend ) {
+			Animation.prefilters.unshift( callback );
+		} else {
+			Animation.prefilters.push( callback );
+		}
+	}
+} );
+
+jQuery.speed = function( speed, easing, fn ) {
+	var opt = speed && typeof speed === "object" ? jQuery.extend( {}, speed ) : {
+		complete: fn || !fn && easing ||
+			isFunction( speed ) && speed,
+		duration: speed,
+		easing: fn && easing || easing && !isFunction( easing ) && easing
+	};
+
+	// Go to the end state if fx are off
+	if ( jQuery.fx.off ) {
+		opt.duration = 0;
+
+	} else {
+		if ( typeof opt.duration !== "number" ) {
+			if ( opt.duration in jQuery.fx.speeds ) {
+				opt.duration = jQuery.fx.speeds[ opt.duration ];
+
+			} else {
+				opt.duration = jQuery.fx.speeds._default;
+			}
+		}
+	}
+
+	// Normalize opt.queue - true/undefined/null -> "fx"
+	if ( opt.queue == null || opt.queue === true ) {
+		opt.queue = "fx";
+	}
+
+	// Queueing
+	opt.old = opt.complete;
+
+	opt.complete = function() {
+		if ( isFunction( opt.old ) ) {
+			opt.old.call( this );
+		}
+
+		if ( opt.queue ) {
+			jQuery.dequeue( this, opt.queue );
+		}
+	};
+
+	return opt;
+};
+
+jQuery.fn.extend( {
+	fadeTo: function( speed, to, easing, callback ) {
+
+		// Show any hidden elements after setting opacity to 0
+		return this.filter( isHiddenWithinTree ).css( "opacity", 0 ).show()
+
+			// Animate to the value specified
+			.end().animate( { opacity: to }, speed, easing, callback );
+	},
+	animate: function( prop, speed, easing, callback ) {
+		var empty = jQuery.isEmptyObject( prop ),
+			optall = jQuery.speed( speed, easing, callback ),
+			doAnimation = function() {
+
+				// Operate on a copy of prop so per-property easing won't be lost
+				var anim = Animation( this, jQuery.extend( {}, prop ), optall );
+
+				// Empty animations, or finishing resolves immediately
+				if ( empty || dataPriv.get( this, "finish" ) ) {
+					anim.stop( true );
+				}
+			};
+			doAnimation.finish = doAnimation;
+
+		return empty || optall.queue === false ?
+			this.each( doAnimation ) :
+			this.queue( optall.queue, doAnimation );
+	},
+	stop: function( type, clearQueue, gotoEnd ) {
+		var stopQueue = function( hooks ) {
+			var stop = hooks.stop;
+			delete hooks.stop;
+			stop( gotoEnd );
+		};
+
+		if ( typeof type !== "string" ) {
+			gotoEnd = clearQueue;
+			clearQueue = type;
+			type = undefined;
+		}
+		if ( clearQueue ) {
+			this.queue( type || "fx", [] );
+		}
+
+		return this.each( function() {
+			var dequeue = true,
+				index = type != null && type + "queueHooks",
+				timers = jQuery.timers,
+				data = dataPriv.get( this );
+
+			if ( index ) {
+				if ( data[ index ] && data[ index ].stop ) {
+					stopQueue( data[ index ] );
+				}
+			} else {
+				for ( index in data ) {
+					if ( data[ index ] && data[ index ].stop && rrun.test( index ) ) {
+						stopQueue( data[ index ] );
+					}
+				}
+			}
+
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this &&
+					( type == null || timers[ index ].queue === type ) ) {
+
+					timers[ index ].anim.stop( gotoEnd );
+					dequeue = false;
+					timers.splice( index, 1 );
+				}
+			}
+
+			// Start the next in the queue if the last step wasn't forced.
+			// Timers currently will call their complete callbacks, which
+			// will dequeue but only if they were gotoEnd.
+			if ( dequeue || !gotoEnd ) {
+				jQuery.dequeue( this, type );
+			}
+		} );
+	},
+	finish: function( type ) {
+		if ( type !== false ) {
+			type = type || "fx";
+		}
+		return this.each( function() {
+			var index,
+				data = dataPriv.get( this ),
+				queue = data[ type + "queue" ],
+				hooks = data[ type + "queueHooks" ],
+				timers = jQuery.timers,
+				length = queue ? queue.length : 0;
+
+			// Enable finishing flag on private data
+			data.finish = true;
+
+			// Empty the queue first
+			jQuery.queue( this, type, [] );
+
+			if ( hooks && hooks.stop ) {
+				hooks.stop.call( this, true );
+			}
+
+			// Look for any active animations, and finish them
+			for ( index = timers.length; index--; ) {
+				if ( timers[ index ].elem === this && timers[ index ].queue === type ) {
+					timers[ index ].anim.stop( true );
+					timers.splice( index, 1 );
+				}
+			}
+
+			// Look for any animations in the old queue and finish them
+			for ( index = 0; index < length; index++ ) {
+				if ( queue[ index ] && queue[ index ].finish ) {
+					queue[ index ].finish.call( this );
+				}
+			}
+
+			// Turn off finishing flag
+			delete data.finish;
+		} );
+	}
+} );
+
+jQuery.each( [ "toggle", "show", "hide" ], function( _i, name ) {
+	var cssFn = jQuery.fn[ name ];
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return speed == null || typeof speed === "boolean" ?
+			cssFn.apply( this, arguments ) :
+			this.animate( genFx( name, true ), speed, easing, callback );
+	};
+} );
+
+// Generate shortcuts for custom animations
+jQuery.each( {
+	slideDown: genFx( "show" ),
+	slideUp: genFx( "hide" ),
+	slideToggle: genFx( "toggle" ),
+	fadeIn: { opacity: "show" },
+	fadeOut: { opacity: "hide" },
+	fadeToggle: { opacity: "toggle" }
+}, function( name, props ) {
+	jQuery.fn[ name ] = function( speed, easing, callback ) {
+		return this.animate( props, speed, easing, callback );
+	};
+} );
+
+jQuery.timers = [];
+jQuery.fx.tick = function() {
+	var timer,
+		i = 0,
+		timers = jQuery.timers;
+
+	fxNow = Date.now();
+
+	for ( ; i < timers.length; i++ ) {
+		timer = timers[ i ];
+
+		// Run the timer and safely remove it when done (allowing for external removal)
+		if ( !timer() && timers[ i ] === timer ) {
+			timers.splice( i--, 1 );
+		}
+	}
+
+	if ( !timers.length ) {
+		jQuery.fx.stop();
+	}
+	fxNow = undefined;
+};
+
+jQuery.fx.timer = function( timer ) {
+	jQuery.timers.push( timer );
+	jQuery.fx.start();
+};
+
+jQuery.fx.interval = 13;
+jQuery.fx.start = function() {
+	if ( inProgress ) {
+		return;
+	}
+
+	inProgress = true;
+	schedule();
+};
+
+jQuery.fx.stop = function() {
+	inProgress = null;
+};
+
+jQuery.fx.speeds = {
+	slow: 600,
+	fast: 200,
+
+	// Default speed
+	_default: 400
+};
+
+
+// Based off of the plugin by Clint Helfers, with permission.
+// https://web.archive.org/web/20100324014747/http://blindsignals.com/index.php/2009/07/jquery-delay/
+jQuery.fn.delay = function( time, type ) {
+	time = jQuery.fx ? jQuery.fx.speeds[ time ] || time : time;
+	type = type || "fx";
+
+	return this.queue( type, function( next, hooks ) {
+		var timeout = window.setTimeout( next, time );
+		hooks.stop = function() {
+			window.clearTimeout( timeout );
+		};
+	} );
+};
+
+
+( function() {
+	var input = document.createElement( "input" ),
+		select = document.createElement( "select" ),
+		opt = select.appendChild( document.createElement( "option" ) );
+
+	input.type = "checkbox";
+
+	// Support: Android <=4.3 only
+	// Default value for a checkbox should be "on"
+	support.checkOn = input.value !== "";
+
+	// Support: IE <=11 only
+	// Must access selectedIndex to make default options select
+	support.optSelected = opt.selected;
+
+	// Support: IE <=11 only
+	// An input loses its value after becoming a radio
+	input = document.createElement( "input" );
+	input.value = "t";
+	input.type = "radio";
+	support.radioValue = input.value === "t";
+} )();
+
+
+var boolHook,
+	attrHandle = jQuery.expr.attrHandle;
+
+jQuery.fn.extend( {
+	attr: function( name, value ) {
+		return access( this, jQuery.attr, name, value, arguments.length > 1 );
+	},
+
+	removeAttr: function( name ) {
+		return this.each( function() {
+			jQuery.removeAttr( this, name );
+		} );
+	}
+} );
+
+jQuery.extend( {
+	attr: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
+
+		// Don't get/set attributes on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
+
+		// Fallback to prop when attributes are not supported
+		if ( typeof elem.getAttribute === "undefined" ) {
+			return jQuery.prop( elem, name, value );
+		}
+
+		// Attribute hooks are determined by the lowercase version
+		// Grab necessary hook if one is defined
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+			hooks = jQuery.attrHooks[ name.toLowerCase() ] ||
+				( jQuery.expr.match.bool.test( name ) ? boolHook : undefined );
+		}
+
+		if ( value !== undefined ) {
+			if ( value === null ) {
+				jQuery.removeAttr( elem, name );
+				return;
+			}
+
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
+
+			elem.setAttribute( name, value + "" );
+			return value;
+		}
+
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
+
+		ret = jQuery.find.attr( elem, name );
+
+		// Non-existent attributes return null, we normalize to undefined
+		return ret == null ? undefined : ret;
+	},
+
+	attrHooks: {
+		type: {
+			set: function( elem, value ) {
+				if ( !support.radioValue && value === "radio" &&
+					nodeName( elem, "input" ) ) {
+					var val = elem.value;
+					elem.setAttribute( "type", value );
+					if ( val ) {
+						elem.value = val;
+					}
+					return value;
+				}
+			}
+		}
+	},
+
+	removeAttr: function( elem, value ) {
+		var name,
+			i = 0,
+
+			// Attribute names can contain non-HTML whitespace characters
+			// https://html.spec.whatwg.org/multipage/syntax.html#attributes-2
+			attrNames = value && value.match( rnothtmlwhite );
+
+		if ( attrNames && elem.nodeType === 1 ) {
+			while ( ( name = attrNames[ i++ ] ) ) {
+				elem.removeAttribute( name );
+			}
+		}
+	}
+} );
+
+// Hooks for boolean attributes
+boolHook = {
+	set: function( elem, value, name ) {
+		if ( value === false ) {
+
+			// Remove boolean attributes when set to false
+			jQuery.removeAttr( elem, name );
+		} else {
+			elem.setAttribute( name, name );
+		}
+		return name;
+	}
+};
+
+jQuery.each( jQuery.expr.match.bool.source.match( /\w+/g ), function( _i, name ) {
+	var getter = attrHandle[ name ] || jQuery.find.attr;
+
+	attrHandle[ name ] = function( elem, name, isXML ) {
+		var ret, handle,
+			lowercaseName = name.toLowerCase();
+
+		if ( !isXML ) {
+
+			// Avoid an infinite loop by temporarily removing this function from the getter
+			handle = attrHandle[ lowercaseName ];
+			attrHandle[ lowercaseName ] = ret;
+			ret = getter( elem, name, isXML ) != null ?
+				lowercaseName :
+				null;
+			attrHandle[ lowercaseName ] = handle;
+		}
+		return ret;
+	};
+} );
+
+
+
+
+var rfocusable = /^(?:input|select|textarea|button)$/i,
+	rclickable = /^(?:a|area)$/i;
+
+jQuery.fn.extend( {
+	prop: function( name, value ) {
+		return access( this, jQuery.prop, name, value, arguments.length > 1 );
+	},
+
+	removeProp: function( name ) {
+		return this.each( function() {
+			delete this[ jQuery.propFix[ name ] || name ];
+		} );
+	}
+} );
+
+jQuery.extend( {
+	prop: function( elem, name, value ) {
+		var ret, hooks,
+			nType = elem.nodeType;
+
+		// Don't get/set properties on text, comment and attribute nodes
+		if ( nType === 3 || nType === 8 || nType === 2 ) {
+			return;
+		}
+
+		if ( nType !== 1 || !jQuery.isXMLDoc( elem ) ) {
+
+			// Fix name and attach hooks
+			name = jQuery.propFix[ name ] || name;
+			hooks = jQuery.propHooks[ name ];
+		}
+
+		if ( value !== undefined ) {
+			if ( hooks && "set" in hooks &&
+				( ret = hooks.set( elem, value, name ) ) !== undefined ) {
+				return ret;
+			}
+
+			return ( elem[ name ] = value );
+		}
+
+		if ( hooks && "get" in hooks && ( ret = hooks.get( elem, name ) ) !== null ) {
+			return ret;
+		}
+
+		return elem[ name ];
+	},
+
+	propHooks: {
+		tabIndex: {
+			get: function( elem ) {
+
+				// Support: IE <=9 - 11 only
+				// elem.tabIndex doesn't always return the
+				// correct value when it hasn't been explicitly set
+				// https://web.archive.org/web/20141116233347/http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/
+				// Use proper attribute retrieval(#12072)
+				var tabindex = jQuery.find.attr( elem, "tabindex" );
+
+				if ( tabindex ) {
+					return parseInt( tabindex, 10 );
+				}
+
+				if (
+					rfocusable.test( elem.nodeName ) ||
+					rclickable.test( elem.nodeName ) &&
+					elem.href
+				) {
+					return 0;
+				}
+
+				return -1;
+			}
+		}
+	},
+
+	propFix: {
+		"for": "htmlFor",
+		"class": "className"
+	}
+} );
+
+// Support: IE <=11 only
+// Accessing the selectedIndex property
+// forces the browser to respect setting selected
+// on the option
+// The getter ensures a default option is selected
+// when in an optgroup
+// eslint rule "no-unused-expressions" is disabled for this code
+// since it considers such accessions noop
+if ( !support.optSelected ) {
+	jQuery.propHooks.selected = {
+		get: function( elem ) {
+
+			/* eslint no-unused-expressions: "off" */
+
+			var parent = elem.parentNode;
+			if ( parent && parent.parentNode ) {
+				parent.parentNode.selectedIndex;
+			}
+			return null;
+		},
+		set: function( elem ) {
+
+			/* eslint no-unused-expressions: "off" */
+
+			var parent = elem.parentNode;
+			if ( parent ) {
+				parent.selectedIndex;
+
+				if ( parent.parentNode ) {
+					parent.parentNode.selectedIndex;
+				}
+			}
+		}
+	};
+}
+
+jQuery.each( [
+	"tabIndex",
+	"readOnly",
+	"maxLength",
+	"cellSpacing",
+	"cellPadding",
+	"rowSpan",
+	"colSpan",
+	"useMap",
+	"frameBorder",
+	"contentEditable"
+], function() {
+	jQuery.propFix[ this.toLowerCase() ] = this;
+} );
+
+
+
+
+	// Strip and collapse whitespace according to HTML spec
+	// https://infra.spec.whatwg.org/#strip-and-collapse-ascii-whitespace
+	function stripAndCollapse( value ) {
+		var tokens = value.match( rnothtmlwhite ) || [];
+		return tokens.join( " " );
+	}
+
+
+function getClass( elem ) {
+	return elem.getAttribute && elem.getAttribute( "class" ) || "";
+}
+
+function classesToArray( value ) {
+	if ( Array.isArray( value ) ) {
+		return value;
+	}
+	if ( typeof value === "string" ) {
+		return value.match( rnothtmlwhite ) || [];
+	}
+	return [];
+}
+
+jQuery.fn.extend( {
+	addClass: function( value ) {
+		var classes, elem, cur, curValue, clazz, j, finalValue,
+			i = 0;
+
+		if ( isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).addClass( value.call( this, j, getClass( this ) ) );
+			} );
+		}
+
+		classes = classesToArray( value );
+
+		if ( classes.length ) {
+			while ( ( elem = this[ i++ ] ) ) {
+				curValue = getClass( elem );
+				cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+				if ( cur ) {
+					j = 0;
+					while ( ( clazz = classes[ j++ ] ) ) {
+						if ( cur.indexOf( " " + clazz + " " ) < 0 ) {
+							cur += clazz + " ";
+						}
+					}
+
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = stripAndCollapse( cur );
+					if ( curValue !== finalValue ) {
+						elem.setAttribute( "class", finalValue );
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	removeClass: function( value ) {
+		var classes, elem, cur, curValue, clazz, j, finalValue,
+			i = 0;
+
+		if ( isFunction( value ) ) {
+			return this.each( function( j ) {
+				jQuery( this ).removeClass( value.call( this, j, getClass( this ) ) );
+			} );
+		}
+
+		if ( !arguments.length ) {
+			return this.attr( "class", "" );
+		}
+
+		classes = classesToArray( value );
+
+		if ( classes.length ) {
+			while ( ( elem = this[ i++ ] ) ) {
+				curValue = getClass( elem );
+
+				// This expression is here for better compressibility (see addClass)
+				cur = elem.nodeType === 1 && ( " " + stripAndCollapse( curValue ) + " " );
+
+				if ( cur ) {
+					j = 0;
+					while ( ( clazz = classes[ j++ ] ) ) {
+
+						// Remove *all* instances
+						while ( cur.indexOf( " " + clazz + " " ) > -1 ) {
+							cur = cur.replace( " " + clazz + " ", " " );
+						}
+					}
+
+					// Only assign if different to avoid unneeded rendering.
+					finalValue = stripAndCollapse( cur );
+					if ( curValue !== finalValue ) {
+						elem.setAttribute( "class", finalValue );
+					}
+				}
+			}
+		}
+
+		return this;
+	},
+
+	toggleClass: function( value, stateVal ) {
+		var type = typeof value,
+			isValidValue = type === "string" || Array.isArray( value );
+
+		if ( typeof stateVal === "boolean" && isValidValue ) {
+			return stateVal ? this.addClass( value ) : this.removeClass( value );
+		}
+
+		if ( isFunction( value ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).toggleClass(
+					value.call( this, i, getClass( this ), stateVal ),
+					stateVal
+				);
+			} );
+		}
+
+		return this.each( function() {
+			var className, i, self, classNames;
+
+			if ( isValidValue ) {
+
+				// Toggle individual class names
+				i = 0;
+				self = jQuery( this );
+				classNames = classesToArray( value );
+
+				while ( ( className = classNames[ i++ ] ) ) {
+
+					// Check each className given, space separated list
+					if ( self.hasClass( className ) ) {
+						self.removeClass( className );
+					} else {
+						self.addClass( className );
+					}
+				}
+
+			// Toggle whole class name
+			} else if ( value === undefined || type === "boolean" ) {
+				className = getClass( this );
+				if ( className ) {
+
+					// Store className if set
+					dataPriv.set( this, "__className__", className );
+				}
+
+				// If the element has a class name or if we're passed `false`,
+				// then remove the whole classname (if there was one, the above saved it).
+				// Otherwise bring back whatever was previously saved (if anything),
+				// falling back to the empty string if nothing was stored.
+				if ( this.setAttribute ) {
+					this.setAttribute( "class",
+						className || value === false ?
+						"" :
+						dataPriv.get( this, "__className__" ) || ""
+					);
+				}
+			}
+		} );
+	},
+
+	hasClass: function( selector ) {
+		var className, elem,
+			i = 0;
+
+		className = " " + selector + " ";
+		while ( ( elem = this[ i++ ] ) ) {
+			if ( elem.nodeType === 1 &&
+				( " " + stripAndCollapse( getClass( elem ) ) + " " ).indexOf( className ) > -1 ) {
+					return true;
+			}
+		}
+
+		return false;
+	}
+} );
+
+
+
+
+var rreturn = /\r/g;
+
+jQuery.fn.extend( {
+	val: function( value ) {
+		var hooks, ret, valueIsFunction,
+			elem = this[ 0 ];
+
+		if ( !arguments.length ) {
+			if ( elem ) {
+				hooks = jQuery.valHooks[ elem.type ] ||
+					jQuery.valHooks[ elem.nodeName.toLowerCase() ];
+
+				if ( hooks &&
+					"get" in hooks &&
+					( ret = hooks.get( elem, "value" ) ) !== undefined
+				) {
+					return ret;
+				}
+
+				ret = elem.value;
+
+				// Handle most common string cases
+				if ( typeof ret === "string" ) {
+					return ret.replace( rreturn, "" );
+				}
+
+				// Handle cases where value is null/undef or number
+				return ret == null ? "" : ret;
+			}
+
+			return;
+		}
+
+		valueIsFunction = isFunction( value );
+
+		return this.each( function( i ) {
+			var val;
+
+			if ( this.nodeType !== 1 ) {
+				return;
+			}
+
+			if ( valueIsFunction ) {
+				val = value.call( this, i, jQuery( this ).val() );
+			} else {
+				val = value;
+			}
+
+			// Treat null/undefined as ""; convert numbers to string
+			if ( val == null ) {
+				val = "";
+
+			} else if ( typeof val === "number" ) {
+				val += "";
+
+			} else if ( Array.isArray( val ) ) {
+				val = jQuery.map( val, function( value ) {
+					return value == null ? "" : value + "";
+				} );
+			}
+
+			hooks = jQuery.valHooks[ this.type ] || jQuery.valHooks[ this.nodeName.toLowerCase() ];
+
+			// If set returns undefined, fall back to normal setting
+			if ( !hooks || !( "set" in hooks ) || hooks.set( this, val, "value" ) === undefined ) {
+				this.value = val;
+			}
+		} );
+	}
+} );
+
+jQuery.extend( {
+	valHooks: {
+		option: {
+			get: function( elem ) {
+
+				var val = jQuery.find.attr( elem, "value" );
+				return val != null ?
+					val :
+
+					// Support: IE <=10 - 11 only
+					// option.text throws exceptions (#14686, #14858)
+					// Strip and collapse whitespace
+					// https://html.spec.whatwg.org/#strip-and-collapse-whitespace
+					stripAndCollapse( jQuery.text( elem ) );
+			}
+		},
+		select: {
+			get: function( elem ) {
+				var value, option, i,
+					options = elem.options,
+					index = elem.selectedIndex,
+					one = elem.type === "select-one",
+					values = one ? null : [],
+					max = one ? index + 1 : options.length;
+
+				if ( index < 0 ) {
+					i = max;
+
+				} else {
+					i = one ? index : 0;
+				}
+
+				// Loop through all the selected options
+				for ( ; i < max; i++ ) {
+					option = options[ i ];
+
+					// Support: IE <=9 only
+					// IE8-9 doesn't update selected after form reset (#2551)
+					if ( ( option.selected || i === index ) &&
+
+							// Don't return options that are disabled or in a disabled optgroup
+							!option.disabled &&
+							( !option.parentNode.disabled ||
+								!nodeName( option.parentNode, "optgroup" ) ) ) {
+
+						// Get the specific value for the option
+						value = jQuery( option ).val();
+
+						// We don't need an array for one selects
+						if ( one ) {
+							return value;
+						}
+
+						// Multi-Selects return an array
+						values.push( value );
+					}
+				}
+
+				return values;
+			},
+
+			set: function( elem, value ) {
+				var optionSet, option,
+					options = elem.options,
+					values = jQuery.makeArray( value ),
+					i = options.length;
+
+				while ( i-- ) {
+					option = options[ i ];
+
+					/* eslint-disable no-cond-assign */
+
+					if ( option.selected =
+						jQuery.inArray( jQuery.valHooks.option.get( option ), values ) > -1
+					) {
+						optionSet = true;
+					}
+
+					/* eslint-enable no-cond-assign */
+				}
+
+				// Force browsers to behave consistently when non-matching value is set
+				if ( !optionSet ) {
+					elem.selectedIndex = -1;
+				}
+				return values;
+			}
+		}
+	}
+} );
+
+// Radios and checkboxes getter/setter
+jQuery.each( [ "radio", "checkbox" ], function() {
+	jQuery.valHooks[ this ] = {
+		set: function( elem, value ) {
+			if ( Array.isArray( value ) ) {
+				return ( elem.checked = jQuery.inArray( jQuery( elem ).val(), value ) > -1 );
+			}
+		}
+	};
+	if ( !support.checkOn ) {
+		jQuery.valHooks[ this ].get = function( elem ) {
+			return elem.getAttribute( "value" ) === null ? "on" : elem.value;
+		};
+	}
+} );
+
+
+
+
+// Return jQuery for attributes-only inclusion
+
+
+support.focusin = "onfocusin" in window;
+
+
+var rfocusMorph = /^(?:focusinfocus|focusoutblur)$/,
+	stopPropagationCallback = function( e ) {
+		e.stopPropagation();
+	};
+
+jQuery.extend( jQuery.event, {
+
+	trigger: function( event, data, elem, onlyHandlers ) {
+
+		var i, cur, tmp, bubbleType, ontype, handle, special, lastElement,
+			eventPath = [ elem || document ],
+			type = hasOwn.call( event, "type" ) ? event.type : event,
+			namespaces = hasOwn.call( event, "namespace" ) ? event.namespace.split( "." ) : [];
+
+		cur = lastElement = tmp = elem = elem || document;
+
+		// Don't do events on text and comment nodes
+		if ( elem.nodeType === 3 || elem.nodeType === 8 ) {
+			return;
+		}
+
+		// focus/blur morphs to focusin/out; ensure we're not firing them right now
+		if ( rfocusMorph.test( type + jQuery.event.triggered ) ) {
+			return;
+		}
+
+		if ( type.indexOf( "." ) > -1 ) {
+
+			// Namespaced trigger; create a regexp to match event type in handle()
+			namespaces = type.split( "." );
+			type = namespaces.shift();
+			namespaces.sort();
+		}
+		ontype = type.indexOf( ":" ) < 0 && "on" + type;
+
+		// Caller can pass in a jQuery.Event object, Object, or just an event type string
+		event = event[ jQuery.expando ] ?
+			event :
+			new jQuery.Event( type, typeof event === "object" && event );
+
+		// Trigger bitmask: & 1 for native handlers; & 2 for jQuery (always true)
+		event.isTrigger = onlyHandlers ? 2 : 3;
+		event.namespace = namespaces.join( "." );
+		event.rnamespace = event.namespace ?
+			new RegExp( "(^|\\.)" + namespaces.join( "\\.(?:.*\\.|)" ) + "(\\.|$)" ) :
+			null;
+
+		// Clean up the event in case it is being reused
+		event.result = undefined;
+		if ( !event.target ) {
+			event.target = elem;
+		}
+
+		// Clone any incoming data and prepend the event, creating the handler arg list
+		data = data == null ?
+			[ event ] :
+			jQuery.makeArray( data, [ event ] );
+
+		// Allow special events to draw outside the lines
+		special = jQuery.event.special[ type ] || {};
+		if ( !onlyHandlers && special.trigger && special.trigger.apply( elem, data ) === false ) {
+			return;
+		}
+
+		// Determine event propagation path in advance, per W3C events spec (#9951)
+		// Bubble up to document, then to window; watch for a global ownerDocument var (#9724)
+		if ( !onlyHandlers && !special.noBubble && !isWindow( elem ) ) {
+
+			bubbleType = special.delegateType || type;
+			if ( !rfocusMorph.test( bubbleType + type ) ) {
+				cur = cur.parentNode;
+			}
+			for ( ; cur; cur = cur.parentNode ) {
+				eventPath.push( cur );
+				tmp = cur;
+			}
+
+			// Only add window if we got to document (e.g., not plain obj or detached DOM)
+			if ( tmp === ( elem.ownerDocument || document ) ) {
+				eventPath.push( tmp.defaultView || tmp.parentWindow || window );
+			}
+		}
+
+		// Fire handlers on the event path
+		i = 0;
+		while ( ( cur = eventPath[ i++ ] ) && !event.isPropagationStopped() ) {
+			lastElement = cur;
+			event.type = i > 1 ?
+				bubbleType :
+				special.bindType || type;
+
+			// jQuery handler
+			handle = (
+					dataPriv.get( cur, "events" ) || Object.create( null )
+				)[ event.type ] &&
+				dataPriv.get( cur, "handle" );
+			if ( handle ) {
+				handle.apply( cur, data );
+			}
+
+			// Native handler
+			handle = ontype && cur[ ontype ];
+			if ( handle && handle.apply && acceptData( cur ) ) {
+				event.result = handle.apply( cur, data );
+				if ( event.result === false ) {
+					event.preventDefault();
+				}
+			}
+		}
+		event.type = type;
+
+		// If nobody prevented the default action, do it now
+		if ( !onlyHandlers && !event.isDefaultPrevented() ) {
+
+			if ( ( !special._default ||
+				special._default.apply( eventPath.pop(), data ) === false ) &&
+				acceptData( elem ) ) {
+
+				// Call a native DOM method on the target with the same name as the event.
+				// Don't do default actions on window, that's where global variables be (#6170)
+				if ( ontype && isFunction( elem[ type ] ) && !isWindow( elem ) ) {
+
+					// Don't re-trigger an onFOO event when we call its FOO() method
+					tmp = elem[ ontype ];
+
+					if ( tmp ) {
+						elem[ ontype ] = null;
+					}
+
+					// Prevent re-triggering of the same event, since we already bubbled it above
+					jQuery.event.triggered = type;
+
+					if ( event.isPropagationStopped() ) {
+						lastElement.addEventListener( type, stopPropagationCallback );
+					}
+
+					elem[ type ]();
+
+					if ( event.isPropagationStopped() ) {
+						lastElement.removeEventListener( type, stopPropagationCallback );
+					}
+
+					jQuery.event.triggered = undefined;
+
+					if ( tmp ) {
+						elem[ ontype ] = tmp;
+					}
+				}
+			}
+		}
+
+		return event.result;
+	},
+
+	// Piggyback on a donor event to simulate a different one
+	// Used only for `focus(in | out)` events
+	simulate: function( type, elem, event ) {
+		var e = jQuery.extend(
+			new jQuery.Event(),
+			event,
+			{
+				type: type,
+				isSimulated: true
+			}
+		);
+
+		jQuery.event.trigger( e, null, elem );
+	}
+
+} );
+
+jQuery.fn.extend( {
+
+	trigger: function( type, data ) {
+		return this.each( function() {
+			jQuery.event.trigger( type, data, this );
+		} );
+	},
+	triggerHandler: function( type, data ) {
+		var elem = this[ 0 ];
+		if ( elem ) {
+			return jQuery.event.trigger( type, data, elem, true );
+		}
+	}
+} );
+
+
+// Support: Firefox <=44
+// Firefox doesn't have focus(in | out) events
+// Related ticket - https://bugzilla.mozilla.org/show_bug.cgi?id=687787
+//
+// Support: Chrome <=48 - 49, Safari <=9.0 - 9.1
+// focus(in | out) events fire after focus & blur events,
+// which is spec violation - http://www.w3.org/TR/DOM-Level-3-Events/#events-focusevent-event-order
+// Related ticket - https://bugs.chromium.org/p/chromium/issues/detail?id=449857
+if ( !support.focusin ) {
+	jQuery.each( { focus: "focusin", blur: "focusout" }, function( orig, fix ) {
+
+		// Attach a single capturing handler on the document while someone wants focusin/focusout
+		var handler = function( event ) {
+			jQuery.event.simulate( fix, event.target, jQuery.event.fix( event ) );
+		};
+
+		jQuery.event.special[ fix ] = {
+			setup: function() {
+
+				// Handle: regular nodes (via `this.ownerDocument`), window
+				// (via `this.document`) & document (via `this`).
+				var doc = this.ownerDocument || this.document || this,
+					attaches = dataPriv.access( doc, fix );
+
+				if ( !attaches ) {
+					doc.addEventListener( orig, handler, true );
+				}
+				dataPriv.access( doc, fix, ( attaches || 0 ) + 1 );
+			},
+			teardown: function() {
+				var doc = this.ownerDocument || this.document || this,
+					attaches = dataPriv.access( doc, fix ) - 1;
+
+				if ( !attaches ) {
+					doc.removeEventListener( orig, handler, true );
+					dataPriv.remove( doc, fix );
+
+				} else {
+					dataPriv.access( doc, fix, attaches );
+				}
+			}
+		};
+	} );
+}
+var location = window.location;
+
+var nonce = { guid: Date.now() };
+
+var rquery = ( /\?/ );
+
+
+
+// Cross-browser xml parsing
+jQuery.parseXML = function( data ) {
+	var xml;
+	if ( !data || typeof data !== "string" ) {
+		return null;
+	}
+
+	// Support: IE 9 - 11 only
+	// IE throws on parseFromString with invalid input.
+	try {
+		xml = ( new window.DOMParser() ).parseFromString( data, "text/xml" );
+	} catch ( e ) {
+		xml = undefined;
+	}
+
+	if ( !xml || xml.getElementsByTagName( "parsererror" ).length ) {
+		jQuery.error( "Invalid XML: " + data );
+	}
+	return xml;
+};
+
+
+var
+	rbracket = /\[\]$/,
+	rCRLF = /\r?\n/g,
+	rsubmitterTypes = /^(?:submit|button|image|reset|file)$/i,
+	rsubmittable = /^(?:input|select|textarea|keygen)/i;
+
+function buildParams( prefix, obj, traditional, add ) {
+	var name;
+
+	if ( Array.isArray( obj ) ) {
+
+		// Serialize array item.
+		jQuery.each( obj, function( i, v ) {
+			if ( traditional || rbracket.test( prefix ) ) {
+
+				// Treat each array item as a scalar.
+				add( prefix, v );
+
+			} else {
+
+				// Item is non-scalar (array or object), encode its numeric index.
+				buildParams(
+					prefix + "[" + ( typeof v === "object" && v != null ? i : "" ) + "]",
+					v,
+					traditional,
+					add
+				);
+			}
+		} );
+
+	} else if ( !traditional && toType( obj ) === "object" ) {
+
+		// Serialize object item.
+		for ( name in obj ) {
+			buildParams( prefix + "[" + name + "]", obj[ name ], traditional, add );
+		}
+
+	} else {
+
+		// Serialize scalar item.
+		add( prefix, obj );
+	}
+}
+
+// Serialize an array of form elements or a set of
+// key/values into a query string
+jQuery.param = function( a, traditional ) {
+	var prefix,
+		s = [],
+		add = function( key, valueOrFunction ) {
+
+			// If value is a function, invoke it and use its return value
+			var value = isFunction( valueOrFunction ) ?
+				valueOrFunction() :
+				valueOrFunction;
+
+			s[ s.length ] = encodeURIComponent( key ) + "=" +
+				encodeURIComponent( value == null ? "" : value );
+		};
+
+	if ( a == null ) {
+		return "";
+	}
+
+	// If an array was passed in, assume that it is an array of form elements.
+	if ( Array.isArray( a ) || ( a.jquery && !jQuery.isPlainObject( a ) ) ) {
+
+		// Serialize the form elements
+		jQuery.each( a, function() {
+			add( this.name, this.value );
+		} );
+
+	} else {
+
+		// If traditional, encode the "old" way (the way 1.3.2 or older
+		// did it), otherwise encode params recursively.
+		for ( prefix in a ) {
+			buildParams( prefix, a[ prefix ], traditional, add );
+		}
+	}
+
+	// Return the resulting serialization
+	return s.join( "&" );
+};
+
+jQuery.fn.extend( {
+	serialize: function() {
+		return jQuery.param( this.serializeArray() );
+	},
+	serializeArray: function() {
+		return this.map( function() {
+
+			// Can add propHook for "elements" to filter or add form elements
+			var elements = jQuery.prop( this, "elements" );
+			return elements ? jQuery.makeArray( elements ) : this;
+		} )
+		.filter( function() {
+			var type = this.type;
+
+			// Use .is( ":disabled" ) so that fieldset[disabled] works
+			return this.name && !jQuery( this ).is( ":disabled" ) &&
+				rsubmittable.test( this.nodeName ) && !rsubmitterTypes.test( type ) &&
+				( this.checked || !rcheckableType.test( type ) );
+		} )
+		.map( function( _i, elem ) {
+			var val = jQuery( this ).val();
+
+			if ( val == null ) {
+				return null;
+			}
+
+			if ( Array.isArray( val ) ) {
+				return jQuery.map( val, function( val ) {
+					return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+				} );
+			}
+
+			return { name: elem.name, value: val.replace( rCRLF, "\r\n" ) };
+		} ).get();
+	}
+} );
+
+
+var
+	r20 = /%20/g,
+	rhash = /#.*$/,
+	rantiCache = /([?&])_=[^&]*/,
+	rheaders = /^(.*?):[ \t]*([^\r\n]*)$/mg,
+
+	// #7653, #8125, #8152: local protocol detection
+	rlocalProtocol = /^(?:about|app|app-storage|.+-extension|file|res|widget):$/,
+	rnoContent = /^(?:GET|HEAD)$/,
+	rprotocol = /^\/\//,
+
+	/* Prefilters
+	 * 1) They are useful to introduce custom dataTypes (see ajax/jsonp.js for an example)
+	 * 2) These are called:
+	 *    - BEFORE asking for a transport
+	 *    - AFTER param serialization (s.data is a string if s.processData is true)
+	 * 3) key is the dataType
+	 * 4) the catchall symbol "*" can be used
+	 * 5) execution will start with transport dataType and THEN continue down to "*" if needed
+	 */
+	prefilters = {},
+
+	/* Transports bindings
+	 * 1) key is the dataType
+	 * 2) the catchall symbol "*" can be used
+	 * 3) selection will start with transport dataType and THEN go to "*" if needed
+	 */
+	transports = {},
+
+	// Avoid comment-prolog char sequence (#10098); must appease lint and evade compression
+	allTypes = "*/".concat( "*" ),
+
+	// Anchor tag for parsing the document origin
+	originAnchor = document.createElement( "a" );
+	originAnchor.href = location.href;
+
+// Base "constructor" for jQuery.ajaxPrefilter and jQuery.ajaxTransport
+function addToPrefiltersOrTransports( structure ) {
+
+	// dataTypeExpression is optional and defaults to "*"
+	return function( dataTypeExpression, func ) {
+
+		if ( typeof dataTypeExpression !== "string" ) {
+			func = dataTypeExpression;
+			dataTypeExpression = "*";
+		}
+
+		var dataType,
+			i = 0,
+			dataTypes = dataTypeExpression.toLowerCase().match( rnothtmlwhite ) || [];
+
+		if ( isFunction( func ) ) {
+
+			// For each dataType in the dataTypeExpression
+			while ( ( dataType = dataTypes[ i++ ] ) ) {
+
+				// Prepend if requested
+				if ( dataType[ 0 ] === "+" ) {
+					dataType = dataType.slice( 1 ) || "*";
+					( structure[ dataType ] = structure[ dataType ] || [] ).unshift( func );
+
+				// Otherwise append
+				} else {
+					( structure[ dataType ] = structure[ dataType ] || [] ).push( func );
+				}
+			}
+		}
+	};
+}
+
+// Base inspection function for prefilters and transports
+function inspectPrefiltersOrTransports( structure, options, originalOptions, jqXHR ) {
+
+	var inspected = {},
+		seekingTransport = ( structure === transports );
+
+	function inspect( dataType ) {
+		var selected;
+		inspected[ dataType ] = true;
+		jQuery.each( structure[ dataType ] || [], function( _, prefilterOrFactory ) {
+			var dataTypeOrTransport = prefilterOrFactory( options, originalOptions, jqXHR );
+			if ( typeof dataTypeOrTransport === "string" &&
+				!seekingTransport && !inspected[ dataTypeOrTransport ] ) {
+
+				options.dataTypes.unshift( dataTypeOrTransport );
+				inspect( dataTypeOrTransport );
+				return false;
+			} else if ( seekingTransport ) {
+				return !( selected = dataTypeOrTransport );
+			}
+		} );
+		return selected;
+	}
+
+	return inspect( options.dataTypes[ 0 ] ) || !inspected[ "*" ] && inspect( "*" );
+}
+
+// A special extend for ajax options
+// that takes "flat" options (not to be deep extended)
+// Fixes #9887
+function ajaxExtend( target, src ) {
+	var key, deep,
+		flatOptions = jQuery.ajaxSettings.flatOptions || {};
+
+	for ( key in src ) {
+		if ( src[ key ] !== undefined ) {
+			( flatOptions[ key ] ? target : ( deep || ( deep = {} ) ) )[ key ] = src[ key ];
+		}
+	}
+	if ( deep ) {
+		jQuery.extend( true, target, deep );
+	}
+
+	return target;
+}
+
+/* Handles responses to an ajax request:
+ * - finds the right dataType (mediates between content-type and expected dataType)
+ * - returns the corresponding response
+ */
+function ajaxHandleResponses( s, jqXHR, responses ) {
+
+	var ct, type, finalDataType, firstDataType,
+		contents = s.contents,
+		dataTypes = s.dataTypes;
+
+	// Remove auto dataType and get content-type in the process
+	while ( dataTypes[ 0 ] === "*" ) {
+		dataTypes.shift();
+		if ( ct === undefined ) {
+			ct = s.mimeType || jqXHR.getResponseHeader( "Content-Type" );
+		}
+	}
+
+	// Check if we're dealing with a known content-type
+	if ( ct ) {
+		for ( type in contents ) {
+			if ( contents[ type ] && contents[ type ].test( ct ) ) {
+				dataTypes.unshift( type );
+				break;
+			}
+		}
+	}
+
+	// Check to see if we have a response for the expected dataType
+	if ( dataTypes[ 0 ] in responses ) {
+		finalDataType = dataTypes[ 0 ];
+	} else {
+
+		// Try convertible dataTypes
+		for ( type in responses ) {
+			if ( !dataTypes[ 0 ] || s.converters[ type + " " + dataTypes[ 0 ] ] ) {
+				finalDataType = type;
+				break;
+			}
+			if ( !firstDataType ) {
+				firstDataType = type;
+			}
+		}
+
+		// Or just use first one
+		finalDataType = finalDataType || firstDataType;
+	}
+
+	// If we found a dataType
+	// We add the dataType to the list if needed
+	// and return the corresponding response
+	if ( finalDataType ) {
+		if ( finalDataType !== dataTypes[ 0 ] ) {
+			dataTypes.unshift( finalDataType );
+		}
+		return responses[ finalDataType ];
+	}
+}
+
+/* Chain conversions given the request and the original response
+ * Also sets the responseXXX fields on the jqXHR instance
+ */
+function ajaxConvert( s, response, jqXHR, isSuccess ) {
+	var conv2, current, conv, tmp, prev,
+		converters = {},
+
+		// Work with a copy of dataTypes in case we need to modify it for conversion
+		dataTypes = s.dataTypes.slice();
+
+	// Create converters map with lowercased keys
+	if ( dataTypes[ 1 ] ) {
+		for ( conv in s.converters ) {
+			converters[ conv.toLowerCase() ] = s.converters[ conv ];
+		}
+	}
+
+	current = dataTypes.shift();
+
+	// Convert to each sequential dataType
+	while ( current ) {
+
+		if ( s.responseFields[ current ] ) {
+			jqXHR[ s.responseFields[ current ] ] = response;
+		}
+
+		// Apply the dataFilter if provided
+		if ( !prev && isSuccess && s.dataFilter ) {
+			response = s.dataFilter( response, s.dataType );
+		}
+
+		prev = current;
+		current = dataTypes.shift();
+
+		if ( current ) {
+
+			// There's only work to do if current dataType is non-auto
+			if ( current === "*" ) {
+
+				current = prev;
+
+			// Convert response if prev dataType is non-auto and differs from current
+			} else if ( prev !== "*" && prev !== current ) {
+
+				// Seek a direct converter
+				conv = converters[ prev + " " + current ] || converters[ "* " + current ];
+
+				// If none found, seek a pair
+				if ( !conv ) {
+					for ( conv2 in converters ) {
+
+						// If conv2 outputs current
+						tmp = conv2.split( " " );
+						if ( tmp[ 1 ] === current ) {
+
+							// If prev can be converted to accepted input
+							conv = converters[ prev + " " + tmp[ 0 ] ] ||
+								converters[ "* " + tmp[ 0 ] ];
+							if ( conv ) {
+
+								// Condense equivalence converters
+								if ( conv === true ) {
+									conv = converters[ conv2 ];
+
+								// Otherwise, insert the intermediate dataType
+								} else if ( converters[ conv2 ] !== true ) {
+									current = tmp[ 0 ];
+									dataTypes.unshift( tmp[ 1 ] );
+								}
+								break;
+							}
+						}
+					}
+				}
+
+				// Apply converter (if not an equivalence)
+				if ( conv !== true ) {
+
+					// Unless errors are allowed to bubble, catch and return them
+					if ( conv && s.throws ) {
+						response = conv( response );
+					} else {
+						try {
+							response = conv( response );
+						} catch ( e ) {
+							return {
+								state: "parsererror",
+								error: conv ? e : "No conversion from " + prev + " to " + current
+							};
+						}
+					}
+				}
+			}
+		}
+	}
+
+	return { state: "success", data: response };
+}
+
+jQuery.extend( {
+
+	// Counter for holding the number of active queries
+	active: 0,
+
+	// Last-Modified header cache for next request
+	lastModified: {},
+	etag: {},
+
+	ajaxSettings: {
+		url: location.href,
+		type: "GET",
+		isLocal: rlocalProtocol.test( location.protocol ),
+		global: true,
+		processData: true,
+		async: true,
+		contentType: "application/x-www-form-urlencoded; charset=UTF-8",
+
+		/*
+		timeout: 0,
+		data: null,
+		dataType: null,
+		username: null,
+		password: null,
+		cache: null,
+		throws: false,
+		traditional: false,
+		headers: {},
+		*/
+
+		accepts: {
+			"*": allTypes,
+			text: "text/plain",
+			html: "text/html",
+			xml: "application/xml, text/xml",
+			json: "application/json, text/javascript"
+		},
+
+		contents: {
+			xml: /\bxml\b/,
+			html: /\bhtml/,
+			json: /\bjson\b/
+		},
+
+		responseFields: {
+			xml: "responseXML",
+			text: "responseText",
+			json: "responseJSON"
+		},
+
+		// Data converters
+		// Keys separate source (or catchall "*") and destination types with a single space
+		converters: {
+
+			// Convert anything to text
+			"* text": String,
+
+			// Text to html (true = no transformation)
+			"text html": true,
+
+			// Evaluate text as a json expression
+			"text json": JSON.parse,
+
+			// Parse text as xml
+			"text xml": jQuery.parseXML
+		},
+
+		// For options that shouldn't be deep extended:
+		// you can add your own custom options here if
+		// and when you create one that shouldn't be
+		// deep extended (see ajaxExtend)
+		flatOptions: {
+			url: true,
+			context: true
+		}
+	},
+
+	// Creates a full fledged settings object into target
+	// with both ajaxSettings and settings fields.
+	// If target is omitted, writes into ajaxSettings.
+	ajaxSetup: function( target, settings ) {
+		return settings ?
+
+			// Building a settings object
+			ajaxExtend( ajaxExtend( target, jQuery.ajaxSettings ), settings ) :
+
+			// Extending ajaxSettings
+			ajaxExtend( jQuery.ajaxSettings, target );
+	},
+
+	ajaxPrefilter: addToPrefiltersOrTransports( prefilters ),
+	ajaxTransport: addToPrefiltersOrTransports( transports ),
+
+	// Main method
+	ajax: function( url, options ) {
+
+		// If url is an object, simulate pre-1.5 signature
+		if ( typeof url === "object" ) {
+			options = url;
+			url = undefined;
+		}
+
+		// Force options to be an object
+		options = options || {};
+
+		var transport,
+
+			// URL without anti-cache param
+			cacheURL,
+
+			// Response headers
+			responseHeadersString,
+			responseHeaders,
+
+			// timeout handle
+			timeoutTimer,
+
+			// Url cleanup var
+			urlAnchor,
+
+			// Request state (becomes false upon send and true upon completion)
+			completed,
+
+			// To know if global events are to be dispatched
+			fireGlobals,
+
+			// Loop variable
+			i,
+
+			// uncached part of the url
+			uncached,
+
+			// Create the final options object
+			s = jQuery.ajaxSetup( {}, options ),
+
+			// Callbacks context
+			callbackContext = s.context || s,
+
+			// Context for global events is callbackContext if it is a DOM node or jQuery collection
+			globalEventContext = s.context &&
+				( callbackContext.nodeType || callbackContext.jquery ) ?
+					jQuery( callbackContext ) :
+					jQuery.event,
+
+			// Deferreds
+			deferred = jQuery.Deferred(),
+			completeDeferred = jQuery.Callbacks( "once memory" ),
+
+			// Status-dependent callbacks
+			statusCode = s.statusCode || {},
+
+			// Headers (they are sent all at once)
+			requestHeaders = {},
+			requestHeadersNames = {},
+
+			// Default abort message
+			strAbort = "canceled",
+
+			// Fake xhr
+			jqXHR = {
+				readyState: 0,
+
+				// Builds headers hashtable if needed
+				getResponseHeader: function( key ) {
+					var match;
+					if ( completed ) {
+						if ( !responseHeaders ) {
+							responseHeaders = {};
+							while ( ( match = rheaders.exec( responseHeadersString ) ) ) {
+								responseHeaders[ match[ 1 ].toLowerCase() + " " ] =
+									( responseHeaders[ match[ 1 ].toLowerCase() + " " ] || [] )
+										.concat( match[ 2 ] );
+							}
+						}
+						match = responseHeaders[ key.toLowerCase() + " " ];
+					}
+					return match == null ? null : match.join( ", " );
+				},
+
+				// Raw string
+				getAllResponseHeaders: function() {
+					return completed ? responseHeadersString : null;
+				},
+
+				// Caches the header
+				setRequestHeader: function( name, value ) {
+					if ( completed == null ) {
+						name = requestHeadersNames[ name.toLowerCase() ] =
+							requestHeadersNames[ name.toLowerCase() ] || name;
+						requestHeaders[ name ] = value;
+					}
+					return this;
+				},
+
+				// Overrides response content-type header
+				overrideMimeType: function( type ) {
+					if ( completed == null ) {
+						s.mimeType = type;
+					}
+					return this;
+				},
+
+				// Status-dependent callbacks
+				statusCode: function( map ) {
+					var code;
+					if ( map ) {
+						if ( completed ) {
+
+							// Execute the appropriate callbacks
+							jqXHR.always( map[ jqXHR.status ] );
+						} else {
+
+							// Lazy-add the new callbacks in a way that preserves old ones
+							for ( code in map ) {
+								statusCode[ code ] = [ statusCode[ code ], map[ code ] ];
+							}
+						}
+					}
+					return this;
+				},
+
+				// Cancel the request
+				abort: function( statusText ) {
+					var finalText = statusText || strAbort;
+					if ( transport ) {
+						transport.abort( finalText );
+					}
+					done( 0, finalText );
+					return this;
+				}
+			};
+
+		// Attach deferreds
+		deferred.promise( jqXHR );
+
+		// Add protocol if not provided (prefilters might expect it)
+		// Handle falsy url in the settings object (#10093: consistency with old signature)
+		// We also use the url parameter if available
+		s.url = ( ( url || s.url || location.href ) + "" )
+			.replace( rprotocol, location.protocol + "//" );
+
+		// Alias method option to type as per ticket #12004
+		s.type = options.method || options.type || s.method || s.type;
+
+		// Extract dataTypes list
+		s.dataTypes = ( s.dataType || "*" ).toLowerCase().match( rnothtmlwhite ) || [ "" ];
+
+		// A cross-domain request is in order when the origin doesn't match the current origin.
+		if ( s.crossDomain == null ) {
+			urlAnchor = document.createElement( "a" );
+
+			// Support: IE <=8 - 11, Edge 12 - 15
+			// IE throws exception on accessing the href property if url is malformed,
+			// e.g. http://example.com:80x/
+			try {
+				urlAnchor.href = s.url;
+
+				// Support: IE <=8 - 11 only
+				// Anchor's host property isn't correctly set when s.url is relative
+				urlAnchor.href = urlAnchor.href;
+				s.crossDomain = originAnchor.protocol + "//" + originAnchor.host !==
+					urlAnchor.protocol + "//" + urlAnchor.host;
+			} catch ( e ) {
+
+				// If there is an error parsing the URL, assume it is crossDomain,
+				// it can be rejected by the transport if it is invalid
+				s.crossDomain = true;
+			}
+		}
+
+		// Convert data if not already a string
+		if ( s.data && s.processData && typeof s.data !== "string" ) {
+			s.data = jQuery.param( s.data, s.traditional );
+		}
+
+		// Apply prefilters
+		inspectPrefiltersOrTransports( prefilters, s, options, jqXHR );
+
+		// If request was aborted inside a prefilter, stop there
+		if ( completed ) {
+			return jqXHR;
+		}
+
+		// We can fire global events as of now if asked to
+		// Don't fire events if jQuery.event is undefined in an AMD-usage scenario (#15118)
+		fireGlobals = jQuery.event && s.global;
+
+		// Watch for a new set of requests
+		if ( fireGlobals && jQuery.active++ === 0 ) {
+			jQuery.event.trigger( "ajaxStart" );
+		}
+
+		// Uppercase the type
+		s.type = s.type.toUpperCase();
+
+		// Determine if request has content
+		s.hasContent = !rnoContent.test( s.type );
+
+		// Save the URL in case we're toying with the If-Modified-Since
+		// and/or If-None-Match header later on
+		// Remove hash to simplify url manipulation
+		cacheURL = s.url.replace( rhash, "" );
+
+		// More options handling for requests with no content
+		if ( !s.hasContent ) {
+
+			// Remember the hash so we can put it back
+			uncached = s.url.slice( cacheURL.length );
+
+			// If data is available and should be processed, append data to url
+			if ( s.data && ( s.processData || typeof s.data === "string" ) ) {
+				cacheURL += ( rquery.test( cacheURL ) ? "&" : "?" ) + s.data;
+
+				// #9682: remove data so that it's not used in an eventual retry
+				delete s.data;
+			}
+
+			// Add or update anti-cache param if needed
+			if ( s.cache === false ) {
+				cacheURL = cacheURL.replace( rantiCache, "$1" );
+				uncached = ( rquery.test( cacheURL ) ? "&" : "?" ) + "_=" + ( nonce.guid++ ) +
+					uncached;
+			}
+
+			// Put hash and anti-cache on the URL that will be requested (gh-1732)
+			s.url = cacheURL + uncached;
+
+		// Change '%20' to '+' if this is encoded form body content (gh-2658)
+		} else if ( s.data && s.processData &&
+			( s.contentType || "" ).indexOf( "application/x-www-form-urlencoded" ) === 0 ) {
+			s.data = s.data.replace( r20, "+" );
+		}
+
+		// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+		if ( s.ifModified ) {
+			if ( jQuery.lastModified[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-Modified-Since", jQuery.lastModified[ cacheURL ] );
+			}
+			if ( jQuery.etag[ cacheURL ] ) {
+				jqXHR.setRequestHeader( "If-None-Match", jQuery.etag[ cacheURL ] );
+			}
+		}
+
+		// Set the correct header, if data is being sent
+		if ( s.data && s.hasContent && s.contentType !== false || options.contentType ) {
+			jqXHR.setRequestHeader( "Content-Type", s.contentType );
+		}
+
+		// Set the Accepts header for the server, depending on the dataType
+		jqXHR.setRequestHeader(
+			"Accept",
+			s.dataTypes[ 0 ] && s.accepts[ s.dataTypes[ 0 ] ] ?
+				s.accepts[ s.dataTypes[ 0 ] ] +
+					( s.dataTypes[ 0 ] !== "*" ? ", " + allTypes + "; q=0.01" : "" ) :
+				s.accepts[ "*" ]
+		);
+
+		// Check for headers option
+		for ( i in s.headers ) {
+			jqXHR.setRequestHeader( i, s.headers[ i ] );
+		}
+
+		// Allow custom headers/mimetypes and early abort
+		if ( s.beforeSend &&
+			( s.beforeSend.call( callbackContext, jqXHR, s ) === false || completed ) ) {
+
+			// Abort if not done already and return
+			return jqXHR.abort();
+		}
+
+		// Aborting is no longer a cancellation
+		strAbort = "abort";
+
+		// Install callbacks on deferreds
+		completeDeferred.add( s.complete );
+		jqXHR.done( s.success );
+		jqXHR.fail( s.error );
+
+		// Get transport
+		transport = inspectPrefiltersOrTransports( transports, s, options, jqXHR );
+
+		// If no transport, we auto-abort
+		if ( !transport ) {
+			done( -1, "No Transport" );
+		} else {
+			jqXHR.readyState = 1;
+
+			// Send global event
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxSend", [ jqXHR, s ] );
+			}
+
+			// If request was aborted inside ajaxSend, stop there
+			if ( completed ) {
+				return jqXHR;
+			}
+
+			// Timeout
+			if ( s.async && s.timeout > 0 ) {
+				timeoutTimer = window.setTimeout( function() {
+					jqXHR.abort( "timeout" );
+				}, s.timeout );
+			}
+
+			try {
+				completed = false;
+				transport.send( requestHeaders, done );
+			} catch ( e ) {
+
+				// Rethrow post-completion exceptions
+				if ( completed ) {
+					throw e;
+				}
+
+				// Propagate others as results
+				done( -1, e );
+			}
+		}
+
+		// Callback for when everything is done
+		function done( status, nativeStatusText, responses, headers ) {
+			var isSuccess, success, error, response, modified,
+				statusText = nativeStatusText;
+
+			// Ignore repeat invocations
+			if ( completed ) {
+				return;
+			}
+
+			completed = true;
+
+			// Clear timeout if it exists
+			if ( timeoutTimer ) {
+				window.clearTimeout( timeoutTimer );
+			}
+
+			// Dereference transport for early garbage collection
+			// (no matter how long the jqXHR object will be used)
+			transport = undefined;
+
+			// Cache response headers
+			responseHeadersString = headers || "";
+
+			// Set readyState
+			jqXHR.readyState = status > 0 ? 4 : 0;
+
+			// Determine if successful
+			isSuccess = status >= 200 && status < 300 || status === 304;
+
+			// Get response data
+			if ( responses ) {
+				response = ajaxHandleResponses( s, jqXHR, responses );
+			}
+
+			// Use a noop converter for missing script
+			if ( !isSuccess && jQuery.inArray( "script", s.dataTypes ) > -1 ) {
+				s.converters[ "text script" ] = function() {};
+			}
+
+			// Convert no matter what (that way responseXXX fields are always set)
+			response = ajaxConvert( s, response, jqXHR, isSuccess );
+
+			// If successful, handle type chaining
+			if ( isSuccess ) {
+
+				// Set the If-Modified-Since and/or If-None-Match header, if in ifModified mode.
+				if ( s.ifModified ) {
+					modified = jqXHR.getResponseHeader( "Last-Modified" );
+					if ( modified ) {
+						jQuery.lastModified[ cacheURL ] = modified;
+					}
+					modified = jqXHR.getResponseHeader( "etag" );
+					if ( modified ) {
+						jQuery.etag[ cacheURL ] = modified;
+					}
+				}
+
+				// if no content
+				if ( status === 204 || s.type === "HEAD" ) {
+					statusText = "nocontent";
+
+				// if not modified
+				} else if ( status === 304 ) {
+					statusText = "notmodified";
+
+				// If we have data, let's convert it
+				} else {
+					statusText = response.state;
+					success = response.data;
+					error = response.error;
+					isSuccess = !error;
+				}
+			} else {
+
+				// Extract error from statusText and normalize for non-aborts
+				error = statusText;
+				if ( status || !statusText ) {
+					statusText = "error";
+					if ( status < 0 ) {
+						status = 0;
+					}
+				}
+			}
+
+			// Set data for the fake xhr object
+			jqXHR.status = status;
+			jqXHR.statusText = ( nativeStatusText || statusText ) + "";
+
+			// Success/Error
+			if ( isSuccess ) {
+				deferred.resolveWith( callbackContext, [ success, statusText, jqXHR ] );
+			} else {
+				deferred.rejectWith( callbackContext, [ jqXHR, statusText, error ] );
+			}
+
+			// Status-dependent callbacks
+			jqXHR.statusCode( statusCode );
+			statusCode = undefined;
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( isSuccess ? "ajaxSuccess" : "ajaxError",
+					[ jqXHR, s, isSuccess ? success : error ] );
+			}
+
+			// Complete
+			completeDeferred.fireWith( callbackContext, [ jqXHR, statusText ] );
+
+			if ( fireGlobals ) {
+				globalEventContext.trigger( "ajaxComplete", [ jqXHR, s ] );
+
+				// Handle the global AJAX counter
+				if ( !( --jQuery.active ) ) {
+					jQuery.event.trigger( "ajaxStop" );
+				}
+			}
+		}
+
+		return jqXHR;
+	},
+
+	getJSON: function( url, data, callback ) {
+		return jQuery.get( url, data, callback, "json" );
+	},
+
+	getScript: function( url, callback ) {
+		return jQuery.get( url, undefined, callback, "script" );
+	}
+} );
+
+jQuery.each( [ "get", "post" ], function( _i, method ) {
+	jQuery[ method ] = function( url, data, callback, type ) {
+
+		// Shift arguments if data argument was omitted
+		if ( isFunction( data ) ) {
+			type = type || callback;
+			callback = data;
+			data = undefined;
+		}
+
+		// The url can be an options object (which then must have .url)
+		return jQuery.ajax( jQuery.extend( {
+			url: url,
+			type: method,
+			dataType: type,
+			data: data,
+			success: callback
+		}, jQuery.isPlainObject( url ) && url ) );
+	};
+} );
+
+jQuery.ajaxPrefilter( function( s ) {
+	var i;
+	for ( i in s.headers ) {
+		if ( i.toLowerCase() === "content-type" ) {
+			s.contentType = s.headers[ i ] || "";
+		}
+	}
+} );
+
+
+jQuery._evalUrl = function( url, options, doc ) {
+	return jQuery.ajax( {
+		url: url,
+
+		// Make this explicit, since user can override this through ajaxSetup (#11264)
+		type: "GET",
+		dataType: "script",
+		cache: true,
+		async: false,
+		global: false,
+
+		// Only evaluate the response if it is successful (gh-4126)
+		// dataFilter is not invoked for failure responses, so using it instead
+		// of the default converter is kludgy but it works.
+		converters: {
+			"text script": function() {}
+		},
+		dataFilter: function( response ) {
+			jQuery.globalEval( response, options, doc );
+		}
+	} );
+};
+
+
+jQuery.fn.extend( {
+	wrapAll: function( html ) {
+		var wrap;
+
+		if ( this[ 0 ] ) {
+			if ( isFunction( html ) ) {
+				html = html.call( this[ 0 ] );
+			}
+
+			// The elements to wrap the target around
+			wrap = jQuery( html, this[ 0 ].ownerDocument ).eq( 0 ).clone( true );
+
+			if ( this[ 0 ].parentNode ) {
+				wrap.insertBefore( this[ 0 ] );
+			}
+
+			wrap.map( function() {
+				var elem = this;
+
+				while ( elem.firstElementChild ) {
+					elem = elem.firstElementChild;
+				}
+
+				return elem;
+			} ).append( this );
+		}
+
+		return this;
+	},
+
+	wrapInner: function( html ) {
+		if ( isFunction( html ) ) {
+			return this.each( function( i ) {
+				jQuery( this ).wrapInner( html.call( this, i ) );
+			} );
+		}
+
+		return this.each( function() {
+			var self = jQuery( this ),
+				contents = self.contents();
+
+			if ( contents.length ) {
+				contents.wrapAll( html );
+
+			} else {
+				self.append( html );
+			}
+		} );
+	},
+
+	wrap: function( html ) {
+		var htmlIsFunction = isFunction( html );
+
+		return this.each( function( i ) {
+			jQuery( this ).wrapAll( htmlIsFunction ? html.call( this, i ) : html );
+		} );
+	},
+
+	unwrap: function( selector ) {
+		this.parent( selector ).not( "body" ).each( function() {
+			jQuery( this ).replaceWith( this.childNodes );
+		} );
+		return this;
+	}
+} );
+
+
+jQuery.expr.pseudos.hidden = function( elem ) {
+	return !jQuery.expr.pseudos.visible( elem );
+};
+jQuery.expr.pseudos.visible = function( elem ) {
+	return !!( elem.offsetWidth || elem.offsetHeight || elem.getClientRects().length );
+};
+
+
+
+
+jQuery.ajaxSettings.xhr = function() {
+	try {
+		return new window.XMLHttpRequest();
+	} catch ( e ) {}
+};
+
+var xhrSuccessStatus = {
+
+		// File protocol always yields status code 0, assume 200
+		0: 200,
+
+		// Support: IE <=9 only
+		// #1450: sometimes IE returns 1223 when it should be 204
+		1223: 204
+	},
+	xhrSupported = jQuery.ajaxSettings.xhr();
+
+support.cors = !!xhrSupported && ( "withCredentials" in xhrSupported );
+support.ajax = xhrSupported = !!xhrSupported;
+
+jQuery.ajaxTransport( function( options ) {
+	var callback, errorCallback;
+
+	// Cross domain only allowed if supported through XMLHttpRequest
+	if ( support.cors || xhrSupported && !options.crossDomain ) {
+		return {
+			send: function( headers, complete ) {
+				var i,
+					xhr = options.xhr();
+
+				xhr.open(
+					options.type,
+					options.url,
+					options.async,
+					options.username,
+					options.password
+				);
+
+				// Apply custom fields if provided
+				if ( options.xhrFields ) {
+					for ( i in options.xhrFields ) {
+						xhr[ i ] = options.xhrFields[ i ];
+					}
+				}
+
+				// Override mime type if needed
+				if ( options.mimeType && xhr.overrideMimeType ) {
+					xhr.overrideMimeType( options.mimeType );
+				}
+
+				// X-Requested-With header
+				// For cross-domain requests, seeing as conditions for a preflight are
+				// akin to a jigsaw puzzle, we simply never set it to be sure.
+				// (it can always be set on a per-request basis or even using ajaxSetup)
+				// For same-domain requests, won't change header if already provided.
+				if ( !options.crossDomain && !headers[ "X-Requested-With" ] ) {
+					headers[ "X-Requested-With" ] = "XMLHttpRequest";
+				}
+
+				// Set headers
+				for ( i in headers ) {
+					xhr.setRequestHeader( i, headers[ i ] );
+				}
+
+				// Callback
+				callback = function( type ) {
+					return function() {
+						if ( callback ) {
+							callback = errorCallback = xhr.onload =
+								xhr.onerror = xhr.onabort = xhr.ontimeout =
+									xhr.onreadystatechange = null;
+
+							if ( type === "abort" ) {
+								xhr.abort();
+							} else if ( type === "error" ) {
+
+								// Support: IE <=9 only
+								// On a manual native abort, IE9 throws
+								// errors on any property access that is not readyState
+								if ( typeof xhr.status !== "number" ) {
+									complete( 0, "error" );
+								} else {
+									complete(
+
+										// File: protocol always yields status 0; see #8605, #14207
+										xhr.status,
+										xhr.statusText
+									);
+								}
+							} else {
+								complete(
+									xhrSuccessStatus[ xhr.status ] || xhr.status,
+									xhr.statusText,
+
+									// Support: IE <=9 only
+									// IE9 has no XHR2 but throws on binary (trac-11426)
+									// For XHR2 non-text, let the caller handle it (gh-2498)
+									( xhr.responseType || "text" ) !== "text"  ||
+									typeof xhr.responseText !== "string" ?
+										{ binary: xhr.response } :
+										{ text: xhr.responseText },
+									xhr.getAllResponseHeaders()
+								);
+							}
+						}
+					};
+				};
+
+				// Listen to events
+				xhr.onload = callback();
+				errorCallback = xhr.onerror = xhr.ontimeout = callback( "error" );
+
+				// Support: IE 9 only
+				// Use onreadystatechange to replace onabort
+				// to handle uncaught aborts
+				if ( xhr.onabort !== undefined ) {
+					xhr.onabort = errorCallback;
+				} else {
+					xhr.onreadystatechange = function() {
+
+						// Check readyState before timeout as it changes
+						if ( xhr.readyState === 4 ) {
+
+							// Allow onerror to be called first,
+							// but that will not handle a native abort
+							// Also, save errorCallback to a variable
+							// as xhr.onerror cannot be accessed
+							window.setTimeout( function() {
+								if ( callback ) {
+									errorCallback();
+								}
+							} );
+						}
+					};
+				}
+
+				// Create the abort callback
+				callback = callback( "abort" );
+
+				try {
+
+					// Do send the request (this may raise an exception)
+					xhr.send( options.hasContent && options.data || null );
+				} catch ( e ) {
+
+					// #14683: Only rethrow if this hasn't been notified as an error yet
+					if ( callback ) {
+						throw e;
+					}
+				}
+			},
+
+			abort: function() {
+				if ( callback ) {
+					callback();
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+// Prevent auto-execution of scripts when no explicit dataType was provided (See gh-2432)
+jQuery.ajaxPrefilter( function( s ) {
+	if ( s.crossDomain ) {
+		s.contents.script = false;
+	}
+} );
+
+// Install script dataType
+jQuery.ajaxSetup( {
+	accepts: {
+		script: "text/javascript, application/javascript, " +
+			"application/ecmascript, application/x-ecmascript"
+	},
+	contents: {
+		script: /\b(?:java|ecma)script\b/
+	},
+	converters: {
+		"text script": function( text ) {
+			jQuery.globalEval( text );
+			return text;
+		}
+	}
+} );
+
+// Handle cache's special case and crossDomain
+jQuery.ajaxPrefilter( "script", function( s ) {
+	if ( s.cache === undefined ) {
+		s.cache = false;
+	}
+	if ( s.crossDomain ) {
+		s.type = "GET";
+	}
+} );
+
+// Bind script tag hack transport
+jQuery.ajaxTransport( "script", function( s ) {
+
+	// This transport only deals with cross domain or forced-by-attrs requests
+	if ( s.crossDomain || s.scriptAttrs ) {
+		var script, callback;
+		return {
+			send: function( _, complete ) {
+				script = jQuery( "<script>" )
+					.attr( s.scriptAttrs || {} )
+					.prop( { charset: s.scriptCharset, src: s.url } )
+					.on( "load error", callback = function( evt ) {
+						script.remove();
+						callback = null;
+						if ( evt ) {
+							complete( evt.type === "error" ? 404 : 200, evt.type );
+						}
+					} );
+
+				// Use native DOM manipulation to avoid our domManip AJAX trickery
+				document.head.appendChild( script[ 0 ] );
+			},
+			abort: function() {
+				if ( callback ) {
+					callback();
+				}
+			}
+		};
+	}
+} );
+
+
+
+
+var oldCallbacks = [],
+	rjsonp = /(=)\?(?=&|$)|\?\?/;
+
+// Default jsonp settings
+jQuery.ajaxSetup( {
+	jsonp: "callback",
+	jsonpCallback: function() {
+		var callback = oldCallbacks.pop() || ( jQuery.expando + "_" + ( nonce.guid++ ) );
+		this[ callback ] = true;
+		return callback;
+	}
+} );
+
+// Detect, normalize options and install callbacks for jsonp requests
+jQuery.ajaxPrefilter( "json jsonp", function( s, originalSettings, jqXHR ) {
+
+	var callbackName, overwritten, responseContainer,
+		jsonProp = s.jsonp !== false && ( rjsonp.test( s.url ) ?
+			"url" :
+			typeof s.data === "string" &&
+				( s.contentType || "" )
+					.indexOf( "application/x-www-form-urlencoded" ) === 0 &&
+				rjsonp.test( s.data ) && "data"
+		);
+
+	// Handle iff the expected data type is "jsonp" or we have a parameter to set
+	if ( jsonProp || s.dataTypes[ 0 ] === "jsonp" ) {
+
+		// Get callback name, remembering preexisting value associated with it
+		callbackName = s.jsonpCallback = isFunction( s.jsonpCallback ) ?
+			s.jsonpCallback() :
+			s.jsonpCallback;
+
+		// Insert callback into url or form data
+		if ( jsonProp ) {
+			s[ jsonProp ] = s[ jsonProp ].replace( rjsonp, "$1" + callbackName );
+		} else if ( s.jsonp !== false ) {
+			s.url += ( rquery.test( s.url ) ? "&" : "?" ) + s.jsonp + "=" + callbackName;
+		}
+
+		// Use data converter to retrieve json after script execution
+		s.converters[ "script json" ] = function() {
+			if ( !responseContainer ) {
+				jQuery.error( callbackName + " was not called" );
+			}
+			return responseContainer[ 0 ];
+		};
+
+		// Force json dataType
+		s.dataTypes[ 0 ] = "json";
+
+		// Install callback
+		overwritten = window[ callbackName ];
+		window[ callbackName ] = function() {
+			responseContainer = arguments;
+		};
+
+		// Clean-up function (fires after converters)
+		jqXHR.always( function() {
+
+			// If previous value didn't exist - remove it
+			if ( overwritten === undefined ) {
+				jQuery( window ).removeProp( callbackName );
+
+			// Otherwise restore preexisting value
+			} else {
+				window[ callbackName ] = overwritten;
+			}
+
+			// Save back as free
+			if ( s[ callbackName ] ) {
+
+				// Make sure that re-using the options doesn't screw things around
+				s.jsonpCallback = originalSettings.jsonpCallback;
+
+				// Save the callback name for future use
+				oldCallbacks.push( callbackName );
+			}
+
+			// Call if it was a function and we have a response
+			if ( responseContainer && isFunction( overwritten ) ) {
+				overwritten( responseContainer[ 0 ] );
+			}
+
+			responseContainer = overwritten = undefined;
+		} );
+
+		// Delegate to script
+		return "script";
+	}
+} );
+
+
+
+
+// Support: Safari 8 only
+// In Safari 8 documents created via document.implementation.createHTMLDocument
+// collapse sibling forms: the second one becomes a child of the first one.
+// Because of that, this security measure has to be disabled in Safari 8.
+// https://bugs.webkit.org/show_bug.cgi?id=137337
+support.createHTMLDocument = ( function() {
+	var body = document.implementation.createHTMLDocument( "" ).body;
+	body.innerHTML = "<form></form><form></form>";
+	return body.childNodes.length === 2;
+} )();
+
+
+// Argument "data" should be string of html
+// context (optional): If specified, the fragment will be created in this context,
+// defaults to document
+// keepScripts (optional): If true, will include scripts passed in the html string
+jQuery.parseHTML = function( data, context, keepScripts ) {
+	if ( typeof data !== "string" ) {
+		return [];
+	}
+	if ( typeof context === "boolean" ) {
+		keepScripts = context;
+		context = false;
+	}
+
+	var base, parsed, scripts;
+
+	if ( !context ) {
+
+		// Stop scripts or inline event handlers from being executed immediately
+		// by using document.implementation
+		if ( support.createHTMLDocument ) {
+			context = document.implementation.createHTMLDocument( "" );
+
+			// Set the base href for the created document
+			// so any parsed elements with URLs
+			// are based on the document's URL (gh-2965)
+			base = context.createElement( "base" );
+			base.href = document.location.href;
+			context.head.appendChild( base );
+		} else {
+			context = document;
+		}
+	}
+
+	parsed = rsingleTag.exec( data );
+	scripts = !keepScripts && [];
+
+	// Single tag
+	if ( parsed ) {
+		return [ context.createElement( parsed[ 1 ] ) ];
+	}
+
+	parsed = buildFragment( [ data ], context, scripts );
+
+	if ( scripts && scripts.length ) {
+		jQuery( scripts ).remove();
+	}
+
+	return jQuery.merge( [], parsed.childNodes );
+};
+
+
+/**
+ * Load a url into a page
+ */
+jQuery.fn.load = function( url, params, callback ) {
+	var selector, type, response,
+		self = this,
+		off = url.indexOf( " " );
+
+	if ( off > -1 ) {
+		selector = stripAndCollapse( url.slice( off ) );
+		url = url.slice( 0, off );
+	}
+
+	// If it's a function
+	if ( isFunction( params ) ) {
+
+		// We assume that it's the callback
+		callback = params;
+		params = undefined;
+
+	// Otherwise, build a param string
+	} else if ( params && typeof params === "object" ) {
+		type = "POST";
+	}
+
+	// If we have elements to modify, make the request
+	if ( self.length > 0 ) {
+		jQuery.ajax( {
+			url: url,
+
+			// If "type" variable is undefined, then "GET" method will be used.
+			// Make value of this field explicit since
+			// user can override it through ajaxSetup method
+			type: type || "GET",
+			dataType: "html",
+			data: params
+		} ).done( function( responseText ) {
+
+			// Save response for use in complete callback
+			response = arguments;
+
+			self.html( selector ?
+
+				// If a selector was specified, locate the right elements in a dummy div
+				// Exclude scripts to avoid IE 'Permission Denied' errors
+				jQuery( "<div>" ).append( jQuery.parseHTML( responseText ) ).find( selector ) :
+
+				// Otherwise use the full result
+				responseText );
+
+		// If the request succeeds, this function gets "data", "status", "jqXHR"
+		// but they are ignored because response was set above.
+		// If it fails, this function gets "jqXHR", "status", "error"
+		} ).always( callback && function( jqXHR, status ) {
+			self.each( function() {
+				callback.apply( this, response || [ jqXHR.responseText, status, jqXHR ] );
+			} );
+		} );
+	}
+
+	return this;
+};
+
+
+
+
+jQuery.expr.pseudos.animated = function( elem ) {
+	return jQuery.grep( jQuery.timers, function( fn ) {
+		return elem === fn.elem;
+	} ).length;
+};
+
+
+
+
+jQuery.offset = {
+	setOffset: function( elem, options, i ) {
+		var curPosition, curLeft, curCSSTop, curTop, curOffset, curCSSLeft, calculatePosition,
+			position = jQuery.css( elem, "position" ),
+			curElem = jQuery( elem ),
+			props = {};
+
+		// Set position first, in-case top/left are set even on static elem
+		if ( position === "static" ) {
+			elem.style.position = "relative";
+		}
+
+		curOffset = curElem.offset();
+		curCSSTop = jQuery.css( elem, "top" );
+		curCSSLeft = jQuery.css( elem, "left" );
+		calculatePosition = ( position === "absolute" || position === "fixed" ) &&
+			( curCSSTop + curCSSLeft ).indexOf( "auto" ) > -1;
+
+		// Need to be able to calculate position if either
+		// top or left is auto and position is either absolute or fixed
+		if ( calculatePosition ) {
+			curPosition = curElem.position();
+			curTop = curPosition.top;
+			curLeft = curPosition.left;
+
+		} else {
+			curTop = parseFloat( curCSSTop ) || 0;
+			curLeft = parseFloat( curCSSLeft ) || 0;
+		}
+
+		if ( isFunction( options ) ) {
+
+			// Use jQuery.extend here to allow modification of coordinates argument (gh-1848)
+			options = options.call( elem, i, jQuery.extend( {}, curOffset ) );
+		}
+
+		if ( options.top != null ) {
+			props.top = ( options.top - curOffset.top ) + curTop;
+		}
+		if ( options.left != null ) {
+			props.left = ( options.left - curOffset.left ) + curLeft;
+		}
+
+		if ( "using" in options ) {
+			options.using.call( elem, props );
+
+		} else {
+			if ( typeof props.top === "number" ) {
+				props.top += "px";
+			}
+			if ( typeof props.left === "number" ) {
+				props.left += "px";
+			}
+			curElem.css( props );
+		}
+	}
+};
+
+jQuery.fn.extend( {
+
+	// offset() relates an element's border box to the document origin
+	offset: function( options ) {
+
+		// Preserve chaining for setter
+		if ( arguments.length ) {
+			return options === undefined ?
+				this :
+				this.each( function( i ) {
+					jQuery.offset.setOffset( this, options, i );
+				} );
+		}
+
+		var rect, win,
+			elem = this[ 0 ];
+
+		if ( !elem ) {
+			return;
+		}
+
+		// Return zeros for disconnected and hidden (display: none) elements (gh-2310)
+		// Support: IE <=11 only
+		// Running getBoundingClientRect on a
+		// disconnected node in IE throws an error
+		if ( !elem.getClientRects().length ) {
+			return { top: 0, left: 0 };
+		}
+
+		// Get document-relative position by adding viewport scroll to viewport-relative gBCR
+		rect = elem.getBoundingClientRect();
+		win = elem.ownerDocument.defaultView;
+		return {
+			top: rect.top + win.pageYOffset,
+			left: rect.left + win.pageXOffset
+		};
+	},
+
+	// position() relates an element's margin box to its offset parent's padding box
+	// This corresponds to the behavior of CSS absolute positioning
+	position: function() {
+		if ( !this[ 0 ] ) {
+			return;
+		}
+
+		var offsetParent, offset, doc,
+			elem = this[ 0 ],
+			parentOffset = { top: 0, left: 0 };
+
+		// position:fixed elements are offset from the viewport, which itself always has zero offset
+		if ( jQuery.css( elem, "position" ) === "fixed" ) {
+
+			// Assume position:fixed implies availability of getBoundingClientRect
+			offset = elem.getBoundingClientRect();
+
+		} else {
+			offset = this.offset();
+
+			// Account for the *real* offset parent, which can be the document or its root element
+			// when a statically positioned element is identified
+			doc = elem.ownerDocument;
+			offsetParent = elem.offsetParent || doc.documentElement;
+			while ( offsetParent &&
+				( offsetParent === doc.body || offsetParent === doc.documentElement ) &&
+				jQuery.css( offsetParent, "position" ) === "static" ) {
+
+				offsetParent = offsetParent.parentNode;
+			}
+			if ( offsetParent && offsetParent !== elem && offsetParent.nodeType === 1 ) {
+
+				// Incorporate borders into its offset, since they are outside its content origin
+				parentOffset = jQuery( offsetParent ).offset();
+				parentOffset.top += jQuery.css( offsetParent, "borderTopWidth", true );
+				parentOffset.left += jQuery.css( offsetParent, "borderLeftWidth", true );
+			}
+		}
+
+		// Subtract parent offsets and element margins
+		return {
+			top: offset.top - parentOffset.top - jQuery.css( elem, "marginTop", true ),
+			left: offset.left - parentOffset.left - jQuery.css( elem, "marginLeft", true )
+		};
+	},
+
+	// This method will return documentElement in the following cases:
+	// 1) For the element inside the iframe without offsetParent, this method will return
+	//    documentElement of the parent window
+	// 2) For the hidden or detached element
+	// 3) For body or html element, i.e. in case of the html node - it will return itself
+	//
+	// but those exceptions were never presented as a real life use-cases
+	// and might be considered as more preferable results.
+	//
+	// This logic, however, is not guaranteed and can change at any point in the future
+	offsetParent: function() {
+		return this.map( function() {
+			var offsetParent = this.offsetParent;
+
+			while ( offsetParent && jQuery.css( offsetParent, "position" ) === "static" ) {
+				offsetParent = offsetParent.offsetParent;
+			}
+
+			return offsetParent || documentElement;
+		} );
+	}
+} );
+
+// Create scrollLeft and scrollTop methods
+jQuery.each( { scrollLeft: "pageXOffset", scrollTop: "pageYOffset" }, function( method, prop ) {
+	var top = "pageYOffset" === prop;
+
+	jQuery.fn[ method ] = function( val ) {
+		return access( this, function( elem, method, val ) {
+
+			// Coalesce documents and windows
+			var win;
+			if ( isWindow( elem ) ) {
+				win = elem;
+			} else if ( elem.nodeType === 9 ) {
+				win = elem.defaultView;
+			}
+
+			if ( val === undefined ) {
+				return win ? win[ prop ] : elem[ method ];
+			}
+
+			if ( win ) {
+				win.scrollTo(
+					!top ? val : win.pageXOffset,
+					top ? val : win.pageYOffset
+				);
+
+			} else {
+				elem[ method ] = val;
+			}
+		}, method, val, arguments.length );
+	};
+} );
+
+// Support: Safari <=7 - 9.1, Chrome <=37 - 49
+// Add the top/left cssHooks using jQuery.fn.position
+// Webkit bug: https://bugs.webkit.org/show_bug.cgi?id=29084
+// Blink bug: https://bugs.chromium.org/p/chromium/issues/detail?id=589347
+// getComputedStyle returns percent when specified for top/left/bottom/right;
+// rather than make the css module depend on the offset module, just check for it here
+jQuery.each( [ "top", "left" ], function( _i, prop ) {
+	jQuery.cssHooks[ prop ] = addGetHookIf( support.pixelPosition,
+		function( elem, computed ) {
+			if ( computed ) {
+				computed = curCSS( elem, prop );
+
+				// If curCSS returns percentage, fallback to offset
+				return rnumnonpx.test( computed ) ?
+					jQuery( elem ).position()[ prop ] + "px" :
+					computed;
+			}
+		}
+	);
+} );
+
+
+// Create innerHeight, innerWidth, height, width, outerHeight and outerWidth methods
+jQuery.each( { Height: "height", Width: "width" }, function( name, type ) {
+	jQuery.each( { padding: "inner" + name, content: type, "": "outer" + name },
+		function( defaultExtra, funcName ) {
+
+		// Margin is only for outerHeight, outerWidth
+		jQuery.fn[ funcName ] = function( margin, value ) {
+			var chainable = arguments.length && ( defaultExtra || typeof margin !== "boolean" ),
+				extra = defaultExtra || ( margin === true || value === true ? "margin" : "border" );
+
+			return access( this, function( elem, type, value ) {
+				var doc;
+
+				if ( isWindow( elem ) ) {
+
+					// $( window ).outerWidth/Height return w/h including scrollbars (gh-1729)
+					return funcName.indexOf( "outer" ) === 0 ?
+						elem[ "inner" + name ] :
+						elem.document.documentElement[ "client" + name ];
+				}
+
+				// Get document width or height
+				if ( elem.nodeType === 9 ) {
+					doc = elem.documentElement;
+
+					// Either scroll[Width/Height] or offset[Width/Height] or client[Width/Height],
+					// whichever is greatest
+					return Math.max(
+						elem.body[ "scroll" + name ], doc[ "scroll" + name ],
+						elem.body[ "offset" + name ], doc[ "offset" + name ],
+						doc[ "client" + name ]
+					);
+				}
+
+				return value === undefined ?
+
+					// Get width or height on the element, requesting but not forcing parseFloat
+					jQuery.css( elem, type, extra ) :
+
+					// Set width or height on the element
+					jQuery.style( elem, type, value, extra );
+			}, type, chainable ? margin : undefined, chainable );
+		};
+	} );
+} );
+
+
+jQuery.each( [
+	"ajaxStart",
+	"ajaxStop",
+	"ajaxComplete",
+	"ajaxError",
+	"ajaxSuccess",
+	"ajaxSend"
+], function( _i, type ) {
+	jQuery.fn[ type ] = function( fn ) {
+		return this.on( type, fn );
+	};
+} );
+
+
+
+
+jQuery.fn.extend( {
+
+	bind: function( types, data, fn ) {
+		return this.on( types, null, data, fn );
+	},
+	unbind: function( types, fn ) {
+		return this.off( types, null, fn );
+	},
+
+	delegate: function( selector, types, data, fn ) {
+		return this.on( types, selector, data, fn );
+	},
+	undelegate: function( selector, types, fn ) {
+
+		// ( namespace ) or ( selector, types [, fn] )
+		return arguments.length === 1 ?
+			this.off( selector, "**" ) :
+			this.off( types, selector || "**", fn );
+	},
+
+	hover: function( fnOver, fnOut ) {
+		return this.mouseenter( fnOver ).mouseleave( fnOut || fnOver );
+	}
+} );
+
+jQuery.each( ( "blur focus focusin focusout resize scroll click dblclick " +
+	"mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave " +
+	"change select submit keydown keypress keyup contextmenu" ).split( " " ),
+	function( _i, name ) {
+
+		// Handle event binding
+		jQuery.fn[ name ] = function( data, fn ) {
+			return arguments.length > 0 ?
+				this.on( name, null, data, fn ) :
+				this.trigger( name );
+		};
+	} );
+
+
+
+
+// Support: Android <=4.0 only
+// Make sure we trim BOM and NBSP
+var rtrim = /^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;
+
+// Bind a function to a context, optionally partially applying any
+// arguments.
+// jQuery.proxy is deprecated to promote standards (specifically Function#bind)
+// However, it is not slated for removal any time soon
+jQuery.proxy = function( fn, context ) {
+	var tmp, args, proxy;
+
+	if ( typeof context === "string" ) {
+		tmp = fn[ context ];
+		context = fn;
+		fn = tmp;
+	}
+
+	// Quick check to determine if target is callable, in the spec
+	// this throws a TypeError, but we will just return undefined.
+	if ( !isFunction( fn ) ) {
+		return undefined;
+	}
+
+	// Simulated bind
+	args = slice.call( arguments, 2 );
+	proxy = function() {
+		return fn.apply( context || this, args.concat( slice.call( arguments ) ) );
+	};
+
+	// Set the guid of unique handler to the same of original handler, so it can be removed
+	proxy.guid = fn.guid = fn.guid || jQuery.guid++;
+
+	return proxy;
+};
+
+jQuery.holdReady = function( hold ) {
+	if ( hold ) {
+		jQuery.readyWait++;
+	} else {
+		jQuery.ready( true );
+	}
+};
+jQuery.isArray = Array.isArray;
+jQuery.parseJSON = JSON.parse;
+jQuery.nodeName = nodeName;
+jQuery.isFunction = isFunction;
+jQuery.isWindow = isWindow;
+jQuery.camelCase = camelCase;
+jQuery.type = toType;
+
+jQuery.now = Date.now;
+
+jQuery.isNumeric = function( obj ) {
+
+	// As of jQuery 3.0, isNumeric is limited to
+	// strings and numbers (primitives or objects)
+	// that can be coerced to finite numbers (gh-2662)
+	var type = jQuery.type( obj );
+	return ( type === "number" || type === "string" ) &&
+
+		// parseFloat NaNs numeric-cast false positives ("")
+		// ...but misinterprets leading-number strings, particularly hex literals ("0x...")
+		// subtraction forces infinities to NaN
+		!isNaN( obj - parseFloat( obj ) );
+};
+
+jQuery.trim = function( text ) {
+	return text == null ?
+		"" :
+		( text + "" ).replace( rtrim, "" );
+};
+
+
+
+// Register as a named AMD module, since jQuery can be concatenated with other
+// files that may use define, but not via a proper concatenation script that
+// understands anonymous AMD modules. A named AMD is safest and most robust
+// way to register. Lowercase jquery is used because AMD module names are
+// derived from file names, and jQuery is normally delivered in a lowercase
+// file name. Do this after creating the global so that if an AMD module wants
+// to call noConflict to hide this version of jQuery, it will work.
+
+// Note that for maximum portability, libraries that are not jQuery should
+// declare themselves as anonymous modules, and avoid setting a global if an
+// AMD loader is present. jQuery is a special case. For more information, see
+// https://github.com/jrburke/requirejs/wiki/Updating-existing-libraries#wiki-anon
+
+if ( typeof define === "function" && define.amd ) {
+	define( "jquery", [], function() {
+		return jQuery;
+	} );
+}
+
+
+
+
+var
+
+	// Map over jQuery in case of overwrite
+	_jQuery = window.jQuery,
+
+	// Map over the $ in case of overwrite
+	_$ = window.$;
+
+jQuery.noConflict = function( deep ) {
+	if ( window.$ === jQuery ) {
+		window.$ = _$;
+	}
+
+	if ( deep && window.jQuery === jQuery ) {
+		window.jQuery = _jQuery;
+	}
+
+	return jQuery;
+};
+
+// Expose jQuery and $ identifiers, even in AMD
+// (#7102#comment:10, https://github.com/jquery/jquery/pull/557)
+// and CommonJS for browser emulators (#13566)
+if ( typeof noGlobal === "undefined" ) {
+	window.jQuery = window.$ = jQuery;
+}
+
+
+
+
+return jQuery;
+} );
 jQuery.noConflict();
\ No newline at end of file
diff --git a/wp-includes/js/jquery/jquery.min.js b/wp-includes/js/jquery/jquery.min.js
new file mode 100644
index 0000000000..91e3fbc393
--- /dev/null
+++ b/wp-includes/js/jquery/jquery.min.js
@@ -0,0 +1,3 @@
+/*! jQuery v3.5.1 | (c) JS Foundation and other contributors | jquery.org/license */
+!function(e,t){"use strict";"object"==typeof module&&"object"==typeof module.exports?module.exports=e.document?t(e,!0):function(e){if(!e.document)throw new Error("jQuery requires a window with a document");return t(e)}:t(e)}("undefined"!=typeof window?window:this,function(C,e){"use strict";var t=[],r=Object.getPrototypeOf,s=t.slice,g=t.flat?function(e){return t.flat.call(e)}:function(e){return t.concat.apply([],e)},u=t.push,i=t.indexOf,n={},o=n.toString,v=n.hasOwnProperty,a=v.toString,l=a.call(Object),y={},m=function(e){return"function"==typeof e&&"number"!=typeof e.nodeType},x=function(e){return null!=e&&e===e.window},E=C.document,c={type:!0,src:!0,nonce:!0,noModule:!0};function b(e,t,n){var r,i,o=(n=n||E).createElement("script");if(o.text=e,t)for(r in c)(i=t[r]||t.getAttribute&&t.getAttribute(r))&&o.setAttribute(r,i);n.head.appendChild(o).parentNode.removeChild(o)}function w(e){return null==e?e+"":"object"==typeof e||"function"==typeof e?n[o.call(e)]||"object":typeof e}var f="3.5.1",S=function(e,t){return new S.fn.init(e,t)};function p(e){var t=!!e&&"length"in e&&e.length,n=w(e);return!m(e)&&!x(e)&&("array"===n||0===t||"number"==typeof t&&0<t&&t-1 in e)}S.fn=S.prototype={jquery:f,constructor:S,length:0,toArray:function(){return s.call(this)},get:function(e){return null==e?s.call(this):e<0?this[e+this.length]:this[e]},pushStack:function(e){var t=S.merge(this.constructor(),e);return t.prevObject=this,t},each:function(e){return S.each(this,e)},map:function(n){return this.pushStack(S.map(this,function(e,t){return n.call(e,t,e)}))},slice:function(){return this.pushStack(s.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},even:function(){return this.pushStack(S.grep(this,function(e,t){return(t+1)%2}))},odd:function(){return this.pushStack(S.grep(this,function(e,t){return t%2}))},eq:function(e){var t=this.length,n=+e+(e<0?t:0);return this.pushStack(0<=n&&n<t?[this[n]]:[])},end:function(){return this.prevObject||this.constructor()},push:u,sort:t.sort,splice:t.splice},S.extend=S.fn.extend=function(){var e,t,n,r,i,o,a=arguments[0]||{},s=1,u=arguments.length,l=!1;for("boolean"==typeof a&&(l=a,a=arguments[s]||{},s++),"object"==typeof a||m(a)||(a={}),s===u&&(a=this,s--);s<u;s++)if(null!=(e=arguments[s]))for(t in e)r=e[t],"__proto__"!==t&&a!==r&&(l&&r&&(S.isPlainObject(r)||(i=Array.isArray(r)))?(n=a[t],o=i&&!Array.isArray(n)?[]:i||S.isPlainObject(n)?n:{},i=!1,a[t]=S.extend(l,o,r)):void 0!==r&&(a[t]=r));return a},S.extend({expando:"jQuery"+(f+Math.random()).replace(/\D/g,""),isReady:!0,error:function(e){throw new Error(e)},noop:function(){},isPlainObject:function(e){var t,n;return!(!e||"[object Object]"!==o.call(e))&&(!(t=r(e))||"function"==typeof(n=v.call(t,"constructor")&&t.constructor)&&a.call(n)===l)},isEmptyObject:function(e){var t;for(t in e)return!1;return!0},globalEval:function(e,t,n){b(e,{nonce:t&&t.nonce},n)},each:function(e,t){var n,r=0;if(p(e)){for(n=e.length;r<n;r++)if(!1===t.call(e[r],r,e[r]))break}else for(r in e)if(!1===t.call(e[r],r,e[r]))break;return e},makeArray:function(e,t){var n=t||[];return null!=e&&(p(Object(e))?S.merge(n,"string"==typeof e?[e]:e):u.call(n,e)),n},inArray:function(e,t,n){return null==t?-1:i.call(t,e,n)},merge:function(e,t){for(var n=+t.length,r=0,i=e.length;r<n;r++)e[i++]=t[r];return e.length=i,e},grep:function(e,t,n){for(var r=[],i=0,o=e.length,a=!n;i<o;i++)!t(e[i],i)!==a&&r.push(e[i]);return r},map:function(e,t,n){var r,i,o=0,a=[];if(p(e))for(r=e.length;o<r;o++)null!=(i=t(e[o],o,n))&&a.push(i);else for(o in e)null!=(i=t(e[o],o,n))&&a.push(i);return g(a)},guid:1,support:y}),"function"==typeof Symbol&&(S.fn[Symbol.iterator]=t[Symbol.iterator]),S.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(e,t){n["[object "+t+"]"]=t.toLowerCase()});var d=function(n){var e,d,b,o,i,h,f,g,w,u,l,T,C,a,E,v,s,c,y,S="sizzle"+1*new Date,p=n.document,k=0,r=0,m=ue(),x=ue(),A=ue(),N=ue(),D=function(e,t){return e===t&&(l=!0),0},j={}.hasOwnProperty,t=[],q=t.pop,L=t.push,H=t.push,O=t.slice,P=function(e,t){for(var n=0,r=e.length;n<r;n++)if(e[n]===t)return n;return-1},R="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",M="[\\x20\\t\\r\\n\\f]",I="(?:\\\\[\\da-fA-F]{1,6}"+M+"?|\\\\[^\\r\\n\\f]|[\\w-]|[^\0-\\x7f])+",W="\\["+M+"*("+I+")(?:"+M+"*([*^$|!~]?=)"+M+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+I+"))|)"+M+"*\\]",F=":("+I+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+W+")*)|.*)\\)|)",B=new RegExp(M+"+","g"),$=new RegExp("^"+M+"+|((?:^|[^\\\\])(?:\\\\.)*)"+M+"+$","g"),_=new RegExp("^"+M+"*,"+M+"*"),z=new RegExp("^"+M+"*([>+~]|"+M+")"+M+"*"),U=new RegExp(M+"|>"),X=new RegExp(F),V=new RegExp("^"+I+"$"),G={ID:new RegExp("^#("+I+")"),CLASS:new RegExp("^\\.("+I+")"),TAG:new RegExp("^("+I+"|[*])"),ATTR:new RegExp("^"+W),PSEUDO:new RegExp("^"+F),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+M+"*(even|odd|(([+-]|)(\\d*)n|)"+M+"*(?:([+-]|)"+M+"*(\\d+)|))"+M+"*\\)|)","i"),bool:new RegExp("^(?:"+R+")$","i"),needsContext:new RegExp("^"+M+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+M+"*((?:-\\d)?\\d*)"+M+"*\\)|)(?=[^-]|$)","i")},Y=/HTML$/i,Q=/^(?:input|select|textarea|button)$/i,J=/^h\d$/i,K=/^[^{]+\{\s*\[native \w/,Z=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,ee=/[+~]/,te=new RegExp("\\\\[\\da-fA-F]{1,6}"+M+"?|\\\\([^\\r\\n\\f])","g"),ne=function(e,t){var n="0x"+e.slice(1)-65536;return t||(n<0?String.fromCharCode(n+65536):String.fromCharCode(n>>10|55296,1023&n|56320))},re=/([\0-\x1f\x7f]|^-?\d)|^-$|[^\0-\x1f\x7f-\uFFFF\w-]/g,ie=function(e,t){return t?"\0"===e?"\ufffd":e.slice(0,-1)+"\\"+e.charCodeAt(e.length-1).toString(16)+" ":"\\"+e},oe=function(){T()},ae=be(function(e){return!0===e.disabled&&"fieldset"===e.nodeName.toLowerCase()},{dir:"parentNode",next:"legend"});try{H.apply(t=O.call(p.childNodes),p.childNodes),t[p.childNodes.length].nodeType}catch(e){H={apply:t.length?function(e,t){L.apply(e,O.call(t))}:function(e,t){var n=e.length,r=0;while(e[n++]=t[r++]);e.length=n-1}}}function se(t,e,n,r){var i,o,a,s,u,l,c,f=e&&e.ownerDocument,p=e?e.nodeType:9;if(n=n||[],"string"!=typeof t||!t||1!==p&&9!==p&&11!==p)return n;if(!r&&(T(e),e=e||C,E)){if(11!==p&&(u=Z.exec(t)))if(i=u[1]){if(9===p){if(!(a=e.getElementById(i)))return n;if(a.id===i)return n.push(a),n}else if(f&&(a=f.getElementById(i))&&y(e,a)&&a.id===i)return n.push(a),n}else{if(u[2])return H.apply(n,e.getElementsByTagName(t)),n;if((i=u[3])&&d.getElementsByClassName&&e.getElementsByClassName)return H.apply(n,e.getElementsByClassName(i)),n}if(d.qsa&&!N[t+" "]&&(!v||!v.test(t))&&(1!==p||"object"!==e.nodeName.toLowerCase())){if(c=t,f=e,1===p&&(U.test(t)||z.test(t))){(f=ee.test(t)&&ye(e.parentNode)||e)===e&&d.scope||((s=e.getAttribute("id"))?s=s.replace(re,ie):e.setAttribute("id",s=S)),o=(l=h(t)).length;while(o--)l[o]=(s?"#"+s:":scope")+" "+xe(l[o]);c=l.join(",")}try{return H.apply(n,f.querySelectorAll(c)),n}catch(e){N(t,!0)}finally{s===S&&e.removeAttribute("id")}}}return g(t.replace($,"$1"),e,n,r)}function ue(){var r=[];return function e(t,n){return r.push(t+" ")>b.cacheLength&&delete e[r.shift()],e[t+" "]=n}}function le(e){return e[S]=!0,e}function ce(e){var t=C.createElement("fieldset");try{return!!e(t)}catch(e){return!1}finally{t.parentNode&&t.parentNode.removeChild(t),t=null}}function fe(e,t){var n=e.split("|"),r=n.length;while(r--)b.attrHandle[n[r]]=t}function pe(e,t){var n=t&&e,r=n&&1===e.nodeType&&1===t.nodeType&&e.sourceIndex-t.sourceIndex;if(r)return r;if(n)while(n=n.nextSibling)if(n===t)return-1;return e?1:-1}function de(t){return function(e){return"input"===e.nodeName.toLowerCase()&&e.type===t}}function he(n){return function(e){var t=e.nodeName.toLowerCase();return("input"===t||"button"===t)&&e.type===n}}function ge(t){return function(e){return"form"in e?e.parentNode&&!1===e.disabled?"label"in e?"label"in e.parentNode?e.parentNode.disabled===t:e.disabled===t:e.isDisabled===t||e.isDisabled!==!t&&ae(e)===t:e.disabled===t:"label"in e&&e.disabled===t}}function ve(a){return le(function(o){return o=+o,le(function(e,t){var n,r=a([],e.length,o),i=r.length;while(i--)e[n=r[i]]&&(e[n]=!(t[n]=e[n]))})})}function ye(e){return e&&"undefined"!=typeof e.getElementsByTagName&&e}for(e in d=se.support={},i=se.isXML=function(e){var t=e.namespaceURI,n=(e.ownerDocument||e).documentElement;return!Y.test(t||n&&n.nodeName||"HTML")},T=se.setDocument=function(e){var t,n,r=e?e.ownerDocument||e:p;return r!=C&&9===r.nodeType&&r.documentElement&&(a=(C=r).documentElement,E=!i(C),p!=C&&(n=C.defaultView)&&n.top!==n&&(n.addEventListener?n.addEventListener("unload",oe,!1):n.attachEvent&&n.attachEvent("onunload",oe)),d.scope=ce(function(e){return a.appendChild(e).appendChild(C.createElement("div")),"undefined"!=typeof e.querySelectorAll&&!e.querySelectorAll(":scope fieldset div").length}),d.attributes=ce(function(e){return e.className="i",!e.getAttribute("className")}),d.getElementsByTagName=ce(function(e){return e.appendChild(C.createComment("")),!e.getElementsByTagName("*").length}),d.getElementsByClassName=K.test(C.getElementsByClassName),d.getById=ce(function(e){return a.appendChild(e).id=S,!C.getElementsByName||!C.getElementsByName(S).length}),d.getById?(b.filter.ID=function(e){var t=e.replace(te,ne);return function(e){return e.getAttribute("id")===t}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n=t.getElementById(e);return n?[n]:[]}}):(b.filter.ID=function(e){var n=e.replace(te,ne);return function(e){var t="undefined"!=typeof e.getAttributeNode&&e.getAttributeNode("id");return t&&t.value===n}},b.find.ID=function(e,t){if("undefined"!=typeof t.getElementById&&E){var n,r,i,o=t.getElementById(e);if(o){if((n=o.getAttributeNode("id"))&&n.value===e)return[o];i=t.getElementsByName(e),r=0;while(o=i[r++])if((n=o.getAttributeNode("id"))&&n.value===e)return[o]}return[]}}),b.find.TAG=d.getElementsByTagName?function(e,t){return"undefined"!=typeof t.getElementsByTagName?t.getElementsByTagName(e):d.qsa?t.querySelectorAll(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){while(n=o[i++])1===n.nodeType&&r.push(n);return r}return o},b.find.CLASS=d.getElementsByClassName&&function(e,t){if("undefined"!=typeof t.getElementsByClassName&&E)return t.getElementsByClassName(e)},s=[],v=[],(d.qsa=K.test(C.querySelectorAll))&&(ce(function(e){var t;a.appendChild(e).innerHTML="<a id='"+S+"'></a><select id='"+S+"-\r\\' msallowcapture=''><option selected=''></option></select>",e.querySelectorAll("[msallowcapture^='']").length&&v.push("[*^$]="+M+"*(?:''|\"\")"),e.querySelectorAll("[selected]").length||v.push("\\["+M+"*(?:value|"+R+")"),e.querySelectorAll("[id~="+S+"-]").length||v.push("~="),(t=C.createElement("input")).setAttribute("name",""),e.appendChild(t),e.querySelectorAll("[name='']").length||v.push("\\["+M+"*name"+M+"*="+M+"*(?:''|\"\")"),e.querySelectorAll(":checked").length||v.push(":checked"),e.querySelectorAll("a#"+S+"+*").length||v.push(".#.+[+~]"),e.querySelectorAll("\\\f"),v.push("[\\r\\n\\f]")}),ce(function(e){e.innerHTML="<a href='' disabled='disabled'></a><select disabled='disabled'><option/></select>";var t=C.createElement("input");t.setAttribute("type","hidden"),e.appendChild(t).setAttribute("name","D"),e.querySelectorAll("[name=d]").length&&v.push("name"+M+"*[*^$|!~]?="),2!==e.querySelectorAll(":enabled").length&&v.push(":enabled",":disabled"),a.appendChild(e).disabled=!0,2!==e.querySelectorAll(":disabled").length&&v.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),v.push(",.*:")})),(d.matchesSelector=K.test(c=a.matches||a.webkitMatchesSelector||a.mozMatchesSelector||a.oMatchesSelector||a.msMatchesSelector))&&ce(function(e){d.disconnectedMatch=c.call(e,"*"),c.call(e,"[s!='']:x"),s.push("!=",F)}),v=v.length&&new RegExp(v.join("|")),s=s.length&&new RegExp(s.join("|")),t=K.test(a.compareDocumentPosition),y=t||K.test(a.contains)?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)while(t=t.parentNode)if(t===e)return!0;return!1},D=t?function(e,t){if(e===t)return l=!0,0;var n=!e.compareDocumentPosition-!t.compareDocumentPosition;return n||(1&(n=(e.ownerDocument||e)==(t.ownerDocument||t)?e.compareDocumentPosition(t):1)||!d.sortDetached&&t.compareDocumentPosition(e)===n?e==C||e.ownerDocument==p&&y(p,e)?-1:t==C||t.ownerDocument==p&&y(p,t)?1:u?P(u,e)-P(u,t):0:4&n?-1:1)}:function(e,t){if(e===t)return l=!0,0;var n,r=0,i=e.parentNode,o=t.parentNode,a=[e],s=[t];if(!i||!o)return e==C?-1:t==C?1:i?-1:o?1:u?P(u,e)-P(u,t):0;if(i===o)return pe(e,t);n=e;while(n=n.parentNode)a.unshift(n);n=t;while(n=n.parentNode)s.unshift(n);while(a[r]===s[r])r++;return r?pe(a[r],s[r]):a[r]==p?-1:s[r]==p?1:0}),C},se.matches=function(e,t){return se(e,null,null,t)},se.matchesSelector=function(e,t){if(T(e),d.matchesSelector&&E&&!N[t+" "]&&(!s||!s.test(t))&&(!v||!v.test(t)))try{var n=c.call(e,t);if(n||d.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(e){N(t,!0)}return 0<se(t,C,null,[e]).length},se.contains=function(e,t){return(e.ownerDocument||e)!=C&&T(e),y(e,t)},se.attr=function(e,t){(e.ownerDocument||e)!=C&&T(e);var n=b.attrHandle[t.toLowerCase()],r=n&&j.call(b.attrHandle,t.toLowerCase())?n(e,t,!E):void 0;return void 0!==r?r:d.attributes||!E?e.getAttribute(t):(r=e.getAttributeNode(t))&&r.specified?r.value:null},se.escape=function(e){return(e+"").replace(re,ie)},se.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},se.uniqueSort=function(e){var t,n=[],r=0,i=0;if(l=!d.detectDuplicates,u=!d.sortStable&&e.slice(0),e.sort(D),l){while(t=e[i++])t===e[i]&&(r=n.push(i));while(r--)e.splice(n[r],1)}return u=null,e},o=se.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=o(e)}else if(3===i||4===i)return e.nodeValue}else while(t=e[r++])n+=o(t);return n},(b=se.selectors={cacheLength:50,createPseudo:le,match:G,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(te,ne),e[3]=(e[3]||e[4]||e[5]||"").replace(te,ne),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||se.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&se.error(e[0]),e},PSEUDO:function(e){var t,n=!e[6]&&e[2];return G.CHILD.test(e[0])?null:(e[3]?e[2]=e[4]||e[5]||"":n&&X.test(n)&&(t=h(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){var t=e.replace(te,ne).toLowerCase();return"*"===e?function(){return!0}:function(e){return e.nodeName&&e.nodeName.toLowerCase()===t}},CLASS:function(e){var t=m[e+" "];return t||(t=new RegExp("(^|"+M+")"+e+"("+M+"|$)"))&&m(e,function(e){return t.test("string"==typeof e.className&&e.className||"undefined"!=typeof e.getAttribute&&e.getAttribute("class")||"")})},ATTR:function(n,r,i){return function(e){var t=se.attr(e,n);return null==t?"!="===r:!r||(t+="","="===r?t===i:"!="===r?t!==i:"^="===r?i&&0===t.indexOf(i):"*="===r?i&&-1<t.indexOf(i):"$="===r?i&&t.slice(-i.length)===i:"~="===r?-1<(" "+t.replace(B," ")+" ").indexOf(i):"|="===r&&(t===i||t.slice(0,i.length+1)===i+"-"))}},CHILD:function(h,e,t,g,v){var y="nth"!==h.slice(0,3),m="last"!==h.slice(-4),x="of-type"===e;return 1===g&&0===v?function(e){return!!e.parentNode}:function(e,t,n){var r,i,o,a,s,u,l=y!==m?"nextSibling":"previousSibling",c=e.parentNode,f=x&&e.nodeName.toLowerCase(),p=!n&&!x,d=!1;if(c){if(y){while(l){a=e;while(a=a[l])if(x?a.nodeName.toLowerCase()===f:1===a.nodeType)return!1;u=l="only"===h&&!u&&"nextSibling"}return!0}if(u=[m?c.firstChild:c.lastChild],m&&p){d=(s=(r=(i=(o=(a=c)[S]||(a[S]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]||[])[0]===k&&r[1])&&r[2],a=s&&c.childNodes[s];while(a=++s&&a&&a[l]||(d=s=0)||u.pop())if(1===a.nodeType&&++d&&a===e){i[h]=[k,s,d];break}}else if(p&&(d=s=(r=(i=(o=(a=e)[S]||(a[S]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]||[])[0]===k&&r[1]),!1===d)while(a=++s&&a&&a[l]||(d=s=0)||u.pop())if((x?a.nodeName.toLowerCase()===f:1===a.nodeType)&&++d&&(p&&((i=(o=a[S]||(a[S]={}))[a.uniqueID]||(o[a.uniqueID]={}))[h]=[k,d]),a===e))break;return(d-=v)===g||d%g==0&&0<=d/g}}},PSEUDO:function(e,o){var t,a=b.pseudos[e]||b.setFilters[e.toLowerCase()]||se.error("unsupported pseudo: "+e);return a[S]?a(o):1<a.length?(t=[e,e,"",o],b.setFilters.hasOwnProperty(e.toLowerCase())?le(function(e,t){var n,r=a(e,o),i=r.length;while(i--)e[n=P(e,r[i])]=!(t[n]=r[i])}):function(e){return a(e,0,t)}):a}},pseudos:{not:le(function(e){var r=[],i=[],s=f(e.replace($,"$1"));return s[S]?le(function(e,t,n,r){var i,o=s(e,null,r,[]),a=e.length;while(a--)(i=o[a])&&(e[a]=!(t[a]=i))}):function(e,t,n){return r[0]=e,s(r,null,n,i),r[0]=null,!i.pop()}}),has:le(function(t){return function(e){return 0<se(t,e).length}}),contains:le(function(t){return t=t.replace(te,ne),function(e){return-1<(e.textContent||o(e)).indexOf(t)}}),lang:le(function(n){return V.test(n||"")||se.error("unsupported lang: "+n),n=n.replace(te,ne).toLowerCase(),function(e){var t;do{if(t=E?e.lang:e.getAttribute("xml:lang")||e.getAttribute("lang"))return(t=t.toLowerCase())===n||0===t.indexOf(n+"-")}while((e=e.parentNode)&&1===e.nodeType);return!1}}),target:function(e){var t=n.location&&n.location.hash;return t&&t.slice(1)===e.id},root:function(e){return e===a},focus:function(e){return e===C.activeElement&&(!C.hasFocus||C.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:ge(!1),disabled:ge(!0),checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,!0===e.selected},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeType<6)return!1;return!0},parent:function(e){return!b.pseudos.empty(e)},header:function(e){return J.test(e.nodeName)},input:function(e){return Q.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||"text"===t.toLowerCase())},first:ve(function(){return[0]}),last:ve(function(e,t){return[t-1]}),eq:ve(function(e,t,n){return[n<0?n+t:n]}),even:ve(function(e,t){for(var n=0;n<t;n+=2)e.push(n);return e}),odd:ve(function(e,t){for(var n=1;n<t;n+=2)e.push(n);return e}),lt:ve(function(e,t,n){for(var r=n<0?n+t:t<n?t:n;0<=--r;)e.push(r);return e}),gt:ve(function(e,t,n){for(var r=n<0?n+t:n;++r<t;)e.push(r);return e})}}).pseudos.nth=b.pseudos.eq,{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})b.pseudos[e]=de(e);for(e in{submit:!0,reset:!0})b.pseudos[e]=he(e);function me(){}function xe(e){for(var t=0,n=e.length,r="";t<n;t++)r+=e[t].value;return r}function be(s,e,t){var u=e.dir,l=e.next,c=l||u,f=t&&"parentNode"===c,p=r++;return e.first?function(e,t,n){while(e=e[u])if(1===e.nodeType||f)return s(e,t,n);return!1}:function(e,t,n){var r,i,o,a=[k,p];if(n){while(e=e[u])if((1===e.nodeType||f)&&s(e,t,n))return!0}else while(e=e[u])if(1===e.nodeType||f)if(i=(o=e[S]||(e[S]={}))[e.uniqueID]||(o[e.uniqueID]={}),l&&l===e.nodeName.toLowerCase())e=e[u]||e;else{if((r=i[c])&&r[0]===k&&r[1]===p)return a[2]=r[2];if((i[c]=a)[2]=s(e,t,n))return!0}return!1}}function we(i){return 1<i.length?function(e,t,n){var r=i.length;while(r--)if(!i[r](e,t,n))return!1;return!0}:i[0]}function Te(e,t,n,r,i){for(var o,a=[],s=0,u=e.length,l=null!=t;s<u;s++)(o=e[s])&&(n&&!n(o,r,i)||(a.push(o),l&&t.push(s)));return a}function Ce(d,h,g,v,y,e){return v&&!v[S]&&(v=Ce(v)),y&&!y[S]&&(y=Ce(y,e)),le(function(e,t,n,r){var i,o,a,s=[],u=[],l=t.length,c=e||function(e,t,n){for(var r=0,i=t.length;r<i;r++)se(e,t[r],n);return n}(h||"*",n.nodeType?[n]:n,[]),f=!d||!e&&h?c:Te(c,s,d,n,r),p=g?y||(e?d:l||v)?[]:t:f;if(g&&g(f,p,n,r),v){i=Te(p,u),v(i,[],n,r),o=i.length;while(o--)(a=i[o])&&(p[u[o]]=!(f[u[o]]=a))}if(e){if(y||d){if(y){i=[],o=p.length;while(o--)(a=p[o])&&i.push(f[o]=a);y(null,p=[],i,r)}o=p.length;while(o--)(a=p[o])&&-1<(i=y?P(e,a):s[o])&&(e[i]=!(t[i]=a))}}else p=Te(p===t?p.splice(l,p.length):p),y?y(null,t,p,r):H.apply(t,p)})}function Ee(e){for(var i,t,n,r=e.length,o=b.relative[e[0].type],a=o||b.relative[" "],s=o?1:0,u=be(function(e){return e===i},a,!0),l=be(function(e){return-1<P(i,e)},a,!0),c=[function(e,t,n){var r=!o&&(n||t!==w)||((i=t).nodeType?u(e,t,n):l(e,t,n));return i=null,r}];s<r;s++)if(t=b.relative[e[s].type])c=[be(we(c),t)];else{if((t=b.filter[e[s].type].apply(null,e[s].matches))[S]){for(n=++s;n<r;n++)if(b.relative[e[n].type])break;return Ce(1<s&&we(c),1<s&&xe(e.slice(0,s-1).concat({value:" "===e[s-2].type?"*":""})).replace($,"$1"),t,s<n&&Ee(e.slice(s,n)),n<r&&Ee(e=e.slice(n)),n<r&&xe(e))}c.push(t)}return we(c)}return me.prototype=b.filters=b.pseudos,b.setFilters=new me,h=se.tokenize=function(e,t){var n,r,i,o,a,s,u,l=x[e+" "];if(l)return t?0:l.slice(0);a=e,s=[],u=b.preFilter;while(a){for(o in n&&!(r=_.exec(a))||(r&&(a=a.slice(r[0].length)||a),s.push(i=[])),n=!1,(r=z.exec(a))&&(n=r.shift(),i.push({value:n,type:r[0].replace($," ")}),a=a.slice(n.length)),b.filter)!(r=G[o].exec(a))||u[o]&&!(r=u[o](r))||(n=r.shift(),i.push({value:n,type:o,matches:r}),a=a.slice(n.length));if(!n)break}return t?a.length:a?se.error(e):x(e,s).slice(0)},f=se.compile=function(e,t){var n,v,y,m,x,r,i=[],o=[],a=A[e+" "];if(!a){t||(t=h(e)),n=t.length;while(n--)(a=Ee(t[n]))[S]?i.push(a):o.push(a);(a=A(e,(v=o,m=0<(y=i).length,x=0<v.length,r=function(e,t,n,r,i){var o,a,s,u=0,l="0",c=e&&[],f=[],p=w,d=e||x&&b.find.TAG("*",i),h=k+=null==p?1:Math.random()||.1,g=d.length;for(i&&(w=t==C||t||i);l!==g&&null!=(o=d[l]);l++){if(x&&o){a=0,t||o.ownerDocument==C||(T(o),n=!E);while(s=v[a++])if(s(o,t||C,n)){r.push(o);break}i&&(k=h)}m&&((o=!s&&o)&&u--,e&&c.push(o))}if(u+=l,m&&l!==u){a=0;while(s=y[a++])s(c,f,t,n);if(e){if(0<u)while(l--)c[l]||f[l]||(f[l]=q.call(r));f=Te(f)}H.apply(r,f),i&&!e&&0<f.length&&1<u+y.length&&se.uniqueSort(r)}return i&&(k=h,w=p),c},m?le(r):r))).selector=e}return a},g=se.select=function(e,t,n,r){var i,o,a,s,u,l="function"==typeof e&&e,c=!r&&h(e=l.selector||e);if(n=n||[],1===c.length){if(2<(o=c[0]=c[0].slice(0)).length&&"ID"===(a=o[0]).type&&9===t.nodeType&&E&&b.relative[o[1].type]){if(!(t=(b.find.ID(a.matches[0].replace(te,ne),t)||[])[0]))return n;l&&(t=t.parentNode),e=e.slice(o.shift().value.length)}i=G.needsContext.test(e)?0:o.length;while(i--){if(a=o[i],b.relative[s=a.type])break;if((u=b.find[s])&&(r=u(a.matches[0].replace(te,ne),ee.test(o[0].type)&&ye(t.parentNode)||t))){if(o.splice(i,1),!(e=r.length&&xe(o)))return H.apply(n,r),n;break}}}return(l||f(e,c))(r,t,!E,n,!t||ee.test(e)&&ye(t.parentNode)||t),n},d.sortStable=S.split("").sort(D).join("")===S,d.detectDuplicates=!!l,T(),d.sortDetached=ce(function(e){return 1&e.compareDocumentPosition(C.createElement("fieldset"))}),ce(function(e){return e.innerHTML="<a href='#'></a>","#"===e.firstChild.getAttribute("href")})||fe("type|href|height|width",function(e,t,n){if(!n)return e.getAttribute(t,"type"===t.toLowerCase()?1:2)}),d.attributes&&ce(function(e){return e.innerHTML="<input/>",e.firstChild.setAttribute("value",""),""===e.firstChild.getAttribute("value")})||fe("value",function(e,t,n){if(!n&&"input"===e.nodeName.toLowerCase())return e.defaultValue}),ce(function(e){return null==e.getAttribute("disabled")})||fe(R,function(e,t,n){var r;if(!n)return!0===e[t]?t.toLowerCase():(r=e.getAttributeNode(t))&&r.specified?r.value:null}),se}(C);S.find=d,S.expr=d.selectors,S.expr[":"]=S.expr.pseudos,S.uniqueSort=S.unique=d.uniqueSort,S.text=d.getText,S.isXMLDoc=d.isXML,S.contains=d.contains,S.escapeSelector=d.escape;var h=function(e,t,n){var r=[],i=void 0!==n;while((e=e[t])&&9!==e.nodeType)if(1===e.nodeType){if(i&&S(e).is(n))break;r.push(e)}return r},T=function(e,t){for(var n=[];e;e=e.nextSibling)1===e.nodeType&&e!==t&&n.push(e);return n},k=S.expr.match.needsContext;function A(e,t){return e.nodeName&&e.nodeName.toLowerCase()===t.toLowerCase()}var N=/^<([a-z][^\/\0>:\x20\t\r\n\f]*)[\x20\t\r\n\f]*\/?>(?:<\/\1>|)$/i;function D(e,n,r){return m(n)?S.grep(e,function(e,t){return!!n.call(e,t,e)!==r}):n.nodeType?S.grep(e,function(e){return e===n!==r}):"string"!=typeof n?S.grep(e,function(e){return-1<i.call(n,e)!==r}):S.filter(n,e,r)}S.filter=function(e,t,n){var r=t[0];return n&&(e=":not("+e+")"),1===t.length&&1===r.nodeType?S.find.matchesSelector(r,e)?[r]:[]:S.find.matches(e,S.grep(t,function(e){return 1===e.nodeType}))},S.fn.extend({find:function(e){var t,n,r=this.length,i=this;if("string"!=typeof e)return this.pushStack(S(e).filter(function(){for(t=0;t<r;t++)if(S.contains(i[t],this))return!0}));for(n=this.pushStack([]),t=0;t<r;t++)S.find(e,i[t],n);return 1<r?S.uniqueSort(n):n},filter:function(e){return this.pushStack(D(this,e||[],!1))},not:function(e){return this.pushStack(D(this,e||[],!0))},is:function(e){return!!D(this,"string"==typeof e&&k.test(e)?S(e):e||[],!1).length}});var j,q=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]+))$/;(S.fn.init=function(e,t,n){var r,i;if(!e)return this;if(n=n||j,"string"==typeof e){if(!(r="<"===e[0]&&">"===e[e.length-1]&&3<=e.length?[null,e,null]:q.exec(e))||!r[1]&&t)return!t||t.jquery?(t||n).find(e):this.constructor(t).find(e);if(r[1]){if(t=t instanceof S?t[0]:t,S.merge(this,S.parseHTML(r[1],t&&t.nodeType?t.ownerDocument||t:E,!0)),N.test(r[1])&&S.isPlainObject(t))for(r in t)m(this[r])?this[r](t[r]):this.attr(r,t[r]);return this}return(i=E.getElementById(r[2]))&&(this[0]=i,this.length=1),this}return e.nodeType?(this[0]=e,this.length=1,this):m(e)?void 0!==n.ready?n.ready(e):e(S):S.makeArray(e,this)}).prototype=S.fn,j=S(E);var L=/^(?:parents|prev(?:Until|All))/,H={children:!0,contents:!0,next:!0,prev:!0};function O(e,t){while((e=e[t])&&1!==e.nodeType);return e}S.fn.extend({has:function(e){var t=S(e,this),n=t.length;return this.filter(function(){for(var e=0;e<n;e++)if(S.contains(this,t[e]))return!0})},closest:function(e,t){var n,r=0,i=this.length,o=[],a="string"!=typeof e&&S(e);if(!k.test(e))for(;r<i;r++)for(n=this[r];n&&n!==t;n=n.parentNode)if(n.nodeType<11&&(a?-1<a.index(n):1===n.nodeType&&S.find.matchesSelector(n,e))){o.push(n);break}return this.pushStack(1<o.length?S.uniqueSort(o):o)},index:function(e){return e?"string"==typeof e?i.call(S(e),this[0]):i.call(this,e.jquery?e[0]:e):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(e,t){return this.pushStack(S.uniqueSort(S.merge(this.get(),S(e,t))))},addBack:function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}}),S.each({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return h(e,"parentNode")},parentsUntil:function(e,t,n){return h(e,"parentNode",n)},next:function(e){return O(e,"nextSibling")},prev:function(e){return O(e,"previousSibling")},nextAll:function(e){return h(e,"nextSibling")},prevAll:function(e){return h(e,"previousSibling")},nextUntil:function(e,t,n){return h(e,"nextSibling",n)},prevUntil:function(e,t,n){return h(e,"previousSibling",n)},siblings:function(e){return T((e.parentNode||{}).firstChild,e)},children:function(e){return T(e.firstChild)},contents:function(e){return null!=e.contentDocument&&r(e.contentDocument)?e.contentDocument:(A(e,"template")&&(e=e.content||e),S.merge([],e.childNodes))}},function(r,i){S.fn[r]=function(e,t){var n=S.map(this,i,e);return"Until"!==r.slice(-5)&&(t=e),t&&"string"==typeof t&&(n=S.filter(t,n)),1<this.length&&(H[r]||S.uniqueSort(n),L.test(r)&&n.reverse()),this.pushStack(n)}});var P=/[^\x20\t\r\n\f]+/g;function R(e){return e}function M(e){throw e}function I(e,t,n,r){var i;try{e&&m(i=e.promise)?i.call(e).done(t).fail(n):e&&m(i=e.then)?i.call(e,t,n):t.apply(void 0,[e].slice(r))}catch(e){n.apply(void 0,[e])}}S.Callbacks=function(r){var e,n;r="string"==typeof r?(e=r,n={},S.each(e.match(P)||[],function(e,t){n[t]=!0}),n):S.extend({},r);var i,t,o,a,s=[],u=[],l=-1,c=function(){for(a=a||r.once,o=i=!0;u.length;l=-1){t=u.shift();while(++l<s.length)!1===s[l].apply(t[0],t[1])&&r.stopOnFalse&&(l=s.length,t=!1)}r.memory||(t=!1),i=!1,a&&(s=t?[]:"")},f={add:function(){return s&&(t&&!i&&(l=s.length-1,u.push(t)),function n(e){S.each(e,function(e,t){m(t)?r.unique&&f.has(t)||s.push(t):t&&t.length&&"string"!==w(t)&&n(t)})}(arguments),t&&!i&&c()),this},remove:function(){return S.each(arguments,function(e,t){var n;while(-1<(n=S.inArray(t,s,n)))s.splice(n,1),n<=l&&l--}),this},has:function(e){return e?-1<S.inArray(e,s):0<s.length},empty:function(){return s&&(s=[]),this},disable:function(){return a=u=[],s=t="",this},disabled:function(){return!s},lock:function(){return a=u=[],t||i||(s=t=""),this},locked:function(){return!!a},fireWith:function(e,t){return a||(t=[e,(t=t||[]).slice?t.slice():t],u.push(t),i||c()),this},fire:function(){return f.fireWith(this,arguments),this},fired:function(){return!!o}};return f},S.extend({Deferred:function(e){var o=[["notify","progress",S.Callbacks("memory"),S.Callbacks("memory"),2],["resolve","done",S.Callbacks("once memory"),S.Callbacks("once memory"),0,"resolved"],["reject","fail",S.Callbacks("once memory"),S.Callbacks("once memory"),1,"rejected"]],i="pending",a={state:function(){return i},always:function(){return s.done(arguments).fail(arguments),this},"catch":function(e){return a.then(null,e)},pipe:function(){var i=arguments;return S.Deferred(function(r){S.each(o,function(e,t){var n=m(i[t[4]])&&i[t[4]];s[t[1]](function(){var e=n&&n.apply(this,arguments);e&&m(e.promise)?e.promise().progress(r.notify).done(r.resolve).fail(r.reject):r[t[0]+"With"](this,n?[e]:arguments)})}),i=null}).promise()},then:function(t,n,r){var u=0;function l(i,o,a,s){return function(){var n=this,r=arguments,e=function(){var e,t;if(!(i<u)){if((e=a.apply(n,r))===o.promise())throw new TypeError("Thenable self-resolution");t=e&&("object"==typeof e||"function"==typeof e)&&e.then,m(t)?s?t.call(e,l(u,o,R,s),l(u,o,M,s)):(u++,t.call(e,l(u,o,R,s),l(u,o,M,s),l(u,o,R,o.notifyWith))):(a!==R&&(n=void 0,r=[e]),(s||o.resolveWith)(n,r))}},t=s?e:function(){try{e()}catch(e){S.Deferred.exceptionHook&&S.Deferred.exceptionHook(e,t.stackTrace),u<=i+1&&(a!==M&&(n=void 0,r=[e]),o.rejectWith(n,r))}};i?t():(S.Deferred.getStackHook&&(t.stackTrace=S.Deferred.getStackHook()),C.setTimeout(t))}}return S.Deferred(function(e){o[0][3].add(l(0,e,m(r)?r:R,e.notifyWith)),o[1][3].add(l(0,e,m(t)?t:R)),o[2][3].add(l(0,e,m(n)?n:M))}).promise()},promise:function(e){return null!=e?S.extend(e,a):a}},s={};return S.each(o,function(e,t){var n=t[2],r=t[5];a[t[1]]=n.add,r&&n.add(function(){i=r},o[3-e][2].disable,o[3-e][3].disable,o[0][2].lock,o[0][3].lock),n.add(t[3].fire),s[t[0]]=function(){return s[t[0]+"With"](this===s?void 0:this,arguments),this},s[t[0]+"With"]=n.fireWith}),a.promise(s),e&&e.call(s,s),s},when:function(e){var n=arguments.length,t=n,r=Array(t),i=s.call(arguments),o=S.Deferred(),a=function(t){return function(e){r[t]=this,i[t]=1<arguments.length?s.call(arguments):e,--n||o.resolveWith(r,i)}};if(n<=1&&(I(e,o.done(a(t)).resolve,o.reject,!n),"pending"===o.state()||m(i[t]&&i[t].then)))return o.then();while(t--)I(i[t],a(t),o.reject);return o.promise()}});var W=/^(Eval|Internal|Range|Reference|Syntax|Type|URI)Error$/;S.Deferred.exceptionHook=function(e,t){C.console&&C.console.warn&&e&&W.test(e.name)&&C.console.warn("jQuery.Deferred exception: "+e.message,e.stack,t)},S.readyException=function(e){C.setTimeout(function(){throw e})};var F=S.Deferred();function B(){E.removeEventListener("DOMContentLoaded",B),C.removeEventListener("load",B),S.ready()}S.fn.ready=function(e){return F.then(e)["catch"](function(e){S.readyException(e)}),this},S.extend({isReady:!1,readyWait:1,ready:function(e){(!0===e?--S.readyWait:S.isReady)||(S.isReady=!0)!==e&&0<--S.readyWait||F.resolveWith(E,[S])}}),S.ready.then=F.then,"complete"===E.readyState||"loading"!==E.readyState&&!E.documentElement.doScroll?C.setTimeout(S.ready):(E.addEventListener("DOMContentLoaded",B),C.addEventListener("load",B));var $=function(e,t,n,r,i,o,a){var s=0,u=e.length,l=null==n;if("object"===w(n))for(s in i=!0,n)$(e,t,s,n[s],!0,o,a);else if(void 0!==r&&(i=!0,m(r)||(a=!0),l&&(a?(t.call(e,r),t=null):(l=t,t=function(e,t,n){return l.call(S(e),n)})),t))for(;s<u;s++)t(e[s],n,a?r:r.call(e[s],s,t(e[s],n)));return i?e:l?t.call(e):u?t(e[0],n):o},_=/^-ms-/,z=/-([a-z])/g;function U(e,t){return t.toUpperCase()}function X(e){return e.replace(_,"ms-").replace(z,U)}var V=function(e){return 1===e.nodeType||9===e.nodeType||!+e.nodeType};function G(){this.expando=S.expando+G.uid++}G.uid=1,G.prototype={cache:function(e){var t=e[this.expando];return t||(t={},V(e)&&(e.nodeType?e[this.expando]=t:Object.defineProperty(e,this.expando,{value:t,configurable:!0}))),t},set:function(e,t,n){var r,i=this.cache(e);if("string"==typeof t)i[X(t)]=n;else for(r in t)i[X(r)]=t[r];return i},get:function(e,t){return void 0===t?this.cache(e):e[this.expando]&&e[this.expando][X(t)]},access:function(e,t,n){return void 0===t||t&&"string"==typeof t&&void 0===n?this.get(e,t):(this.set(e,t,n),void 0!==n?n:t)},remove:function(e,t){var n,r=e[this.expando];if(void 0!==r){if(void 0!==t){n=(t=Array.isArray(t)?t.map(X):(t=X(t))in r?[t]:t.match(P)||[]).length;while(n--)delete r[t[n]]}(void 0===t||S.isEmptyObject(r))&&(e.nodeType?e[this.expando]=void 0:delete e[this.expando])}},hasData:function(e){var t=e[this.expando];return void 0!==t&&!S.isEmptyObject(t)}};var Y=new G,Q=new G,J=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,K=/[A-Z]/g;function Z(e,t,n){var r,i;if(void 0===n&&1===e.nodeType)if(r="data-"+t.replace(K,"-$&").toLowerCase(),"string"==typeof(n=e.getAttribute(r))){try{n="true"===(i=n)||"false"!==i&&("null"===i?null:i===+i+""?+i:J.test(i)?JSON.parse(i):i)}catch(e){}Q.set(e,t,n)}else n=void 0;return n}S.extend({hasData:function(e){return Q.hasData(e)||Y.hasData(e)},data:function(e,t,n){return Q.access(e,t,n)},removeData:function(e,t){Q.remove(e,t)},_data:function(e,t,n){return Y.access(e,t,n)},_removeData:function(e,t){Y.remove(e,t)}}),S.fn.extend({data:function(n,e){var t,r,i,o=this[0],a=o&&o.attributes;if(void 0===n){if(this.length&&(i=Q.get(o),1===o.nodeType&&!Y.get(o,"hasDataAttrs"))){t=a.length;while(t--)a[t]&&0===(r=a[t].name).indexOf("data-")&&(r=X(r.slice(5)),Z(o,r,i[r]));Y.set(o,"hasDataAttrs",!0)}return i}return"object"==typeof n?this.each(function(){Q.set(this,n)}):$(this,function(e){var t;if(o&&void 0===e)return void 0!==(t=Q.get(o,n))?t:void 0!==(t=Z(o,n))?t:void 0;this.each(function(){Q.set(this,n,e)})},null,e,1<arguments.length,null,!0)},removeData:function(e){return this.each(function(){Q.remove(this,e)})}}),S.extend({queue:function(e,t,n){var r;if(e)return t=(t||"fx")+"queue",r=Y.get(e,t),n&&(!r||Array.isArray(n)?r=Y.access(e,t,S.makeArray(n)):r.push(n)),r||[]},dequeue:function(e,t){t=t||"fx";var n=S.queue(e,t),r=n.length,i=n.shift(),o=S._queueHooks(e,t);"inprogress"===i&&(i=n.shift(),r--),i&&("fx"===t&&n.unshift("inprogress"),delete o.stop,i.call(e,function(){S.dequeue(e,t)},o)),!r&&o&&o.empty.fire()},_queueHooks:function(e,t){var n=t+"queueHooks";return Y.get(e,n)||Y.access(e,n,{empty:S.Callbacks("once memory").add(function(){Y.remove(e,[t+"queue",n])})})}}),S.fn.extend({queue:function(t,n){var e=2;return"string"!=typeof t&&(n=t,t="fx",e--),arguments.length<e?S.queue(this[0],t):void 0===n?this:this.each(function(){var e=S.queue(this,t,n);S._queueHooks(this,t),"fx"===t&&"inprogress"!==e[0]&&S.dequeue(this,t)})},dequeue:function(e){return this.each(function(){S.dequeue(this,e)})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(e,t){var n,r=1,i=S.Deferred(),o=this,a=this.length,s=function(){--r||i.resolveWith(o,[o])};"string"!=typeof e&&(t=e,e=void 0),e=e||"fx";while(a--)(n=Y.get(o[a],e+"queueHooks"))&&n.empty&&(r++,n.empty.add(s));return s(),i.promise(t)}});var ee=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,te=new RegExp("^(?:([+-])=|)("+ee+")([a-z%]*)$","i"),ne=["Top","Right","Bottom","Left"],re=E.documentElement,ie=function(e){return S.contains(e.ownerDocument,e)},oe={composed:!0};re.getRootNode&&(ie=function(e){return S.contains(e.ownerDocument,e)||e.getRootNode(oe)===e.ownerDocument});var ae=function(e,t){return"none"===(e=t||e).style.display||""===e.style.display&&ie(e)&&"none"===S.css(e,"display")};function se(e,t,n,r){var i,o,a=20,s=r?function(){return r.cur()}:function(){return S.css(e,t,"")},u=s(),l=n&&n[3]||(S.cssNumber[t]?"":"px"),c=e.nodeType&&(S.cssNumber[t]||"px"!==l&&+u)&&te.exec(S.css(e,t));if(c&&c[3]!==l){u/=2,l=l||c[3],c=+u||1;while(a--)S.style(e,t,c+l),(1-o)*(1-(o=s()/u||.5))<=0&&(a=0),c/=o;c*=2,S.style(e,t,c+l),n=n||[]}return n&&(c=+c||+u||0,i=n[1]?c+(n[1]+1)*n[2]:+n[2],r&&(r.unit=l,r.start=c,r.end=i)),i}var ue={};function le(e,t){for(var n,r,i,o,a,s,u,l=[],c=0,f=e.length;c<f;c++)(r=e[c]).style&&(n=r.style.display,t?("none"===n&&(l[c]=Y.get(r,"display")||null,l[c]||(r.style.display="")),""===r.style.display&&ae(r)&&(l[c]=(u=a=o=void 0,a=(i=r).ownerDocument,s=i.nodeName,(u=ue[s])||(o=a.body.appendChild(a.createElement(s)),u=S.css(o,"display"),o.parentNode.removeChild(o),"none"===u&&(u="block"),ue[s]=u)))):"none"!==n&&(l[c]="none",Y.set(r,"display",n)));for(c=0;c<f;c++)null!=l[c]&&(e[c].style.display=l[c]);return e}S.fn.extend({show:function(){return le(this,!0)},hide:function(){return le(this)},toggle:function(e){return"boolean"==typeof e?e?this.show():this.hide():this.each(function(){ae(this)?S(this).show():S(this).hide()})}});var ce,fe,pe=/^(?:checkbox|radio)$/i,de=/<([a-z][^\/\0>\x20\t\r\n\f]*)/i,he=/^$|^module$|\/(?:java|ecma)script/i;ce=E.createDocumentFragment().appendChild(E.createElement("div")),(fe=E.createElement("input")).setAttribute("type","radio"),fe.setAttribute("checked","checked"),fe.setAttribute("name","t"),ce.appendChild(fe),y.checkClone=ce.cloneNode(!0).cloneNode(!0).lastChild.checked,ce.innerHTML="<textarea>x</textarea>",y.noCloneChecked=!!ce.cloneNode(!0).lastChild.defaultValue,ce.innerHTML="<option></option>",y.option=!!ce.lastChild;var ge={thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};function ve(e,t){var n;return n="undefined"!=typeof e.getElementsByTagName?e.getElementsByTagName(t||"*"):"undefined"!=typeof e.querySelectorAll?e.querySelectorAll(t||"*"):[],void 0===t||t&&A(e,t)?S.merge([e],n):n}function ye(e,t){for(var n=0,r=e.length;n<r;n++)Y.set(e[n],"globalEval",!t||Y.get(t[n],"globalEval"))}ge.tbody=ge.tfoot=ge.colgroup=ge.caption=ge.thead,ge.th=ge.td,y.option||(ge.optgroup=ge.option=[1,"<select multiple='multiple'>","</select>"]);var me=/<|&#?\w+;/;function xe(e,t,n,r,i){for(var o,a,s,u,l,c,f=t.createDocumentFragment(),p=[],d=0,h=e.length;d<h;d++)if((o=e[d])||0===o)if("object"===w(o))S.merge(p,o.nodeType?[o]:o);else if(me.test(o)){a=a||f.appendChild(t.createElement("div")),s=(de.exec(o)||["",""])[1].toLowerCase(),u=ge[s]||ge._default,a.innerHTML=u[1]+S.htmlPrefilter(o)+u[2],c=u[0];while(c--)a=a.lastChild;S.merge(p,a.childNodes),(a=f.firstChild).textContent=""}else p.push(t.createTextNode(o));f.textContent="",d=0;while(o=p[d++])if(r&&-1<S.inArray(o,r))i&&i.push(o);else if(l=ie(o),a=ve(f.appendChild(o),"script"),l&&ye(a),n){c=0;while(o=a[c++])he.test(o.type||"")&&n.push(o)}return f}var be=/^key/,we=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,Te=/^([^.]*)(?:\.(.+)|)/;function Ce(){return!0}function Ee(){return!1}function Se(e,t){return e===function(){try{return E.activeElement}catch(e){}}()==("focus"===t)}function ke(e,t,n,r,i,o){var a,s;if("object"==typeof t){for(s in"string"!=typeof n&&(r=r||n,n=void 0),t)ke(e,s,n,r,t[s],o);return e}if(null==r&&null==i?(i=n,r=n=void 0):null==i&&("string"==typeof n?(i=r,r=void 0):(i=r,r=n,n=void 0)),!1===i)i=Ee;else if(!i)return e;return 1===o&&(a=i,(i=function(e){return S().off(e),a.apply(this,arguments)}).guid=a.guid||(a.guid=S.guid++)),e.each(function(){S.event.add(this,t,i,r,n)})}function Ae(e,i,o){o?(Y.set(e,i,!1),S.event.add(e,i,{namespace:!1,handler:function(e){var t,n,r=Y.get(this,i);if(1&e.isTrigger&&this[i]){if(r.length)(S.event.special[i]||{}).delegateType&&e.stopPropagation();else if(r=s.call(arguments),Y.set(this,i,r),t=o(this,i),this[i](),r!==(n=Y.get(this,i))||t?Y.set(this,i,!1):n={},r!==n)return e.stopImmediatePropagation(),e.preventDefault(),n.value}else r.length&&(Y.set(this,i,{value:S.event.trigger(S.extend(r[0],S.Event.prototype),r.slice(1),this)}),e.stopImmediatePropagation())}})):void 0===Y.get(e,i)&&S.event.add(e,i,Ce)}S.event={global:{},add:function(t,e,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=Y.get(t);if(V(t)){n.handler&&(n=(o=n).handler,i=o.selector),i&&S.find.matchesSelector(re,i),n.guid||(n.guid=S.guid++),(u=v.events)||(u=v.events=Object.create(null)),(a=v.handle)||(a=v.handle=function(e){return"undefined"!=typeof S&&S.event.triggered!==e.type?S.event.dispatch.apply(t,arguments):void 0}),l=(e=(e||"").match(P)||[""]).length;while(l--)d=g=(s=Te.exec(e[l])||[])[1],h=(s[2]||"").split(".").sort(),d&&(f=S.event.special[d]||{},d=(i?f.delegateType:f.bindType)||d,f=S.event.special[d]||{},c=S.extend({type:d,origType:g,data:r,handler:n,guid:n.guid,selector:i,needsContext:i&&S.expr.match.needsContext.test(i),namespace:h.join(".")},o),(p=u[d])||((p=u[d]=[]).delegateCount=0,f.setup&&!1!==f.setup.call(t,r,h,a)||t.addEventListener&&t.addEventListener(d,a)),f.add&&(f.add.call(t,c),c.handler.guid||(c.handler.guid=n.guid)),i?p.splice(p.delegateCount++,0,c):p.push(c),S.event.global[d]=!0)}},remove:function(e,t,n,r,i){var o,a,s,u,l,c,f,p,d,h,g,v=Y.hasData(e)&&Y.get(e);if(v&&(u=v.events)){l=(t=(t||"").match(P)||[""]).length;while(l--)if(d=g=(s=Te.exec(t[l])||[])[1],h=(s[2]||"").split(".").sort(),d){f=S.event.special[d]||{},p=u[d=(r?f.delegateType:f.bindType)||d]||[],s=s[2]&&new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"),a=o=p.length;while(o--)c=p[o],!i&&g!==c.origType||n&&n.guid!==c.guid||s&&!s.test(c.namespace)||r&&r!==c.selector&&("**"!==r||!c.selector)||(p.splice(o,1),c.selector&&p.delegateCount--,f.remove&&f.remove.call(e,c));a&&!p.length&&(f.teardown&&!1!==f.teardown.call(e,h,v.handle)||S.removeEvent(e,d,v.handle),delete u[d])}else for(d in u)S.event.remove(e,d+t[l],n,r,!0);S.isEmptyObject(u)&&Y.remove(e,"handle events")}},dispatch:function(e){var t,n,r,i,o,a,s=new Array(arguments.length),u=S.event.fix(e),l=(Y.get(this,"events")||Object.create(null))[u.type]||[],c=S.event.special[u.type]||{};for(s[0]=u,t=1;t<arguments.length;t++)s[t]=arguments[t];if(u.delegateTarget=this,!c.preDispatch||!1!==c.preDispatch.call(this,u)){a=S.event.handlers.call(this,u,l),t=0;while((i=a[t++])&&!u.isPropagationStopped()){u.currentTarget=i.elem,n=0;while((o=i.handlers[n++])&&!u.isImmediatePropagationStopped())u.rnamespace&&!1!==o.namespace&&!u.rnamespace.test(o.namespace)||(u.handleObj=o,u.data=o.data,void 0!==(r=((S.event.special[o.origType]||{}).handle||o.handler).apply(i.elem,s))&&!1===(u.result=r)&&(u.preventDefault(),u.stopPropagation()))}return c.postDispatch&&c.postDispatch.call(this,u),u.result}},handlers:function(e,t){var n,r,i,o,a,s=[],u=t.delegateCount,l=e.target;if(u&&l.nodeType&&!("click"===e.type&&1<=e.button))for(;l!==this;l=l.parentNode||this)if(1===l.nodeType&&("click"!==e.type||!0!==l.disabled)){for(o=[],a={},n=0;n<u;n++)void 0===a[i=(r=t[n]).selector+" "]&&(a[i]=r.needsContext?-1<S(i,this).index(l):S.find(i,this,null,[l]).length),a[i]&&o.push(r);o.length&&s.push({elem:l,handlers:o})}return l=this,u<t.length&&s.push({elem:l,handlers:t.slice(u)}),s},addProp:function(t,e){Object.defineProperty(S.Event.prototype,t,{enumerable:!0,configurable:!0,get:m(e)?function(){if(this.originalEvent)return e(this.originalEvent)}:function(){if(this.originalEvent)return this.originalEvent[t]},set:function(e){Object.defineProperty(this,t,{enumerable:!0,configurable:!0,writable:!0,value:e})}})},fix:function(e){return e[S.expando]?e:new S.Event(e)},special:{load:{noBubble:!0},click:{setup:function(e){var t=this||e;return pe.test(t.type)&&t.click&&A(t,"input")&&Ae(t,"click",Ce),!1},trigger:function(e){var t=this||e;return pe.test(t.type)&&t.click&&A(t,"input")&&Ae(t,"click"),!0},_default:function(e){var t=e.target;return pe.test(t.type)&&t.click&&A(t,"input")&&Y.get(t,"click")||A(t,"a")}},beforeunload:{postDispatch:function(e){void 0!==e.result&&e.originalEvent&&(e.originalEvent.returnValue=e.result)}}}},S.removeEvent=function(e,t,n){e.removeEventListener&&e.removeEventListener(t,n)},S.Event=function(e,t){if(!(this instanceof S.Event))return new S.Event(e,t);e&&e.type?(this.originalEvent=e,this.type=e.type,this.isDefaultPrevented=e.defaultPrevented||void 0===e.defaultPrevented&&!1===e.returnValue?Ce:Ee,this.target=e.target&&3===e.target.nodeType?e.target.parentNode:e.target,this.currentTarget=e.currentTarget,this.relatedTarget=e.relatedTarget):this.type=e,t&&S.extend(this,t),this.timeStamp=e&&e.timeStamp||Date.now(),this[S.expando]=!0},S.Event.prototype={constructor:S.Event,isDefaultPrevented:Ee,isPropagationStopped:Ee,isImmediatePropagationStopped:Ee,isSimulated:!1,preventDefault:function(){var e=this.originalEvent;this.isDefaultPrevented=Ce,e&&!this.isSimulated&&e.preventDefault()},stopPropagation:function(){var e=this.originalEvent;this.isPropagationStopped=Ce,e&&!this.isSimulated&&e.stopPropagation()},stopImmediatePropagation:function(){var e=this.originalEvent;this.isImmediatePropagationStopped=Ce,e&&!this.isSimulated&&e.stopImmediatePropagation(),this.stopPropagation()}},S.each({altKey:!0,bubbles:!0,cancelable:!0,changedTouches:!0,ctrlKey:!0,detail:!0,eventPhase:!0,metaKey:!0,pageX:!0,pageY:!0,shiftKey:!0,view:!0,"char":!0,code:!0,charCode:!0,key:!0,keyCode:!0,button:!0,buttons:!0,clientX:!0,clientY:!0,offsetX:!0,offsetY:!0,pointerId:!0,pointerType:!0,screenX:!0,screenY:!0,targetTouches:!0,toElement:!0,touches:!0,which:function(e){var t=e.button;return null==e.which&&be.test(e.type)?null!=e.charCode?e.charCode:e.keyCode:!e.which&&void 0!==t&&we.test(e.type)?1&t?1:2&t?3:4&t?2:0:e.which}},S.event.addProp),S.each({focus:"focusin",blur:"focusout"},function(e,t){S.event.special[e]={setup:function(){return Ae(this,e,Se),!1},trigger:function(){return Ae(this,e),!0},delegateType:t}}),S.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(e,i){S.event.special[e]={delegateType:i,bindType:i,handle:function(e){var t,n=e.relatedTarget,r=e.handleObj;return n&&(n===this||S.contains(this,n))||(e.type=r.origType,t=r.handler.apply(this,arguments),e.type=i),t}}}),S.fn.extend({on:function(e,t,n,r){return ke(this,e,t,n,r)},one:function(e,t,n,r){return ke(this,e,t,n,r,1)},off:function(e,t,n){var r,i;if(e&&e.preventDefault&&e.handleObj)return r=e.handleObj,S(e.delegateTarget).off(r.namespace?r.origType+"."+r.namespace:r.origType,r.selector,r.handler),this;if("object"==typeof e){for(i in e)this.off(i,t,e[i]);return this}return!1!==t&&"function"!=typeof t||(n=t,t=void 0),!1===n&&(n=Ee),this.each(function(){S.event.remove(this,e,n,t)})}});var Ne=/<script|<style|<link/i,De=/checked\s*(?:[^=]|=\s*.checked.)/i,je=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;function qe(e,t){return A(e,"table")&&A(11!==t.nodeType?t:t.firstChild,"tr")&&S(e).children("tbody")[0]||e}function Le(e){return e.type=(null!==e.getAttribute("type"))+"/"+e.type,e}function He(e){return"true/"===(e.type||"").slice(0,5)?e.type=e.type.slice(5):e.removeAttribute("type"),e}function Oe(e,t){var n,r,i,o,a,s;if(1===t.nodeType){if(Y.hasData(e)&&(s=Y.get(e).events))for(i in Y.remove(t,"handle events"),s)for(n=0,r=s[i].length;n<r;n++)S.event.add(t,i,s[i][n]);Q.hasData(e)&&(o=Q.access(e),a=S.extend({},o),Q.set(t,a))}}function Pe(n,r,i,o){r=g(r);var e,t,a,s,u,l,c=0,f=n.length,p=f-1,d=r[0],h=m(d);if(h||1<f&&"string"==typeof d&&!y.checkClone&&De.test(d))return n.each(function(e){var t=n.eq(e);h&&(r[0]=d.call(this,e,t.html())),Pe(t,r,i,o)});if(f&&(t=(e=xe(r,n[0].ownerDocument,!1,n,o)).firstChild,1===e.childNodes.length&&(e=t),t||o)){for(s=(a=S.map(ve(e,"script"),Le)).length;c<f;c++)u=e,c!==p&&(u=S.clone(u,!0,!0),s&&S.merge(a,ve(u,"script"))),i.call(n[c],u,c);if(s)for(l=a[a.length-1].ownerDocument,S.map(a,He),c=0;c<s;c++)u=a[c],he.test(u.type||"")&&!Y.access(u,"globalEval")&&S.contains(l,u)&&(u.src&&"module"!==(u.type||"").toLowerCase()?S._evalUrl&&!u.noModule&&S._evalUrl(u.src,{nonce:u.nonce||u.getAttribute("nonce")},l):b(u.textContent.replace(je,""),u,l))}return n}function Re(e,t,n){for(var r,i=t?S.filter(t,e):e,o=0;null!=(r=i[o]);o++)n||1!==r.nodeType||S.cleanData(ve(r)),r.parentNode&&(n&&ie(r)&&ye(ve(r,"script")),r.parentNode.removeChild(r));return e}S.extend({htmlPrefilter:function(e){return e},clone:function(e,t,n){var r,i,o,a,s,u,l,c=e.cloneNode(!0),f=ie(e);if(!(y.noCloneChecked||1!==e.nodeType&&11!==e.nodeType||S.isXMLDoc(e)))for(a=ve(c),r=0,i=(o=ve(e)).length;r<i;r++)s=o[r],u=a[r],void 0,"input"===(l=u.nodeName.toLowerCase())&&pe.test(s.type)?u.checked=s.checked:"input"!==l&&"textarea"!==l||(u.defaultValue=s.defaultValue);if(t)if(n)for(o=o||ve(e),a=a||ve(c),r=0,i=o.length;r<i;r++)Oe(o[r],a[r]);else Oe(e,c);return 0<(a=ve(c,"script")).length&&ye(a,!f&&ve(e,"script")),c},cleanData:function(e){for(var t,n,r,i=S.event.special,o=0;void 0!==(n=e[o]);o++)if(V(n)){if(t=n[Y.expando]){if(t.events)for(r in t.events)i[r]?S.event.remove(n,r):S.removeEvent(n,r,t.handle);n[Y.expando]=void 0}n[Q.expando]&&(n[Q.expando]=void 0)}}}),S.fn.extend({detach:function(e){return Re(this,e,!0)},remove:function(e){return Re(this,e)},text:function(e){return $(this,function(e){return void 0===e?S.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=e)})},null,e,arguments.length)},append:function(){return Pe(this,arguments,function(e){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||qe(this,e).appendChild(e)})},prepend:function(){return Pe(this,arguments,function(e){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var t=qe(this,e);t.insertBefore(e,t.firstChild)}})},before:function(){return Pe(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this)})},after:function(){return Pe(this,arguments,function(e){this.parentNode&&this.parentNode.insertBefore(e,this.nextSibling)})},empty:function(){for(var e,t=0;null!=(e=this[t]);t++)1===e.nodeType&&(S.cleanData(ve(e,!1)),e.textContent="");return this},clone:function(e,t){return e=null!=e&&e,t=null==t?e:t,this.map(function(){return S.clone(this,e,t)})},html:function(e){return $(this,function(e){var t=this[0]||{},n=0,r=this.length;if(void 0===e&&1===t.nodeType)return t.innerHTML;if("string"==typeof e&&!Ne.test(e)&&!ge[(de.exec(e)||["",""])[1].toLowerCase()]){e=S.htmlPrefilter(e);try{for(;n<r;n++)1===(t=this[n]||{}).nodeType&&(S.cleanData(ve(t,!1)),t.innerHTML=e);t=0}catch(e){}}t&&this.empty().append(e)},null,e,arguments.length)},replaceWith:function(){var n=[];return Pe(this,arguments,function(e){var t=this.parentNode;S.inArray(this,n)<0&&(S.cleanData(ve(this)),t&&t.replaceChild(e,this))},n)}}),S.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,a){S.fn[e]=function(e){for(var t,n=[],r=S(e),i=r.length-1,o=0;o<=i;o++)t=o===i?this:this.clone(!0),S(r[o])[a](t),u.apply(n,t.get());return this.pushStack(n)}});var Me=new RegExp("^("+ee+")(?!px)[a-z%]+$","i"),Ie=function(e){var t=e.ownerDocument.defaultView;return t&&t.opener||(t=C),t.getComputedStyle(e)},We=function(e,t,n){var r,i,o={};for(i in t)o[i]=e.style[i],e.style[i]=t[i];for(i in r=n.call(e),t)e.style[i]=o[i];return r},Fe=new RegExp(ne.join("|"),"i");function Be(e,t,n){var r,i,o,a,s=e.style;return(n=n||Ie(e))&&(""!==(a=n.getPropertyValue(t)||n[t])||ie(e)||(a=S.style(e,t)),!y.pixelBoxStyles()&&Me.test(a)&&Fe.test(t)&&(r=s.width,i=s.minWidth,o=s.maxWidth,s.minWidth=s.maxWidth=s.width=a,a=n.width,s.width=r,s.minWidth=i,s.maxWidth=o)),void 0!==a?a+"":a}function $e(e,t){return{get:function(){if(!e())return(this.get=t).apply(this,arguments);delete this.get}}}!function(){function e(){if(l){u.style.cssText="position:absolute;left:-11111px;width:60px;margin-top:1px;padding:0;border:0",l.style.cssText="position:relative;display:block;box-sizing:border-box;overflow:scroll;margin:auto;border:1px;padding:1px;width:60%;top:1%",re.appendChild(u).appendChild(l);var e=C.getComputedStyle(l);n="1%"!==e.top,s=12===t(e.marginLeft),l.style.right="60%",o=36===t(e.right),r=36===t(e.width),l.style.position="absolute",i=12===t(l.offsetWidth/3),re.removeChild(u),l=null}}function t(e){return Math.round(parseFloat(e))}var n,r,i,o,a,s,u=E.createElement("div"),l=E.createElement("div");l.style&&(l.style.backgroundClip="content-box",l.cloneNode(!0).style.backgroundClip="",y.clearCloneStyle="content-box"===l.style.backgroundClip,S.extend(y,{boxSizingReliable:function(){return e(),r},pixelBoxStyles:function(){return e(),o},pixelPosition:function(){return e(),n},reliableMarginLeft:function(){return e(),s},scrollboxSize:function(){return e(),i},reliableTrDimensions:function(){var e,t,n,r;return null==a&&(e=E.createElement("table"),t=E.createElement("tr"),n=E.createElement("div"),e.style.cssText="position:absolute;left:-11111px",t.style.height="1px",n.style.height="9px",re.appendChild(e).appendChild(t).appendChild(n),r=C.getComputedStyle(t),a=3<parseInt(r.height),re.removeChild(e)),a}}))}();var _e=["Webkit","Moz","ms"],ze=E.createElement("div").style,Ue={};function Xe(e){var t=S.cssProps[e]||Ue[e];return t||(e in ze?e:Ue[e]=function(e){var t=e[0].toUpperCase()+e.slice(1),n=_e.length;while(n--)if((e=_e[n]+t)in ze)return e}(e)||e)}var Ve=/^(none|table(?!-c[ea]).+)/,Ge=/^--/,Ye={position:"absolute",visibility:"hidden",display:"block"},Qe={letterSpacing:"0",fontWeight:"400"};function Je(e,t,n){var r=te.exec(t);return r?Math.max(0,r[2]-(n||0))+(r[3]||"px"):t}function Ke(e,t,n,r,i,o){var a="width"===t?1:0,s=0,u=0;if(n===(r?"border":"content"))return 0;for(;a<4;a+=2)"margin"===n&&(u+=S.css(e,n+ne[a],!0,i)),r?("content"===n&&(u-=S.css(e,"padding"+ne[a],!0,i)),"margin"!==n&&(u-=S.css(e,"border"+ne[a]+"Width",!0,i))):(u+=S.css(e,"padding"+ne[a],!0,i),"padding"!==n?u+=S.css(e,"border"+ne[a]+"Width",!0,i):s+=S.css(e,"border"+ne[a]+"Width",!0,i));return!r&&0<=o&&(u+=Math.max(0,Math.ceil(e["offset"+t[0].toUpperCase()+t.slice(1)]-o-u-s-.5))||0),u}function Ze(e,t,n){var r=Ie(e),i=(!y.boxSizingReliable()||n)&&"border-box"===S.css(e,"boxSizing",!1,r),o=i,a=Be(e,t,r),s="offset"+t[0].toUpperCase()+t.slice(1);if(Me.test(a)){if(!n)return a;a="auto"}return(!y.boxSizingReliable()&&i||!y.reliableTrDimensions()&&A(e,"tr")||"auto"===a||!parseFloat(a)&&"inline"===S.css(e,"display",!1,r))&&e.getClientRects().length&&(i="border-box"===S.css(e,"boxSizing",!1,r),(o=s in e)&&(a=e[s])),(a=parseFloat(a)||0)+Ke(e,t,n||(i?"border":"content"),o,r,a)+"px"}function et(e,t,n,r,i){return new et.prototype.init(e,t,n,r,i)}S.extend({cssHooks:{opacity:{get:function(e,t){if(t){var n=Be(e,"opacity");return""===n?"1":n}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,gridArea:!0,gridColumn:!0,gridColumnEnd:!0,gridColumnStart:!0,gridRow:!0,gridRowEnd:!0,gridRowStart:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{},style:function(e,t,n,r){if(e&&3!==e.nodeType&&8!==e.nodeType&&e.style){var i,o,a,s=X(t),u=Ge.test(t),l=e.style;if(u||(t=Xe(s)),a=S.cssHooks[t]||S.cssHooks[s],void 0===n)return a&&"get"in a&&void 0!==(i=a.get(e,!1,r))?i:l[t];"string"===(o=typeof n)&&(i=te.exec(n))&&i[1]&&(n=se(e,t,i),o="number"),null!=n&&n==n&&("number"!==o||u||(n+=i&&i[3]||(S.cssNumber[s]?"":"px")),y.clearCloneStyle||""!==n||0!==t.indexOf("background")||(l[t]="inherit"),a&&"set"in a&&void 0===(n=a.set(e,n,r))||(u?l.setProperty(t,n):l[t]=n))}},css:function(e,t,n,r){var i,o,a,s=X(t);return Ge.test(t)||(t=Xe(s)),(a=S.cssHooks[t]||S.cssHooks[s])&&"get"in a&&(i=a.get(e,!0,n)),void 0===i&&(i=Be(e,t,r)),"normal"===i&&t in Qe&&(i=Qe[t]),""===n||n?(o=parseFloat(i),!0===n||isFinite(o)?o||0:i):i}}),S.each(["height","width"],function(e,u){S.cssHooks[u]={get:function(e,t,n){if(t)return!Ve.test(S.css(e,"display"))||e.getClientRects().length&&e.getBoundingClientRect().width?Ze(e,u,n):We(e,Ye,function(){return Ze(e,u,n)})},set:function(e,t,n){var r,i=Ie(e),o=!y.scrollboxSize()&&"absolute"===i.position,a=(o||n)&&"border-box"===S.css(e,"boxSizing",!1,i),s=n?Ke(e,u,n,a,i):0;return a&&o&&(s-=Math.ceil(e["offset"+u[0].toUpperCase()+u.slice(1)]-parseFloat(i[u])-Ke(e,u,"border",!1,i)-.5)),s&&(r=te.exec(t))&&"px"!==(r[3]||"px")&&(e.style[u]=t,t=S.css(e,u)),Je(0,t,s)}}}),S.cssHooks.marginLeft=$e(y.reliableMarginLeft,function(e,t){if(t)return(parseFloat(Be(e,"marginLeft"))||e.getBoundingClientRect().left-We(e,{marginLeft:0},function(){return e.getBoundingClientRect().left}))+"px"}),S.each({margin:"",padding:"",border:"Width"},function(i,o){S.cssHooks[i+o]={expand:function(e){for(var t=0,n={},r="string"==typeof e?e.split(" "):[e];t<4;t++)n[i+ne[t]+o]=r[t]||r[t-2]||r[0];return n}},"margin"!==i&&(S.cssHooks[i+o].set=Je)}),S.fn.extend({css:function(e,t){return $(this,function(e,t,n){var r,i,o={},a=0;if(Array.isArray(t)){for(r=Ie(e),i=t.length;a<i;a++)o[t[a]]=S.css(e,t[a],!1,r);return o}return void 0!==n?S.style(e,t,n):S.css(e,t)},e,t,1<arguments.length)}}),((S.Tween=et).prototype={constructor:et,init:function(e,t,n,r,i,o){this.elem=e,this.prop=n,this.easing=i||S.easing._default,this.options=t,this.start=this.now=this.cur(),this.end=r,this.unit=o||(S.cssNumber[n]?"":"px")},cur:function(){var e=et.propHooks[this.prop];return e&&e.get?e.get(this):et.propHooks._default.get(this)},run:function(e){var t,n=et.propHooks[this.prop];return this.options.duration?this.pos=t=S.easing[this.easing](e,this.options.duration*e,0,1,this.options.duration):this.pos=t=e,this.now=(this.end-this.start)*t+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),n&&n.set?n.set(this):et.propHooks._default.set(this),this}}).init.prototype=et.prototype,(et.propHooks={_default:{get:function(e){var t;return 1!==e.elem.nodeType||null!=e.elem[e.prop]&&null==e.elem.style[e.prop]?e.elem[e.prop]:(t=S.css(e.elem,e.prop,""))&&"auto"!==t?t:0},set:function(e){S.fx.step[e.prop]?S.fx.step[e.prop](e):1!==e.elem.nodeType||!S.cssHooks[e.prop]&&null==e.elem.style[Xe(e.prop)]?e.elem[e.prop]=e.now:S.style(e.elem,e.prop,e.now+e.unit)}}}).scrollTop=et.propHooks.scrollLeft={set:function(e){e.elem.nodeType&&e.elem.parentNode&&(e.elem[e.prop]=e.now)}},S.easing={linear:function(e){return e},swing:function(e){return.5-Math.cos(e*Math.PI)/2},_default:"swing"},S.fx=et.prototype.init,S.fx.step={};var tt,nt,rt,it,ot=/^(?:toggle|show|hide)$/,at=/queueHooks$/;function st(){nt&&(!1===E.hidden&&C.requestAnimationFrame?C.requestAnimationFrame(st):C.setTimeout(st,S.fx.interval),S.fx.tick())}function ut(){return C.setTimeout(function(){tt=void 0}),tt=Date.now()}function lt(e,t){var n,r=0,i={height:e};for(t=t?1:0;r<4;r+=2-t)i["margin"+(n=ne[r])]=i["padding"+n]=e;return t&&(i.opacity=i.width=e),i}function ct(e,t,n){for(var r,i=(ft.tweeners[t]||[]).concat(ft.tweeners["*"]),o=0,a=i.length;o<a;o++)if(r=i[o].call(n,t,e))return r}function ft(o,e,t){var n,a,r=0,i=ft.prefilters.length,s=S.Deferred().always(function(){delete u.elem}),u=function(){if(a)return!1;for(var e=tt||ut(),t=Math.max(0,l.startTime+l.duration-e),n=1-(t/l.duration||0),r=0,i=l.tweens.length;r<i;r++)l.tweens[r].run(n);return s.notifyWith(o,[l,n,t]),n<1&&i?t:(i||s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l]),!1)},l=s.promise({elem:o,props:S.extend({},e),opts:S.extend(!0,{specialEasing:{},easing:S.easing._default},t),originalProperties:e,originalOptions:t,startTime:tt||ut(),duration:t.duration,tweens:[],createTween:function(e,t){var n=S.Tween(o,l.opts,e,t,l.opts.specialEasing[e]||l.opts.easing);return l.tweens.push(n),n},stop:function(e){var t=0,n=e?l.tweens.length:0;if(a)return this;for(a=!0;t<n;t++)l.tweens[t].run(1);return e?(s.notifyWith(o,[l,1,0]),s.resolveWith(o,[l,e])):s.rejectWith(o,[l,e]),this}}),c=l.props;for(!function(e,t){var n,r,i,o,a;for(n in e)if(i=t[r=X(n)],o=e[n],Array.isArray(o)&&(i=o[1],o=e[n]=o[0]),n!==r&&(e[r]=o,delete e[n]),(a=S.cssHooks[r])&&"expand"in a)for(n in o=a.expand(o),delete e[r],o)n in e||(e[n]=o[n],t[n]=i);else t[r]=i}(c,l.opts.specialEasing);r<i;r++)if(n=ft.prefilters[r].call(l,o,c,l.opts))return m(n.stop)&&(S._queueHooks(l.elem,l.opts.queue).stop=n.stop.bind(n)),n;return S.map(c,ct,l),m(l.opts.start)&&l.opts.start.call(o,l),l.progress(l.opts.progress).done(l.opts.done,l.opts.complete).fail(l.opts.fail).always(l.opts.always),S.fx.timer(S.extend(u,{elem:o,anim:l,queue:l.opts.queue})),l}S.Animation=S.extend(ft,{tweeners:{"*":[function(e,t){var n=this.createTween(e,t);return se(n.elem,e,te.exec(t),n),n}]},tweener:function(e,t){m(e)?(t=e,e=["*"]):e=e.match(P);for(var n,r=0,i=e.length;r<i;r++)n=e[r],ft.tweeners[n]=ft.tweeners[n]||[],ft.tweeners[n].unshift(t)},prefilters:[function(e,t,n){var r,i,o,a,s,u,l,c,f="width"in t||"height"in t,p=this,d={},h=e.style,g=e.nodeType&&ae(e),v=Y.get(e,"fxshow");for(r in n.queue||(null==(a=S._queueHooks(e,"fx")).unqueued&&(a.unqueued=0,s=a.empty.fire,a.empty.fire=function(){a.unqueued||s()}),a.unqueued++,p.always(function(){p.always(function(){a.unqueued--,S.queue(e,"fx").length||a.empty.fire()})})),t)if(i=t[r],ot.test(i)){if(delete t[r],o=o||"toggle"===i,i===(g?"hide":"show")){if("show"!==i||!v||void 0===v[r])continue;g=!0}d[r]=v&&v[r]||S.style(e,r)}if((u=!S.isEmptyObject(t))||!S.isEmptyObject(d))for(r in f&&1===e.nodeType&&(n.overflow=[h.overflow,h.overflowX,h.overflowY],null==(l=v&&v.display)&&(l=Y.get(e,"display")),"none"===(c=S.css(e,"display"))&&(l?c=l:(le([e],!0),l=e.style.display||l,c=S.css(e,"display"),le([e]))),("inline"===c||"inline-block"===c&&null!=l)&&"none"===S.css(e,"float")&&(u||(p.done(function(){h.display=l}),null==l&&(c=h.display,l="none"===c?"":c)),h.display="inline-block")),n.overflow&&(h.overflow="hidden",p.always(function(){h.overflow=n.overflow[0],h.overflowX=n.overflow[1],h.overflowY=n.overflow[2]})),u=!1,d)u||(v?"hidden"in v&&(g=v.hidden):v=Y.access(e,"fxshow",{display:l}),o&&(v.hidden=!g),g&&le([e],!0),p.done(function(){for(r in g||le([e]),Y.remove(e,"fxshow"),d)S.style(e,r,d[r])})),u=ct(g?v[r]:0,r,p),r in v||(v[r]=u.start,g&&(u.end=u.start,u.start=0))}],prefilter:function(e,t){t?ft.prefilters.unshift(e):ft.prefilters.push(e)}}),S.speed=function(e,t,n){var r=e&&"object"==typeof e?S.extend({},e):{complete:n||!n&&t||m(e)&&e,duration:e,easing:n&&t||t&&!m(t)&&t};return S.fx.off?r.duration=0:"number"!=typeof r.duration&&(r.duration in S.fx.speeds?r.duration=S.fx.speeds[r.duration]:r.duration=S.fx.speeds._default),null!=r.queue&&!0!==r.queue||(r.queue="fx"),r.old=r.complete,r.complete=function(){m(r.old)&&r.old.call(this),r.queue&&S.dequeue(this,r.queue)},r},S.fn.extend({fadeTo:function(e,t,n,r){return this.filter(ae).css("opacity",0).show().end().animate({opacity:t},e,n,r)},animate:function(t,e,n,r){var i=S.isEmptyObject(t),o=S.speed(e,n,r),a=function(){var e=ft(this,S.extend({},t),o);(i||Y.get(this,"finish"))&&e.stop(!0)};return a.finish=a,i||!1===o.queue?this.each(a):this.queue(o.queue,a)},stop:function(i,e,o){var a=function(e){var t=e.stop;delete e.stop,t(o)};return"string"!=typeof i&&(o=e,e=i,i=void 0),e&&this.queue(i||"fx",[]),this.each(function(){var e=!0,t=null!=i&&i+"queueHooks",n=S.timers,r=Y.get(this);if(t)r[t]&&r[t].stop&&a(r[t]);else for(t in r)r[t]&&r[t].stop&&at.test(t)&&a(r[t]);for(t=n.length;t--;)n[t].elem!==this||null!=i&&n[t].queue!==i||(n[t].anim.stop(o),e=!1,n.splice(t,1));!e&&o||S.dequeue(this,i)})},finish:function(a){return!1!==a&&(a=a||"fx"),this.each(function(){var e,t=Y.get(this),n=t[a+"queue"],r=t[a+"queueHooks"],i=S.timers,o=n?n.length:0;for(t.finish=!0,S.queue(this,a,[]),r&&r.stop&&r.stop.call(this,!0),e=i.length;e--;)i[e].elem===this&&i[e].queue===a&&(i[e].anim.stop(!0),i.splice(e,1));for(e=0;e<o;e++)n[e]&&n[e].finish&&n[e].finish.call(this);delete t.finish})}}),S.each(["toggle","show","hide"],function(e,r){var i=S.fn[r];S.fn[r]=function(e,t,n){return null==e||"boolean"==typeof e?i.apply(this,arguments):this.animate(lt(r,!0),e,t,n)}}),S.each({slideDown:lt("show"),slideUp:lt("hide"),slideToggle:lt("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,r){S.fn[e]=function(e,t,n){return this.animate(r,e,t,n)}}),S.timers=[],S.fx.tick=function(){var e,t=0,n=S.timers;for(tt=Date.now();t<n.length;t++)(e=n[t])()||n[t]!==e||n.splice(t--,1);n.length||S.fx.stop(),tt=void 0},S.fx.timer=function(e){S.timers.push(e),S.fx.start()},S.fx.interval=13,S.fx.start=function(){nt||(nt=!0,st())},S.fx.stop=function(){nt=null},S.fx.speeds={slow:600,fast:200,_default:400},S.fn.delay=function(r,e){return r=S.fx&&S.fx.speeds[r]||r,e=e||"fx",this.queue(e,function(e,t){var n=C.setTimeout(e,r);t.stop=function(){C.clearTimeout(n)}})},rt=E.createElement("input"),it=E.createElement("select").appendChild(E.createElement("option")),rt.type="checkbox",y.checkOn=""!==rt.value,y.optSelected=it.selected,(rt=E.createElement("input")).value="t",rt.type="radio",y.radioValue="t"===rt.value;var pt,dt=S.expr.attrHandle;S.fn.extend({attr:function(e,t){return $(this,S.attr,e,t,1<arguments.length)},removeAttr:function(e){return this.each(function(){S.removeAttr(this,e)})}}),S.extend({attr:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return"undefined"==typeof e.getAttribute?S.prop(e,t,n):(1===o&&S.isXMLDoc(e)||(i=S.attrHooks[t.toLowerCase()]||(S.expr.match.bool.test(t)?pt:void 0)),void 0!==n?null===n?void S.removeAttr(e,t):i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:(e.setAttribute(t,n+""),n):i&&"get"in i&&null!==(r=i.get(e,t))?r:null==(r=S.find.attr(e,t))?void 0:r)},attrHooks:{type:{set:function(e,t){if(!y.radioValue&&"radio"===t&&A(e,"input")){var n=e.value;return e.setAttribute("type",t),n&&(e.value=n),t}}}},removeAttr:function(e,t){var n,r=0,i=t&&t.match(P);if(i&&1===e.nodeType)while(n=i[r++])e.removeAttribute(n)}}),pt={set:function(e,t,n){return!1===t?S.removeAttr(e,n):e.setAttribute(n,n),n}},S.each(S.expr.match.bool.source.match(/\w+/g),function(e,t){var a=dt[t]||S.find.attr;dt[t]=function(e,t,n){var r,i,o=t.toLowerCase();return n||(i=dt[o],dt[o]=r,r=null!=a(e,t,n)?o:null,dt[o]=i),r}});var ht=/^(?:input|select|textarea|button)$/i,gt=/^(?:a|area)$/i;function vt(e){return(e.match(P)||[]).join(" ")}function yt(e){return e.getAttribute&&e.getAttribute("class")||""}function mt(e){return Array.isArray(e)?e:"string"==typeof e&&e.match(P)||[]}S.fn.extend({prop:function(e,t){return $(this,S.prop,e,t,1<arguments.length)},removeProp:function(e){return this.each(function(){delete this[S.propFix[e]||e]})}}),S.extend({prop:function(e,t,n){var r,i,o=e.nodeType;if(3!==o&&8!==o&&2!==o)return 1===o&&S.isXMLDoc(e)||(t=S.propFix[t]||t,i=S.propHooks[t]),void 0!==n?i&&"set"in i&&void 0!==(r=i.set(e,n,t))?r:e[t]=n:i&&"get"in i&&null!==(r=i.get(e,t))?r:e[t]},propHooks:{tabIndex:{get:function(e){var t=S.find.attr(e,"tabindex");return t?parseInt(t,10):ht.test(e.nodeName)||gt.test(e.nodeName)&&e.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),y.optSelected||(S.propHooks.selected={get:function(e){var t=e.parentNode;return t&&t.parentNode&&t.parentNode.selectedIndex,null},set:function(e){var t=e.parentNode;t&&(t.selectedIndex,t.parentNode&&t.parentNode.selectedIndex)}}),S.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){S.propFix[this.toLowerCase()]=this}),S.fn.extend({addClass:function(t){var e,n,r,i,o,a,s,u=0;if(m(t))return this.each(function(e){S(this).addClass(t.call(this,e,yt(this)))});if((e=mt(t)).length)while(n=this[u++])if(i=yt(n),r=1===n.nodeType&&" "+vt(i)+" "){a=0;while(o=e[a++])r.indexOf(" "+o+" ")<0&&(r+=o+" ");i!==(s=vt(r))&&n.setAttribute("class",s)}return this},removeClass:function(t){var e,n,r,i,o,a,s,u=0;if(m(t))return this.each(function(e){S(this).removeClass(t.call(this,e,yt(this)))});if(!arguments.length)return this.attr("class","");if((e=mt(t)).length)while(n=this[u++])if(i=yt(n),r=1===n.nodeType&&" "+vt(i)+" "){a=0;while(o=e[a++])while(-1<r.indexOf(" "+o+" "))r=r.replace(" "+o+" "," ");i!==(s=vt(r))&&n.setAttribute("class",s)}return this},toggleClass:function(i,t){var o=typeof i,a="string"===o||Array.isArray(i);return"boolean"==typeof t&&a?t?this.addClass(i):this.removeClass(i):m(i)?this.each(function(e){S(this).toggleClass(i.call(this,e,yt(this),t),t)}):this.each(function(){var e,t,n,r;if(a){t=0,n=S(this),r=mt(i);while(e=r[t++])n.hasClass(e)?n.removeClass(e):n.addClass(e)}else void 0!==i&&"boolean"!==o||((e=yt(this))&&Y.set(this,"__className__",e),this.setAttribute&&this.setAttribute("class",e||!1===i?"":Y.get(this,"__className__")||""))})},hasClass:function(e){var t,n,r=0;t=" "+e+" ";while(n=this[r++])if(1===n.nodeType&&-1<(" "+vt(yt(n))+" ").indexOf(t))return!0;return!1}});var xt=/\r/g;S.fn.extend({val:function(n){var r,e,i,t=this[0];return arguments.length?(i=m(n),this.each(function(e){var t;1===this.nodeType&&(null==(t=i?n.call(this,e,S(this).val()):n)?t="":"number"==typeof t?t+="":Array.isArray(t)&&(t=S.map(t,function(e){return null==e?"":e+""})),(r=S.valHooks[this.type]||S.valHooks[this.nodeName.toLowerCase()])&&"set"in r&&void 0!==r.set(this,t,"value")||(this.value=t))})):t?(r=S.valHooks[t.type]||S.valHooks[t.nodeName.toLowerCase()])&&"get"in r&&void 0!==(e=r.get(t,"value"))?e:"string"==typeof(e=t.value)?e.replace(xt,""):null==e?"":e:void 0}}),S.extend({valHooks:{option:{get:function(e){var t=S.find.attr(e,"value");return null!=t?t:vt(S.text(e))}},select:{get:function(e){var t,n,r,i=e.options,o=e.selectedIndex,a="select-one"===e.type,s=a?null:[],u=a?o+1:i.length;for(r=o<0?u:a?o:0;r<u;r++)if(((n=i[r]).selected||r===o)&&!n.disabled&&(!n.parentNode.disabled||!A(n.parentNode,"optgroup"))){if(t=S(n).val(),a)return t;s.push(t)}return s},set:function(e,t){var n,r,i=e.options,o=S.makeArray(t),a=i.length;while(a--)((r=i[a]).selected=-1<S.inArray(S.valHooks.option.get(r),o))&&(n=!0);return n||(e.selectedIndex=-1),o}}}}),S.each(["radio","checkbox"],function(){S.valHooks[this]={set:function(e,t){if(Array.isArray(t))return e.checked=-1<S.inArray(S(e).val(),t)}},y.checkOn||(S.valHooks[this].get=function(e){return null===e.getAttribute("value")?"on":e.value})}),y.focusin="onfocusin"in C;var bt=/^(?:focusinfocus|focusoutblur)$/,wt=function(e){e.stopPropagation()};S.extend(S.event,{trigger:function(e,t,n,r){var i,o,a,s,u,l,c,f,p=[n||E],d=v.call(e,"type")?e.type:e,h=v.call(e,"namespace")?e.namespace.split("."):[];if(o=f=a=n=n||E,3!==n.nodeType&&8!==n.nodeType&&!bt.test(d+S.event.triggered)&&(-1<d.indexOf(".")&&(d=(h=d.split(".")).shift(),h.sort()),u=d.indexOf(":")<0&&"on"+d,(e=e[S.expando]?e:new S.Event(d,"object"==typeof e&&e)).isTrigger=r?2:3,e.namespace=h.join("."),e.rnamespace=e.namespace?new RegExp("(^|\\.)"+h.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,e.result=void 0,e.target||(e.target=n),t=null==t?[e]:S.makeArray(t,[e]),c=S.event.special[d]||{},r||!c.trigger||!1!==c.trigger.apply(n,t))){if(!r&&!c.noBubble&&!x(n)){for(s=c.delegateType||d,bt.test(s+d)||(o=o.parentNode);o;o=o.parentNode)p.push(o),a=o;a===(n.ownerDocument||E)&&p.push(a.defaultView||a.parentWindow||C)}i=0;while((o=p[i++])&&!e.isPropagationStopped())f=o,e.type=1<i?s:c.bindType||d,(l=(Y.get(o,"events")||Object.create(null))[e.type]&&Y.get(o,"handle"))&&l.apply(o,t),(l=u&&o[u])&&l.apply&&V(o)&&(e.result=l.apply(o,t),!1===e.result&&e.preventDefault());return e.type=d,r||e.isDefaultPrevented()||c._default&&!1!==c._default.apply(p.pop(),t)||!V(n)||u&&m(n[d])&&!x(n)&&((a=n[u])&&(n[u]=null),S.event.triggered=d,e.isPropagationStopped()&&f.addEventListener(d,wt),n[d](),e.isPropagationStopped()&&f.removeEventListener(d,wt),S.event.triggered=void 0,a&&(n[u]=a)),e.result}},simulate:function(e,t,n){var r=S.extend(new S.Event,n,{type:e,isSimulated:!0});S.event.trigger(r,null,t)}}),S.fn.extend({trigger:function(e,t){return this.each(function(){S.event.trigger(e,t,this)})},triggerHandler:function(e,t){var n=this[0];if(n)return S.event.trigger(e,t,n,!0)}}),y.focusin||S.each({focus:"focusin",blur:"focusout"},function(n,r){var i=function(e){S.event.simulate(r,e.target,S.event.fix(e))};S.event.special[r]={setup:function(){var e=this.ownerDocument||this.document||this,t=Y.access(e,r);t||e.addEventListener(n,i,!0),Y.access(e,r,(t||0)+1)},teardown:function(){var e=this.ownerDocument||this.document||this,t=Y.access(e,r)-1;t?Y.access(e,r,t):(e.removeEventListener(n,i,!0),Y.remove(e,r))}}});var Tt=C.location,Ct={guid:Date.now()},Et=/\?/;S.parseXML=function(e){var t;if(!e||"string"!=typeof e)return null;try{t=(new C.DOMParser).parseFromString(e,"text/xml")}catch(e){t=void 0}return t&&!t.getElementsByTagName("parsererror").length||S.error("Invalid XML: "+e),t};var St=/\[\]$/,kt=/\r?\n/g,At=/^(?:submit|button|image|reset|file)$/i,Nt=/^(?:input|select|textarea|keygen)/i;function Dt(n,e,r,i){var t;if(Array.isArray(e))S.each(e,function(e,t){r||St.test(n)?i(n,t):Dt(n+"["+("object"==typeof t&&null!=t?e:"")+"]",t,r,i)});else if(r||"object"!==w(e))i(n,e);else for(t in e)Dt(n+"["+t+"]",e[t],r,i)}S.param=function(e,t){var n,r=[],i=function(e,t){var n=m(t)?t():t;r[r.length]=encodeURIComponent(e)+"="+encodeURIComponent(null==n?"":n)};if(null==e)return"";if(Array.isArray(e)||e.jquery&&!S.isPlainObject(e))S.each(e,function(){i(this.name,this.value)});else for(n in e)Dt(n,e[n],t,i);return r.join("&")},S.fn.extend({serialize:function(){return S.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var e=S.prop(this,"elements");return e?S.makeArray(e):this}).filter(function(){var e=this.type;return this.name&&!S(this).is(":disabled")&&Nt.test(this.nodeName)&&!At.test(e)&&(this.checked||!pe.test(e))}).map(function(e,t){var n=S(this).val();return null==n?null:Array.isArray(n)?S.map(n,function(e){return{name:t.name,value:e.replace(kt,"\r\n")}}):{name:t.name,value:n.replace(kt,"\r\n")}}).get()}});var jt=/%20/g,qt=/#.*$/,Lt=/([?&])_=[^&]*/,Ht=/^(.*?):[ \t]*([^\r\n]*)$/gm,Ot=/^(?:GET|HEAD)$/,Pt=/^\/\//,Rt={},Mt={},It="*/".concat("*"),Wt=E.createElement("a");function Ft(o){return function(e,t){"string"!=typeof e&&(t=e,e="*");var n,r=0,i=e.toLowerCase().match(P)||[];if(m(t))while(n=i[r++])"+"===n[0]?(n=n.slice(1)||"*",(o[n]=o[n]||[]).unshift(t)):(o[n]=o[n]||[]).push(t)}}function Bt(t,i,o,a){var s={},u=t===Mt;function l(e){var r;return s[e]=!0,S.each(t[e]||[],function(e,t){var n=t(i,o,a);return"string"!=typeof n||u||s[n]?u?!(r=n):void 0:(i.dataTypes.unshift(n),l(n),!1)}),r}return l(i.dataTypes[0])||!s["*"]&&l("*")}function $t(e,t){var n,r,i=S.ajaxSettings.flatOptions||{};for(n in t)void 0!==t[n]&&((i[n]?e:r||(r={}))[n]=t[n]);return r&&S.extend(!0,e,r),e}Wt.href=Tt.href,S.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:Tt.href,type:"GET",isLocal:/^(?:about|app|app-storage|.+-extension|file|res|widget):$/.test(Tt.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":It,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":JSON.parse,"text xml":S.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(e,t){return t?$t($t(e,S.ajaxSettings),t):$t(S.ajaxSettings,e)},ajaxPrefilter:Ft(Rt),ajaxTransport:Ft(Mt),ajax:function(e,t){"object"==typeof e&&(t=e,e=void 0),t=t||{};var c,f,p,n,d,r,h,g,i,o,v=S.ajaxSetup({},t),y=v.context||v,m=v.context&&(y.nodeType||y.jquery)?S(y):S.event,x=S.Deferred(),b=S.Callbacks("once memory"),w=v.statusCode||{},a={},s={},u="canceled",T={readyState:0,getResponseHeader:function(e){var t;if(h){if(!n){n={};while(t=Ht.exec(p))n[t[1].toLowerCase()+" "]=(n[t[1].toLowerCase()+" "]||[]).concat(t[2])}t=n[e.toLowerCase()+" "]}return null==t?null:t.join(", ")},getAllResponseHeaders:function(){return h?p:null},setRequestHeader:function(e,t){return null==h&&(e=s[e.toLowerCase()]=s[e.toLowerCase()]||e,a[e]=t),this},overrideMimeType:function(e){return null==h&&(v.mimeType=e),this},statusCode:function(e){var t;if(e)if(h)T.always(e[T.status]);else for(t in e)w[t]=[w[t],e[t]];return this},abort:function(e){var t=e||u;return c&&c.abort(t),l(0,t),this}};if(x.promise(T),v.url=((e||v.url||Tt.href)+"").replace(Pt,Tt.protocol+"//"),v.type=t.method||t.type||v.method||v.type,v.dataTypes=(v.dataType||"*").toLowerCase().match(P)||[""],null==v.crossDomain){r=E.createElement("a");try{r.href=v.url,r.href=r.href,v.crossDomain=Wt.protocol+"//"+Wt.host!=r.protocol+"//"+r.host}catch(e){v.crossDomain=!0}}if(v.data&&v.processData&&"string"!=typeof v.data&&(v.data=S.param(v.data,v.traditional)),Bt(Rt,v,t,T),h)return T;for(i in(g=S.event&&v.global)&&0==S.active++&&S.event.trigger("ajaxStart"),v.type=v.type.toUpperCase(),v.hasContent=!Ot.test(v.type),f=v.url.replace(qt,""),v.hasContent?v.data&&v.processData&&0===(v.contentType||"").indexOf("application/x-www-form-urlencoded")&&(v.data=v.data.replace(jt,"+")):(o=v.url.slice(f.length),v.data&&(v.processData||"string"==typeof v.data)&&(f+=(Et.test(f)?"&":"?")+v.data,delete v.data),!1===v.cache&&(f=f.replace(Lt,"$1"),o=(Et.test(f)?"&":"?")+"_="+Ct.guid+++o),v.url=f+o),v.ifModified&&(S.lastModified[f]&&T.setRequestHeader("If-Modified-Since",S.lastModified[f]),S.etag[f]&&T.setRequestHeader("If-None-Match",S.etag[f])),(v.data&&v.hasContent&&!1!==v.contentType||t.contentType)&&T.setRequestHeader("Content-Type",v.contentType),T.setRequestHeader("Accept",v.dataTypes[0]&&v.accepts[v.dataTypes[0]]?v.accepts[v.dataTypes[0]]+("*"!==v.dataTypes[0]?", "+It+"; q=0.01":""):v.accepts["*"]),v.headers)T.setRequestHeader(i,v.headers[i]);if(v.beforeSend&&(!1===v.beforeSend.call(y,T,v)||h))return T.abort();if(u="abort",b.add(v.complete),T.done(v.success),T.fail(v.error),c=Bt(Mt,v,t,T)){if(T.readyState=1,g&&m.trigger("ajaxSend",[T,v]),h)return T;v.async&&0<v.timeout&&(d=C.setTimeout(function(){T.abort("timeout")},v.timeout));try{h=!1,c.send(a,l)}catch(e){if(h)throw e;l(-1,e)}}else l(-1,"No Transport");function l(e,t,n,r){var i,o,a,s,u,l=t;h||(h=!0,d&&C.clearTimeout(d),c=void 0,p=r||"",T.readyState=0<e?4:0,i=200<=e&&e<300||304===e,n&&(s=function(e,t,n){var r,i,o,a,s=e.contents,u=e.dataTypes;while("*"===u[0])u.shift(),void 0===r&&(r=e.mimeType||t.getResponseHeader("Content-Type"));if(r)for(i in s)if(s[i]&&s[i].test(r)){u.unshift(i);break}if(u[0]in n)o=u[0];else{for(i in n){if(!u[0]||e.converters[i+" "+u[0]]){o=i;break}a||(a=i)}o=o||a}if(o)return o!==u[0]&&u.unshift(o),n[o]}(v,T,n)),!i&&-1<S.inArray("script",v.dataTypes)&&(v.converters["text script"]=function(){}),s=function(e,t,n,r){var i,o,a,s,u,l={},c=e.dataTypes.slice();if(c[1])for(a in e.converters)l[a.toLowerCase()]=e.converters[a];o=c.shift();while(o)if(e.responseFields[o]&&(n[e.responseFields[o]]=t),!u&&r&&e.dataFilter&&(t=e.dataFilter(t,e.dataType)),u=o,o=c.shift())if("*"===o)o=u;else if("*"!==u&&u!==o){if(!(a=l[u+" "+o]||l["* "+o]))for(i in l)if((s=i.split(" "))[1]===o&&(a=l[u+" "+s[0]]||l["* "+s[0]])){!0===a?a=l[i]:!0!==l[i]&&(o=s[0],c.unshift(s[1]));break}if(!0!==a)if(a&&e["throws"])t=a(t);else try{t=a(t)}catch(e){return{state:"parsererror",error:a?e:"No conversion from "+u+" to "+o}}}return{state:"success",data:t}}(v,s,T,i),i?(v.ifModified&&((u=T.getResponseHeader("Last-Modified"))&&(S.lastModified[f]=u),(u=T.getResponseHeader("etag"))&&(S.etag[f]=u)),204===e||"HEAD"===v.type?l="nocontent":304===e?l="notmodified":(l=s.state,o=s.data,i=!(a=s.error))):(a=l,!e&&l||(l="error",e<0&&(e=0))),T.status=e,T.statusText=(t||l)+"",i?x.resolveWith(y,[o,l,T]):x.rejectWith(y,[T,l,a]),T.statusCode(w),w=void 0,g&&m.trigger(i?"ajaxSuccess":"ajaxError",[T,v,i?o:a]),b.fireWith(y,[T,l]),g&&(m.trigger("ajaxComplete",[T,v]),--S.active||S.event.trigger("ajaxStop")))}return T},getJSON:function(e,t,n){return S.get(e,t,n,"json")},getScript:function(e,t){return S.get(e,void 0,t,"script")}}),S.each(["get","post"],function(e,i){S[i]=function(e,t,n,r){return m(t)&&(r=r||n,n=t,t=void 0),S.ajax(S.extend({url:e,type:i,dataType:r,data:t,success:n},S.isPlainObject(e)&&e))}}),S.ajaxPrefilter(function(e){var t;for(t in e.headers)"content-type"===t.toLowerCase()&&(e.contentType=e.headers[t]||"")}),S._evalUrl=function(e,t,n){return S.ajax({url:e,type:"GET",dataType:"script",cache:!0,async:!1,global:!1,converters:{"text script":function(){}},dataFilter:function(e){S.globalEval(e,t,n)}})},S.fn.extend({wrapAll:function(e){var t;return this[0]&&(m(e)&&(e=e.call(this[0])),t=S(e,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&t.insertBefore(this[0]),t.map(function(){var e=this;while(e.firstElementChild)e=e.firstElementChild;return e}).append(this)),this},wrapInner:function(n){return m(n)?this.each(function(e){S(this).wrapInner(n.call(this,e))}):this.each(function(){var e=S(this),t=e.contents();t.length?t.wrapAll(n):e.append(n)})},wrap:function(t){var n=m(t);return this.each(function(e){S(this).wrapAll(n?t.call(this,e):t)})},unwrap:function(e){return this.parent(e).not("body").each(function(){S(this).replaceWith(this.childNodes)}),this}}),S.expr.pseudos.hidden=function(e){return!S.expr.pseudos.visible(e)},S.expr.pseudos.visible=function(e){return!!(e.offsetWidth||e.offsetHeight||e.getClientRects().length)},S.ajaxSettings.xhr=function(){try{return new C.XMLHttpRequest}catch(e){}};var _t={0:200,1223:204},zt=S.ajaxSettings.xhr();y.cors=!!zt&&"withCredentials"in zt,y.ajax=zt=!!zt,S.ajaxTransport(function(i){var o,a;if(y.cors||zt&&!i.crossDomain)return{send:function(e,t){var n,r=i.xhr();if(r.open(i.type,i.url,i.async,i.username,i.password),i.xhrFields)for(n in i.xhrFields)r[n]=i.xhrFields[n];for(n in i.mimeType&&r.overrideMimeType&&r.overrideMimeType(i.mimeType),i.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest"),e)r.setRequestHeader(n,e[n]);o=function(e){return function(){o&&(o=a=r.onload=r.onerror=r.onabort=r.ontimeout=r.onreadystatechange=null,"abort"===e?r.abort():"error"===e?"number"!=typeof r.status?t(0,"error"):t(r.status,r.statusText):t(_t[r.status]||r.status,r.statusText,"text"!==(r.responseType||"text")||"string"!=typeof r.responseText?{binary:r.response}:{text:r.responseText},r.getAllResponseHeaders()))}},r.onload=o(),a=r.onerror=r.ontimeout=o("error"),void 0!==r.onabort?r.onabort=a:r.onreadystatechange=function(){4===r.readyState&&C.setTimeout(function(){o&&a()})},o=o("abort");try{r.send(i.hasContent&&i.data||null)}catch(e){if(o)throw e}},abort:function(){o&&o()}}}),S.ajaxPrefilter(function(e){e.crossDomain&&(e.contents.script=!1)}),S.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(e){return S.globalEval(e),e}}}),S.ajaxPrefilter("script",function(e){void 0===e.cache&&(e.cache=!1),e.crossDomain&&(e.type="GET")}),S.ajaxTransport("script",function(n){var r,i;if(n.crossDomain||n.scriptAttrs)return{send:function(e,t){r=S("<script>").attr(n.scriptAttrs||{}).prop({charset:n.scriptCharset,src:n.url}).on("load error",i=function(e){r.remove(),i=null,e&&t("error"===e.type?404:200,e.type)}),E.head.appendChild(r[0])},abort:function(){i&&i()}}});var Ut,Xt=[],Vt=/(=)\?(?=&|$)|\?\?/;S.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var e=Xt.pop()||S.expando+"_"+Ct.guid++;return this[e]=!0,e}}),S.ajaxPrefilter("json jsonp",function(e,t,n){var r,i,o,a=!1!==e.jsonp&&(Vt.test(e.url)?"url":"string"==typeof e.data&&0===(e.contentType||"").indexOf("application/x-www-form-urlencoded")&&Vt.test(e.data)&&"data");if(a||"jsonp"===e.dataTypes[0])return r=e.jsonpCallback=m(e.jsonpCallback)?e.jsonpCallback():e.jsonpCallback,a?e[a]=e[a].replace(Vt,"$1"+r):!1!==e.jsonp&&(e.url+=(Et.test(e.url)?"&":"?")+e.jsonp+"="+r),e.converters["script json"]=function(){return o||S.error(r+" was not called"),o[0]},e.dataTypes[0]="json",i=C[r],C[r]=function(){o=arguments},n.always(function(){void 0===i?S(C).removeProp(r):C[r]=i,e[r]&&(e.jsonpCallback=t.jsonpCallback,Xt.push(r)),o&&m(i)&&i(o[0]),o=i=void 0}),"script"}),y.createHTMLDocument=((Ut=E.implementation.createHTMLDocument("").body).innerHTML="<form></form><form></form>",2===Ut.childNodes.length),S.parseHTML=function(e,t,n){return"string"!=typeof e?[]:("boolean"==typeof t&&(n=t,t=!1),t||(y.createHTMLDocument?((r=(t=E.implementation.createHTMLDocument("")).createElement("base")).href=E.location.href,t.head.appendChild(r)):t=E),o=!n&&[],(i=N.exec(e))?[t.createElement(i[1])]:(i=xe([e],t,o),o&&o.length&&S(o).remove(),S.merge([],i.childNodes)));var r,i,o},S.fn.load=function(e,t,n){var r,i,o,a=this,s=e.indexOf(" ");return-1<s&&(r=vt(e.slice(s)),e=e.slice(0,s)),m(t)?(n=t,t=void 0):t&&"object"==typeof t&&(i="POST"),0<a.length&&S.ajax({url:e,type:i||"GET",dataType:"html",data:t}).done(function(e){o=arguments,a.html(r?S("<div>").append(S.parseHTML(e)).find(r):e)}).always(n&&function(e,t){a.each(function(){n.apply(this,o||[e.responseText,t,e])})}),this},S.expr.pseudos.animated=function(t){return S.grep(S.timers,function(e){return t===e.elem}).length},S.offset={setOffset:function(e,t,n){var r,i,o,a,s,u,l=S.css(e,"position"),c=S(e),f={};"static"===l&&(e.style.position="relative"),s=c.offset(),o=S.css(e,"top"),u=S.css(e,"left"),("absolute"===l||"fixed"===l)&&-1<(o+u).indexOf("auto")?(a=(r=c.position()).top,i=r.left):(a=parseFloat(o)||0,i=parseFloat(u)||0),m(t)&&(t=t.call(e,n,S.extend({},s))),null!=t.top&&(f.top=t.top-s.top+a),null!=t.left&&(f.left=t.left-s.left+i),"using"in t?t.using.call(e,f):("number"==typeof f.top&&(f.top+="px"),"number"==typeof f.left&&(f.left+="px"),c.css(f))}},S.fn.extend({offset:function(t){if(arguments.length)return void 0===t?this:this.each(function(e){S.offset.setOffset(this,t,e)});var e,n,r=this[0];return r?r.getClientRects().length?(e=r.getBoundingClientRect(),n=r.ownerDocument.defaultView,{top:e.top+n.pageYOffset,left:e.left+n.pageXOffset}):{top:0,left:0}:void 0},position:function(){if(this[0]){var e,t,n,r=this[0],i={top:0,left:0};if("fixed"===S.css(r,"position"))t=r.getBoundingClientRect();else{t=this.offset(),n=r.ownerDocument,e=r.offsetParent||n.documentElement;while(e&&(e===n.body||e===n.documentElement)&&"static"===S.css(e,"position"))e=e.parentNode;e&&e!==r&&1===e.nodeType&&((i=S(e).offset()).top+=S.css(e,"borderTopWidth",!0),i.left+=S.css(e,"borderLeftWidth",!0))}return{top:t.top-i.top-S.css(r,"marginTop",!0),left:t.left-i.left-S.css(r,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var e=this.offsetParent;while(e&&"static"===S.css(e,"position"))e=e.offsetParent;return e||re})}}),S.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(t,i){var o="pageYOffset"===i;S.fn[t]=function(e){return $(this,function(e,t,n){var r;if(x(e)?r=e:9===e.nodeType&&(r=e.defaultView),void 0===n)return r?r[i]:e[t];r?r.scrollTo(o?r.pageXOffset:n,o?n:r.pageYOffset):e[t]=n},t,e,arguments.length)}}),S.each(["top","left"],function(e,n){S.cssHooks[n]=$e(y.pixelPosition,function(e,t){if(t)return t=Be(e,n),Me.test(t)?S(e).position()[n]+"px":t})}),S.each({Height:"height",Width:"width"},function(a,s){S.each({padding:"inner"+a,content:s,"":"outer"+a},function(r,o){S.fn[o]=function(e,t){var n=arguments.length&&(r||"boolean"!=typeof e),i=r||(!0===e||!0===t?"margin":"border");return $(this,function(e,t,n){var r;return x(e)?0===o.indexOf("outer")?e["inner"+a]:e.document.documentElement["client"+a]:9===e.nodeType?(r=e.documentElement,Math.max(e.body["scroll"+a],r["scroll"+a],e.body["offset"+a],r["offset"+a],r["client"+a])):void 0===n?S.css(e,t,i):S.style(e,t,n,i)},s,n?e:void 0,n)}})}),S.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(e,t){S.fn[t]=function(e){return this.on(t,e)}}),S.fn.extend({bind:function(e,t,n){return this.on(e,null,t,n)},unbind:function(e,t){return this.off(e,null,t)},delegate:function(e,t,n,r){return this.on(t,e,n,r)},undelegate:function(e,t,n){return 1===arguments.length?this.off(e,"**"):this.off(t,e||"**",n)},hover:function(e,t){return this.mouseenter(e).mouseleave(t||e)}}),S.each("blur focus focusin focusout resize scroll click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup contextmenu".split(" "),function(e,n){S.fn[n]=function(e,t){return 0<arguments.length?this.on(n,null,e,t):this.trigger(n)}});var Gt=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g;S.proxy=function(e,t){var n,r,i;if("string"==typeof t&&(n=e[t],t=e,e=n),m(e))return r=s.call(arguments,2),(i=function(){return e.apply(t||this,r.concat(s.call(arguments)))}).guid=e.guid=e.guid||S.guid++,i},S.holdReady=function(e){e?S.readyWait++:S.ready(!0)},S.isArray=Array.isArray,S.parseJSON=JSON.parse,S.nodeName=A,S.isFunction=m,S.isWindow=x,S.camelCase=X,S.type=w,S.now=Date.now,S.isNumeric=function(e){var t=S.type(e);return("number"===t||"string"===t)&&!isNaN(e-parseFloat(e))},S.trim=function(e){return null==e?"":(e+"").replace(Gt,"")},"function"==typeof define&&define.amd&&define("jquery",[],function(){return S});var Yt=C.jQuery,Qt=C.$;return S.noConflict=function(e){return C.$===S&&(C.$=Qt),e&&C.jQuery===S&&(C.jQuery=Yt),S},"undefined"==typeof e&&(C.jQuery=C.$=S),S});
+jQuery.noConflict();
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/accordion.js b/wp-includes/js/jquery/ui/accordion.js
new file mode 100644
index 0000000000..c1b3f26e8e
--- /dev/null
+++ b/wp-includes/js/jquery/ui/accordion.js
@@ -0,0 +1,610 @@
+/*!
+ * jQuery UI Accordion 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Accordion
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Displays collapsible content panels for presenting information in a limited amount of space.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/accordion/
+//>>demos: http://jqueryui.com/accordion/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/accordion.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.accordion", {
+	version: "1.12.1",
+	options: {
+		active: 0,
+		animate: {},
+		classes: {
+			"ui-accordion-header": "ui-corner-top",
+			"ui-accordion-header-collapsed": "ui-corner-all",
+			"ui-accordion-content": "ui-corner-bottom"
+		},
+		collapsible: false,
+		event: "click",
+		header: "> li > :first-child, > :not(li):even",
+		heightStyle: "auto",
+		icons: {
+			activeHeader: "ui-icon-triangle-1-s",
+			header: "ui-icon-triangle-1-e"
+		},
+
+		// Callbacks
+		activate: null,
+		beforeActivate: null
+	},
+
+	hideProps: {
+		borderTopWidth: "hide",
+		borderBottomWidth: "hide",
+		paddingTop: "hide",
+		paddingBottom: "hide",
+		height: "hide"
+	},
+
+	showProps: {
+		borderTopWidth: "show",
+		borderBottomWidth: "show",
+		paddingTop: "show",
+		paddingBottom: "show",
+		height: "show"
+	},
+
+	_create: function() {
+		var options = this.options;
+
+		this.prevShow = this.prevHide = $();
+		this._addClass( "ui-accordion", "ui-widget ui-helper-reset" );
+		this.element.attr( "role", "tablist" );
+
+		// Don't allow collapsible: false and active: false / null
+		if ( !options.collapsible && ( options.active === false || options.active == null ) ) {
+			options.active = 0;
+		}
+
+		this._processPanels();
+
+		// handle negative values
+		if ( options.active < 0 ) {
+			options.active += this.headers.length;
+		}
+		this._refresh();
+	},
+
+	_getCreateEventData: function() {
+		return {
+			header: this.active,
+			panel: !this.active.length ? $() : this.active.next()
+		};
+	},
+
+	_createIcons: function() {
+		var icon, children,
+			icons = this.options.icons;
+
+		if ( icons ) {
+			icon = $( "<span>" );
+			this._addClass( icon, "ui-accordion-header-icon", "ui-icon " + icons.header );
+			icon.prependTo( this.headers );
+			children = this.active.children( ".ui-accordion-header-icon" );
+			this._removeClass( children, icons.header )
+				._addClass( children, null, icons.activeHeader )
+				._addClass( this.headers, "ui-accordion-icons" );
+		}
+	},
+
+	_destroyIcons: function() {
+		this._removeClass( this.headers, "ui-accordion-icons" );
+		this.headers.children( ".ui-accordion-header-icon" ).remove();
+	},
+
+	_destroy: function() {
+		var contents;
+
+		// Clean up main element
+		this.element.removeAttr( "role" );
+
+		// Clean up headers
+		this.headers
+			.removeAttr( "role aria-expanded aria-selected aria-controls tabIndex" )
+			.removeUniqueId();
+
+		this._destroyIcons();
+
+		// Clean up content panels
+		contents = this.headers.next()
+			.css( "display", "" )
+			.removeAttr( "role aria-hidden aria-labelledby" )
+			.removeUniqueId();
+
+		if ( this.options.heightStyle !== "content" ) {
+			contents.css( "height", "" );
+		}
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "active" ) {
+
+			// _activate() will handle invalid values and update this.options
+			this._activate( value );
+			return;
+		}
+
+		if ( key === "event" ) {
+			if ( this.options.event ) {
+				this._off( this.headers, this.options.event );
+			}
+			this._setupEvents( value );
+		}
+
+		this._super( key, value );
+
+		// Setting collapsible: false while collapsed; open first panel
+		if ( key === "collapsible" && !value && this.options.active === false ) {
+			this._activate( 0 );
+		}
+
+		if ( key === "icons" ) {
+			this._destroyIcons();
+			if ( value ) {
+				this._createIcons();
+			}
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.element.attr( "aria-disabled", value );
+
+		// Support: IE8 Only
+		// #5332 / #6059 - opacity doesn't cascade to positioned elements in IE
+		// so we need to add the disabled class to the headers and panels
+		this._toggleClass( null, "ui-state-disabled", !!value );
+		this._toggleClass( this.headers.add( this.headers.next() ), null, "ui-state-disabled",
+			!!value );
+	},
+
+	_keydown: function( event ) {
+		if ( event.altKey || event.ctrlKey ) {
+			return;
+		}
+
+		var keyCode = $.ui.keyCode,
+			length = this.headers.length,
+			currentIndex = this.headers.index( event.target ),
+			toFocus = false;
+
+		switch ( event.keyCode ) {
+		case keyCode.RIGHT:
+		case keyCode.DOWN:
+			toFocus = this.headers[ ( currentIndex + 1 ) % length ];
+			break;
+		case keyCode.LEFT:
+		case keyCode.UP:
+			toFocus = this.headers[ ( currentIndex - 1 + length ) % length ];
+			break;
+		case keyCode.SPACE:
+		case keyCode.ENTER:
+			this._eventHandler( event );
+			break;
+		case keyCode.HOME:
+			toFocus = this.headers[ 0 ];
+			break;
+		case keyCode.END:
+			toFocus = this.headers[ length - 1 ];
+			break;
+		}
+
+		if ( toFocus ) {
+			$( event.target ).attr( "tabIndex", -1 );
+			$( toFocus ).attr( "tabIndex", 0 );
+			$( toFocus ).trigger( "focus" );
+			event.preventDefault();
+		}
+	},
+
+	_panelKeyDown: function( event ) {
+		if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) {
+			$( event.currentTarget ).prev().trigger( "focus" );
+		}
+	},
+
+	refresh: function() {
+		var options = this.options;
+		this._processPanels();
+
+		// Was collapsed or no panel
+		if ( ( options.active === false && options.collapsible === true ) ||
+				!this.headers.length ) {
+			options.active = false;
+			this.active = $();
+
+		// active false only when collapsible is true
+		} else if ( options.active === false ) {
+			this._activate( 0 );
+
+		// was active, but active panel is gone
+		} else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+
+			// all remaining panel are disabled
+			if ( this.headers.length === this.headers.find( ".ui-state-disabled" ).length ) {
+				options.active = false;
+				this.active = $();
+
+			// activate previous panel
+			} else {
+				this._activate( Math.max( 0, options.active - 1 ) );
+			}
+
+		// was active, active panel still exists
+		} else {
+
+			// make sure active index is correct
+			options.active = this.headers.index( this.active );
+		}
+
+		this._destroyIcons();
+
+		this._refresh();
+	},
+
+	_processPanels: function() {
+		var prevHeaders = this.headers,
+			prevPanels = this.panels;
+
+		this.headers = this.element.find( this.options.header );
+		this._addClass( this.headers, "ui-accordion-header ui-accordion-header-collapsed",
+			"ui-state-default" );
+
+		this.panels = this.headers.next().filter( ":not(.ui-accordion-content-active)" ).hide();
+		this._addClass( this.panels, "ui-accordion-content", "ui-helper-reset ui-widget-content" );
+
+		// Avoid memory leaks (#10056)
+		if ( prevPanels ) {
+			this._off( prevHeaders.not( this.headers ) );
+			this._off( prevPanels.not( this.panels ) );
+		}
+	},
+
+	_refresh: function() {
+		var maxHeight,
+			options = this.options,
+			heightStyle = options.heightStyle,
+			parent = this.element.parent();
+
+		this.active = this._findActive( options.active );
+		this._addClass( this.active, "ui-accordion-header-active", "ui-state-active" )
+			._removeClass( this.active, "ui-accordion-header-collapsed" );
+		this._addClass( this.active.next(), "ui-accordion-content-active" );
+		this.active.next().show();
+
+		this.headers
+			.attr( "role", "tab" )
+			.each( function() {
+				var header = $( this ),
+					headerId = header.uniqueId().attr( "id" ),
+					panel = header.next(),
+					panelId = panel.uniqueId().attr( "id" );
+				header.attr( "aria-controls", panelId );
+				panel.attr( "aria-labelledby", headerId );
+			} )
+			.next()
+				.attr( "role", "tabpanel" );
+
+		this.headers
+			.not( this.active )
+				.attr( {
+					"aria-selected": "false",
+					"aria-expanded": "false",
+					tabIndex: -1
+				} )
+				.next()
+					.attr( {
+						"aria-hidden": "true"
+					} )
+					.hide();
+
+		// Make sure at least one header is in the tab order
+		if ( !this.active.length ) {
+			this.headers.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			this.active.attr( {
+				"aria-selected": "true",
+				"aria-expanded": "true",
+				tabIndex: 0
+			} )
+				.next()
+					.attr( {
+						"aria-hidden": "false"
+					} );
+		}
+
+		this._createIcons();
+
+		this._setupEvents( options.event );
+
+		if ( heightStyle === "fill" ) {
+			maxHeight = parent.height();
+			this.element.siblings( ":visible" ).each( function() {
+				var elem = $( this ),
+					position = elem.css( "position" );
+
+				if ( position === "absolute" || position === "fixed" ) {
+					return;
+				}
+				maxHeight -= elem.outerHeight( true );
+			} );
+
+			this.headers.each( function() {
+				maxHeight -= $( this ).outerHeight( true );
+			} );
+
+			this.headers.next()
+				.each( function() {
+					$( this ).height( Math.max( 0, maxHeight -
+						$( this ).innerHeight() + $( this ).height() ) );
+				} )
+				.css( "overflow", "auto" );
+		} else if ( heightStyle === "auto" ) {
+			maxHeight = 0;
+			this.headers.next()
+				.each( function() {
+					var isVisible = $( this ).is( ":visible" );
+					if ( !isVisible ) {
+						$( this ).show();
+					}
+					maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() );
+					if ( !isVisible ) {
+						$( this ).hide();
+					}
+				} )
+				.height( maxHeight );
+		}
+	},
+
+	_activate: function( index ) {
+		var active = this._findActive( index )[ 0 ];
+
+		// Trying to activate the already active panel
+		if ( active === this.active[ 0 ] ) {
+			return;
+		}
+
+		// Trying to collapse, simulate a click on the currently active header
+		active = active || this.active[ 0 ];
+
+		this._eventHandler( {
+			target: active,
+			currentTarget: active,
+			preventDefault: $.noop
+		} );
+	},
+
+	_findActive: function( selector ) {
+		return typeof selector === "number" ? this.headers.eq( selector ) : $();
+	},
+
+	_setupEvents: function( event ) {
+		var events = {
+			keydown: "_keydown"
+		};
+		if ( event ) {
+			$.each( event.split( " " ), function( index, eventName ) {
+				events[ eventName ] = "_eventHandler";
+			} );
+		}
+
+		this._off( this.headers.add( this.headers.next() ) );
+		this._on( this.headers, events );
+		this._on( this.headers.next(), { keydown: "_panelKeyDown" } );
+		this._hoverable( this.headers );
+		this._focusable( this.headers );
+	},
+
+	_eventHandler: function( event ) {
+		var activeChildren, clickedChildren,
+			options = this.options,
+			active = this.active,
+			clicked = $( event.currentTarget ),
+			clickedIsActive = clicked[ 0 ] === active[ 0 ],
+			collapsing = clickedIsActive && options.collapsible,
+			toShow = collapsing ? $() : clicked.next(),
+			toHide = active.next(),
+			eventData = {
+				oldHeader: active,
+				oldPanel: toHide,
+				newHeader: collapsing ? $() : clicked,
+				newPanel: toShow
+			};
+
+		event.preventDefault();
+
+		if (
+
+				// click on active header, but not collapsible
+				( clickedIsActive && !options.collapsible ) ||
+
+				// allow canceling activation
+				( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+			return;
+		}
+
+		options.active = collapsing ? false : this.headers.index( clicked );
+
+		// When the call to ._toggle() comes after the class changes
+		// it causes a very odd bug in IE 8 (see #6720)
+		this.active = clickedIsActive ? $() : clicked;
+		this._toggle( eventData );
+
+		// Switch classes
+		// corner classes on the previously active header stay after the animation
+		this._removeClass( active, "ui-accordion-header-active", "ui-state-active" );
+		if ( options.icons ) {
+			activeChildren = active.children( ".ui-accordion-header-icon" );
+			this._removeClass( activeChildren, null, options.icons.activeHeader )
+				._addClass( activeChildren, null, options.icons.header );
+		}
+
+		if ( !clickedIsActive ) {
+			this._removeClass( clicked, "ui-accordion-header-collapsed" )
+				._addClass( clicked, "ui-accordion-header-active", "ui-state-active" );
+			if ( options.icons ) {
+				clickedChildren = clicked.children( ".ui-accordion-header-icon" );
+				this._removeClass( clickedChildren, null, options.icons.header )
+					._addClass( clickedChildren, null, options.icons.activeHeader );
+			}
+
+			this._addClass( clicked.next(), "ui-accordion-content-active" );
+		}
+	},
+
+	_toggle: function( data ) {
+		var toShow = data.newPanel,
+			toHide = this.prevShow.length ? this.prevShow : data.oldPanel;
+
+		// Handle activating a panel during the animation for another activation
+		this.prevShow.add( this.prevHide ).stop( true, true );
+		this.prevShow = toShow;
+		this.prevHide = toHide;
+
+		if ( this.options.animate ) {
+			this._animate( toShow, toHide, data );
+		} else {
+			toHide.hide();
+			toShow.show();
+			this._toggleComplete( data );
+		}
+
+		toHide.attr( {
+			"aria-hidden": "true"
+		} );
+		toHide.prev().attr( {
+			"aria-selected": "false",
+			"aria-expanded": "false"
+		} );
+
+		// if we're switching panels, remove the old header from the tab order
+		// if we're opening from collapsed state, remove the previous header from the tab order
+		// if we're collapsing, then keep the collapsing header in the tab order
+		if ( toShow.length && toHide.length ) {
+			toHide.prev().attr( {
+				"tabIndex": -1,
+				"aria-expanded": "false"
+			} );
+		} else if ( toShow.length ) {
+			this.headers.filter( function() {
+				return parseInt( $( this ).attr( "tabIndex" ), 10 ) === 0;
+			} )
+				.attr( "tabIndex", -1 );
+		}
+
+		toShow
+			.attr( "aria-hidden", "false" )
+			.prev()
+				.attr( {
+					"aria-selected": "true",
+					"aria-expanded": "true",
+					tabIndex: 0
+				} );
+	},
+
+	_animate: function( toShow, toHide, data ) {
+		var total, easing, duration,
+			that = this,
+			adjust = 0,
+			boxSizing = toShow.css( "box-sizing" ),
+			down = toShow.length &&
+				( !toHide.length || ( toShow.index() < toHide.index() ) ),
+			animate = this.options.animate || {},
+			options = down && animate.down || animate,
+			complete = function() {
+				that._toggleComplete( data );
+			};
+
+		if ( typeof options === "number" ) {
+			duration = options;
+		}
+		if ( typeof options === "string" ) {
+			easing = options;
+		}
+
+		// fall back from options to animation in case of partial down settings
+		easing = easing || options.easing || animate.easing;
+		duration = duration || options.duration || animate.duration;
+
+		if ( !toHide.length ) {
+			return toShow.animate( this.showProps, duration, easing, complete );
+		}
+		if ( !toShow.length ) {
+			return toHide.animate( this.hideProps, duration, easing, complete );
+		}
+
+		total = toShow.show().outerHeight();
+		toHide.animate( this.hideProps, {
+			duration: duration,
+			easing: easing,
+			step: function( now, fx ) {
+				fx.now = Math.round( now );
+			}
+		} );
+		toShow
+			.hide()
+			.animate( this.showProps, {
+				duration: duration,
+				easing: easing,
+				complete: complete,
+				step: function( now, fx ) {
+					fx.now = Math.round( now );
+					if ( fx.prop !== "height" ) {
+						if ( boxSizing === "content-box" ) {
+							adjust += fx.now;
+						}
+					} else if ( that.options.heightStyle !== "content" ) {
+						fx.now = Math.round( total - toHide.outerHeight() - adjust );
+						adjust = 0;
+					}
+				}
+			} );
+	},
+
+	_toggleComplete: function( data ) {
+		var toHide = data.oldPanel,
+			prev = toHide.prev();
+
+		this._removeClass( toHide, "ui-accordion-content-active" );
+		this._removeClass( prev, "ui-accordion-header-active" )
+			._addClass( prev, "ui-accordion-header-collapsed" );
+
+		// Work around for rendering bug in IE (#5421)
+		if ( toHide.length ) {
+			toHide.parent()[ 0 ].className = toHide.parent()[ 0 ].className;
+		}
+		this._trigger( "activate", null, data );
+	}
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/accordion.min.js b/wp-includes/js/jquery/ui/accordion.min.js
index dcbfc8ba58..4781c7e5ef 100644
--- a/wp-includes/js/jquery/ui/accordion.min.js
+++ b/wp-includes/js/jquery/ui/accordion.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Accordion 1.11.4
+ * jQuery UI Accordion 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/accordion/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./widget"],e):e(jQuery)}(function(d){return d.widget("ui.accordion",{version:"1.11.4",options:{active:0,animate:{},collapsible:!1,event:"click",header:"> li > :first-child,> :not(li):even",heightStyle:"auto",icons:{activeHeader:"ui-icon-triangle-1-s",header:"ui-icon-triangle-1-e"},activate:null,beforeActivate:null},hideProps:{borderTopWidth:"hide",borderBottomWidth:"hide",paddingTop:"hide",paddingBottom:"hide",height:"hide"},showProps:{borderTopWidth:"show",borderBottomWidth:"show",paddingTop:"show",paddingBottom:"show",height:"show"},_create:function(){var e=this.options;this.prevShow=this.prevHide=d(),this.element.addClass("ui-accordion ui-widget ui-helper-reset").attr("role","tablist"),e.collapsible||!1!==e.active&&null!=e.active||(e.active=0),this._processPanels(),e.active<0&&(e.active+=this.headers.length),this._refresh()},_getCreateEventData:function(){return{header:this.active,panel:this.active.length?this.active.next():d()}},_createIcons:function(){var e=this.options.icons;e&&(d("<span>").addClass("ui-accordion-header-icon ui-icon "+e.header).prependTo(this.headers),this.active.children(".ui-accordion-header-icon").removeClass(e.header).addClass(e.activeHeader),this.headers.addClass("ui-accordion-icons"))},_destroyIcons:function(){this.headers.removeClass("ui-accordion-icons").children(".ui-accordion-header-icon").remove()},_destroy:function(){var e;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role"),this.headers.removeClass("ui-accordion-header ui-accordion-header-active ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("aria-selected").removeAttr("aria-controls").removeAttr("tabIndex").removeUniqueId(),this._destroyIcons(),e=this.headers.next().removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled").css("display","").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeUniqueId(),"content"!==this.options.heightStyle&&e.css("height","")},_setOption:function(e,t){"active"!==e?("event"===e&&(this.options.event&&this._off(this.headers,this.options.event),this._setupEvents(t)),this._super(e,t),"collapsible"!==e||t||!1!==this.options.active||this._activate(0),"icons"===e&&(this._destroyIcons(),t&&this._createIcons()),"disabled"===e&&(this.element.toggleClass("ui-state-disabled",!!t).attr("aria-disabled",t),this.headers.add(this.headers.next()).toggleClass("ui-state-disabled",!!t))):this._activate(t)},_keydown:function(e){if(!e.altKey&&!e.ctrlKey){var t=d.ui.keyCode,i=this.headers.length,a=this.headers.index(e.target),s=!1;switch(e.keyCode){case t.RIGHT:case t.DOWN:s=this.headers[(a+1)%i];break;case t.LEFT:case t.UP:s=this.headers[(a-1+i)%i];break;case t.SPACE:case t.ENTER:this._eventHandler(e);break;case t.HOME:s=this.headers[0];break;case t.END:s=this.headers[i-1]}s&&(d(e.target).attr("tabIndex",-1),d(s).attr("tabIndex",0),s.focus(),e.preventDefault())}},_panelKeyDown:function(e){e.keyCode===d.ui.keyCode.UP&&e.ctrlKey&&d(e.currentTarget).prev().focus()},refresh:function(){var e=this.options;this._processPanels(),!1===e.active&&!0===e.collapsible||!this.headers.length?(e.active=!1,this.active=d()):!1===e.active?this._activate(0):this.active.length&&!d.contains(this.element[0],this.active[0])?this.headers.length===this.headers.find(".ui-state-disabled").length?(e.active=!1,this.active=d()):this._activate(Math.max(0,e.active-1)):e.active=this.headers.index(this.active),this._destroyIcons(),this._refresh()},_processPanels:function(){var e=this.headers,t=this.panels;this.headers=this.element.find(this.options.header).addClass("ui-accordion-header ui-state-default ui-corner-all"),this.panels=this.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom").filter(":not(.ui-accordion-content-active)").hide(),t&&(this._off(e.not(this.headers)),this._off(t.not(this.panels)))},_refresh:function(){var i,e=this.options,t=e.heightStyle,a=this.element.parent();this.active=this._findActive(e.active).addClass("ui-accordion-header-active ui-state-active ui-corner-top").removeClass("ui-corner-all"),this.active.next().addClass("ui-accordion-content-active").show(),this.headers.attr("role","tab").each(function(){var e=d(this),t=e.uniqueId().attr("id"),i=e.next(),a=i.uniqueId().attr("id");e.attr("aria-controls",a),i.attr("aria-labelledby",t)}).next().attr("role","tabpanel"),this.headers.not(this.active).attr({"aria-selected":"false","aria-expanded":"false",tabIndex:-1}).next().attr({"aria-hidden":"true"}).hide(),this.active.length?this.active.attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0}).next().attr({"aria-hidden":"false"}):this.headers.eq(0).attr("tabIndex",0),this._createIcons(),this._setupEvents(e.event),"fill"===t?(i=a.height(),this.element.siblings(":visible").each(function(){var e=d(this),t=e.css("position");"absolute"!==t&&"fixed"!==t&&(i-=e.outerHeight(!0))}),this.headers.each(function(){i-=d(this).outerHeight(!0)}),this.headers.next().each(function(){d(this).height(Math.max(0,i-d(this).innerHeight()+d(this).height()))}).css("overflow","auto")):"auto"===t&&(i=0,this.headers.next().each(function(){i=Math.max(i,d(this).css("height","").height())}).height(i))},_activate:function(e){var t=this._findActive(e)[0];t!==this.active[0]&&(t=t||this.active[0],this._eventHandler({target:t,currentTarget:t,preventDefault:d.noop}))},_findActive:function(e){return"number"==typeof e?this.headers.eq(e):d()},_setupEvents:function(e){var i={keydown:"_keydown"};e&&d.each(e.split(" "),function(e,t){i[t]="_eventHandler"}),this._off(this.headers.add(this.headers.next())),this._on(this.headers,i),this._on(this.headers.next(),{keydown:"_panelKeyDown"}),this._hoverable(this.headers),this._focusable(this.headers)},_eventHandler:function(e){var t=this.options,i=this.active,a=d(e.currentTarget),s=a[0]===i[0],n=s&&t.collapsible,r=n?d():a.next(),o=i.next(),h={oldHeader:i,oldPanel:o,newHeader:n?d():a,newPanel:r};e.preventDefault(),s&&!t.collapsible||!1===this._trigger("beforeActivate",e,h)||(t.active=!n&&this.headers.index(a),this.active=s?d():a,this._toggle(h),i.removeClass("ui-accordion-header-active ui-state-active"),t.icons&&i.children(".ui-accordion-header-icon").removeClass(t.icons.activeHeader).addClass(t.icons.header),s||(a.removeClass("ui-corner-all").addClass("ui-accordion-header-active ui-state-active ui-corner-top"),t.icons&&a.children(".ui-accordion-header-icon").removeClass(t.icons.header).addClass(t.icons.activeHeader),a.next().addClass("ui-accordion-content-active")))},_toggle:function(e){var t=e.newPanel,i=this.prevShow.length?this.prevShow:e.oldPanel;this.prevShow.add(this.prevHide).stop(!0,!0),this.prevShow=t,this.prevHide=i,this.options.animate?this._animate(t,i,e):(i.hide(),t.show(),this._toggleComplete(e)),i.attr({"aria-hidden":"true"}),i.prev().attr({"aria-selected":"false","aria-expanded":"false"}),t.length&&i.length?i.prev().attr({tabIndex:-1,"aria-expanded":"false"}):t.length&&this.headers.filter(function(){return 0===parseInt(d(this).attr("tabIndex"),10)}).attr("tabIndex",-1),t.attr("aria-hidden","false").prev().attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0})},_animate:function(e,i,t){function a(){o._toggleComplete(t)}var s,n,r,o=this,h=0,d=e.css("box-sizing"),c=e.length&&(!i.length||e.index()<i.index()),l=this.options.animate||{},u=c&&l.down||l;return"number"==typeof u&&(r=u),"string"==typeof u&&(n=u),n=n||u.easing||l.easing,r=r||u.duration||l.duration,i.length?e.length?(s=e.show().outerHeight(),i.animate(this.hideProps,{duration:r,easing:n,step:function(e,t){t.now=Math.round(e)}}),void e.hide().animate(this.showProps,{duration:r,easing:n,complete:a,step:function(e,t){t.now=Math.round(e),"height"!==t.prop?"content-box"===d&&(h+=t.now):"content"!==o.options.heightStyle&&(t.now=Math.round(s-i.outerHeight()-h),h=0)}})):i.animate(this.hideProps,r,n,a):e.animate(this.showProps,r,n,a)},_toggleComplete:function(e){var t=e.oldPanel;t.removeClass("ui-accordion-content-active").prev().removeClass("ui-corner-top").addClass("ui-corner-all"),t.length&&(t.parent()[0].className=t.parent()[0].className),this._trigger("activate",null,e)}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(l){return l.widget("ui.accordion",{version:"1.12.1",options:{active:0,animate:{},classes:{"ui-accordion-header":"ui-corner-top","ui-accordion-header-collapsed":"ui-corner-all","ui-accordion-content":"ui-corner-bottom"},collapsible:!1,event:"click",header:"> li > :first-child, > :not(li):even",heightStyle:"auto",icons:{activeHeader:"ui-icon-triangle-1-s",header:"ui-icon-triangle-1-e"},activate:null,beforeActivate:null},hideProps:{borderTopWidth:"hide",borderBottomWidth:"hide",paddingTop:"hide",paddingBottom:"hide",height:"hide"},showProps:{borderTopWidth:"show",borderBottomWidth:"show",paddingTop:"show",paddingBottom:"show",height:"show"},_create:function(){var e=this.options;this.prevShow=this.prevHide=l(),this._addClass("ui-accordion","ui-widget ui-helper-reset"),this.element.attr("role","tablist"),e.collapsible||!1!==e.active&&null!=e.active||(e.active=0),this._processPanels(),e.active<0&&(e.active+=this.headers.length),this._refresh()},_getCreateEventData:function(){return{header:this.active,panel:this.active.length?this.active.next():l()}},_createIcons:function(){var e,t,i=this.options.icons;i&&(e=l("<span>"),this._addClass(e,"ui-accordion-header-icon","ui-icon "+i.header),e.prependTo(this.headers),t=this.active.children(".ui-accordion-header-icon"),this._removeClass(t,i.header)._addClass(t,null,i.activeHeader)._addClass(this.headers,"ui-accordion-icons"))},_destroyIcons:function(){this._removeClass(this.headers,"ui-accordion-icons"),this.headers.children(".ui-accordion-header-icon").remove()},_destroy:function(){var e;this.element.removeAttr("role"),this.headers.removeAttr("role aria-expanded aria-selected aria-controls tabIndex").removeUniqueId(),this._destroyIcons(),e=this.headers.next().css("display","").removeAttr("role aria-hidden aria-labelledby").removeUniqueId(),"content"!==this.options.heightStyle&&e.css("height","")},_setOption:function(e,t){"active"!==e?("event"===e&&(this.options.event&&this._off(this.headers,this.options.event),this._setupEvents(t)),this._super(e,t),"collapsible"!==e||t||!1!==this.options.active||this._activate(0),"icons"===e&&(this._destroyIcons(),t&&this._createIcons())):this._activate(t)},_setOptionDisabled:function(e){this._super(e),this.element.attr("aria-disabled",e),this._toggleClass(null,"ui-state-disabled",!!e),this._toggleClass(this.headers.add(this.headers.next()),null,"ui-state-disabled",!!e)},_keydown:function(e){if(!e.altKey&&!e.ctrlKey){var t=l.ui.keyCode,i=this.headers.length,a=this.headers.index(e.target),s=!1;switch(e.keyCode){case t.RIGHT:case t.DOWN:s=this.headers[(a+1)%i];break;case t.LEFT:case t.UP:s=this.headers[(a-1+i)%i];break;case t.SPACE:case t.ENTER:this._eventHandler(e);break;case t.HOME:s=this.headers[0];break;case t.END:s=this.headers[i-1]}s&&(l(e.target).attr("tabIndex",-1),l(s).attr("tabIndex",0),l(s).trigger("focus"),e.preventDefault())}},_panelKeyDown:function(e){e.keyCode===l.ui.keyCode.UP&&e.ctrlKey&&l(e.currentTarget).prev().trigger("focus")},refresh:function(){var e=this.options;this._processPanels(),!1===e.active&&!0===e.collapsible||!this.headers.length?(e.active=!1,this.active=l()):!1===e.active?this._activate(0):this.active.length&&!l.contains(this.element[0],this.active[0])?this.headers.length===this.headers.find(".ui-state-disabled").length?(e.active=!1,this.active=l()):this._activate(Math.max(0,e.active-1)):e.active=this.headers.index(this.active),this._destroyIcons(),this._refresh()},_processPanels:function(){var e=this.headers,t=this.panels;this.headers=this.element.find(this.options.header),this._addClass(this.headers,"ui-accordion-header ui-accordion-header-collapsed","ui-state-default"),this.panels=this.headers.next().filter(":not(.ui-accordion-content-active)").hide(),this._addClass(this.panels,"ui-accordion-content","ui-helper-reset ui-widget-content"),t&&(this._off(e.not(this.headers)),this._off(t.not(this.panels)))},_refresh:function(){var i,e=this.options,t=e.heightStyle,a=this.element.parent();this.active=this._findActive(e.active),this._addClass(this.active,"ui-accordion-header-active","ui-state-active")._removeClass(this.active,"ui-accordion-header-collapsed"),this._addClass(this.active.next(),"ui-accordion-content-active"),this.active.next().show(),this.headers.attr("role","tab").each(function(){var e=l(this),t=e.uniqueId().attr("id"),i=e.next(),a=i.uniqueId().attr("id");e.attr("aria-controls",a),i.attr("aria-labelledby",t)}).next().attr("role","tabpanel"),this.headers.not(this.active).attr({"aria-selected":"false","aria-expanded":"false",tabIndex:-1}).next().attr({"aria-hidden":"true"}).hide(),this.active.length?this.active.attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0}).next().attr({"aria-hidden":"false"}):this.headers.eq(0).attr("tabIndex",0),this._createIcons(),this._setupEvents(e.event),"fill"===t?(i=a.height(),this.element.siblings(":visible").each(function(){var e=l(this),t=e.css("position");"absolute"!==t&&"fixed"!==t&&(i-=e.outerHeight(!0))}),this.headers.each(function(){i-=l(this).outerHeight(!0)}),this.headers.next().each(function(){l(this).height(Math.max(0,i-l(this).innerHeight()+l(this).height()))}).css("overflow","auto")):"auto"===t&&(i=0,this.headers.next().each(function(){var e=l(this).is(":visible");e||l(this).show(),i=Math.max(i,l(this).css("height","").height()),e||l(this).hide()}).height(i))},_activate:function(e){var t=this._findActive(e)[0];t!==this.active[0]&&(t=t||this.active[0],this._eventHandler({target:t,currentTarget:t,preventDefault:l.noop}))},_findActive:function(e){return"number"==typeof e?this.headers.eq(e):l()},_setupEvents:function(e){var i={keydown:"_keydown"};e&&l.each(e.split(" "),function(e,t){i[t]="_eventHandler"}),this._off(this.headers.add(this.headers.next())),this._on(this.headers,i),this._on(this.headers.next(),{keydown:"_panelKeyDown"}),this._hoverable(this.headers),this._focusable(this.headers)},_eventHandler:function(e){var t,i,a=this.options,s=this.active,n=l(e.currentTarget),h=n[0]===s[0],r=h&&a.collapsible,o=r?l():n.next(),d=s.next(),c={oldHeader:s,oldPanel:d,newHeader:r?l():n,newPanel:o};e.preventDefault(),h&&!a.collapsible||!1===this._trigger("beforeActivate",e,c)||(a.active=!r&&this.headers.index(n),this.active=h?l():n,this._toggle(c),this._removeClass(s,"ui-accordion-header-active","ui-state-active"),a.icons&&(t=s.children(".ui-accordion-header-icon"),this._removeClass(t,null,a.icons.activeHeader)._addClass(t,null,a.icons.header)),h||(this._removeClass(n,"ui-accordion-header-collapsed")._addClass(n,"ui-accordion-header-active","ui-state-active"),a.icons&&(i=n.children(".ui-accordion-header-icon"),this._removeClass(i,null,a.icons.header)._addClass(i,null,a.icons.activeHeader)),this._addClass(n.next(),"ui-accordion-content-active")))},_toggle:function(e){var t=e.newPanel,i=this.prevShow.length?this.prevShow:e.oldPanel;this.prevShow.add(this.prevHide).stop(!0,!0),this.prevShow=t,this.prevHide=i,this.options.animate?this._animate(t,i,e):(i.hide(),t.show(),this._toggleComplete(e)),i.attr({"aria-hidden":"true"}),i.prev().attr({"aria-selected":"false","aria-expanded":"false"}),t.length&&i.length?i.prev().attr({tabIndex:-1,"aria-expanded":"false"}):t.length&&this.headers.filter(function(){return 0===parseInt(l(this).attr("tabIndex"),10)}).attr("tabIndex",-1),t.attr("aria-hidden","false").prev().attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0})},_animate:function(e,i,t){function a(){r._toggleComplete(t)}var s,n,h,r=this,o=0,d=e.css("box-sizing"),c=e.length&&(!i.length||e.index()<i.index()),l=this.options.animate||{},u=c&&l.down||l;return"number"==typeof u&&(h=u),"string"==typeof u&&(n=u),n=n||u.easing||l.easing,h=h||u.duration||l.duration,i.length?e.length?(s=e.show().outerHeight(),i.animate(this.hideProps,{duration:h,easing:n,step:function(e,t){t.now=Math.round(e)}}),void e.hide().animate(this.showProps,{duration:h,easing:n,complete:a,step:function(e,t){t.now=Math.round(e),"height"!==t.prop?"content-box"===d&&(o+=t.now):"content"!==r.options.heightStyle&&(t.now=Math.round(s-i.outerHeight()-o),o=0)}})):i.animate(this.hideProps,h,n,a):e.animate(this.showProps,h,n,a)},_toggleComplete:function(e){var t=e.oldPanel,i=t.prev();this._removeClass(t,"ui-accordion-content-active"),this._removeClass(i,"ui-accordion-header-active")._addClass(i,"ui-accordion-header-collapsed"),t.length&&(t.parent()[0].className=t.parent()[0].className),this._trigger("activate",null,e)}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/autocomplete.js b/wp-includes/js/jquery/ui/autocomplete.js
new file mode 100644
index 0000000000..f5f58213f1
--- /dev/null
+++ b/wp-includes/js/jquery/ui/autocomplete.js
@@ -0,0 +1,678 @@
+/*!
+ * jQuery UI Autocomplete 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Autocomplete
+//>>group: Widgets
+//>>description: Lists suggested words as the user is typing.
+//>>docs: http://api.jqueryui.com/autocomplete/
+//>>demos: http://jqueryui.com/autocomplete/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/autocomplete.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./menu",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.autocomplete", {
+	version: "1.12.1",
+	defaultElement: "<input>",
+	options: {
+		appendTo: null,
+		autoFocus: false,
+		delay: 300,
+		minLength: 1,
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		source: null,
+
+		// Callbacks
+		change: null,
+		close: null,
+		focus: null,
+		open: null,
+		response: null,
+		search: null,
+		select: null
+	},
+
+	requestIndex: 0,
+	pending: 0,
+
+	_create: function() {
+
+		// Some browsers only repeat keydown events, not keypress events,
+		// so we use the suppressKeyPress flag to determine if we've already
+		// handled the keydown event. #7269
+		// Unfortunately the code for & in keypress is the same as the up arrow,
+		// so we use the suppressKeyPressRepeat flag to avoid handling keypress
+		// events when we know the keydown event was used to modify the
+		// search term. #7799
+		var suppressKeyPress, suppressKeyPressRepeat, suppressInput,
+			nodeName = this.element[ 0 ].nodeName.toLowerCase(),
+			isTextarea = nodeName === "textarea",
+			isInput = nodeName === "input";
+
+		// Textareas are always multi-line
+		// Inputs are always single-line, even if inside a contentEditable element
+		// IE also treats inputs as contentEditable
+		// All other element types are determined by whether or not they're contentEditable
+		this.isMultiLine = isTextarea || !isInput && this._isContentEditable( this.element );
+
+		this.valueMethod = this.element[ isTextarea || isInput ? "val" : "text" ];
+		this.isNewMenu = true;
+
+		this._addClass( "ui-autocomplete-input" );
+		this.element.attr( "autocomplete", "off" );
+
+		this._on( this.element, {
+			keydown: function( event ) {
+				if ( this.element.prop( "readOnly" ) ) {
+					suppressKeyPress = true;
+					suppressInput = true;
+					suppressKeyPressRepeat = true;
+					return;
+				}
+
+				suppressKeyPress = false;
+				suppressInput = false;
+				suppressKeyPressRepeat = false;
+				var keyCode = $.ui.keyCode;
+				switch ( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					suppressKeyPress = true;
+					this._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					suppressKeyPress = true;
+					this._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					suppressKeyPress = true;
+					this._keyEvent( "previous", event );
+					break;
+				case keyCode.DOWN:
+					suppressKeyPress = true;
+					this._keyEvent( "next", event );
+					break;
+				case keyCode.ENTER:
+
+					// when menu is open and has focus
+					if ( this.menu.active ) {
+
+						// #6055 - Opera still allows the keypress to occur
+						// which causes forms to submit
+						suppressKeyPress = true;
+						event.preventDefault();
+						this.menu.select( event );
+					}
+					break;
+				case keyCode.TAB:
+					if ( this.menu.active ) {
+						this.menu.select( event );
+					}
+					break;
+				case keyCode.ESCAPE:
+					if ( this.menu.element.is( ":visible" ) ) {
+						if ( !this.isMultiLine ) {
+							this._value( this.term );
+						}
+						this.close( event );
+
+						// Different browsers have different default behavior for escape
+						// Single press can mean undo or clear
+						// Double press in IE means clear the whole form
+						event.preventDefault();
+					}
+					break;
+				default:
+					suppressKeyPressRepeat = true;
+
+					// search timeout should be triggered before the input value is changed
+					this._searchTimeout( event );
+					break;
+				}
+			},
+			keypress: function( event ) {
+				if ( suppressKeyPress ) {
+					suppressKeyPress = false;
+					if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+						event.preventDefault();
+					}
+					return;
+				}
+				if ( suppressKeyPressRepeat ) {
+					return;
+				}
+
+				// Replicate some key handlers to allow them to repeat in Firefox and Opera
+				var keyCode = $.ui.keyCode;
+				switch ( event.keyCode ) {
+				case keyCode.PAGE_UP:
+					this._move( "previousPage", event );
+					break;
+				case keyCode.PAGE_DOWN:
+					this._move( "nextPage", event );
+					break;
+				case keyCode.UP:
+					this._keyEvent( "previous", event );
+					break;
+				case keyCode.DOWN:
+					this._keyEvent( "next", event );
+					break;
+				}
+			},
+			input: function( event ) {
+				if ( suppressInput ) {
+					suppressInput = false;
+					event.preventDefault();
+					return;
+				}
+				this._searchTimeout( event );
+			},
+			focus: function() {
+				this.selectedItem = null;
+				this.previous = this._value();
+			},
+			blur: function( event ) {
+				if ( this.cancelBlur ) {
+					delete this.cancelBlur;
+					return;
+				}
+
+				clearTimeout( this.searching );
+				this.close( event );
+				this._change( event );
+			}
+		} );
+
+		this._initSource();
+		this.menu = $( "<ul>" )
+			.appendTo( this._appendTo() )
+			.menu( {
+
+				// disable ARIA support, the live region takes care of that
+				role: null
+			} )
+			.hide()
+			.menu( "instance" );
+
+		this._addClass( this.menu.element, "ui-autocomplete", "ui-front" );
+		this._on( this.menu.element, {
+			mousedown: function( event ) {
+
+				// prevent moving focus out of the text field
+				event.preventDefault();
+
+				// IE doesn't prevent moving focus even with event.preventDefault()
+				// so we set a flag to know when we should ignore the blur event
+				this.cancelBlur = true;
+				this._delay( function() {
+					delete this.cancelBlur;
+
+					// Support: IE 8 only
+					// Right clicking a menu item or selecting text from the menu items will
+					// result in focus moving out of the input. However, we've already received
+					// and ignored the blur event because of the cancelBlur flag set above. So
+					// we restore focus to ensure that the menu closes properly based on the user's
+					// next actions.
+					if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) {
+						this.element.trigger( "focus" );
+					}
+				} );
+			},
+			menufocus: function( event, ui ) {
+				var label, item;
+
+				// support: Firefox
+				// Prevent accidental activation of menu items in Firefox (#7024 #9118)
+				if ( this.isNewMenu ) {
+					this.isNewMenu = false;
+					if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) {
+						this.menu.blur();
+
+						this.document.one( "mousemove", function() {
+							$( event.target ).trigger( event.originalEvent );
+						} );
+
+						return;
+					}
+				}
+
+				item = ui.item.data( "ui-autocomplete-item" );
+				if ( false !== this._trigger( "focus", event, { item: item } ) ) {
+
+					// use value to match what will end up in the input, if it was a key event
+					if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) {
+						this._value( item.value );
+					}
+				}
+
+				// Announce the value in the liveRegion
+				label = ui.item.attr( "aria-label" ) || item.value;
+				if ( label && $.trim( label ).length ) {
+					this.liveRegion.children().hide();
+					$( "<div>" ).text( label ).appendTo( this.liveRegion );
+				}
+			},
+			menuselect: function( event, ui ) {
+				var item = ui.item.data( "ui-autocomplete-item" ),
+					previous = this.previous;
+
+				// Only trigger when focus was lost (click on menu)
+				if ( this.element[ 0 ] !== $.ui.safeActiveElement( this.document[ 0 ] ) ) {
+					this.element.trigger( "focus" );
+					this.previous = previous;
+
+					// #6109 - IE triggers two focus events and the second
+					// is asynchronous, so we need to reset the previous
+					// term synchronously and asynchronously :-(
+					this._delay( function() {
+						this.previous = previous;
+						this.selectedItem = item;
+					} );
+				}
+
+				if ( false !== this._trigger( "select", event, { item: item } ) ) {
+					this._value( item.value );
+				}
+
+				// reset the term after the select event
+				// this allows custom select handling to work properly
+				this.term = this._value();
+
+				this.close( event );
+				this.selectedItem = item;
+			}
+		} );
+
+		this.liveRegion = $( "<div>", {
+			role: "status",
+			"aria-live": "assertive",
+			"aria-relevant": "additions"
+		} )
+			.appendTo( this.document[ 0 ].body );
+
+		this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" );
+
+		// Turning off autocomplete prevents the browser from remembering the
+		// value when navigating through history, so we re-enable autocomplete
+		// if the page is unloaded before the widget is destroyed. #7790
+		this._on( this.window, {
+			beforeunload: function() {
+				this.element.removeAttr( "autocomplete" );
+			}
+		} );
+	},
+
+	_destroy: function() {
+		clearTimeout( this.searching );
+		this.element.removeAttr( "autocomplete" );
+		this.menu.element.remove();
+		this.liveRegion.remove();
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+		if ( key === "source" ) {
+			this._initSource();
+		}
+		if ( key === "appendTo" ) {
+			this.menu.element.appendTo( this._appendTo() );
+		}
+		if ( key === "disabled" && value && this.xhr ) {
+			this.xhr.abort();
+		}
+	},
+
+	_isEventTargetInWidget: function( event ) {
+		var menuElement = this.menu.element[ 0 ];
+
+		return event.target === this.element[ 0 ] ||
+			event.target === menuElement ||
+			$.contains( menuElement, event.target );
+	},
+
+	_closeOnClickOutside: function( event ) {
+		if ( !this._isEventTargetInWidget( event ) ) {
+			this.close();
+		}
+	},
+
+	_appendTo: function() {
+		var element = this.options.appendTo;
+
+		if ( element ) {
+			element = element.jquery || element.nodeType ?
+				$( element ) :
+				this.document.find( element ).eq( 0 );
+		}
+
+		if ( !element || !element[ 0 ] ) {
+			element = this.element.closest( ".ui-front, dialog" );
+		}
+
+		if ( !element.length ) {
+			element = this.document[ 0 ].body;
+		}
+
+		return element;
+	},
+
+	_initSource: function() {
+		var array, url,
+			that = this;
+		if ( $.isArray( this.options.source ) ) {
+			array = this.options.source;
+			this.source = function( request, response ) {
+				response( $.ui.autocomplete.filter( array, request.term ) );
+			};
+		} else if ( typeof this.options.source === "string" ) {
+			url = this.options.source;
+			this.source = function( request, response ) {
+				if ( that.xhr ) {
+					that.xhr.abort();
+				}
+				that.xhr = $.ajax( {
+					url: url,
+					data: request,
+					dataType: "json",
+					success: function( data ) {
+						response( data );
+					},
+					error: function() {
+						response( [] );
+					}
+				} );
+			};
+		} else {
+			this.source = this.options.source;
+		}
+	},
+
+	_searchTimeout: function( event ) {
+		clearTimeout( this.searching );
+		this.searching = this._delay( function() {
+
+			// Search if the value has changed, or if the user retypes the same value (see #7434)
+			var equalValues = this.term === this._value(),
+				menuVisible = this.menu.element.is( ":visible" ),
+				modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey;
+
+			if ( !equalValues || ( equalValues && !menuVisible && !modifierKey ) ) {
+				this.selectedItem = null;
+				this.search( null, event );
+			}
+		}, this.options.delay );
+	},
+
+	search: function( value, event ) {
+		value = value != null ? value : this._value();
+
+		// Always save the actual value, not the one passed as an argument
+		this.term = this._value();
+
+		if ( value.length < this.options.minLength ) {
+			return this.close( event );
+		}
+
+		if ( this._trigger( "search", event ) === false ) {
+			return;
+		}
+
+		return this._search( value );
+	},
+
+	_search: function( value ) {
+		this.pending++;
+		this._addClass( "ui-autocomplete-loading" );
+		this.cancelSearch = false;
+
+		this.source( { term: value }, this._response() );
+	},
+
+	_response: function() {
+		var index = ++this.requestIndex;
+
+		return $.proxy( function( content ) {
+			if ( index === this.requestIndex ) {
+				this.__response( content );
+			}
+
+			this.pending--;
+			if ( !this.pending ) {
+				this._removeClass( "ui-autocomplete-loading" );
+			}
+		}, this );
+	},
+
+	__response: function( content ) {
+		if ( content ) {
+			content = this._normalize( content );
+		}
+		this._trigger( "response", null, { content: content } );
+		if ( !this.options.disabled && content && content.length && !this.cancelSearch ) {
+			this._suggest( content );
+			this._trigger( "open" );
+		} else {
+
+			// use ._close() instead of .close() so we don't cancel future searches
+			this._close();
+		}
+	},
+
+	close: function( event ) {
+		this.cancelSearch = true;
+		this._close( event );
+	},
+
+	_close: function( event ) {
+
+		// Remove the handler that closes the menu on outside clicks
+		this._off( this.document, "mousedown" );
+
+		if ( this.menu.element.is( ":visible" ) ) {
+			this.menu.element.hide();
+			this.menu.blur();
+			this.isNewMenu = true;
+			this._trigger( "close", event );
+		}
+	},
+
+	_change: function( event ) {
+		if ( this.previous !== this._value() ) {
+			this._trigger( "change", event, { item: this.selectedItem } );
+		}
+	},
+
+	_normalize: function( items ) {
+
+		// assume all items have the right format when the first item is complete
+		if ( items.length && items[ 0 ].label && items[ 0 ].value ) {
+			return items;
+		}
+		return $.map( items, function( item ) {
+			if ( typeof item === "string" ) {
+				return {
+					label: item,
+					value: item
+				};
+			}
+			return $.extend( {}, item, {
+				label: item.label || item.value,
+				value: item.value || item.label
+			} );
+		} );
+	},
+
+	_suggest: function( items ) {
+		var ul = this.menu.element.empty();
+		this._renderMenu( ul, items );
+		this.isNewMenu = true;
+		this.menu.refresh();
+
+		// Size and position menu
+		ul.show();
+		this._resizeMenu();
+		ul.position( $.extend( {
+			of: this.element
+		}, this.options.position ) );
+
+		if ( this.options.autoFocus ) {
+			this.menu.next();
+		}
+
+		// Listen for interactions outside of the widget (#6642)
+		this._on( this.document, {
+			mousedown: "_closeOnClickOutside"
+		} );
+	},
+
+	_resizeMenu: function() {
+		var ul = this.menu.element;
+		ul.outerWidth( Math.max(
+
+			// Firefox wraps long text (possibly a rounding bug)
+			// so we add 1px to avoid the wrapping (#7513)
+			ul.width( "" ).outerWidth() + 1,
+			this.element.outerWidth()
+		) );
+	},
+
+	_renderMenu: function( ul, items ) {
+		var that = this;
+		$.each( items, function( index, item ) {
+			that._renderItemData( ul, item );
+		} );
+	},
+
+	_renderItemData: function( ul, item ) {
+		return this._renderItem( ul, item ).data( "ui-autocomplete-item", item );
+	},
+
+	_renderItem: function( ul, item ) {
+		return $( "<li>" )
+			.append( $( "<div>" ).text( item.label ) )
+			.appendTo( ul );
+	},
+
+	_move: function( direction, event ) {
+		if ( !this.menu.element.is( ":visible" ) ) {
+			this.search( null, event );
+			return;
+		}
+		if ( this.menu.isFirstItem() && /^previous/.test( direction ) ||
+				this.menu.isLastItem() && /^next/.test( direction ) ) {
+
+			if ( !this.isMultiLine ) {
+				this._value( this.term );
+			}
+
+			this.menu.blur();
+			return;
+		}
+		this.menu[ direction ]( event );
+	},
+
+	widget: function() {
+		return this.menu.element;
+	},
+
+	_value: function() {
+		return this.valueMethod.apply( this.element, arguments );
+	},
+
+	_keyEvent: function( keyEvent, event ) {
+		if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) {
+			this._move( keyEvent, event );
+
+			// Prevents moving cursor to beginning/end of the text field in some browsers
+			event.preventDefault();
+		}
+	},
+
+	// Support: Chrome <=50
+	// We should be able to just use this.element.prop( "isContentEditable" )
+	// but hidden elements always report false in Chrome.
+	// https://code.google.com/p/chromium/issues/detail?id=313082
+	_isContentEditable: function( element ) {
+		if ( !element.length ) {
+			return false;
+		}
+
+		var editable = element.prop( "contentEditable" );
+
+		if ( editable === "inherit" ) {
+		  return this._isContentEditable( element.parent() );
+		}
+
+		return editable === "true";
+	}
+} );
+
+$.extend( $.ui.autocomplete, {
+	escapeRegex: function( value ) {
+		return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" );
+	},
+	filter: function( array, term ) {
+		var matcher = new RegExp( $.ui.autocomplete.escapeRegex( term ), "i" );
+		return $.grep( array, function( value ) {
+			return matcher.test( value.label || value.value || value );
+		} );
+	}
+} );
+
+// Live region extension, adding a `messages` option
+// NOTE: This is an experimental API. We are still investigating
+// a full solution for string manipulation and internationalization.
+$.widget( "ui.autocomplete", $.ui.autocomplete, {
+	options: {
+		messages: {
+			noResults: "No search results.",
+			results: function( amount ) {
+				return amount + ( amount > 1 ? " results are" : " result is" ) +
+					" available, use up and down arrow keys to navigate.";
+			}
+		}
+	},
+
+	__response: function( content ) {
+		var message;
+		this._superApply( arguments );
+		if ( this.options.disabled || this.cancelSearch ) {
+			return;
+		}
+		if ( content && content.length ) {
+			message = this.options.messages.results( content.length );
+		} else {
+			message = this.options.messages.noResults;
+		}
+		this.liveRegion.children().hide();
+		$( "<div>" ).text( message ).appendTo( this.liveRegion );
+	}
+} );
+
+return $.ui.autocomplete;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/autocomplete.min.js b/wp-includes/js/jquery/ui/autocomplete.min.js
index 232a85955d..08ef65ac1d 100644
--- a/wp-includes/js/jquery/ui/autocomplete.min.js
+++ b/wp-includes/js/jquery/ui/autocomplete.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Autocomplete 1.11.4
+ * jQuery UI Autocomplete 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/autocomplete/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./position","./menu"],e):e(jQuery)}(function(u){return u.widget("ui.autocomplete",{version:"1.11.4",defaultElement:"<input>",options:{appendTo:null,autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null,change:null,close:null,focus:null,open:null,response:null,search:null,select:null},requestIndex:0,pending:0,_create:function(){var i,s,n,e=this.element[0].nodeName.toLowerCase(),t="textarea"===e,o="input"===e;this.isMultiLine=t||!o&&this.element.prop("isContentEditable"),this.valueMethod=this.element[t||o?"val":"text"],this.isNewMenu=!0,this.element.addClass("ui-autocomplete-input").attr("autocomplete","off"),this._on(this.element,{keydown:function(e){if(this.element.prop("readOnly"))s=n=i=!0;else{s=n=i=!1;var t=u.ui.keyCode;switch(e.keyCode){case t.PAGE_UP:i=!0,this._move("previousPage",e);break;case t.PAGE_DOWN:i=!0,this._move("nextPage",e);break;case t.UP:i=!0,this._keyEvent("previous",e);break;case t.DOWN:i=!0,this._keyEvent("next",e);break;case t.ENTER:this.menu.active&&(i=!0,e.preventDefault(),this.menu.select(e));break;case t.TAB:this.menu.active&&this.menu.select(e);break;case t.ESCAPE:this.menu.element.is(":visible")&&(this.isMultiLine||this._value(this.term),this.close(e),e.preventDefault());break;default:s=!0,this._searchTimeout(e)}}},keypress:function(e){if(i)return i=!1,void(this.isMultiLine&&!this.menu.element.is(":visible")||e.preventDefault());if(!s){var t=u.ui.keyCode;switch(e.keyCode){case t.PAGE_UP:this._move("previousPage",e);break;case t.PAGE_DOWN:this._move("nextPage",e);break;case t.UP:this._keyEvent("previous",e);break;case t.DOWN:this._keyEvent("next",e)}}},input:function(e){if(n)return n=!1,void e.preventDefault();this._searchTimeout(e)},focus:function(){this.selectedItem=null,this.previous=this._value()},blur:function(e){this.cancelBlur?delete this.cancelBlur:(clearTimeout(this.searching),this.close(e),this._change(e))}}),this._initSource(),this.menu=u("<ul>").addClass("ui-autocomplete ui-front").appendTo(this._appendTo()).menu({role:null}).hide().menu("instance"),this._on(this.menu.element,{mousedown:function(e){e.preventDefault(),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur});var i=this.menu.element[0];u(e.target).closest(".ui-menu-item").length||this._delay(function(){var t=this;this.document.one("mousedown",function(e){e.target===t.element[0]||e.target===i||u.contains(i,e.target)||t.close()})})},menufocus:function(e,t){var i,s;if(this.isNewMenu&&(this.isNewMenu=!1,e.originalEvent&&/^mouse/.test(e.originalEvent.type)))return this.menu.blur(),void this.document.one("mousemove",function(){u(e.target).trigger(e.originalEvent)});s=t.item.data("ui-autocomplete-item"),!1!==this._trigger("focus",e,{item:s})&&e.originalEvent&&/^key/.test(e.originalEvent.type)&&this._value(s.value),(i=t.item.attr("aria-label")||s.value)&&u.trim(i).length&&(this.liveRegion.children().hide(),u("<div>").text(i).appendTo(this.liveRegion))},menuselect:function(e,t){var i=t.item.data("ui-autocomplete-item"),s=this.previous;this.element[0]!==this.document[0].activeElement&&(this.element.focus(),this.previous=s,this._delay(function(){this.previous=s,this.selectedItem=i})),!1!==this._trigger("select",e,{item:i})&&this._value(i.value),this.term=this._value(),this.close(e),this.selectedItem=i}}),this.liveRegion=u("<span>",{role:"status","aria-live":"assertive","aria-relevant":"additions"}).addClass("ui-helper-hidden-accessible").appendTo(this.document[0].body),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_destroy:function(){clearTimeout(this.searching),this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete"),this.menu.element.remove(),this.liveRegion.remove()},_setOption:function(e,t){this._super(e,t),"source"===e&&this._initSource(),"appendTo"===e&&this.menu.element.appendTo(this._appendTo()),"disabled"===e&&t&&this.xhr&&this.xhr.abort()},_appendTo:function(){var e=this.options.appendTo;return(e=e&&(e.jquery||e.nodeType?u(e):this.document.find(e).eq(0)))&&e[0]||(e=this.element.closest(".ui-front")),e.length||(e=this.document[0].body),e},_initSource:function(){var i,s,n=this;u.isArray(this.options.source)?(i=this.options.source,this.source=function(e,t){t(u.ui.autocomplete.filter(i,e.term))}):"string"==typeof this.options.source?(s=this.options.source,this.source=function(e,t){n.xhr&&n.xhr.abort(),n.xhr=u.ajax({url:s,data:e,dataType:"json",success:function(e){t(e)},error:function(){t([])}})}):this.source=this.options.source},_searchTimeout:function(s){clearTimeout(this.searching),this.searching=this._delay(function(){var e=this.term===this._value(),t=this.menu.element.is(":visible"),i=s.altKey||s.ctrlKey||s.metaKey||s.shiftKey;e&&(!e||t||i)||(this.selectedItem=null,this.search(null,s))},this.options.delay)},search:function(e,t){return e=null!=e?e:this._value(),this.term=this._value(),e.length<this.options.minLength?this.close(t):!1!==this._trigger("search",t)?this._search(e):void 0},_search:function(e){this.pending++,this.element.addClass("ui-autocomplete-loading"),this.cancelSearch=!1,this.source({term:e},this._response())},_response:function(){var t=++this.requestIndex;return u.proxy(function(e){t===this.requestIndex&&this.__response(e),this.pending--,this.pending||this.element.removeClass("ui-autocomplete-loading")},this)},__response:function(e){e=e&&this._normalize(e),this._trigger("response",null,{content:e}),!this.options.disabled&&e&&e.length&&!this.cancelSearch?(this._suggest(e),this._trigger("open")):this._close()},close:function(e){this.cancelSearch=!0,this._close(e)},_close:function(e){this.menu.element.is(":visible")&&(this.menu.element.hide(),this.menu.blur(),this.isNewMenu=!0,this._trigger("close",e))},_change:function(e){this.previous!==this._value()&&this._trigger("change",e,{item:this.selectedItem})},_normalize:function(e){return e.length&&e[0].label&&e[0].value?e:u.map(e,function(e){return"string"==typeof e?{label:e,value:e}:u.extend({},e,{label:e.label||e.value,value:e.value||e.label})})},_suggest:function(e){var t=this.menu.element.empty();this._renderMenu(t,e),this.isNewMenu=!0,this.menu.refresh(),t.show(),this._resizeMenu(),t.position(u.extend({of:this.element},this.options.position)),this.options.autoFocus&&this.menu.next()},_resizeMenu:function(){var e=this.menu.element;e.outerWidth(Math.max(e.width("").outerWidth()+1,this.element.outerWidth()))},_renderMenu:function(i,e){var s=this;u.each(e,function(e,t){s._renderItemData(i,t)})},_renderItemData:function(e,t){return this._renderItem(e,t).data("ui-autocomplete-item",t)},_renderItem:function(e,t){return u("<li>").text(t.label).appendTo(e)},_move:function(e,t){if(this.menu.element.is(":visible"))return this.menu.isFirstItem()&&/^previous/.test(e)||this.menu.isLastItem()&&/^next/.test(e)?(this.isMultiLine||this._value(this.term),void this.menu.blur()):void this.menu[e](t);this.search(null,t)},widget:function(){return this.menu.element},_value:function(){return this.valueMethod.apply(this.element,arguments)},_keyEvent:function(e,t){this.isMultiLine&&!this.menu.element.is(":visible")||(this._move(e,t),t.preventDefault())}}),u.extend(u.ui.autocomplete,{escapeRegex:function(e){return e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&")},filter:function(e,t){var i=new RegExp(u.ui.autocomplete.escapeRegex(t),"i");return u.grep(e,function(e){return i.test(e.label||e.value||e)})}}),u.widget("ui.autocomplete",u.ui.autocomplete,{options:{messages:{noResults:"No search results.",results:function(e){return e+(1<e?" results are":" result is")+" available, use up and down arrow keys to navigate."}}},__response:function(e){var t;this._superApply(arguments),this.options.disabled||this.cancelSearch||(t=e&&e.length?this.options.messages.results(e.length):this.options.messages.noResults,this.liveRegion.children().hide(),u("<div>").text(t).appendTo(this.liveRegion))}}),u.ui.autocomplete});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./menu","./core"],e):e(jQuery)}(function(u){return u.widget("ui.autocomplete",{version:"1.12.1",defaultElement:"<input>",options:{appendTo:null,autoFocus:!1,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null,change:null,close:null,focus:null,open:null,response:null,search:null,select:null},requestIndex:0,pending:0,_create:function(){var i,s,n,e=this.element[0].nodeName.toLowerCase(),t="textarea"===e,o="input"===e;this.isMultiLine=t||!o&&this._isContentEditable(this.element),this.valueMethod=this.element[t||o?"val":"text"],this.isNewMenu=!0,this._addClass("ui-autocomplete-input"),this.element.attr("autocomplete","off"),this._on(this.element,{keydown:function(e){if(this.element.prop("readOnly"))s=n=i=!0;else{s=n=i=!1;var t=u.ui.keyCode;switch(e.keyCode){case t.PAGE_UP:i=!0,this._move("previousPage",e);break;case t.PAGE_DOWN:i=!0,this._move("nextPage",e);break;case t.UP:i=!0,this._keyEvent("previous",e);break;case t.DOWN:i=!0,this._keyEvent("next",e);break;case t.ENTER:this.menu.active&&(i=!0,e.preventDefault(),this.menu.select(e));break;case t.TAB:this.menu.active&&this.menu.select(e);break;case t.ESCAPE:this.menu.element.is(":visible")&&(this.isMultiLine||this._value(this.term),this.close(e),e.preventDefault());break;default:s=!0,this._searchTimeout(e)}}},keypress:function(e){if(i)return i=!1,void(this.isMultiLine&&!this.menu.element.is(":visible")||e.preventDefault());if(!s){var t=u.ui.keyCode;switch(e.keyCode){case t.PAGE_UP:this._move("previousPage",e);break;case t.PAGE_DOWN:this._move("nextPage",e);break;case t.UP:this._keyEvent("previous",e);break;case t.DOWN:this._keyEvent("next",e)}}},input:function(e){if(n)return n=!1,void e.preventDefault();this._searchTimeout(e)},focus:function(){this.selectedItem=null,this.previous=this._value()},blur:function(e){this.cancelBlur?delete this.cancelBlur:(clearTimeout(this.searching),this.close(e),this._change(e))}}),this._initSource(),this.menu=u("<ul>").appendTo(this._appendTo()).menu({role:null}).hide().menu("instance"),this._addClass(this.menu.element,"ui-autocomplete","ui-front"),this._on(this.menu.element,{mousedown:function(e){e.preventDefault(),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur,this.element[0]!==u.ui.safeActiveElement(this.document[0])&&this.element.trigger("focus")})},menufocus:function(e,t){var i,s;if(this.isNewMenu&&(this.isNewMenu=!1,e.originalEvent&&/^mouse/.test(e.originalEvent.type)))return this.menu.blur(),void this.document.one("mousemove",function(){u(e.target).trigger(e.originalEvent)});s=t.item.data("ui-autocomplete-item"),!1!==this._trigger("focus",e,{item:s})&&e.originalEvent&&/^key/.test(e.originalEvent.type)&&this._value(s.value),(i=t.item.attr("aria-label")||s.value)&&u.trim(i).length&&(this.liveRegion.children().hide(),u("<div>").text(i).appendTo(this.liveRegion))},menuselect:function(e,t){var i=t.item.data("ui-autocomplete-item"),s=this.previous;this.element[0]!==u.ui.safeActiveElement(this.document[0])&&(this.element.trigger("focus"),this.previous=s,this._delay(function(){this.previous=s,this.selectedItem=i})),!1!==this._trigger("select",e,{item:i})&&this._value(i.value),this.term=this._value(),this.close(e),this.selectedItem=i}}),this.liveRegion=u("<div>",{role:"status","aria-live":"assertive","aria-relevant":"additions"}).appendTo(this.document[0].body),this._addClass(this.liveRegion,null,"ui-helper-hidden-accessible"),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_destroy:function(){clearTimeout(this.searching),this.element.removeAttr("autocomplete"),this.menu.element.remove(),this.liveRegion.remove()},_setOption:function(e,t){this._super(e,t),"source"===e&&this._initSource(),"appendTo"===e&&this.menu.element.appendTo(this._appendTo()),"disabled"===e&&t&&this.xhr&&this.xhr.abort()},_isEventTargetInWidget:function(e){var t=this.menu.element[0];return e.target===this.element[0]||e.target===t||u.contains(t,e.target)},_closeOnClickOutside:function(e){this._isEventTargetInWidget(e)||this.close()},_appendTo:function(){var e=this.options.appendTo;return(e=e&&(e.jquery||e.nodeType?u(e):this.document.find(e).eq(0)))&&e[0]||(e=this.element.closest(".ui-front, dialog")),e.length||(e=this.document[0].body),e},_initSource:function(){var i,s,n=this;u.isArray(this.options.source)?(i=this.options.source,this.source=function(e,t){t(u.ui.autocomplete.filter(i,e.term))}):"string"==typeof this.options.source?(s=this.options.source,this.source=function(e,t){n.xhr&&n.xhr.abort(),n.xhr=u.ajax({url:s,data:e,dataType:"json",success:function(e){t(e)},error:function(){t([])}})}):this.source=this.options.source},_searchTimeout:function(s){clearTimeout(this.searching),this.searching=this._delay(function(){var e=this.term===this._value(),t=this.menu.element.is(":visible"),i=s.altKey||s.ctrlKey||s.metaKey||s.shiftKey;e&&(!e||t||i)||(this.selectedItem=null,this.search(null,s))},this.options.delay)},search:function(e,t){return e=null!=e?e:this._value(),this.term=this._value(),e.length<this.options.minLength?this.close(t):!1!==this._trigger("search",t)?this._search(e):void 0},_search:function(e){this.pending++,this._addClass("ui-autocomplete-loading"),this.cancelSearch=!1,this.source({term:e},this._response())},_response:function(){var t=++this.requestIndex;return u.proxy(function(e){t===this.requestIndex&&this.__response(e),this.pending--,this.pending||this._removeClass("ui-autocomplete-loading")},this)},__response:function(e){e=e&&this._normalize(e),this._trigger("response",null,{content:e}),!this.options.disabled&&e&&e.length&&!this.cancelSearch?(this._suggest(e),this._trigger("open")):this._close()},close:function(e){this.cancelSearch=!0,this._close(e)},_close:function(e){this._off(this.document,"mousedown"),this.menu.element.is(":visible")&&(this.menu.element.hide(),this.menu.blur(),this.isNewMenu=!0,this._trigger("close",e))},_change:function(e){this.previous!==this._value()&&this._trigger("change",e,{item:this.selectedItem})},_normalize:function(e){return e.length&&e[0].label&&e[0].value?e:u.map(e,function(e){return"string"==typeof e?{label:e,value:e}:u.extend({},e,{label:e.label||e.value,value:e.value||e.label})})},_suggest:function(e){var t=this.menu.element.empty();this._renderMenu(t,e),this.isNewMenu=!0,this.menu.refresh(),t.show(),this._resizeMenu(),t.position(u.extend({of:this.element},this.options.position)),this.options.autoFocus&&this.menu.next(),this._on(this.document,{mousedown:"_closeOnClickOutside"})},_resizeMenu:function(){var e=this.menu.element;e.outerWidth(Math.max(e.width("").outerWidth()+1,this.element.outerWidth()))},_renderMenu:function(i,e){var s=this;u.each(e,function(e,t){s._renderItemData(i,t)})},_renderItemData:function(e,t){return this._renderItem(e,t).data("ui-autocomplete-item",t)},_renderItem:function(e,t){return u("<li>").append(u("<div>").text(t.label)).appendTo(e)},_move:function(e,t){if(this.menu.element.is(":visible"))return this.menu.isFirstItem()&&/^previous/.test(e)||this.menu.isLastItem()&&/^next/.test(e)?(this.isMultiLine||this._value(this.term),void this.menu.blur()):void this.menu[e](t);this.search(null,t)},widget:function(){return this.menu.element},_value:function(){return this.valueMethod.apply(this.element,arguments)},_keyEvent:function(e,t){this.isMultiLine&&!this.menu.element.is(":visible")||(this._move(e,t),t.preventDefault())},_isContentEditable:function(e){if(!e.length)return!1;var t=e.prop("contentEditable");return"inherit"===t?this._isContentEditable(e.parent()):"true"===t}}),u.extend(u.ui.autocomplete,{escapeRegex:function(e){return e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&")},filter:function(e,t){var i=new RegExp(u.ui.autocomplete.escapeRegex(t),"i");return u.grep(e,function(e){return i.test(e.label||e.value||e)})}}),u.widget("ui.autocomplete",u.ui.autocomplete,{options:{messages:{noResults:"No search results.",results:function(e){return e+(1<e?" results are":" result is")+" available, use up and down arrow keys to navigate."}}},__response:function(e){var t;this._superApply(arguments),this.options.disabled||this.cancelSearch||(t=e&&e.length?this.options.messages.results(e.length):this.options.messages.noResults,this.liveRegion.children().hide(),u("<div>").text(t).appendTo(this.liveRegion))}}),u.ui.autocomplete});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/button.js b/wp-includes/js/jquery/ui/button.js
new file mode 100644
index 0000000000..17348b7166
--- /dev/null
+++ b/wp-includes/js/jquery/ui/button.js
@@ -0,0 +1,385 @@
+/*!
+ * jQuery UI Button 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Button
+//>>group: Widgets
+//>>description: Enhances a form with themeable buttons.
+//>>docs: http://api.jqueryui.com/button/
+//>>demos: http://jqueryui.com/button/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/button.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+
+			// These are only for backcompat
+			// TODO: Remove after 1.12
+			"./controlgroup",
+			"./checkboxradio",
+
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.button", {
+	version: "1.12.1",
+	defaultElement: "<button>",
+	options: {
+		classes: {
+			"ui-button": "ui-corner-all"
+		},
+		disabled: null,
+		icon: null,
+		iconPosition: "beginning",
+		label: null,
+		showLabel: true
+	},
+
+	_getCreateOptions: function() {
+		var disabled,
+
+			// This is to support cases like in jQuery Mobile where the base widget does have
+			// an implementation of _getCreateOptions
+			options = this._super() || {};
+
+		this.isInput = this.element.is( "input" );
+
+		disabled = this.element[ 0 ].disabled;
+		if ( disabled != null ) {
+			options.disabled = disabled;
+		}
+
+		this.originalLabel = this.isInput ? this.element.val() : this.element.html();
+		if ( this.originalLabel ) {
+			options.label = this.originalLabel;
+		}
+
+		return options;
+	},
+
+	_create: function() {
+		if ( !this.option.showLabel & !this.options.icon ) {
+			this.options.showLabel = true;
+		}
+
+		// We have to check the option again here even though we did in _getCreateOptions,
+		// because null may have been passed on init which would override what was set in
+		// _getCreateOptions
+		if ( this.options.disabled == null ) {
+			this.options.disabled = this.element[ 0 ].disabled || false;
+		}
+
+		this.hasTitle = !!this.element.attr( "title" );
+
+		// Check to see if the label needs to be set or if its already correct
+		if ( this.options.label && this.options.label !== this.originalLabel ) {
+			if ( this.isInput ) {
+				this.element.val( this.options.label );
+			} else {
+				this.element.html( this.options.label );
+			}
+		}
+		this._addClass( "ui-button", "ui-widget" );
+		this._setOption( "disabled", this.options.disabled );
+		this._enhance();
+
+		if ( this.element.is( "a" ) ) {
+			this._on( {
+				"keyup": function( event ) {
+					if ( event.keyCode === $.ui.keyCode.SPACE ) {
+						event.preventDefault();
+
+						// Support: PhantomJS <= 1.9, IE 8 Only
+						// If a native click is available use it so we actually cause navigation
+						// otherwise just trigger a click event
+						if ( this.element[ 0 ].click ) {
+							this.element[ 0 ].click();
+						} else {
+							this.element.trigger( "click" );
+						}
+					}
+				}
+			} );
+		}
+	},
+
+	_enhance: function() {
+		if ( !this.element.is( "button" ) ) {
+			this.element.attr( "role", "button" );
+		}
+
+		if ( this.options.icon ) {
+			this._updateIcon( "icon", this.options.icon );
+			this._updateTooltip();
+		}
+	},
+
+	_updateTooltip: function() {
+		this.title = this.element.attr( "title" );
+
+		if ( !this.options.showLabel && !this.title ) {
+			this.element.attr( "title", this.options.label );
+		}
+	},
+
+	_updateIcon: function( option, value ) {
+		var icon = option !== "iconPosition",
+			position = icon ? this.options.iconPosition : value,
+			displayBlock = position === "top" || position === "bottom";
+
+		// Create icon
+		if ( !this.icon ) {
+			this.icon = $( "<span>" );
+
+			this._addClass( this.icon, "ui-button-icon", "ui-icon" );
+
+			if ( !this.options.showLabel ) {
+				this._addClass( "ui-button-icon-only" );
+			}
+		} else if ( icon ) {
+
+			// If we are updating the icon remove the old icon class
+			this._removeClass( this.icon, null, this.options.icon );
+		}
+
+		// If we are updating the icon add the new icon class
+		if ( icon ) {
+			this._addClass( this.icon, null, value );
+		}
+
+		this._attachIcon( position );
+
+		// If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove
+		// the iconSpace if there is one.
+		if ( displayBlock ) {
+			this._addClass( this.icon, null, "ui-widget-icon-block" );
+			if ( this.iconSpace ) {
+				this.iconSpace.remove();
+			}
+		} else {
+
+			// Position is beginning or end so remove the ui-widget-icon-block class and add the
+			// space if it does not exist
+			if ( !this.iconSpace ) {
+				this.iconSpace = $( "<span> </span>" );
+				this._addClass( this.iconSpace, "ui-button-icon-space" );
+			}
+			this._removeClass( this.icon, null, "ui-wiget-icon-block" );
+			this._attachIconSpace( position );
+		}
+	},
+
+	_destroy: function() {
+		this.element.removeAttr( "role" );
+
+		if ( this.icon ) {
+			this.icon.remove();
+		}
+		if ( this.iconSpace ) {
+			this.iconSpace.remove();
+		}
+		if ( !this.hasTitle ) {
+			this.element.removeAttr( "title" );
+		}
+	},
+
+	_attachIconSpace: function( iconPosition ) {
+		this.icon[ /^(?:end|bottom)/.test( iconPosition ) ? "before" : "after" ]( this.iconSpace );
+	},
+
+	_attachIcon: function( iconPosition ) {
+		this.element[ /^(?:end|bottom)/.test( iconPosition ) ? "append" : "prepend" ]( this.icon );
+	},
+
+	_setOptions: function( options ) {
+		var newShowLabel = options.showLabel === undefined ?
+				this.options.showLabel :
+				options.showLabel,
+			newIcon = options.icon === undefined ? this.options.icon : options.icon;
+
+		if ( !newShowLabel && !newIcon ) {
+			options.showLabel = true;
+		}
+		this._super( options );
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "icon" ) {
+			if ( value ) {
+				this._updateIcon( key, value );
+			} else if ( this.icon ) {
+				this.icon.remove();
+				if ( this.iconSpace ) {
+					this.iconSpace.remove();
+				}
+			}
+		}
+
+		if ( key === "iconPosition" ) {
+			this._updateIcon( key, value );
+		}
+
+		// Make sure we can't end up with a button that has neither text nor icon
+		if ( key === "showLabel" ) {
+				this._toggleClass( "ui-button-icon-only", null, !value );
+				this._updateTooltip();
+		}
+
+		if ( key === "label" ) {
+			if ( this.isInput ) {
+				this.element.val( value );
+			} else {
+
+				// If there is an icon, append it, else nothing then append the value
+				// this avoids removal of the icon when setting label text
+				this.element.html( value );
+				if ( this.icon ) {
+					this._attachIcon( this.options.iconPosition );
+					this._attachIconSpace( this.options.iconPosition );
+				}
+			}
+		}
+
+		this._super( key, value );
+
+		if ( key === "disabled" ) {
+			this._toggleClass( null, "ui-state-disabled", value );
+			this.element[ 0 ].disabled = value;
+			if ( value ) {
+				this.element.blur();
+			}
+		}
+	},
+
+	refresh: function() {
+
+		// Make sure to only check disabled if its an element that supports this otherwise
+		// check for the disabled class to determine state
+		var isDisabled = this.element.is( "input, button" ) ?
+			this.element[ 0 ].disabled : this.element.hasClass( "ui-button-disabled" );
+
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOptions( { disabled: isDisabled } );
+		}
+
+		this._updateTooltip();
+	}
+} );
+
+// DEPRECATED
+if ( $.uiBackCompat !== false ) {
+
+	// Text and Icons options
+	$.widget( "ui.button", $.ui.button, {
+		options: {
+			text: true,
+			icons: {
+				primary: null,
+				secondary: null
+			}
+		},
+
+		_create: function() {
+			if ( this.options.showLabel && !this.options.text ) {
+				this.options.showLabel = this.options.text;
+			}
+			if ( !this.options.showLabel && this.options.text ) {
+				this.options.text = this.options.showLabel;
+			}
+			if ( !this.options.icon && ( this.options.icons.primary ||
+					this.options.icons.secondary ) ) {
+				if ( this.options.icons.primary ) {
+					this.options.icon = this.options.icons.primary;
+				} else {
+					this.options.icon = this.options.icons.secondary;
+					this.options.iconPosition = "end";
+				}
+			} else if ( this.options.icon ) {
+				this.options.icons.primary = this.options.icon;
+			}
+			this._super();
+		},
+
+		_setOption: function( key, value ) {
+			if ( key === "text" ) {
+				this._super( "showLabel", value );
+				return;
+			}
+			if ( key === "showLabel" ) {
+				this.options.text = value;
+			}
+			if ( key === "icon" ) {
+				this.options.icons.primary = value;
+			}
+			if ( key === "icons" ) {
+				if ( value.primary ) {
+					this._super( "icon", value.primary );
+					this._super( "iconPosition", "beginning" );
+				} else if ( value.secondary ) {
+					this._super( "icon", value.secondary );
+					this._super( "iconPosition", "end" );
+				}
+			}
+			this._superApply( arguments );
+		}
+	} );
+
+	$.fn.button = ( function( orig ) {
+		return function() {
+			if ( !this.length || ( this.length && this[ 0 ].tagName !== "INPUT" ) ||
+					( this.length && this[ 0 ].tagName === "INPUT" && (
+						this.attr( "type" ) !== "checkbox" && this.attr( "type" ) !== "radio"
+					) ) ) {
+				return orig.apply( this, arguments );
+			}
+			if ( !$.ui.checkboxradio ) {
+				$.error( "Checkboxradio widget missing" );
+			}
+			if ( arguments.length === 0 ) {
+				return this.checkboxradio( {
+					"icon": false
+				} );
+			}
+			return this.checkboxradio.apply( this, arguments );
+		};
+	} )( $.fn.button );
+
+	$.fn.buttonset = function() {
+		if ( !$.ui.controlgroup ) {
+			$.error( "Controlgroup widget missing" );
+		}
+		if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" && arguments[ 2 ] ) {
+			return this.controlgroup.apply( this,
+				[ arguments[ 0 ], "items.button", arguments[ 2 ] ] );
+		}
+		if ( arguments[ 0 ] === "option" && arguments[ 1 ] === "items" ) {
+			return this.controlgroup.apply( this, [ arguments[ 0 ], "items.button" ] );
+		}
+		if ( typeof arguments[ 0 ] === "object" && arguments[ 0 ].items ) {
+			arguments[ 0 ].items = {
+				button: arguments[ 0 ].items
+			};
+		}
+		return this.controlgroup.apply( this, arguments );
+	};
+}
+
+return $.ui.button;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/button.min.js b/wp-includes/js/jquery/ui/button.min.js
index 8b1b4afa35..981f095bc3 100644
--- a/wp-includes/js/jquery/ui/button.min.js
+++ b/wp-includes/js/jquery/ui/button.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Button 1.11.4
+ * jQuery UI Button 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/button/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./widget"],t):t(jQuery)}(function(o){function n(){var t=o(this);setTimeout(function(){t.find(":ui-button").button("refresh")},1)}function a(t){var e=t.name,i=t.form,s=o([]);return e&&(e=e.replace(/'/g,"\\'"),s=i?o(i).find("[name='"+e+"'][type=radio]"):o("[name='"+e+"'][type=radio]",t.ownerDocument).filter(function(){return!this.form})),s}var u,r="ui-button ui-widget ui-state-default ui-corner-all",l="ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only";return o.widget("ui.button",{version:"1.11.4",defaultElement:"<button>",options:{disabled:null,text:!0,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset"+this.eventNamespace).bind("reset"+this.eventNamespace,n),"boolean"!=typeof this.options.disabled?this.options.disabled=!!this.element.prop("disabled"):this.element.prop("disabled",this.options.disabled),this._determineButtonType(),this.hasTitle=!!this.buttonElement.attr("title");var e=this,i=this.options,t="checkbox"===this.type||"radio"===this.type,s=t?"":"ui-state-active";null===i.label&&(i.label="input"===this.type?this.buttonElement.val():this.buttonElement.html()),this._hoverable(this.buttonElement),this.buttonElement.addClass(r).attr("role","button").bind("mouseenter"+this.eventNamespace,function(){i.disabled||this===u&&o(this).addClass("ui-state-active")}).bind("mouseleave"+this.eventNamespace,function(){i.disabled||o(this).removeClass(s)}).bind("click"+this.eventNamespace,function(t){i.disabled&&(t.preventDefault(),t.stopImmediatePropagation())}),this._on({focus:function(){this.buttonElement.addClass("ui-state-focus")},blur:function(){this.buttonElement.removeClass("ui-state-focus")}}),t&&this.element.bind("change"+this.eventNamespace,function(){e.refresh()}),"checkbox"===this.type?this.buttonElement.bind("click"+this.eventNamespace,function(){if(i.disabled)return!1}):"radio"===this.type?this.buttonElement.bind("click"+this.eventNamespace,function(){if(i.disabled)return!1;o(this).addClass("ui-state-active"),e.buttonElement.attr("aria-pressed","true");var t=e.element[0];a(t).not(t).map(function(){return o(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")}):(this.buttonElement.bind("mousedown"+this.eventNamespace,function(){if(i.disabled)return!1;o(this).addClass("ui-state-active"),u=this,e.document.one("mouseup",function(){u=null})}).bind("mouseup"+this.eventNamespace,function(){if(i.disabled)return!1;o(this).removeClass("ui-state-active")}).bind("keydown"+this.eventNamespace,function(t){if(i.disabled)return!1;t.keyCode!==o.ui.keyCode.SPACE&&t.keyCode!==o.ui.keyCode.ENTER||o(this).addClass("ui-state-active")}).bind("keyup"+this.eventNamespace+" blur"+this.eventNamespace,function(){o(this).removeClass("ui-state-active")}),this.buttonElement.is("a")&&this.buttonElement.keyup(function(t){t.keyCode===o.ui.keyCode.SPACE&&o(this).click()})),this._setOption("disabled",i.disabled),this._resetButton()},_determineButtonType:function(){var t,e,i;this.element.is("[type=checkbox]")?this.type="checkbox":this.element.is("[type=radio]")?this.type="radio":this.element.is("input")?this.type="input":this.type="button","checkbox"===this.type||"radio"===this.type?(t=this.element.parents().last(),e="label[for='"+this.element.attr("id")+"']",this.buttonElement=t.find(e),this.buttonElement.length||(t=t.length?t.siblings():this.element.siblings(),this.buttonElement=t.filter(e),this.buttonElement.length||(this.buttonElement=t.find(e))),this.element.addClass("ui-helper-hidden-accessible"),(i=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active"),this.buttonElement.prop("aria-pressed",i)):this.buttonElement=this.element},widget:function(){return this.buttonElement},_destroy:function(){this.element.removeClass("ui-helper-hidden-accessible"),this.buttonElement.removeClass(r+" ui-state-active "+l).removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html()),this.hasTitle||this.buttonElement.removeAttr("title")},_setOption:function(t,e){if(this._super(t,e),"disabled"===t)return this.widget().toggleClass("ui-state-disabled",!!e),this.element.prop("disabled",!!e),void(e&&("checkbox"===this.type||"radio"===this.type?this.buttonElement.removeClass("ui-state-focus"):this.buttonElement.removeClass("ui-state-focus ui-state-active")));this._resetButton()},refresh:function(){var t=this.element.is("input, button")?this.element.is(":disabled"):this.element.hasClass("ui-button-disabled");t!==this.options.disabled&&this._setOption("disabled",t),"radio"===this.type?a(this.element[0]).each(function(){o(this).is(":checked")?o(this).button("widget").addClass("ui-state-active").attr("aria-pressed","true"):o(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")}):"checkbox"===this.type&&(this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false"))},_resetButton:function(){if("input"!==this.type){var t=this.buttonElement.removeClass(l),e=o("<span></span>",this.document[0]).addClass("ui-button-text").html(this.options.label).appendTo(t.empty()).text(),i=this.options.icons,s=i.primary&&i.secondary,n=[];i.primary||i.secondary?(this.options.text&&n.push("ui-button-text-icon"+(s?"s":i.primary?"-primary":"-secondary")),i.primary&&t.prepend("<span class='ui-button-icon-primary ui-icon "+i.primary+"'></span>"),i.secondary&&t.append("<span class='ui-button-icon-secondary ui-icon "+i.secondary+"'></span>"),this.options.text||(n.push(s?"ui-button-icons-only":"ui-button-icon-only"),this.hasTitle||t.attr("title",o.trim(e)))):n.push("ui-button-text-only"),t.addClass(n.join(" "))}else this.options.label&&this.element.val(this.options.label)}}),o.widget("ui.buttonset",{version:"1.11.4",options:{items:"button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(t,e){"disabled"===t&&this.buttons.button("option",t,e),this._super(t,e)},refresh:function(){var t="rtl"===this.element.css("direction"),e=this.element.find(this.options.items),i=e.filter(":ui-button");e.not(":ui-button").button(),i.button("refresh"),this.buttons=e.map(function(){return o(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(t?"ui-corner-right":"ui-corner-left").end().filter(":last").addClass(t?"ui-corner-left":"ui-corner-right").end().end()},_destroy:function(){this.element.removeClass("ui-buttonset"),this.buttons.map(function(){return o(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy")}}),o.ui.button});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./controlgroup","./checkboxradio","./core"],t):t(jQuery)}(function(e){var t;return e.widget("ui.button",{version:"1.12.1",defaultElement:"<button>",options:{classes:{"ui-button":"ui-corner-all"},disabled:null,icon:null,iconPosition:"beginning",label:null,showLabel:!0},_getCreateOptions:function(){var t,i=this._super()||{};return this.isInput=this.element.is("input"),null!=(t=this.element[0].disabled)&&(i.disabled=t),this.originalLabel=this.isInput?this.element.val():this.element.html(),this.originalLabel&&(i.label=this.originalLabel),i},_create:function(){!this.option.showLabel&!this.options.icon&&(this.options.showLabel=!0),null==this.options.disabled&&(this.options.disabled=this.element[0].disabled||!1),this.hasTitle=!!this.element.attr("title"),this.options.label&&this.options.label!==this.originalLabel&&(this.isInput?this.element.val(this.options.label):this.element.html(this.options.label)),this._addClass("ui-button","ui-widget"),this._setOption("disabled",this.options.disabled),this._enhance(),this.element.is("a")&&this._on({keyup:function(t){t.keyCode===e.ui.keyCode.SPACE&&(t.preventDefault(),this.element[0].click?this.element[0].click():this.element.trigger("click"))}})},_enhance:function(){this.element.is("button")||this.element.attr("role","button"),this.options.icon&&(this._updateIcon("icon",this.options.icon),this._updateTooltip())},_updateTooltip:function(){this.title=this.element.attr("title"),this.options.showLabel||this.title||this.element.attr("title",this.options.label)},_updateIcon:function(t,i){var o="iconPosition"!==t,s=o?this.options.iconPosition:i,n="top"===s||"bottom"===s;this.icon?o&&this._removeClass(this.icon,null,this.options.icon):(this.icon=e("<span>"),this._addClass(this.icon,"ui-button-icon","ui-icon"),this.options.showLabel||this._addClass("ui-button-icon-only")),o&&this._addClass(this.icon,null,i),this._attachIcon(s),n?(this._addClass(this.icon,null,"ui-widget-icon-block"),this.iconSpace&&this.iconSpace.remove()):(this.iconSpace||(this.iconSpace=e("<span> </span>"),this._addClass(this.iconSpace,"ui-button-icon-space")),this._removeClass(this.icon,null,"ui-wiget-icon-block"),this._attachIconSpace(s))},_destroy:function(){this.element.removeAttr("role"),this.icon&&this.icon.remove(),this.iconSpace&&this.iconSpace.remove(),this.hasTitle||this.element.removeAttr("title")},_attachIconSpace:function(t){this.icon[/^(?:end|bottom)/.test(t)?"before":"after"](this.iconSpace)},_attachIcon:function(t){this.element[/^(?:end|bottom)/.test(t)?"append":"prepend"](this.icon)},_setOptions:function(t){var i=void 0===t.showLabel?this.options.showLabel:t.showLabel,o=void 0===t.icon?this.options.icon:t.icon;i||o||(t.showLabel=!0),this._super(t)},_setOption:function(t,i){"icon"===t&&(i?this._updateIcon(t,i):this.icon&&(this.icon.remove(),this.iconSpace&&this.iconSpace.remove())),"iconPosition"===t&&this._updateIcon(t,i),"showLabel"===t&&(this._toggleClass("ui-button-icon-only",null,!i),this._updateTooltip()),"label"===t&&(this.isInput?this.element.val(i):(this.element.html(i),this.icon&&(this._attachIcon(this.options.iconPosition),this._attachIconSpace(this.options.iconPosition)))),this._super(t,i),"disabled"===t&&(this._toggleClass(null,"ui-state-disabled",i),(this.element[0].disabled=i)&&this.element.blur())},refresh:function(){var t=this.element.is("input, button")?this.element[0].disabled:this.element.hasClass("ui-button-disabled");t!==this.options.disabled&&this._setOptions({disabled:t}),this._updateTooltip()}}),!1!==e.uiBackCompat&&(e.widget("ui.button",e.ui.button,{options:{text:!0,icons:{primary:null,secondary:null}},_create:function(){this.options.showLabel&&!this.options.text&&(this.options.showLabel=this.options.text),!this.options.showLabel&&this.options.text&&(this.options.text=this.options.showLabel),this.options.icon||!this.options.icons.primary&&!this.options.icons.secondary?this.options.icon&&(this.options.icons.primary=this.options.icon):this.options.icons.primary?this.options.icon=this.options.icons.primary:(this.options.icon=this.options.icons.secondary,this.options.iconPosition="end"),this._super()},_setOption:function(t,i){"text"!==t?("showLabel"===t&&(this.options.text=i),"icon"===t&&(this.options.icons.primary=i),"icons"===t&&(i.primary?(this._super("icon",i.primary),this._super("iconPosition","beginning")):i.secondary&&(this._super("icon",i.secondary),this._super("iconPosition","end"))),this._superApply(arguments)):this._super("showLabel",i)}}),e.fn.button=(t=e.fn.button,function(){return!this.length||this.length&&"INPUT"!==this[0].tagName||this.length&&"INPUT"===this[0].tagName&&"checkbox"!==this.attr("type")&&"radio"!==this.attr("type")?t.apply(this,arguments):(e.ui.checkboxradio||e.error("Checkboxradio widget missing"),0===arguments.length?this.checkboxradio({icon:!1}):this.checkboxradio.apply(this,arguments))}),e.fn.buttonset=function(){return e.ui.controlgroup||e.error("Controlgroup widget missing"),"option"===arguments[0]&&"items"===arguments[1]&&arguments[2]?this.controlgroup.apply(this,[arguments[0],"items.button",arguments[2]]):"option"===arguments[0]&&"items"===arguments[1]?this.controlgroup.apply(this,[arguments[0],"items.button"]):("object"==typeof arguments[0]&&arguments[0].items&&(arguments[0].items={button:arguments[0].items}),this.controlgroup.apply(this,arguments))}),e.ui.button});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/checkboxradio.js b/wp-includes/js/jquery/ui/checkboxradio.js
new file mode 100644
index 0000000000..c2d9029207
--- /dev/null
+++ b/wp-includes/js/jquery/ui/checkboxradio.js
@@ -0,0 +1,283 @@
+/*!
+ * jQuery UI Checkboxradio 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Checkboxradio
+//>>group: Widgets
+//>>description: Enhances a form with multiple themeable checkboxes or radio buttons.
+//>>docs: http://api.jqueryui.com/checkboxradio/
+//>>demos: http://jqueryui.com/checkboxradio/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/button.css
+//>>css.structure: ../../themes/base/checkboxradio.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.checkboxradio", [ $.ui.formResetMixin, {
+	version: "1.12.1",
+	options: {
+		disabled: null,
+		label: null,
+		icon: true,
+		classes: {
+			"ui-checkboxradio-label": "ui-corner-all",
+			"ui-checkboxradio-icon": "ui-corner-all"
+		}
+	},
+
+	_getCreateOptions: function() {
+		var disabled, labels;
+		var that = this;
+		var options = this._super() || {};
+
+		// We read the type here, because it makes more sense to throw a element type error first,
+		// rather then the error for lack of a label. Often if its the wrong type, it
+		// won't have a label (e.g. calling on a div, btn, etc)
+		this._readType();
+
+		labels = this.element.labels();
+
+		// If there are multiple labels, use the last one
+		this.label = $( labels[ labels.length - 1 ] );
+		if ( !this.label.length ) {
+			$.error( "No label found for checkboxradio widget" );
+		}
+
+		this.originalLabel = "";
+
+		// We need to get the label text but this may also need to make sure it does not contain the
+		// input itself.
+		this.label.contents().not( this.element[ 0 ] ).each( function() {
+
+			// The label contents could be text, html, or a mix. We concat each element to get a
+			// string representation of the label, without the input as part of it.
+			that.originalLabel += this.nodeType === 3 ? $( this ).text() : this.outerHTML;
+		} );
+
+		// Set the label option if we found label text
+		if ( this.originalLabel ) {
+			options.label = this.originalLabel;
+		}
+
+		disabled = this.element[ 0 ].disabled;
+		if ( disabled != null ) {
+			options.disabled = disabled;
+		}
+		return options;
+	},
+
+	_create: function() {
+		var checked = this.element[ 0 ].checked;
+
+		this._bindFormResetHandler();
+
+		if ( this.options.disabled == null ) {
+			this.options.disabled = this.element[ 0 ].disabled;
+		}
+
+		this._setOption( "disabled", this.options.disabled );
+		this._addClass( "ui-checkboxradio", "ui-helper-hidden-accessible" );
+		this._addClass( this.label, "ui-checkboxradio-label", "ui-button ui-widget" );
+
+		if ( this.type === "radio" ) {
+			this._addClass( this.label, "ui-checkboxradio-radio-label" );
+		}
+
+		if ( this.options.label && this.options.label !== this.originalLabel ) {
+			this._updateLabel();
+		} else if ( this.originalLabel ) {
+			this.options.label = this.originalLabel;
+		}
+
+		this._enhance();
+
+		if ( checked ) {
+			this._addClass( this.label, "ui-checkboxradio-checked", "ui-state-active" );
+			if ( this.icon ) {
+				this._addClass( this.icon, null, "ui-state-hover" );
+			}
+		}
+
+		this._on( {
+			change: "_toggleClasses",
+			focus: function() {
+				this._addClass( this.label, null, "ui-state-focus ui-visual-focus" );
+			},
+			blur: function() {
+				this._removeClass( this.label, null, "ui-state-focus ui-visual-focus" );
+			}
+		} );
+	},
+
+	_readType: function() {
+		var nodeName = this.element[ 0 ].nodeName.toLowerCase();
+		this.type = this.element[ 0 ].type;
+		if ( nodeName !== "input" || !/radio|checkbox/.test( this.type ) ) {
+			$.error( "Can't create checkboxradio on element.nodeName=" + nodeName +
+				" and element.type=" + this.type );
+		}
+	},
+
+	// Support jQuery Mobile enhanced option
+	_enhance: function() {
+		this._updateIcon( this.element[ 0 ].checked );
+	},
+
+	widget: function() {
+		return this.label;
+	},
+
+	_getRadioGroup: function() {
+		var group;
+		var name = this.element[ 0 ].name;
+		var nameSelector = "input[name='" + $.ui.escapeSelector( name ) + "']";
+
+		if ( !name ) {
+			return $( [] );
+		}
+
+		if ( this.form.length ) {
+			group = $( this.form[ 0 ].elements ).filter( nameSelector );
+		} else {
+
+			// Not inside a form, check all inputs that also are not inside a form
+			group = $( nameSelector ).filter( function() {
+				return $( this ).form().length === 0;
+			} );
+		}
+
+		return group.not( this.element );
+	},
+
+	_toggleClasses: function() {
+		var checked = this.element[ 0 ].checked;
+		this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked );
+
+		if ( this.options.icon && this.type === "checkbox" ) {
+			this._toggleClass( this.icon, null, "ui-icon-check ui-state-checked", checked )
+				._toggleClass( this.icon, null, "ui-icon-blank", !checked );
+		}
+
+		if ( this.type === "radio" ) {
+			this._getRadioGroup()
+				.each( function() {
+					var instance = $( this ).checkboxradio( "instance" );
+
+					if ( instance ) {
+						instance._removeClass( instance.label,
+							"ui-checkboxradio-checked", "ui-state-active" );
+					}
+				} );
+		}
+	},
+
+	_destroy: function() {
+		this._unbindFormResetHandler();
+
+		if ( this.icon ) {
+			this.icon.remove();
+			this.iconSpace.remove();
+		}
+	},
+
+	_setOption: function( key, value ) {
+
+		// We don't allow the value to be set to nothing
+		if ( key === "label" && !value ) {
+			return;
+		}
+
+		this._super( key, value );
+
+		if ( key === "disabled" ) {
+			this._toggleClass( this.label, null, "ui-state-disabled", value );
+			this.element[ 0 ].disabled = value;
+
+			// Don't refresh when setting disabled
+			return;
+		}
+		this.refresh();
+	},
+
+	_updateIcon: function( checked ) {
+		var toAdd = "ui-icon ui-icon-background ";
+
+		if ( this.options.icon ) {
+			if ( !this.icon ) {
+				this.icon = $( "<span>" );
+				this.iconSpace = $( "<span> </span>" );
+				this._addClass( this.iconSpace, "ui-checkboxradio-icon-space" );
+			}
+
+			if ( this.type === "checkbox" ) {
+				toAdd += checked ? "ui-icon-check ui-state-checked" : "ui-icon-blank";
+				this._removeClass( this.icon, null, checked ? "ui-icon-blank" : "ui-icon-check" );
+			} else {
+				toAdd += "ui-icon-blank";
+			}
+			this._addClass( this.icon, "ui-checkboxradio-icon", toAdd );
+			if ( !checked ) {
+				this._removeClass( this.icon, null, "ui-icon-check ui-state-checked" );
+			}
+			this.icon.prependTo( this.label ).after( this.iconSpace );
+		} else if ( this.icon !== undefined ) {
+			this.icon.remove();
+			this.iconSpace.remove();
+			delete this.icon;
+		}
+	},
+
+	_updateLabel: function() {
+
+		// Remove the contents of the label ( minus the icon, icon space, and input )
+		var contents = this.label.contents().not( this.element[ 0 ] );
+		if ( this.icon ) {
+			contents = contents.not( this.icon[ 0 ] );
+		}
+		if ( this.iconSpace ) {
+			contents = contents.not( this.iconSpace[ 0 ] );
+		}
+		contents.remove();
+
+		this.label.append( this.options.label );
+	},
+
+	refresh: function() {
+		var checked = this.element[ 0 ].checked,
+			isDisabled = this.element[ 0 ].disabled;
+
+		this._updateIcon( checked );
+		this._toggleClass( this.label, "ui-checkboxradio-checked", "ui-state-active", checked );
+		if ( this.options.label !== null ) {
+			this._updateLabel();
+		}
+
+		if ( isDisabled !== this.options.disabled ) {
+			this._setOptions( { "disabled": isDisabled } );
+		}
+	}
+
+} ] );
+
+return $.ui.checkboxradio;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/checkboxradio.min.js b/wp-includes/js/jquery/ui/checkboxradio.min.js
new file mode 100644
index 0000000000..09e7f97841
--- /dev/null
+++ b/wp-includes/js/jquery/ui/checkboxradio.min.js
@@ -0,0 +1,9 @@
+/*!
+ * jQuery UI Checkboxradio 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(o){return o.widget("ui.checkboxradio",[o.ui.formResetMixin,{version:"1.12.1",options:{disabled:null,label:null,icon:!0,classes:{"ui-checkboxradio-label":"ui-corner-all","ui-checkboxradio-icon":"ui-corner-all"}},_getCreateOptions:function(){var e,i,t=this,s=this._super()||{};return this._readType(),i=this.element.labels(),this.label=o(i[i.length-1]),this.label.length||o.error("No label found for checkboxradio widget"),this.originalLabel="",this.label.contents().not(this.element[0]).each(function(){t.originalLabel+=3===this.nodeType?o(this).text():this.outerHTML}),this.originalLabel&&(s.label=this.originalLabel),null!=(e=this.element[0].disabled)&&(s.disabled=e),s},_create:function(){var e=this.element[0].checked;this._bindFormResetHandler(),null==this.options.disabled&&(this.options.disabled=this.element[0].disabled),this._setOption("disabled",this.options.disabled),this._addClass("ui-checkboxradio","ui-helper-hidden-accessible"),this._addClass(this.label,"ui-checkboxradio-label","ui-button ui-widget"),"radio"===this.type&&this._addClass(this.label,"ui-checkboxradio-radio-label"),this.options.label&&this.options.label!==this.originalLabel?this._updateLabel():this.originalLabel&&(this.options.label=this.originalLabel),this._enhance(),e&&(this._addClass(this.label,"ui-checkboxradio-checked","ui-state-active"),this.icon&&this._addClass(this.icon,null,"ui-state-hover")),this._on({change:"_toggleClasses",focus:function(){this._addClass(this.label,null,"ui-state-focus ui-visual-focus")},blur:function(){this._removeClass(this.label,null,"ui-state-focus ui-visual-focus")}})},_readType:function(){var e=this.element[0].nodeName.toLowerCase();this.type=this.element[0].type,"input"===e&&/radio|checkbox/.test(this.type)||o.error("Can't create checkboxradio on element.nodeName="+e+" and element.type="+this.type)},_enhance:function(){this._updateIcon(this.element[0].checked)},widget:function(){return this.label},_getRadioGroup:function(){var e=this.element[0].name,i="input[name='"+o.ui.escapeSelector(e)+"']";return e?(this.form.length?o(this.form[0].elements).filter(i):o(i).filter(function(){return 0===o(this).form().length})).not(this.element):o([])},_toggleClasses:function(){var e=this.element[0].checked;this._toggleClass(this.label,"ui-checkboxradio-checked","ui-state-active",e),this.options.icon&&"checkbox"===this.type&&this._toggleClass(this.icon,null,"ui-icon-check ui-state-checked",e)._toggleClass(this.icon,null,"ui-icon-blank",!e),"radio"===this.type&&this._getRadioGroup().each(function(){var e=o(this).checkboxradio("instance");e&&e._removeClass(e.label,"ui-checkboxradio-checked","ui-state-active")})},_destroy:function(){this._unbindFormResetHandler(),this.icon&&(this.icon.remove(),this.iconSpace.remove())},_setOption:function(e,i){if("label"!==e||i){if(this._super(e,i),"disabled"===e)return this._toggleClass(this.label,null,"ui-state-disabled",i),void(this.element[0].disabled=i);this.refresh()}},_updateIcon:function(e){var i="ui-icon ui-icon-background ";this.options.icon?(this.icon||(this.icon=o("<span>"),this.iconSpace=o("<span> </span>"),this._addClass(this.iconSpace,"ui-checkboxradio-icon-space")),"checkbox"===this.type?(i+=e?"ui-icon-check ui-state-checked":"ui-icon-blank",this._removeClass(this.icon,null,e?"ui-icon-blank":"ui-icon-check")):i+="ui-icon-blank",this._addClass(this.icon,"ui-checkboxradio-icon",i),e||this._removeClass(this.icon,null,"ui-icon-check ui-state-checked"),this.icon.prependTo(this.label).after(this.iconSpace)):void 0!==this.icon&&(this.icon.remove(),this.iconSpace.remove(),delete this.icon)},_updateLabel:function(){var e=this.label.contents().not(this.element[0]);this.icon&&(e=e.not(this.icon[0])),this.iconSpace&&(e=e.not(this.iconSpace[0])),e.remove(),this.label.append(this.options.label)},refresh:function(){var e=this.element[0].checked,i=this.element[0].disabled;this._updateIcon(e),this._toggleClass(this.label,"ui-checkboxradio-checked","ui-state-active",e),null!==this.options.label&&this._updateLabel(),i!==this.options.disabled&&this._setOptions({disabled:i})}}]),o.ui.checkboxradio});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/controlgroup.js b/wp-includes/js/jquery/ui/controlgroup.js
new file mode 100644
index 0000000000..9fc364b846
--- /dev/null
+++ b/wp-includes/js/jquery/ui/controlgroup.js
@@ -0,0 +1,298 @@
+/*!
+ * jQuery UI Controlgroup 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Controlgroup
+//>>group: Widgets
+//>>description: Visually groups form control widgets
+//>>docs: http://api.jqueryui.com/controlgroup/
+//>>demos: http://jqueryui.com/controlgroup/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/controlgroup.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g;
+
+return $.widget( "ui.controlgroup", {
+	version: "1.12.1",
+	defaultElement: "<div>",
+	options: {
+		direction: "horizontal",
+		disabled: null,
+		onlyVisible: true,
+		items: {
+			"button": "input[type=button], input[type=submit], input[type=reset], button, a",
+			"controlgroupLabel": ".ui-controlgroup-label",
+			"checkboxradio": "input[type='checkbox'], input[type='radio']",
+			"selectmenu": "select",
+			"spinner": ".ui-spinner-input"
+		}
+	},
+
+	_create: function() {
+		this._enhance();
+	},
+
+	// To support the enhanced option in jQuery Mobile, we isolate DOM manipulation
+	_enhance: function() {
+		this.element.attr( "role", "toolbar" );
+		this.refresh();
+	},
+
+	_destroy: function() {
+		this._callChildMethod( "destroy" );
+		this.childWidgets.removeData( "ui-controlgroup-data" );
+		this.element.removeAttr( "role" );
+		if ( this.options.items.controlgroupLabel ) {
+			this.element
+				.find( this.options.items.controlgroupLabel )
+				.find( ".ui-controlgroup-label-contents" )
+				.contents().unwrap();
+		}
+	},
+
+	_initWidgets: function() {
+		var that = this,
+			childWidgets = [];
+
+		// First we iterate over each of the items options
+		$.each( this.options.items, function( widget, selector ) {
+			var labels;
+			var options = {};
+
+			// Make sure the widget has a selector set
+			if ( !selector ) {
+				return;
+			}
+
+			if ( widget === "controlgroupLabel" ) {
+				labels = that.element.find( selector );
+				labels.each( function() {
+					var element = $( this );
+
+					if ( element.children( ".ui-controlgroup-label-contents" ).length ) {
+						return;
+					}
+					element.contents()
+						.wrapAll( "<span class='ui-controlgroup-label-contents'></span>" );
+				} );
+				that._addClass( labels, null, "ui-widget ui-widget-content ui-state-default" );
+				childWidgets = childWidgets.concat( labels.get() );
+				return;
+			}
+
+			// Make sure the widget actually exists
+			if ( !$.fn[ widget ] ) {
+				return;
+			}
+
+			// We assume everything is in the middle to start because we can't determine
+			// first / last elements until all enhancments are done.
+			if ( that[ "_" + widget + "Options" ] ) {
+				options = that[ "_" + widget + "Options" ]( "middle" );
+			} else {
+				options = { classes: {} };
+			}
+
+			// Find instances of this widget inside controlgroup and init them
+			that.element
+				.find( selector )
+				.each( function() {
+					var element = $( this );
+					var instance = element[ widget ]( "instance" );
+
+					// We need to clone the default options for this type of widget to avoid
+					// polluting the variable options which has a wider scope than a single widget.
+					var instanceOptions = $.widget.extend( {}, options );
+
+					// If the button is the child of a spinner ignore it
+					// TODO: Find a more generic solution
+					if ( widget === "button" && element.parent( ".ui-spinner" ).length ) {
+						return;
+					}
+
+					// Create the widget if it doesn't exist
+					if ( !instance ) {
+						instance = element[ widget ]()[ widget ]( "instance" );
+					}
+					if ( instance ) {
+						instanceOptions.classes =
+							that._resolveClassesValues( instanceOptions.classes, instance );
+					}
+					element[ widget ]( instanceOptions );
+
+					// Store an instance of the controlgroup to be able to reference
+					// from the outermost element for changing options and refresh
+					var widgetElement = element[ widget ]( "widget" );
+					$.data( widgetElement[ 0 ], "ui-controlgroup-data",
+						instance ? instance : element[ widget ]( "instance" ) );
+
+					childWidgets.push( widgetElement[ 0 ] );
+				} );
+		} );
+
+		this.childWidgets = $( $.unique( childWidgets ) );
+		this._addClass( this.childWidgets, "ui-controlgroup-item" );
+	},
+
+	_callChildMethod: function( method ) {
+		this.childWidgets.each( function() {
+			var element = $( this ),
+				data = element.data( "ui-controlgroup-data" );
+			if ( data && data[ method ] ) {
+				data[ method ]();
+			}
+		} );
+	},
+
+	_updateCornerClass: function( element, position ) {
+		var remove = "ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all";
+		var add = this._buildSimpleOptions( position, "label" ).classes.label;
+
+		this._removeClass( element, null, remove );
+		this._addClass( element, null, add );
+	},
+
+	_buildSimpleOptions: function( position, key ) {
+		var direction = this.options.direction === "vertical";
+		var result = {
+			classes: {}
+		};
+		result.classes[ key ] = {
+			"middle": "",
+			"first": "ui-corner-" + ( direction ? "top" : "left" ),
+			"last": "ui-corner-" + ( direction ? "bottom" : "right" ),
+			"only": "ui-corner-all"
+		}[ position ];
+
+		return result;
+	},
+
+	_spinnerOptions: function( position ) {
+		var options = this._buildSimpleOptions( position, "ui-spinner" );
+
+		options.classes[ "ui-spinner-up" ] = "";
+		options.classes[ "ui-spinner-down" ] = "";
+
+		return options;
+	},
+
+	_buttonOptions: function( position ) {
+		return this._buildSimpleOptions( position, "ui-button" );
+	},
+
+	_checkboxradioOptions: function( position ) {
+		return this._buildSimpleOptions( position, "ui-checkboxradio-label" );
+	},
+
+	_selectmenuOptions: function( position ) {
+		var direction = this.options.direction === "vertical";
+		return {
+			width: direction ? "auto" : false,
+			classes: {
+				middle: {
+					"ui-selectmenu-button-open": "",
+					"ui-selectmenu-button-closed": ""
+				},
+				first: {
+					"ui-selectmenu-button-open": "ui-corner-" + ( direction ? "top" : "tl" ),
+					"ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "top" : "left" )
+				},
+				last: {
+					"ui-selectmenu-button-open": direction ? "" : "ui-corner-tr",
+					"ui-selectmenu-button-closed": "ui-corner-" + ( direction ? "bottom" : "right" )
+				},
+				only: {
+					"ui-selectmenu-button-open": "ui-corner-top",
+					"ui-selectmenu-button-closed": "ui-corner-all"
+				}
+
+			}[ position ]
+		};
+	},
+
+	_resolveClassesValues: function( classes, instance ) {
+		var result = {};
+		$.each( classes, function( key ) {
+			var current = instance.options.classes[ key ] || "";
+			current = $.trim( current.replace( controlgroupCornerRegex, "" ) );
+			result[ key ] = ( current + " " + classes[ key ] ).replace( /\s+/g, " " );
+		} );
+		return result;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "direction" ) {
+			this._removeClass( "ui-controlgroup-" + this.options.direction );
+		}
+
+		this._super( key, value );
+		if ( key === "disabled" ) {
+			this._callChildMethod( value ? "disable" : "enable" );
+			return;
+		}
+
+		this.refresh();
+	},
+
+	refresh: function() {
+		var children,
+			that = this;
+
+		this._addClass( "ui-controlgroup ui-controlgroup-" + this.options.direction );
+
+		if ( this.options.direction === "horizontal" ) {
+			this._addClass( null, "ui-helper-clearfix" );
+		}
+		this._initWidgets();
+
+		children = this.childWidgets;
+
+		// We filter here because we need to track all childWidgets not just the visible ones
+		if ( this.options.onlyVisible ) {
+			children = children.filter( ":visible" );
+		}
+
+		if ( children.length ) {
+
+			// We do this last because we need to make sure all enhancment is done
+			// before determining first and last
+			$.each( [ "first", "last" ], function( index, value ) {
+				var instance = children[ value ]().data( "ui-controlgroup-data" );
+
+				if ( instance && that[ "_" + instance.widgetName + "Options" ] ) {
+					var options = that[ "_" + instance.widgetName + "Options" ](
+						children.length === 1 ? "only" : value
+					);
+					options.classes = that._resolveClassesValues( options.classes, instance );
+					instance.element[ instance.widgetName ]( options );
+				} else {
+					that._updateCornerClass( children[ value ](), value );
+				}
+			} );
+
+			// Finally call the refresh method on each of the child widgets.
+			this._callChildMethod( "refresh" );
+		}
+	}
+} );
+} ) );
diff --git a/wp-includes/js/jquery/ui/controlgroup.min.js b/wp-includes/js/jquery/ui/controlgroup.min.js
new file mode 100644
index 0000000000..b5cce2ebdc
--- /dev/null
+++ b/wp-includes/js/jquery/ui/controlgroup.min.js
@@ -0,0 +1,9 @@
+/*!
+ * jQuery UI Controlgroup 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./core"],t):t(jQuery)}(function(u){var s=/ui-corner-([a-z]){2,6}/g;return u.widget("ui.controlgroup",{version:"1.12.1",defaultElement:"<div>",options:{direction:"horizontal",disabled:null,onlyVisible:!0,items:{button:"input[type=button], input[type=submit], input[type=reset], button, a",controlgroupLabel:".ui-controlgroup-label",checkboxradio:"input[type='checkbox'], input[type='radio']",selectmenu:"select",spinner:".ui-spinner-input"}},_create:function(){this._enhance()},_enhance:function(){this.element.attr("role","toolbar"),this.refresh()},_destroy:function(){this._callChildMethod("destroy"),this.childWidgets.removeData("ui-controlgroup-data"),this.element.removeAttr("role"),this.options.items.controlgroupLabel&&this.element.find(this.options.items.controlgroupLabel).find(".ui-controlgroup-label-contents").contents().unwrap()},_initWidgets:function(){var l=this,r=[];u.each(this.options.items,function(o,t){var e,s={};if(t)return"controlgroupLabel"===o?((e=l.element.find(t)).each(function(){var t=u(this);t.children(".ui-controlgroup-label-contents").length||t.contents().wrapAll("<span class='ui-controlgroup-label-contents'></span>")}),l._addClass(e,null,"ui-widget ui-widget-content ui-state-default"),void(r=r.concat(e.get()))):void(u.fn[o]&&(s=l["_"+o+"Options"]?l["_"+o+"Options"]("middle"):{classes:{}},l.element.find(t).each(function(){var t=u(this),e=t[o]("instance"),i=u.widget.extend({},s);if("button"!==o||!t.parent(".ui-spinner").length){(e=e||t[o]()[o]("instance"))&&(i.classes=l._resolveClassesValues(i.classes,e)),t[o](i);var n=t[o]("widget");u.data(n[0],"ui-controlgroup-data",e||t[o]("instance")),r.push(n[0])}})))}),this.childWidgets=u(u.unique(r)),this._addClass(this.childWidgets,"ui-controlgroup-item")},_callChildMethod:function(e){this.childWidgets.each(function(){var t=u(this).data("ui-controlgroup-data");t&&t[e]&&t[e]()})},_updateCornerClass:function(t,e){var i=this._buildSimpleOptions(e,"label").classes.label;this._removeClass(t,null,"ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all"),this._addClass(t,null,i)},_buildSimpleOptions:function(t,e){var i="vertical"===this.options.direction,n={classes:{}};return n.classes[e]={middle:"",first:"ui-corner-"+(i?"top":"left"),last:"ui-corner-"+(i?"bottom":"right"),only:"ui-corner-all"}[t],n},_spinnerOptions:function(t){var e=this._buildSimpleOptions(t,"ui-spinner");return e.classes["ui-spinner-up"]="",e.classes["ui-spinner-down"]="",e},_buttonOptions:function(t){return this._buildSimpleOptions(t,"ui-button")},_checkboxradioOptions:function(t){return this._buildSimpleOptions(t,"ui-checkboxradio-label")},_selectmenuOptions:function(t){var e="vertical"===this.options.direction;return{width:e&&"auto",classes:{middle:{"ui-selectmenu-button-open":"","ui-selectmenu-button-closed":""},first:{"ui-selectmenu-button-open":"ui-corner-"+(e?"top":"tl"),"ui-selectmenu-button-closed":"ui-corner-"+(e?"top":"left")},last:{"ui-selectmenu-button-open":e?"":"ui-corner-tr","ui-selectmenu-button-closed":"ui-corner-"+(e?"bottom":"right")},only:{"ui-selectmenu-button-open":"ui-corner-top","ui-selectmenu-button-closed":"ui-corner-all"}}[t]}},_resolveClassesValues:function(i,n){var o={};return u.each(i,function(t){var e=n.options.classes[t]||"";e=u.trim(e.replace(s,"")),o[t]=(e+" "+i[t]).replace(/\s+/g," ")}),o},_setOption:function(t,e){"direction"===t&&this._removeClass("ui-controlgroup-"+this.options.direction),this._super(t,e),"disabled"!==t?this.refresh():this._callChildMethod(e?"disable":"enable")},refresh:function(){var o,s=this;this._addClass("ui-controlgroup ui-controlgroup-"+this.options.direction),"horizontal"===this.options.direction&&this._addClass(null,"ui-helper-clearfix"),this._initWidgets(),o=this.childWidgets,this.options.onlyVisible&&(o=o.filter(":visible")),o.length&&(u.each(["first","last"],function(t,e){var i=o[e]().data("ui-controlgroup-data");if(i&&s["_"+i.widgetName+"Options"]){var n=s["_"+i.widgetName+"Options"](1===o.length?"only":e);n.classes=s._resolveClassesValues(n.classes,i),i.element[i.widgetName](n)}else s._updateCornerClass(o[e](),e)}),this._callChildMethod("refresh"))}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/core.js b/wp-includes/js/jquery/ui/core.js
new file mode 100644
index 0000000000..32b8d10842
--- /dev/null
+++ b/wp-includes/js/jquery/ui/core.js
@@ -0,0 +1,1768 @@
+/*! jQuery UI - v1.12.1 - 2020-09-25
+* http://jqueryui.com
+* Includes: data.js, disable-selection.js, escape-selector.js, focusable.js, form-reset-mixin.js, form.js, ie.js, jquery-1-7.js, keycode.js, labels.js, plugin.js, position.js, safe-active-element.js, safe-blur.js, scroll-parent.js, tabbable.js, unique-id.js, version.js, widget.js
+* Copyright jQuery Foundation and other contributors; Licensed  */
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [ "jquery" ], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+} ( function( $ ) {
+
+// Source: version.js
+$.ui = $.ui || {};
+
+$.ui.version = "1.12.1";
+
+// Source: data.js
+/*!
+ * jQuery UI :data 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: :data Selector
+//>>group: Core
+//>>description: Selects elements which have data stored under the specified key.
+//>>docs: http://api.jqueryui.com/data-selector/
+
+$.extend( $.expr[ ":" ], {
+	data: $.expr.createPseudo ?
+		$.expr.createPseudo( function( dataName ) {
+			return function( elem ) {
+				return !!$.data( elem, dataName );
+			};
+		} ) :
+
+		// Support: jQuery <1.8
+		function( elem, i, match ) {
+			return !!$.data( elem, match[ 3 ] );
+		}
+} );
+
+
+// Source: disable-selection.js
+/*!
+ * jQuery UI Disable Selection 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: disableSelection
+//>>group: Core
+//>>description: Disable selection of text content within the set of matched elements.
+//>>docs: http://api.jqueryui.com/disableSelection/
+
+// This file is deprecated
+$.fn.extend( {
+	disableSelection: ( function() {
+		var eventType = "onselectstart" in document.createElement( "div" ) ?
+			"selectstart" :
+			"mousedown";
+
+		return function() {
+			return this.on( eventType + ".ui-disableSelection", function( event ) {
+				event.preventDefault();
+			} );
+		};
+	} )(),
+
+	enableSelection: function() {
+		return this.off( ".ui-disableSelection" );
+	}
+} );
+
+// Source: escape-selector.js
+// Internal use only
+$.ui.escapeSelector = ( function() {
+	var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g;
+	return function( selector ) {
+		return selector.replace( selectorEscape, "\\$1" );
+	};
+} )();
+
+// Source: focusable.js
+/*!
+ * jQuery UI Focusable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: :focusable Selector
+//>>group: Core
+//>>description: Selects elements which can be focused.
+//>>docs: http://api.jqueryui.com/focusable-selector/
+
+// Selectors
+$.ui.focusable = function( element, hasTabindex ) {
+	var map, mapName, img, focusableIfVisible, fieldset,
+		nodeName = element.nodeName.toLowerCase();
+
+	if ( "area" === nodeName ) {
+		map = element.parentNode;
+		mapName = map.name;
+		if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) {
+			return false;
+		}
+		img = $( "img[usemap='#" + mapName + "']" );
+		return img.length > 0 && img.is( ":visible" );
+	}
+
+	if ( /^(input|select|textarea|button|object)$/.test( nodeName ) ) {
+		focusableIfVisible = !element.disabled;
+
+		if ( focusableIfVisible ) {
+
+			// Form controls within a disabled fieldset are disabled.
+			// However, controls within the fieldset's legend do not get disabled.
+			// Since controls generally aren't placed inside legends, we skip
+			// this portion of the check.
+			fieldset = $( element ).closest( "fieldset" )[ 0 ];
+			if ( fieldset ) {
+				focusableIfVisible = !fieldset.disabled;
+			}
+		}
+	} else if ( "a" === nodeName ) {
+		focusableIfVisible = element.href || hasTabindex;
+	} else {
+		focusableIfVisible = hasTabindex;
+	}
+
+	return focusableIfVisible && $( element ).is( ":visible" ) && visible( $( element ) );
+};
+
+// Support: IE 8 only
+// IE 8 doesn't resolve inherit to visible/hidden for computed values
+function visible( element ) {
+	var visibility = element.css( "visibility" );
+	while ( visibility === "inherit" ) {
+		element = element.parent();
+		visibility = element.css( "visibility" );
+	}
+	return visibility !== "hidden";
+}
+
+$.extend( $.expr[ ":" ], {
+	focusable: function( element ) {
+		return $.ui.focusable( element, $.attr( element, "tabindex" ) != null );
+	}
+} );
+
+// Source: form.js
+// Support: IE8 Only
+// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop
+// with a string, so we need to find the proper form.
+$.fn.form = function() {
+	return typeof this[ 0 ].form === "string" ? this.closest( "form" ) : $( this[ 0 ].form );
+};
+
+// Source: form-reset-mixin.js
+/*!
+ * jQuery UI Form Reset Mixin 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Form Reset Mixin
+//>>group: Core
+//>>description: Refresh input widgets when their form is reset
+//>>docs: http://api.jqueryui.com/form-reset-mixin/
+
+$.ui.formResetMixin = {
+	_formResetHandler: function() {
+		var form = $( this );
+
+		// Wait for the form reset to actually happen before refreshing
+		setTimeout( function() {
+			var instances = form.data( "ui-form-reset-instances" );
+			$.each( instances, function() {
+				this.refresh();
+			} );
+		} );
+	},
+
+	_bindFormResetHandler: function() {
+		this.form = this.element.form();
+		if ( !this.form.length ) {
+			return;
+		}
+
+		var instances = this.form.data( "ui-form-reset-instances" ) || [];
+		if ( !instances.length ) {
+
+			// We don't use _on() here because we use a single event handler per form
+			this.form.on( "reset.ui-form-reset", this._formResetHandler );
+		}
+		instances.push( this );
+		this.form.data( "ui-form-reset-instances", instances );
+	},
+
+	_unbindFormResetHandler: function() {
+		if ( !this.form.length ) {
+			return;
+		}
+
+		var instances = this.form.data( "ui-form-reset-instances" );
+		instances.splice( $.inArray( this, instances ), 1 );
+		if ( instances.length ) {
+			this.form.data( "ui-form-reset-instances", instances );
+		} else {
+			this.form
+				.removeData( "ui-form-reset-instances" )
+				.off( "reset.ui-form-reset" );
+		}
+	}
+};
+
+// Source: ie.js
+// This file is deprecated
+$.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() );
+
+// Source: jquery-1-7.js
+/*!
+ * jQuery UI Support for jQuery core 1.7.x 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ */
+
+//>>label: jQuery 1.7 Support
+//>>group: Core
+//>>description: Support version 1.7.x of jQuery core
+
+// Support: jQuery 1.7 only
+// Not a great way to check versions, but since we only support 1.7+ and only
+// need to detect <1.8, this is a simple check that should suffice. Checking
+// for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0
+// and we'll never reach 1.70.0 (if we do, we certainly won't be supporting
+// 1.7 anymore). See #11197 for why we're not using feature detection.
+if ( $.fn.jquery.substring( 0, 3 ) === "1.7" ) {
+
+	// Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight()
+	// Unlike jQuery Core 1.8+, these only support numeric values to set the
+	// dimensions in pixels
+	$.each( [ "Width", "Height" ], function( i, name ) {
+		var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ],
+			type = name.toLowerCase(),
+			orig = {
+				innerWidth: $.fn.innerWidth,
+				innerHeight: $.fn.innerHeight,
+				outerWidth: $.fn.outerWidth,
+				outerHeight: $.fn.outerHeight
+			};
+
+		function reduce( elem, size, border, margin ) {
+			$.each( side, function() {
+				size -= parseFloat( $.css( elem, "padding" + this ) ) || 0;
+				if ( border ) {
+					size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0;
+				}
+				if ( margin ) {
+					size -= parseFloat( $.css( elem, "margin" + this ) ) || 0;
+				}
+			} );
+			return size;
+		}
+
+		$.fn[ "inner" + name ] = function( size ) {
+			if ( size === undefined ) {
+				return orig[ "inner" + name ].call( this );
+			}
+
+			return this.each( function() {
+				$( this ).css( type, reduce( this, size ) + "px" );
+			} );
+		};
+
+		$.fn[ "outer" + name ] = function( size, margin ) {
+			if ( typeof size !== "number" ) {
+				return orig[ "outer" + name ].call( this, size );
+			}
+
+			return this.each( function() {
+				$( this ).css( type, reduce( this, size, true, margin ) + "px" );
+			} );
+		};
+	} );
+
+	$.fn.addBack = function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	};
+}
+
+// Source: keycode.js
+/*!
+ * jQuery UI Keycode 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Keycode
+//>>group: Core
+//>>description: Provide keycodes as keynames
+//>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/
+
+$.ui.keyCode = {
+	BACKSPACE: 8,
+	COMMA: 188,
+	DELETE: 46,
+	DOWN: 40,
+	END: 35,
+	ENTER: 13,
+	ESCAPE: 27,
+	HOME: 36,
+	LEFT: 37,
+	PAGE_DOWN: 34,
+	PAGE_UP: 33,
+	PERIOD: 190,
+	RIGHT: 39,
+	SPACE: 32,
+	TAB: 9,
+	UP: 38
+};
+
+// Source: labels.js
+/*!
+ * jQuery UI Labels 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: labels
+//>>group: Core
+//>>description: Find all the labels associated with a given input
+//>>docs: http://api.jqueryui.com/labels/
+
+$.fn.labels = function() {
+	var ancestor, selector, id, labels, ancestors;
+
+	// Check control.labels first
+	if ( this[ 0 ].labels && this[ 0 ].labels.length ) {
+		return this.pushStack( this[ 0 ].labels );
+	}
+
+	// Support: IE <= 11, FF <= 37, Android <= 2.3 only
+	// Above browsers do not support control.labels. Everything below is to support them
+	// as well as document fragments. control.labels does not work on document fragments
+	labels = this.eq( 0 ).parents( "label" );
+
+	// Look for the label based on the id
+	id = this.attr( "id" );
+	if ( id ) {
+
+		// We don't search against the document in case the element
+		// is disconnected from the DOM
+		ancestor = this.eq( 0 ).parents().last();
+
+		// Get a full set of top level ancestors
+		ancestors = ancestor.add( ancestor.length ? ancestor.siblings() : this.siblings() );
+
+		// Create a selector for the label based on the id
+		selector = "label[for='" + $.ui.escapeSelector( id ) + "']";
+
+		labels = labels.add( ancestors.find( selector ).addBack( selector ) );
+
+	}
+
+	// Return whatever we have found for labels
+	return this.pushStack( labels );
+};
+
+// Source: plugin.js
+// $.ui.plugin is deprecated. Use $.widget() extensions instead.
+$.ui.plugin = {
+	add: function( module, option, set ) {
+		var i,
+			proto = $.ui[ module ].prototype;
+		for ( i in set ) {
+			proto.plugins[ i ] = proto.plugins[ i ] || [];
+			proto.plugins[ i ].push( [ option, set[ i ] ] );
+		}
+	},
+	call: function( instance, name, args, allowDisconnected ) {
+		var i,
+			set = instance.plugins[ name ];
+
+		if ( !set ) {
+			return;
+		}
+
+		if ( !allowDisconnected && ( !instance.element[ 0 ].parentNode ||
+				instance.element[ 0 ].parentNode.nodeType === 11 ) ) {
+			return;
+		}
+
+		for ( i = 0; i < set.length; i++ ) {
+			if ( instance.options[ set[ i ][ 0 ] ] ) {
+				set[ i ][ 1 ].apply( instance.element, args );
+			}
+		}
+	}
+};
+
+// Source: position.js
+/*!
+ * jQuery UI Position 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/position/
+ */
+
+//>>label: Position
+//>>group: Core
+//>>description: Positions elements relative to other elements.
+//>>docs: http://api.jqueryui.com/position/
+//>>demos: http://jqueryui.com/position/
+
+( function() {
+var cachedScrollbarWidth,
+	max = Math.max,
+	abs = Math.abs,
+	rhorizontal = /left|center|right/,
+	rvertical = /top|center|bottom/,
+	roffset = /[\+\-]\d+(\.[\d]+)?%?/,
+	rposition = /^\w+/,
+	rpercent = /%$/,
+	_position = $.fn.position;
+
+function getOffsets( offsets, width, height ) {
+	return [
+		parseFloat( offsets[ 0 ] ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ),
+		parseFloat( offsets[ 1 ] ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 )
+	];
+}
+
+function parseCss( element, property ) {
+	return parseInt( $.css( element, property ), 10 ) || 0;
+}
+
+function getDimensions( elem ) {
+	var raw = elem[ 0 ];
+	if ( raw.nodeType === 9 ) {
+		return {
+			width: elem.width(),
+			height: elem.height(),
+			offset: { top: 0, left: 0 }
+		};
+	}
+	if ( $.isWindow( raw ) ) {
+		return {
+			width: elem.width(),
+			height: elem.height(),
+			offset: { top: elem.scrollTop(), left: elem.scrollLeft() }
+		};
+	}
+	if ( raw.preventDefault ) {
+		return {
+			width: 0,
+			height: 0,
+			offset: { top: raw.pageY, left: raw.pageX }
+		};
+	}
+	return {
+		width: elem.outerWidth(),
+		height: elem.outerHeight(),
+		offset: elem.offset()
+	};
+}
+
+$.position = {
+	scrollbarWidth: function() {
+		if ( cachedScrollbarWidth !== undefined ) {
+			return cachedScrollbarWidth;
+		}
+		var w1, w2,
+			div = $( "<div " +
+				"style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" +
+				"<div style='height:100px;width:auto;'></div></div>" ),
+			innerDiv = div.children()[ 0 ];
+
+		$( "body" ).append( div );
+		w1 = innerDiv.offsetWidth;
+		div.css( "overflow", "scroll" );
+
+		w2 = innerDiv.offsetWidth;
+
+		if ( w1 === w2 ) {
+			w2 = div[ 0 ].clientWidth;
+		}
+
+		div.remove();
+
+		return ( cachedScrollbarWidth = w1 - w2 );
+	},
+	getScrollInfo: function( within ) {
+		var overflowX = within.isWindow || within.isDocument ? "" :
+				within.element.css( "overflow-x" ),
+			overflowY = within.isWindow || within.isDocument ? "" :
+				within.element.css( "overflow-y" ),
+			hasOverflowX = overflowX === "scroll" ||
+				( overflowX === "auto" && within.width < within.element[ 0 ].scrollWidth ),
+			hasOverflowY = overflowY === "scroll" ||
+				( overflowY === "auto" && within.height < within.element[ 0 ].scrollHeight );
+		return {
+			width: hasOverflowY ? $.position.scrollbarWidth() : 0,
+			height: hasOverflowX ? $.position.scrollbarWidth() : 0
+		};
+	},
+	getWithinInfo: function( element ) {
+		var withinElement = $( element || window ),
+			isWindow = $.isWindow( withinElement[ 0 ] ),
+			isDocument = !!withinElement[ 0 ] && withinElement[ 0 ].nodeType === 9,
+			hasOffset = !isWindow && !isDocument;
+		return {
+			element: withinElement,
+			isWindow: isWindow,
+			isDocument: isDocument,
+			offset: hasOffset ? $( element ).offset() : { left: 0, top: 0 },
+			scrollLeft: withinElement.scrollLeft(),
+			scrollTop: withinElement.scrollTop(),
+			width: withinElement.outerWidth(),
+			height: withinElement.outerHeight()
+		};
+	}
+};
+
+$.fn.position = function( options ) {
+	if ( !options || !options.of ) {
+		return _position.apply( this, arguments );
+	}
+
+	// Make a copy, we don't want to modify arguments
+	options = $.extend( {}, options );
+
+	var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions,
+		target = $( options.of ),
+		within = $.position.getWithinInfo( options.within ),
+		scrollInfo = $.position.getScrollInfo( within ),
+		collision = ( options.collision || "flip" ).split( " " ),
+		offsets = {};
+
+	dimensions = getDimensions( target );
+	if ( target[ 0 ].preventDefault ) {
+
+		// Force left top to allow flipping
+		options.at = "left top";
+	}
+	targetWidth = dimensions.width;
+	targetHeight = dimensions.height;
+	targetOffset = dimensions.offset;
+
+	// Clone to reuse original targetOffset later
+	basePosition = $.extend( {}, targetOffset );
+
+	// Force my and at to have valid horizontal and vertical positions
+	// if a value is missing or invalid, it will be converted to center
+	$.each( [ "my", "at" ], function() {
+		var pos = ( options[ this ] || "" ).split( " " ),
+			horizontalOffset,
+			verticalOffset;
+
+		if ( pos.length === 1 ) {
+			pos = rhorizontal.test( pos[ 0 ] ) ?
+				pos.concat( [ "center" ] ) :
+				rvertical.test( pos[ 0 ] ) ?
+					[ "center" ].concat( pos ) :
+					[ "center", "center" ];
+		}
+		pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center";
+		pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center";
+
+		// Calculate offsets
+		horizontalOffset = roffset.exec( pos[ 0 ] );
+		verticalOffset = roffset.exec( pos[ 1 ] );
+		offsets[ this ] = [
+			horizontalOffset ? horizontalOffset[ 0 ] : 0,
+			verticalOffset ? verticalOffset[ 0 ] : 0
+		];
+
+		// Reduce to just the positions without the offsets
+		options[ this ] = [
+			rposition.exec( pos[ 0 ] )[ 0 ],
+			rposition.exec( pos[ 1 ] )[ 0 ]
+		];
+	} );
+
+	// Normalize collision option
+	if ( collision.length === 1 ) {
+		collision[ 1 ] = collision[ 0 ];
+	}
+
+	if ( options.at[ 0 ] === "right" ) {
+		basePosition.left += targetWidth;
+	} else if ( options.at[ 0 ] === "center" ) {
+		basePosition.left += targetWidth / 2;
+	}
+
+	if ( options.at[ 1 ] === "bottom" ) {
+		basePosition.top += targetHeight;
+	} else if ( options.at[ 1 ] === "center" ) {
+		basePosition.top += targetHeight / 2;
+	}
+
+	atOffset = getOffsets( offsets.at, targetWidth, targetHeight );
+	basePosition.left += atOffset[ 0 ];
+	basePosition.top += atOffset[ 1 ];
+
+	return this.each( function() {
+		var collisionPosition, using,
+			elem = $( this ),
+			elemWidth = elem.outerWidth(),
+			elemHeight = elem.outerHeight(),
+			marginLeft = parseCss( this, "marginLeft" ),
+			marginTop = parseCss( this, "marginTop" ),
+			collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) +
+				scrollInfo.width,
+			collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) +
+				scrollInfo.height,
+			position = $.extend( {}, basePosition ),
+			myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() );
+
+		if ( options.my[ 0 ] === "right" ) {
+			position.left -= elemWidth;
+		} else if ( options.my[ 0 ] === "center" ) {
+			position.left -= elemWidth / 2;
+		}
+
+		if ( options.my[ 1 ] === "bottom" ) {
+			position.top -= elemHeight;
+		} else if ( options.my[ 1 ] === "center" ) {
+			position.top -= elemHeight / 2;
+		}
+
+		position.left += myOffset[ 0 ];
+		position.top += myOffset[ 1 ];
+
+		collisionPosition = {
+			marginLeft: marginLeft,
+			marginTop: marginTop
+		};
+
+		$.each( [ "left", "top" ], function( i, dir ) {
+			if ( $.ui.position[ collision[ i ] ] ) {
+				$.ui.position[ collision[ i ] ][ dir ]( position, {
+					targetWidth: targetWidth,
+					targetHeight: targetHeight,
+					elemWidth: elemWidth,
+					elemHeight: elemHeight,
+					collisionPosition: collisionPosition,
+					collisionWidth: collisionWidth,
+					collisionHeight: collisionHeight,
+					offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ],
+					my: options.my,
+					at: options.at,
+					within: within,
+					elem: elem
+				} );
+			}
+		} );
+
+		if ( options.using ) {
+
+			// Adds feedback as second argument to using callback, if present
+			using = function( props ) {
+				var left = targetOffset.left - position.left,
+					right = left + targetWidth - elemWidth,
+					top = targetOffset.top - position.top,
+					bottom = top + targetHeight - elemHeight,
+					feedback = {
+						target: {
+							element: target,
+							left: targetOffset.left,
+							top: targetOffset.top,
+							width: targetWidth,
+							height: targetHeight
+						},
+						element: {
+							element: elem,
+							left: position.left,
+							top: position.top,
+							width: elemWidth,
+							height: elemHeight
+						},
+						horizontal: right < 0 ? "left" : left > 0 ? "right" : "center",
+						vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle"
+					};
+				if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) {
+					feedback.horizontal = "center";
+				}
+				if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) {
+					feedback.vertical = "middle";
+				}
+				if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) {
+					feedback.important = "horizontal";
+				} else {
+					feedback.important = "vertical";
+				}
+				options.using.call( this, props, feedback );
+			};
+		}
+
+		elem.offset( $.extend( position, { using: using } ) );
+	} );
+};
+
+$.ui.position = {
+	fit: {
+		left: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
+				outerWidth = within.width,
+				collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+				overLeft = withinOffset - collisionPosLeft,
+				overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
+				newOverRight;
+
+			// Element is wider than within
+			if ( data.collisionWidth > outerWidth ) {
+
+				// Element is initially over the left side of within
+				if ( overLeft > 0 && overRight <= 0 ) {
+					newOverRight = position.left + overLeft + data.collisionWidth - outerWidth -
+						withinOffset;
+					position.left += overLeft - newOverRight;
+
+				// Element is initially over right side of within
+				} else if ( overRight > 0 && overLeft <= 0 ) {
+					position.left = withinOffset;
+
+				// Element is initially over both left and right sides of within
+				} else {
+					if ( overLeft > overRight ) {
+						position.left = withinOffset + outerWidth - data.collisionWidth;
+					} else {
+						position.left = withinOffset;
+					}
+				}
+
+			// Too far left -> align with left edge
+			} else if ( overLeft > 0 ) {
+				position.left += overLeft;
+
+			// Too far right -> align with right edge
+			} else if ( overRight > 0 ) {
+				position.left -= overRight;
+
+			// Adjust based on position and margin
+			} else {
+				position.left = max( position.left - collisionPosLeft, position.left );
+			}
+		},
+		top: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
+				outerHeight = data.within.height,
+				collisionPosTop = position.top - data.collisionPosition.marginTop,
+				overTop = withinOffset - collisionPosTop,
+				overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
+				newOverBottom;
+
+			// Element is taller than within
+			if ( data.collisionHeight > outerHeight ) {
+
+				// Element is initially over the top of within
+				if ( overTop > 0 && overBottom <= 0 ) {
+					newOverBottom = position.top + overTop + data.collisionHeight - outerHeight -
+						withinOffset;
+					position.top += overTop - newOverBottom;
+
+				// Element is initially over bottom of within
+				} else if ( overBottom > 0 && overTop <= 0 ) {
+					position.top = withinOffset;
+
+				// Element is initially over both top and bottom of within
+				} else {
+					if ( overTop > overBottom ) {
+						position.top = withinOffset + outerHeight - data.collisionHeight;
+					} else {
+						position.top = withinOffset;
+					}
+				}
+
+			// Too far up -> align with top
+			} else if ( overTop > 0 ) {
+				position.top += overTop;
+
+			// Too far down -> align with bottom edge
+			} else if ( overBottom > 0 ) {
+				position.top -= overBottom;
+
+			// Adjust based on position and margin
+			} else {
+				position.top = max( position.top - collisionPosTop, position.top );
+			}
+		}
+	},
+	flip: {
+		left: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.offset.left + within.scrollLeft,
+				outerWidth = within.width,
+				offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
+				collisionPosLeft = position.left - data.collisionPosition.marginLeft,
+				overLeft = collisionPosLeft - offsetLeft,
+				overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
+				myOffset = data.my[ 0 ] === "left" ?
+					-data.elemWidth :
+					data.my[ 0 ] === "right" ?
+						data.elemWidth :
+						0,
+				atOffset = data.at[ 0 ] === "left" ?
+					data.targetWidth :
+					data.at[ 0 ] === "right" ?
+						-data.targetWidth :
+						0,
+				offset = -2 * data.offset[ 0 ],
+				newOverRight,
+				newOverLeft;
+
+			if ( overLeft < 0 ) {
+				newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth -
+					outerWidth - withinOffset;
+				if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) {
+					position.left += myOffset + atOffset + offset;
+				}
+			} else if ( overRight > 0 ) {
+				newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset +
+					atOffset + offset - offsetLeft;
+				if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) {
+					position.left += myOffset + atOffset + offset;
+				}
+			}
+		},
+		top: function( position, data ) {
+			var within = data.within,
+				withinOffset = within.offset.top + within.scrollTop,
+				outerHeight = within.height,
+				offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
+				collisionPosTop = position.top - data.collisionPosition.marginTop,
+				overTop = collisionPosTop - offsetTop,
+				overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
+				top = data.my[ 1 ] === "top",
+				myOffset = top ?
+					-data.elemHeight :
+					data.my[ 1 ] === "bottom" ?
+						data.elemHeight :
+						0,
+				atOffset = data.at[ 1 ] === "top" ?
+					data.targetHeight :
+					data.at[ 1 ] === "bottom" ?
+						-data.targetHeight :
+						0,
+				offset = -2 * data.offset[ 1 ],
+				newOverTop,
+				newOverBottom;
+			if ( overTop < 0 ) {
+				newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight -
+					outerHeight - withinOffset;
+				if ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) {
+					position.top += myOffset + atOffset + offset;
+				}
+			} else if ( overBottom > 0 ) {
+				newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset +
+					offset - offsetTop;
+				if ( newOverTop > 0 || abs( newOverTop ) < overBottom ) {
+					position.top += myOffset + atOffset + offset;
+				}
+			}
+		}
+	},
+	flipfit: {
+		left: function() {
+			$.ui.position.flip.left.apply( this, arguments );
+			$.ui.position.fit.left.apply( this, arguments );
+		},
+		top: function() {
+			$.ui.position.flip.top.apply( this, arguments );
+			$.ui.position.fit.top.apply( this, arguments );
+		}
+	}
+};
+
+} )();
+
+// Source: safe-active-element.js
+$.ui.safeActiveElement = function( document ) {
+	var activeElement;
+
+	// Support: IE 9 only
+	// IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
+	try {
+		activeElement = document.activeElement;
+	} catch ( error ) {
+		activeElement = document.body;
+	}
+
+	// Support: IE 9 - 11 only
+	// IE may return null instead of an element
+	// Interestingly, this only seems to occur when NOT in an iframe
+	if ( !activeElement ) {
+		activeElement = document.body;
+	}
+
+	// Support: IE 11 only
+	// IE11 returns a seemingly empty object in some cases when accessing
+	// document.activeElement from an <iframe>
+	if ( !activeElement.nodeName ) {
+		activeElement = document.body;
+	}
+
+	return activeElement;
+};
+
+// Source: safe-blur.js
+$.ui.safeBlur = function( element ) {
+
+	// Support: IE9 - 10 only
+	// If the <body> is blurred, IE will switch windows, see #9420
+	if ( element && element.nodeName.toLowerCase() !== "body" ) {
+		$( element ).trigger( "blur" );
+	}
+};
+
+// Source: scroll-parent.js
+/*!
+ * jQuery UI Scroll Parent 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: scrollParent
+//>>group: Core
+//>>description: Get the closest ancestor element that is scrollable.
+//>>docs: http://api.jqueryui.com/scrollParent/
+
+$.fn.scrollParent = function( includeHidden ) {
+	var position = this.css( "position" ),
+		excludeStaticParent = position === "absolute",
+		overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
+		scrollParent = this.parents().filter( function() {
+			var parent = $( this );
+			if ( excludeStaticParent && parent.css( "position" ) === "static" ) {
+				return false;
+			}
+			return overflowRegex.test( parent.css( "overflow" ) + parent.css( "overflow-y" ) +
+				parent.css( "overflow-x" ) );
+		} ).eq( 0 );
+
+	return position === "fixed" || !scrollParent.length ?
+		$( this[ 0 ].ownerDocument || document ) :
+		scrollParent;
+};
+
+// Source: tabbable.js
+/*!
+ * jQuery UI Tabbable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: :tabbable Selector
+//>>group: Core
+//>>description: Selects elements which can be tabbed to.
+//>>docs: http://api.jqueryui.com/tabbable-selector/
+
+$.extend( $.expr[ ":" ], {
+	tabbable: function( element ) {
+		var tabIndex = $.attr( element, "tabindex" ),
+			hasTabindex = tabIndex != null;
+		return ( !hasTabindex || tabIndex >= 0 ) && $.ui.focusable( element, hasTabindex );
+	}
+} );
+
+// Source: unique-id.js
+/*!
+ * jQuery UI Unique ID 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: uniqueId
+//>>group: Core
+//>>description: Functions to generate and remove uniqueId's
+//>>docs: http://api.jqueryui.com/uniqueId/
+
+$.fn.extend( {
+	uniqueId: ( function() {
+		var uuid = 0;
+
+		return function() {
+			return this.each( function() {
+				if ( !this.id ) {
+					this.id = "ui-id-" + ( ++uuid );
+				}
+			} );
+		};
+	} )(),
+
+	removeUniqueId: function() {
+		return this.each( function() {
+			if ( /^ui-id-\d+$/.test( this.id ) ) {
+				$( this ).removeAttr( "id" );
+			}
+		} );
+	}
+} );
+
+// Source: widget.js
+/*!
+ * jQuery UI Widget 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Widget
+//>>group: Core
+//>>description: Provides a factory for creating stateful widgets with a common API.
+//>>docs: http://api.jqueryui.com/jQuery.widget/
+//>>demos: http://jqueryui.com/widget/
+
+var widgetUuid = 0;
+var widgetSlice = Array.prototype.slice;
+
+$.cleanData = ( function( orig ) {
+	return function( elems ) {
+		var events, elem, i;
+		for ( i = 0; ( elem = elems[ i ] ) != null; i++ ) {
+			try {
+
+				// Only trigger remove when necessary to save time
+				events = $._data( elem, "events" );
+				if ( events && events.remove ) {
+					$( elem ).triggerHandler( "remove" );
+				}
+
+			// Http://bugs.jquery.com/ticket/8235
+			} catch ( e ) {}
+		}
+		orig( elems );
+	};
+} )( $.cleanData );
+
+$.widget = function( name, base, prototype ) {
+	var existingConstructor, constructor, basePrototype;
+
+	// ProxiedPrototype allows the provided prototype to remain unmodified
+	// so that it can be used as a mixin for multiple widgets (#8876)
+	var proxiedPrototype = {};
+
+	var namespace = name.split( "." )[ 0 ];
+	name = name.split( "." )[ 1 ];
+	var fullName = namespace + "-" + name;
+
+	if ( !prototype ) {
+		prototype = base;
+		base = $.Widget;
+	}
+
+	if ( $.isArray( prototype ) ) {
+		prototype = $.extend.apply( null, [ {} ].concat( prototype ) );
+	}
+
+	// Create selector for plugin
+	$.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) {
+		return !!$.data( elem, fullName );
+	};
+
+	$[ namespace ] = $[ namespace ] || {};
+	existingConstructor = $[ namespace ][ name ];
+	constructor = $[ namespace ][ name ] = function( options, element ) {
+
+		// Allow instantiation without "new" keyword
+		if ( !this._createWidget ) {
+			return new constructor( options, element );
+		}
+
+		// Allow instantiation without initializing for simple inheritance
+		// must use "new" keyword (the code above always passes args)
+		if ( arguments.length ) {
+			this._createWidget( options, element );
+		}
+	};
+
+	// Extend with the existing constructor to carry over any static properties
+	$.extend( constructor, existingConstructor, {
+		version: prototype.version,
+
+		// Copy the object used to create the prototype in case we need to
+		// redefine the widget later
+		_proto: $.extend( {}, prototype ),
+
+		// Track widgets that inherit from this widget in case this widget is
+		// redefined after a widget inherits from it
+		_childConstructors: []
+	} );
+
+	basePrototype = new base();
+
+	// We need to make the options hash a property directly on the new instance
+	// otherwise we'll modify the options hash on the prototype that we're
+	// inheriting from
+	basePrototype.options = $.widget.extend( {}, basePrototype.options );
+	$.each( prototype, function( prop, value ) {
+		if ( !$.isFunction( value ) ) {
+			proxiedPrototype[ prop ] = value;
+			return;
+		}
+		proxiedPrototype[ prop ] = ( function() {
+			function _super() {
+				return base.prototype[ prop ].apply( this, arguments );
+			}
+
+			function _superApply( args ) {
+				return base.prototype[ prop ].apply( this, args );
+			}
+
+			return function() {
+				var __super = this._super;
+				var __superApply = this._superApply;
+				var returnValue;
+
+				this._super = _super;
+				this._superApply = _superApply;
+
+				returnValue = value.apply( this, arguments );
+
+				this._super = __super;
+				this._superApply = __superApply;
+
+				return returnValue;
+			};
+		} )();
+	} );
+	constructor.prototype = $.widget.extend( basePrototype, {
+
+		// TODO: remove support for widgetEventPrefix
+		// always use the name + a colon as the prefix, e.g., draggable:start
+		// don't prefix for widgets that aren't DOM-based
+		widgetEventPrefix: existingConstructor ? ( basePrototype.widgetEventPrefix || name ) : name
+	}, proxiedPrototype, {
+		constructor: constructor,
+		namespace: namespace,
+		widgetName: name,
+		widgetFullName: fullName
+	} );
+
+	// If this widget is being redefined then we need to find all widgets that
+	// are inheriting from it and redefine all of them so that they inherit from
+	// the new version of this widget. We're essentially trying to replace one
+	// level in the prototype chain.
+	if ( existingConstructor ) {
+		$.each( existingConstructor._childConstructors, function( i, child ) {
+			var childPrototype = child.prototype;
+
+			// Redefine the child widget using the same prototype that was
+			// originally used, but inherit from the new version of the base
+			$.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor,
+				child._proto );
+		} );
+
+		// Remove the list of existing child constructors from the old constructor
+		// so the old child constructors can be garbage collected
+		delete existingConstructor._childConstructors;
+	} else {
+		base._childConstructors.push( constructor );
+	}
+
+	$.widget.bridge( name, constructor );
+
+	return constructor;
+};
+
+$.widget.extend = function( target ) {
+	var input = widgetSlice.call( arguments, 1 );
+	var inputIndex = 0;
+	var inputLength = input.length;
+	var key;
+	var value;
+
+	for ( ; inputIndex < inputLength; inputIndex++ ) {
+		for ( key in input[ inputIndex ] ) {
+			value = input[ inputIndex ][ key ];
+			if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) {
+
+				// Clone objects
+				if ( $.isPlainObject( value ) ) {
+					target[ key ] = $.isPlainObject( target[ key ] ) ?
+						$.widget.extend( {}, target[ key ], value ) :
+
+						// Don't extend strings, arrays, etc. with objects
+						$.widget.extend( {}, value );
+
+				// Copy everything else by reference
+				} else {
+					target[ key ] = value;
+				}
+			}
+		}
+	}
+	return target;
+};
+
+$.widget.bridge = function( name, object ) {
+	var fullName = object.prototype.widgetFullName || name;
+	$.fn[ name ] = function( options ) {
+		var isMethodCall = typeof options === "string";
+		var args = widgetSlice.call( arguments, 1 );
+		var returnValue = this;
+
+		if ( isMethodCall ) {
+
+			// If this is an empty collection, we need to have the instance method
+			// return undefined instead of the jQuery instance
+			if ( !this.length && options === "instance" ) {
+				returnValue = undefined;
+			} else {
+				this.each( function() {
+					var methodValue;
+					var instance = $.data( this, fullName );
+
+					if ( options === "instance" ) {
+						returnValue = instance;
+						return false;
+					}
+
+					if ( !instance ) {
+						return $.error( "cannot call methods on " + name +
+							" prior to initialization; " +
+							"attempted to call method '" + options + "'" );
+					}
+
+					if ( !$.isFunction( instance[ options ] ) || options.charAt( 0 ) === "_" ) {
+						return $.error( "no such method '" + options + "' for " + name +
+							" widget instance" );
+					}
+
+					methodValue = instance[ options ].apply( instance, args );
+
+					if ( methodValue !== instance && methodValue !== undefined ) {
+						returnValue = methodValue && methodValue.jquery ?
+							returnValue.pushStack( methodValue.get() ) :
+							methodValue;
+						return false;
+					}
+				} );
+			}
+		} else {
+
+			// Allow multiple hashes to be passed on init
+			if ( args.length ) {
+				options = $.widget.extend.apply( null, [ options ].concat( args ) );
+			}
+
+			this.each( function() {
+				var instance = $.data( this, fullName );
+				if ( instance ) {
+					instance.option( options || {} );
+					if ( instance._init ) {
+						instance._init();
+					}
+				} else {
+					$.data( this, fullName, new object( options, this ) );
+				}
+			} );
+		}
+
+		return returnValue;
+	};
+};
+
+$.Widget = function( /* options, element */ ) {};
+$.Widget._childConstructors = [];
+
+$.Widget.prototype = {
+	widgetName: "widget",
+	widgetEventPrefix: "",
+	defaultElement: "<div>",
+
+	options: {
+		classes: {},
+		disabled: false,
+
+		// Callbacks
+		create: null
+	},
+
+	_createWidget: function( options, element ) {
+		element = $( element || this.defaultElement || this )[ 0 ];
+		this.element = $( element );
+		this.uuid = widgetUuid++;
+		this.eventNamespace = "." + this.widgetName + this.uuid;
+
+		this.bindings = $();
+		this.hoverable = $();
+		this.focusable = $();
+		this.classesElementLookup = {};
+
+		if ( element !== this ) {
+			$.data( element, this.widgetFullName, this );
+			this._on( true, this.element, {
+				remove: function( event ) {
+					if ( event.target === element ) {
+						this.destroy();
+					}
+				}
+			} );
+			this.document = $( element.style ?
+
+				// Element within the document
+				element.ownerDocument :
+
+				// Element is window or document
+				element.document || element );
+			this.window = $( this.document[ 0 ].defaultView || this.document[ 0 ].parentWindow );
+		}
+
+		this.options = $.widget.extend( {},
+			this.options,
+			this._getCreateOptions(),
+			options );
+
+		this._create();
+
+		if ( this.options.disabled ) {
+			this._setOptionDisabled( this.options.disabled );
+		}
+
+		this._trigger( "create", null, this._getCreateEventData() );
+		this._init();
+	},
+
+	_getCreateOptions: function() {
+		return {};
+	},
+
+	_getCreateEventData: $.noop,
+
+	_create: $.noop,
+
+	_init: $.noop,
+
+	destroy: function() {
+		var that = this;
+
+		this._destroy();
+		$.each( this.classesElementLookup, function( key, value ) {
+			that._removeClass( value, key );
+		} );
+
+		// We can probably remove the unbind calls in 2.0
+		// all event bindings should go through this._on()
+		this.element
+			.off( this.eventNamespace )
+			.removeData( this.widgetFullName );
+		this.widget()
+			.off( this.eventNamespace )
+			.removeAttr( "aria-disabled" );
+
+		// Clean up events and states
+		this.bindings.off( this.eventNamespace );
+	},
+
+	_destroy: $.noop,
+
+	widget: function() {
+		return this.element;
+	},
+
+	option: function( key, value ) {
+		var options = key;
+		var parts;
+		var curOption;
+		var i;
+
+		if ( arguments.length === 0 ) {
+
+			// Don't return a reference to the internal hash
+			return $.widget.extend( {}, this.options );
+		}
+
+		if ( typeof key === "string" ) {
+
+			// Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
+			options = {};
+			parts = key.split( "." );
+			key = parts.shift();
+			if ( parts.length ) {
+				curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] );
+				for ( i = 0; i < parts.length - 1; i++ ) {
+					curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {};
+					curOption = curOption[ parts[ i ] ];
+				}
+				key = parts.pop();
+				if ( arguments.length === 1 ) {
+					return curOption[ key ] === undefined ? null : curOption[ key ];
+				}
+				curOption[ key ] = value;
+			} else {
+				if ( arguments.length === 1 ) {
+					return this.options[ key ] === undefined ? null : this.options[ key ];
+				}
+				options[ key ] = value;
+			}
+		}
+
+		this._setOptions( options );
+
+		return this;
+	},
+
+	_setOptions: function( options ) {
+		var key;
+
+		for ( key in options ) {
+			this._setOption( key, options[ key ] );
+		}
+
+		return this;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "classes" ) {
+			this._setOptionClasses( value );
+		}
+
+		this.options[ key ] = value;
+
+		if ( key === "disabled" ) {
+			this._setOptionDisabled( value );
+		}
+
+		return this;
+	},
+
+	_setOptionClasses: function( value ) {
+		var classKey, elements, currentElements;
+
+		for ( classKey in value ) {
+			currentElements = this.classesElementLookup[ classKey ];
+			if ( value[ classKey ] === this.options.classes[ classKey ] ||
+					!currentElements ||
+					!currentElements.length ) {
+				continue;
+			}
+
+			// We are doing this to create a new jQuery object because the _removeClass() call
+			// on the next line is going to destroy the reference to the current elements being
+			// tracked. We need to save a copy of this collection so that we can add the new classes
+			// below.
+			elements = $( currentElements.get() );
+			this._removeClass( currentElements, classKey );
+
+			// We don't use _addClass() here, because that uses this.options.classes
+			// for generating the string of classes. We want to use the value passed in from
+			// _setOption(), this is the new value of the classes option which was passed to
+			// _setOption(). We pass this value directly to _classes().
+			elements.addClass( this._classes( {
+				element: elements,
+				keys: classKey,
+				classes: value,
+				add: true
+			} ) );
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null, !!value );
+
+		// If the widget is becoming disabled, then nothing is interactive
+		if ( value ) {
+			this._removeClass( this.hoverable, null, "ui-state-hover" );
+			this._removeClass( this.focusable, null, "ui-state-focus" );
+		}
+	},
+
+	enable: function() {
+		return this._setOptions( { disabled: false } );
+	},
+
+	disable: function() {
+		return this._setOptions( { disabled: true } );
+	},
+
+	_classes: function( options ) {
+		var full = [];
+		var that = this;
+
+		options = $.extend( {
+			element: this.element,
+			classes: this.options.classes || {}
+		}, options );
+
+		function processClassString( classes, checkOption ) {
+			var current, i;
+			for ( i = 0; i < classes.length; i++ ) {
+				current = that.classesElementLookup[ classes[ i ] ] || $();
+				if ( options.add ) {
+					current = $( $.unique( current.get().concat( options.element.get() ) ) );
+				} else {
+					current = $( current.not( options.element ).get() );
+				}
+				that.classesElementLookup[ classes[ i ] ] = current;
+				full.push( classes[ i ] );
+				if ( checkOption && options.classes[ classes[ i ] ] ) {
+					full.push( options.classes[ classes[ i ] ] );
+				}
+			}
+		}
+
+		this._on( options.element, {
+			"remove": "_untrackClassesElement"
+		} );
+
+		if ( options.keys ) {
+			processClassString( options.keys.match( /\S+/g ) || [], true );
+		}
+		if ( options.extra ) {
+			processClassString( options.extra.match( /\S+/g ) || [] );
+		}
+
+		return full.join( " " );
+	},
+
+	_untrackClassesElement: function( event ) {
+		var that = this;
+		$.each( that.classesElementLookup, function( key, value ) {
+			if ( $.inArray( event.target, value ) !== -1 ) {
+				that.classesElementLookup[ key ] = $( value.not( event.target ).get() );
+			}
+		} );
+	},
+
+	_removeClass: function( element, keys, extra ) {
+		return this._toggleClass( element, keys, extra, false );
+	},
+
+	_addClass: function( element, keys, extra ) {
+		return this._toggleClass( element, keys, extra, true );
+	},
+
+	_toggleClass: function( element, keys, extra, add ) {
+		add = ( typeof add === "boolean" ) ? add : extra;
+		var shift = ( typeof element === "string" || element === null ),
+			options = {
+				extra: shift ? keys : extra,
+				keys: shift ? element : keys,
+				element: shift ? this.element : element,
+				add: add
+			};
+		options.element.toggleClass( this._classes( options ), add );
+		return this;
+	},
+
+	_on: function( suppressDisabledCheck, element, handlers ) {
+		var delegateElement;
+		var instance = this;
+
+		// No suppressDisabledCheck flag, shuffle arguments
+		if ( typeof suppressDisabledCheck !== "boolean" ) {
+			handlers = element;
+			element = suppressDisabledCheck;
+			suppressDisabledCheck = false;
+		}
+
+		// No element argument, shuffle and use this.element
+		if ( !handlers ) {
+			handlers = element;
+			element = this.element;
+			delegateElement = this.widget();
+		} else {
+			element = delegateElement = $( element );
+			this.bindings = this.bindings.add( element );
+		}
+
+		$.each( handlers, function( event, handler ) {
+			function handlerProxy() {
+
+				// Allow widgets to customize the disabled handling
+				// - disabled as an array instead of boolean
+				// - disabled class as method for disabling individual parts
+				if ( !suppressDisabledCheck &&
+						( instance.options.disabled === true ||
+						$( this ).hasClass( "ui-state-disabled" ) ) ) {
+					return;
+				}
+				return ( typeof handler === "string" ? instance[ handler ] : handler )
+					.apply( instance, arguments );
+			}
+
+			// Copy the guid so direct unbinding works
+			if ( typeof handler !== "string" ) {
+				handlerProxy.guid = handler.guid =
+					handler.guid || handlerProxy.guid || $.guid++;
+			}
+
+			var match = event.match( /^([\w:-]*)\s*(.*)$/ );
+			var eventName = match[ 1 ] + instance.eventNamespace;
+			var selector = match[ 2 ];
+
+			if ( selector ) {
+				delegateElement.on( eventName, selector, handlerProxy );
+			} else {
+				element.on( eventName, handlerProxy );
+			}
+		} );
+	},
+
+	_off: function( element, eventName ) {
+		eventName = ( eventName || "" ).split( " " ).join( this.eventNamespace + " " ) +
+			this.eventNamespace;
+		element.off( eventName ).off( eventName );
+
+		// Clear the stack to avoid memory leaks (#10056)
+		this.bindings = $( this.bindings.not( element ).get() );
+		this.focusable = $( this.focusable.not( element ).get() );
+		this.hoverable = $( this.hoverable.not( element ).get() );
+	},
+
+	_delay: function( handler, delay ) {
+		function handlerProxy() {
+			return ( typeof handler === "string" ? instance[ handler ] : handler )
+				.apply( instance, arguments );
+		}
+		var instance = this;
+		return setTimeout( handlerProxy, delay || 0 );
+	},
+
+	_hoverable: function( element ) {
+		this.hoverable = this.hoverable.add( element );
+		this._on( element, {
+			mouseenter: function( event ) {
+				this._addClass( $( event.currentTarget ), null, "ui-state-hover" );
+			},
+			mouseleave: function( event ) {
+				this._removeClass( $( event.currentTarget ), null, "ui-state-hover" );
+			}
+		} );
+	},
+
+	_focusable: function( element ) {
+		this.focusable = this.focusable.add( element );
+		this._on( element, {
+			focusin: function( event ) {
+				this._addClass( $( event.currentTarget ), null, "ui-state-focus" );
+			},
+			focusout: function( event ) {
+				this._removeClass( $( event.currentTarget ), null, "ui-state-focus" );
+			}
+		} );
+	},
+
+	_trigger: function( type, event, data ) {
+		var prop, orig;
+		var callback = this.options[ type ];
+
+		data = data || {};
+		event = $.Event( event );
+		event.type = ( type === this.widgetEventPrefix ?
+			type :
+			this.widgetEventPrefix + type ).toLowerCase();
+
+		// The original event may come from any element
+		// so we need to reset the target on the new event
+		event.target = this.element[ 0 ];
+
+		// Copy original event properties over to the new event
+		orig = event.originalEvent;
+		if ( orig ) {
+			for ( prop in orig ) {
+				if ( !( prop in event ) ) {
+					event[ prop ] = orig[ prop ];
+				}
+			}
+		}
+
+		this.element.trigger( event, data );
+		return !( $.isFunction( callback ) &&
+			callback.apply( this.element[ 0 ], [ event ].concat( data ) ) === false ||
+			event.isDefaultPrevented() );
+	}
+};
+
+$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) {
+	$.Widget.prototype[ "_" + method ] = function( element, options, callback ) {
+		if ( typeof options === "string" ) {
+			options = { effect: options };
+		}
+
+		var hasOptions;
+		var effectName = !options ?
+			method :
+			options === true || typeof options === "number" ?
+				defaultEffect :
+				options.effect || defaultEffect;
+
+		options = options || {};
+		if ( typeof options === "number" ) {
+			options = { duration: options };
+		}
+
+		hasOptions = !$.isEmptyObject( options );
+		options.complete = callback;
+
+		if ( options.delay ) {
+			element.delay( options.delay );
+		}
+
+		if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) {
+			element[ method ]( options );
+		} else if ( effectName !== method && element[ effectName ] ) {
+			element[ effectName ]( options.duration, options.easing, callback );
+		} else {
+			element.queue( function( next ) {
+				$( this )[ method ]();
+				if ( callback ) {
+					callback.call( element[ 0 ] );
+				}
+				next();
+			} );
+		}
+	};
+} );
+
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/core.min.js b/wp-includes/js/jquery/ui/core.min.js
index cbf09d66be..3dc0c40a5b 100644
--- a/wp-includes/js/jquery/ui/core.min.js
+++ b/wp-includes/js/jquery/ui/core.min.js
@@ -1,11 +1,116 @@
+/*! jQuery UI - v1.12.1 - 2020-09-25
+* http://jqueryui.com
+* Includes: data.js, disable-selection.js, escape-selector.js, focusable.js, form-reset-mixin.js, form.js, ie.js, jquery-1-7.js, keycode.js, labels.js, plugin.js, position.js, safe-active-element.js, safe-blur.js, scroll-parent.js, tabbable.js, unique-id.js, version.js, widget.js
+* Copyright jQuery Foundation and other contributors; Licensed  */
+!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):t(jQuery)}(function(x){var t,e,o,W,C,n,s,r,l,a,i,h;function E(t,e,i){return[parseFloat(t[0])*(a.test(t[0])?e/100:1),parseFloat(t[1])*(a.test(t[1])?i/100:1)]}function H(t,e){return parseInt(x.css(t,e),10)||0}x.ui=x.ui||{},x.ui.version="1.12.1",
 /*!
- * jQuery UI Core 1.11.4
+ * jQuery UI :data 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.extend(x.expr[":"],{data:x.expr.createPseudo?x.expr.createPseudo(function(e){return function(t){return!!x.data(t,e)}}):function(t,e,i){return!!x.data(t,i[3])}}),
+/*!
+ * jQuery UI Disable Selection 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.fn.extend({disableSelection:(t="onselectstart"in document.createElement("div")?"selectstart":"mousedown",function(){return this.on(t+".ui-disableSelection",function(t){t.preventDefault()})}),enableSelection:function(){return this.off(".ui-disableSelection")}}),x.ui.escapeSelector=(e=/([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g,function(t){return t.replace(e,"\\$1")}),
+/*!
+ * jQuery UI Focusable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.ui.focusable=function(t,e){var i,n,o,s,r,l=t.nodeName.toLowerCase();return"area"===l?(n=(i=t.parentNode).name,!(!t.href||!n||"map"!==i.nodeName.toLowerCase())&&(0<(o=x("img[usemap='#"+n+"']")).length&&o.is(":visible"))):(/^(input|select|textarea|button|object)$/.test(l)?(s=!t.disabled)&&(r=x(t).closest("fieldset")[0])&&(s=!r.disabled):s="a"===l&&t.href||e,s&&x(t).is(":visible")&&function(t){var e=t.css("visibility");for(;"inherit"===e;)t=t.parent(),e=t.css("visibility");return"hidden"!==e}(x(t)))},x.extend(x.expr[":"],{focusable:function(t){return x.ui.focusable(t,null!=x.attr(t,"tabindex"))}}),x.fn.form=function(){return"string"==typeof this[0].form?this.closest("form"):x(this[0].form)},
+/*!
+ * jQuery UI Form Reset Mixin 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.ui.formResetMixin={_formResetHandler:function(){var e=x(this);setTimeout(function(){var t=e.data("ui-form-reset-instances");x.each(t,function(){this.refresh()})})},_bindFormResetHandler:function(){if(this.form=this.element.form(),this.form.length){var t=this.form.data("ui-form-reset-instances")||[];t.length||this.form.on("reset.ui-form-reset",this._formResetHandler),t.push(this),this.form.data("ui-form-reset-instances",t)}},_unbindFormResetHandler:function(){if(this.form.length){var t=this.form.data("ui-form-reset-instances");t.splice(x.inArray(this,t),1),t.length?this.form.data("ui-form-reset-instances",t):this.form.removeData("ui-form-reset-instances").off("reset.ui-form-reset")}}},x.ui.ie=!!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase()),
+/*!
+ * jQuery UI Support for jQuery core 1.7.x 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
  *
- * http://api.jqueryui.com/category/ui-core/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery"],e):e(jQuery)}(function(a){var e,t,n,i;function r(e,t){var n,i,r,o=e.nodeName.toLowerCase();return"area"===o?(i=(n=e.parentNode).name,!(!e.href||!i||"map"!==n.nodeName.toLowerCase())&&(!!(r=a("img[usemap='#"+i+"']")[0])&&s(r))):(/^(input|select|textarea|button|object)$/.test(o)?!e.disabled:"a"===o&&e.href||t)&&s(e)}function s(e){return a.expr.filters.visible(e)&&!a(e).parents().addBack().filter(function(){return"hidden"===a.css(this,"visibility")}).length}a.ui=a.ui||{},a.extend(a.ui,{version:"1.11.4",keyCode:{BACKSPACE:8,COMMA:188,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,LEFT:37,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SPACE:32,TAB:9,UP:38}}),a.fn.extend({scrollParent:function(e){var t=this.css("position"),n="absolute"===t,i=e?/(auto|scroll|hidden)/:/(auto|scroll)/,r=this.parents().filter(function(){var e=a(this);return(!n||"static"!==e.css("position"))&&i.test(e.css("overflow")+e.css("overflow-y")+e.css("overflow-x"))}).eq(0);return"fixed"!==t&&r.length?r:a(this[0].ownerDocument||document)},uniqueId:(e=0,function(){return this.each(function(){this.id||(this.id="ui-id-"+ ++e)})}),removeUniqueId:function(){return this.each(function(){/^ui-id-\d+$/.test(this.id)&&a(this).removeAttr("id")})}}),a.extend(a.expr[":"],{data:a.expr.createPseudo?a.expr.createPseudo(function(t){return function(e){return!!a.data(e,t)}}):function(e,t,n){return!!a.data(e,n[3])},focusable:function(e){return r(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(e){var t=a.attr(e,"tabindex"),n=isNaN(t);return(n||0<=t)&&r(e,!n)}}),a("<a>").outerWidth(1).jquery||a.each(["Width","Height"],function(e,n){var r="Width"===n?["Left","Right"]:["Top","Bottom"],i=n.toLowerCase(),o={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function s(e,t,n,i){return a.each(r,function(){t-=parseFloat(a.css(e,"padding"+this))||0,n&&(t-=parseFloat(a.css(e,"border"+this+"Width"))||0),i&&(t-=parseFloat(a.css(e,"margin"+this))||0)}),t}a.fn["inner"+n]=function(e){return void 0===e?o["inner"+n].call(this):this.each(function(){a(this).css(i,s(this,e)+"px")})},a.fn["outer"+n]=function(e,t){return"number"!=typeof e?o["outer"+n].call(this,e):this.each(function(){a(this).css(i,s(this,e,!0,t)+"px")})}}),a.fn.addBack||(a.fn.addBack=function(e){return this.add(null==e?this.prevObject:this.prevObject.filter(e))}),a("<a>").data("a-b","a").removeData("a-b").data("a-b")&&(a.fn.removeData=(t=a.fn.removeData,function(e){return arguments.length?t.call(this,a.camelCase(e)):t.call(this)})),a.ui.ie=!!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase()),a.fn.extend({focus:(i=a.fn.focus,function(t,n){return"number"==typeof t?this.each(function(){var e=this;setTimeout(function(){a(e).focus(),n&&n.call(e)},t)}):i.apply(this,arguments)}),disableSelection:(n="onselectstart"in document.createElement("div")?"selectstart":"mousedown",function(){return this.bind(n+".ui-disableSelection",function(e){e.preventDefault()})}),enableSelection:function(){return this.unbind(".ui-disableSelection")},zIndex:function(e){if(void 0!==e)return this.css("zIndex",e);if(this.length)for(var t,n,i=a(this[0]);i.length&&i[0]!==document;){if(("absolute"===(t=i.css("position"))||"relative"===t||"fixed"===t)&&(n=parseInt(i.css("zIndex"),10),!isNaN(n)&&0!==n))return n;i=i.parent()}return 0}}),a.ui.plugin={add:function(e,t,n){var i,r=a.ui[e].prototype;for(i in n)r.plugins[i]=r.plugins[i]||[],r.plugins[i].push([t,n[i]])},call:function(e,t,n,i){var r,o=e.plugins[t];if(o&&(i||e.element[0].parentNode&&11!==e.element[0].parentNode.nodeType))for(r=0;r<o.length;r++)e.options[o[r][0]]&&o[r][1].apply(e.element,n)}}});
\ No newline at end of file
+"1.7"===x.fn.jquery.substring(0,3)&&(x.each(["Width","Height"],function(t,i){var o="Width"===i?["Left","Right"]:["Top","Bottom"],n=i.toLowerCase(),s={innerWidth:x.fn.innerWidth,innerHeight:x.fn.innerHeight,outerWidth:x.fn.outerWidth,outerHeight:x.fn.outerHeight};function r(t,e,i,n){return x.each(o,function(){e-=parseFloat(x.css(t,"padding"+this))||0,i&&(e-=parseFloat(x.css(t,"border"+this+"Width"))||0),n&&(e-=parseFloat(x.css(t,"margin"+this))||0)}),e}x.fn["inner"+i]=function(t){return void 0===t?s["inner"+i].call(this):this.each(function(){x(this).css(n,r(this,t)+"px")})},x.fn["outer"+i]=function(t,e){return"number"!=typeof t?s["outer"+i].call(this,t):this.each(function(){x(this).css(n,r(this,t,!0,e)+"px")})}}),x.fn.addBack=function(t){return this.add(null==t?this.prevObject:this.prevObject.filter(t))}),
+/*!
+ * jQuery UI Keycode 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.ui.keyCode={BACKSPACE:8,COMMA:188,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,LEFT:37,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SPACE:32,TAB:9,UP:38},
+/*!
+ * jQuery UI Labels 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.fn.labels=function(){var t,e,i,n,o;return this[0].labels&&this[0].labels.length?this.pushStack(this[0].labels):(n=this.eq(0).parents("label"),(i=this.attr("id"))&&(o=(t=this.eq(0).parents().last()).add(t.length?t.siblings():this.siblings()),e="label[for='"+x.ui.escapeSelector(i)+"']",n=n.add(o.find(e).addBack(e))),this.pushStack(n))},x.ui.plugin={add:function(t,e,i){var n,o=x.ui[t].prototype;for(n in i)o.plugins[n]=o.plugins[n]||[],o.plugins[n].push([e,i[n]])},call:function(t,e,i,n){var o,s=t.plugins[e];if(s&&(n||t.element[0].parentNode&&11!==t.element[0].parentNode.nodeType))for(o=0;o<s.length;o++)t.options[s[o][0]]&&s[o][1].apply(t.element,i)}},
+/*!
+ * jQuery UI Position 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * http://api.jqueryui.com/position/
+ */
+W=Math.max,C=Math.abs,n=/left|center|right/,s=/top|center|bottom/,r=/[\+\-]\d+(\.[\d]+)?%?/,l=/^\w+/,a=/%$/,i=x.fn.position,x.position={scrollbarWidth:function(){if(void 0!==o)return o;var t,e,i=x("<div style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"),n=i.children()[0];return x("body").append(i),t=n.offsetWidth,i.css("overflow","scroll"),t===(e=n.offsetWidth)&&(e=i[0].clientWidth),i.remove(),o=t-e},getScrollInfo:function(t){var e=t.isWindow||t.isDocument?"":t.element.css("overflow-x"),i=t.isWindow||t.isDocument?"":t.element.css("overflow-y"),n="scroll"===e||"auto"===e&&t.width<t.element[0].scrollWidth;return{width:"scroll"===i||"auto"===i&&t.height<t.element[0].scrollHeight?x.position.scrollbarWidth():0,height:n?x.position.scrollbarWidth():0}},getWithinInfo:function(t){var e=x(t||window),i=x.isWindow(e[0]),n=!!e[0]&&9===e[0].nodeType;return{element:e,isWindow:i,isDocument:n,offset:i||n?{left:0,top:0}:x(t).offset(),scrollLeft:e.scrollLeft(),scrollTop:e.scrollTop(),width:e.outerWidth(),height:e.outerHeight()}}},x.fn.position=function(f){if(!f||!f.of)return i.apply(this,arguments);f=x.extend({},f);var u,d,p,g,m,t,v=x(f.of),b=x.position.getWithinInfo(f.within),w=x.position.getScrollInfo(b),y=(f.collision||"flip").split(" "),_={};return t=function(t){var e=t[0];return 9===e.nodeType?{width:t.width(),height:t.height(),offset:{top:0,left:0}}:x.isWindow(e)?{width:t.width(),height:t.height(),offset:{top:t.scrollTop(),left:t.scrollLeft()}}:e.preventDefault?{width:0,height:0,offset:{top:e.pageY,left:e.pageX}}:{width:t.outerWidth(),height:t.outerHeight(),offset:t.offset()}}(v),v[0].preventDefault&&(f.at="left top"),d=t.width,p=t.height,g=t.offset,m=x.extend({},g),x.each(["my","at"],function(){var t,e,i=(f[this]||"").split(" ");1===i.length&&(i=n.test(i[0])?i.concat(["center"]):s.test(i[0])?["center"].concat(i):["center","center"]),i[0]=n.test(i[0])?i[0]:"center",i[1]=s.test(i[1])?i[1]:"center",t=r.exec(i[0]),e=r.exec(i[1]),_[this]=[t?t[0]:0,e?e[0]:0],f[this]=[l.exec(i[0])[0],l.exec(i[1])[0]]}),1===y.length&&(y[1]=y[0]),"right"===f.at[0]?m.left+=d:"center"===f.at[0]&&(m.left+=d/2),"bottom"===f.at[1]?m.top+=p:"center"===f.at[1]&&(m.top+=p/2),u=E(_.at,d,p),m.left+=u[0],m.top+=u[1],this.each(function(){var i,t,r=x(this),l=r.outerWidth(),a=r.outerHeight(),e=H(this,"marginLeft"),n=H(this,"marginTop"),o=l+e+H(this,"marginRight")+w.width,s=a+n+H(this,"marginBottom")+w.height,h=x.extend({},m),c=E(_.my,r.outerWidth(),r.outerHeight());"right"===f.my[0]?h.left-=l:"center"===f.my[0]&&(h.left-=l/2),"bottom"===f.my[1]?h.top-=a:"center"===f.my[1]&&(h.top-=a/2),h.left+=c[0],h.top+=c[1],i={marginLeft:e,marginTop:n},x.each(["left","top"],function(t,e){x.ui.position[y[t]]&&x.ui.position[y[t]][e](h,{targetWidth:d,targetHeight:p,elemWidth:l,elemHeight:a,collisionPosition:i,collisionWidth:o,collisionHeight:s,offset:[u[0]+c[0],u[1]+c[1]],my:f.my,at:f.at,within:b,elem:r})}),f.using&&(t=function(t){var e=g.left-h.left,i=e+d-l,n=g.top-h.top,o=n+p-a,s={target:{element:v,left:g.left,top:g.top,width:d,height:p},element:{element:r,left:h.left,top:h.top,width:l,height:a},horizontal:i<0?"left":0<e?"right":"center",vertical:o<0?"top":0<n?"bottom":"middle"};d<l&&C(e+i)<d&&(s.horizontal="center"),p<a&&C(n+o)<p&&(s.vertical="middle"),W(C(e),C(i))>W(C(n),C(o))?s.important="horizontal":s.important="vertical",f.using.call(this,t,s)}),r.offset(x.extend(h,{using:t}))})},x.ui.position={fit:{left:function(t,e){var i,n=e.within,o=n.isWindow?n.scrollLeft:n.offset.left,s=n.width,r=t.left-e.collisionPosition.marginLeft,l=o-r,a=r+e.collisionWidth-s-o;e.collisionWidth>s?0<l&&a<=0?(i=t.left+l+e.collisionWidth-s-o,t.left+=l-i):t.left=0<a&&l<=0?o:a<l?o+s-e.collisionWidth:o:0<l?t.left+=l:0<a?t.left-=a:t.left=W(t.left-r,t.left)},top:function(t,e){var i,n=e.within,o=n.isWindow?n.scrollTop:n.offset.top,s=e.within.height,r=t.top-e.collisionPosition.marginTop,l=o-r,a=r+e.collisionHeight-s-o;e.collisionHeight>s?0<l&&a<=0?(i=t.top+l+e.collisionHeight-s-o,t.top+=l-i):t.top=0<a&&l<=0?o:a<l?o+s-e.collisionHeight:o:0<l?t.top+=l:0<a?t.top-=a:t.top=W(t.top-r,t.top)}},flip:{left:function(t,e){var i,n,o=e.within,s=o.offset.left+o.scrollLeft,r=o.width,l=o.isWindow?o.scrollLeft:o.offset.left,a=t.left-e.collisionPosition.marginLeft,h=a-l,c=a+e.collisionWidth-r-l,f="left"===e.my[0]?-e.elemWidth:"right"===e.my[0]?e.elemWidth:0,u="left"===e.at[0]?e.targetWidth:"right"===e.at[0]?-e.targetWidth:0,d=-2*e.offset[0];h<0?((i=t.left+f+u+d+e.collisionWidth-r-s)<0||i<C(h))&&(t.left+=f+u+d):0<c&&(0<(n=t.left-e.collisionPosition.marginLeft+f+u+d-l)||C(n)<c)&&(t.left+=f+u+d)},top:function(t,e){var i,n,o=e.within,s=o.offset.top+o.scrollTop,r=o.height,l=o.isWindow?o.scrollTop:o.offset.top,a=t.top-e.collisionPosition.marginTop,h=a-l,c=a+e.collisionHeight-r-l,f="top"===e.my[1]?-e.elemHeight:"bottom"===e.my[1]?e.elemHeight:0,u="top"===e.at[1]?e.targetHeight:"bottom"===e.at[1]?-e.targetHeight:0,d=-2*e.offset[1];h<0?((n=t.top+f+u+d+e.collisionHeight-r-s)<0||n<C(h))&&(t.top+=f+u+d):0<c&&(0<(i=t.top-e.collisionPosition.marginTop+f+u+d-l)||C(i)<c)&&(t.top+=f+u+d)}},flipfit:{left:function(){x.ui.position.flip.left.apply(this,arguments),x.ui.position.fit.left.apply(this,arguments)},top:function(){x.ui.position.flip.top.apply(this,arguments),x.ui.position.fit.top.apply(this,arguments)}}},x.ui.safeActiveElement=function(e){var i;try{i=e.activeElement}catch(t){i=e.body}return(i=i||e.body).nodeName||(i=e.body),i},x.ui.safeBlur=function(t){t&&"body"!==t.nodeName.toLowerCase()&&x(t).trigger("blur")},
+/*!
+ * jQuery UI Scroll Parent 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.fn.scrollParent=function(t){var e=this.css("position"),i="absolute"===e,n=t?/(auto|scroll|hidden)/:/(auto|scroll)/,o=this.parents().filter(function(){var t=x(this);return(!i||"static"!==t.css("position"))&&n.test(t.css("overflow")+t.css("overflow-y")+t.css("overflow-x"))}).eq(0);return"fixed"!==e&&o.length?o:x(this[0].ownerDocument||document)},
+/*!
+ * jQuery UI Tabbable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.extend(x.expr[":"],{tabbable:function(t){var e=x.attr(t,"tabindex"),i=null!=e;return(!i||0<=e)&&x.ui.focusable(t,i)}}),
+/*!
+ * jQuery UI Unique ID 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+x.fn.extend({uniqueId:(h=0,function(){return this.each(function(){this.id||(this.id="ui-id-"+ ++h)})}),removeUniqueId:function(){return this.each(function(){/^ui-id-\d+$/.test(this.id)&&x(this).removeAttr("id")})}});
+/*!
+ * jQuery UI Widget 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+var c,f=0,u=Array.prototype.slice;x.cleanData=(c=x.cleanData,function(t){var e,i,n;for(n=0;null!=(i=t[n]);n++)try{(e=x._data(i,"events"))&&e.remove&&x(i).triggerHandler("remove")}catch(t){}c(t)}),x.widget=function(t,i,e){var n,o,s,r={},l=t.split(".")[0],a=l+"-"+(t=t.split(".")[1]);return e||(e=i,i=x.Widget),x.isArray(e)&&(e=x.extend.apply(null,[{}].concat(e))),x.expr[":"][a.toLowerCase()]=function(t){return!!x.data(t,a)},x[l]=x[l]||{},n=x[l][t],o=x[l][t]=function(t,e){if(!this._createWidget)return new o(t,e);arguments.length&&this._createWidget(t,e)},x.extend(o,n,{version:e.version,_proto:x.extend({},e),_childConstructors:[]}),(s=new i).options=x.widget.extend({},s.options),x.each(e,function(e,n){function o(){return i.prototype[e].apply(this,arguments)}function s(t){return i.prototype[e].apply(this,t)}x.isFunction(n)?r[e]=function(){var t,e=this._super,i=this._superApply;return this._super=o,this._superApply=s,t=n.apply(this,arguments),this._super=e,this._superApply=i,t}:r[e]=n}),o.prototype=x.widget.extend(s,{widgetEventPrefix:n&&s.widgetEventPrefix||t},r,{constructor:o,namespace:l,widgetName:t,widgetFullName:a}),n?(x.each(n._childConstructors,function(t,e){var i=e.prototype;x.widget(i.namespace+"."+i.widgetName,o,e._proto)}),delete n._childConstructors):i._childConstructors.push(o),x.widget.bridge(t,o),o},x.widget.extend=function(t){for(var e,i,n=u.call(arguments,1),o=0,s=n.length;o<s;o++)for(e in n[o])i=n[o][e],n[o].hasOwnProperty(e)&&void 0!==i&&(x.isPlainObject(i)?t[e]=x.isPlainObject(t[e])?x.widget.extend({},t[e],i):x.widget.extend({},i):t[e]=i);return t},x.widget.bridge=function(s,e){var r=e.prototype.widgetFullName||s;x.fn[s]=function(i){var t="string"==typeof i,n=u.call(arguments,1),o=this;return t?this.length||"instance"!==i?this.each(function(){var t,e=x.data(this,r);return"instance"===i?(o=e,!1):e?x.isFunction(e[i])&&"_"!==i.charAt(0)?(t=e[i].apply(e,n))!==e&&void 0!==t?(o=t&&t.jquery?o.pushStack(t.get()):t,!1):void 0:x.error("no such method '"+i+"' for "+s+" widget instance"):x.error("cannot call methods on "+s+" prior to initialization; attempted to call method '"+i+"'")}):o=void 0:(n.length&&(i=x.widget.extend.apply(null,[i].concat(n))),this.each(function(){var t=x.data(this,r);t?(t.option(i||{}),t._init&&t._init()):x.data(this,r,new e(i,this))})),o}},x.Widget=function(){},x.Widget._childConstructors=[],x.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",defaultElement:"<div>",options:{classes:{},disabled:!1,create:null},_createWidget:function(t,e){e=x(e||this.defaultElement||this)[0],this.element=x(e),this.uuid=f++,this.eventNamespace="."+this.widgetName+this.uuid,this.bindings=x(),this.hoverable=x(),this.focusable=x(),this.classesElementLookup={},e!==this&&(x.data(e,this.widgetFullName,this),this._on(!0,this.element,{remove:function(t){t.target===e&&this.destroy()}}),this.document=x(e.style?e.ownerDocument:e.document||e),this.window=x(this.document[0].defaultView||this.document[0].parentWindow)),this.options=x.widget.extend({},this.options,this._getCreateOptions(),t),this._create(),this.options.disabled&&this._setOptionDisabled(this.options.disabled),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:function(){return{}},_getCreateEventData:x.noop,_create:x.noop,_init:x.noop,destroy:function(){var i=this;this._destroy(),x.each(this.classesElementLookup,function(t,e){i._removeClass(e,t)}),this.element.off(this.eventNamespace).removeData(this.widgetFullName),this.widget().off(this.eventNamespace).removeAttr("aria-disabled"),this.bindings.off(this.eventNamespace)},_destroy:x.noop,widget:function(){return this.element},option:function(t,e){var i,n,o,s=t;if(0===arguments.length)return x.widget.extend({},this.options);if("string"==typeof t)if(s={},t=(i=t.split(".")).shift(),i.length){for(n=s[t]=x.widget.extend({},this.options[t]),o=0;o<i.length-1;o++)n[i[o]]=n[i[o]]||{},n=n[i[o]];if(t=i.pop(),1===arguments.length)return void 0===n[t]?null:n[t];n[t]=e}else{if(1===arguments.length)return void 0===this.options[t]?null:this.options[t];s[t]=e}return this._setOptions(s),this},_setOptions:function(t){var e;for(e in t)this._setOption(e,t[e]);return this},_setOption:function(t,e){return"classes"===t&&this._setOptionClasses(e),this.options[t]=e,"disabled"===t&&this._setOptionDisabled(e),this},_setOptionClasses:function(t){var e,i,n;for(e in t)n=this.classesElementLookup[e],t[e]!==this.options.classes[e]&&n&&n.length&&(i=x(n.get()),this._removeClass(n,e),i.addClass(this._classes({element:i,keys:e,classes:t,add:!0})))},_setOptionDisabled:function(t){this._toggleClass(this.widget(),this.widgetFullName+"-disabled",null,!!t),t&&(this._removeClass(this.hoverable,null,"ui-state-hover"),this._removeClass(this.focusable,null,"ui-state-focus"))},enable:function(){return this._setOptions({disabled:!1})},disable:function(){return this._setOptions({disabled:!0})},_classes:function(o){var s=[],r=this;function t(t,e){var i,n;for(n=0;n<t.length;n++)i=r.classesElementLookup[t[n]]||x(),i=o.add?x(x.unique(i.get().concat(o.element.get()))):x(i.not(o.element).get()),r.classesElementLookup[t[n]]=i,s.push(t[n]),e&&o.classes[t[n]]&&s.push(o.classes[t[n]])}return o=x.extend({element:this.element,classes:this.options.classes||{}},o),this._on(o.element,{remove:"_untrackClassesElement"}),o.keys&&t(o.keys.match(/\S+/g)||[],!0),o.extra&&t(o.extra.match(/\S+/g)||[]),s.join(" ")},_untrackClassesElement:function(i){var n=this;x.each(n.classesElementLookup,function(t,e){-1!==x.inArray(i.target,e)&&(n.classesElementLookup[t]=x(e.not(i.target).get()))})},_removeClass:function(t,e,i){return this._toggleClass(t,e,i,!1)},_addClass:function(t,e,i){return this._toggleClass(t,e,i,!0)},_toggleClass:function(t,e,i,n){n="boolean"==typeof n?n:i;var o="string"==typeof t||null===t,s={extra:o?e:i,keys:o?t:e,element:o?this.element:t,add:n};return s.element.toggleClass(this._classes(s),n),this},_on:function(r,l,t){var a,h=this;"boolean"!=typeof r&&(t=l,l=r,r=!1),t?(l=a=x(l),this.bindings=this.bindings.add(l)):(t=l,l=this.element,a=this.widget()),x.each(t,function(t,e){function i(){if(r||!0!==h.options.disabled&&!x(this).hasClass("ui-state-disabled"))return("string"==typeof e?h[e]:e).apply(h,arguments)}"string"!=typeof e&&(i.guid=e.guid=e.guid||i.guid||x.guid++);var n=t.match(/^([\w:-]*)\s*(.*)$/),o=n[1]+h.eventNamespace,s=n[2];s?a.on(o,s,i):l.on(o,i)})},_off:function(t,e){e=(e||"").split(" ").join(this.eventNamespace+" ")+this.eventNamespace,t.off(e).off(e),this.bindings=x(this.bindings.not(t).get()),this.focusable=x(this.focusable.not(t).get()),this.hoverable=x(this.hoverable.not(t).get())},_delay:function(t,e){var i=this;return setTimeout(function(){return("string"==typeof t?i[t]:t).apply(i,arguments)},e||0)},_hoverable:function(t){this.hoverable=this.hoverable.add(t),this._on(t,{mouseenter:function(t){this._addClass(x(t.currentTarget),null,"ui-state-hover")},mouseleave:function(t){this._removeClass(x(t.currentTarget),null,"ui-state-hover")}})},_focusable:function(t){this.focusable=this.focusable.add(t),this._on(t,{focusin:function(t){this._addClass(x(t.currentTarget),null,"ui-state-focus")},focusout:function(t){this._removeClass(x(t.currentTarget),null,"ui-state-focus")}})},_trigger:function(t,e,i){var n,o,s=this.options[t];if(i=i||{},(e=x.Event(e)).type=(t===this.widgetEventPrefix?t:this.widgetEventPrefix+t).toLowerCase(),e.target=this.element[0],o=e.originalEvent)for(n in o)n in e||(e[n]=o[n]);return this.element.trigger(e,i),!(x.isFunction(s)&&!1===s.apply(this.element[0],[e].concat(i))||e.isDefaultPrevented())}},x.each({show:"fadeIn",hide:"fadeOut"},function(s,r){x.Widget.prototype["_"+s]=function(e,t,i){var n;"string"==typeof t&&(t={effect:t});var o=t?!0===t||"number"==typeof t?r:t.effect||r:s;"number"==typeof(t=t||{})&&(t={duration:t}),n=!x.isEmptyObject(t),t.complete=i,t.delay&&e.delay(t.delay),n&&x.effects&&x.effects.effect[o]?e[s](t):o!==s&&e[o]?e[o](t.duration,t.easing,i):e.queue(function(t){x(this)[s](),i&&i.call(e[0]),t()})}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/datepicker.js b/wp-includes/js/jquery/ui/datepicker.js
new file mode 100644
index 0000000000..7bb751b69b
--- /dev/null
+++ b/wp-includes/js/jquery/ui/datepicker.js
@@ -0,0 +1,2119 @@
+// jscs:disable maximumLineLength
+/* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */
+/*!
+ * jQuery UI Datepicker 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Datepicker
+//>>group: Widgets
+//>>description: Displays a calendar from an input or inline for selecting dates.
+//>>docs: http://api.jqueryui.com/datepicker/
+//>>demos: http://jqueryui.com/datepicker/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/datepicker.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.extend( $.ui, { datepicker: { version: "1.12.1" } } );
+
+var datepicker_instActive;
+
+function datepicker_getZindex( elem ) {
+	var position, value;
+	while ( elem.length && elem[ 0 ] !== document ) {
+
+		// Ignore z-index if position is set to a value where z-index is ignored by the browser
+		// This makes behavior of this function consistent across browsers
+		// WebKit always returns auto if the element is positioned
+		position = elem.css( "position" );
+		if ( position === "absolute" || position === "relative" || position === "fixed" ) {
+
+			// IE returns 0 when zIndex is not specified
+			// other browsers return a string
+			// we ignore the case of nested elements with an explicit value of 0
+			// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+			value = parseInt( elem.css( "zIndex" ), 10 );
+			if ( !isNaN( value ) && value !== 0 ) {
+				return value;
+			}
+		}
+		elem = elem.parent();
+	}
+
+	return 0;
+}
+/* Date picker manager.
+   Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+   Settings for (groups of) date pickers are maintained in an instance object,
+   allowing multiple different settings on the same page. */
+
+function Datepicker() {
+	this._curInst = null; // The current instance in use
+	this._keyEvent = false; // If the last event was a key event
+	this._disabledInputs = []; // List of date picker inputs that have been disabled
+	this._datepickerShowing = false; // True if the popup picker is showing , false if not
+	this._inDialog = false; // True if showing within a "dialog", false if not
+	this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division
+	this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class
+	this._appendClass = "ui-datepicker-append"; // The name of the append marker class
+	this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class
+	this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class
+	this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class
+	this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class
+	this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class
+	this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class
+	this.regional = []; // Available regional settings, indexed by language code
+	this.regional[ "" ] = { // Default regional settings
+		closeText: "Done", // Display text for close link
+		prevText: "Prev", // Display text for previous month link
+		nextText: "Next", // Display text for next month link
+		currentText: "Today", // Display text for current month link
+		monthNames: [ "January","February","March","April","May","June",
+			"July","August","September","October","November","December" ], // Names of months for drop-down and formatting
+		monthNamesShort: [ "Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec" ], // For formatting
+		dayNames: [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ], // For formatting
+		dayNamesShort: [ "Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat" ], // For formatting
+		dayNamesMin: [ "Su","Mo","Tu","We","Th","Fr","Sa" ], // Column headings for days starting at Sunday
+		weekHeader: "Wk", // Column header for week of the year
+		dateFormat: "mm/dd/yy", // See format options on parseDate
+		firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+		isRTL: false, // True if right-to-left language, false if left-to-right
+		showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+		yearSuffix: "" // Additional text to append to the year in the month headers
+	};
+	this._defaults = { // Global defaults for all the date picker instances
+		showOn: "focus", // "focus" for popup on focus,
+			// "button" for trigger button, or "both" for either
+		showAnim: "fadeIn", // Name of jQuery animation for popup
+		showOptions: {}, // Options for enhanced animations
+		defaultDate: null, // Used when field is blank: actual date,
+			// +/-number for offset from today, null for today
+		appendText: "", // Display text following the input box, e.g. showing the format
+		buttonText: "...", // Text for trigger button
+		buttonImage: "", // URL for trigger button image
+		buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+		hideIfNoPrevNext: false, // True to hide next/previous month links
+			// if not applicable, false to just disable them
+		navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+		gotoCurrent: false, // True if today link goes back to current selection instead
+		changeMonth: false, // True if month can be selected directly, false if only prev/next
+		changeYear: false, // True if year can be selected directly, false if only prev/next
+		yearRange: "c-10:c+10", // Range of years to display in drop-down,
+			// either relative to today's year (-nn:+nn), relative to currently displayed year
+			// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
+		showOtherMonths: false, // True to show dates in other months, false to leave blank
+		selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+		showWeek: false, // True to show week of the year, false to not show it
+		calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+			// takes a Date and returns the number of the week for it
+		shortYearCutoff: "+10", // Short year values < this are in the current century,
+			// > this are in the previous century,
+			// string value starting with "+" for current year + value
+		minDate: null, // The earliest selectable date, or null for no limit
+		maxDate: null, // The latest selectable date, or null for no limit
+		duration: "fast", // Duration of display/closure
+		beforeShowDay: null, // Function that takes a date and returns an array with
+			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
+			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
+		beforeShow: null, // Function that takes an input field and
+			// returns a set of custom settings for the date picker
+		onSelect: null, // Define a callback function when a date is selected
+		onChangeMonthYear: null, // Define a callback function when the month or year is changed
+		onClose: null, // Define a callback function when the datepicker is closed
+		numberOfMonths: 1, // Number of months to show at a time
+		showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+		stepMonths: 1, // Number of months to step back/forward
+		stepBigMonths: 12, // Number of months to step back/forward for the big links
+		altField: "", // Selector for an alternate field to store selected dates into
+		altFormat: "", // The date format to use for the alternate field
+		constrainInput: true, // The input is constrained by the current date format
+		showButtonPanel: false, // True to show button panel, false to not show it
+		autoSize: false, // True to size the input for the date format, false to leave as is
+		disabled: false // The initial disabled state
+	};
+	$.extend( this._defaults, this.regional[ "" ] );
+	this.regional.en = $.extend( true, {}, this.regional[ "" ] );
+	this.regional[ "en-US" ] = $.extend( true, {}, this.regional.en );
+	this.dpDiv = datepicker_bindHover( $( "<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) );
+}
+
+$.extend( Datepicker.prototype, {
+	/* Class name added to elements to indicate already configured with a date picker. */
+	markerClassName: "hasDatepicker",
+
+	//Keep track of the maximum number of rows displayed (see #7043)
+	maxRows: 4,
+
+	// TODO rename to "widget" when switching to widget factory
+	_widgetDatepicker: function() {
+		return this.dpDiv;
+	},
+
+	/* Override the default settings for all instances of the date picker.
+	 * @param  settings  object - the new settings to use as defaults (anonymous object)
+	 * @return the manager object
+	 */
+	setDefaults: function( settings ) {
+		datepicker_extendRemove( this._defaults, settings || {} );
+		return this;
+	},
+
+	/* Attach the date picker to a jQuery selection.
+	 * @param  target	element - the target input field or division or span
+	 * @param  settings  object - the new settings to use for this date picker instance (anonymous)
+	 */
+	_attachDatepicker: function( target, settings ) {
+		var nodeName, inline, inst;
+		nodeName = target.nodeName.toLowerCase();
+		inline = ( nodeName === "div" || nodeName === "span" );
+		if ( !target.id ) {
+			this.uuid += 1;
+			target.id = "dp" + this.uuid;
+		}
+		inst = this._newInst( $( target ), inline );
+		inst.settings = $.extend( {}, settings || {} );
+		if ( nodeName === "input" ) {
+			this._connectDatepicker( target, inst );
+		} else if ( inline ) {
+			this._inlineDatepicker( target, inst );
+		}
+	},
+
+	/* Create a new instance object. */
+	_newInst: function( target, inline ) {
+		var id = target[ 0 ].id.replace( /([^A-Za-z0-9_\-])/g, "\\\\$1" ); // escape jQuery meta chars
+		return { id: id, input: target, // associated target
+			selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+			drawMonth: 0, drawYear: 0, // month being drawn
+			inline: inline, // is datepicker inline or not
+			dpDiv: ( !inline ? this.dpDiv : // presentation div
+			datepicker_bindHover( $( "<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>" ) ) ) };
+	},
+
+	/* Attach the date picker to an input field. */
+	_connectDatepicker: function( target, inst ) {
+		var input = $( target );
+		inst.append = $( [] );
+		inst.trigger = $( [] );
+		if ( input.hasClass( this.markerClassName ) ) {
+			return;
+		}
+		this._attachments( input, inst );
+		input.addClass( this.markerClassName ).on( "keydown", this._doKeyDown ).
+			on( "keypress", this._doKeyPress ).on( "keyup", this._doKeyUp );
+		this._autoSize( inst );
+		$.data( target, "datepicker", inst );
+
+		//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
+		if ( inst.settings.disabled ) {
+			this._disableDatepicker( target );
+		}
+	},
+
+	/* Make attachments based on settings. */
+	_attachments: function( input, inst ) {
+		var showOn, buttonText, buttonImage,
+			appendText = this._get( inst, "appendText" ),
+			isRTL = this._get( inst, "isRTL" );
+
+		if ( inst.append ) {
+			inst.append.remove();
+		}
+		if ( appendText ) {
+			inst.append = $( "<span class='" + this._appendClass + "'>" + appendText + "</span>" );
+			input[ isRTL ? "before" : "after" ]( inst.append );
+		}
+
+		input.off( "focus", this._showDatepicker );
+
+		if ( inst.trigger ) {
+			inst.trigger.remove();
+		}
+
+		showOn = this._get( inst, "showOn" );
+		if ( showOn === "focus" || showOn === "both" ) { // pop-up date picker when in the marked field
+			input.on( "focus", this._showDatepicker );
+		}
+		if ( showOn === "button" || showOn === "both" ) { // pop-up date picker when button clicked
+			buttonText = this._get( inst, "buttonText" );
+			buttonImage = this._get( inst, "buttonImage" );
+			inst.trigger = $( this._get( inst, "buttonImageOnly" ) ?
+				$( "<img/>" ).addClass( this._triggerClass ).
+					attr( { src: buttonImage, alt: buttonText, title: buttonText } ) :
+				$( "<button type='button'></button>" ).addClass( this._triggerClass ).
+					html( !buttonImage ? buttonText : $( "<img/>" ).attr(
+					{ src:buttonImage, alt:buttonText, title:buttonText } ) ) );
+			input[ isRTL ? "before" : "after" ]( inst.trigger );
+			inst.trigger.on( "click", function() {
+				if ( $.datepicker._datepickerShowing && $.datepicker._lastInput === input[ 0 ] ) {
+					$.datepicker._hideDatepicker();
+				} else if ( $.datepicker._datepickerShowing && $.datepicker._lastInput !== input[ 0 ] ) {
+					$.datepicker._hideDatepicker();
+					$.datepicker._showDatepicker( input[ 0 ] );
+				} else {
+					$.datepicker._showDatepicker( input[ 0 ] );
+				}
+				return false;
+			} );
+		}
+	},
+
+	/* Apply the maximum length for the date format. */
+	_autoSize: function( inst ) {
+		if ( this._get( inst, "autoSize" ) && !inst.inline ) {
+			var findMax, max, maxI, i,
+				date = new Date( 2009, 12 - 1, 20 ), // Ensure double digits
+				dateFormat = this._get( inst, "dateFormat" );
+
+			if ( dateFormat.match( /[DM]/ ) ) {
+				findMax = function( names ) {
+					max = 0;
+					maxI = 0;
+					for ( i = 0; i < names.length; i++ ) {
+						if ( names[ i ].length > max ) {
+							max = names[ i ].length;
+							maxI = i;
+						}
+					}
+					return maxI;
+				};
+				date.setMonth( findMax( this._get( inst, ( dateFormat.match( /MM/ ) ?
+					"monthNames" : "monthNamesShort" ) ) ) );
+				date.setDate( findMax( this._get( inst, ( dateFormat.match( /DD/ ) ?
+					"dayNames" : "dayNamesShort" ) ) ) + 20 - date.getDay() );
+			}
+			inst.input.attr( "size", this._formatDate( inst, date ).length );
+		}
+	},
+
+	/* Attach an inline date picker to a div. */
+	_inlineDatepicker: function( target, inst ) {
+		var divSpan = $( target );
+		if ( divSpan.hasClass( this.markerClassName ) ) {
+			return;
+		}
+		divSpan.addClass( this.markerClassName ).append( inst.dpDiv );
+		$.data( target, "datepicker", inst );
+		this._setDate( inst, this._getDefaultDate( inst ), true );
+		this._updateDatepicker( inst );
+		this._updateAlternate( inst );
+
+		//If disabled option is true, disable the datepicker before showing it (see ticket #5665)
+		if ( inst.settings.disabled ) {
+			this._disableDatepicker( target );
+		}
+
+		// Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
+		// http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
+		inst.dpDiv.css( "display", "block" );
+	},
+
+	/* Pop-up the date picker in a "dialog" box.
+	 * @param  input element - ignored
+	 * @param  date	string or Date - the initial date to display
+	 * @param  onSelect  function - the function to call when a date is selected
+	 * @param  settings  object - update the dialog date picker instance's settings (anonymous object)
+	 * @param  pos int[2] - coordinates for the dialog's position within the screen or
+	 *					event - with x/y coordinates or
+	 *					leave empty for default (screen centre)
+	 * @return the manager object
+	 */
+	_dialogDatepicker: function( input, date, onSelect, settings, pos ) {
+		var id, browserWidth, browserHeight, scrollX, scrollY,
+			inst = this._dialogInst; // internal instance
+
+		if ( !inst ) {
+			this.uuid += 1;
+			id = "dp" + this.uuid;
+			this._dialogInput = $( "<input type='text' id='" + id +
+				"' style='position: absolute; top: -100px; width: 0px;'/>" );
+			this._dialogInput.on( "keydown", this._doKeyDown );
+			$( "body" ).append( this._dialogInput );
+			inst = this._dialogInst = this._newInst( this._dialogInput, false );
+			inst.settings = {};
+			$.data( this._dialogInput[ 0 ], "datepicker", inst );
+		}
+		datepicker_extendRemove( inst.settings, settings || {} );
+		date = ( date && date.constructor === Date ? this._formatDate( inst, date ) : date );
+		this._dialogInput.val( date );
+
+		this._pos = ( pos ? ( pos.length ? pos : [ pos.pageX, pos.pageY ] ) : null );
+		if ( !this._pos ) {
+			browserWidth = document.documentElement.clientWidth;
+			browserHeight = document.documentElement.clientHeight;
+			scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+			scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+			this._pos = // should use actual width/height below
+				[ ( browserWidth / 2 ) - 100 + scrollX, ( browserHeight / 2 ) - 150 + scrollY ];
+		}
+
+		// Move input on screen for focus, but hidden behind dialog
+		this._dialogInput.css( "left", ( this._pos[ 0 ] + 20 ) + "px" ).css( "top", this._pos[ 1 ] + "px" );
+		inst.settings.onSelect = onSelect;
+		this._inDialog = true;
+		this.dpDiv.addClass( this._dialogClass );
+		this._showDatepicker( this._dialogInput[ 0 ] );
+		if ( $.blockUI ) {
+			$.blockUI( this.dpDiv );
+		}
+		$.data( this._dialogInput[ 0 ], "datepicker", inst );
+		return this;
+	},
+
+	/* Detach a datepicker from its control.
+	 * @param  target	element - the target input field or division or span
+	 */
+	_destroyDatepicker: function( target ) {
+		var nodeName,
+			$target = $( target ),
+			inst = $.data( target, "datepicker" );
+
+		if ( !$target.hasClass( this.markerClassName ) ) {
+			return;
+		}
+
+		nodeName = target.nodeName.toLowerCase();
+		$.removeData( target, "datepicker" );
+		if ( nodeName === "input" ) {
+			inst.append.remove();
+			inst.trigger.remove();
+			$target.removeClass( this.markerClassName ).
+				off( "focus", this._showDatepicker ).
+				off( "keydown", this._doKeyDown ).
+				off( "keypress", this._doKeyPress ).
+				off( "keyup", this._doKeyUp );
+		} else if ( nodeName === "div" || nodeName === "span" ) {
+			$target.removeClass( this.markerClassName ).empty();
+		}
+
+		if ( datepicker_instActive === inst ) {
+			datepicker_instActive = null;
+		}
+	},
+
+	/* Enable the date picker to a jQuery selection.
+	 * @param  target	element - the target input field or division or span
+	 */
+	_enableDatepicker: function( target ) {
+		var nodeName, inline,
+			$target = $( target ),
+			inst = $.data( target, "datepicker" );
+
+		if ( !$target.hasClass( this.markerClassName ) ) {
+			return;
+		}
+
+		nodeName = target.nodeName.toLowerCase();
+		if ( nodeName === "input" ) {
+			target.disabled = false;
+			inst.trigger.filter( "button" ).
+				each( function() { this.disabled = false; } ).end().
+				filter( "img" ).css( { opacity: "1.0", cursor: "" } );
+		} else if ( nodeName === "div" || nodeName === "span" ) {
+			inline = $target.children( "." + this._inlineClass );
+			inline.children().removeClass( "ui-state-disabled" );
+			inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ).
+				prop( "disabled", false );
+		}
+		this._disabledInputs = $.map( this._disabledInputs,
+			function( value ) { return ( value === target ? null : value ); } ); // delete entry
+	},
+
+	/* Disable the date picker to a jQuery selection.
+	 * @param  target	element - the target input field or division or span
+	 */
+	_disableDatepicker: function( target ) {
+		var nodeName, inline,
+			$target = $( target ),
+			inst = $.data( target, "datepicker" );
+
+		if ( !$target.hasClass( this.markerClassName ) ) {
+			return;
+		}
+
+		nodeName = target.nodeName.toLowerCase();
+		if ( nodeName === "input" ) {
+			target.disabled = true;
+			inst.trigger.filter( "button" ).
+				each( function() { this.disabled = true; } ).end().
+				filter( "img" ).css( { opacity: "0.5", cursor: "default" } );
+		} else if ( nodeName === "div" || nodeName === "span" ) {
+			inline = $target.children( "." + this._inlineClass );
+			inline.children().addClass( "ui-state-disabled" );
+			inline.find( "select.ui-datepicker-month, select.ui-datepicker-year" ).
+				prop( "disabled", true );
+		}
+		this._disabledInputs = $.map( this._disabledInputs,
+			function( value ) { return ( value === target ? null : value ); } ); // delete entry
+		this._disabledInputs[ this._disabledInputs.length ] = target;
+	},
+
+	/* Is the first field in a jQuery collection disabled as a datepicker?
+	 * @param  target	element - the target input field or division or span
+	 * @return boolean - true if disabled, false if enabled
+	 */
+	_isDisabledDatepicker: function( target ) {
+		if ( !target ) {
+			return false;
+		}
+		for ( var i = 0; i < this._disabledInputs.length; i++ ) {
+			if ( this._disabledInputs[ i ] === target ) {
+				return true;
+			}
+		}
+		return false;
+	},
+
+	/* Retrieve the instance data for the target control.
+	 * @param  target  element - the target input field or division or span
+	 * @return  object - the associated instance data
+	 * @throws  error if a jQuery problem getting data
+	 */
+	_getInst: function( target ) {
+		try {
+			return $.data( target, "datepicker" );
+		}
+		catch ( err ) {
+			throw "Missing instance data for this datepicker";
+		}
+	},
+
+	/* Update or retrieve the settings for a date picker attached to an input field or division.
+	 * @param  target  element - the target input field or division or span
+	 * @param  name	object - the new settings to update or
+	 *				string - the name of the setting to change or retrieve,
+	 *				when retrieving also "all" for all instance settings or
+	 *				"defaults" for all global defaults
+	 * @param  value   any - the new value for the setting
+	 *				(omit if above is an object or to retrieve a value)
+	 */
+	_optionDatepicker: function( target, name, value ) {
+		var settings, date, minDate, maxDate,
+			inst = this._getInst( target );
+
+		if ( arguments.length === 2 && typeof name === "string" ) {
+			return ( name === "defaults" ? $.extend( {}, $.datepicker._defaults ) :
+				( inst ? ( name === "all" ? $.extend( {}, inst.settings ) :
+				this._get( inst, name ) ) : null ) );
+		}
+
+		settings = name || {};
+		if ( typeof name === "string" ) {
+			settings = {};
+			settings[ name ] = value;
+		}
+
+		if ( inst ) {
+			if ( this._curInst === inst ) {
+				this._hideDatepicker();
+			}
+
+			date = this._getDateDatepicker( target, true );
+			minDate = this._getMinMaxDate( inst, "min" );
+			maxDate = this._getMinMaxDate( inst, "max" );
+			datepicker_extendRemove( inst.settings, settings );
+
+			// reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
+			if ( minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined ) {
+				inst.settings.minDate = this._formatDate( inst, minDate );
+			}
+			if ( maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined ) {
+				inst.settings.maxDate = this._formatDate( inst, maxDate );
+			}
+			if ( "disabled" in settings ) {
+				if ( settings.disabled ) {
+					this._disableDatepicker( target );
+				} else {
+					this._enableDatepicker( target );
+				}
+			}
+			this._attachments( $( target ), inst );
+			this._autoSize( inst );
+			this._setDate( inst, date );
+			this._updateAlternate( inst );
+			this._updateDatepicker( inst );
+		}
+	},
+
+	// Change method deprecated
+	_changeDatepicker: function( target, name, value ) {
+		this._optionDatepicker( target, name, value );
+	},
+
+	/* Redraw the date picker attached to an input field or division.
+	 * @param  target  element - the target input field or division or span
+	 */
+	_refreshDatepicker: function( target ) {
+		var inst = this._getInst( target );
+		if ( inst ) {
+			this._updateDatepicker( inst );
+		}
+	},
+
+	/* Set the dates for a jQuery selection.
+	 * @param  target element - the target input field or division or span
+	 * @param  date	Date - the new date
+	 */
+	_setDateDatepicker: function( target, date ) {
+		var inst = this._getInst( target );
+		if ( inst ) {
+			this._setDate( inst, date );
+			this._updateDatepicker( inst );
+			this._updateAlternate( inst );
+		}
+	},
+
+	/* Get the date(s) for the first entry in a jQuery selection.
+	 * @param  target element - the target input field or division or span
+	 * @param  noDefault boolean - true if no default date is to be used
+	 * @return Date - the current date
+	 */
+	_getDateDatepicker: function( target, noDefault ) {
+		var inst = this._getInst( target );
+		if ( inst && !inst.inline ) {
+			this._setDateFromField( inst, noDefault );
+		}
+		return ( inst ? this._getDate( inst ) : null );
+	},
+
+	/* Handle keystrokes. */
+	_doKeyDown: function( event ) {
+		var onSelect, dateStr, sel,
+			inst = $.datepicker._getInst( event.target ),
+			handled = true,
+			isRTL = inst.dpDiv.is( ".ui-datepicker-rtl" );
+
+		inst._keyEvent = true;
+		if ( $.datepicker._datepickerShowing ) {
+			switch ( event.keyCode ) {
+				case 9: $.datepicker._hideDatepicker();
+						handled = false;
+						break; // hide on tab out
+				case 13: sel = $( "td." + $.datepicker._dayOverClass + ":not(." +
+									$.datepicker._currentClass + ")", inst.dpDiv );
+						if ( sel[ 0 ] ) {
+							$.datepicker._selectDay( event.target, inst.selectedMonth, inst.selectedYear, sel[ 0 ] );
+						}
+
+						onSelect = $.datepicker._get( inst, "onSelect" );
+						if ( onSelect ) {
+							dateStr = $.datepicker._formatDate( inst );
+
+							// Trigger custom callback
+							onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] );
+						} else {
+							$.datepicker._hideDatepicker();
+						}
+
+						return false; // don't submit the form
+				case 27: $.datepicker._hideDatepicker();
+						break; // hide on escape
+				case 33: $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+							-$.datepicker._get( inst, "stepBigMonths" ) :
+							-$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						break; // previous month/year on page up/+ ctrl
+				case 34: $.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+							+$.datepicker._get( inst, "stepBigMonths" ) :
+							+$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						break; // next month/year on page down/+ ctrl
+				case 35: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._clearDate( event.target );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // clear on ctrl or command +end
+				case 36: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._gotoToday( event.target );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // current on ctrl or command +home
+				case 37: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, ( isRTL ? +1 : -1 ), "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+
+						// -1 day on ctrl or command +left
+						if ( event.originalEvent.altKey ) {
+							$.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+								-$.datepicker._get( inst, "stepBigMonths" ) :
+								-$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						}
+
+						// next month/year on alt +left on Mac
+						break;
+				case 38: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, -7, "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // -1 week on ctrl or command +up
+				case 39: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, ( isRTL ? -1 : +1 ), "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+
+						// +1 day on ctrl or command +right
+						if ( event.originalEvent.altKey ) {
+							$.datepicker._adjustDate( event.target, ( event.ctrlKey ?
+								+$.datepicker._get( inst, "stepBigMonths" ) :
+								+$.datepicker._get( inst, "stepMonths" ) ), "M" );
+						}
+
+						// next month/year on alt +right
+						break;
+				case 40: if ( event.ctrlKey || event.metaKey ) {
+							$.datepicker._adjustDate( event.target, +7, "D" );
+						}
+						handled = event.ctrlKey || event.metaKey;
+						break; // +1 week on ctrl or command +down
+				default: handled = false;
+			}
+		} else if ( event.keyCode === 36 && event.ctrlKey ) { // display the date picker on ctrl+home
+			$.datepicker._showDatepicker( this );
+		} else {
+			handled = false;
+		}
+
+		if ( handled ) {
+			event.preventDefault();
+			event.stopPropagation();
+		}
+	},
+
+	/* Filter entered characters - based on date format. */
+	_doKeyPress: function( event ) {
+		var chars, chr,
+			inst = $.datepicker._getInst( event.target );
+
+		if ( $.datepicker._get( inst, "constrainInput" ) ) {
+			chars = $.datepicker._possibleChars( $.datepicker._get( inst, "dateFormat" ) );
+			chr = String.fromCharCode( event.charCode == null ? event.keyCode : event.charCode );
+			return event.ctrlKey || event.metaKey || ( chr < " " || !chars || chars.indexOf( chr ) > -1 );
+		}
+	},
+
+	/* Synchronise manual entry and field/alternate field. */
+	_doKeyUp: function( event ) {
+		var date,
+			inst = $.datepicker._getInst( event.target );
+
+		if ( inst.input.val() !== inst.lastVal ) {
+			try {
+				date = $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ),
+					( inst.input ? inst.input.val() : null ),
+					$.datepicker._getFormatConfig( inst ) );
+
+				if ( date ) { // only if valid
+					$.datepicker._setDateFromField( inst );
+					$.datepicker._updateAlternate( inst );
+					$.datepicker._updateDatepicker( inst );
+				}
+			}
+			catch ( err ) {
+			}
+		}
+		return true;
+	},
+
+	/* Pop-up the date picker for a given input field.
+	 * If false returned from beforeShow event handler do not show.
+	 * @param  input  element - the input field attached to the date picker or
+	 *					event - if triggered by focus
+	 */
+	_showDatepicker: function( input ) {
+		input = input.target || input;
+		if ( input.nodeName.toLowerCase() !== "input" ) { // find from button/image trigger
+			input = $( "input", input.parentNode )[ 0 ];
+		}
+
+		if ( $.datepicker._isDisabledDatepicker( input ) || $.datepicker._lastInput === input ) { // already here
+			return;
+		}
+
+		var inst, beforeShow, beforeShowSettings, isFixed,
+			offset, showAnim, duration;
+
+		inst = $.datepicker._getInst( input );
+		if ( $.datepicker._curInst && $.datepicker._curInst !== inst ) {
+			$.datepicker._curInst.dpDiv.stop( true, true );
+			if ( inst && $.datepicker._datepickerShowing ) {
+				$.datepicker._hideDatepicker( $.datepicker._curInst.input[ 0 ] );
+			}
+		}
+
+		beforeShow = $.datepicker._get( inst, "beforeShow" );
+		beforeShowSettings = beforeShow ? beforeShow.apply( input, [ input, inst ] ) : {};
+		if ( beforeShowSettings === false ) {
+			return;
+		}
+		datepicker_extendRemove( inst.settings, beforeShowSettings );
+
+		inst.lastVal = null;
+		$.datepicker._lastInput = input;
+		$.datepicker._setDateFromField( inst );
+
+		if ( $.datepicker._inDialog ) { // hide cursor
+			input.value = "";
+		}
+		if ( !$.datepicker._pos ) { // position below input
+			$.datepicker._pos = $.datepicker._findPos( input );
+			$.datepicker._pos[ 1 ] += input.offsetHeight; // add the height
+		}
+
+		isFixed = false;
+		$( input ).parents().each( function() {
+			isFixed |= $( this ).css( "position" ) === "fixed";
+			return !isFixed;
+		} );
+
+		offset = { left: $.datepicker._pos[ 0 ], top: $.datepicker._pos[ 1 ] };
+		$.datepicker._pos = null;
+
+		//to avoid flashes on Firefox
+		inst.dpDiv.empty();
+
+		// determine sizing offscreen
+		inst.dpDiv.css( { position: "absolute", display: "block", top: "-1000px" } );
+		$.datepicker._updateDatepicker( inst );
+
+		// fix width for dynamic number of date pickers
+		// and adjust position before showing
+		offset = $.datepicker._checkOffset( inst, offset, isFixed );
+		inst.dpDiv.css( { position: ( $.datepicker._inDialog && $.blockUI ?
+			"static" : ( isFixed ? "fixed" : "absolute" ) ), display: "none",
+			left: offset.left + "px", top: offset.top + "px" } );
+
+		if ( !inst.inline ) {
+			showAnim = $.datepicker._get( inst, "showAnim" );
+			duration = $.datepicker._get( inst, "duration" );
+			inst.dpDiv.css( "z-index", datepicker_getZindex( $( input ) ) + 1 );
+			$.datepicker._datepickerShowing = true;
+
+			if ( $.effects && $.effects.effect[ showAnim ] ) {
+				inst.dpDiv.show( showAnim, $.datepicker._get( inst, "showOptions" ), duration );
+			} else {
+				inst.dpDiv[ showAnim || "show" ]( showAnim ? duration : null );
+			}
+
+			if ( $.datepicker._shouldFocusInput( inst ) ) {
+				inst.input.trigger( "focus" );
+			}
+
+			$.datepicker._curInst = inst;
+		}
+	},
+
+	/* Generate the date picker content. */
+	_updateDatepicker: function( inst ) {
+		this.maxRows = 4; //Reset the max number of rows being displayed (see #7043)
+		datepicker_instActive = inst; // for delegate hover events
+		inst.dpDiv.empty().append( this._generateHTML( inst ) );
+		this._attachHandlers( inst );
+
+		var origyearshtml,
+			numMonths = this._getNumberOfMonths( inst ),
+			cols = numMonths[ 1 ],
+			width = 17,
+			activeCell = inst.dpDiv.find( "." + this._dayOverClass + " a" );
+
+		if ( activeCell.length > 0 ) {
+			datepicker_handleMouseover.apply( activeCell.get( 0 ) );
+		}
+
+		inst.dpDiv.removeClass( "ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4" ).width( "" );
+		if ( cols > 1 ) {
+			inst.dpDiv.addClass( "ui-datepicker-multi-" + cols ).css( "width", ( width * cols ) + "em" );
+		}
+		inst.dpDiv[ ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ? "add" : "remove" ) +
+			"Class" ]( "ui-datepicker-multi" );
+		inst.dpDiv[ ( this._get( inst, "isRTL" ) ? "add" : "remove" ) +
+			"Class" ]( "ui-datepicker-rtl" );
+
+		if ( inst === $.datepicker._curInst && $.datepicker._datepickerShowing && $.datepicker._shouldFocusInput( inst ) ) {
+			inst.input.trigger( "focus" );
+		}
+
+		// Deffered render of the years select (to avoid flashes on Firefox)
+		if ( inst.yearshtml ) {
+			origyearshtml = inst.yearshtml;
+			setTimeout( function() {
+
+				//assure that inst.yearshtml didn't change.
+				if ( origyearshtml === inst.yearshtml && inst.yearshtml ) {
+					inst.dpDiv.find( "select.ui-datepicker-year:first" ).replaceWith( inst.yearshtml );
+				}
+				origyearshtml = inst.yearshtml = null;
+			}, 0 );
+		}
+	},
+
+	// #6694 - don't focus the input if it's already focused
+	// this breaks the change event in IE
+	// Support: IE and jQuery <1.9
+	_shouldFocusInput: function( inst ) {
+		return inst.input && inst.input.is( ":visible" ) && !inst.input.is( ":disabled" ) && !inst.input.is( ":focus" );
+	},
+
+	/* Check positioning to remain on screen. */
+	_checkOffset: function( inst, offset, isFixed ) {
+		var dpWidth = inst.dpDiv.outerWidth(),
+			dpHeight = inst.dpDiv.outerHeight(),
+			inputWidth = inst.input ? inst.input.outerWidth() : 0,
+			inputHeight = inst.input ? inst.input.outerHeight() : 0,
+			viewWidth = document.documentElement.clientWidth + ( isFixed ? 0 : $( document ).scrollLeft() ),
+			viewHeight = document.documentElement.clientHeight + ( isFixed ? 0 : $( document ).scrollTop() );
+
+		offset.left -= ( this._get( inst, "isRTL" ) ? ( dpWidth - inputWidth ) : 0 );
+		offset.left -= ( isFixed && offset.left === inst.input.offset().left ) ? $( document ).scrollLeft() : 0;
+		offset.top -= ( isFixed && offset.top === ( inst.input.offset().top + inputHeight ) ) ? $( document ).scrollTop() : 0;
+
+		// Now check if datepicker is showing outside window viewport - move to a better place if so.
+		offset.left -= Math.min( offset.left, ( offset.left + dpWidth > viewWidth && viewWidth > dpWidth ) ?
+			Math.abs( offset.left + dpWidth - viewWidth ) : 0 );
+		offset.top -= Math.min( offset.top, ( offset.top + dpHeight > viewHeight && viewHeight > dpHeight ) ?
+			Math.abs( dpHeight + inputHeight ) : 0 );
+
+		return offset;
+	},
+
+	/* Find an object's position on the screen. */
+	_findPos: function( obj ) {
+		var position,
+			inst = this._getInst( obj ),
+			isRTL = this._get( inst, "isRTL" );
+
+		while ( obj && ( obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden( obj ) ) ) {
+			obj = obj[ isRTL ? "previousSibling" : "nextSibling" ];
+		}
+
+		position = $( obj ).offset();
+		return [ position.left, position.top ];
+	},
+
+	/* Hide the date picker from view.
+	 * @param  input  element - the input field attached to the date picker
+	 */
+	_hideDatepicker: function( input ) {
+		var showAnim, duration, postProcess, onClose,
+			inst = this._curInst;
+
+		if ( !inst || ( input && inst !== $.data( input, "datepicker" ) ) ) {
+			return;
+		}
+
+		if ( this._datepickerShowing ) {
+			showAnim = this._get( inst, "showAnim" );
+			duration = this._get( inst, "duration" );
+			postProcess = function() {
+				$.datepicker._tidyDialog( inst );
+			};
+
+			// DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
+			if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) {
+				inst.dpDiv.hide( showAnim, $.datepicker._get( inst, "showOptions" ), duration, postProcess );
+			} else {
+				inst.dpDiv[ ( showAnim === "slideDown" ? "slideUp" :
+					( showAnim === "fadeIn" ? "fadeOut" : "hide" ) ) ]( ( showAnim ? duration : null ), postProcess );
+			}
+
+			if ( !showAnim ) {
+				postProcess();
+			}
+			this._datepickerShowing = false;
+
+			onClose = this._get( inst, "onClose" );
+			if ( onClose ) {
+				onClose.apply( ( inst.input ? inst.input[ 0 ] : null ), [ ( inst.input ? inst.input.val() : "" ), inst ] );
+			}
+
+			this._lastInput = null;
+			if ( this._inDialog ) {
+				this._dialogInput.css( { position: "absolute", left: "0", top: "-100px" } );
+				if ( $.blockUI ) {
+					$.unblockUI();
+					$( "body" ).append( this.dpDiv );
+				}
+			}
+			this._inDialog = false;
+		}
+	},
+
+	/* Tidy up after a dialog display. */
+	_tidyDialog: function( inst ) {
+		inst.dpDiv.removeClass( this._dialogClass ).off( ".ui-datepicker-calendar" );
+	},
+
+	/* Close date picker if clicked elsewhere. */
+	_checkExternalClick: function( event ) {
+		if ( !$.datepicker._curInst ) {
+			return;
+		}
+
+		var $target = $( event.target ),
+			inst = $.datepicker._getInst( $target[ 0 ] );
+
+		if ( ( ( $target[ 0 ].id !== $.datepicker._mainDivId &&
+				$target.parents( "#" + $.datepicker._mainDivId ).length === 0 &&
+				!$target.hasClass( $.datepicker.markerClassName ) &&
+				!$target.closest( "." + $.datepicker._triggerClass ).length &&
+				$.datepicker._datepickerShowing && !( $.datepicker._inDialog && $.blockUI ) ) ) ||
+			( $target.hasClass( $.datepicker.markerClassName ) && $.datepicker._curInst !== inst ) ) {
+				$.datepicker._hideDatepicker();
+		}
+	},
+
+	/* Adjust one of the date sub-fields. */
+	_adjustDate: function( id, offset, period ) {
+		var target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		if ( this._isDisabledDatepicker( target[ 0 ] ) ) {
+			return;
+		}
+		this._adjustInstDate( inst, offset +
+			( period === "M" ? this._get( inst, "showCurrentAtPos" ) : 0 ), // undo positioning
+			period );
+		this._updateDatepicker( inst );
+	},
+
+	/* Action for current link. */
+	_gotoToday: function( id ) {
+		var date,
+			target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		if ( this._get( inst, "gotoCurrent" ) && inst.currentDay ) {
+			inst.selectedDay = inst.currentDay;
+			inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+			inst.drawYear = inst.selectedYear = inst.currentYear;
+		} else {
+			date = new Date();
+			inst.selectedDay = date.getDate();
+			inst.drawMonth = inst.selectedMonth = date.getMonth();
+			inst.drawYear = inst.selectedYear = date.getFullYear();
+		}
+		this._notifyChange( inst );
+		this._adjustDate( target );
+	},
+
+	/* Action for selecting a new month/year. */
+	_selectMonthYear: function( id, select, period ) {
+		var target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		inst[ "selected" + ( period === "M" ? "Month" : "Year" ) ] =
+		inst[ "draw" + ( period === "M" ? "Month" : "Year" ) ] =
+			parseInt( select.options[ select.selectedIndex ].value, 10 );
+
+		this._notifyChange( inst );
+		this._adjustDate( target );
+	},
+
+	/* Action for selecting a day. */
+	_selectDay: function( id, month, year, td ) {
+		var inst,
+			target = $( id );
+
+		if ( $( td ).hasClass( this._unselectableClass ) || this._isDisabledDatepicker( target[ 0 ] ) ) {
+			return;
+		}
+
+		inst = this._getInst( target[ 0 ] );
+		inst.selectedDay = inst.currentDay = $( "a", td ).html();
+		inst.selectedMonth = inst.currentMonth = month;
+		inst.selectedYear = inst.currentYear = year;
+		this._selectDate( id, this._formatDate( inst,
+			inst.currentDay, inst.currentMonth, inst.currentYear ) );
+	},
+
+	/* Erase the input field and hide the date picker. */
+	_clearDate: function( id ) {
+		var target = $( id );
+		this._selectDate( target, "" );
+	},
+
+	/* Update the input field with the selected date. */
+	_selectDate: function( id, dateStr ) {
+		var onSelect,
+			target = $( id ),
+			inst = this._getInst( target[ 0 ] );
+
+		dateStr = ( dateStr != null ? dateStr : this._formatDate( inst ) );
+		if ( inst.input ) {
+			inst.input.val( dateStr );
+		}
+		this._updateAlternate( inst );
+
+		onSelect = this._get( inst, "onSelect" );
+		if ( onSelect ) {
+			onSelect.apply( ( inst.input ? inst.input[ 0 ] : null ), [ dateStr, inst ] );  // trigger custom callback
+		} else if ( inst.input ) {
+			inst.input.trigger( "change" ); // fire the change event
+		}
+
+		if ( inst.inline ) {
+			this._updateDatepicker( inst );
+		} else {
+			this._hideDatepicker();
+			this._lastInput = inst.input[ 0 ];
+			if ( typeof( inst.input[ 0 ] ) !== "object" ) {
+				inst.input.trigger( "focus" ); // restore focus
+			}
+			this._lastInput = null;
+		}
+	},
+
+	/* Update any alternate field to synchronise with the main field. */
+	_updateAlternate: function( inst ) {
+		var altFormat, date, dateStr,
+			altField = this._get( inst, "altField" );
+
+		if ( altField ) { // update alternate field too
+			altFormat = this._get( inst, "altFormat" ) || this._get( inst, "dateFormat" );
+			date = this._getDate( inst );
+			dateStr = this.formatDate( altFormat, date, this._getFormatConfig( inst ) );
+			$( altField ).val( dateStr );
+		}
+	},
+
+	/* Set as beforeShowDay function to prevent selection of weekends.
+	 * @param  date  Date - the date to customise
+	 * @return [boolean, string] - is this date selectable?, what is its CSS class?
+	 */
+	noWeekends: function( date ) {
+		var day = date.getDay();
+		return [ ( day > 0 && day < 6 ), "" ];
+	},
+
+	/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+	 * @param  date  Date - the date to get the week for
+	 * @return  number - the number of the week within the year that contains this date
+	 */
+	iso8601Week: function( date ) {
+		var time,
+			checkDate = new Date( date.getTime() );
+
+		// Find Thursday of this week starting on Monday
+		checkDate.setDate( checkDate.getDate() + 4 - ( checkDate.getDay() || 7 ) );
+
+		time = checkDate.getTime();
+		checkDate.setMonth( 0 ); // Compare with Jan 1
+		checkDate.setDate( 1 );
+		return Math.floor( Math.round( ( time - checkDate ) / 86400000 ) / 7 ) + 1;
+	},
+
+	/* Parse a string value into a date object.
+	 * See formatDate below for the possible formats.
+	 *
+	 * @param  format string - the expected format of the date
+	 * @param  value string - the date in the above format
+	 * @param  settings Object - attributes include:
+	 *					shortYearCutoff  number - the cutoff year for determining the century (optional)
+	 *					dayNamesShort	string[7] - abbreviated names of the days from Sunday (optional)
+	 *					dayNames		string[7] - names of the days from Sunday (optional)
+	 *					monthNamesShort string[12] - abbreviated names of the months (optional)
+	 *					monthNames		string[12] - names of the months (optional)
+	 * @return  Date - the extracted date value or null if value is blank
+	 */
+	parseDate: function( format, value, settings ) {
+		if ( format == null || value == null ) {
+			throw "Invalid arguments";
+		}
+
+		value = ( typeof value === "object" ? value.toString() : value + "" );
+		if ( value === "" ) {
+			return null;
+		}
+
+		var iFormat, dim, extra,
+			iValue = 0,
+			shortYearCutoffTemp = ( settings ? settings.shortYearCutoff : null ) || this._defaults.shortYearCutoff,
+			shortYearCutoff = ( typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp :
+				new Date().getFullYear() % 100 + parseInt( shortYearCutoffTemp, 10 ) ),
+			dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort,
+			dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames,
+			monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort,
+			monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames,
+			year = -1,
+			month = -1,
+			day = -1,
+			doy = -1,
+			literal = false,
+			date,
+
+			// Check whether a format character is doubled
+			lookAhead = function( match ) {
+				var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+				if ( matches ) {
+					iFormat++;
+				}
+				return matches;
+			},
+
+			// Extract a number from the string value
+			getNumber = function( match ) {
+				var isDoubled = lookAhead( match ),
+					size = ( match === "@" ? 14 : ( match === "!" ? 20 :
+					( match === "y" && isDoubled ? 4 : ( match === "o" ? 3 : 2 ) ) ) ),
+					minSize = ( match === "y" ? size : 1 ),
+					digits = new RegExp( "^\\d{" + minSize + "," + size + "}" ),
+					num = value.substring( iValue ).match( digits );
+				if ( !num ) {
+					throw "Missing number at position " + iValue;
+				}
+				iValue += num[ 0 ].length;
+				return parseInt( num[ 0 ], 10 );
+			},
+
+			// Extract a name from the string value and convert to an index
+			getName = function( match, shortNames, longNames ) {
+				var index = -1,
+					names = $.map( lookAhead( match ) ? longNames : shortNames, function( v, k ) {
+						return [ [ k, v ] ];
+					} ).sort( function( a, b ) {
+						return -( a[ 1 ].length - b[ 1 ].length );
+					} );
+
+				$.each( names, function( i, pair ) {
+					var name = pair[ 1 ];
+					if ( value.substr( iValue, name.length ).toLowerCase() === name.toLowerCase() ) {
+						index = pair[ 0 ];
+						iValue += name.length;
+						return false;
+					}
+				} );
+				if ( index !== -1 ) {
+					return index + 1;
+				} else {
+					throw "Unknown name at position " + iValue;
+				}
+			},
+
+			// Confirm that a literal character matches the string value
+			checkLiteral = function() {
+				if ( value.charAt( iValue ) !== format.charAt( iFormat ) ) {
+					throw "Unexpected literal at position " + iValue;
+				}
+				iValue++;
+			};
+
+		for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+			if ( literal ) {
+				if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+					literal = false;
+				} else {
+					checkLiteral();
+				}
+			} else {
+				switch ( format.charAt( iFormat ) ) {
+					case "d":
+						day = getNumber( "d" );
+						break;
+					case "D":
+						getName( "D", dayNamesShort, dayNames );
+						break;
+					case "o":
+						doy = getNumber( "o" );
+						break;
+					case "m":
+						month = getNumber( "m" );
+						break;
+					case "M":
+						month = getName( "M", monthNamesShort, monthNames );
+						break;
+					case "y":
+						year = getNumber( "y" );
+						break;
+					case "@":
+						date = new Date( getNumber( "@" ) );
+						year = date.getFullYear();
+						month = date.getMonth() + 1;
+						day = date.getDate();
+						break;
+					case "!":
+						date = new Date( ( getNumber( "!" ) - this._ticksTo1970 ) / 10000 );
+						year = date.getFullYear();
+						month = date.getMonth() + 1;
+						day = date.getDate();
+						break;
+					case "'":
+						if ( lookAhead( "'" ) ) {
+							checkLiteral();
+						} else {
+							literal = true;
+						}
+						break;
+					default:
+						checkLiteral();
+				}
+			}
+		}
+
+		if ( iValue < value.length ) {
+			extra = value.substr( iValue );
+			if ( !/^\s+/.test( extra ) ) {
+				throw "Extra/unparsed characters found in date: " + extra;
+			}
+		}
+
+		if ( year === -1 ) {
+			year = new Date().getFullYear();
+		} else if ( year < 100 ) {
+			year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+				( year <= shortYearCutoff ? 0 : -100 );
+		}
+
+		if ( doy > -1 ) {
+			month = 1;
+			day = doy;
+			do {
+				dim = this._getDaysInMonth( year, month - 1 );
+				if ( day <= dim ) {
+					break;
+				}
+				month++;
+				day -= dim;
+			} while ( true );
+		}
+
+		date = this._daylightSavingAdjust( new Date( year, month - 1, day ) );
+		if ( date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day ) {
+			throw "Invalid date"; // E.g. 31/02/00
+		}
+		return date;
+	},
+
+	/* Standard date formats. */
+	ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601)
+	COOKIE: "D, dd M yy",
+	ISO_8601: "yy-mm-dd",
+	RFC_822: "D, d M y",
+	RFC_850: "DD, dd-M-y",
+	RFC_1036: "D, d M y",
+	RFC_1123: "D, d M yy",
+	RFC_2822: "D, d M yy",
+	RSS: "D, d M y", // RFC 822
+	TICKS: "!",
+	TIMESTAMP: "@",
+	W3C: "yy-mm-dd", // ISO 8601
+
+	_ticksTo1970: ( ( ( 1970 - 1 ) * 365 + Math.floor( 1970 / 4 ) - Math.floor( 1970 / 100 ) +
+		Math.floor( 1970 / 400 ) ) * 24 * 60 * 60 * 10000000 ),
+
+	/* Format a date object into a string value.
+	 * The format can be combinations of the following:
+	 * d  - day of month (no leading zero)
+	 * dd - day of month (two digit)
+	 * o  - day of year (no leading zeros)
+	 * oo - day of year (three digit)
+	 * D  - day name short
+	 * DD - day name long
+	 * m  - month of year (no leading zero)
+	 * mm - month of year (two digit)
+	 * M  - month name short
+	 * MM - month name long
+	 * y  - year (two digit)
+	 * yy - year (four digit)
+	 * @ - Unix timestamp (ms since 01/01/1970)
+	 * ! - Windows ticks (100ns since 01/01/0001)
+	 * "..." - literal text
+	 * '' - single quote
+	 *
+	 * @param  format string - the desired format of the date
+	 * @param  date Date - the date value to format
+	 * @param  settings Object - attributes include:
+	 *					dayNamesShort	string[7] - abbreviated names of the days from Sunday (optional)
+	 *					dayNames		string[7] - names of the days from Sunday (optional)
+	 *					monthNamesShort string[12] - abbreviated names of the months (optional)
+	 *					monthNames		string[12] - names of the months (optional)
+	 * @return  string - the date in the above format
+	 */
+	formatDate: function( format, date, settings ) {
+		if ( !date ) {
+			return "";
+		}
+
+		var iFormat,
+			dayNamesShort = ( settings ? settings.dayNamesShort : null ) || this._defaults.dayNamesShort,
+			dayNames = ( settings ? settings.dayNames : null ) || this._defaults.dayNames,
+			monthNamesShort = ( settings ? settings.monthNamesShort : null ) || this._defaults.monthNamesShort,
+			monthNames = ( settings ? settings.monthNames : null ) || this._defaults.monthNames,
+
+			// Check whether a format character is doubled
+			lookAhead = function( match ) {
+				var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+				if ( matches ) {
+					iFormat++;
+				}
+				return matches;
+			},
+
+			// Format a number, with leading zero if necessary
+			formatNumber = function( match, value, len ) {
+				var num = "" + value;
+				if ( lookAhead( match ) ) {
+					while ( num.length < len ) {
+						num = "0" + num;
+					}
+				}
+				return num;
+			},
+
+			// Format a name, short or long as requested
+			formatName = function( match, value, shortNames, longNames ) {
+				return ( lookAhead( match ) ? longNames[ value ] : shortNames[ value ] );
+			},
+			output = "",
+			literal = false;
+
+		if ( date ) {
+			for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+				if ( literal ) {
+					if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+						literal = false;
+					} else {
+						output += format.charAt( iFormat );
+					}
+				} else {
+					switch ( format.charAt( iFormat ) ) {
+						case "d":
+							output += formatNumber( "d", date.getDate(), 2 );
+							break;
+						case "D":
+							output += formatName( "D", date.getDay(), dayNamesShort, dayNames );
+							break;
+						case "o":
+							output += formatNumber( "o",
+								Math.round( ( new Date( date.getFullYear(), date.getMonth(), date.getDate() ).getTime() - new Date( date.getFullYear(), 0, 0 ).getTime() ) / 86400000 ), 3 );
+							break;
+						case "m":
+							output += formatNumber( "m", date.getMonth() + 1, 2 );
+							break;
+						case "M":
+							output += formatName( "M", date.getMonth(), monthNamesShort, monthNames );
+							break;
+						case "y":
+							output += ( lookAhead( "y" ) ? date.getFullYear() :
+								( date.getFullYear() % 100 < 10 ? "0" : "" ) + date.getFullYear() % 100 );
+							break;
+						case "@":
+							output += date.getTime();
+							break;
+						case "!":
+							output += date.getTime() * 10000 + this._ticksTo1970;
+							break;
+						case "'":
+							if ( lookAhead( "'" ) ) {
+								output += "'";
+							} else {
+								literal = true;
+							}
+							break;
+						default:
+							output += format.charAt( iFormat );
+					}
+				}
+			}
+		}
+		return output;
+	},
+
+	/* Extract all possible characters from the date format. */
+	_possibleChars: function( format ) {
+		var iFormat,
+			chars = "",
+			literal = false,
+
+			// Check whether a format character is doubled
+			lookAhead = function( match ) {
+				var matches = ( iFormat + 1 < format.length && format.charAt( iFormat + 1 ) === match );
+				if ( matches ) {
+					iFormat++;
+				}
+				return matches;
+			};
+
+		for ( iFormat = 0; iFormat < format.length; iFormat++ ) {
+			if ( literal ) {
+				if ( format.charAt( iFormat ) === "'" && !lookAhead( "'" ) ) {
+					literal = false;
+				} else {
+					chars += format.charAt( iFormat );
+				}
+			} else {
+				switch ( format.charAt( iFormat ) ) {
+					case "d": case "m": case "y": case "@":
+						chars += "0123456789";
+						break;
+					case "D": case "M":
+						return null; // Accept anything
+					case "'":
+						if ( lookAhead( "'" ) ) {
+							chars += "'";
+						} else {
+							literal = true;
+						}
+						break;
+					default:
+						chars += format.charAt( iFormat );
+				}
+			}
+		}
+		return chars;
+	},
+
+	/* Get a setting value, defaulting if necessary. */
+	_get: function( inst, name ) {
+		return inst.settings[ name ] !== undefined ?
+			inst.settings[ name ] : this._defaults[ name ];
+	},
+
+	/* Parse existing date and initialise date picker. */
+	_setDateFromField: function( inst, noDefault ) {
+		if ( inst.input.val() === inst.lastVal ) {
+			return;
+		}
+
+		var dateFormat = this._get( inst, "dateFormat" ),
+			dates = inst.lastVal = inst.input ? inst.input.val() : null,
+			defaultDate = this._getDefaultDate( inst ),
+			date = defaultDate,
+			settings = this._getFormatConfig( inst );
+
+		try {
+			date = this.parseDate( dateFormat, dates, settings ) || defaultDate;
+		} catch ( event ) {
+			dates = ( noDefault ? "" : dates );
+		}
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		inst.currentDay = ( dates ? date.getDate() : 0 );
+		inst.currentMonth = ( dates ? date.getMonth() : 0 );
+		inst.currentYear = ( dates ? date.getFullYear() : 0 );
+		this._adjustInstDate( inst );
+	},
+
+	/* Retrieve the default date shown on opening. */
+	_getDefaultDate: function( inst ) {
+		return this._restrictMinMax( inst,
+			this._determineDate( inst, this._get( inst, "defaultDate" ), new Date() ) );
+	},
+
+	/* A date may be specified as an exact value or a relative one. */
+	_determineDate: function( inst, date, defaultDate ) {
+		var offsetNumeric = function( offset ) {
+				var date = new Date();
+				date.setDate( date.getDate() + offset );
+				return date;
+			},
+			offsetString = function( offset ) {
+				try {
+					return $.datepicker.parseDate( $.datepicker._get( inst, "dateFormat" ),
+						offset, $.datepicker._getFormatConfig( inst ) );
+				}
+				catch ( e ) {
+
+					// Ignore
+				}
+
+				var date = ( offset.toLowerCase().match( /^c/ ) ?
+					$.datepicker._getDate( inst ) : null ) || new Date(),
+					year = date.getFullYear(),
+					month = date.getMonth(),
+					day = date.getDate(),
+					pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
+					matches = pattern.exec( offset );
+
+				while ( matches ) {
+					switch ( matches[ 2 ] || "d" ) {
+						case "d" : case "D" :
+							day += parseInt( matches[ 1 ], 10 ); break;
+						case "w" : case "W" :
+							day += parseInt( matches[ 1 ], 10 ) * 7; break;
+						case "m" : case "M" :
+							month += parseInt( matches[ 1 ], 10 );
+							day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) );
+							break;
+						case "y": case "Y" :
+							year += parseInt( matches[ 1 ], 10 );
+							day = Math.min( day, $.datepicker._getDaysInMonth( year, month ) );
+							break;
+					}
+					matches = pattern.exec( offset );
+				}
+				return new Date( year, month, day );
+			},
+			newDate = ( date == null || date === "" ? defaultDate : ( typeof date === "string" ? offsetString( date ) :
+				( typeof date === "number" ? ( isNaN( date ) ? defaultDate : offsetNumeric( date ) ) : new Date( date.getTime() ) ) ) );
+
+		newDate = ( newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate );
+		if ( newDate ) {
+			newDate.setHours( 0 );
+			newDate.setMinutes( 0 );
+			newDate.setSeconds( 0 );
+			newDate.setMilliseconds( 0 );
+		}
+		return this._daylightSavingAdjust( newDate );
+	},
+
+	/* Handle switch to/from daylight saving.
+	 * Hours may be non-zero on daylight saving cut-over:
+	 * > 12 when midnight changeover, but then cannot generate
+	 * midnight datetime, so jump to 1AM, otherwise reset.
+	 * @param  date  (Date) the date to check
+	 * @return  (Date) the corrected date
+	 */
+	_daylightSavingAdjust: function( date ) {
+		if ( !date ) {
+			return null;
+		}
+		date.setHours( date.getHours() > 12 ? date.getHours() + 2 : 0 );
+		return date;
+	},
+
+	/* Set the date(s) directly. */
+	_setDate: function( inst, date, noChange ) {
+		var clear = !date,
+			origMonth = inst.selectedMonth,
+			origYear = inst.selectedYear,
+			newDate = this._restrictMinMax( inst, this._determineDate( inst, date, new Date() ) );
+
+		inst.selectedDay = inst.currentDay = newDate.getDate();
+		inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth();
+		inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear();
+		if ( ( origMonth !== inst.selectedMonth || origYear !== inst.selectedYear ) && !noChange ) {
+			this._notifyChange( inst );
+		}
+		this._adjustInstDate( inst );
+		if ( inst.input ) {
+			inst.input.val( clear ? "" : this._formatDate( inst ) );
+		}
+	},
+
+	/* Retrieve the date(s) directly. */
+	_getDate: function( inst ) {
+		var startDate = ( !inst.currentYear || ( inst.input && inst.input.val() === "" ) ? null :
+			this._daylightSavingAdjust( new Date(
+			inst.currentYear, inst.currentMonth, inst.currentDay ) ) );
+			return startDate;
+	},
+
+	/* Attach the onxxx handlers.  These are declared statically so
+	 * they work with static code transformers like Caja.
+	 */
+	_attachHandlers: function( inst ) {
+		var stepMonths = this._get( inst, "stepMonths" ),
+			id = "#" + inst.id.replace( /\\\\/g, "\\" );
+		inst.dpDiv.find( "[data-handler]" ).map( function() {
+			var handler = {
+				prev: function() {
+					$.datepicker._adjustDate( id, -stepMonths, "M" );
+				},
+				next: function() {
+					$.datepicker._adjustDate( id, +stepMonths, "M" );
+				},
+				hide: function() {
+					$.datepicker._hideDatepicker();
+				},
+				today: function() {
+					$.datepicker._gotoToday( id );
+				},
+				selectDay: function() {
+					$.datepicker._selectDay( id, +this.getAttribute( "data-month" ), +this.getAttribute( "data-year" ), this );
+					return false;
+				},
+				selectMonth: function() {
+					$.datepicker._selectMonthYear( id, this, "M" );
+					return false;
+				},
+				selectYear: function() {
+					$.datepicker._selectMonthYear( id, this, "Y" );
+					return false;
+				}
+			};
+			$( this ).on( this.getAttribute( "data-event" ), handler[ this.getAttribute( "data-handler" ) ] );
+		} );
+	},
+
+	/* Generate the HTML for the current state of the date picker. */
+	_generateHTML: function( inst ) {
+		var maxDraw, prevText, prev, nextText, next, currentText, gotoDate,
+			controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin,
+			monthNames, monthNamesShort, beforeShowDay, showOtherMonths,
+			selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate,
+			cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows,
+			printDate, dRow, tbody, daySettings, otherMonth, unselectable,
+			tempDate = new Date(),
+			today = this._daylightSavingAdjust(
+				new Date( tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate() ) ), // clear time
+			isRTL = this._get( inst, "isRTL" ),
+			showButtonPanel = this._get( inst, "showButtonPanel" ),
+			hideIfNoPrevNext = this._get( inst, "hideIfNoPrevNext" ),
+			navigationAsDateFormat = this._get( inst, "navigationAsDateFormat" ),
+			numMonths = this._getNumberOfMonths( inst ),
+			showCurrentAtPos = this._get( inst, "showCurrentAtPos" ),
+			stepMonths = this._get( inst, "stepMonths" ),
+			isMultiMonth = ( numMonths[ 0 ] !== 1 || numMonths[ 1 ] !== 1 ),
+			currentDate = this._daylightSavingAdjust( ( !inst.currentDay ? new Date( 9999, 9, 9 ) :
+				new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) ),
+			minDate = this._getMinMaxDate( inst, "min" ),
+			maxDate = this._getMinMaxDate( inst, "max" ),
+			drawMonth = inst.drawMonth - showCurrentAtPos,
+			drawYear = inst.drawYear;
+
+		if ( drawMonth < 0 ) {
+			drawMonth += 12;
+			drawYear--;
+		}
+		if ( maxDate ) {
+			maxDraw = this._daylightSavingAdjust( new Date( maxDate.getFullYear(),
+				maxDate.getMonth() - ( numMonths[ 0 ] * numMonths[ 1 ] ) + 1, maxDate.getDate() ) );
+			maxDraw = ( minDate && maxDraw < minDate ? minDate : maxDraw );
+			while ( this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 ) ) > maxDraw ) {
+				drawMonth--;
+				if ( drawMonth < 0 ) {
+					drawMonth = 11;
+					drawYear--;
+				}
+			}
+		}
+		inst.drawMonth = drawMonth;
+		inst.drawYear = drawYear;
+
+		prevText = this._get( inst, "prevText" );
+		prevText = ( !navigationAsDateFormat ? prevText : this.formatDate( prevText,
+			this._daylightSavingAdjust( new Date( drawYear, drawMonth - stepMonths, 1 ) ),
+			this._getFormatConfig( inst ) ) );
+
+		prev = ( this._canAdjustMonth( inst, -1, drawYear, drawMonth ) ?
+			"<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
+			" title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" :
+			( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w" ) + "'>" + prevText + "</span></a>" ) );
+
+		nextText = this._get( inst, "nextText" );
+		nextText = ( !navigationAsDateFormat ? nextText : this.formatDate( nextText,
+			this._daylightSavingAdjust( new Date( drawYear, drawMonth + stepMonths, 1 ) ),
+			this._getFormatConfig( inst ) ) );
+
+		next = ( this._canAdjustMonth( inst, +1, drawYear, drawMonth ) ?
+			"<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
+			" title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" :
+			( hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e" ) + "'>" + nextText + "</span></a>" ) );
+
+		currentText = this._get( inst, "currentText" );
+		gotoDate = ( this._get( inst, "gotoCurrent" ) && inst.currentDay ? currentDate : today );
+		currentText = ( !navigationAsDateFormat ? currentText :
+			this.formatDate( currentText, gotoDate, this._getFormatConfig( inst ) ) );
+
+		controls = ( !inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
+			this._get( inst, "closeText" ) + "</button>" : "" );
+
+		buttonPanel = ( showButtonPanel ) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + ( isRTL ? controls : "" ) +
+			( this._isInRange( inst, gotoDate ) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
+			">" + currentText + "</button>" : "" ) + ( isRTL ? "" : controls ) + "</div>" : "";
+
+		firstDay = parseInt( this._get( inst, "firstDay" ), 10 );
+		firstDay = ( isNaN( firstDay ) ? 0 : firstDay );
+
+		showWeek = this._get( inst, "showWeek" );
+		dayNames = this._get( inst, "dayNames" );
+		dayNamesMin = this._get( inst, "dayNamesMin" );
+		monthNames = this._get( inst, "monthNames" );
+		monthNamesShort = this._get( inst, "monthNamesShort" );
+		beforeShowDay = this._get( inst, "beforeShowDay" );
+		showOtherMonths = this._get( inst, "showOtherMonths" );
+		selectOtherMonths = this._get( inst, "selectOtherMonths" );
+		defaultDate = this._getDefaultDate( inst );
+		html = "";
+
+		for ( row = 0; row < numMonths[ 0 ]; row++ ) {
+			group = "";
+			this.maxRows = 4;
+			for ( col = 0; col < numMonths[ 1 ]; col++ ) {
+				selectedDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, inst.selectedDay ) );
+				cornerClass = " ui-corner-all";
+				calender = "";
+				if ( isMultiMonth ) {
+					calender += "<div class='ui-datepicker-group";
+					if ( numMonths[ 1 ] > 1 ) {
+						switch ( col ) {
+							case 0: calender += " ui-datepicker-group-first";
+								cornerClass = " ui-corner-" + ( isRTL ? "right" : "left" ); break;
+							case numMonths[ 1 ] - 1: calender += " ui-datepicker-group-last";
+								cornerClass = " ui-corner-" + ( isRTL ? "left" : "right" ); break;
+							default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break;
+						}
+					}
+					calender += "'>";
+				}
+				calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" +
+					( /all|left/.test( cornerClass ) && row === 0 ? ( isRTL ? next : prev ) : "" ) +
+					( /all|right/.test( cornerClass ) && row === 0 ? ( isRTL ? prev : next ) : "" ) +
+					this._generateMonthYearHeader( inst, drawMonth, drawYear, minDate, maxDate,
+					row > 0 || col > 0, monthNames, monthNamesShort ) + // draw month headers
+					"</div><table class='ui-datepicker-calendar'><thead>" +
+					"<tr>";
+				thead = ( showWeek ? "<th class='ui-datepicker-week-col'>" + this._get( inst, "weekHeader" ) + "</th>" : "" );
+				for ( dow = 0; dow < 7; dow++ ) { // days of the week
+					day = ( dow + firstDay ) % 7;
+					thead += "<th scope='col'" + ( ( dow + firstDay + 6 ) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "" ) + ">" +
+						"<span title='" + dayNames[ day ] + "'>" + dayNamesMin[ day ] + "</span></th>";
+				}
+				calender += thead + "</tr></thead><tbody>";
+				daysInMonth = this._getDaysInMonth( drawYear, drawMonth );
+				if ( drawYear === inst.selectedYear && drawMonth === inst.selectedMonth ) {
+					inst.selectedDay = Math.min( inst.selectedDay, daysInMonth );
+				}
+				leadDays = ( this._getFirstDayOfMonth( drawYear, drawMonth ) - firstDay + 7 ) % 7;
+				curRows = Math.ceil( ( leadDays + daysInMonth ) / 7 ); // calculate the number of rows to generate
+				numRows = ( isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows ); //If multiple months, use the higher number of rows (see #7043)
+				this.maxRows = numRows;
+				printDate = this._daylightSavingAdjust( new Date( drawYear, drawMonth, 1 - leadDays ) );
+				for ( dRow = 0; dRow < numRows; dRow++ ) { // create date picker rows
+					calender += "<tr>";
+					tbody = ( !showWeek ? "" : "<td class='ui-datepicker-week-col'>" +
+						this._get( inst, "calculateWeek" )( printDate ) + "</td>" );
+					for ( dow = 0; dow < 7; dow++ ) { // create date picker days
+						daySettings = ( beforeShowDay ?
+							beforeShowDay.apply( ( inst.input ? inst.input[ 0 ] : null ), [ printDate ] ) : [ true, "" ] );
+						otherMonth = ( printDate.getMonth() !== drawMonth );
+						unselectable = ( otherMonth && !selectOtherMonths ) || !daySettings[ 0 ] ||
+							( minDate && printDate < minDate ) || ( maxDate && printDate > maxDate );
+						tbody += "<td class='" +
+							( ( dow + firstDay + 6 ) % 7 >= 5 ? " ui-datepicker-week-end" : "" ) + // highlight weekends
+							( otherMonth ? " ui-datepicker-other-month" : "" ) + // highlight days from other months
+							( ( printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent ) || // user pressed key
+							( defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime() ) ?
+
+							// or defaultDate is current printedDate and defaultDate is selectedDate
+							" " + this._dayOverClass : "" ) + // highlight selected day
+							( unselectable ? " " + this._unselectableClass + " ui-state-disabled" : "" ) +  // highlight unselectable days
+							( otherMonth && !showOtherMonths ? "" : " " + daySettings[ 1 ] + // highlight custom dates
+							( printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "" ) + // highlight selected day
+							( printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "" ) ) + "'" + // highlight today (if different)
+							( ( !otherMonth || showOtherMonths ) && daySettings[ 2 ] ? " title='" + daySettings[ 2 ].replace( /'/g, "&#39;" ) + "'" : "" ) + // cell title
+							( unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'" ) + ">" + // actions
+							( otherMonth && !showOtherMonths ? "&#xa0;" : // display for other months
+							( unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" +
+							( printDate.getTime() === today.getTime() ? " ui-state-highlight" : "" ) +
+							( printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "" ) + // highlight selected day
+							( otherMonth ? " ui-priority-secondary" : "" ) + // distinguish dates from other months
+							"' href='#'>" + printDate.getDate() + "</a>" ) ) + "</td>"; // display selectable date
+						printDate.setDate( printDate.getDate() + 1 );
+						printDate = this._daylightSavingAdjust( printDate );
+					}
+					calender += tbody + "</tr>";
+				}
+				drawMonth++;
+				if ( drawMonth > 11 ) {
+					drawMonth = 0;
+					drawYear++;
+				}
+				calender += "</tbody></table>" + ( isMultiMonth ? "</div>" +
+							( ( numMonths[ 0 ] > 0 && col === numMonths[ 1 ] - 1 ) ? "<div class='ui-datepicker-row-break'></div>" : "" ) : "" );
+				group += calender;
+			}
+			html += group;
+		}
+		html += buttonPanel;
+		inst._keyEvent = false;
+		return html;
+	},
+
+	/* Generate the month and year header. */
+	_generateMonthYearHeader: function( inst, drawMonth, drawYear, minDate, maxDate,
+			secondary, monthNames, monthNamesShort ) {
+
+		var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear,
+			changeMonth = this._get( inst, "changeMonth" ),
+			changeYear = this._get( inst, "changeYear" ),
+			showMonthAfterYear = this._get( inst, "showMonthAfterYear" ),
+			html = "<div class='ui-datepicker-title'>",
+			monthHtml = "";
+
+		// Month selection
+		if ( secondary || !changeMonth ) {
+			monthHtml += "<span class='ui-datepicker-month'>" + monthNames[ drawMonth ] + "</span>";
+		} else {
+			inMinYear = ( minDate && minDate.getFullYear() === drawYear );
+			inMaxYear = ( maxDate && maxDate.getFullYear() === drawYear );
+			monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>";
+			for ( month = 0; month < 12; month++ ) {
+				if ( ( !inMinYear || month >= minDate.getMonth() ) && ( !inMaxYear || month <= maxDate.getMonth() ) ) {
+					monthHtml += "<option value='" + month + "'" +
+						( month === drawMonth ? " selected='selected'" : "" ) +
+						">" + monthNamesShort[ month ] + "</option>";
+				}
+			}
+			monthHtml += "</select>";
+		}
+
+		if ( !showMonthAfterYear ) {
+			html += monthHtml + ( secondary || !( changeMonth && changeYear ) ? "&#xa0;" : "" );
+		}
+
+		// Year selection
+		if ( !inst.yearshtml ) {
+			inst.yearshtml = "";
+			if ( secondary || !changeYear ) {
+				html += "<span class='ui-datepicker-year'>" + drawYear + "</span>";
+			} else {
+
+				// determine range of years to display
+				years = this._get( inst, "yearRange" ).split( ":" );
+				thisYear = new Date().getFullYear();
+				determineYear = function( value ) {
+					var year = ( value.match( /c[+\-].*/ ) ? drawYear + parseInt( value.substring( 1 ), 10 ) :
+						( value.match( /[+\-].*/ ) ? thisYear + parseInt( value, 10 ) :
+						parseInt( value, 10 ) ) );
+					return ( isNaN( year ) ? thisYear : year );
+				};
+				year = determineYear( years[ 0 ] );
+				endYear = Math.max( year, determineYear( years[ 1 ] || "" ) );
+				year = ( minDate ? Math.max( year, minDate.getFullYear() ) : year );
+				endYear = ( maxDate ? Math.min( endYear, maxDate.getFullYear() ) : endYear );
+				inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";
+				for ( ; year <= endYear; year++ ) {
+					inst.yearshtml += "<option value='" + year + "'" +
+						( year === drawYear ? " selected='selected'" : "" ) +
+						">" + year + "</option>";
+				}
+				inst.yearshtml += "</select>";
+
+				html += inst.yearshtml;
+				inst.yearshtml = null;
+			}
+		}
+
+		html += this._get( inst, "yearSuffix" );
+		if ( showMonthAfterYear ) {
+			html += ( secondary || !( changeMonth && changeYear ) ? "&#xa0;" : "" ) + monthHtml;
+		}
+		html += "</div>"; // Close datepicker_header
+		return html;
+	},
+
+	/* Adjust one of the date sub-fields. */
+	_adjustInstDate: function( inst, offset, period ) {
+		var year = inst.selectedYear + ( period === "Y" ? offset : 0 ),
+			month = inst.selectedMonth + ( period === "M" ? offset : 0 ),
+			day = Math.min( inst.selectedDay, this._getDaysInMonth( year, month ) ) + ( period === "D" ? offset : 0 ),
+			date = this._restrictMinMax( inst, this._daylightSavingAdjust( new Date( year, month, day ) ) );
+
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		if ( period === "M" || period === "Y" ) {
+			this._notifyChange( inst );
+		}
+	},
+
+	/* Ensure a date is within any min/max bounds. */
+	_restrictMinMax: function( inst, date ) {
+		var minDate = this._getMinMaxDate( inst, "min" ),
+			maxDate = this._getMinMaxDate( inst, "max" ),
+			newDate = ( minDate && date < minDate ? minDate : date );
+		return ( maxDate && newDate > maxDate ? maxDate : newDate );
+	},
+
+	/* Notify change of month/year. */
+	_notifyChange: function( inst ) {
+		var onChange = this._get( inst, "onChangeMonthYear" );
+		if ( onChange ) {
+			onChange.apply( ( inst.input ? inst.input[ 0 ] : null ),
+				[ inst.selectedYear, inst.selectedMonth + 1, inst ] );
+		}
+	},
+
+	/* Determine the number of months to show. */
+	_getNumberOfMonths: function( inst ) {
+		var numMonths = this._get( inst, "numberOfMonths" );
+		return ( numMonths == null ? [ 1, 1 ] : ( typeof numMonths === "number" ? [ 1, numMonths ] : numMonths ) );
+	},
+
+	/* Determine the current maximum date - ensure no time components are set. */
+	_getMinMaxDate: function( inst, minMax ) {
+		return this._determineDate( inst, this._get( inst, minMax + "Date" ), null );
+	},
+
+	/* Find the number of days in a given month. */
+	_getDaysInMonth: function( year, month ) {
+		return 32 - this._daylightSavingAdjust( new Date( year, month, 32 ) ).getDate();
+	},
+
+	/* Find the day of the week of the first of a month. */
+	_getFirstDayOfMonth: function( year, month ) {
+		return new Date( year, month, 1 ).getDay();
+	},
+
+	/* Determines if we should allow a "next/prev" month display change. */
+	_canAdjustMonth: function( inst, offset, curYear, curMonth ) {
+		var numMonths = this._getNumberOfMonths( inst ),
+			date = this._daylightSavingAdjust( new Date( curYear,
+			curMonth + ( offset < 0 ? offset : numMonths[ 0 ] * numMonths[ 1 ] ), 1 ) );
+
+		if ( offset < 0 ) {
+			date.setDate( this._getDaysInMonth( date.getFullYear(), date.getMonth() ) );
+		}
+		return this._isInRange( inst, date );
+	},
+
+	/* Is the given date in the accepted range? */
+	_isInRange: function( inst, date ) {
+		var yearSplit, currentYear,
+			minDate = this._getMinMaxDate( inst, "min" ),
+			maxDate = this._getMinMaxDate( inst, "max" ),
+			minYear = null,
+			maxYear = null,
+			years = this._get( inst, "yearRange" );
+			if ( years ) {
+				yearSplit = years.split( ":" );
+				currentYear = new Date().getFullYear();
+				minYear = parseInt( yearSplit[ 0 ], 10 );
+				maxYear = parseInt( yearSplit[ 1 ], 10 );
+				if ( yearSplit[ 0 ].match( /[+\-].*/ ) ) {
+					minYear += currentYear;
+				}
+				if ( yearSplit[ 1 ].match( /[+\-].*/ ) ) {
+					maxYear += currentYear;
+				}
+			}
+
+		return ( ( !minDate || date.getTime() >= minDate.getTime() ) &&
+			( !maxDate || date.getTime() <= maxDate.getTime() ) &&
+			( !minYear || date.getFullYear() >= minYear ) &&
+			( !maxYear || date.getFullYear() <= maxYear ) );
+	},
+
+	/* Provide the configuration settings for formatting/parsing. */
+	_getFormatConfig: function( inst ) {
+		var shortYearCutoff = this._get( inst, "shortYearCutoff" );
+		shortYearCutoff = ( typeof shortYearCutoff !== "string" ? shortYearCutoff :
+			new Date().getFullYear() % 100 + parseInt( shortYearCutoff, 10 ) );
+		return { shortYearCutoff: shortYearCutoff,
+			dayNamesShort: this._get( inst, "dayNamesShort" ), dayNames: this._get( inst, "dayNames" ),
+			monthNamesShort: this._get( inst, "monthNamesShort" ), monthNames: this._get( inst, "monthNames" ) };
+	},
+
+	/* Format the given date for display. */
+	_formatDate: function( inst, day, month, year ) {
+		if ( !day ) {
+			inst.currentDay = inst.selectedDay;
+			inst.currentMonth = inst.selectedMonth;
+			inst.currentYear = inst.selectedYear;
+		}
+		var date = ( day ? ( typeof day === "object" ? day :
+			this._daylightSavingAdjust( new Date( year, month, day ) ) ) :
+			this._daylightSavingAdjust( new Date( inst.currentYear, inst.currentMonth, inst.currentDay ) ) );
+		return this.formatDate( this._get( inst, "dateFormat" ), date, this._getFormatConfig( inst ) );
+	}
+} );
+
+/*
+ * Bind hover events for datepicker elements.
+ * Done via delegate so the binding only occurs once in the lifetime of the parent div.
+ * Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
+ */
+function datepicker_bindHover( dpDiv ) {
+	var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";
+	return dpDiv.on( "mouseout", selector, function() {
+			$( this ).removeClass( "ui-state-hover" );
+			if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) {
+				$( this ).removeClass( "ui-datepicker-prev-hover" );
+			}
+			if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) {
+				$( this ).removeClass( "ui-datepicker-next-hover" );
+			}
+		} )
+		.on( "mouseover", selector, datepicker_handleMouseover );
+}
+
+function datepicker_handleMouseover() {
+	if ( !$.datepicker._isDisabledDatepicker( datepicker_instActive.inline ? datepicker_instActive.dpDiv.parent()[ 0 ] : datepicker_instActive.input[ 0 ] ) ) {
+		$( this ).parents( ".ui-datepicker-calendar" ).find( "a" ).removeClass( "ui-state-hover" );
+		$( this ).addClass( "ui-state-hover" );
+		if ( this.className.indexOf( "ui-datepicker-prev" ) !== -1 ) {
+			$( this ).addClass( "ui-datepicker-prev-hover" );
+		}
+		if ( this.className.indexOf( "ui-datepicker-next" ) !== -1 ) {
+			$( this ).addClass( "ui-datepicker-next-hover" );
+		}
+	}
+}
+
+/* jQuery extend now ignores nulls! */
+function datepicker_extendRemove( target, props ) {
+	$.extend( target, props );
+	for ( var name in props ) {
+		if ( props[ name ] == null ) {
+			target[ name ] = props[ name ];
+		}
+	}
+	return target;
+}
+
+/* Invoke the datepicker functionality.
+   @param  options  string - a command, optionally followed by additional parameters or
+					Object - settings for attaching new datepicker functionality
+   @return  jQuery object */
+$.fn.datepicker = function( options ) {
+
+	/* Verify an empty collection wasn't passed - Fixes #6976 */
+	if ( !this.length ) {
+		return this;
+	}
+
+	/* Initialise the date picker. */
+	if ( !$.datepicker.initialized ) {
+		$( document ).on( "mousedown", $.datepicker._checkExternalClick );
+		$.datepicker.initialized = true;
+	}
+
+	/* Append datepicker main container to body if not exist. */
+	if ( $( "#" + $.datepicker._mainDivId ).length === 0 ) {
+		$( "body" ).append( $.datepicker.dpDiv );
+	}
+
+	var otherArgs = Array.prototype.slice.call( arguments, 1 );
+	if ( typeof options === "string" && ( options === "isDisabled" || options === "getDate" || options === "widget" ) ) {
+		return $.datepicker[ "_" + options + "Datepicker" ].
+			apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) );
+	}
+	if ( options === "option" && arguments.length === 2 && typeof arguments[ 1 ] === "string" ) {
+		return $.datepicker[ "_" + options + "Datepicker" ].
+			apply( $.datepicker, [ this[ 0 ] ].concat( otherArgs ) );
+	}
+	return this.each( function() {
+		typeof options === "string" ?
+			$.datepicker[ "_" + options + "Datepicker" ].
+				apply( $.datepicker, [ this ].concat( otherArgs ) ) :
+			$.datepicker._attachDatepicker( this, options );
+	} );
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "1.12.1";
+
+return $.datepicker;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/datepicker.min.js b/wp-includes/js/jquery/ui/datepicker.min.js
index d87847d086..5afd8ebc26 100644
--- a/wp-includes/js/jquery/ui/datepicker.min.js
+++ b/wp-includes/js/jquery/ui/datepicker.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Datepicker 1.11.4
+ * jQuery UI Datepicker 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/datepicker/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(b){var r;function e(){this._curInst=null,this._keyEvent=!1,this._disabledInputs=[],this._datepickerShowing=!1,this._inDialog=!1,this._mainDivId="ui-datepicker-div",this._inlineClass="ui-datepicker-inline",this._appendClass="ui-datepicker-append",this._triggerClass="ui-datepicker-trigger",this._dialogClass="ui-datepicker-dialog",this._disableClass="ui-datepicker-disabled",this._unselectableClass="ui-datepicker-unselectable",this._currentClass="ui-datepicker-current-day",this._dayOverClass="ui-datepicker-days-cell-over",this.regional=[],this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:!1,showMonthAfterYear:!1,yearSuffix:""},this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:!1,hideIfNoPrevNext:!1,navigationAsDateFormat:!1,gotoCurrent:!1,changeMonth:!1,changeYear:!1,yearRange:"c-10:c+10",showOtherMonths:!1,selectOtherMonths:!1,showWeek:!1,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:!0,showButtonPanel:!1,autoSize:!1,disabled:!1},b.extend(this._defaults,this.regional[""]),this.regional.en=b.extend(!0,{},this.regional[""]),this.regional["en-US"]=b.extend(!0,{},this.regional.en),this.dpDiv=a(b("<div id='"+this._mainDivId+"' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"))}function a(e){var t="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return e.delegate(t,"mouseout",function(){b(this).removeClass("ui-state-hover"),-1!==this.className.indexOf("ui-datepicker-prev")&&b(this).removeClass("ui-datepicker-prev-hover"),-1!==this.className.indexOf("ui-datepicker-next")&&b(this).removeClass("ui-datepicker-next-hover")}).delegate(t,"mouseover",n)}function n(){b.datepicker._isDisabledDatepicker(r.inline?r.dpDiv.parent()[0]:r.input[0])||(b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),b(this).addClass("ui-state-hover"),-1!==this.className.indexOf("ui-datepicker-prev")&&b(this).addClass("ui-datepicker-prev-hover"),-1!==this.className.indexOf("ui-datepicker-next")&&b(this).addClass("ui-datepicker-next-hover"))}function h(e,t){for(var a in b.extend(e,t),t)null==t[a]&&(e[a]=t[a]);return e}return b.extend(b.ui,{datepicker:{version:"1.11.4"}}),b.extend(e.prototype,{markerClassName:"hasDatepicker",maxRows:4,_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(e){return h(this._defaults,e||{}),this},_attachDatepicker:function(e,t){var a,i,s;i="div"===(a=e.nodeName.toLowerCase())||"span"===a,e.id||(this.uuid+=1,e.id="dp"+this.uuid),(s=this._newInst(b(e),i)).settings=b.extend({},t||{}),"input"===a?this._connectDatepicker(e,s):i&&this._inlineDatepicker(e,s)},_newInst:function(e,t){return{id:e[0].id.replace(/([^A-Za-z0-9_\-])/g,"\\\\$1"),input:e,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:t,dpDiv:t?a(b("<div class='"+this._inlineClass+" ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")):this.dpDiv}},_connectDatepicker:function(e,t){var a=b(e);t.append=b([]),t.trigger=b([]),a.hasClass(this.markerClassName)||(this._attachments(a,t),a.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp),this._autoSize(t),b.data(e,"datepicker",t),t.settings.disabled&&this._disableDatepicker(e))},_attachments:function(e,t){var a,i,s,r=this._get(t,"appendText"),n=this._get(t,"isRTL");t.append&&t.append.remove(),r&&(t.append=b("<span class='"+this._appendClass+"'>"+r+"</span>"),e[n?"before":"after"](t.append)),e.unbind("focus",this._showDatepicker),t.trigger&&t.trigger.remove(),"focus"!==(a=this._get(t,"showOn"))&&"both"!==a||e.focus(this._showDatepicker),"button"!==a&&"both"!==a||(i=this._get(t,"buttonText"),s=this._get(t,"buttonImage"),t.trigger=b(this._get(t,"buttonImageOnly")?b("<img/>").addClass(this._triggerClass).attr({src:s,alt:i,title:i}):b("<button type='button'></button>").addClass(this._triggerClass).html(s?b("<img/>").attr({src:s,alt:i,title:i}):i)),e[n?"before":"after"](t.trigger),t.trigger.click(function(){return b.datepicker._datepickerShowing&&b.datepicker._lastInput===e[0]?b.datepicker._hideDatepicker():(b.datepicker._datepickerShowing&&b.datepicker._lastInput!==e[0]&&b.datepicker._hideDatepicker(),b.datepicker._showDatepicker(e[0])),!1}))},_autoSize:function(e){if(this._get(e,"autoSize")&&!e.inline){var t,a,i,s,r=new Date(2009,11,20),n=this._get(e,"dateFormat");n.match(/[DM]/)&&(t=function(e){for(s=i=a=0;s<e.length;s++)e[s].length>a&&(a=e[s].length,i=s);return i},r.setMonth(t(this._get(e,n.match(/MM/)?"monthNames":"monthNamesShort"))),r.setDate(t(this._get(e,n.match(/DD/)?"dayNames":"dayNamesShort"))+20-r.getDay())),e.input.attr("size",this._formatDate(e,r).length)}},_inlineDatepicker:function(e,t){var a=b(e);a.hasClass(this.markerClassName)||(a.addClass(this.markerClassName).append(t.dpDiv),b.data(e,"datepicker",t),this._setDate(t,this._getDefaultDate(t),!0),this._updateDatepicker(t),this._updateAlternate(t),t.settings.disabled&&this._disableDatepicker(e),t.dpDiv.css("display","block"))},_dialogDatepicker:function(e,t,a,i,s){var r,n,d,c,o,l=this._dialogInst;return l||(this.uuid+=1,r="dp"+this.uuid,this._dialogInput=b("<input type='text' id='"+r+"' style='position: absolute; top: -100px; width: 0px;'/>"),this._dialogInput.keydown(this._doKeyDown),b("body").append(this._dialogInput),(l=this._dialogInst=this._newInst(this._dialogInput,!1)).settings={},b.data(this._dialogInput[0],"datepicker",l)),h(l.settings,i||{}),t=t&&t.constructor===Date?this._formatDate(l,t):t,this._dialogInput.val(t),this._pos=s?s.length?s:[s.pageX,s.pageY]:null,this._pos||(n=document.documentElement.clientWidth,d=document.documentElement.clientHeight,c=document.documentElement.scrollLeft||document.body.scrollLeft,o=document.documentElement.scrollTop||document.body.scrollTop,this._pos=[n/2-100+c,d/2-150+o]),this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),l.settings.onSelect=a,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),b.blockUI&&b.blockUI(this.dpDiv),b.data(this._dialogInput[0],"datepicker",l),this},_destroyDatepicker:function(e){var t,a=b(e),i=b.data(e,"datepicker");a.hasClass(this.markerClassName)&&(t=e.nodeName.toLowerCase(),b.removeData(e,"datepicker"),"input"===t?(i.append.remove(),i.trigger.remove(),a.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)):"div"!==t&&"span"!==t||a.removeClass(this.markerClassName).empty(),r===i&&(r=null))},_enableDatepicker:function(t){var e,a,i=b(t),s=b.data(t,"datepicker");i.hasClass(this.markerClassName)&&("input"===(e=t.nodeName.toLowerCase())?(t.disabled=!1,s.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""})):"div"!==e&&"span"!==e||((a=i.children("."+this._inlineClass)).children().removeClass("ui-state-disabled"),a.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled",!1)),this._disabledInputs=b.map(this._disabledInputs,function(e){return e===t?null:e}))},_disableDatepicker:function(t){var e,a,i=b(t),s=b.data(t,"datepicker");i.hasClass(this.markerClassName)&&("input"===(e=t.nodeName.toLowerCase())?(t.disabled=!0,s.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"})):"div"!==e&&"span"!==e||((a=i.children("."+this._inlineClass)).children().addClass("ui-state-disabled"),a.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled",!0)),this._disabledInputs=b.map(this._disabledInputs,function(e){return e===t?null:e}),this._disabledInputs[this._disabledInputs.length]=t)},_isDisabledDatepicker:function(e){if(!e)return!1;for(var t=0;t<this._disabledInputs.length;t++)if(this._disabledInputs[t]===e)return!0;return!1},_getInst:function(e){try{return b.data(e,"datepicker")}catch(e){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(e,t,a){var i,s,r,n,d=this._getInst(e);if(2===arguments.length&&"string"==typeof t)return"defaults"===t?b.extend({},b.datepicker._defaults):d?"all"===t?b.extend({},d.settings):this._get(d,t):null;i=t||{},"string"==typeof t&&((i={})[t]=a),d&&(this._curInst===d&&this._hideDatepicker(),s=this._getDateDatepicker(e,!0),r=this._getMinMaxDate(d,"min"),n=this._getMinMaxDate(d,"max"),h(d.settings,i),null!==r&&void 0!==i.dateFormat&&void 0===i.minDate&&(d.settings.minDate=this._formatDate(d,r)),null!==n&&void 0!==i.dateFormat&&void 0===i.maxDate&&(d.settings.maxDate=this._formatDate(d,n)),"disabled"in i&&(i.disabled?this._disableDatepicker(e):this._enableDatepicker(e)),this._attachments(b(e),d),this._autoSize(d),this._setDate(d,s),this._updateAlternate(d),this._updateDatepicker(d))},_changeDatepicker:function(e,t,a){this._optionDatepicker(e,t,a)},_refreshDatepicker:function(e){var t=this._getInst(e);t&&this._updateDatepicker(t)},_setDateDatepicker:function(e,t){var a=this._getInst(e);a&&(this._setDate(a,t),this._updateDatepicker(a),this._updateAlternate(a))},_getDateDatepicker:function(e,t){var a=this._getInst(e);return a&&!a.inline&&this._setDateFromField(a,t),a?this._getDate(a):null},_doKeyDown:function(e){var t,a,i,s=b.datepicker._getInst(e.target),r=!0,n=s.dpDiv.is(".ui-datepicker-rtl");if(s._keyEvent=!0,b.datepicker._datepickerShowing)switch(e.keyCode){case 9:b.datepicker._hideDatepicker(),r=!1;break;case 13:return(i=b("td."+b.datepicker._dayOverClass+":not(."+b.datepicker._currentClass+")",s.dpDiv))[0]&&b.datepicker._selectDay(e.target,s.selectedMonth,s.selectedYear,i[0]),(t=b.datepicker._get(s,"onSelect"))?(a=b.datepicker._formatDate(s),t.apply(s.input?s.input[0]:null,[a,s])):b.datepicker._hideDatepicker(),!1;case 27:b.datepicker._hideDatepicker();break;case 33:b.datepicker._adjustDate(e.target,e.ctrlKey?-b.datepicker._get(s,"stepBigMonths"):-b.datepicker._get(s,"stepMonths"),"M");break;case 34:b.datepicker._adjustDate(e.target,e.ctrlKey?+b.datepicker._get(s,"stepBigMonths"):+b.datepicker._get(s,"stepMonths"),"M");break;case 35:(e.ctrlKey||e.metaKey)&&b.datepicker._clearDate(e.target),r=e.ctrlKey||e.metaKey;break;case 36:(e.ctrlKey||e.metaKey)&&b.datepicker._gotoToday(e.target),r=e.ctrlKey||e.metaKey;break;case 37:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,n?1:-1,"D"),r=e.ctrlKey||e.metaKey,e.originalEvent.altKey&&b.datepicker._adjustDate(e.target,e.ctrlKey?-b.datepicker._get(s,"stepBigMonths"):-b.datepicker._get(s,"stepMonths"),"M");break;case 38:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,-7,"D"),r=e.ctrlKey||e.metaKey;break;case 39:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,n?-1:1,"D"),r=e.ctrlKey||e.metaKey,e.originalEvent.altKey&&b.datepicker._adjustDate(e.target,e.ctrlKey?+b.datepicker._get(s,"stepBigMonths"):+b.datepicker._get(s,"stepMonths"),"M");break;case 40:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,7,"D"),r=e.ctrlKey||e.metaKey;break;default:r=!1}else 36===e.keyCode&&e.ctrlKey?b.datepicker._showDatepicker(this):r=!1;r&&(e.preventDefault(),e.stopPropagation())},_doKeyPress:function(e){var t,a,i=b.datepicker._getInst(e.target);if(b.datepicker._get(i,"constrainInput"))return t=b.datepicker._possibleChars(b.datepicker._get(i,"dateFormat")),a=String.fromCharCode(null==e.charCode?e.keyCode:e.charCode),e.ctrlKey||e.metaKey||a<" "||!t||-1<t.indexOf(a)},_doKeyUp:function(e){var t=b.datepicker._getInst(e.target);if(t.input.val()!==t.lastVal)try{b.datepicker.parseDate(b.datepicker._get(t,"dateFormat"),t.input?t.input.val():null,b.datepicker._getFormatConfig(t))&&(b.datepicker._setDateFromField(t),b.datepicker._updateAlternate(t),b.datepicker._updateDatepicker(t))}catch(e){}return!0},_showDatepicker:function(e){var t,a,i,s,r,n,d;"input"!==(e=e.target||e).nodeName.toLowerCase()&&(e=b("input",e.parentNode)[0]),b.datepicker._isDisabledDatepicker(e)||b.datepicker._lastInput===e||(t=b.datepicker._getInst(e),b.datepicker._curInst&&b.datepicker._curInst!==t&&(b.datepicker._curInst.dpDiv.stop(!0,!0),t&&b.datepicker._datepickerShowing&&b.datepicker._hideDatepicker(b.datepicker._curInst.input[0])),!1!==(i=(a=b.datepicker._get(t,"beforeShow"))?a.apply(e,[e,t]):{})&&(h(t.settings,i),t.lastVal=null,b.datepicker._lastInput=e,b.datepicker._setDateFromField(t),b.datepicker._inDialog&&(e.value=""),b.datepicker._pos||(b.datepicker._pos=b.datepicker._findPos(e),b.datepicker._pos[1]+=e.offsetHeight),s=!1,b(e).parents().each(function(){return!(s|="fixed"===b(this).css("position"))}),r={left:b.datepicker._pos[0],top:b.datepicker._pos[1]},b.datepicker._pos=null,t.dpDiv.empty(),t.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),b.datepicker._updateDatepicker(t),r=b.datepicker._checkOffset(t,r,s),t.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":s?"fixed":"absolute",display:"none",left:r.left+"px",top:r.top+"px"}),t.inline||(n=b.datepicker._get(t,"showAnim"),d=b.datepicker._get(t,"duration"),t.dpDiv.css("z-index",function(e){for(var t,a;e.length&&e[0]!==document;){if(("absolute"===(t=e.css("position"))||"relative"===t||"fixed"===t)&&(a=parseInt(e.css("zIndex"),10),!isNaN(a)&&0!==a))return a;e=e.parent()}return 0}(b(e))+1),b.datepicker._datepickerShowing=!0,b.effects&&b.effects.effect[n]?t.dpDiv.show(n,b.datepicker._get(t,"showOptions"),d):t.dpDiv[n||"show"](n?d:null),b.datepicker._shouldFocusInput(t)&&t.input.focus(),b.datepicker._curInst=t)))},_updateDatepicker:function(e){this.maxRows=4,(r=e).dpDiv.empty().append(this._generateHTML(e)),this._attachHandlers(e);var t,a=this._getNumberOfMonths(e),i=a[1],s=e.dpDiv.find("."+this._dayOverClass+" a");0<s.length&&n.apply(s.get(0)),e.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),1<i&&e.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"),e.dpDiv[(1!==a[0]||1!==a[1]?"add":"remove")+"Class"]("ui-datepicker-multi"),e.dpDiv[(this._get(e,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),e===b.datepicker._curInst&&b.datepicker._datepickerShowing&&b.datepicker._shouldFocusInput(e)&&e.input.focus(),e.yearshtml&&(t=e.yearshtml,setTimeout(function(){t===e.yearshtml&&e.yearshtml&&e.dpDiv.find("select.ui-datepicker-year:first").replaceWith(e.yearshtml),t=e.yearshtml=null},0))},_shouldFocusInput:function(e){return e.input&&e.input.is(":visible")&&!e.input.is(":disabled")&&!e.input.is(":focus")},_checkOffset:function(e,t,a){var i=e.dpDiv.outerWidth(),s=e.dpDiv.outerHeight(),r=e.input?e.input.outerWidth():0,n=e.input?e.input.outerHeight():0,d=document.documentElement.clientWidth+(a?0:b(document).scrollLeft()),c=document.documentElement.clientHeight+(a?0:b(document).scrollTop());return t.left-=this._get(e,"isRTL")?i-r:0,t.left-=a&&t.left===e.input.offset().left?b(document).scrollLeft():0,t.top-=a&&t.top===e.input.offset().top+n?b(document).scrollTop():0,t.left-=Math.min(t.left,t.left+i>d&&i<d?Math.abs(t.left+i-d):0),t.top-=Math.min(t.top,t.top+s>c&&s<c?Math.abs(s+n):0),t},_findPos:function(e){for(var t,a=this._getInst(e),i=this._get(a,"isRTL");e&&("hidden"===e.type||1!==e.nodeType||b.expr.filters.hidden(e));)e=e[i?"previousSibling":"nextSibling"];return[(t=b(e).offset()).left,t.top]},_hideDatepicker:function(e){var t,a,i,s,r=this._curInst;!r||e&&r!==b.data(e,"datepicker")||this._datepickerShowing&&(t=this._get(r,"showAnim"),a=this._get(r,"duration"),i=function(){b.datepicker._tidyDialog(r)},b.effects&&(b.effects.effect[t]||b.effects[t])?r.dpDiv.hide(t,b.datepicker._get(r,"showOptions"),a,i):r.dpDiv["slideDown"===t?"slideUp":"fadeIn"===t?"fadeOut":"hide"](t?a:null,i),t||i(),this._datepickerShowing=!1,(s=this._get(r,"onClose"))&&s.apply(r.input?r.input[0]:null,[r.input?r.input.val():"",r]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),b.blockUI&&(b.unblockUI(),b("body").append(this.dpDiv))),this._inDialog=!1)},_tidyDialog:function(e){e.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")},_checkExternalClick:function(e){if(b.datepicker._curInst){var t=b(e.target),a=b.datepicker._getInst(t[0]);(t[0].id===b.datepicker._mainDivId||0!==t.parents("#"+b.datepicker._mainDivId).length||t.hasClass(b.datepicker.markerClassName)||t.closest("."+b.datepicker._triggerClass).length||!b.datepicker._datepickerShowing||b.datepicker._inDialog&&b.blockUI)&&(!t.hasClass(b.datepicker.markerClassName)||b.datepicker._curInst===a)||b.datepicker._hideDatepicker()}},_adjustDate:function(e,t,a){var i=b(e),s=this._getInst(i[0]);this._isDisabledDatepicker(i[0])||(this._adjustInstDate(s,t+("M"===a?this._get(s,"showCurrentAtPos"):0),a),this._updateDatepicker(s))},_gotoToday:function(e){var t,a=b(e),i=this._getInst(a[0]);this._get(i,"gotoCurrent")&&i.currentDay?(i.selectedDay=i.currentDay,i.drawMonth=i.selectedMonth=i.currentMonth,i.drawYear=i.selectedYear=i.currentYear):(t=new Date,i.selectedDay=t.getDate(),i.drawMonth=i.selectedMonth=t.getMonth(),i.drawYear=i.selectedYear=t.getFullYear()),this._notifyChange(i),this._adjustDate(a)},_selectMonthYear:function(e,t,a){var i=b(e),s=this._getInst(i[0]);s["selected"+("M"===a?"Month":"Year")]=s["draw"+("M"===a?"Month":"Year")]=parseInt(t.options[t.selectedIndex].value,10),this._notifyChange(s),this._adjustDate(i)},_selectDay:function(e,t,a,i){var s,r=b(e);b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(r[0])||((s=this._getInst(r[0])).selectedDay=s.currentDay=b("a",i).html(),s.selectedMonth=s.currentMonth=t,s.selectedYear=s.currentYear=a,this._selectDate(e,this._formatDate(s,s.currentDay,s.currentMonth,s.currentYear)))},_clearDate:function(e){var t=b(e);this._selectDate(t,"")},_selectDate:function(e,t){var a,i=b(e),s=this._getInst(i[0]);t=null!=t?t:this._formatDate(s),s.input&&s.input.val(t),this._updateAlternate(s),(a=this._get(s,"onSelect"))?a.apply(s.input?s.input[0]:null,[t,s]):s.input&&s.input.trigger("change"),s.inline?this._updateDatepicker(s):(this._hideDatepicker(),this._lastInput=s.input[0],"object"!=typeof s.input[0]&&s.input.focus(),this._lastInput=null)},_updateAlternate:function(e){var t,a,i,s=this._get(e,"altField");s&&(t=this._get(e,"altFormat")||this._get(e,"dateFormat"),a=this._getDate(e),i=this.formatDate(t,a,this._getFormatConfig(e)),b(s).each(function(){b(this).val(i)}))},noWeekends:function(e){var t=e.getDay();return[0<t&&t<6,""]},iso8601Week:function(e){var t,a=new Date(e.getTime());return a.setDate(a.getDate()+4-(a.getDay()||7)),t=a.getTime(),a.setMonth(0),a.setDate(1),Math.floor(Math.round((t-a)/864e5)/7)+1},parseDate:function(a,r,e){if(null==a||null==r)throw"Invalid arguments";if(""===(r="object"==typeof r?r.toString():r+""))return null;function n(e){var t=d+1<a.length&&a.charAt(d+1)===e;return t&&d++,t}function t(e){var t=n(e),a="@"===e?14:"!"===e?20:"y"===e&&t?4:"o"===e?3:2,i=new RegExp("^\\d{"+("y"===e?a:1)+","+a+"}"),s=r.substring(h).match(i);if(!s)throw"Missing number at position "+h;return h+=s[0].length,parseInt(s[0],10)}function i(e,t,a){var i=-1,s=b.map(n(e)?a:t,function(e,t){return[[t,e]]}).sort(function(e,t){return-(e[1].length-t[1].length)});if(b.each(s,function(e,t){var a=t[1];if(r.substr(h,a.length).toLowerCase()===a.toLowerCase())return i=t[0],h+=a.length,!1}),-1!==i)return i+1;throw"Unknown name at position "+h}function s(){if(r.charAt(h)!==a.charAt(d))throw"Unexpected literal at position "+h;h++}var d,c,o,l,h=0,u=(e?e.shortYearCutoff:null)||this._defaults.shortYearCutoff,p="string"!=typeof u?u:(new Date).getFullYear()%100+parseInt(u,10),g=(e?e.dayNamesShort:null)||this._defaults.dayNamesShort,_=(e?e.dayNames:null)||this._defaults.dayNames,f=(e?e.monthNamesShort:null)||this._defaults.monthNamesShort,k=(e?e.monthNames:null)||this._defaults.monthNames,D=-1,m=-1,y=-1,v=-1,M=!1;for(d=0;d<a.length;d++)if(M)"'"!==a.charAt(d)||n("'")?s():M=!1;else switch(a.charAt(d)){case"d":y=t("d");break;case"D":i("D",g,_);break;case"o":v=t("o");break;case"m":m=t("m");break;case"M":m=i("M",f,k);break;case"y":D=t("y");break;case"@":D=(l=new Date(t("@"))).getFullYear(),m=l.getMonth()+1,y=l.getDate();break;case"!":D=(l=new Date((t("!")-this._ticksTo1970)/1e4)).getFullYear(),m=l.getMonth()+1,y=l.getDate();break;case"'":n("'")?s():M=!0;break;default:s()}if(h<r.length&&(o=r.substr(h),!/^\s+/.test(o)))throw"Extra/unparsed characters found in date: "+o;if(-1===D?D=(new Date).getFullYear():D<100&&(D+=(new Date).getFullYear()-(new Date).getFullYear()%100+(D<=p?0:-100)),-1<v)for(m=1,y=v;;){if(y<=(c=this._getDaysInMonth(D,m-1)))break;m++,y-=c}if((l=this._daylightSavingAdjust(new Date(D,m-1,y))).getFullYear()!==D||l.getMonth()+1!==m||l.getDate()!==y)throw"Invalid date";return l},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:24*(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*60*60*1e7,formatDate:function(a,e,t){if(!e)return"";function s(e){var t=n+1<a.length&&a.charAt(n+1)===e;return t&&n++,t}function i(e,t,a){var i=""+t;if(s(e))for(;i.length<a;)i="0"+i;return i}function r(e,t,a,i){return s(e)?i[t]:a[t]}var n,d=(t?t.dayNamesShort:null)||this._defaults.dayNamesShort,c=(t?t.dayNames:null)||this._defaults.dayNames,o=(t?t.monthNamesShort:null)||this._defaults.monthNamesShort,l=(t?t.monthNames:null)||this._defaults.monthNames,h="",u=!1;if(e)for(n=0;n<a.length;n++)if(u)"'"!==a.charAt(n)||s("'")?h+=a.charAt(n):u=!1;else switch(a.charAt(n)){case"d":h+=i("d",e.getDate(),2);break;case"D":h+=r("D",e.getDay(),d,c);break;case"o":h+=i("o",Math.round((new Date(e.getFullYear(),e.getMonth(),e.getDate()).getTime()-new Date(e.getFullYear(),0,0).getTime())/864e5),3);break;case"m":h+=i("m",e.getMonth()+1,2);break;case"M":h+=r("M",e.getMonth(),o,l);break;case"y":h+=s("y")?e.getFullYear():(e.getYear()%100<10?"0":"")+e.getYear()%100;break;case"@":h+=e.getTime();break;case"!":h+=1e4*e.getTime()+this._ticksTo1970;break;case"'":s("'")?h+="'":u=!0;break;default:h+=a.charAt(n)}return h},_possibleChars:function(a){function e(e){var t=i+1<a.length&&a.charAt(i+1)===e;return t&&i++,t}var i,t="",s=!1;for(i=0;i<a.length;i++)if(s)"'"!==a.charAt(i)||e("'")?t+=a.charAt(i):s=!1;else switch(a.charAt(i)){case"d":case"m":case"y":case"@":t+="0123456789";break;case"D":case"M":return null;case"'":e("'")?t+="'":s=!0;break;default:t+=a.charAt(i)}return t},_get:function(e,t){return void 0!==e.settings[t]?e.settings[t]:this._defaults[t]},_setDateFromField:function(e,t){if(e.input.val()!==e.lastVal){var a=this._get(e,"dateFormat"),i=e.lastVal=e.input?e.input.val():null,s=this._getDefaultDate(e),r=s,n=this._getFormatConfig(e);try{r=this.parseDate(a,i,n)||s}catch(e){i=t?"":i}e.selectedDay=r.getDate(),e.drawMonth=e.selectedMonth=r.getMonth(),e.drawYear=e.selectedYear=r.getFullYear(),e.currentDay=i?r.getDate():0,e.currentMonth=i?r.getMonth():0,e.currentYear=i?r.getFullYear():0,this._adjustInstDate(e)}},_getDefaultDate:function(e){return this._restrictMinMax(e,this._determineDate(e,this._get(e,"defaultDate"),new Date))},_determineDate:function(d,e,t){var a,i,s=null==e||""===e?t:"string"==typeof e?function(e){try{return b.datepicker.parseDate(b.datepicker._get(d,"dateFormat"),e,b.datepicker._getFormatConfig(d))}catch(e){}for(var t=(e.toLowerCase().match(/^c/)?b.datepicker._getDate(d):null)||new Date,a=t.getFullYear(),i=t.getMonth(),s=t.getDate(),r=/([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,n=r.exec(e);n;){switch(n[2]||"d"){case"d":case"D":s+=parseInt(n[1],10);break;case"w":case"W":s+=7*parseInt(n[1],10);break;case"m":case"M":i+=parseInt(n[1],10),s=Math.min(s,b.datepicker._getDaysInMonth(a,i));break;case"y":case"Y":a+=parseInt(n[1],10),s=Math.min(s,b.datepicker._getDaysInMonth(a,i))}n=r.exec(e)}return new Date(a,i,s)}(e):"number"==typeof e?isNaN(e)?t:(a=e,(i=new Date).setDate(i.getDate()+a),i):new Date(e.getTime());return(s=s&&"Invalid Date"===s.toString()?t:s)&&(s.setHours(0),s.setMinutes(0),s.setSeconds(0),s.setMilliseconds(0)),this._daylightSavingAdjust(s)},_daylightSavingAdjust:function(e){return e?(e.setHours(12<e.getHours()?e.getHours()+2:0),e):null},_setDate:function(e,t,a){var i=!t,s=e.selectedMonth,r=e.selectedYear,n=this._restrictMinMax(e,this._determineDate(e,t,new Date));e.selectedDay=e.currentDay=n.getDate(),e.drawMonth=e.selectedMonth=e.currentMonth=n.getMonth(),e.drawYear=e.selectedYear=e.currentYear=n.getFullYear(),s===e.selectedMonth&&r===e.selectedYear||a||this._notifyChange(e),this._adjustInstDate(e),e.input&&e.input.val(i?"":this._formatDate(e))},_getDate:function(e){return!e.currentYear||e.input&&""===e.input.val()?null:this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay))},_attachHandlers:function(e){var t=this._get(e,"stepMonths"),a="#"+e.id.replace(/\\\\/g,"\\");e.dpDiv.find("[data-handler]").map(function(){var e={prev:function(){b.datepicker._adjustDate(a,-t,"M")},next:function(){b.datepicker._adjustDate(a,+t,"M")},hide:function(){b.datepicker._hideDatepicker()},today:function(){b.datepicker._gotoToday(a)},selectDay:function(){return b.datepicker._selectDay(a,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return b.datepicker._selectMonthYear(a,this,"M"),!1},selectYear:function(){return b.datepicker._selectMonthYear(a,this,"Y"),!1}};b(this).bind(this.getAttribute("data-event"),e[this.getAttribute("data-handler")])})},_generateHTML:function(e){var t,a,i,s,r,n,d,c,o,l,h,u,p,g,_,f,k,D,m,y,v,M,b,w,C,I,x,Y,S,N,F,T,A,K,j,O,R,L,W,E=new Date,H=this._daylightSavingAdjust(new Date(E.getFullYear(),E.getMonth(),E.getDate())),P=this._get(e,"isRTL"),U=this._get(e,"showButtonPanel"),z=this._get(e,"hideIfNoPrevNext"),B=this._get(e,"navigationAsDateFormat"),J=this._getNumberOfMonths(e),V=this._get(e,"showCurrentAtPos"),q=this._get(e,"stepMonths"),Q=1!==J[0]||1!==J[1],X=this._daylightSavingAdjust(e.currentDay?new Date(e.currentYear,e.currentMonth,e.currentDay):new Date(9999,9,9)),Z=this._getMinMaxDate(e,"min"),$=this._getMinMaxDate(e,"max"),G=e.drawMonth-V,ee=e.drawYear;if(G<0&&(G+=12,ee--),$)for(t=this._daylightSavingAdjust(new Date($.getFullYear(),$.getMonth()-J[0]*J[1]+1,$.getDate())),t=Z&&t<Z?Z:t;this._daylightSavingAdjust(new Date(ee,G,1))>t;)--G<0&&(G=11,ee--);for(e.drawMonth=G,e.drawYear=ee,a=this._get(e,"prevText"),a=B?this.formatDate(a,this._daylightSavingAdjust(new Date(ee,G-q,1)),this._getFormatConfig(e)):a,i=this._canAdjustMonth(e,-1,ee,G)?"<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click' title='"+a+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"e":"w")+"'>"+a+"</span></a>":z?"":"<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='"+a+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"e":"w")+"'>"+a+"</span></a>",s=this._get(e,"nextText"),s=B?this.formatDate(s,this._daylightSavingAdjust(new Date(ee,G+q,1)),this._getFormatConfig(e)):s,r=this._canAdjustMonth(e,1,ee,G)?"<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click' title='"+s+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"w":"e")+"'>"+s+"</span></a>":z?"":"<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='"+s+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"w":"e")+"'>"+s+"</span></a>",n=this._get(e,"currentText"),d=this._get(e,"gotoCurrent")&&e.currentDay?X:H,n=B?this.formatDate(n,d,this._getFormatConfig(e)):n,c=e.inline?"":"<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>"+this._get(e,"closeText")+"</button>",o=U?"<div class='ui-datepicker-buttonpane ui-widget-content'>"+(P?c:"")+(this._isInRange(e,d)?"<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'>"+n+"</button>":"")+(P?"":c)+"</div>":"",l=parseInt(this._get(e,"firstDay"),10),l=isNaN(l)?0:l,h=this._get(e,"showWeek"),u=this._get(e,"dayNames"),p=this._get(e,"dayNamesMin"),g=this._get(e,"monthNames"),_=this._get(e,"monthNamesShort"),f=this._get(e,"beforeShowDay"),k=this._get(e,"showOtherMonths"),D=this._get(e,"selectOtherMonths"),m=this._getDefaultDate(e),y="",M=0;M<J[0];M++){for(b="",this.maxRows=4,w=0;w<J[1];w++){if(C=this._daylightSavingAdjust(new Date(ee,G,e.selectedDay)),I=" ui-corner-all",x="",Q){if(x+="<div class='ui-datepicker-group",1<J[1])switch(w){case 0:x+=" ui-datepicker-group-first",I=" ui-corner-"+(P?"right":"left");break;case J[1]-1:x+=" ui-datepicker-group-last",I=" ui-corner-"+(P?"left":"right");break;default:x+=" ui-datepicker-group-middle",I=""}x+="'>"}for(x+="<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix"+I+"'>"+(/all|left/.test(I)&&0===M?P?r:i:"")+(/all|right/.test(I)&&0===M?P?i:r:"")+this._generateMonthYearHeader(e,G,ee,Z,$,0<M||0<w,g,_)+"</div><table class='ui-datepicker-calendar'><thead><tr>",Y=h?"<th class='ui-datepicker-week-col'>"+this._get(e,"weekHeader")+"</th>":"",v=0;v<7;v++)Y+="<th scope='col'"+(5<=(v+l+6)%7?" class='ui-datepicker-week-end'":"")+"><span title='"+u[S=(v+l)%7]+"'>"+p[S]+"</span></th>";for(x+=Y+"</tr></thead><tbody>",N=this._getDaysInMonth(ee,G),ee===e.selectedYear&&G===e.selectedMonth&&(e.selectedDay=Math.min(e.selectedDay,N)),F=(this._getFirstDayOfMonth(ee,G)-l+7)%7,T=Math.ceil((F+N)/7),A=Q&&this.maxRows>T?this.maxRows:T,this.maxRows=A,K=this._daylightSavingAdjust(new Date(ee,G,1-F)),j=0;j<A;j++){for(x+="<tr>",O=h?"<td class='ui-datepicker-week-col'>"+this._get(e,"calculateWeek")(K)+"</td>":"",v=0;v<7;v++)R=f?f.apply(e.input?e.input[0]:null,[K]):[!0,""],W=(L=K.getMonth()!==G)&&!D||!R[0]||Z&&K<Z||$&&$<K,O+="<td class='"+(5<=(v+l+6)%7?" ui-datepicker-week-end":"")+(L?" ui-datepicker-other-month":"")+(K.getTime()===C.getTime()&&G===e.selectedMonth&&e._keyEvent||m.getTime()===K.getTime()&&m.getTime()===C.getTime()?" "+this._dayOverClass:"")+(W?" "+this._unselectableClass+" ui-state-disabled":"")+(L&&!k?"":" "+R[1]+(K.getTime()===X.getTime()?" "+this._currentClass:"")+(K.getTime()===H.getTime()?" ui-datepicker-today":""))+"'"+(L&&!k||!R[2]?"":" title='"+R[2].replace(/'/g,"&#39;")+"'")+(W?"":" data-handler='selectDay' data-event='click' data-month='"+K.getMonth()+"' data-year='"+K.getFullYear()+"'")+">"+(L&&!k?"&#xa0;":W?"<span class='ui-state-default'>"+K.getDate()+"</span>":"<a class='ui-state-default"+(K.getTime()===H.getTime()?" ui-state-highlight":"")+(K.getTime()===X.getTime()?" ui-state-active":"")+(L?" ui-priority-secondary":"")+"' href='#'>"+K.getDate()+"</a>")+"</td>",K.setDate(K.getDate()+1),K=this._daylightSavingAdjust(K);x+=O+"</tr>"}11<++G&&(G=0,ee++),b+=x+="</tbody></table>"+(Q?"</div>"+(0<J[0]&&w===J[1]-1?"<div class='ui-datepicker-row-break'></div>":""):"")}y+=b}return y+=o,e._keyEvent=!1,y},_generateMonthYearHeader:function(e,t,a,i,s,r,n,d){var c,o,l,h,u,p,g,_,f=this._get(e,"changeMonth"),k=this._get(e,"changeYear"),D=this._get(e,"showMonthAfterYear"),m="<div class='ui-datepicker-title'>",y="";if(r||!f)y+="<span class='ui-datepicker-month'>"+n[t]+"</span>";else{for(c=i&&i.getFullYear()===a,o=s&&s.getFullYear()===a,y+="<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>",l=0;l<12;l++)(!c||l>=i.getMonth())&&(!o||l<=s.getMonth())&&(y+="<option value='"+l+"'"+(l===t?" selected='selected'":"")+">"+d[l]+"</option>");y+="</select>"}if(D||(m+=y+(!r&&f&&k?"":"&#xa0;")),!e.yearshtml)if(e.yearshtml="",r||!k)m+="<span class='ui-datepicker-year'>"+a+"</span>";else{for(h=this._get(e,"yearRange").split(":"),u=(new Date).getFullYear(),g=(p=function(e){var t=e.match(/c[+\-].*/)?a+parseInt(e.substring(1),10):e.match(/[+\-].*/)?u+parseInt(e,10):parseInt(e,10);return isNaN(t)?u:t})(h[0]),_=Math.max(g,p(h[1]||"")),g=i?Math.max(g,i.getFullYear()):g,_=s?Math.min(_,s.getFullYear()):_,e.yearshtml+="<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";g<=_;g++)e.yearshtml+="<option value='"+g+"'"+(g===a?" selected='selected'":"")+">"+g+"</option>";e.yearshtml+="</select>",m+=e.yearshtml,e.yearshtml=null}return m+=this._get(e,"yearSuffix"),D&&(m+=(!r&&f&&k?"":"&#xa0;")+y),m+="</div>"},_adjustInstDate:function(e,t,a){var i=e.drawYear+("Y"===a?t:0),s=e.drawMonth+("M"===a?t:0),r=Math.min(e.selectedDay,this._getDaysInMonth(i,s))+("D"===a?t:0),n=this._restrictMinMax(e,this._daylightSavingAdjust(new Date(i,s,r)));e.selectedDay=n.getDate(),e.drawMonth=e.selectedMonth=n.getMonth(),e.drawYear=e.selectedYear=n.getFullYear(),"M"!==a&&"Y"!==a||this._notifyChange(e)},_restrictMinMax:function(e,t){var a=this._getMinMaxDate(e,"min"),i=this._getMinMaxDate(e,"max"),s=a&&t<a?a:t;return i&&i<s?i:s},_notifyChange:function(e){var t=this._get(e,"onChangeMonthYear");t&&t.apply(e.input?e.input[0]:null,[e.selectedYear,e.selectedMonth+1,e])},_getNumberOfMonths:function(e){var t=this._get(e,"numberOfMonths");return null==t?[1,1]:"number"==typeof t?[1,t]:t},_getMinMaxDate:function(e,t){return this._determineDate(e,this._get(e,t+"Date"),null)},_getDaysInMonth:function(e,t){return 32-this._daylightSavingAdjust(new Date(e,t,32)).getDate()},_getFirstDayOfMonth:function(e,t){return new Date(e,t,1).getDay()},_canAdjustMonth:function(e,t,a,i){var s=this._getNumberOfMonths(e),r=this._daylightSavingAdjust(new Date(a,i+(t<0?t:s[0]*s[1]),1));return t<0&&r.setDate(this._getDaysInMonth(r.getFullYear(),r.getMonth())),this._isInRange(e,r)},_isInRange:function(e,t){var a,i,s=this._getMinMaxDate(e,"min"),r=this._getMinMaxDate(e,"max"),n=null,d=null,c=this._get(e,"yearRange");return c&&(a=c.split(":"),i=(new Date).getFullYear(),n=parseInt(a[0],10),d=parseInt(a[1],10),a[0].match(/[+\-].*/)&&(n+=i),a[1].match(/[+\-].*/)&&(d+=i)),(!s||t.getTime()>=s.getTime())&&(!r||t.getTime()<=r.getTime())&&(!n||t.getFullYear()>=n)&&(!d||t.getFullYear()<=d)},_getFormatConfig:function(e){var t=this._get(e,"shortYearCutoff");return{shortYearCutoff:t="string"!=typeof t?t:(new Date).getFullYear()%100+parseInt(t,10),dayNamesShort:this._get(e,"dayNamesShort"),dayNames:this._get(e,"dayNames"),monthNamesShort:this._get(e,"monthNamesShort"),monthNames:this._get(e,"monthNames")}},_formatDate:function(e,t,a,i){t||(e.currentDay=e.selectedDay,e.currentMonth=e.selectedMonth,e.currentYear=e.selectedYear);var s=t?"object"==typeof t?t:this._daylightSavingAdjust(new Date(i,a,t)):this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay));return this.formatDate(this._get(e,"dateFormat"),s,this._getFormatConfig(e))}}),b.fn.datepicker=function(e){if(!this.length)return this;b.datepicker.initialized||(b(document).mousedown(b.datepicker._checkExternalClick),b.datepicker.initialized=!0),0===b("#"+b.datepicker._mainDivId).length&&b("body").append(b.datepicker.dpDiv);var t=Array.prototype.slice.call(arguments,1);return"string"!=typeof e||"isDisabled"!==e&&"getDate"!==e&&"widget"!==e?"option"===e&&2===arguments.length&&"string"==typeof arguments[1]?b.datepicker["_"+e+"Datepicker"].apply(b.datepicker,[this[0]].concat(t)):this.each(function(){"string"==typeof e?b.datepicker["_"+e+"Datepicker"].apply(b.datepicker,[this].concat(t)):b.datepicker._attachDatepicker(this,e)}):b.datepicker["_"+e+"Datepicker"].apply(b.datepicker,[this[0]].concat(t))},b.datepicker=new e,b.datepicker.initialized=!1,b.datepicker.uuid=(new Date).getTime(),b.datepicker.version="1.11.4",b.datepicker});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(b){var r;function e(){this._curInst=null,this._keyEvent=!1,this._disabledInputs=[],this._datepickerShowing=!1,this._inDialog=!1,this._mainDivId="ui-datepicker-div",this._inlineClass="ui-datepicker-inline",this._appendClass="ui-datepicker-append",this._triggerClass="ui-datepicker-trigger",this._dialogClass="ui-datepicker-dialog",this._disableClass="ui-datepicker-disabled",this._unselectableClass="ui-datepicker-unselectable",this._currentClass="ui-datepicker-current-day",this._dayOverClass="ui-datepicker-days-cell-over",this.regional=[],this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su","Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:!1,showMonthAfterYear:!1,yearSuffix:""},this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:!1,hideIfNoPrevNext:!1,navigationAsDateFormat:!1,gotoCurrent:!1,changeMonth:!1,changeYear:!1,yearRange:"c-10:c+10",showOtherMonths:!1,selectOtherMonths:!1,showWeek:!1,calculateWeek:this.iso8601Week,shortYearCutoff:"+10",minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:!0,showButtonPanel:!1,autoSize:!1,disabled:!1},b.extend(this._defaults,this.regional[""]),this.regional.en=b.extend(!0,{},this.regional[""]),this.regional["en-US"]=b.extend(!0,{},this.regional.en),this.dpDiv=a(b("<div id='"+this._mainDivId+"' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"))}function a(e){var t="button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a";return e.on("mouseout",t,function(){b(this).removeClass("ui-state-hover"),-1!==this.className.indexOf("ui-datepicker-prev")&&b(this).removeClass("ui-datepicker-prev-hover"),-1!==this.className.indexOf("ui-datepicker-next")&&b(this).removeClass("ui-datepicker-next-hover")}).on("mouseover",t,n)}function n(){b.datepicker._isDisabledDatepicker(r.inline?r.dpDiv.parent()[0]:r.input[0])||(b(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"),b(this).addClass("ui-state-hover"),-1!==this.className.indexOf("ui-datepicker-prev")&&b(this).addClass("ui-datepicker-prev-hover"),-1!==this.className.indexOf("ui-datepicker-next")&&b(this).addClass("ui-datepicker-next-hover"))}function h(e,t){for(var a in b.extend(e,t),t)null==t[a]&&(e[a]=t[a]);return e}return b.extend(b.ui,{datepicker:{version:"1.12.1"}}),b.extend(e.prototype,{markerClassName:"hasDatepicker",maxRows:4,_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(e){return h(this._defaults,e||{}),this},_attachDatepicker:function(e,t){var a,i,s;i="div"===(a=e.nodeName.toLowerCase())||"span"===a,e.id||(this.uuid+=1,e.id="dp"+this.uuid),(s=this._newInst(b(e),i)).settings=b.extend({},t||{}),"input"===a?this._connectDatepicker(e,s):i&&this._inlineDatepicker(e,s)},_newInst:function(e,t){return{id:e[0].id.replace(/([^A-Za-z0-9_\-])/g,"\\\\$1"),input:e,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:t,dpDiv:t?a(b("<div class='"+this._inlineClass+" ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")):this.dpDiv}},_connectDatepicker:function(e,t){var a=b(e);t.append=b([]),t.trigger=b([]),a.hasClass(this.markerClassName)||(this._attachments(a,t),a.addClass(this.markerClassName).on("keydown",this._doKeyDown).on("keypress",this._doKeyPress).on("keyup",this._doKeyUp),this._autoSize(t),b.data(e,"datepicker",t),t.settings.disabled&&this._disableDatepicker(e))},_attachments:function(e,t){var a,i,s,r=this._get(t,"appendText"),n=this._get(t,"isRTL");t.append&&t.append.remove(),r&&(t.append=b("<span class='"+this._appendClass+"'>"+r+"</span>"),e[n?"before":"after"](t.append)),e.off("focus",this._showDatepicker),t.trigger&&t.trigger.remove(),"focus"!==(a=this._get(t,"showOn"))&&"both"!==a||e.on("focus",this._showDatepicker),"button"!==a&&"both"!==a||(i=this._get(t,"buttonText"),s=this._get(t,"buttonImage"),t.trigger=b(this._get(t,"buttonImageOnly")?b("<img/>").addClass(this._triggerClass).attr({src:s,alt:i,title:i}):b("<button type='button'></button>").addClass(this._triggerClass).html(s?b("<img/>").attr({src:s,alt:i,title:i}):i)),e[n?"before":"after"](t.trigger),t.trigger.on("click",function(){return b.datepicker._datepickerShowing&&b.datepicker._lastInput===e[0]?b.datepicker._hideDatepicker():(b.datepicker._datepickerShowing&&b.datepicker._lastInput!==e[0]&&b.datepicker._hideDatepicker(),b.datepicker._showDatepicker(e[0])),!1}))},_autoSize:function(e){if(this._get(e,"autoSize")&&!e.inline){var t,a,i,s,r=new Date(2009,11,20),n=this._get(e,"dateFormat");n.match(/[DM]/)&&(t=function(e){for(s=i=a=0;s<e.length;s++)e[s].length>a&&(a=e[s].length,i=s);return i},r.setMonth(t(this._get(e,n.match(/MM/)?"monthNames":"monthNamesShort"))),r.setDate(t(this._get(e,n.match(/DD/)?"dayNames":"dayNamesShort"))+20-r.getDay())),e.input.attr("size",this._formatDate(e,r).length)}},_inlineDatepicker:function(e,t){var a=b(e);a.hasClass(this.markerClassName)||(a.addClass(this.markerClassName).append(t.dpDiv),b.data(e,"datepicker",t),this._setDate(t,this._getDefaultDate(t),!0),this._updateDatepicker(t),this._updateAlternate(t),t.settings.disabled&&this._disableDatepicker(e),t.dpDiv.css("display","block"))},_dialogDatepicker:function(e,t,a,i,s){var r,n,d,c,o,l=this._dialogInst;return l||(this.uuid+=1,r="dp"+this.uuid,this._dialogInput=b("<input type='text' id='"+r+"' style='position: absolute; top: -100px; width: 0px;'/>"),this._dialogInput.on("keydown",this._doKeyDown),b("body").append(this._dialogInput),(l=this._dialogInst=this._newInst(this._dialogInput,!1)).settings={},b.data(this._dialogInput[0],"datepicker",l)),h(l.settings,i||{}),t=t&&t.constructor===Date?this._formatDate(l,t):t,this._dialogInput.val(t),this._pos=s?s.length?s:[s.pageX,s.pageY]:null,this._pos||(n=document.documentElement.clientWidth,d=document.documentElement.clientHeight,c=document.documentElement.scrollLeft||document.body.scrollLeft,o=document.documentElement.scrollTop||document.body.scrollTop,this._pos=[n/2-100+c,d/2-150+o]),this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px"),l.settings.onSelect=a,this._inDialog=!0,this.dpDiv.addClass(this._dialogClass),this._showDatepicker(this._dialogInput[0]),b.blockUI&&b.blockUI(this.dpDiv),b.data(this._dialogInput[0],"datepicker",l),this},_destroyDatepicker:function(e){var t,a=b(e),i=b.data(e,"datepicker");a.hasClass(this.markerClassName)&&(t=e.nodeName.toLowerCase(),b.removeData(e,"datepicker"),"input"===t?(i.append.remove(),i.trigger.remove(),a.removeClass(this.markerClassName).off("focus",this._showDatepicker).off("keydown",this._doKeyDown).off("keypress",this._doKeyPress).off("keyup",this._doKeyUp)):"div"!==t&&"span"!==t||a.removeClass(this.markerClassName).empty(),r===i&&(r=null))},_enableDatepicker:function(t){var e,a,i=b(t),s=b.data(t,"datepicker");i.hasClass(this.markerClassName)&&("input"===(e=t.nodeName.toLowerCase())?(t.disabled=!1,s.trigger.filter("button").each(function(){this.disabled=!1}).end().filter("img").css({opacity:"1.0",cursor:""})):"div"!==e&&"span"!==e||((a=i.children("."+this._inlineClass)).children().removeClass("ui-state-disabled"),a.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled",!1)),this._disabledInputs=b.map(this._disabledInputs,function(e){return e===t?null:e}))},_disableDatepicker:function(t){var e,a,i=b(t),s=b.data(t,"datepicker");i.hasClass(this.markerClassName)&&("input"===(e=t.nodeName.toLowerCase())?(t.disabled=!0,s.trigger.filter("button").each(function(){this.disabled=!0}).end().filter("img").css({opacity:"0.5",cursor:"default"})):"div"!==e&&"span"!==e||((a=i.children("."+this._inlineClass)).children().addClass("ui-state-disabled"),a.find("select.ui-datepicker-month, select.ui-datepicker-year").prop("disabled",!0)),this._disabledInputs=b.map(this._disabledInputs,function(e){return e===t?null:e}),this._disabledInputs[this._disabledInputs.length]=t)},_isDisabledDatepicker:function(e){if(!e)return!1;for(var t=0;t<this._disabledInputs.length;t++)if(this._disabledInputs[t]===e)return!0;return!1},_getInst:function(e){try{return b.data(e,"datepicker")}catch(e){throw"Missing instance data for this datepicker"}},_optionDatepicker:function(e,t,a){var i,s,r,n,d=this._getInst(e);if(2===arguments.length&&"string"==typeof t)return"defaults"===t?b.extend({},b.datepicker._defaults):d?"all"===t?b.extend({},d.settings):this._get(d,t):null;i=t||{},"string"==typeof t&&((i={})[t]=a),d&&(this._curInst===d&&this._hideDatepicker(),s=this._getDateDatepicker(e,!0),r=this._getMinMaxDate(d,"min"),n=this._getMinMaxDate(d,"max"),h(d.settings,i),null!==r&&void 0!==i.dateFormat&&void 0===i.minDate&&(d.settings.minDate=this._formatDate(d,r)),null!==n&&void 0!==i.dateFormat&&void 0===i.maxDate&&(d.settings.maxDate=this._formatDate(d,n)),"disabled"in i&&(i.disabled?this._disableDatepicker(e):this._enableDatepicker(e)),this._attachments(b(e),d),this._autoSize(d),this._setDate(d,s),this._updateAlternate(d),this._updateDatepicker(d))},_changeDatepicker:function(e,t,a){this._optionDatepicker(e,t,a)},_refreshDatepicker:function(e){var t=this._getInst(e);t&&this._updateDatepicker(t)},_setDateDatepicker:function(e,t){var a=this._getInst(e);a&&(this._setDate(a,t),this._updateDatepicker(a),this._updateAlternate(a))},_getDateDatepicker:function(e,t){var a=this._getInst(e);return a&&!a.inline&&this._setDateFromField(a,t),a?this._getDate(a):null},_doKeyDown:function(e){var t,a,i,s=b.datepicker._getInst(e.target),r=!0,n=s.dpDiv.is(".ui-datepicker-rtl");if(s._keyEvent=!0,b.datepicker._datepickerShowing)switch(e.keyCode){case 9:b.datepicker._hideDatepicker(),r=!1;break;case 13:return(i=b("td."+b.datepicker._dayOverClass+":not(."+b.datepicker._currentClass+")",s.dpDiv))[0]&&b.datepicker._selectDay(e.target,s.selectedMonth,s.selectedYear,i[0]),(t=b.datepicker._get(s,"onSelect"))?(a=b.datepicker._formatDate(s),t.apply(s.input?s.input[0]:null,[a,s])):b.datepicker._hideDatepicker(),!1;case 27:b.datepicker._hideDatepicker();break;case 33:b.datepicker._adjustDate(e.target,e.ctrlKey?-b.datepicker._get(s,"stepBigMonths"):-b.datepicker._get(s,"stepMonths"),"M");break;case 34:b.datepicker._adjustDate(e.target,e.ctrlKey?+b.datepicker._get(s,"stepBigMonths"):+b.datepicker._get(s,"stepMonths"),"M");break;case 35:(e.ctrlKey||e.metaKey)&&b.datepicker._clearDate(e.target),r=e.ctrlKey||e.metaKey;break;case 36:(e.ctrlKey||e.metaKey)&&b.datepicker._gotoToday(e.target),r=e.ctrlKey||e.metaKey;break;case 37:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,n?1:-1,"D"),r=e.ctrlKey||e.metaKey,e.originalEvent.altKey&&b.datepicker._adjustDate(e.target,e.ctrlKey?-b.datepicker._get(s,"stepBigMonths"):-b.datepicker._get(s,"stepMonths"),"M");break;case 38:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,-7,"D"),r=e.ctrlKey||e.metaKey;break;case 39:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,n?-1:1,"D"),r=e.ctrlKey||e.metaKey,e.originalEvent.altKey&&b.datepicker._adjustDate(e.target,e.ctrlKey?+b.datepicker._get(s,"stepBigMonths"):+b.datepicker._get(s,"stepMonths"),"M");break;case 40:(e.ctrlKey||e.metaKey)&&b.datepicker._adjustDate(e.target,7,"D"),r=e.ctrlKey||e.metaKey;break;default:r=!1}else 36===e.keyCode&&e.ctrlKey?b.datepicker._showDatepicker(this):r=!1;r&&(e.preventDefault(),e.stopPropagation())},_doKeyPress:function(e){var t,a,i=b.datepicker._getInst(e.target);if(b.datepicker._get(i,"constrainInput"))return t=b.datepicker._possibleChars(b.datepicker._get(i,"dateFormat")),a=String.fromCharCode(null==e.charCode?e.keyCode:e.charCode),e.ctrlKey||e.metaKey||a<" "||!t||-1<t.indexOf(a)},_doKeyUp:function(e){var t=b.datepicker._getInst(e.target);if(t.input.val()!==t.lastVal)try{b.datepicker.parseDate(b.datepicker._get(t,"dateFormat"),t.input?t.input.val():null,b.datepicker._getFormatConfig(t))&&(b.datepicker._setDateFromField(t),b.datepicker._updateAlternate(t),b.datepicker._updateDatepicker(t))}catch(e){}return!0},_showDatepicker:function(e){var t,a,i,s,r,n,d;"input"!==(e=e.target||e).nodeName.toLowerCase()&&(e=b("input",e.parentNode)[0]),b.datepicker._isDisabledDatepicker(e)||b.datepicker._lastInput===e||(t=b.datepicker._getInst(e),b.datepicker._curInst&&b.datepicker._curInst!==t&&(b.datepicker._curInst.dpDiv.stop(!0,!0),t&&b.datepicker._datepickerShowing&&b.datepicker._hideDatepicker(b.datepicker._curInst.input[0])),!1!==(i=(a=b.datepicker._get(t,"beforeShow"))?a.apply(e,[e,t]):{})&&(h(t.settings,i),t.lastVal=null,b.datepicker._lastInput=e,b.datepicker._setDateFromField(t),b.datepicker._inDialog&&(e.value=""),b.datepicker._pos||(b.datepicker._pos=b.datepicker._findPos(e),b.datepicker._pos[1]+=e.offsetHeight),s=!1,b(e).parents().each(function(){return!(s|="fixed"===b(this).css("position"))}),r={left:b.datepicker._pos[0],top:b.datepicker._pos[1]},b.datepicker._pos=null,t.dpDiv.empty(),t.dpDiv.css({position:"absolute",display:"block",top:"-1000px"}),b.datepicker._updateDatepicker(t),r=b.datepicker._checkOffset(t,r,s),t.dpDiv.css({position:b.datepicker._inDialog&&b.blockUI?"static":s?"fixed":"absolute",display:"none",left:r.left+"px",top:r.top+"px"}),t.inline||(n=b.datepicker._get(t,"showAnim"),d=b.datepicker._get(t,"duration"),t.dpDiv.css("z-index",function(e){for(var t,a;e.length&&e[0]!==document;){if(("absolute"===(t=e.css("position"))||"relative"===t||"fixed"===t)&&(a=parseInt(e.css("zIndex"),10),!isNaN(a)&&0!==a))return a;e=e.parent()}return 0}(b(e))+1),b.datepicker._datepickerShowing=!0,b.effects&&b.effects.effect[n]?t.dpDiv.show(n,b.datepicker._get(t,"showOptions"),d):t.dpDiv[n||"show"](n?d:null),b.datepicker._shouldFocusInput(t)&&t.input.trigger("focus"),b.datepicker._curInst=t)))},_updateDatepicker:function(e){this.maxRows=4,(r=e).dpDiv.empty().append(this._generateHTML(e)),this._attachHandlers(e);var t,a=this._getNumberOfMonths(e),i=a[1],s=e.dpDiv.find("."+this._dayOverClass+" a");0<s.length&&n.apply(s.get(0)),e.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""),1<i&&e.dpDiv.addClass("ui-datepicker-multi-"+i).css("width",17*i+"em"),e.dpDiv[(1!==a[0]||1!==a[1]?"add":"remove")+"Class"]("ui-datepicker-multi"),e.dpDiv[(this._get(e,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl"),e===b.datepicker._curInst&&b.datepicker._datepickerShowing&&b.datepicker._shouldFocusInput(e)&&e.input.trigger("focus"),e.yearshtml&&(t=e.yearshtml,setTimeout(function(){t===e.yearshtml&&e.yearshtml&&e.dpDiv.find("select.ui-datepicker-year:first").replaceWith(e.yearshtml),t=e.yearshtml=null},0))},_shouldFocusInput:function(e){return e.input&&e.input.is(":visible")&&!e.input.is(":disabled")&&!e.input.is(":focus")},_checkOffset:function(e,t,a){var i=e.dpDiv.outerWidth(),s=e.dpDiv.outerHeight(),r=e.input?e.input.outerWidth():0,n=e.input?e.input.outerHeight():0,d=document.documentElement.clientWidth+(a?0:b(document).scrollLeft()),c=document.documentElement.clientHeight+(a?0:b(document).scrollTop());return t.left-=this._get(e,"isRTL")?i-r:0,t.left-=a&&t.left===e.input.offset().left?b(document).scrollLeft():0,t.top-=a&&t.top===e.input.offset().top+n?b(document).scrollTop():0,t.left-=Math.min(t.left,t.left+i>d&&i<d?Math.abs(t.left+i-d):0),t.top-=Math.min(t.top,t.top+s>c&&s<c?Math.abs(s+n):0),t},_findPos:function(e){for(var t,a=this._getInst(e),i=this._get(a,"isRTL");e&&("hidden"===e.type||1!==e.nodeType||b.expr.filters.hidden(e));)e=e[i?"previousSibling":"nextSibling"];return[(t=b(e).offset()).left,t.top]},_hideDatepicker:function(e){var t,a,i,s,r=this._curInst;!r||e&&r!==b.data(e,"datepicker")||this._datepickerShowing&&(t=this._get(r,"showAnim"),a=this._get(r,"duration"),i=function(){b.datepicker._tidyDialog(r)},b.effects&&(b.effects.effect[t]||b.effects[t])?r.dpDiv.hide(t,b.datepicker._get(r,"showOptions"),a,i):r.dpDiv["slideDown"===t?"slideUp":"fadeIn"===t?"fadeOut":"hide"](t?a:null,i),t||i(),this._datepickerShowing=!1,(s=this._get(r,"onClose"))&&s.apply(r.input?r.input[0]:null,[r.input?r.input.val():"",r]),this._lastInput=null,this._inDialog&&(this._dialogInput.css({position:"absolute",left:"0",top:"-100px"}),b.blockUI&&(b.unblockUI(),b("body").append(this.dpDiv))),this._inDialog=!1)},_tidyDialog:function(e){e.dpDiv.removeClass(this._dialogClass).off(".ui-datepicker-calendar")},_checkExternalClick:function(e){if(b.datepicker._curInst){var t=b(e.target),a=b.datepicker._getInst(t[0]);(t[0].id===b.datepicker._mainDivId||0!==t.parents("#"+b.datepicker._mainDivId).length||t.hasClass(b.datepicker.markerClassName)||t.closest("."+b.datepicker._triggerClass).length||!b.datepicker._datepickerShowing||b.datepicker._inDialog&&b.blockUI)&&(!t.hasClass(b.datepicker.markerClassName)||b.datepicker._curInst===a)||b.datepicker._hideDatepicker()}},_adjustDate:function(e,t,a){var i=b(e),s=this._getInst(i[0]);this._isDisabledDatepicker(i[0])||(this._adjustInstDate(s,t+("M"===a?this._get(s,"showCurrentAtPos"):0),a),this._updateDatepicker(s))},_gotoToday:function(e){var t,a=b(e),i=this._getInst(a[0]);this._get(i,"gotoCurrent")&&i.currentDay?(i.selectedDay=i.currentDay,i.drawMonth=i.selectedMonth=i.currentMonth,i.drawYear=i.selectedYear=i.currentYear):(t=new Date,i.selectedDay=t.getDate(),i.drawMonth=i.selectedMonth=t.getMonth(),i.drawYear=i.selectedYear=t.getFullYear()),this._notifyChange(i),this._adjustDate(a)},_selectMonthYear:function(e,t,a){var i=b(e),s=this._getInst(i[0]);s["selected"+("M"===a?"Month":"Year")]=s["draw"+("M"===a?"Month":"Year")]=parseInt(t.options[t.selectedIndex].value,10),this._notifyChange(s),this._adjustDate(i)},_selectDay:function(e,t,a,i){var s,r=b(e);b(i).hasClass(this._unselectableClass)||this._isDisabledDatepicker(r[0])||((s=this._getInst(r[0])).selectedDay=s.currentDay=b("a",i).html(),s.selectedMonth=s.currentMonth=t,s.selectedYear=s.currentYear=a,this._selectDate(e,this._formatDate(s,s.currentDay,s.currentMonth,s.currentYear)))},_clearDate:function(e){var t=b(e);this._selectDate(t,"")},_selectDate:function(e,t){var a,i=b(e),s=this._getInst(i[0]);t=null!=t?t:this._formatDate(s),s.input&&s.input.val(t),this._updateAlternate(s),(a=this._get(s,"onSelect"))?a.apply(s.input?s.input[0]:null,[t,s]):s.input&&s.input.trigger("change"),s.inline?this._updateDatepicker(s):(this._hideDatepicker(),this._lastInput=s.input[0],"object"!=typeof s.input[0]&&s.input.trigger("focus"),this._lastInput=null)},_updateAlternate:function(e){var t,a,i,s=this._get(e,"altField");s&&(t=this._get(e,"altFormat")||this._get(e,"dateFormat"),a=this._getDate(e),i=this.formatDate(t,a,this._getFormatConfig(e)),b(s).val(i))},noWeekends:function(e){var t=e.getDay();return[0<t&&t<6,""]},iso8601Week:function(e){var t,a=new Date(e.getTime());return a.setDate(a.getDate()+4-(a.getDay()||7)),t=a.getTime(),a.setMonth(0),a.setDate(1),Math.floor(Math.round((t-a)/864e5)/7)+1},parseDate:function(a,r,e){if(null==a||null==r)throw"Invalid arguments";if(""===(r="object"==typeof r?r.toString():r+""))return null;function n(e){var t=d+1<a.length&&a.charAt(d+1)===e;return t&&d++,t}function t(e){var t=n(e),a="@"===e?14:"!"===e?20:"y"===e&&t?4:"o"===e?3:2,i=new RegExp("^\\d{"+("y"===e?a:1)+","+a+"}"),s=r.substring(h).match(i);if(!s)throw"Missing number at position "+h;return h+=s[0].length,parseInt(s[0],10)}function i(e,t,a){var i=-1,s=b.map(n(e)?a:t,function(e,t){return[[t,e]]}).sort(function(e,t){return-(e[1].length-t[1].length)});if(b.each(s,function(e,t){var a=t[1];if(r.substr(h,a.length).toLowerCase()===a.toLowerCase())return i=t[0],h+=a.length,!1}),-1!==i)return i+1;throw"Unknown name at position "+h}function s(){if(r.charAt(h)!==a.charAt(d))throw"Unexpected literal at position "+h;h++}var d,c,o,l,h=0,u=(e?e.shortYearCutoff:null)||this._defaults.shortYearCutoff,p="string"!=typeof u?u:(new Date).getFullYear()%100+parseInt(u,10),g=(e?e.dayNamesShort:null)||this._defaults.dayNamesShort,_=(e?e.dayNames:null)||this._defaults.dayNames,f=(e?e.monthNamesShort:null)||this._defaults.monthNamesShort,k=(e?e.monthNames:null)||this._defaults.monthNames,D=-1,m=-1,y=-1,v=-1,M=!1;for(d=0;d<a.length;d++)if(M)"'"!==a.charAt(d)||n("'")?s():M=!1;else switch(a.charAt(d)){case"d":y=t("d");break;case"D":i("D",g,_);break;case"o":v=t("o");break;case"m":m=t("m");break;case"M":m=i("M",f,k);break;case"y":D=t("y");break;case"@":D=(l=new Date(t("@"))).getFullYear(),m=l.getMonth()+1,y=l.getDate();break;case"!":D=(l=new Date((t("!")-this._ticksTo1970)/1e4)).getFullYear(),m=l.getMonth()+1,y=l.getDate();break;case"'":n("'")?s():M=!0;break;default:s()}if(h<r.length&&(o=r.substr(h),!/^\s+/.test(o)))throw"Extra/unparsed characters found in date: "+o;if(-1===D?D=(new Date).getFullYear():D<100&&(D+=(new Date).getFullYear()-(new Date).getFullYear()%100+(D<=p?0:-100)),-1<v)for(m=1,y=v;;){if(y<=(c=this._getDaysInMonth(D,m-1)))break;m++,y-=c}if((l=this._daylightSavingAdjust(new Date(D,m-1,y))).getFullYear()!==D||l.getMonth()+1!==m||l.getDate()!==y)throw"Invalid date";return l},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:24*(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*60*60*1e7,formatDate:function(a,e,t){if(!e)return"";function s(e){var t=n+1<a.length&&a.charAt(n+1)===e;return t&&n++,t}function i(e,t,a){var i=""+t;if(s(e))for(;i.length<a;)i="0"+i;return i}function r(e,t,a,i){return s(e)?i[t]:a[t]}var n,d=(t?t.dayNamesShort:null)||this._defaults.dayNamesShort,c=(t?t.dayNames:null)||this._defaults.dayNames,o=(t?t.monthNamesShort:null)||this._defaults.monthNamesShort,l=(t?t.monthNames:null)||this._defaults.monthNames,h="",u=!1;if(e)for(n=0;n<a.length;n++)if(u)"'"!==a.charAt(n)||s("'")?h+=a.charAt(n):u=!1;else switch(a.charAt(n)){case"d":h+=i("d",e.getDate(),2);break;case"D":h+=r("D",e.getDay(),d,c);break;case"o":h+=i("o",Math.round((new Date(e.getFullYear(),e.getMonth(),e.getDate()).getTime()-new Date(e.getFullYear(),0,0).getTime())/864e5),3);break;case"m":h+=i("m",e.getMonth()+1,2);break;case"M":h+=r("M",e.getMonth(),o,l);break;case"y":h+=s("y")?e.getFullYear():(e.getFullYear()%100<10?"0":"")+e.getFullYear()%100;break;case"@":h+=e.getTime();break;case"!":h+=1e4*e.getTime()+this._ticksTo1970;break;case"'":s("'")?h+="'":u=!0;break;default:h+=a.charAt(n)}return h},_possibleChars:function(a){function e(e){var t=i+1<a.length&&a.charAt(i+1)===e;return t&&i++,t}var i,t="",s=!1;for(i=0;i<a.length;i++)if(s)"'"!==a.charAt(i)||e("'")?t+=a.charAt(i):s=!1;else switch(a.charAt(i)){case"d":case"m":case"y":case"@":t+="0123456789";break;case"D":case"M":return null;case"'":e("'")?t+="'":s=!0;break;default:t+=a.charAt(i)}return t},_get:function(e,t){return void 0!==e.settings[t]?e.settings[t]:this._defaults[t]},_setDateFromField:function(e,t){if(e.input.val()!==e.lastVal){var a=this._get(e,"dateFormat"),i=e.lastVal=e.input?e.input.val():null,s=this._getDefaultDate(e),r=s,n=this._getFormatConfig(e);try{r=this.parseDate(a,i,n)||s}catch(e){i=t?"":i}e.selectedDay=r.getDate(),e.drawMonth=e.selectedMonth=r.getMonth(),e.drawYear=e.selectedYear=r.getFullYear(),e.currentDay=i?r.getDate():0,e.currentMonth=i?r.getMonth():0,e.currentYear=i?r.getFullYear():0,this._adjustInstDate(e)}},_getDefaultDate:function(e){return this._restrictMinMax(e,this._determineDate(e,this._get(e,"defaultDate"),new Date))},_determineDate:function(d,e,t){var a,i,s=null==e||""===e?t:"string"==typeof e?function(e){try{return b.datepicker.parseDate(b.datepicker._get(d,"dateFormat"),e,b.datepicker._getFormatConfig(d))}catch(e){}for(var t=(e.toLowerCase().match(/^c/)?b.datepicker._getDate(d):null)||new Date,a=t.getFullYear(),i=t.getMonth(),s=t.getDate(),r=/([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,n=r.exec(e);n;){switch(n[2]||"d"){case"d":case"D":s+=parseInt(n[1],10);break;case"w":case"W":s+=7*parseInt(n[1],10);break;case"m":case"M":i+=parseInt(n[1],10),s=Math.min(s,b.datepicker._getDaysInMonth(a,i));break;case"y":case"Y":a+=parseInt(n[1],10),s=Math.min(s,b.datepicker._getDaysInMonth(a,i))}n=r.exec(e)}return new Date(a,i,s)}(e):"number"==typeof e?isNaN(e)?t:(a=e,(i=new Date).setDate(i.getDate()+a),i):new Date(e.getTime());return(s=s&&"Invalid Date"===s.toString()?t:s)&&(s.setHours(0),s.setMinutes(0),s.setSeconds(0),s.setMilliseconds(0)),this._daylightSavingAdjust(s)},_daylightSavingAdjust:function(e){return e?(e.setHours(12<e.getHours()?e.getHours()+2:0),e):null},_setDate:function(e,t,a){var i=!t,s=e.selectedMonth,r=e.selectedYear,n=this._restrictMinMax(e,this._determineDate(e,t,new Date));e.selectedDay=e.currentDay=n.getDate(),e.drawMonth=e.selectedMonth=e.currentMonth=n.getMonth(),e.drawYear=e.selectedYear=e.currentYear=n.getFullYear(),s===e.selectedMonth&&r===e.selectedYear||a||this._notifyChange(e),this._adjustInstDate(e),e.input&&e.input.val(i?"":this._formatDate(e))},_getDate:function(e){return!e.currentYear||e.input&&""===e.input.val()?null:this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay))},_attachHandlers:function(e){var t=this._get(e,"stepMonths"),a="#"+e.id.replace(/\\\\/g,"\\");e.dpDiv.find("[data-handler]").map(function(){var e={prev:function(){b.datepicker._adjustDate(a,-t,"M")},next:function(){b.datepicker._adjustDate(a,+t,"M")},hide:function(){b.datepicker._hideDatepicker()},today:function(){b.datepicker._gotoToday(a)},selectDay:function(){return b.datepicker._selectDay(a,+this.getAttribute("data-month"),+this.getAttribute("data-year"),this),!1},selectMonth:function(){return b.datepicker._selectMonthYear(a,this,"M"),!1},selectYear:function(){return b.datepicker._selectMonthYear(a,this,"Y"),!1}};b(this).on(this.getAttribute("data-event"),e[this.getAttribute("data-handler")])})},_generateHTML:function(e){var t,a,i,s,r,n,d,c,o,l,h,u,p,g,_,f,k,D,m,y,v,M,b,w,C,I,x,Y,S,F,N,T,A,K,j,O,R,L,W,E=new Date,H=this._daylightSavingAdjust(new Date(E.getFullYear(),E.getMonth(),E.getDate())),P=this._get(e,"isRTL"),U=this._get(e,"showButtonPanel"),z=this._get(e,"hideIfNoPrevNext"),B=this._get(e,"navigationAsDateFormat"),J=this._getNumberOfMonths(e),V=this._get(e,"showCurrentAtPos"),q=this._get(e,"stepMonths"),Q=1!==J[0]||1!==J[1],X=this._daylightSavingAdjust(e.currentDay?new Date(e.currentYear,e.currentMonth,e.currentDay):new Date(9999,9,9)),Z=this._getMinMaxDate(e,"min"),$=this._getMinMaxDate(e,"max"),G=e.drawMonth-V,ee=e.drawYear;if(G<0&&(G+=12,ee--),$)for(t=this._daylightSavingAdjust(new Date($.getFullYear(),$.getMonth()-J[0]*J[1]+1,$.getDate())),t=Z&&t<Z?Z:t;this._daylightSavingAdjust(new Date(ee,G,1))>t;)--G<0&&(G=11,ee--);for(e.drawMonth=G,e.drawYear=ee,a=this._get(e,"prevText"),a=B?this.formatDate(a,this._daylightSavingAdjust(new Date(ee,G-q,1)),this._getFormatConfig(e)):a,i=this._canAdjustMonth(e,-1,ee,G)?"<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click' title='"+a+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"e":"w")+"'>"+a+"</span></a>":z?"":"<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='"+a+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"e":"w")+"'>"+a+"</span></a>",s=this._get(e,"nextText"),s=B?this.formatDate(s,this._daylightSavingAdjust(new Date(ee,G+q,1)),this._getFormatConfig(e)):s,r=this._canAdjustMonth(e,1,ee,G)?"<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click' title='"+s+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"w":"e")+"'>"+s+"</span></a>":z?"":"<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='"+s+"'><span class='ui-icon ui-icon-circle-triangle-"+(P?"w":"e")+"'>"+s+"</span></a>",n=this._get(e,"currentText"),d=this._get(e,"gotoCurrent")&&e.currentDay?X:H,n=B?this.formatDate(n,d,this._getFormatConfig(e)):n,c=e.inline?"":"<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>"+this._get(e,"closeText")+"</button>",o=U?"<div class='ui-datepicker-buttonpane ui-widget-content'>"+(P?c:"")+(this._isInRange(e,d)?"<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'>"+n+"</button>":"")+(P?"":c)+"</div>":"",l=parseInt(this._get(e,"firstDay"),10),l=isNaN(l)?0:l,h=this._get(e,"showWeek"),u=this._get(e,"dayNames"),p=this._get(e,"dayNamesMin"),g=this._get(e,"monthNames"),_=this._get(e,"monthNamesShort"),f=this._get(e,"beforeShowDay"),k=this._get(e,"showOtherMonths"),D=this._get(e,"selectOtherMonths"),m=this._getDefaultDate(e),y="",M=0;M<J[0];M++){for(b="",this.maxRows=4,w=0;w<J[1];w++){if(C=this._daylightSavingAdjust(new Date(ee,G,e.selectedDay)),I=" ui-corner-all",x="",Q){if(x+="<div class='ui-datepicker-group",1<J[1])switch(w){case 0:x+=" ui-datepicker-group-first",I=" ui-corner-"+(P?"right":"left");break;case J[1]-1:x+=" ui-datepicker-group-last",I=" ui-corner-"+(P?"left":"right");break;default:x+=" ui-datepicker-group-middle",I=""}x+="'>"}for(x+="<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix"+I+"'>"+(/all|left/.test(I)&&0===M?P?r:i:"")+(/all|right/.test(I)&&0===M?P?i:r:"")+this._generateMonthYearHeader(e,G,ee,Z,$,0<M||0<w,g,_)+"</div><table class='ui-datepicker-calendar'><thead><tr>",Y=h?"<th class='ui-datepicker-week-col'>"+this._get(e,"weekHeader")+"</th>":"",v=0;v<7;v++)Y+="<th scope='col'"+(5<=(v+l+6)%7?" class='ui-datepicker-week-end'":"")+"><span title='"+u[S=(v+l)%7]+"'>"+p[S]+"</span></th>";for(x+=Y+"</tr></thead><tbody>",F=this._getDaysInMonth(ee,G),ee===e.selectedYear&&G===e.selectedMonth&&(e.selectedDay=Math.min(e.selectedDay,F)),N=(this._getFirstDayOfMonth(ee,G)-l+7)%7,T=Math.ceil((N+F)/7),A=Q&&this.maxRows>T?this.maxRows:T,this.maxRows=A,K=this._daylightSavingAdjust(new Date(ee,G,1-N)),j=0;j<A;j++){for(x+="<tr>",O=h?"<td class='ui-datepicker-week-col'>"+this._get(e,"calculateWeek")(K)+"</td>":"",v=0;v<7;v++)R=f?f.apply(e.input?e.input[0]:null,[K]):[!0,""],W=(L=K.getMonth()!==G)&&!D||!R[0]||Z&&K<Z||$&&$<K,O+="<td class='"+(5<=(v+l+6)%7?" ui-datepicker-week-end":"")+(L?" ui-datepicker-other-month":"")+(K.getTime()===C.getTime()&&G===e.selectedMonth&&e._keyEvent||m.getTime()===K.getTime()&&m.getTime()===C.getTime()?" "+this._dayOverClass:"")+(W?" "+this._unselectableClass+" ui-state-disabled":"")+(L&&!k?"":" "+R[1]+(K.getTime()===X.getTime()?" "+this._currentClass:"")+(K.getTime()===H.getTime()?" ui-datepicker-today":""))+"'"+(L&&!k||!R[2]?"":" title='"+R[2].replace(/'/g,"&#39;")+"'")+(W?"":" data-handler='selectDay' data-event='click' data-month='"+K.getMonth()+"' data-year='"+K.getFullYear()+"'")+">"+(L&&!k?"&#xa0;":W?"<span class='ui-state-default'>"+K.getDate()+"</span>":"<a class='ui-state-default"+(K.getTime()===H.getTime()?" ui-state-highlight":"")+(K.getTime()===X.getTime()?" ui-state-active":"")+(L?" ui-priority-secondary":"")+"' href='#'>"+K.getDate()+"</a>")+"</td>",K.setDate(K.getDate()+1),K=this._daylightSavingAdjust(K);x+=O+"</tr>"}11<++G&&(G=0,ee++),b+=x+="</tbody></table>"+(Q?"</div>"+(0<J[0]&&w===J[1]-1?"<div class='ui-datepicker-row-break'></div>":""):"")}y+=b}return y+=o,e._keyEvent=!1,y},_generateMonthYearHeader:function(e,t,a,i,s,r,n,d){var c,o,l,h,u,p,g,_,f=this._get(e,"changeMonth"),k=this._get(e,"changeYear"),D=this._get(e,"showMonthAfterYear"),m="<div class='ui-datepicker-title'>",y="";if(r||!f)y+="<span class='ui-datepicker-month'>"+n[t]+"</span>";else{for(c=i&&i.getFullYear()===a,o=s&&s.getFullYear()===a,y+="<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>",l=0;l<12;l++)(!c||l>=i.getMonth())&&(!o||l<=s.getMonth())&&(y+="<option value='"+l+"'"+(l===t?" selected='selected'":"")+">"+d[l]+"</option>");y+="</select>"}if(D||(m+=y+(!r&&f&&k?"":"&#xa0;")),!e.yearshtml)if(e.yearshtml="",r||!k)m+="<span class='ui-datepicker-year'>"+a+"</span>";else{for(h=this._get(e,"yearRange").split(":"),u=(new Date).getFullYear(),g=(p=function(e){var t=e.match(/c[+\-].*/)?a+parseInt(e.substring(1),10):e.match(/[+\-].*/)?u+parseInt(e,10):parseInt(e,10);return isNaN(t)?u:t})(h[0]),_=Math.max(g,p(h[1]||"")),g=i?Math.max(g,i.getFullYear()):g,_=s?Math.min(_,s.getFullYear()):_,e.yearshtml+="<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>";g<=_;g++)e.yearshtml+="<option value='"+g+"'"+(g===a?" selected='selected'":"")+">"+g+"</option>";e.yearshtml+="</select>",m+=e.yearshtml,e.yearshtml=null}return m+=this._get(e,"yearSuffix"),D&&(m+=(!r&&f&&k?"":"&#xa0;")+y),m+="</div>"},_adjustInstDate:function(e,t,a){var i=e.selectedYear+("Y"===a?t:0),s=e.selectedMonth+("M"===a?t:0),r=Math.min(e.selectedDay,this._getDaysInMonth(i,s))+("D"===a?t:0),n=this._restrictMinMax(e,this._daylightSavingAdjust(new Date(i,s,r)));e.selectedDay=n.getDate(),e.drawMonth=e.selectedMonth=n.getMonth(),e.drawYear=e.selectedYear=n.getFullYear(),"M"!==a&&"Y"!==a||this._notifyChange(e)},_restrictMinMax:function(e,t){var a=this._getMinMaxDate(e,"min"),i=this._getMinMaxDate(e,"max"),s=a&&t<a?a:t;return i&&i<s?i:s},_notifyChange:function(e){var t=this._get(e,"onChangeMonthYear");t&&t.apply(e.input?e.input[0]:null,[e.selectedYear,e.selectedMonth+1,e])},_getNumberOfMonths:function(e){var t=this._get(e,"numberOfMonths");return null==t?[1,1]:"number"==typeof t?[1,t]:t},_getMinMaxDate:function(e,t){return this._determineDate(e,this._get(e,t+"Date"),null)},_getDaysInMonth:function(e,t){return 32-this._daylightSavingAdjust(new Date(e,t,32)).getDate()},_getFirstDayOfMonth:function(e,t){return new Date(e,t,1).getDay()},_canAdjustMonth:function(e,t,a,i){var s=this._getNumberOfMonths(e),r=this._daylightSavingAdjust(new Date(a,i+(t<0?t:s[0]*s[1]),1));return t<0&&r.setDate(this._getDaysInMonth(r.getFullYear(),r.getMonth())),this._isInRange(e,r)},_isInRange:function(e,t){var a,i,s=this._getMinMaxDate(e,"min"),r=this._getMinMaxDate(e,"max"),n=null,d=null,c=this._get(e,"yearRange");return c&&(a=c.split(":"),i=(new Date).getFullYear(),n=parseInt(a[0],10),d=parseInt(a[1],10),a[0].match(/[+\-].*/)&&(n+=i),a[1].match(/[+\-].*/)&&(d+=i)),(!s||t.getTime()>=s.getTime())&&(!r||t.getTime()<=r.getTime())&&(!n||t.getFullYear()>=n)&&(!d||t.getFullYear()<=d)},_getFormatConfig:function(e){var t=this._get(e,"shortYearCutoff");return{shortYearCutoff:t="string"!=typeof t?t:(new Date).getFullYear()%100+parseInt(t,10),dayNamesShort:this._get(e,"dayNamesShort"),dayNames:this._get(e,"dayNames"),monthNamesShort:this._get(e,"monthNamesShort"),monthNames:this._get(e,"monthNames")}},_formatDate:function(e,t,a,i){t||(e.currentDay=e.selectedDay,e.currentMonth=e.selectedMonth,e.currentYear=e.selectedYear);var s=t?"object"==typeof t?t:this._daylightSavingAdjust(new Date(i,a,t)):this._daylightSavingAdjust(new Date(e.currentYear,e.currentMonth,e.currentDay));return this.formatDate(this._get(e,"dateFormat"),s,this._getFormatConfig(e))}}),b.fn.datepicker=function(e){if(!this.length)return this;b.datepicker.initialized||(b(document).on("mousedown",b.datepicker._checkExternalClick),b.datepicker.initialized=!0),0===b("#"+b.datepicker._mainDivId).length&&b("body").append(b.datepicker.dpDiv);var t=Array.prototype.slice.call(arguments,1);return"string"!=typeof e||"isDisabled"!==e&&"getDate"!==e&&"widget"!==e?"option"===e&&2===arguments.length&&"string"==typeof arguments[1]?b.datepicker["_"+e+"Datepicker"].apply(b.datepicker,[this[0]].concat(t)):this.each(function(){"string"==typeof e?b.datepicker["_"+e+"Datepicker"].apply(b.datepicker,[this].concat(t)):b.datepicker._attachDatepicker(this,e)}):b.datepicker["_"+e+"Datepicker"].apply(b.datepicker,[this[0]].concat(t))},b.datepicker=new e,b.datepicker.initialized=!1,b.datepicker.uuid=(new Date).getTime(),b.datepicker.version="1.12.1",b.datepicker});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/dialog.js b/wp-includes/js/jquery/ui/dialog.js
new file mode 100644
index 0000000000..aa9b871de6
--- /dev/null
+++ b/wp-includes/js/jquery/ui/dialog.js
@@ -0,0 +1,932 @@
+/*!
+ * jQuery UI Dialog 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Dialog
+//>>group: Widgets
+//>>description: Displays customizable dialog windows.
+//>>docs: http://api.jqueryui.com/dialog/
+//>>demos: http://jqueryui.com/dialog/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/dialog.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./button",
+			"./draggable",
+			"./mouse",
+			"./resizable",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.dialog", {
+	version: "1.12.1",
+	options: {
+		appendTo: "body",
+		autoOpen: true,
+		buttons: [],
+		classes: {
+			"ui-dialog": "ui-corner-all",
+			"ui-dialog-titlebar": "ui-corner-all"
+		},
+		closeOnEscape: true,
+		closeText: "Close",
+		draggable: true,
+		hide: null,
+		height: "auto",
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 150,
+		minWidth: 150,
+		modal: false,
+		position: {
+			my: "center",
+			at: "center",
+			of: window,
+			collision: "fit",
+
+			// Ensure the titlebar is always visible
+			using: function( pos ) {
+				var topOffset = $( this ).css( pos ).offset().top;
+				if ( topOffset < 0 ) {
+					$( this ).css( "top", pos.top - topOffset );
+				}
+			}
+		},
+		resizable: true,
+		show: null,
+		title: null,
+		width: 300,
+
+		// Callbacks
+		beforeClose: null,
+		close: null,
+		drag: null,
+		dragStart: null,
+		dragStop: null,
+		focus: null,
+		open: null,
+		resize: null,
+		resizeStart: null,
+		resizeStop: null
+	},
+
+	sizeRelatedOptions: {
+		buttons: true,
+		height: true,
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true,
+		width: true
+	},
+
+	resizableRelatedOptions: {
+		maxHeight: true,
+		maxWidth: true,
+		minHeight: true,
+		minWidth: true
+	},
+
+	_create: function() {
+		this.originalCss = {
+			display: this.element[ 0 ].style.display,
+			width: this.element[ 0 ].style.width,
+			minHeight: this.element[ 0 ].style.minHeight,
+			maxHeight: this.element[ 0 ].style.maxHeight,
+			height: this.element[ 0 ].style.height
+		};
+		this.originalPosition = {
+			parent: this.element.parent(),
+			index: this.element.parent().children().index( this.element )
+		};
+		this.originalTitle = this.element.attr( "title" );
+		if ( this.options.title == null && this.originalTitle != null ) {
+			this.options.title = this.originalTitle;
+		}
+
+		// Dialogs can't be disabled
+		if ( this.options.disabled ) {
+			this.options.disabled = false;
+		}
+
+		this._createWrapper();
+
+		this.element
+			.show()
+			.removeAttr( "title" )
+			.appendTo( this.uiDialog );
+
+		this._addClass( "ui-dialog-content", "ui-widget-content" );
+
+		this._createTitlebar();
+		this._createButtonPane();
+
+		if ( this.options.draggable && $.fn.draggable ) {
+			this._makeDraggable();
+		}
+		if ( this.options.resizable && $.fn.resizable ) {
+			this._makeResizable();
+		}
+
+		this._isOpen = false;
+
+		this._trackFocus();
+	},
+
+	_init: function() {
+		if ( this.options.autoOpen ) {
+			this.open();
+		}
+	},
+
+	_appendTo: function() {
+		var element = this.options.appendTo;
+		if ( element && ( element.jquery || element.nodeType ) ) {
+			return $( element );
+		}
+		return this.document.find( element || "body" ).eq( 0 );
+	},
+
+	_destroy: function() {
+		var next,
+			originalPosition = this.originalPosition;
+
+		this._untrackInstance();
+		this._destroyOverlay();
+
+		this.element
+			.removeUniqueId()
+			.css( this.originalCss )
+
+			// Without detaching first, the following becomes really slow
+			.detach();
+
+		this.uiDialog.remove();
+
+		if ( this.originalTitle ) {
+			this.element.attr( "title", this.originalTitle );
+		}
+
+		next = originalPosition.parent.children().eq( originalPosition.index );
+
+		// Don't try to place the dialog next to itself (#8613)
+		if ( next.length && next[ 0 ] !== this.element[ 0 ] ) {
+			next.before( this.element );
+		} else {
+			originalPosition.parent.append( this.element );
+		}
+	},
+
+	widget: function() {
+		return this.uiDialog;
+	},
+
+	disable: $.noop,
+	enable: $.noop,
+
+	close: function( event ) {
+		var that = this;
+
+		if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) {
+			return;
+		}
+
+		this._isOpen = false;
+		this._focusedElement = null;
+		this._destroyOverlay();
+		this._untrackInstance();
+
+		if ( !this.opener.filter( ":focusable" ).trigger( "focus" ).length ) {
+
+			// Hiding a focused element doesn't trigger blur in WebKit
+			// so in case we have nothing to focus on, explicitly blur the active element
+			// https://bugs.webkit.org/show_bug.cgi?id=47182
+			$.ui.safeBlur( $.ui.safeActiveElement( this.document[ 0 ] ) );
+		}
+
+		this._hide( this.uiDialog, this.options.hide, function() {
+			that._trigger( "close", event );
+		} );
+	},
+
+	isOpen: function() {
+		return this._isOpen;
+	},
+
+	moveToTop: function() {
+		this._moveToTop();
+	},
+
+	_moveToTop: function( event, silent ) {
+		var moved = false,
+			zIndices = this.uiDialog.siblings( ".ui-front:visible" ).map( function() {
+				return +$( this ).css( "z-index" );
+			} ).get(),
+			zIndexMax = Math.max.apply( null, zIndices );
+
+		if ( zIndexMax >= +this.uiDialog.css( "z-index" ) ) {
+			this.uiDialog.css( "z-index", zIndexMax + 1 );
+			moved = true;
+		}
+
+		if ( moved && !silent ) {
+			this._trigger( "focus", event );
+		}
+		return moved;
+	},
+
+	open: function() {
+		var that = this;
+		if ( this._isOpen ) {
+			if ( this._moveToTop() ) {
+				this._focusTabbable();
+			}
+			return;
+		}
+
+		this._isOpen = true;
+		this.opener = $( $.ui.safeActiveElement( this.document[ 0 ] ) );
+
+		this._size();
+		this._position();
+		this._createOverlay();
+		this._moveToTop( null, true );
+
+		// Ensure the overlay is moved to the top with the dialog, but only when
+		// opening. The overlay shouldn't move after the dialog is open so that
+		// modeless dialogs opened after the modal dialog stack properly.
+		if ( this.overlay ) {
+			this.overlay.css( "z-index", this.uiDialog.css( "z-index" ) - 1 );
+		}
+
+		this._show( this.uiDialog, this.options.show, function() {
+			that._focusTabbable();
+			that._trigger( "focus" );
+		} );
+
+		// Track the dialog immediately upon openening in case a focus event
+		// somehow occurs outside of the dialog before an element inside the
+		// dialog is focused (#10152)
+		this._makeFocusTarget();
+
+		this._trigger( "open" );
+	},
+
+	_focusTabbable: function() {
+
+		// Set focus to the first match:
+		// 1. An element that was focused previously
+		// 2. First element inside the dialog matching [autofocus]
+		// 3. Tabbable element inside the content element
+		// 4. Tabbable element inside the buttonpane
+		// 5. The close button
+		// 6. The dialog itself
+		var hasFocus = this._focusedElement;
+		if ( !hasFocus ) {
+			hasFocus = this.element.find( "[autofocus]" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.element.find( ":tabbable" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.uiDialogButtonPane.find( ":tabbable" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.uiDialogTitlebarClose.filter( ":tabbable" );
+		}
+		if ( !hasFocus.length ) {
+			hasFocus = this.uiDialog;
+		}
+		hasFocus.eq( 0 ).trigger( "focus" );
+	},
+
+	_keepFocus: function( event ) {
+		function checkFocus() {
+			var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ),
+				isActive = this.uiDialog[ 0 ] === activeElement ||
+					$.contains( this.uiDialog[ 0 ], activeElement );
+			if ( !isActive ) {
+				this._focusTabbable();
+			}
+		}
+		event.preventDefault();
+		checkFocus.call( this );
+
+		// support: IE
+		// IE <= 8 doesn't prevent moving focus even with event.preventDefault()
+		// so we check again later
+		this._delay( checkFocus );
+	},
+
+	_createWrapper: function() {
+		this.uiDialog = $( "<div>" )
+			.hide()
+			.attr( {
+
+				// Setting tabIndex makes the div focusable
+				tabIndex: -1,
+				role: "dialog"
+			} )
+			.appendTo( this._appendTo() );
+
+		this._addClass( this.uiDialog, "ui-dialog", "ui-widget ui-widget-content ui-front" );
+		this._on( this.uiDialog, {
+			keydown: function( event ) {
+				if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode &&
+						event.keyCode === $.ui.keyCode.ESCAPE ) {
+					event.preventDefault();
+					this.close( event );
+					return;
+				}
+
+				// Prevent tabbing out of dialogs
+				if ( event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented() ) {
+					return;
+				}
+				var tabbables = this.uiDialog.find( ":tabbable" ),
+					first = tabbables.filter( ":first" ),
+					last = tabbables.filter( ":last" );
+
+				if ( ( event.target === last[ 0 ] || event.target === this.uiDialog[ 0 ] ) &&
+						!event.shiftKey ) {
+					this._delay( function() {
+						first.trigger( "focus" );
+					} );
+					event.preventDefault();
+				} else if ( ( event.target === first[ 0 ] ||
+						event.target === this.uiDialog[ 0 ] ) && event.shiftKey ) {
+					this._delay( function() {
+						last.trigger( "focus" );
+					} );
+					event.preventDefault();
+				}
+			},
+			mousedown: function( event ) {
+				if ( this._moveToTop( event ) ) {
+					this._focusTabbable();
+				}
+			}
+		} );
+
+		// We assume that any existing aria-describedby attribute means
+		// that the dialog content is marked up properly
+		// otherwise we brute force the content as the description
+		if ( !this.element.find( "[aria-describedby]" ).length ) {
+			this.uiDialog.attr( {
+				"aria-describedby": this.element.uniqueId().attr( "id" )
+			} );
+		}
+	},
+
+	_createTitlebar: function() {
+		var uiDialogTitle;
+
+		this.uiDialogTitlebar = $( "<div>" );
+		this._addClass( this.uiDialogTitlebar,
+			"ui-dialog-titlebar", "ui-widget-header ui-helper-clearfix" );
+		this._on( this.uiDialogTitlebar, {
+			mousedown: function( event ) {
+
+				// Don't prevent click on close button (#8838)
+				// Focusing a dialog that is partially scrolled out of view
+				// causes the browser to scroll it into view, preventing the click event
+				if ( !$( event.target ).closest( ".ui-dialog-titlebar-close" ) ) {
+
+					// Dialog isn't getting focus when dragging (#8063)
+					this.uiDialog.trigger( "focus" );
+				}
+			}
+		} );
+
+		// Support: IE
+		// Use type="button" to prevent enter keypresses in textboxes from closing the
+		// dialog in IE (#9312)
+		this.uiDialogTitlebarClose = $( "<button type='button'></button>" )
+			.button( {
+				label: $( "<a>" ).text( this.options.closeText ).html(),
+				icon: "ui-icon-closethick",
+				showLabel: false
+			} )
+			.appendTo( this.uiDialogTitlebar );
+
+		this._addClass( this.uiDialogTitlebarClose, "ui-dialog-titlebar-close" );
+		this._on( this.uiDialogTitlebarClose, {
+			click: function( event ) {
+				event.preventDefault();
+				this.close( event );
+			}
+		} );
+
+		uiDialogTitle = $( "<span>" ).uniqueId().prependTo( this.uiDialogTitlebar );
+		this._addClass( uiDialogTitle, "ui-dialog-title" );
+		this._title( uiDialogTitle );
+
+		this.uiDialogTitlebar.prependTo( this.uiDialog );
+
+		this.uiDialog.attr( {
+			"aria-labelledby": uiDialogTitle.attr( "id" )
+		} );
+	},
+
+	_title: function( title ) {
+		if ( this.options.title ) {
+			title.text( this.options.title );
+		} else {
+			title.html( "&#160;" );
+		}
+	},
+
+	_createButtonPane: function() {
+		this.uiDialogButtonPane = $( "<div>" );
+		this._addClass( this.uiDialogButtonPane, "ui-dialog-buttonpane",
+			"ui-widget-content ui-helper-clearfix" );
+
+		this.uiButtonSet = $( "<div>" )
+			.appendTo( this.uiDialogButtonPane );
+		this._addClass( this.uiButtonSet, "ui-dialog-buttonset" );
+
+		this._createButtons();
+	},
+
+	_createButtons: function() {
+		var that = this,
+			buttons = this.options.buttons;
+
+		// If we already have a button pane, remove it
+		this.uiDialogButtonPane.remove();
+		this.uiButtonSet.empty();
+
+		if ( $.isEmptyObject( buttons ) || ( $.isArray( buttons ) && !buttons.length ) ) {
+			this._removeClass( this.uiDialog, "ui-dialog-buttons" );
+			return;
+		}
+
+		$.each( buttons, function( name, props ) {
+			var click, buttonOptions;
+			props = $.isFunction( props ) ?
+				{ click: props, text: name } :
+				props;
+
+			// Default to a non-submitting button
+			props = $.extend( { type: "button" }, props );
+
+			// Change the context for the click callback to be the main element
+			click = props.click;
+			buttonOptions = {
+				icon: props.icon,
+				iconPosition: props.iconPosition,
+				showLabel: props.showLabel,
+
+				// Deprecated options
+				icons: props.icons,
+				text: props.text
+			};
+
+			delete props.click;
+			delete props.icon;
+			delete props.iconPosition;
+			delete props.showLabel;
+
+			// Deprecated options
+			delete props.icons;
+			if ( typeof props.text === "boolean" ) {
+				delete props.text;
+			}
+
+			$( "<button></button>", props )
+				.button( buttonOptions )
+				.appendTo( that.uiButtonSet )
+				.on( "click", function() {
+					click.apply( that.element[ 0 ], arguments );
+				} );
+		} );
+		this._addClass( this.uiDialog, "ui-dialog-buttons" );
+		this.uiDialogButtonPane.appendTo( this.uiDialog );
+	},
+
+	_makeDraggable: function() {
+		var that = this,
+			options = this.options;
+
+		function filteredUi( ui ) {
+			return {
+				position: ui.position,
+				offset: ui.offset
+			};
+		}
+
+		this.uiDialog.draggable( {
+			cancel: ".ui-dialog-content, .ui-dialog-titlebar-close",
+			handle: ".ui-dialog-titlebar",
+			containment: "document",
+			start: function( event, ui ) {
+				that._addClass( $( this ), "ui-dialog-dragging" );
+				that._blockFrames();
+				that._trigger( "dragStart", event, filteredUi( ui ) );
+			},
+			drag: function( event, ui ) {
+				that._trigger( "drag", event, filteredUi( ui ) );
+			},
+			stop: function( event, ui ) {
+				var left = ui.offset.left - that.document.scrollLeft(),
+					top = ui.offset.top - that.document.scrollTop();
+
+				options.position = {
+					my: "left top",
+					at: "left" + ( left >= 0 ? "+" : "" ) + left + " " +
+						"top" + ( top >= 0 ? "+" : "" ) + top,
+					of: that.window
+				};
+				that._removeClass( $( this ), "ui-dialog-dragging" );
+				that._unblockFrames();
+				that._trigger( "dragStop", event, filteredUi( ui ) );
+			}
+		} );
+	},
+
+	_makeResizable: function() {
+		var that = this,
+			options = this.options,
+			handles = options.resizable,
+
+			// .ui-resizable has position: relative defined in the stylesheet
+			// but dialogs have to use absolute or fixed positioning
+			position = this.uiDialog.css( "position" ),
+			resizeHandles = typeof handles === "string" ?
+				handles :
+				"n,e,s,w,se,sw,ne,nw";
+
+		function filteredUi( ui ) {
+			return {
+				originalPosition: ui.originalPosition,
+				originalSize: ui.originalSize,
+				position: ui.position,
+				size: ui.size
+			};
+		}
+
+		this.uiDialog.resizable( {
+			cancel: ".ui-dialog-content",
+			containment: "document",
+			alsoResize: this.element,
+			maxWidth: options.maxWidth,
+			maxHeight: options.maxHeight,
+			minWidth: options.minWidth,
+			minHeight: this._minHeight(),
+			handles: resizeHandles,
+			start: function( event, ui ) {
+				that._addClass( $( this ), "ui-dialog-resizing" );
+				that._blockFrames();
+				that._trigger( "resizeStart", event, filteredUi( ui ) );
+			},
+			resize: function( event, ui ) {
+				that._trigger( "resize", event, filteredUi( ui ) );
+			},
+			stop: function( event, ui ) {
+				var offset = that.uiDialog.offset(),
+					left = offset.left - that.document.scrollLeft(),
+					top = offset.top - that.document.scrollTop();
+
+				options.height = that.uiDialog.height();
+				options.width = that.uiDialog.width();
+				options.position = {
+					my: "left top",
+					at: "left" + ( left >= 0 ? "+" : "" ) + left + " " +
+						"top" + ( top >= 0 ? "+" : "" ) + top,
+					of: that.window
+				};
+				that._removeClass( $( this ), "ui-dialog-resizing" );
+				that._unblockFrames();
+				that._trigger( "resizeStop", event, filteredUi( ui ) );
+			}
+		} )
+			.css( "position", position );
+	},
+
+	_trackFocus: function() {
+		this._on( this.widget(), {
+			focusin: function( event ) {
+				this._makeFocusTarget();
+				this._focusedElement = $( event.target );
+			}
+		} );
+	},
+
+	_makeFocusTarget: function() {
+		this._untrackInstance();
+		this._trackingInstances().unshift( this );
+	},
+
+	_untrackInstance: function() {
+		var instances = this._trackingInstances(),
+			exists = $.inArray( this, instances );
+		if ( exists !== -1 ) {
+			instances.splice( exists, 1 );
+		}
+	},
+
+	_trackingInstances: function() {
+		var instances = this.document.data( "ui-dialog-instances" );
+		if ( !instances ) {
+			instances = [];
+			this.document.data( "ui-dialog-instances", instances );
+		}
+		return instances;
+	},
+
+	_minHeight: function() {
+		var options = this.options;
+
+		return options.height === "auto" ?
+			options.minHeight :
+			Math.min( options.minHeight, options.height );
+	},
+
+	_position: function() {
+
+		// Need to show the dialog to get the actual offset in the position plugin
+		var isVisible = this.uiDialog.is( ":visible" );
+		if ( !isVisible ) {
+			this.uiDialog.show();
+		}
+		this.uiDialog.position( this.options.position );
+		if ( !isVisible ) {
+			this.uiDialog.hide();
+		}
+	},
+
+	_setOptions: function( options ) {
+		var that = this,
+			resize = false,
+			resizableOptions = {};
+
+		$.each( options, function( key, value ) {
+			that._setOption( key, value );
+
+			if ( key in that.sizeRelatedOptions ) {
+				resize = true;
+			}
+			if ( key in that.resizableRelatedOptions ) {
+				resizableOptions[ key ] = value;
+			}
+		} );
+
+		if ( resize ) {
+			this._size();
+			this._position();
+		}
+		if ( this.uiDialog.is( ":data(ui-resizable)" ) ) {
+			this.uiDialog.resizable( "option", resizableOptions );
+		}
+	},
+
+	_setOption: function( key, value ) {
+		var isDraggable, isResizable,
+			uiDialog = this.uiDialog;
+
+		if ( key === "disabled" ) {
+			return;
+		}
+
+		this._super( key, value );
+
+		if ( key === "appendTo" ) {
+			this.uiDialog.appendTo( this._appendTo() );
+		}
+
+		if ( key === "buttons" ) {
+			this._createButtons();
+		}
+
+		if ( key === "closeText" ) {
+			this.uiDialogTitlebarClose.button( {
+
+				// Ensure that we always pass a string
+				label: $( "<a>" ).text( "" + this.options.closeText ).html()
+			} );
+		}
+
+		if ( key === "draggable" ) {
+			isDraggable = uiDialog.is( ":data(ui-draggable)" );
+			if ( isDraggable && !value ) {
+				uiDialog.draggable( "destroy" );
+			}
+
+			if ( !isDraggable && value ) {
+				this._makeDraggable();
+			}
+		}
+
+		if ( key === "position" ) {
+			this._position();
+		}
+
+		if ( key === "resizable" ) {
+
+			// currently resizable, becoming non-resizable
+			isResizable = uiDialog.is( ":data(ui-resizable)" );
+			if ( isResizable && !value ) {
+				uiDialog.resizable( "destroy" );
+			}
+
+			// Currently resizable, changing handles
+			if ( isResizable && typeof value === "string" ) {
+				uiDialog.resizable( "option", "handles", value );
+			}
+
+			// Currently non-resizable, becoming resizable
+			if ( !isResizable && value !== false ) {
+				this._makeResizable();
+			}
+		}
+
+		if ( key === "title" ) {
+			this._title( this.uiDialogTitlebar.find( ".ui-dialog-title" ) );
+		}
+	},
+
+	_size: function() {
+
+		// If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+		// divs will both have width and height set, so we need to reset them
+		var nonContentHeight, minContentHeight, maxContentHeight,
+			options = this.options;
+
+		// Reset content sizing
+		this.element.show().css( {
+			width: "auto",
+			minHeight: 0,
+			maxHeight: "none",
+			height: 0
+		} );
+
+		if ( options.minWidth > options.width ) {
+			options.width = options.minWidth;
+		}
+
+		// Reset wrapper sizing
+		// determine the height of all the non-content elements
+		nonContentHeight = this.uiDialog.css( {
+			height: "auto",
+			width: options.width
+		} )
+			.outerHeight();
+		minContentHeight = Math.max( 0, options.minHeight - nonContentHeight );
+		maxContentHeight = typeof options.maxHeight === "number" ?
+			Math.max( 0, options.maxHeight - nonContentHeight ) :
+			"none";
+
+		if ( options.height === "auto" ) {
+			this.element.css( {
+				minHeight: minContentHeight,
+				maxHeight: maxContentHeight,
+				height: "auto"
+			} );
+		} else {
+			this.element.height( Math.max( 0, options.height - nonContentHeight ) );
+		}
+
+		if ( this.uiDialog.is( ":data(ui-resizable)" ) ) {
+			this.uiDialog.resizable( "option", "minHeight", this._minHeight() );
+		}
+	},
+
+	_blockFrames: function() {
+		this.iframeBlocks = this.document.find( "iframe" ).map( function() {
+			var iframe = $( this );
+
+			return $( "<div>" )
+				.css( {
+					position: "absolute",
+					width: iframe.outerWidth(),
+					height: iframe.outerHeight()
+				} )
+				.appendTo( iframe.parent() )
+				.offset( iframe.offset() )[ 0 ];
+		} );
+	},
+
+	_unblockFrames: function() {
+		if ( this.iframeBlocks ) {
+			this.iframeBlocks.remove();
+			delete this.iframeBlocks;
+		}
+	},
+
+	_allowInteraction: function( event ) {
+		if ( $( event.target ).closest( ".ui-dialog" ).length ) {
+			return true;
+		}
+
+		// TODO: Remove hack when datepicker implements
+		// the .ui-front logic (#8989)
+		return !!$( event.target ).closest( ".ui-datepicker" ).length;
+	},
+
+	_createOverlay: function() {
+		if ( !this.options.modal ) {
+			return;
+		}
+
+		// We use a delay in case the overlay is created from an
+		// event that we're going to be cancelling (#2804)
+		var isOpening = true;
+		this._delay( function() {
+			isOpening = false;
+		} );
+
+		if ( !this.document.data( "ui-dialog-overlays" ) ) {
+
+			// Prevent use of anchors and inputs
+			// Using _on() for an event handler shared across many instances is
+			// safe because the dialogs stack and must be closed in reverse order
+			this._on( this.document, {
+				focusin: function( event ) {
+					if ( isOpening ) {
+						return;
+					}
+
+					if ( !this._allowInteraction( event ) ) {
+						event.preventDefault();
+						this._trackingInstances()[ 0 ]._focusTabbable();
+					}
+				}
+			} );
+		}
+
+		this.overlay = $( "<div>" )
+			.appendTo( this._appendTo() );
+
+		this._addClass( this.overlay, null, "ui-widget-overlay ui-front" );
+		this._on( this.overlay, {
+			mousedown: "_keepFocus"
+		} );
+		this.document.data( "ui-dialog-overlays",
+			( this.document.data( "ui-dialog-overlays" ) || 0 ) + 1 );
+	},
+
+	_destroyOverlay: function() {
+		if ( !this.options.modal ) {
+			return;
+		}
+
+		if ( this.overlay ) {
+			var overlays = this.document.data( "ui-dialog-overlays" ) - 1;
+
+			if ( !overlays ) {
+				this._off( this.document, "focusin" );
+				this.document.removeData( "ui-dialog-overlays" );
+			} else {
+				this.document.data( "ui-dialog-overlays", overlays );
+			}
+
+			this.overlay.remove();
+			this.overlay = null;
+		}
+	}
+} );
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for dialogClass option
+	$.widget( "ui.dialog", $.ui.dialog, {
+		options: {
+			dialogClass: ""
+		},
+		_createWrapper: function() {
+			this._super();
+			this.uiDialog.addClass( this.options.dialogClass );
+		},
+		_setOption: function( key, value ) {
+			if ( key === "dialogClass" ) {
+				this.uiDialog
+					.removeClass( this.options.dialogClass )
+					.addClass( value );
+			}
+			this._superApply( arguments );
+		}
+	} );
+}
+
+return $.ui.dialog;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/dialog.min.js b/wp-includes/js/jquery/ui/dialog.min.js
index 3c53a6ff48..d76e9d259f 100644
--- a/wp-includes/js/jquery/ui/dialog.min.js
+++ b/wp-includes/js/jquery/ui/dialog.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Dialog 1.11.4
+ * jQuery UI Dialog 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/dialog/
  */
-!function(i){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./button","./draggable","./mouse","./position","./resizable"],i):i(jQuery)}(function(h){return h.widget("ui.dialog",{version:"1.11.4",options:{appendTo:"body",autoOpen:!0,buttons:[],closeOnEscape:!0,closeText:"Close",dialogClass:"",draggable:!0,hide:null,height:"auto",maxHeight:null,maxWidth:null,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",of:window,collision:"fit",using:function(i){var t=h(this).css(i).offset().top;t<0&&h(this).css("top",i.top-t)}},resizable:!0,show:null,title:null,width:300,beforeClose:null,close:null,drag:null,dragStart:null,dragStop:null,focus:null,open:null,resize:null,resizeStart:null,resizeStop:null},sizeRelatedOptions:{buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},resizableRelatedOptions:{maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},_create:function(){this.originalCss={display:this.element[0].style.display,width:this.element[0].style.width,minHeight:this.element[0].style.minHeight,maxHeight:this.element[0].style.maxHeight,height:this.element[0].style.height},this.originalPosition={parent:this.element.parent(),index:this.element.parent().children().index(this.element)},this.originalTitle=this.element.attr("title"),this.options.title=this.options.title||this.originalTitle,this._createWrapper(),this.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(this.uiDialog),this._createTitlebar(),this._createButtonPane(),this.options.draggable&&h.fn.draggable&&this._makeDraggable(),this.options.resizable&&h.fn.resizable&&this._makeResizable(),this._isOpen=!1,this._trackFocus()},_init:function(){this.options.autoOpen&&this.open()},_appendTo:function(){var i=this.options.appendTo;return i&&(i.jquery||i.nodeType)?h(i):this.document.find(i||"body").eq(0)},_destroy:function(){var i,t=this.originalPosition;this._untrackInstance(),this._destroyOverlay(),this.element.removeUniqueId().removeClass("ui-dialog-content ui-widget-content").css(this.originalCss).detach(),this.uiDialog.stop(!0,!0).remove(),this.originalTitle&&this.element.attr("title",this.originalTitle),(i=t.parent.children().eq(t.index)).length&&i[0]!==this.element[0]?i.before(this.element):t.parent.append(this.element)},widget:function(){return this.uiDialog},disable:h.noop,enable:h.noop,close:function(i){var t,e=this;if(this._isOpen&&!1!==this._trigger("beforeClose",i)){if(this._isOpen=!1,this._focusedElement=null,this._destroyOverlay(),this._untrackInstance(),!this.opener.filter(":focusable").focus().length)try{(t=this.document[0].activeElement)&&"body"!==t.nodeName.toLowerCase()&&h(t).blur()}catch(i){}this._hide(this.uiDialog,this.options.hide,function(){e._trigger("close",i)})}},isOpen:function(){return this._isOpen},moveToTop:function(){this._moveToTop()},_moveToTop:function(i,t){var e=!1,o=this.uiDialog.siblings(".ui-front:visible").map(function(){return+h(this).css("z-index")}).get(),s=Math.max.apply(null,o);return s>=+this.uiDialog.css("z-index")&&(this.uiDialog.css("z-index",s+1),e=!0),e&&!t&&this._trigger("focus",i),e},open:function(){var i=this;this._isOpen?this._moveToTop()&&this._focusTabbable():(this._isOpen=!0,this.opener=h(this.document[0].activeElement),this._size(),this._position(),this._createOverlay(),this._moveToTop(null,!0),this.overlay&&this.overlay.css("z-index",this.uiDialog.css("z-index")-1),this._show(this.uiDialog,this.options.show,function(){i._focusTabbable(),i._trigger("focus")}),this._makeFocusTarget(),this._trigger("open"))},_focusTabbable:function(){var i=this._focusedElement;(i=i||this.element.find("[autofocus]")).length||(i=this.element.find(":tabbable")),i.length||(i=this.uiDialogButtonPane.find(":tabbable")),i.length||(i=this.uiDialogTitlebarClose.filter(":tabbable")),i.length||(i=this.uiDialog),i.eq(0).focus()},_keepFocus:function(i){function t(){var i=this.document[0].activeElement;this.uiDialog[0]===i||h.contains(this.uiDialog[0],i)||this._focusTabbable()}i.preventDefault(),t.call(this),this._delay(t)},_createWrapper:function(){this.uiDialog=h("<div>").addClass("ui-dialog ui-widget ui-widget-content ui-corner-all ui-front "+this.options.dialogClass).hide().attr({tabIndex:-1,role:"dialog"}).appendTo(this._appendTo()),this._on(this.uiDialog,{keydown:function(i){if(this.options.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===h.ui.keyCode.ESCAPE)return i.preventDefault(),void this.close(i);if(i.keyCode===h.ui.keyCode.TAB&&!i.isDefaultPrevented()){var t=this.uiDialog.find(":tabbable"),e=t.filter(":first"),o=t.filter(":last");i.target!==o[0]&&i.target!==this.uiDialog[0]||i.shiftKey?i.target!==e[0]&&i.target!==this.uiDialog[0]||!i.shiftKey||(this._delay(function(){o.focus()}),i.preventDefault()):(this._delay(function(){e.focus()}),i.preventDefault())}},mousedown:function(i){this._moveToTop(i)&&this._focusTabbable()}}),this.element.find("[aria-describedby]").length||this.uiDialog.attr({"aria-describedby":this.element.uniqueId().attr("id")})},_createTitlebar:function(){var i;this.uiDialogTitlebar=h("<div>").addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(this.uiDialog),this._on(this.uiDialogTitlebar,{mousedown:function(i){h(i.target).closest(".ui-dialog-titlebar-close")||this.uiDialog.focus()}}),this.uiDialogTitlebarClose=h("<button type='button'></button>").button({label:this.options.closeText,icons:{primary:"ui-icon-closethick"},text:!1}).addClass("ui-dialog-titlebar-close").appendTo(this.uiDialogTitlebar),this._on(this.uiDialogTitlebarClose,{click:function(i){i.preventDefault(),this.close(i)}}),i=h("<span>").uniqueId().addClass("ui-dialog-title").prependTo(this.uiDialogTitlebar),this._title(i),this.uiDialog.attr({"aria-labelledby":i.attr("id")})},_title:function(i){this.options.title||i.html("&#160;"),i.text(this.options.title)},_createButtonPane:function(){this.uiDialogButtonPane=h("<div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),this.uiButtonSet=h("<div>").addClass("ui-dialog-buttonset").appendTo(this.uiDialogButtonPane),this._createButtons()},_createButtons:function(){var s=this,i=this.options.buttons;this.uiDialogButtonPane.remove(),this.uiButtonSet.empty(),h.isEmptyObject(i)||h.isArray(i)&&!i.length?this.uiDialog.removeClass("ui-dialog-buttons"):(h.each(i,function(i,t){var e,o;t=h.isFunction(t)?{click:t,text:i}:t,t=h.extend({type:"button"},t),e=t.click,t.click=function(){e.apply(s.element[0],arguments)},o={icons:t.icons,text:t.showText},delete t.icons,delete t.showText,h("<button></button>",t).button(o).appendTo(s.uiButtonSet)}),this.uiDialog.addClass("ui-dialog-buttons"),this.uiDialogButtonPane.appendTo(this.uiDialog))},_makeDraggable:function(){var s=this,n=this.options;function a(i){return{position:i.position,offset:i.offset}}this.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(i,t){h(this).addClass("ui-dialog-dragging"),s._blockFrames(),s._trigger("dragStart",i,a(t))},drag:function(i,t){s._trigger("drag",i,a(t))},stop:function(i,t){var e=t.offset.left-s.document.scrollLeft(),o=t.offset.top-s.document.scrollTop();n.position={my:"left top",at:"left"+(0<=e?"+":"")+e+" top"+(0<=o?"+":"")+o,of:s.window},h(this).removeClass("ui-dialog-dragging"),s._unblockFrames(),s._trigger("dragStop",i,a(t))}})},_makeResizable:function(){var n=this,a=this.options,i=a.resizable,t=this.uiDialog.css("position"),e="string"==typeof i?i:"n,e,s,w,se,sw,ne,nw";function l(i){return{originalPosition:i.originalPosition,originalSize:i.originalSize,position:i.position,size:i.size}}this.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:this.element,maxWidth:a.maxWidth,maxHeight:a.maxHeight,minWidth:a.minWidth,minHeight:this._minHeight(),handles:e,start:function(i,t){h(this).addClass("ui-dialog-resizing"),n._blockFrames(),n._trigger("resizeStart",i,l(t))},resize:function(i,t){n._trigger("resize",i,l(t))},stop:function(i,t){var e=n.uiDialog.offset(),o=e.left-n.document.scrollLeft(),s=e.top-n.document.scrollTop();a.height=n.uiDialog.height(),a.width=n.uiDialog.width(),a.position={my:"left top",at:"left"+(0<=o?"+":"")+o+" top"+(0<=s?"+":"")+s,of:n.window},h(this).removeClass("ui-dialog-resizing"),n._unblockFrames(),n._trigger("resizeStop",i,l(t))}}).css("position",t)},_trackFocus:function(){this._on(this.widget(),{focusin:function(i){this._makeFocusTarget(),this._focusedElement=h(i.target)}})},_makeFocusTarget:function(){this._untrackInstance(),this._trackingInstances().unshift(this)},_untrackInstance:function(){var i=this._trackingInstances(),t=h.inArray(this,i);-1!==t&&i.splice(t,1)},_trackingInstances:function(){var i=this.document.data("ui-dialog-instances");return i||(i=[],this.document.data("ui-dialog-instances",i)),i},_minHeight:function(){var i=this.options;return"auto"===i.height?i.minHeight:Math.min(i.minHeight,i.height)},_position:function(){var i=this.uiDialog.is(":visible");i||this.uiDialog.show(),this.uiDialog.position(this.options.position),i||this.uiDialog.hide()},_setOptions:function(i){var e=this,o=!1,s={};h.each(i,function(i,t){e._setOption(i,t),i in e.sizeRelatedOptions&&(o=!0),i in e.resizableRelatedOptions&&(s[i]=t)}),o&&(this._size(),this._position()),this.uiDialog.is(":data(ui-resizable)")&&this.uiDialog.resizable("option",s)},_setOption:function(i,t){var e,o,s=this.uiDialog;"dialogClass"===i&&s.removeClass(this.options.dialogClass).addClass(t),"disabled"!==i&&(this._super(i,t),"appendTo"===i&&this.uiDialog.appendTo(this._appendTo()),"buttons"===i&&this._createButtons(),"closeText"===i&&this.uiDialogTitlebarClose.button({label:""+t}),"draggable"===i&&((e=s.is(":data(ui-draggable)"))&&!t&&s.draggable("destroy"),!e&&t&&this._makeDraggable()),"position"===i&&this._position(),"resizable"===i&&((o=s.is(":data(ui-resizable)"))&&!t&&s.resizable("destroy"),o&&"string"==typeof t&&s.resizable("option","handles",t),o||!1===t||this._makeResizable()),"title"===i&&this._title(this.uiDialogTitlebar.find(".ui-dialog-title")))},_size:function(){var i,t,e,o=this.options;this.element.show().css({width:"auto",minHeight:0,maxHeight:"none",height:0}),o.minWidth>o.width&&(o.width=o.minWidth),i=this.uiDialog.css({height:"auto",width:o.width}).outerHeight(),t=Math.max(0,o.minHeight-i),e="number"==typeof o.maxHeight?Math.max(0,o.maxHeight-i):"none","auto"===o.height?this.element.css({minHeight:t,maxHeight:e,height:"auto"}):this.element.height(Math.max(0,o.height-i)),this.uiDialog.is(":data(ui-resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())},_blockFrames:function(){this.iframeBlocks=this.document.find("iframe").map(function(){var i=h(this);return h("<div>").css({position:"absolute",width:i.outerWidth(),height:i.outerHeight()}).appendTo(i.parent()).offset(i.offset())[0]})},_unblockFrames:function(){this.iframeBlocks&&(this.iframeBlocks.remove(),delete this.iframeBlocks)},_allowInteraction:function(i){return!!h(i.target).closest(".ui-dialog").length||!!h(i.target).closest(".ui-datepicker").length},_createOverlay:function(){if(this.options.modal){var t=!0;this._delay(function(){t=!1}),this.document.data("ui-dialog-overlays")||this._on(this.document,{focusin:function(i){t||this._allowInteraction(i)||(i.preventDefault(),this._trackingInstances()[0]._focusTabbable())}}),this.overlay=h("<div>").addClass("ui-widget-overlay ui-front").appendTo(this._appendTo()),this._on(this.overlay,{mousedown:"_keepFocus"}),this.document.data("ui-dialog-overlays",(this.document.data("ui-dialog-overlays")||0)+1)}},_destroyOverlay:function(){if(this.options.modal&&this.overlay){var i=this.document.data("ui-dialog-overlays")-1;i?this.document.data("ui-dialog-overlays",i):this.document.unbind("focusin").removeData("ui-dialog-overlays"),this.overlay.remove(),this.overlay=null}}})});
\ No newline at end of file
+!function(i){"function"==typeof define&&define.amd?define(["jquery","./button","./draggable","./mouse","./resizable","./core"],i):i(jQuery)}(function(h){return h.widget("ui.dialog",{version:"1.12.1",options:{appendTo:"body",autoOpen:!0,buttons:[],classes:{"ui-dialog":"ui-corner-all","ui-dialog-titlebar":"ui-corner-all"},closeOnEscape:!0,closeText:"Close",draggable:!0,hide:null,height:"auto",maxHeight:null,maxWidth:null,minHeight:150,minWidth:150,modal:!1,position:{my:"center",at:"center",of:window,collision:"fit",using:function(i){var t=h(this).css(i).offset().top;t<0&&h(this).css("top",i.top-t)}},resizable:!0,show:null,title:null,width:300,beforeClose:null,close:null,drag:null,dragStart:null,dragStop:null,focus:null,open:null,resize:null,resizeStart:null,resizeStop:null},sizeRelatedOptions:{buttons:!0,height:!0,maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0,width:!0},resizableRelatedOptions:{maxHeight:!0,maxWidth:!0,minHeight:!0,minWidth:!0},_create:function(){this.originalCss={display:this.element[0].style.display,width:this.element[0].style.width,minHeight:this.element[0].style.minHeight,maxHeight:this.element[0].style.maxHeight,height:this.element[0].style.height},this.originalPosition={parent:this.element.parent(),index:this.element.parent().children().index(this.element)},this.originalTitle=this.element.attr("title"),null==this.options.title&&null!=this.originalTitle&&(this.options.title=this.originalTitle),this.options.disabled&&(this.options.disabled=!1),this._createWrapper(),this.element.show().removeAttr("title").appendTo(this.uiDialog),this._addClass("ui-dialog-content","ui-widget-content"),this._createTitlebar(),this._createButtonPane(),this.options.draggable&&h.fn.draggable&&this._makeDraggable(),this.options.resizable&&h.fn.resizable&&this._makeResizable(),this._isOpen=!1,this._trackFocus()},_init:function(){this.options.autoOpen&&this.open()},_appendTo:function(){var i=this.options.appendTo;return i&&(i.jquery||i.nodeType)?h(i):this.document.find(i||"body").eq(0)},_destroy:function(){var i,t=this.originalPosition;this._untrackInstance(),this._destroyOverlay(),this.element.removeUniqueId().css(this.originalCss).detach(),this.uiDialog.remove(),this.originalTitle&&this.element.attr("title",this.originalTitle),(i=t.parent.children().eq(t.index)).length&&i[0]!==this.element[0]?i.before(this.element):t.parent.append(this.element)},widget:function(){return this.uiDialog},disable:h.noop,enable:h.noop,close:function(i){var t=this;this._isOpen&&!1!==this._trigger("beforeClose",i)&&(this._isOpen=!1,this._focusedElement=null,this._destroyOverlay(),this._untrackInstance(),this.opener.filter(":focusable").trigger("focus").length||h.ui.safeBlur(h.ui.safeActiveElement(this.document[0])),this._hide(this.uiDialog,this.options.hide,function(){t._trigger("close",i)}))},isOpen:function(){return this._isOpen},moveToTop:function(){this._moveToTop()},_moveToTop:function(i,t){var e=!1,o=this.uiDialog.siblings(".ui-front:visible").map(function(){return+h(this).css("z-index")}).get(),s=Math.max.apply(null,o);return s>=+this.uiDialog.css("z-index")&&(this.uiDialog.css("z-index",s+1),e=!0),e&&!t&&this._trigger("focus",i),e},open:function(){var i=this;this._isOpen?this._moveToTop()&&this._focusTabbable():(this._isOpen=!0,this.opener=h(h.ui.safeActiveElement(this.document[0])),this._size(),this._position(),this._createOverlay(),this._moveToTop(null,!0),this.overlay&&this.overlay.css("z-index",this.uiDialog.css("z-index")-1),this._show(this.uiDialog,this.options.show,function(){i._focusTabbable(),i._trigger("focus")}),this._makeFocusTarget(),this._trigger("open"))},_focusTabbable:function(){var i=this._focusedElement;(i=i||this.element.find("[autofocus]")).length||(i=this.element.find(":tabbable")),i.length||(i=this.uiDialogButtonPane.find(":tabbable")),i.length||(i=this.uiDialogTitlebarClose.filter(":tabbable")),i.length||(i=this.uiDialog),i.eq(0).trigger("focus")},_keepFocus:function(i){function t(){var i=h.ui.safeActiveElement(this.document[0]);this.uiDialog[0]===i||h.contains(this.uiDialog[0],i)||this._focusTabbable()}i.preventDefault(),t.call(this),this._delay(t)},_createWrapper:function(){this.uiDialog=h("<div>").hide().attr({tabIndex:-1,role:"dialog"}).appendTo(this._appendTo()),this._addClass(this.uiDialog,"ui-dialog","ui-widget ui-widget-content ui-front"),this._on(this.uiDialog,{keydown:function(i){if(this.options.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===h.ui.keyCode.ESCAPE)return i.preventDefault(),void this.close(i);if(i.keyCode===h.ui.keyCode.TAB&&!i.isDefaultPrevented()){var t=this.uiDialog.find(":tabbable"),e=t.filter(":first"),o=t.filter(":last");i.target!==o[0]&&i.target!==this.uiDialog[0]||i.shiftKey?i.target!==e[0]&&i.target!==this.uiDialog[0]||!i.shiftKey||(this._delay(function(){o.trigger("focus")}),i.preventDefault()):(this._delay(function(){e.trigger("focus")}),i.preventDefault())}},mousedown:function(i){this._moveToTop(i)&&this._focusTabbable()}}),this.element.find("[aria-describedby]").length||this.uiDialog.attr({"aria-describedby":this.element.uniqueId().attr("id")})},_createTitlebar:function(){var i;this.uiDialogTitlebar=h("<div>"),this._addClass(this.uiDialogTitlebar,"ui-dialog-titlebar","ui-widget-header ui-helper-clearfix"),this._on(this.uiDialogTitlebar,{mousedown:function(i){h(i.target).closest(".ui-dialog-titlebar-close")||this.uiDialog.trigger("focus")}}),this.uiDialogTitlebarClose=h("<button type='button'></button>").button({label:h("<a>").text(this.options.closeText).html(),icon:"ui-icon-closethick",showLabel:!1}).appendTo(this.uiDialogTitlebar),this._addClass(this.uiDialogTitlebarClose,"ui-dialog-titlebar-close"),this._on(this.uiDialogTitlebarClose,{click:function(i){i.preventDefault(),this.close(i)}}),i=h("<span>").uniqueId().prependTo(this.uiDialogTitlebar),this._addClass(i,"ui-dialog-title"),this._title(i),this.uiDialogTitlebar.prependTo(this.uiDialog),this.uiDialog.attr({"aria-labelledby":i.attr("id")})},_title:function(i){this.options.title?i.text(this.options.title):i.html("&#160;")},_createButtonPane:function(){this.uiDialogButtonPane=h("<div>"),this._addClass(this.uiDialogButtonPane,"ui-dialog-buttonpane","ui-widget-content ui-helper-clearfix"),this.uiButtonSet=h("<div>").appendTo(this.uiDialogButtonPane),this._addClass(this.uiButtonSet,"ui-dialog-buttonset"),this._createButtons()},_createButtons:function(){var s=this,i=this.options.buttons;this.uiDialogButtonPane.remove(),this.uiButtonSet.empty(),h.isEmptyObject(i)||h.isArray(i)&&!i.length?this._removeClass(this.uiDialog,"ui-dialog-buttons"):(h.each(i,function(i,t){var e,o;t=h.isFunction(t)?{click:t,text:i}:t,t=h.extend({type:"button"},t),e=t.click,o={icon:t.icon,iconPosition:t.iconPosition,showLabel:t.showLabel,icons:t.icons,text:t.text},delete t.click,delete t.icon,delete t.iconPosition,delete t.showLabel,delete t.icons,"boolean"==typeof t.text&&delete t.text,h("<button></button>",t).button(o).appendTo(s.uiButtonSet).on("click",function(){e.apply(s.element[0],arguments)})}),this._addClass(this.uiDialog,"ui-dialog-buttons"),this.uiDialogButtonPane.appendTo(this.uiDialog))},_makeDraggable:function(){var s=this,n=this.options;function a(i){return{position:i.position,offset:i.offset}}this.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(i,t){s._addClass(h(this),"ui-dialog-dragging"),s._blockFrames(),s._trigger("dragStart",i,a(t))},drag:function(i,t){s._trigger("drag",i,a(t))},stop:function(i,t){var e=t.offset.left-s.document.scrollLeft(),o=t.offset.top-s.document.scrollTop();n.position={my:"left top",at:"left"+(0<=e?"+":"")+e+" top"+(0<=o?"+":"")+o,of:s.window},s._removeClass(h(this),"ui-dialog-dragging"),s._unblockFrames(),s._trigger("dragStop",i,a(t))}})},_makeResizable:function(){var n=this,a=this.options,i=a.resizable,t=this.uiDialog.css("position"),e="string"==typeof i?i:"n,e,s,w,se,sw,ne,nw";function l(i){return{originalPosition:i.originalPosition,originalSize:i.originalSize,position:i.position,size:i.size}}this.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:this.element,maxWidth:a.maxWidth,maxHeight:a.maxHeight,minWidth:a.minWidth,minHeight:this._minHeight(),handles:e,start:function(i,t){n._addClass(h(this),"ui-dialog-resizing"),n._blockFrames(),n._trigger("resizeStart",i,l(t))},resize:function(i,t){n._trigger("resize",i,l(t))},stop:function(i,t){var e=n.uiDialog.offset(),o=e.left-n.document.scrollLeft(),s=e.top-n.document.scrollTop();a.height=n.uiDialog.height(),a.width=n.uiDialog.width(),a.position={my:"left top",at:"left"+(0<=o?"+":"")+o+" top"+(0<=s?"+":"")+s,of:n.window},n._removeClass(h(this),"ui-dialog-resizing"),n._unblockFrames(),n._trigger("resizeStop",i,l(t))}}).css("position",t)},_trackFocus:function(){this._on(this.widget(),{focusin:function(i){this._makeFocusTarget(),this._focusedElement=h(i.target)}})},_makeFocusTarget:function(){this._untrackInstance(),this._trackingInstances().unshift(this)},_untrackInstance:function(){var i=this._trackingInstances(),t=h.inArray(this,i);-1!==t&&i.splice(t,1)},_trackingInstances:function(){var i=this.document.data("ui-dialog-instances");return i||(i=[],this.document.data("ui-dialog-instances",i)),i},_minHeight:function(){var i=this.options;return"auto"===i.height?i.minHeight:Math.min(i.minHeight,i.height)},_position:function(){var i=this.uiDialog.is(":visible");i||this.uiDialog.show(),this.uiDialog.position(this.options.position),i||this.uiDialog.hide()},_setOptions:function(i){var e=this,o=!1,s={};h.each(i,function(i,t){e._setOption(i,t),i in e.sizeRelatedOptions&&(o=!0),i in e.resizableRelatedOptions&&(s[i]=t)}),o&&(this._size(),this._position()),this.uiDialog.is(":data(ui-resizable)")&&this.uiDialog.resizable("option",s)},_setOption:function(i,t){var e,o,s=this.uiDialog;"disabled"!==i&&(this._super(i,t),"appendTo"===i&&this.uiDialog.appendTo(this._appendTo()),"buttons"===i&&this._createButtons(),"closeText"===i&&this.uiDialogTitlebarClose.button({label:h("<a>").text(""+this.options.closeText).html()}),"draggable"===i&&((e=s.is(":data(ui-draggable)"))&&!t&&s.draggable("destroy"),!e&&t&&this._makeDraggable()),"position"===i&&this._position(),"resizable"===i&&((o=s.is(":data(ui-resizable)"))&&!t&&s.resizable("destroy"),o&&"string"==typeof t&&s.resizable("option","handles",t),o||!1===t||this._makeResizable()),"title"===i&&this._title(this.uiDialogTitlebar.find(".ui-dialog-title")))},_size:function(){var i,t,e,o=this.options;this.element.show().css({width:"auto",minHeight:0,maxHeight:"none",height:0}),o.minWidth>o.width&&(o.width=o.minWidth),i=this.uiDialog.css({height:"auto",width:o.width}).outerHeight(),t=Math.max(0,o.minHeight-i),e="number"==typeof o.maxHeight?Math.max(0,o.maxHeight-i):"none","auto"===o.height?this.element.css({minHeight:t,maxHeight:e,height:"auto"}):this.element.height(Math.max(0,o.height-i)),this.uiDialog.is(":data(ui-resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())},_blockFrames:function(){this.iframeBlocks=this.document.find("iframe").map(function(){var i=h(this);return h("<div>").css({position:"absolute",width:i.outerWidth(),height:i.outerHeight()}).appendTo(i.parent()).offset(i.offset())[0]})},_unblockFrames:function(){this.iframeBlocks&&(this.iframeBlocks.remove(),delete this.iframeBlocks)},_allowInteraction:function(i){return!!h(i.target).closest(".ui-dialog").length||!!h(i.target).closest(".ui-datepicker").length},_createOverlay:function(){if(this.options.modal){var t=!0;this._delay(function(){t=!1}),this.document.data("ui-dialog-overlays")||this._on(this.document,{focusin:function(i){t||this._allowInteraction(i)||(i.preventDefault(),this._trackingInstances()[0]._focusTabbable())}}),this.overlay=h("<div>").appendTo(this._appendTo()),this._addClass(this.overlay,null,"ui-widget-overlay ui-front"),this._on(this.overlay,{mousedown:"_keepFocus"}),this.document.data("ui-dialog-overlays",(this.document.data("ui-dialog-overlays")||0)+1)}},_destroyOverlay:function(){if(this.options.modal&&this.overlay){var i=this.document.data("ui-dialog-overlays")-1;i?this.document.data("ui-dialog-overlays",i):(this._off(this.document,"focusin"),this.document.removeData("ui-dialog-overlays")),this.overlay.remove(),this.overlay=null}}}),!1!==h.uiBackCompat&&h.widget("ui.dialog",h.ui.dialog,{options:{dialogClass:""},_createWrapper:function(){this._super(),this.uiDialog.addClass(this.options.dialogClass)},_setOption:function(i,t){"dialogClass"===i&&this.uiDialog.removeClass(this.options.dialogClass).addClass(t),this._superApply(arguments)}}),h.ui.dialog});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/draggable.js b/wp-includes/js/jquery/ui/draggable.js
new file mode 100644
index 0000000000..7a1746fd19
--- /dev/null
+++ b/wp-includes/js/jquery/ui/draggable.js
@@ -0,0 +1,1244 @@
+/*!
+ * jQuery UI Draggable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Draggable
+//>>group: Interactions
+//>>description: Enables dragging functionality for any element.
+//>>docs: http://api.jqueryui.com/draggable/
+//>>demos: http://jqueryui.com/draggable/
+//>>css.structure: ../../themes/base/draggable.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./mouse",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.draggable", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "drag",
+	options: {
+		addClasses: true,
+		appendTo: "parent",
+		axis: false,
+		connectToSortable: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		iframeFix: false,
+		opacity: false,
+		refreshPositions: false,
+		revert: false,
+		revertDuration: 500,
+		scope: "default",
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		snap: false,
+		snapMode: "both",
+		snapTolerance: 20,
+		stack: false,
+		zIndex: false,
+
+		// Callbacks
+		drag: null,
+		start: null,
+		stop: null
+	},
+	_create: function() {
+
+		if ( this.options.helper === "original" ) {
+			this._setPositionRelative();
+		}
+		if ( this.options.addClasses ) {
+			this._addClass( "ui-draggable" );
+		}
+		this._setHandleClassName();
+
+		this._mouseInit();
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+		if ( key === "handle" ) {
+			this._removeHandleClassName();
+			this._setHandleClassName();
+		}
+	},
+
+	_destroy: function() {
+		if ( ( this.helper || this.element ).is( ".ui-draggable-dragging" ) ) {
+			this.destroyOnClear = true;
+			return;
+		}
+		this._removeHandleClassName();
+		this._mouseDestroy();
+	},
+
+	_mouseCapture: function( event ) {
+		var o = this.options;
+
+		// Among others, prevent a drag on a resizable-handle
+		if ( this.helper || o.disabled ||
+				$( event.target ).closest( ".ui-resizable-handle" ).length > 0 ) {
+			return false;
+		}
+
+		//Quit if we're not on a valid handle
+		this.handle = this._getHandle( event );
+		if ( !this.handle ) {
+			return false;
+		}
+
+		this._blurActiveElement( event );
+
+		this._blockFrames( o.iframeFix === true ? "iframe" : o.iframeFix );
+
+		return true;
+
+	},
+
+	_blockFrames: function( selector ) {
+		this.iframeBlocks = this.document.find( selector ).map( function() {
+			var iframe = $( this );
+
+			return $( "<div>" )
+				.css( "position", "absolute" )
+				.appendTo( iframe.parent() )
+				.outerWidth( iframe.outerWidth() )
+				.outerHeight( iframe.outerHeight() )
+				.offset( iframe.offset() )[ 0 ];
+		} );
+	},
+
+	_unblockFrames: function() {
+		if ( this.iframeBlocks ) {
+			this.iframeBlocks.remove();
+			delete this.iframeBlocks;
+		}
+	},
+
+	_blurActiveElement: function( event ) {
+		var activeElement = $.ui.safeActiveElement( this.document[ 0 ] ),
+			target = $( event.target );
+
+		// Don't blur if the event occurred on an element that is within
+		// the currently focused element
+		// See #10527, #12472
+		if ( target.closest( activeElement ).length ) {
+			return;
+		}
+
+		// Blur any element that currently has focus, see #4261
+		$.ui.safeBlur( activeElement );
+	},
+
+	_mouseStart: function( event ) {
+
+		var o = this.options;
+
+		//Create and append the visible helper
+		this.helper = this._createHelper( event );
+
+		this._addClass( this.helper, "ui-draggable-dragging" );
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		//If ddmanager is used for droppables, set the global draggable
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.current = this;
+		}
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Store the helper's css position
+		this.cssPosition = this.helper.css( "position" );
+		this.scrollParent = this.helper.scrollParent( true );
+		this.offsetParent = this.helper.offsetParent();
+		this.hasFixedAncestor = this.helper.parents().filter( function() {
+				return $( this ).css( "position" ) === "fixed";
+			} ).length > 0;
+
+		//The element's absolute position on the page minus margins
+		this.positionAbs = this.element.offset();
+		this._refreshOffsets( event );
+
+		//Generate the original position
+		this.originalPosition = this.position = this._generatePosition( event, false );
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+		( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) );
+
+		//Set a containment if given in the options
+		this._setContainment();
+
+		//Trigger event + callbacks
+		if ( this._trigger( "start", event ) === false ) {
+			this._clear();
+			return false;
+		}
+
+		//Recache the helper size
+		this._cacheHelperProportions();
+
+		//Prepare the droppable offsets
+		if ( $.ui.ddmanager && !o.dropBehaviour ) {
+			$.ui.ddmanager.prepareOffsets( this, event );
+		}
+
+		// Execute the drag once - this causes the helper not to be visible before getting its
+		// correct position
+		this._mouseDrag( event, true );
+
+		// If the ddmanager is used for droppables, inform the manager that dragging has started
+		// (see #5003)
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.dragStart( this, event );
+		}
+
+		return true;
+	},
+
+	_refreshOffsets: function( event ) {
+		this.offset = {
+			top: this.positionAbs.top - this.margins.top,
+			left: this.positionAbs.left - this.margins.left,
+			scroll: false,
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset()
+		};
+
+		this.offset.click = {
+			left: event.pageX - this.offset.left,
+			top: event.pageY - this.offset.top
+		};
+	},
+
+	_mouseDrag: function( event, noPropagation ) {
+
+		// reset any necessary cached properties (see #5009)
+		if ( this.hasFixedAncestor ) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		//Compute the helpers position
+		this.position = this._generatePosition( event, true );
+		this.positionAbs = this._convertPositionTo( "absolute" );
+
+		//Call plugins and callbacks and use the resulting position if something is returned
+		if ( !noPropagation ) {
+			var ui = this._uiHash();
+			if ( this._trigger( "drag", event, ui ) === false ) {
+				this._mouseUp( new $.Event( "mouseup", event ) );
+				return false;
+			}
+			this.position = ui.position;
+		}
+
+		this.helper[ 0 ].style.left = this.position.left + "px";
+		this.helper[ 0 ].style.top = this.position.top + "px";
+
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.drag( this, event );
+		}
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+
+		//If we are using droppables, inform the manager about the drop
+		var that = this,
+			dropped = false;
+		if ( $.ui.ddmanager && !this.options.dropBehaviour ) {
+			dropped = $.ui.ddmanager.drop( this, event );
+		}
+
+		//if a drop comes from outside (a sortable)
+		if ( this.dropped ) {
+			dropped = this.dropped;
+			this.dropped = false;
+		}
+
+		if ( ( this.options.revert === "invalid" && !dropped ) ||
+				( this.options.revert === "valid" && dropped ) ||
+				this.options.revert === true || ( $.isFunction( this.options.revert ) &&
+				this.options.revert.call( this.element, dropped ) )
+		) {
+			$( this.helper ).animate(
+				this.originalPosition,
+				parseInt( this.options.revertDuration, 10 ),
+				function() {
+					if ( that._trigger( "stop", event ) !== false ) {
+						that._clear();
+					}
+				}
+			);
+		} else {
+			if ( this._trigger( "stop", event ) !== false ) {
+				this._clear();
+			}
+		}
+
+		return false;
+	},
+
+	_mouseUp: function( event ) {
+		this._unblockFrames();
+
+		// If the ddmanager is used for droppables, inform the manager that dragging has stopped
+		// (see #5003)
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.dragStop( this, event );
+		}
+
+		// Only need to focus if the event occurred on the draggable itself, see #10527
+		if ( this.handleElement.is( event.target ) ) {
+
+			// The interaction is over; whether or not the click resulted in a drag,
+			// focus the element
+			this.element.trigger( "focus" );
+		}
+
+		return $.ui.mouse.prototype._mouseUp.call( this, event );
+	},
+
+	cancel: function() {
+
+		if ( this.helper.is( ".ui-draggable-dragging" ) ) {
+			this._mouseUp( new $.Event( "mouseup", { target: this.element[ 0 ] } ) );
+		} else {
+			this._clear();
+		}
+
+		return this;
+
+	},
+
+	_getHandle: function( event ) {
+		return this.options.handle ?
+			!!$( event.target ).closest( this.element.find( this.options.handle ) ).length :
+			true;
+	},
+
+	_setHandleClassName: function() {
+		this.handleElement = this.options.handle ?
+			this.element.find( this.options.handle ) : this.element;
+		this._addClass( this.handleElement, "ui-draggable-handle" );
+	},
+
+	_removeHandleClassName: function() {
+		this._removeClass( this.handleElement, "ui-draggable-handle" );
+	},
+
+	_createHelper: function( event ) {
+
+		var o = this.options,
+			helperIsFunction = $.isFunction( o.helper ),
+			helper = helperIsFunction ?
+				$( o.helper.apply( this.element[ 0 ], [ event ] ) ) :
+				( o.helper === "clone" ?
+					this.element.clone().removeAttr( "id" ) :
+					this.element );
+
+		if ( !helper.parents( "body" ).length ) {
+			helper.appendTo( ( o.appendTo === "parent" ?
+				this.element[ 0 ].parentNode :
+				o.appendTo ) );
+		}
+
+		// Http://bugs.jqueryui.com/ticket/9446
+		// a helper function can return the original element
+		// which wouldn't have been set to relative in _create
+		if ( helperIsFunction && helper[ 0 ] === this.element[ 0 ] ) {
+			this._setPositionRelative();
+		}
+
+		if ( helper[ 0 ] !== this.element[ 0 ] &&
+				!( /(fixed|absolute)/ ).test( helper.css( "position" ) ) ) {
+			helper.css( "position", "absolute" );
+		}
+
+		return helper;
+
+	},
+
+	_setPositionRelative: function() {
+		if ( !( /^(?:r|a|f)/ ).test( this.element.css( "position" ) ) ) {
+			this.element[ 0 ].style.position = "relative";
+		}
+	},
+
+	_adjustOffsetFromHelper: function( obj ) {
+		if ( typeof obj === "string" ) {
+			obj = obj.split( " " );
+		}
+		if ( $.isArray( obj ) ) {
+			obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 };
+		}
+		if ( "left" in obj ) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ( "right" in obj ) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ( "top" in obj ) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ( "bottom" in obj ) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_isRootNode: function( element ) {
+		return ( /(html|body)/i ).test( element.tagName ) || element === this.document[ 0 ];
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		var po = this.offsetParent.offset(),
+			document = this.document[ 0 ];
+
+		// This is a special case where we need to modify a offset calculated on start, since the
+		// following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the
+		// next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
+		// the document, which means that the scroll is included in the initial calculation of the
+		// offset of the parent, and never recalculated upon drag
+		if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== document &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if ( this._isRootNode( this.offsetParent[ 0 ] ) ) {
+			po = { top: 0, left: 0 };
+		}
+
+		return {
+			top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ),
+			left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 )
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+		if ( this.cssPosition !== "relative" ) {
+			return { top: 0, left: 0 };
+		}
+
+		var p = this.element.position(),
+			scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] );
+
+		return {
+			top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) +
+				( !scrollIsRootNode ? this.scrollParent.scrollTop() : 0 ),
+			left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) +
+				( !scrollIsRootNode ? this.scrollParent.scrollLeft() : 0 )
+		};
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: ( parseInt( this.element.css( "marginLeft" ), 10 ) || 0 ),
+			top: ( parseInt( this.element.css( "marginTop" ), 10 ) || 0 ),
+			right: ( parseInt( this.element.css( "marginRight" ), 10 ) || 0 ),
+			bottom: ( parseInt( this.element.css( "marginBottom" ), 10 ) || 0 )
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var isUserScrollable, c, ce,
+			o = this.options,
+			document = this.document[ 0 ];
+
+		this.relativeContainer = null;
+
+		if ( !o.containment ) {
+			this.containment = null;
+			return;
+		}
+
+		if ( o.containment === "window" ) {
+			this.containment = [
+				$( window ).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
+				$( window ).scrollTop() - this.offset.relative.top - this.offset.parent.top,
+				$( window ).scrollLeft() + $( window ).width() -
+					this.helperProportions.width - this.margins.left,
+				$( window ).scrollTop() +
+					( $( window ).height() || document.body.parentNode.scrollHeight ) -
+					this.helperProportions.height - this.margins.top
+			];
+			return;
+		}
+
+		if ( o.containment === "document" ) {
+			this.containment = [
+				0,
+				0,
+				$( document ).width() - this.helperProportions.width - this.margins.left,
+				( $( document ).height() || document.body.parentNode.scrollHeight ) -
+					this.helperProportions.height - this.margins.top
+			];
+			return;
+		}
+
+		if ( o.containment.constructor === Array ) {
+			this.containment = o.containment;
+			return;
+		}
+
+		if ( o.containment === "parent" ) {
+			o.containment = this.helper[ 0 ].parentNode;
+		}
+
+		c = $( o.containment );
+		ce = c[ 0 ];
+
+		if ( !ce ) {
+			return;
+		}
+
+		isUserScrollable = /(scroll|auto)/.test( c.css( "overflow" ) );
+
+		this.containment = [
+			( parseInt( c.css( "borderLeftWidth" ), 10 ) || 0 ) +
+				( parseInt( c.css( "paddingLeft" ), 10 ) || 0 ),
+			( parseInt( c.css( "borderTopWidth" ), 10 ) || 0 ) +
+				( parseInt( c.css( "paddingTop" ), 10 ) || 0 ),
+			( isUserScrollable ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) -
+				( parseInt( c.css( "borderRightWidth" ), 10 ) || 0 ) -
+				( parseInt( c.css( "paddingRight" ), 10 ) || 0 ) -
+				this.helperProportions.width -
+				this.margins.left -
+				this.margins.right,
+			( isUserScrollable ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) -
+				( parseInt( c.css( "borderBottomWidth" ), 10 ) || 0 ) -
+				( parseInt( c.css( "paddingBottom" ), 10 ) || 0 ) -
+				this.helperProportions.height -
+				this.margins.top -
+				this.margins.bottom
+		];
+		this.relativeContainer = c;
+	},
+
+	_convertPositionTo: function( d, pos ) {
+
+		if ( !pos ) {
+			pos = this.position;
+		}
+
+		var mod = d === "absolute" ? 1 : -1,
+			scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] );
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pos.top	+
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top * mod -
+				( ( this.cssPosition === "fixed" ?
+					-this.offset.scroll.top :
+					( scrollIsRootNode ? 0 : this.offset.scroll.top ) ) * mod )
+			),
+			left: (
+
+				// The absolute mouse position
+				pos.left +
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left * mod	-
+				( ( this.cssPosition === "fixed" ?
+					-this.offset.scroll.left :
+					( scrollIsRootNode ? 0 : this.offset.scroll.left ) ) * mod )
+			)
+		};
+
+	},
+
+	_generatePosition: function( event, constrainPosition ) {
+
+		var containment, co, top, left,
+			o = this.options,
+			scrollIsRootNode = this._isRootNode( this.scrollParent[ 0 ] ),
+			pageX = event.pageX,
+			pageY = event.pageY;
+
+		// Cache the scroll
+		if ( !scrollIsRootNode || !this.offset.scroll ) {
+			this.offset.scroll = {
+				top: this.scrollParent.scrollTop(),
+				left: this.scrollParent.scrollLeft()
+			};
+		}
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		// If we are not dragging yet, we won't check for options
+		if ( constrainPosition ) {
+			if ( this.containment ) {
+				if ( this.relativeContainer ) {
+					co = this.relativeContainer.offset();
+					containment = [
+						this.containment[ 0 ] + co.left,
+						this.containment[ 1 ] + co.top,
+						this.containment[ 2 ] + co.left,
+						this.containment[ 3 ] + co.top
+					];
+				} else {
+					containment = this.containment;
+				}
+
+				if ( event.pageX - this.offset.click.left < containment[ 0 ] ) {
+					pageX = containment[ 0 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top < containment[ 1 ] ) {
+					pageY = containment[ 1 ] + this.offset.click.top;
+				}
+				if ( event.pageX - this.offset.click.left > containment[ 2 ] ) {
+					pageX = containment[ 2 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top > containment[ 3 ] ) {
+					pageY = containment[ 3 ] + this.offset.click.top;
+				}
+			}
+
+			if ( o.grid ) {
+
+				//Check for grid elements set to 0 to prevent divide by 0 error causing invalid
+				// argument errors in IE (see ticket #6950)
+				top = o.grid[ 1 ] ? this.originalPageY + Math.round( ( pageY -
+					this.originalPageY ) / o.grid[ 1 ] ) * o.grid[ 1 ] : this.originalPageY;
+				pageY = containment ? ( ( top - this.offset.click.top >= containment[ 1 ] ||
+					top - this.offset.click.top > containment[ 3 ] ) ?
+						top :
+						( ( top - this.offset.click.top >= containment[ 1 ] ) ?
+							top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) : top;
+
+				left = o.grid[ 0 ] ? this.originalPageX +
+					Math.round( ( pageX - this.originalPageX ) / o.grid[ 0 ] ) * o.grid[ 0 ] :
+					this.originalPageX;
+				pageX = containment ? ( ( left - this.offset.click.left >= containment[ 0 ] ||
+					left - this.offset.click.left > containment[ 2 ] ) ?
+						left :
+						( ( left - this.offset.click.left >= containment[ 0 ] ) ?
+							left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) : left;
+			}
+
+			if ( o.axis === "y" ) {
+				pageX = this.originalPageX;
+			}
+
+			if ( o.axis === "x" ) {
+				pageY = this.originalPageY;
+			}
+		}
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pageY -
+
+				// Click offset (relative to the element)
+				this.offset.click.top -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top +
+				( this.cssPosition === "fixed" ?
+					-this.offset.scroll.top :
+					( scrollIsRootNode ? 0 : this.offset.scroll.top ) )
+			),
+			left: (
+
+				// The absolute mouse position
+				pageX -
+
+				// Click offset (relative to the element)
+				this.offset.click.left -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left +
+				( this.cssPosition === "fixed" ?
+					-this.offset.scroll.left :
+					( scrollIsRootNode ? 0 : this.offset.scroll.left ) )
+			)
+		};
+
+	},
+
+	_clear: function() {
+		this._removeClass( this.helper, "ui-draggable-dragging" );
+		if ( this.helper[ 0 ] !== this.element[ 0 ] && !this.cancelHelperRemoval ) {
+			this.helper.remove();
+		}
+		this.helper = null;
+		this.cancelHelperRemoval = false;
+		if ( this.destroyOnClear ) {
+			this.destroy();
+		}
+	},
+
+	// From now on bulk stuff - mainly helpers
+
+	_trigger: function( type, event, ui ) {
+		ui = ui || this._uiHash();
+		$.ui.plugin.call( this, type, [ event, ui, this ], true );
+
+		// Absolute position and offset (see #6884 ) have to be recalculated after plugins
+		if ( /^(drag|start|stop)/.test( type ) ) {
+			this.positionAbs = this._convertPositionTo( "absolute" );
+			ui.offset = this.positionAbs;
+		}
+		return $.Widget.prototype._trigger.call( this, type, event, ui );
+	},
+
+	plugins: {},
+
+	_uiHash: function() {
+		return {
+			helper: this.helper,
+			position: this.position,
+			originalPosition: this.originalPosition,
+			offset: this.positionAbs
+		};
+	}
+
+} );
+
+$.ui.plugin.add( "draggable", "connectToSortable", {
+	start: function( event, ui, draggable ) {
+		var uiSortable = $.extend( {}, ui, {
+			item: draggable.element
+		} );
+
+		draggable.sortables = [];
+		$( draggable.options.connectToSortable ).each( function() {
+			var sortable = $( this ).sortable( "instance" );
+
+			if ( sortable && !sortable.options.disabled ) {
+				draggable.sortables.push( sortable );
+
+				// RefreshPositions is called at drag start to refresh the containerCache
+				// which is used in drag. This ensures it's initialized and synchronized
+				// with any changes that might have happened on the page since initialization.
+				sortable.refreshPositions();
+				sortable._trigger( "activate", event, uiSortable );
+			}
+		} );
+	},
+	stop: function( event, ui, draggable ) {
+		var uiSortable = $.extend( {}, ui, {
+			item: draggable.element
+		} );
+
+		draggable.cancelHelperRemoval = false;
+
+		$.each( draggable.sortables, function() {
+			var sortable = this;
+
+			if ( sortable.isOver ) {
+				sortable.isOver = 0;
+
+				// Allow this sortable to handle removing the helper
+				draggable.cancelHelperRemoval = true;
+				sortable.cancelHelperRemoval = false;
+
+				// Use _storedCSS To restore properties in the sortable,
+				// as this also handles revert (#9675) since the draggable
+				// may have modified them in unexpected ways (#8809)
+				sortable._storedCSS = {
+					position: sortable.placeholder.css( "position" ),
+					top: sortable.placeholder.css( "top" ),
+					left: sortable.placeholder.css( "left" )
+				};
+
+				sortable._mouseStop( event );
+
+				// Once drag has ended, the sortable should return to using
+				// its original helper, not the shared helper from draggable
+				sortable.options.helper = sortable.options._helper;
+			} else {
+
+				// Prevent this Sortable from removing the helper.
+				// However, don't set the draggable to remove the helper
+				// either as another connected Sortable may yet handle the removal.
+				sortable.cancelHelperRemoval = true;
+
+				sortable._trigger( "deactivate", event, uiSortable );
+			}
+		} );
+	},
+	drag: function( event, ui, draggable ) {
+		$.each( draggable.sortables, function() {
+			var innermostIntersecting = false,
+				sortable = this;
+
+			// Copy over variables that sortable's _intersectsWith uses
+			sortable.positionAbs = draggable.positionAbs;
+			sortable.helperProportions = draggable.helperProportions;
+			sortable.offset.click = draggable.offset.click;
+
+			if ( sortable._intersectsWith( sortable.containerCache ) ) {
+				innermostIntersecting = true;
+
+				$.each( draggable.sortables, function() {
+
+					// Copy over variables that sortable's _intersectsWith uses
+					this.positionAbs = draggable.positionAbs;
+					this.helperProportions = draggable.helperProportions;
+					this.offset.click = draggable.offset.click;
+
+					if ( this !== sortable &&
+							this._intersectsWith( this.containerCache ) &&
+							$.contains( sortable.element[ 0 ], this.element[ 0 ] ) ) {
+						innermostIntersecting = false;
+					}
+
+					return innermostIntersecting;
+				} );
+			}
+
+			if ( innermostIntersecting ) {
+
+				// If it intersects, we use a little isOver variable and set it once,
+				// so that the move-in stuff gets fired only once.
+				if ( !sortable.isOver ) {
+					sortable.isOver = 1;
+
+					// Store draggable's parent in case we need to reappend to it later.
+					draggable._parent = ui.helper.parent();
+
+					sortable.currentItem = ui.helper
+						.appendTo( sortable.element )
+						.data( "ui-sortable-item", true );
+
+					// Store helper option to later restore it
+					sortable.options._helper = sortable.options.helper;
+
+					sortable.options.helper = function() {
+						return ui.helper[ 0 ];
+					};
+
+					// Fire the start events of the sortable with our passed browser event,
+					// and our own helper (so it doesn't create a new one)
+					event.target = sortable.currentItem[ 0 ];
+					sortable._mouseCapture( event, true );
+					sortable._mouseStart( event, true, true );
+
+					// Because the browser event is way off the new appended portlet,
+					// modify necessary variables to reflect the changes
+					sortable.offset.click.top = draggable.offset.click.top;
+					sortable.offset.click.left = draggable.offset.click.left;
+					sortable.offset.parent.left -= draggable.offset.parent.left -
+						sortable.offset.parent.left;
+					sortable.offset.parent.top -= draggable.offset.parent.top -
+						sortable.offset.parent.top;
+
+					draggable._trigger( "toSortable", event );
+
+					// Inform draggable that the helper is in a valid drop zone,
+					// used solely in the revert option to handle "valid/invalid".
+					draggable.dropped = sortable.element;
+
+					// Need to refreshPositions of all sortables in the case that
+					// adding to one sortable changes the location of the other sortables (#9675)
+					$.each( draggable.sortables, function() {
+						this.refreshPositions();
+					} );
+
+					// Hack so receive/update callbacks work (mostly)
+					draggable.currentItem = draggable.element;
+					sortable.fromOutside = draggable;
+				}
+
+				if ( sortable.currentItem ) {
+					sortable._mouseDrag( event );
+
+					// Copy the sortable's position because the draggable's can potentially reflect
+					// a relative position, while sortable is always absolute, which the dragged
+					// element has now become. (#8809)
+					ui.position = sortable.position;
+				}
+			} else {
+
+				// If it doesn't intersect with the sortable, and it intersected before,
+				// we fake the drag stop of the sortable, but make sure it doesn't remove
+				// the helper by using cancelHelperRemoval.
+				if ( sortable.isOver ) {
+
+					sortable.isOver = 0;
+					sortable.cancelHelperRemoval = true;
+
+					// Calling sortable's mouseStop would trigger a revert,
+					// so revert must be temporarily false until after mouseStop is called.
+					sortable.options._revert = sortable.options.revert;
+					sortable.options.revert = false;
+
+					sortable._trigger( "out", event, sortable._uiHash( sortable ) );
+					sortable._mouseStop( event, true );
+
+					// Restore sortable behaviors that were modfied
+					// when the draggable entered the sortable area (#9481)
+					sortable.options.revert = sortable.options._revert;
+					sortable.options.helper = sortable.options._helper;
+
+					if ( sortable.placeholder ) {
+						sortable.placeholder.remove();
+					}
+
+					// Restore and recalculate the draggable's offset considering the sortable
+					// may have modified them in unexpected ways. (#8809, #10669)
+					ui.helper.appendTo( draggable._parent );
+					draggable._refreshOffsets( event );
+					ui.position = draggable._generatePosition( event, true );
+
+					draggable._trigger( "fromSortable", event );
+
+					// Inform draggable that the helper is no longer in a valid drop zone
+					draggable.dropped = false;
+
+					// Need to refreshPositions of all sortables just in case removing
+					// from one sortable changes the location of other sortables (#9675)
+					$.each( draggable.sortables, function() {
+						this.refreshPositions();
+					} );
+				}
+			}
+		} );
+	}
+} );
+
+$.ui.plugin.add( "draggable", "cursor", {
+	start: function( event, ui, instance ) {
+		var t = $( "body" ),
+			o = instance.options;
+
+		if ( t.css( "cursor" ) ) {
+			o._cursor = t.css( "cursor" );
+		}
+		t.css( "cursor", o.cursor );
+	},
+	stop: function( event, ui, instance ) {
+		var o = instance.options;
+		if ( o._cursor ) {
+			$( "body" ).css( "cursor", o._cursor );
+		}
+	}
+} );
+
+$.ui.plugin.add( "draggable", "opacity", {
+	start: function( event, ui, instance ) {
+		var t = $( ui.helper ),
+			o = instance.options;
+		if ( t.css( "opacity" ) ) {
+			o._opacity = t.css( "opacity" );
+		}
+		t.css( "opacity", o.opacity );
+	},
+	stop: function( event, ui, instance ) {
+		var o = instance.options;
+		if ( o._opacity ) {
+			$( ui.helper ).css( "opacity", o._opacity );
+		}
+	}
+} );
+
+$.ui.plugin.add( "draggable", "scroll", {
+	start: function( event, ui, i ) {
+		if ( !i.scrollParentNotHidden ) {
+			i.scrollParentNotHidden = i.helper.scrollParent( false );
+		}
+
+		if ( i.scrollParentNotHidden[ 0 ] !== i.document[ 0 ] &&
+				i.scrollParentNotHidden[ 0 ].tagName !== "HTML" ) {
+			i.overflowOffset = i.scrollParentNotHidden.offset();
+		}
+	},
+	drag: function( event, ui, i  ) {
+
+		var o = i.options,
+			scrolled = false,
+			scrollParent = i.scrollParentNotHidden[ 0 ],
+			document = i.document[ 0 ];
+
+		if ( scrollParent !== document && scrollParent.tagName !== "HTML" ) {
+			if ( !o.axis || o.axis !== "x" ) {
+				if ( ( i.overflowOffset.top + scrollParent.offsetHeight ) - event.pageY <
+						o.scrollSensitivity ) {
+					scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed;
+				} else if ( event.pageY - i.overflowOffset.top < o.scrollSensitivity ) {
+					scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed;
+				}
+			}
+
+			if ( !o.axis || o.axis !== "y" ) {
+				if ( ( i.overflowOffset.left + scrollParent.offsetWidth ) - event.pageX <
+						o.scrollSensitivity ) {
+					scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed;
+				} else if ( event.pageX - i.overflowOffset.left < o.scrollSensitivity ) {
+					scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed;
+				}
+			}
+
+		} else {
+
+			if ( !o.axis || o.axis !== "x" ) {
+				if ( event.pageY - $( document ).scrollTop() < o.scrollSensitivity ) {
+					scrolled = $( document ).scrollTop( $( document ).scrollTop() - o.scrollSpeed );
+				} else if ( $( window ).height() - ( event.pageY - $( document ).scrollTop() ) <
+						o.scrollSensitivity ) {
+					scrolled = $( document ).scrollTop( $( document ).scrollTop() + o.scrollSpeed );
+				}
+			}
+
+			if ( !o.axis || o.axis !== "y" ) {
+				if ( event.pageX - $( document ).scrollLeft() < o.scrollSensitivity ) {
+					scrolled = $( document ).scrollLeft(
+						$( document ).scrollLeft() - o.scrollSpeed
+					);
+				} else if ( $( window ).width() - ( event.pageX - $( document ).scrollLeft() ) <
+						o.scrollSensitivity ) {
+					scrolled = $( document ).scrollLeft(
+						$( document ).scrollLeft() + o.scrollSpeed
+					);
+				}
+			}
+
+		}
+
+		if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) {
+			$.ui.ddmanager.prepareOffsets( i, event );
+		}
+
+	}
+} );
+
+$.ui.plugin.add( "draggable", "snap", {
+	start: function( event, ui, i ) {
+
+		var o = i.options;
+
+		i.snapElements = [];
+
+		$( o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap )
+			.each( function() {
+				var $t = $( this ),
+					$o = $t.offset();
+				if ( this !== i.element[ 0 ] ) {
+					i.snapElements.push( {
+						item: this,
+						width: $t.outerWidth(), height: $t.outerHeight(),
+						top: $o.top, left: $o.left
+					} );
+				}
+			} );
+
+	},
+	drag: function( event, ui, inst ) {
+
+		var ts, bs, ls, rs, l, r, t, b, i, first,
+			o = inst.options,
+			d = o.snapTolerance,
+			x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+		for ( i = inst.snapElements.length - 1; i >= 0; i-- ) {
+
+			l = inst.snapElements[ i ].left - inst.margins.left;
+			r = l + inst.snapElements[ i ].width;
+			t = inst.snapElements[ i ].top - inst.margins.top;
+			b = t + inst.snapElements[ i ].height;
+
+			if ( x2 < l - d || x1 > r + d || y2 < t - d || y1 > b + d ||
+					!$.contains( inst.snapElements[ i ].item.ownerDocument,
+					inst.snapElements[ i ].item ) ) {
+				if ( inst.snapElements[ i ].snapping ) {
+					( inst.options.snap.release &&
+						inst.options.snap.release.call(
+							inst.element,
+							event,
+							$.extend( inst._uiHash(), { snapItem: inst.snapElements[ i ].item } )
+						) );
+				}
+				inst.snapElements[ i ].snapping = false;
+				continue;
+			}
+
+			if ( o.snapMode !== "inner" ) {
+				ts = Math.abs( t - y2 ) <= d;
+				bs = Math.abs( b - y1 ) <= d;
+				ls = Math.abs( l - x2 ) <= d;
+				rs = Math.abs( r - x1 ) <= d;
+				if ( ts ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: t - inst.helperProportions.height,
+						left: 0
+					} ).top;
+				}
+				if ( bs ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: b,
+						left: 0
+					} ).top;
+				}
+				if ( ls ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: l - inst.helperProportions.width
+					} ).left;
+				}
+				if ( rs ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: r
+					} ).left;
+				}
+			}
+
+			first = ( ts || bs || ls || rs );
+
+			if ( o.snapMode !== "outer" ) {
+				ts = Math.abs( t - y1 ) <= d;
+				bs = Math.abs( b - y2 ) <= d;
+				ls = Math.abs( l - x1 ) <= d;
+				rs = Math.abs( r - x2 ) <= d;
+				if ( ts ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: t,
+						left: 0
+					} ).top;
+				}
+				if ( bs ) {
+					ui.position.top = inst._convertPositionTo( "relative", {
+						top: b - inst.helperProportions.height,
+						left: 0
+					} ).top;
+				}
+				if ( ls ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: l
+					} ).left;
+				}
+				if ( rs ) {
+					ui.position.left = inst._convertPositionTo( "relative", {
+						top: 0,
+						left: r - inst.helperProportions.width
+					} ).left;
+				}
+			}
+
+			if ( !inst.snapElements[ i ].snapping && ( ts || bs || ls || rs || first ) ) {
+				( inst.options.snap.snap &&
+					inst.options.snap.snap.call(
+						inst.element,
+						event,
+						$.extend( inst._uiHash(), {
+							snapItem: inst.snapElements[ i ].item
+						} ) ) );
+			}
+			inst.snapElements[ i ].snapping = ( ts || bs || ls || rs || first );
+
+		}
+
+	}
+} );
+
+$.ui.plugin.add( "draggable", "stack", {
+	start: function( event, ui, instance ) {
+		var min,
+			o = instance.options,
+			group = $.makeArray( $( o.stack ) ).sort( function( a, b ) {
+				return ( parseInt( $( a ).css( "zIndex" ), 10 ) || 0 ) -
+					( parseInt( $( b ).css( "zIndex" ), 10 ) || 0 );
+			} );
+
+		if ( !group.length ) { return; }
+
+		min = parseInt( $( group[ 0 ] ).css( "zIndex" ), 10 ) || 0;
+		$( group ).each( function( i ) {
+			$( this ).css( "zIndex", min + i );
+		} );
+		this.css( "zIndex", ( min + group.length ) );
+	}
+} );
+
+$.ui.plugin.add( "draggable", "zIndex", {
+	start: function( event, ui, instance ) {
+		var t = $( ui.helper ),
+			o = instance.options;
+
+		if ( t.css( "zIndex" ) ) {
+			o._zIndex = t.css( "zIndex" );
+		}
+		t.css( "zIndex", o.zIndex );
+	},
+	stop: function( event, ui, instance ) {
+		var o = instance.options;
+
+		if ( o._zIndex ) {
+			$( ui.helper ).css( "zIndex", o._zIndex );
+		}
+	}
+} );
+
+return $.ui.draggable;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/draggable.min.js b/wp-includes/js/jquery/ui/draggable.min.js
index 4eace577b0..88dc976e99 100644
--- a/wp-includes/js/jquery/ui/draggable.min.js
+++ b/wp-includes/js/jquery/ui/draggable.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Draggable 1.11.4
+ * jQuery UI Draggable 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/draggable/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./mouse","./widget"],t):t(jQuery)}(function(P){return P.widget("ui.draggable",P.ui.mouse,{version:"1.11.4",widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1,drag:null,start:null,stop:null},_create:function(){"original"===this.options.helper&&this._setPositionRelative(),this.options.addClasses&&this.element.addClass("ui-draggable"),this.options.disabled&&this.element.addClass("ui-draggable-disabled"),this._setHandleClassName(),this._mouseInit()},_setOption:function(t,e){this._super(t,e),"handle"===t&&(this._removeHandleClassName(),this._setHandleClassName())},_destroy:function(){(this.helper||this.element).is(".ui-draggable-dragging")?this.destroyOnClear=!0:(this.element.removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled"),this._removeHandleClassName(),this._mouseDestroy())},_mouseCapture:function(t){var e=this.options;return this._blurActiveElement(t),!(this.helper||e.disabled||0<P(t.target).closest(".ui-resizable-handle").length)&&(this.handle=this._getHandle(t),!!this.handle&&(this._blockFrames(!0===e.iframeFix?"iframe":e.iframeFix),!0))},_blockFrames:function(t){this.iframeBlocks=this.document.find(t).map(function(){var t=P(this);return P("<div>").css("position","absolute").appendTo(t.parent()).outerWidth(t.outerWidth()).outerHeight(t.outerHeight()).offset(t.offset())[0]})},_unblockFrames:function(){this.iframeBlocks&&(this.iframeBlocks.remove(),delete this.iframeBlocks)},_blurActiveElement:function(t){var e=this.document[0];if(this.handleElement.is(t.target))try{e.activeElement&&"body"!==e.activeElement.nodeName.toLowerCase()&&P(e.activeElement).blur()}catch(t){}},_mouseStart:function(t){var e=this.options;return this.helper=this._createHelper(t),this.helper.addClass("ui-draggable-dragging"),this._cacheHelperProportions(),P.ui.ddmanager&&(P.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(!0),this.offsetParent=this.helper.offsetParent(),this.hasFixedAncestor=0<this.helper.parents().filter(function(){return"fixed"===P(this).css("position")}).length,this.positionAbs=this.element.offset(),this._refreshOffsets(t),this.originalPosition=this.position=this._generatePosition(t,!1),this.originalPageX=t.pageX,this.originalPageY=t.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this._setContainment(),!1===this._trigger("start",t)?(this._clear(),!1):(this._cacheHelperProportions(),P.ui.ddmanager&&!e.dropBehaviour&&P.ui.ddmanager.prepareOffsets(this,t),this._normalizeRightBottom(),this._mouseDrag(t,!0),P.ui.ddmanager&&P.ui.ddmanager.dragStart(this,t),!0)},_refreshOffsets:function(t){this.offset={top:this.positionAbs.top-this.margins.top,left:this.positionAbs.left-this.margins.left,scroll:!1,parent:this._getParentOffset(),relative:this._getRelativeOffset()},this.offset.click={left:t.pageX-this.offset.left,top:t.pageY-this.offset.top}},_mouseDrag:function(t,e){if(this.hasFixedAncestor&&(this.offset.parent=this._getParentOffset()),this.position=this._generatePosition(t,!0),this.positionAbs=this._convertPositionTo("absolute"),!e){var s=this._uiHash();if(!1===this._trigger("drag",t,s))return this._mouseUp({}),!1;this.position=s.position}return this.helper[0].style.left=this.position.left+"px",this.helper[0].style.top=this.position.top+"px",P.ui.ddmanager&&P.ui.ddmanager.drag(this,t),!1},_mouseStop:function(t){var e=this,s=!1;return P.ui.ddmanager&&!this.options.dropBehaviour&&(s=P.ui.ddmanager.drop(this,t)),this.dropped&&(s=this.dropped,this.dropped=!1),"invalid"===this.options.revert&&!s||"valid"===this.options.revert&&s||!0===this.options.revert||P.isFunction(this.options.revert)&&this.options.revert.call(this.element,s)?P(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){!1!==e._trigger("stop",t)&&e._clear()}):!1!==this._trigger("stop",t)&&this._clear(),!1},_mouseUp:function(t){return this._unblockFrames(),P.ui.ddmanager&&P.ui.ddmanager.dragStop(this,t),this.handleElement.is(t.target)&&this.element.focus(),P.ui.mouse.prototype._mouseUp.call(this,t)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear(),this},_getHandle:function(t){return!this.options.handle||!!P(t.target).closest(this.element.find(this.options.handle)).length},_setHandleClassName:function(){this.handleElement=this.options.handle?this.element.find(this.options.handle):this.element,this.handleElement.addClass("ui-draggable-handle")},_removeHandleClassName:function(){this.handleElement.removeClass("ui-draggable-handle")},_createHelper:function(t){var e=this.options,s=P.isFunction(e.helper),i=s?P(e.helper.apply(this.element[0],[t])):"clone"===e.helper?this.element.clone().removeAttr("id"):this.element;return i.parents("body").length||i.appendTo("parent"===e.appendTo?this.element[0].parentNode:e.appendTo),s&&i[0]===this.element[0]&&this._setPositionRelative(),i[0]===this.element[0]||/(fixed|absolute)/.test(i.css("position"))||i.css("position","absolute"),i},_setPositionRelative:function(){/^(?:r|a|f)/.test(this.element.css("position"))||(this.element[0].style.position="relative")},_adjustOffsetFromHelper:function(t){"string"==typeof t&&(t=t.split(" ")),P.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_isRootNode:function(t){return/(html|body)/i.test(t.tagName)||t===this.document[0]},_getParentOffset:function(){var t=this.offsetParent.offset(),e=this.document[0];return"absolute"===this.cssPosition&&this.scrollParent[0]!==e&&P.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop()),this._isRootNode(this.offsetParent[0])&&(t={top:0,left:0}),{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if("relative"!==this.cssPosition)return{top:0,left:0};var t=this.element.position(),e=this._isRootNode(this.scrollParent[0]);return{top:t.top-(parseInt(this.helper.css("top"),10)||0)+(e?0:this.scrollParent.scrollTop()),left:t.left-(parseInt(this.helper.css("left"),10)||0)+(e?0:this.scrollParent.scrollLeft())}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t,e,s,i=this.options,o=this.document[0];this.relativeContainer=null,i.containment?"window"!==i.containment?"document"!==i.containment?i.containment.constructor!==Array?("parent"===i.containment&&(i.containment=this.helper[0].parentNode),(s=(e=P(i.containment))[0])&&(t=/(scroll|auto)/.test(e.css("overflow")),this.containment=[(parseInt(e.css("borderLeftWidth"),10)||0)+(parseInt(e.css("paddingLeft"),10)||0),(parseInt(e.css("borderTopWidth"),10)||0)+(parseInt(e.css("paddingTop"),10)||0),(t?Math.max(s.scrollWidth,s.offsetWidth):s.offsetWidth)-(parseInt(e.css("borderRightWidth"),10)||0)-(parseInt(e.css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(t?Math.max(s.scrollHeight,s.offsetHeight):s.offsetHeight)-(parseInt(e.css("borderBottomWidth"),10)||0)-(parseInt(e.css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relativeContainer=e)):this.containment=i.containment:this.containment=[0,0,P(o).width()-this.helperProportions.width-this.margins.left,(P(o).height()||o.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]:this.containment=[P(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,P(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,P(window).scrollLeft()+P(window).width()-this.helperProportions.width-this.margins.left,P(window).scrollTop()+(P(window).height()||o.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]:this.containment=null},_convertPositionTo:function(t,e){e=e||this.position;var s="absolute"===t?1:-1,i=this._isRootNode(this.scrollParent[0]);return{top:e.top+this.offset.relative.top*s+this.offset.parent.top*s-("fixed"===this.cssPosition?-this.offset.scroll.top:i?0:this.offset.scroll.top)*s,left:e.left+this.offset.relative.left*s+this.offset.parent.left*s-("fixed"===this.cssPosition?-this.offset.scroll.left:i?0:this.offset.scroll.left)*s}},_generatePosition:function(t,e){var s,i,o,n,r=this.options,l=this._isRootNode(this.scrollParent[0]),a=t.pageX,h=t.pageY;return l&&this.offset.scroll||(this.offset.scroll={top:this.scrollParent.scrollTop(),left:this.scrollParent.scrollLeft()}),e&&(this.containment&&(s=this.relativeContainer?(i=this.relativeContainer.offset(),[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]):this.containment,t.pageX-this.offset.click.left<s[0]&&(a=s[0]+this.offset.click.left),t.pageY-this.offset.click.top<s[1]&&(h=s[1]+this.offset.click.top),t.pageX-this.offset.click.left>s[2]&&(a=s[2]+this.offset.click.left),t.pageY-this.offset.click.top>s[3]&&(h=s[3]+this.offset.click.top)),r.grid&&(o=r.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/r.grid[1])*r.grid[1]:this.originalPageY,h=s?o-this.offset.click.top>=s[1]||o-this.offset.click.top>s[3]?o:o-this.offset.click.top>=s[1]?o-r.grid[1]:o+r.grid[1]:o,n=r.grid[0]?this.originalPageX+Math.round((a-this.originalPageX)/r.grid[0])*r.grid[0]:this.originalPageX,a=s?n-this.offset.click.left>=s[0]||n-this.offset.click.left>s[2]?n:n-this.offset.click.left>=s[0]?n-r.grid[0]:n+r.grid[0]:n),"y"===r.axis&&(a=this.originalPageX),"x"===r.axis&&(h=this.originalPageY)),{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+("fixed"===this.cssPosition?-this.offset.scroll.top:l?0:this.offset.scroll.top),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+("fixed"===this.cssPosition?-this.offset.scroll.left:l?0:this.offset.scroll.left)}},_clear:function(){this.helper.removeClass("ui-draggable-dragging"),this.helper[0]===this.element[0]||this.cancelHelperRemoval||this.helper.remove(),this.helper=null,this.cancelHelperRemoval=!1,this.destroyOnClear&&this.destroy()},_normalizeRightBottom:function(){"y"!==this.options.axis&&"auto"!==this.helper.css("right")&&(this.helper.width(this.helper.width()),this.helper.css("right","auto")),"x"!==this.options.axis&&"auto"!==this.helper.css("bottom")&&(this.helper.height(this.helper.height()),this.helper.css("bottom","auto"))},_trigger:function(t,e,s){return s=s||this._uiHash(),P.ui.plugin.call(this,t,[e,s,this],!0),/^(drag|start|stop)/.test(t)&&(this.positionAbs=this._convertPositionTo("absolute"),s.offset=this.positionAbs),P.Widget.prototype._trigger.call(this,t,e,s)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}}),P.ui.plugin.add("draggable","connectToSortable",{start:function(e,t,s){var i=P.extend({},t,{item:s.element});s.sortables=[],P(s.options.connectToSortable).each(function(){var t=P(this).sortable("instance");t&&!t.options.disabled&&(s.sortables.push(t),t.refreshPositions(),t._trigger("activate",e,i))})},stop:function(e,t,s){var i=P.extend({},t,{item:s.element});s.cancelHelperRemoval=!1,P.each(s.sortables,function(){var t=this;t.isOver?(t.isOver=0,s.cancelHelperRemoval=!0,t.cancelHelperRemoval=!1,t._storedCSS={position:t.placeholder.css("position"),top:t.placeholder.css("top"),left:t.placeholder.css("left")},t._mouseStop(e),t.options.helper=t.options._helper):(t.cancelHelperRemoval=!0,t._trigger("deactivate",e,i))})},drag:function(s,i,o){P.each(o.sortables,function(){var t=!1,e=this;e.positionAbs=o.positionAbs,e.helperProportions=o.helperProportions,e.offset.click=o.offset.click,e._intersectsWith(e.containerCache)&&(t=!0,P.each(o.sortables,function(){return this.positionAbs=o.positionAbs,this.helperProportions=o.helperProportions,this.offset.click=o.offset.click,this!==e&&this._intersectsWith(this.containerCache)&&P.contains(e.element[0],this.element[0])&&(t=!1),t})),t?(e.isOver||(e.isOver=1,o._parent=i.helper.parent(),e.currentItem=i.helper.appendTo(e.element).data("ui-sortable-item",!0),e.options._helper=e.options.helper,e.options.helper=function(){return i.helper[0]},s.target=e.currentItem[0],e._mouseCapture(s,!0),e._mouseStart(s,!0,!0),e.offset.click.top=o.offset.click.top,e.offset.click.left=o.offset.click.left,e.offset.parent.left-=o.offset.parent.left-e.offset.parent.left,e.offset.parent.top-=o.offset.parent.top-e.offset.parent.top,o._trigger("toSortable",s),o.dropped=e.element,P.each(o.sortables,function(){this.refreshPositions()}),o.currentItem=o.element,e.fromOutside=o),e.currentItem&&(e._mouseDrag(s),i.position=e.position)):e.isOver&&(e.isOver=0,e.cancelHelperRemoval=!0,e.options._revert=e.options.revert,e.options.revert=!1,e._trigger("out",s,e._uiHash(e)),e._mouseStop(s,!0),e.options.revert=e.options._revert,e.options.helper=e.options._helper,e.placeholder&&e.placeholder.remove(),i.helper.appendTo(o._parent),o._refreshOffsets(s),i.position=o._generatePosition(s,!0),o._trigger("fromSortable",s),o.dropped=!1,P.each(o.sortables,function(){this.refreshPositions()}))})}}),P.ui.plugin.add("draggable","cursor",{start:function(t,e,s){var i=P("body"),o=s.options;i.css("cursor")&&(o._cursor=i.css("cursor")),i.css("cursor",o.cursor)},stop:function(t,e,s){var i=s.options;i._cursor&&P("body").css("cursor",i._cursor)}}),P.ui.plugin.add("draggable","opacity",{start:function(t,e,s){var i=P(e.helper),o=s.options;i.css("opacity")&&(o._opacity=i.css("opacity")),i.css("opacity",o.opacity)},stop:function(t,e,s){var i=s.options;i._opacity&&P(e.helper).css("opacity",i._opacity)}}),P.ui.plugin.add("draggable","scroll",{start:function(t,e,s){s.scrollParentNotHidden||(s.scrollParentNotHidden=s.helper.scrollParent(!1)),s.scrollParentNotHidden[0]!==s.document[0]&&"HTML"!==s.scrollParentNotHidden[0].tagName&&(s.overflowOffset=s.scrollParentNotHidden.offset())},drag:function(t,e,s){var i=s.options,o=!1,n=s.scrollParentNotHidden[0],r=s.document[0];n!==r&&"HTML"!==n.tagName?(i.axis&&"x"===i.axis||(s.overflowOffset.top+n.offsetHeight-t.pageY<i.scrollSensitivity?n.scrollTop=o=n.scrollTop+i.scrollSpeed:t.pageY-s.overflowOffset.top<i.scrollSensitivity&&(n.scrollTop=o=n.scrollTop-i.scrollSpeed)),i.axis&&"y"===i.axis||(s.overflowOffset.left+n.offsetWidth-t.pageX<i.scrollSensitivity?n.scrollLeft=o=n.scrollLeft+i.scrollSpeed:t.pageX-s.overflowOffset.left<i.scrollSensitivity&&(n.scrollLeft=o=n.scrollLeft-i.scrollSpeed))):(i.axis&&"x"===i.axis||(t.pageY-P(r).scrollTop()<i.scrollSensitivity?o=P(r).scrollTop(P(r).scrollTop()-i.scrollSpeed):P(window).height()-(t.pageY-P(r).scrollTop())<i.scrollSensitivity&&(o=P(r).scrollTop(P(r).scrollTop()+i.scrollSpeed))),i.axis&&"y"===i.axis||(t.pageX-P(r).scrollLeft()<i.scrollSensitivity?o=P(r).scrollLeft(P(r).scrollLeft()-i.scrollSpeed):P(window).width()-(t.pageX-P(r).scrollLeft())<i.scrollSensitivity&&(o=P(r).scrollLeft(P(r).scrollLeft()+i.scrollSpeed)))),!1!==o&&P.ui.ddmanager&&!i.dropBehaviour&&P.ui.ddmanager.prepareOffsets(s,t)}}),P.ui.plugin.add("draggable","snap",{start:function(t,e,s){var i=s.options;s.snapElements=[],P(i.snap.constructor!==String?i.snap.items||":data(ui-draggable)":i.snap).each(function(){var t=P(this),e=t.offset();this!==s.element[0]&&s.snapElements.push({item:this,width:t.outerWidth(),height:t.outerHeight(),top:e.top,left:e.left})})},drag:function(t,e,s){var i,o,n,r,l,a,h,p,c,f,d=s.options,g=d.snapTolerance,u=e.offset.left,m=u+s.helperProportions.width,v=e.offset.top,_=v+s.helperProportions.height;for(c=s.snapElements.length-1;0<=c;c--)a=(l=s.snapElements[c].left-s.margins.left)+s.snapElements[c].width,p=(h=s.snapElements[c].top-s.margins.top)+s.snapElements[c].height,m<l-g||a+g<u||_<h-g||p+g<v||!P.contains(s.snapElements[c].item.ownerDocument,s.snapElements[c].item)?(s.snapElements[c].snapping&&s.options.snap.release&&s.options.snap.release.call(s.element,t,P.extend(s._uiHash(),{snapItem:s.snapElements[c].item})),s.snapElements[c].snapping=!1):("inner"!==d.snapMode&&(i=Math.abs(h-_)<=g,o=Math.abs(p-v)<=g,n=Math.abs(l-m)<=g,r=Math.abs(a-u)<=g,i&&(e.position.top=s._convertPositionTo("relative",{top:h-s.helperProportions.height,left:0}).top),o&&(e.position.top=s._convertPositionTo("relative",{top:p,left:0}).top),n&&(e.position.left=s._convertPositionTo("relative",{top:0,left:l-s.helperProportions.width}).left),r&&(e.position.left=s._convertPositionTo("relative",{top:0,left:a}).left)),f=i||o||n||r,"outer"!==d.snapMode&&(i=Math.abs(h-v)<=g,o=Math.abs(p-_)<=g,n=Math.abs(l-u)<=g,r=Math.abs(a-m)<=g,i&&(e.position.top=s._convertPositionTo("relative",{top:h,left:0}).top),o&&(e.position.top=s._convertPositionTo("relative",{top:p-s.helperProportions.height,left:0}).top),n&&(e.position.left=s._convertPositionTo("relative",{top:0,left:l}).left),r&&(e.position.left=s._convertPositionTo("relative",{top:0,left:a-s.helperProportions.width}).left)),!s.snapElements[c].snapping&&(i||o||n||r||f)&&s.options.snap.snap&&s.options.snap.snap.call(s.element,t,P.extend(s._uiHash(),{snapItem:s.snapElements[c].item})),s.snapElements[c].snapping=i||o||n||r||f)}}),P.ui.plugin.add("draggable","stack",{start:function(t,e,s){var i,o=s.options,n=P.makeArray(P(o.stack)).sort(function(t,e){return(parseInt(P(t).css("zIndex"),10)||0)-(parseInt(P(e).css("zIndex"),10)||0)});n.length&&(i=parseInt(P(n[0]).css("zIndex"),10)||0,P(n).each(function(t){P(this).css("zIndex",i+t)}),this.css("zIndex",i+n.length))}}),P.ui.plugin.add("draggable","zIndex",{start:function(t,e,s){var i=P(e.helper),o=s.options;i.css("zIndex")&&(o._zIndex=i.css("zIndex")),i.css("zIndex",o.zIndex)},stop:function(t,e,s){var i=s.options;i._zIndex&&P(e.helper).css("zIndex",i._zIndex)}}),P.ui.draggable});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./mouse","./core"],t):t(jQuery)}(function(P){return P.widget("ui.draggable",P.ui.mouse,{version:"1.12.1",widgetEventPrefix:"drag",options:{addClasses:!0,appendTo:"parent",axis:!1,connectToSortable:!1,containment:!1,cursor:"auto",cursorAt:!1,grid:!1,handle:!1,helper:"original",iframeFix:!1,opacity:!1,refreshPositions:!1,revert:!1,revertDuration:500,scope:"default",scroll:!0,scrollSensitivity:20,scrollSpeed:20,snap:!1,snapMode:"both",snapTolerance:20,stack:!1,zIndex:!1,drag:null,start:null,stop:null},_create:function(){"original"===this.options.helper&&this._setPositionRelative(),this.options.addClasses&&this._addClass("ui-draggable"),this._setHandleClassName(),this._mouseInit()},_setOption:function(t,e){this._super(t,e),"handle"===t&&(this._removeHandleClassName(),this._setHandleClassName())},_destroy:function(){(this.helper||this.element).is(".ui-draggable-dragging")?this.destroyOnClear=!0:(this._removeHandleClassName(),this._mouseDestroy())},_mouseCapture:function(t){var e=this.options;return!(this.helper||e.disabled||0<P(t.target).closest(".ui-resizable-handle").length)&&(this.handle=this._getHandle(t),!!this.handle&&(this._blurActiveElement(t),this._blockFrames(!0===e.iframeFix?"iframe":e.iframeFix),!0))},_blockFrames:function(t){this.iframeBlocks=this.document.find(t).map(function(){var t=P(this);return P("<div>").css("position","absolute").appendTo(t.parent()).outerWidth(t.outerWidth()).outerHeight(t.outerHeight()).offset(t.offset())[0]})},_unblockFrames:function(){this.iframeBlocks&&(this.iframeBlocks.remove(),delete this.iframeBlocks)},_blurActiveElement:function(t){var e=P.ui.safeActiveElement(this.document[0]);P(t.target).closest(e).length||P.ui.safeBlur(e)},_mouseStart:function(t){var e=this.options;return this.helper=this._createHelper(t),this._addClass(this.helper,"ui-draggable-dragging"),this._cacheHelperProportions(),P.ui.ddmanager&&(P.ui.ddmanager.current=this),this._cacheMargins(),this.cssPosition=this.helper.css("position"),this.scrollParent=this.helper.scrollParent(!0),this.offsetParent=this.helper.offsetParent(),this.hasFixedAncestor=0<this.helper.parents().filter(function(){return"fixed"===P(this).css("position")}).length,this.positionAbs=this.element.offset(),this._refreshOffsets(t),this.originalPosition=this.position=this._generatePosition(t,!1),this.originalPageX=t.pageX,this.originalPageY=t.pageY,e.cursorAt&&this._adjustOffsetFromHelper(e.cursorAt),this._setContainment(),!1===this._trigger("start",t)?(this._clear(),!1):(this._cacheHelperProportions(),P.ui.ddmanager&&!e.dropBehaviour&&P.ui.ddmanager.prepareOffsets(this,t),this._mouseDrag(t,!0),P.ui.ddmanager&&P.ui.ddmanager.dragStart(this,t),!0)},_refreshOffsets:function(t){this.offset={top:this.positionAbs.top-this.margins.top,left:this.positionAbs.left-this.margins.left,scroll:!1,parent:this._getParentOffset(),relative:this._getRelativeOffset()},this.offset.click={left:t.pageX-this.offset.left,top:t.pageY-this.offset.top}},_mouseDrag:function(t,e){if(this.hasFixedAncestor&&(this.offset.parent=this._getParentOffset()),this.position=this._generatePosition(t,!0),this.positionAbs=this._convertPositionTo("absolute"),!e){var s=this._uiHash();if(!1===this._trigger("drag",t,s))return this._mouseUp(new P.Event("mouseup",t)),!1;this.position=s.position}return this.helper[0].style.left=this.position.left+"px",this.helper[0].style.top=this.position.top+"px",P.ui.ddmanager&&P.ui.ddmanager.drag(this,t),!1},_mouseStop:function(t){var e=this,s=!1;return P.ui.ddmanager&&!this.options.dropBehaviour&&(s=P.ui.ddmanager.drop(this,t)),this.dropped&&(s=this.dropped,this.dropped=!1),"invalid"===this.options.revert&&!s||"valid"===this.options.revert&&s||!0===this.options.revert||P.isFunction(this.options.revert)&&this.options.revert.call(this.element,s)?P(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){!1!==e._trigger("stop",t)&&e._clear()}):!1!==this._trigger("stop",t)&&this._clear(),!1},_mouseUp:function(t){return this._unblockFrames(),P.ui.ddmanager&&P.ui.ddmanager.dragStop(this,t),this.handleElement.is(t.target)&&this.element.trigger("focus"),P.ui.mouse.prototype._mouseUp.call(this,t)},cancel:function(){return this.helper.is(".ui-draggable-dragging")?this._mouseUp(new P.Event("mouseup",{target:this.element[0]})):this._clear(),this},_getHandle:function(t){return!this.options.handle||!!P(t.target).closest(this.element.find(this.options.handle)).length},_setHandleClassName:function(){this.handleElement=this.options.handle?this.element.find(this.options.handle):this.element,this._addClass(this.handleElement,"ui-draggable-handle")},_removeHandleClassName:function(){this._removeClass(this.handleElement,"ui-draggable-handle")},_createHelper:function(t){var e=this.options,s=P.isFunction(e.helper),i=s?P(e.helper.apply(this.element[0],[t])):"clone"===e.helper?this.element.clone().removeAttr("id"):this.element;return i.parents("body").length||i.appendTo("parent"===e.appendTo?this.element[0].parentNode:e.appendTo),s&&i[0]===this.element[0]&&this._setPositionRelative(),i[0]===this.element[0]||/(fixed|absolute)/.test(i.css("position"))||i.css("position","absolute"),i},_setPositionRelative:function(){/^(?:r|a|f)/.test(this.element.css("position"))||(this.element[0].style.position="relative")},_adjustOffsetFromHelper:function(t){"string"==typeof t&&(t=t.split(" ")),P.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_isRootNode:function(t){return/(html|body)/i.test(t.tagName)||t===this.document[0]},_getParentOffset:function(){var t=this.offsetParent.offset(),e=this.document[0];return"absolute"===this.cssPosition&&this.scrollParent[0]!==e&&P.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop()),this._isRootNode(this.offsetParent[0])&&(t={top:0,left:0}),{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if("relative"!==this.cssPosition)return{top:0,left:0};var t=this.element.position(),e=this._isRootNode(this.scrollParent[0]);return{top:t.top-(parseInt(this.helper.css("top"),10)||0)+(e?0:this.scrollParent.scrollTop()),left:t.left-(parseInt(this.helper.css("left"),10)||0)+(e?0:this.scrollParent.scrollLeft())}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t,e,s,i=this.options,o=this.document[0];this.relativeContainer=null,i.containment?"window"!==i.containment?"document"!==i.containment?i.containment.constructor!==Array?("parent"===i.containment&&(i.containment=this.helper[0].parentNode),(s=(e=P(i.containment))[0])&&(t=/(scroll|auto)/.test(e.css("overflow")),this.containment=[(parseInt(e.css("borderLeftWidth"),10)||0)+(parseInt(e.css("paddingLeft"),10)||0),(parseInt(e.css("borderTopWidth"),10)||0)+(parseInt(e.css("paddingTop"),10)||0),(t?Math.max(s.scrollWidth,s.offsetWidth):s.offsetWidth)-(parseInt(e.css("borderRightWidth"),10)||0)-(parseInt(e.css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(t?Math.max(s.scrollHeight,s.offsetHeight):s.offsetHeight)-(parseInt(e.css("borderBottomWidth"),10)||0)-(parseInt(e.css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom],this.relativeContainer=e)):this.containment=i.containment:this.containment=[0,0,P(o).width()-this.helperProportions.width-this.margins.left,(P(o).height()||o.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]:this.containment=[P(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,P(window).scrollTop()-this.offset.relative.top-this.offset.parent.top,P(window).scrollLeft()+P(window).width()-this.helperProportions.width-this.margins.left,P(window).scrollTop()+(P(window).height()||o.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]:this.containment=null},_convertPositionTo:function(t,e){e=e||this.position;var s="absolute"===t?1:-1,i=this._isRootNode(this.scrollParent[0]);return{top:e.top+this.offset.relative.top*s+this.offset.parent.top*s-("fixed"===this.cssPosition?-this.offset.scroll.top:i?0:this.offset.scroll.top)*s,left:e.left+this.offset.relative.left*s+this.offset.parent.left*s-("fixed"===this.cssPosition?-this.offset.scroll.left:i?0:this.offset.scroll.left)*s}},_generatePosition:function(t,e){var s,i,o,n,r=this.options,l=this._isRootNode(this.scrollParent[0]),a=t.pageX,h=t.pageY;return l&&this.offset.scroll||(this.offset.scroll={top:this.scrollParent.scrollTop(),left:this.scrollParent.scrollLeft()}),e&&(this.containment&&(s=this.relativeContainer?(i=this.relativeContainer.offset(),[this.containment[0]+i.left,this.containment[1]+i.top,this.containment[2]+i.left,this.containment[3]+i.top]):this.containment,t.pageX-this.offset.click.left<s[0]&&(a=s[0]+this.offset.click.left),t.pageY-this.offset.click.top<s[1]&&(h=s[1]+this.offset.click.top),t.pageX-this.offset.click.left>s[2]&&(a=s[2]+this.offset.click.left),t.pageY-this.offset.click.top>s[3]&&(h=s[3]+this.offset.click.top)),r.grid&&(o=r.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/r.grid[1])*r.grid[1]:this.originalPageY,h=s?o-this.offset.click.top>=s[1]||o-this.offset.click.top>s[3]?o:o-this.offset.click.top>=s[1]?o-r.grid[1]:o+r.grid[1]:o,n=r.grid[0]?this.originalPageX+Math.round((a-this.originalPageX)/r.grid[0])*r.grid[0]:this.originalPageX,a=s?n-this.offset.click.left>=s[0]||n-this.offset.click.left>s[2]?n:n-this.offset.click.left>=s[0]?n-r.grid[0]:n+r.grid[0]:n),"y"===r.axis&&(a=this.originalPageX),"x"===r.axis&&(h=this.originalPageY)),{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+("fixed"===this.cssPosition?-this.offset.scroll.top:l?0:this.offset.scroll.top),left:a-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+("fixed"===this.cssPosition?-this.offset.scroll.left:l?0:this.offset.scroll.left)}},_clear:function(){this._removeClass(this.helper,"ui-draggable-dragging"),this.helper[0]===this.element[0]||this.cancelHelperRemoval||this.helper.remove(),this.helper=null,this.cancelHelperRemoval=!1,this.destroyOnClear&&this.destroy()},_trigger:function(t,e,s){return s=s||this._uiHash(),P.ui.plugin.call(this,t,[e,s,this],!0),/^(drag|start|stop)/.test(t)&&(this.positionAbs=this._convertPositionTo("absolute"),s.offset=this.positionAbs),P.Widget.prototype._trigger.call(this,t,e,s)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}}),P.ui.plugin.add("draggable","connectToSortable",{start:function(e,t,s){var i=P.extend({},t,{item:s.element});s.sortables=[],P(s.options.connectToSortable).each(function(){var t=P(this).sortable("instance");t&&!t.options.disabled&&(s.sortables.push(t),t.refreshPositions(),t._trigger("activate",e,i))})},stop:function(e,t,s){var i=P.extend({},t,{item:s.element});s.cancelHelperRemoval=!1,P.each(s.sortables,function(){var t=this;t.isOver?(t.isOver=0,s.cancelHelperRemoval=!0,t.cancelHelperRemoval=!1,t._storedCSS={position:t.placeholder.css("position"),top:t.placeholder.css("top"),left:t.placeholder.css("left")},t._mouseStop(e),t.options.helper=t.options._helper):(t.cancelHelperRemoval=!0,t._trigger("deactivate",e,i))})},drag:function(s,i,o){P.each(o.sortables,function(){var t=!1,e=this;e.positionAbs=o.positionAbs,e.helperProportions=o.helperProportions,e.offset.click=o.offset.click,e._intersectsWith(e.containerCache)&&(t=!0,P.each(o.sortables,function(){return this.positionAbs=o.positionAbs,this.helperProportions=o.helperProportions,this.offset.click=o.offset.click,this!==e&&this._intersectsWith(this.containerCache)&&P.contains(e.element[0],this.element[0])&&(t=!1),t})),t?(e.isOver||(e.isOver=1,o._parent=i.helper.parent(),e.currentItem=i.helper.appendTo(e.element).data("ui-sortable-item",!0),e.options._helper=e.options.helper,e.options.helper=function(){return i.helper[0]},s.target=e.currentItem[0],e._mouseCapture(s,!0),e._mouseStart(s,!0,!0),e.offset.click.top=o.offset.click.top,e.offset.click.left=o.offset.click.left,e.offset.parent.left-=o.offset.parent.left-e.offset.parent.left,e.offset.parent.top-=o.offset.parent.top-e.offset.parent.top,o._trigger("toSortable",s),o.dropped=e.element,P.each(o.sortables,function(){this.refreshPositions()}),o.currentItem=o.element,e.fromOutside=o),e.currentItem&&(e._mouseDrag(s),i.position=e.position)):e.isOver&&(e.isOver=0,e.cancelHelperRemoval=!0,e.options._revert=e.options.revert,e.options.revert=!1,e._trigger("out",s,e._uiHash(e)),e._mouseStop(s,!0),e.options.revert=e.options._revert,e.options.helper=e.options._helper,e.placeholder&&e.placeholder.remove(),i.helper.appendTo(o._parent),o._refreshOffsets(s),i.position=o._generatePosition(s,!0),o._trigger("fromSortable",s),o.dropped=!1,P.each(o.sortables,function(){this.refreshPositions()}))})}}),P.ui.plugin.add("draggable","cursor",{start:function(t,e,s){var i=P("body"),o=s.options;i.css("cursor")&&(o._cursor=i.css("cursor")),i.css("cursor",o.cursor)},stop:function(t,e,s){var i=s.options;i._cursor&&P("body").css("cursor",i._cursor)}}),P.ui.plugin.add("draggable","opacity",{start:function(t,e,s){var i=P(e.helper),o=s.options;i.css("opacity")&&(o._opacity=i.css("opacity")),i.css("opacity",o.opacity)},stop:function(t,e,s){var i=s.options;i._opacity&&P(e.helper).css("opacity",i._opacity)}}),P.ui.plugin.add("draggable","scroll",{start:function(t,e,s){s.scrollParentNotHidden||(s.scrollParentNotHidden=s.helper.scrollParent(!1)),s.scrollParentNotHidden[0]!==s.document[0]&&"HTML"!==s.scrollParentNotHidden[0].tagName&&(s.overflowOffset=s.scrollParentNotHidden.offset())},drag:function(t,e,s){var i=s.options,o=!1,n=s.scrollParentNotHidden[0],r=s.document[0];n!==r&&"HTML"!==n.tagName?(i.axis&&"x"===i.axis||(s.overflowOffset.top+n.offsetHeight-t.pageY<i.scrollSensitivity?n.scrollTop=o=n.scrollTop+i.scrollSpeed:t.pageY-s.overflowOffset.top<i.scrollSensitivity&&(n.scrollTop=o=n.scrollTop-i.scrollSpeed)),i.axis&&"y"===i.axis||(s.overflowOffset.left+n.offsetWidth-t.pageX<i.scrollSensitivity?n.scrollLeft=o=n.scrollLeft+i.scrollSpeed:t.pageX-s.overflowOffset.left<i.scrollSensitivity&&(n.scrollLeft=o=n.scrollLeft-i.scrollSpeed))):(i.axis&&"x"===i.axis||(t.pageY-P(r).scrollTop()<i.scrollSensitivity?o=P(r).scrollTop(P(r).scrollTop()-i.scrollSpeed):P(window).height()-(t.pageY-P(r).scrollTop())<i.scrollSensitivity&&(o=P(r).scrollTop(P(r).scrollTop()+i.scrollSpeed))),i.axis&&"y"===i.axis||(t.pageX-P(r).scrollLeft()<i.scrollSensitivity?o=P(r).scrollLeft(P(r).scrollLeft()-i.scrollSpeed):P(window).width()-(t.pageX-P(r).scrollLeft())<i.scrollSensitivity&&(o=P(r).scrollLeft(P(r).scrollLeft()+i.scrollSpeed)))),!1!==o&&P.ui.ddmanager&&!i.dropBehaviour&&P.ui.ddmanager.prepareOffsets(s,t)}}),P.ui.plugin.add("draggable","snap",{start:function(t,e,s){var i=s.options;s.snapElements=[],P(i.snap.constructor!==String?i.snap.items||":data(ui-draggable)":i.snap).each(function(){var t=P(this),e=t.offset();this!==s.element[0]&&s.snapElements.push({item:this,width:t.outerWidth(),height:t.outerHeight(),top:e.top,left:e.left})})},drag:function(t,e,s){var i,o,n,r,l,a,h,p,c,f,d=s.options,g=d.snapTolerance,u=e.offset.left,m=u+s.helperProportions.width,v=e.offset.top,_=v+s.helperProportions.height;for(c=s.snapElements.length-1;0<=c;c--)a=(l=s.snapElements[c].left-s.margins.left)+s.snapElements[c].width,p=(h=s.snapElements[c].top-s.margins.top)+s.snapElements[c].height,m<l-g||a+g<u||_<h-g||p+g<v||!P.contains(s.snapElements[c].item.ownerDocument,s.snapElements[c].item)?(s.snapElements[c].snapping&&s.options.snap.release&&s.options.snap.release.call(s.element,t,P.extend(s._uiHash(),{snapItem:s.snapElements[c].item})),s.snapElements[c].snapping=!1):("inner"!==d.snapMode&&(i=Math.abs(h-_)<=g,o=Math.abs(p-v)<=g,n=Math.abs(l-m)<=g,r=Math.abs(a-u)<=g,i&&(e.position.top=s._convertPositionTo("relative",{top:h-s.helperProportions.height,left:0}).top),o&&(e.position.top=s._convertPositionTo("relative",{top:p,left:0}).top),n&&(e.position.left=s._convertPositionTo("relative",{top:0,left:l-s.helperProportions.width}).left),r&&(e.position.left=s._convertPositionTo("relative",{top:0,left:a}).left)),f=i||o||n||r,"outer"!==d.snapMode&&(i=Math.abs(h-v)<=g,o=Math.abs(p-_)<=g,n=Math.abs(l-u)<=g,r=Math.abs(a-m)<=g,i&&(e.position.top=s._convertPositionTo("relative",{top:h,left:0}).top),o&&(e.position.top=s._convertPositionTo("relative",{top:p-s.helperProportions.height,left:0}).top),n&&(e.position.left=s._convertPositionTo("relative",{top:0,left:l}).left),r&&(e.position.left=s._convertPositionTo("relative",{top:0,left:a-s.helperProportions.width}).left)),!s.snapElements[c].snapping&&(i||o||n||r||f)&&s.options.snap.snap&&s.options.snap.snap.call(s.element,t,P.extend(s._uiHash(),{snapItem:s.snapElements[c].item})),s.snapElements[c].snapping=i||o||n||r||f)}}),P.ui.plugin.add("draggable","stack",{start:function(t,e,s){var i,o=s.options,n=P.makeArray(P(o.stack)).sort(function(t,e){return(parseInt(P(t).css("zIndex"),10)||0)-(parseInt(P(e).css("zIndex"),10)||0)});n.length&&(i=parseInt(P(n[0]).css("zIndex"),10)||0,P(n).each(function(t){P(this).css("zIndex",i+t)}),this.css("zIndex",i+n.length))}}),P.ui.plugin.add("draggable","zIndex",{start:function(t,e,s){var i=P(e.helper),o=s.options;i.css("zIndex")&&(o._zIndex=i.css("zIndex")),i.css("zIndex",o.zIndex)},stop:function(t,e,s){var i=s.options;i._zIndex&&P(e.helper).css("zIndex",i._zIndex)}}),P.ui.draggable});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/droppable.js b/wp-includes/js/jquery/ui/droppable.js
new file mode 100644
index 0000000000..b71cc30bce
--- /dev/null
+++ b/wp-includes/js/jquery/ui/droppable.js
@@ -0,0 +1,496 @@
+/*!
+ * jQuery UI Droppable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Droppable
+//>>group: Interactions
+//>>description: Enables drop targets for draggable elements.
+//>>docs: http://api.jqueryui.com/droppable/
+//>>demos: http://jqueryui.com/droppable/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./draggable",
+			"./mouse",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.droppable", {
+	version: "1.12.1",
+	widgetEventPrefix: "drop",
+	options: {
+		accept: "*",
+		addClasses: true,
+		greedy: false,
+		scope: "default",
+		tolerance: "intersect",
+
+		// Callbacks
+		activate: null,
+		deactivate: null,
+		drop: null,
+		out: null,
+		over: null
+	},
+	_create: function() {
+
+		var proportions,
+			o = this.options,
+			accept = o.accept;
+
+		this.isover = false;
+		this.isout = true;
+
+		this.accept = $.isFunction( accept ) ? accept : function( d ) {
+			return d.is( accept );
+		};
+
+		this.proportions = function( /* valueToWrite */ ) {
+			if ( arguments.length ) {
+
+				// Store the droppable's proportions
+				proportions = arguments[ 0 ];
+			} else {
+
+				// Retrieve or derive the droppable's proportions
+				return proportions ?
+					proportions :
+					proportions = {
+						width: this.element[ 0 ].offsetWidth,
+						height: this.element[ 0 ].offsetHeight
+					};
+			}
+		};
+
+		this._addToManager( o.scope );
+
+		o.addClasses && this._addClass( "ui-droppable" );
+
+	},
+
+	_addToManager: function( scope ) {
+
+		// Add the reference and positions to the manager
+		$.ui.ddmanager.droppables[ scope ] = $.ui.ddmanager.droppables[ scope ] || [];
+		$.ui.ddmanager.droppables[ scope ].push( this );
+	},
+
+	_splice: function( drop ) {
+		var i = 0;
+		for ( ; i < drop.length; i++ ) {
+			if ( drop[ i ] === this ) {
+				drop.splice( i, 1 );
+			}
+		}
+	},
+
+	_destroy: function() {
+		var drop = $.ui.ddmanager.droppables[ this.options.scope ];
+
+		this._splice( drop );
+	},
+
+	_setOption: function( key, value ) {
+
+		if ( key === "accept" ) {
+			this.accept = $.isFunction( value ) ? value : function( d ) {
+				return d.is( value );
+			};
+		} else if ( key === "scope" ) {
+			var drop = $.ui.ddmanager.droppables[ this.options.scope ];
+
+			this._splice( drop );
+			this._addToManager( value );
+		}
+
+		this._super( key, value );
+	},
+
+	_activate: function( event ) {
+		var draggable = $.ui.ddmanager.current;
+
+		this._addActiveClass();
+		if ( draggable ) {
+			this._trigger( "activate", event, this.ui( draggable ) );
+		}
+	},
+
+	_deactivate: function( event ) {
+		var draggable = $.ui.ddmanager.current;
+
+		this._removeActiveClass();
+		if ( draggable ) {
+			this._trigger( "deactivate", event, this.ui( draggable ) );
+		}
+	},
+
+	_over: function( event ) {
+
+		var draggable = $.ui.ddmanager.current;
+
+		// Bail if draggable and droppable are same element
+		if ( !draggable || ( draggable.currentItem ||
+				draggable.element )[ 0 ] === this.element[ 0 ] ) {
+			return;
+		}
+
+		if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem ||
+				draggable.element ) ) ) {
+			this._addHoverClass();
+			this._trigger( "over", event, this.ui( draggable ) );
+		}
+
+	},
+
+	_out: function( event ) {
+
+		var draggable = $.ui.ddmanager.current;
+
+		// Bail if draggable and droppable are same element
+		if ( !draggable || ( draggable.currentItem ||
+				draggable.element )[ 0 ] === this.element[ 0 ] ) {
+			return;
+		}
+
+		if ( this.accept.call( this.element[ 0 ], ( draggable.currentItem ||
+				draggable.element ) ) ) {
+			this._removeHoverClass();
+			this._trigger( "out", event, this.ui( draggable ) );
+		}
+
+	},
+
+	_drop: function( event, custom ) {
+
+		var draggable = custom || $.ui.ddmanager.current,
+			childrenIntersection = false;
+
+		// Bail if draggable and droppable are same element
+		if ( !draggable || ( draggable.currentItem ||
+				draggable.element )[ 0 ] === this.element[ 0 ] ) {
+			return false;
+		}
+
+		this.element
+			.find( ":data(ui-droppable)" )
+			.not( ".ui-draggable-dragging" )
+			.each( function() {
+				var inst = $( this ).droppable( "instance" );
+				if (
+					inst.options.greedy &&
+					!inst.options.disabled &&
+					inst.options.scope === draggable.options.scope &&
+					inst.accept.call(
+						inst.element[ 0 ], ( draggable.currentItem || draggable.element )
+					) &&
+					intersect(
+						draggable,
+						$.extend( inst, { offset: inst.element.offset() } ),
+						inst.options.tolerance, event
+					)
+				) {
+					childrenIntersection = true;
+					return false; }
+			} );
+		if ( childrenIntersection ) {
+			return false;
+		}
+
+		if ( this.accept.call( this.element[ 0 ],
+				( draggable.currentItem || draggable.element ) ) ) {
+			this._removeActiveClass();
+			this._removeHoverClass();
+
+			this._trigger( "drop", event, this.ui( draggable ) );
+			return this.element;
+		}
+
+		return false;
+
+	},
+
+	ui: function( c ) {
+		return {
+			draggable: ( c.currentItem || c.element ),
+			helper: c.helper,
+			position: c.position,
+			offset: c.positionAbs
+		};
+	},
+
+	// Extension points just to make backcompat sane and avoid duplicating logic
+	// TODO: Remove in 1.13 along with call to it below
+	_addHoverClass: function() {
+		this._addClass( "ui-droppable-hover" );
+	},
+
+	_removeHoverClass: function() {
+		this._removeClass( "ui-droppable-hover" );
+	},
+
+	_addActiveClass: function() {
+		this._addClass( "ui-droppable-active" );
+	},
+
+	_removeActiveClass: function() {
+		this._removeClass( "ui-droppable-active" );
+	}
+} );
+
+var intersect = $.ui.intersect = ( function() {
+	function isOverAxis( x, reference, size ) {
+		return ( x >= reference ) && ( x < ( reference + size ) );
+	}
+
+	return function( draggable, droppable, toleranceMode, event ) {
+
+		if ( !droppable.offset ) {
+			return false;
+		}
+
+		var x1 = ( draggable.positionAbs ||
+				draggable.position.absolute ).left + draggable.margins.left,
+			y1 = ( draggable.positionAbs ||
+				draggable.position.absolute ).top + draggable.margins.top,
+			x2 = x1 + draggable.helperProportions.width,
+			y2 = y1 + draggable.helperProportions.height,
+			l = droppable.offset.left,
+			t = droppable.offset.top,
+			r = l + droppable.proportions().width,
+			b = t + droppable.proportions().height;
+
+		switch ( toleranceMode ) {
+		case "fit":
+			return ( l <= x1 && x2 <= r && t <= y1 && y2 <= b );
+		case "intersect":
+			return ( l < x1 + ( draggable.helperProportions.width / 2 ) && // Right Half
+				x2 - ( draggable.helperProportions.width / 2 ) < r && // Left Half
+				t < y1 + ( draggable.helperProportions.height / 2 ) && // Bottom Half
+				y2 - ( draggable.helperProportions.height / 2 ) < b ); // Top Half
+		case "pointer":
+			return isOverAxis( event.pageY, t, droppable.proportions().height ) &&
+				isOverAxis( event.pageX, l, droppable.proportions().width );
+		case "touch":
+			return (
+				( y1 >= t && y1 <= b ) || // Top edge touching
+				( y2 >= t && y2 <= b ) || // Bottom edge touching
+				( y1 < t && y2 > b ) // Surrounded vertically
+			) && (
+				( x1 >= l && x1 <= r ) || // Left edge touching
+				( x2 >= l && x2 <= r ) || // Right edge touching
+				( x1 < l && x2 > r ) // Surrounded horizontally
+			);
+		default:
+			return false;
+		}
+	};
+} )();
+
+/*
+	This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+	current: null,
+	droppables: { "default": [] },
+	prepareOffsets: function( t, event ) {
+
+		var i, j,
+			m = $.ui.ddmanager.droppables[ t.options.scope ] || [],
+			type = event ? event.type : null, // workaround for #2317
+			list = ( t.currentItem || t.element ).find( ":data(ui-droppable)" ).addBack();
+
+		droppablesLoop: for ( i = 0; i < m.length; i++ ) {
+
+			// No disabled and non-accepted
+			if ( m[ i ].options.disabled || ( t && !m[ i ].accept.call( m[ i ].element[ 0 ],
+					( t.currentItem || t.element ) ) ) ) {
+				continue;
+			}
+
+			// Filter out elements in the current dragged item
+			for ( j = 0; j < list.length; j++ ) {
+				if ( list[ j ] === m[ i ].element[ 0 ] ) {
+					m[ i ].proportions().height = 0;
+					continue droppablesLoop;
+				}
+			}
+
+			m[ i ].visible = m[ i ].element.css( "display" ) !== "none";
+			if ( !m[ i ].visible ) {
+				continue;
+			}
+
+			// Activate the droppable if used directly from draggables
+			if ( type === "mousedown" ) {
+				m[ i ]._activate.call( m[ i ], event );
+			}
+
+			m[ i ].offset = m[ i ].element.offset();
+			m[ i ].proportions( {
+				width: m[ i ].element[ 0 ].offsetWidth,
+				height: m[ i ].element[ 0 ].offsetHeight
+			} );
+
+		}
+
+	},
+	drop: function( draggable, event ) {
+
+		var dropped = false;
+
+		// Create a copy of the droppables in case the list changes during the drop (#9116)
+		$.each( ( $.ui.ddmanager.droppables[ draggable.options.scope ] || [] ).slice(), function() {
+
+			if ( !this.options ) {
+				return;
+			}
+			if ( !this.options.disabled && this.visible &&
+					intersect( draggable, this, this.options.tolerance, event ) ) {
+				dropped = this._drop.call( this, event ) || dropped;
+			}
+
+			if ( !this.options.disabled && this.visible && this.accept.call( this.element[ 0 ],
+					( draggable.currentItem || draggable.element ) ) ) {
+				this.isout = true;
+				this.isover = false;
+				this._deactivate.call( this, event );
+			}
+
+		} );
+		return dropped;
+
+	},
+	dragStart: function( draggable, event ) {
+
+		// Listen for scrolling so that if the dragging causes scrolling the position of the
+		// droppables can be recalculated (see #5003)
+		draggable.element.parentsUntil( "body" ).on( "scroll.droppable", function() {
+			if ( !draggable.options.refreshPositions ) {
+				$.ui.ddmanager.prepareOffsets( draggable, event );
+			}
+		} );
+	},
+	drag: function( draggable, event ) {
+
+		// If you have a highly dynamic page, you might try this option. It renders positions
+		// every time you move the mouse.
+		if ( draggable.options.refreshPositions ) {
+			$.ui.ddmanager.prepareOffsets( draggable, event );
+		}
+
+		// Run through all droppables and check their positions based on specific tolerance options
+		$.each( $.ui.ddmanager.droppables[ draggable.options.scope ] || [], function() {
+
+			if ( this.options.disabled || this.greedyChild || !this.visible ) {
+				return;
+			}
+
+			var parentInstance, scope, parent,
+				intersects = intersect( draggable, this, this.options.tolerance, event ),
+				c = !intersects && this.isover ?
+					"isout" :
+					( intersects && !this.isover ? "isover" : null );
+			if ( !c ) {
+				return;
+			}
+
+			if ( this.options.greedy ) {
+
+				// find droppable parents with same scope
+				scope = this.options.scope;
+				parent = this.element.parents( ":data(ui-droppable)" ).filter( function() {
+					return $( this ).droppable( "instance" ).options.scope === scope;
+				} );
+
+				if ( parent.length ) {
+					parentInstance = $( parent[ 0 ] ).droppable( "instance" );
+					parentInstance.greedyChild = ( c === "isover" );
+				}
+			}
+
+			// We just moved into a greedy child
+			if ( parentInstance && c === "isover" ) {
+				parentInstance.isover = false;
+				parentInstance.isout = true;
+				parentInstance._out.call( parentInstance, event );
+			}
+
+			this[ c ] = true;
+			this[ c === "isout" ? "isover" : "isout" ] = false;
+			this[ c === "isover" ? "_over" : "_out" ].call( this, event );
+
+			// We just moved out of a greedy child
+			if ( parentInstance && c === "isout" ) {
+				parentInstance.isout = false;
+				parentInstance.isover = true;
+				parentInstance._over.call( parentInstance, event );
+			}
+		} );
+
+	},
+	dragStop: function( draggable, event ) {
+		draggable.element.parentsUntil( "body" ).off( "scroll.droppable" );
+
+		// Call prepareOffsets one final time since IE does not fire return scroll events when
+		// overflow was caused by drag (see #5003)
+		if ( !draggable.options.refreshPositions ) {
+			$.ui.ddmanager.prepareOffsets( draggable, event );
+		}
+	}
+};
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for activeClass and hoverClass options
+	$.widget( "ui.droppable", $.ui.droppable, {
+		options: {
+			hoverClass: false,
+			activeClass: false
+		},
+		_addActiveClass: function() {
+			this._super();
+			if ( this.options.activeClass ) {
+				this.element.addClass( this.options.activeClass );
+			}
+		},
+		_removeActiveClass: function() {
+			this._super();
+			if ( this.options.activeClass ) {
+				this.element.removeClass( this.options.activeClass );
+			}
+		},
+		_addHoverClass: function() {
+			this._super();
+			if ( this.options.hoverClass ) {
+				this.element.addClass( this.options.hoverClass );
+			}
+		},
+		_removeHoverClass: function() {
+			this._super();
+			if ( this.options.hoverClass ) {
+				this.element.removeClass( this.options.hoverClass );
+			}
+		}
+	} );
+}
+
+return $.ui.droppable;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/droppable.min.js b/wp-includes/js/jquery/ui/droppable.min.js
index 6747a912f0..22c3804bf4 100644
--- a/wp-includes/js/jquery/ui/droppable.min.js
+++ b/wp-includes/js/jquery/ui/droppable.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Droppable 1.11.4
+ * jQuery UI Droppable 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/droppable/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./mouse","./draggable"],e):e(jQuery)}(function(a){function d(e,t,i){return t<=e&&e<t+i}return a.widget("ui.droppable",{version:"1.11.4",widgetEventPrefix:"drop",options:{accept:"*",activeClass:!1,addClasses:!0,greedy:!1,hoverClass:!1,scope:"default",tolerance:"intersect",activate:null,deactivate:null,drop:null,out:null,over:null},_create:function(){var e,t=this.options,i=t.accept;this.isover=!1,this.isout=!0,this.accept=a.isFunction(i)?i:function(e){return e.is(i)},this.proportions=function(){if(!arguments.length)return e||(e={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight});e=arguments[0]},this._addToManager(t.scope),t.addClasses&&this.element.addClass("ui-droppable")},_addToManager:function(e){a.ui.ddmanager.droppables[e]=a.ui.ddmanager.droppables[e]||[],a.ui.ddmanager.droppables[e].push(this)},_splice:function(e){for(var t=0;t<e.length;t++)e[t]===this&&e.splice(t,1)},_destroy:function(){var e=a.ui.ddmanager.droppables[this.options.scope];this._splice(e),this.element.removeClass("ui-droppable ui-droppable-disabled")},_setOption:function(e,t){if("accept"===e)this.accept=a.isFunction(t)?t:function(e){return e.is(t)};else if("scope"===e){var i=a.ui.ddmanager.droppables[this.options.scope];this._splice(i),this._addToManager(t)}this._super(e,t)},_activate:function(e){var t=a.ui.ddmanager.current;this.options.activeClass&&this.element.addClass(this.options.activeClass),t&&this._trigger("activate",e,this.ui(t))},_deactivate:function(e){var t=a.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass),t&&this._trigger("deactivate",e,this.ui(t))},_over:function(e){var t=a.ui.ddmanager.current;t&&(t.currentItem||t.element)[0]!==this.element[0]&&this.accept.call(this.element[0],t.currentItem||t.element)&&(this.options.hoverClass&&this.element.addClass(this.options.hoverClass),this._trigger("over",e,this.ui(t)))},_out:function(e){var t=a.ui.ddmanager.current;t&&(t.currentItem||t.element)[0]!==this.element[0]&&this.accept.call(this.element[0],t.currentItem||t.element)&&(this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("out",e,this.ui(t)))},_drop:function(t,e){var i=e||a.ui.ddmanager.current,s=!1;return!(!i||(i.currentItem||i.element)[0]===this.element[0])&&(this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function(){var e=a(this).droppable("instance");if(e.options.greedy&&!e.options.disabled&&e.options.scope===i.options.scope&&e.accept.call(e.element[0],i.currentItem||i.element)&&a.ui.intersect(i,a.extend(e,{offset:e.element.offset()}),e.options.tolerance,t))return!(s=!0)}),!s&&(!!this.accept.call(this.element[0],i.currentItem||i.element)&&(this.options.activeClass&&this.element.removeClass(this.options.activeClass),this.options.hoverClass&&this.element.removeClass(this.options.hoverClass),this._trigger("drop",t,this.ui(i)),this.element)))},ui:function(e){return{draggable:e.currentItem||e.element,helper:e.helper,position:e.position,offset:e.positionAbs}}}),a.ui.intersect=function(e,t,i,s){if(!t.offset)return!1;var o=(e.positionAbs||e.position.absolute).left+e.margins.left,n=(e.positionAbs||e.position.absolute).top+e.margins.top,r=o+e.helperProportions.width,a=n+e.helperProportions.height,l=t.offset.left,p=t.offset.top,h=l+t.proportions().width,c=p+t.proportions().height;switch(i){case"fit":return l<=o&&r<=h&&p<=n&&a<=c;case"intersect":return l<o+e.helperProportions.width/2&&r-e.helperProportions.width/2<h&&p<n+e.helperProportions.height/2&&a-e.helperProportions.height/2<c;case"pointer":return d(s.pageY,p,t.proportions().height)&&d(s.pageX,l,t.proportions().width);case"touch":return(p<=n&&n<=c||p<=a&&a<=c||n<p&&c<a)&&(l<=o&&o<=h||l<=r&&r<=h||o<l&&h<r);default:return!1}},a.ui.ddmanager={current:null,droppables:{default:[]},prepareOffsets:function(e,t){var i,s,o=a.ui.ddmanager.droppables[e.options.scope]||[],n=t?t.type:null,r=(e.currentItem||e.element).find(":data(ui-droppable)").addBack();e:for(i=0;i<o.length;i++)if(!(o[i].options.disabled||e&&!o[i].accept.call(o[i].element[0],e.currentItem||e.element))){for(s=0;s<r.length;s++)if(r[s]===o[i].element[0]){o[i].proportions().height=0;continue e}o[i].visible="none"!==o[i].element.css("display"),o[i].visible&&("mousedown"===n&&o[i]._activate.call(o[i],t),o[i].offset=o[i].element.offset(),o[i].proportions({width:o[i].element[0].offsetWidth,height:o[i].element[0].offsetHeight}))}},drop:function(e,t){var i=!1;return a.each((a.ui.ddmanager.droppables[e.options.scope]||[]).slice(),function(){this.options&&(!this.options.disabled&&this.visible&&a.ui.intersect(e,this,this.options.tolerance,t)&&(i=this._drop.call(this,t)||i),!this.options.disabled&&this.visible&&this.accept.call(this.element[0],e.currentItem||e.element)&&(this.isout=!0,this.isover=!1,this._deactivate.call(this,t)))}),i},dragStart:function(e,t){e.element.parentsUntil("body").bind("scroll.droppable",function(){e.options.refreshPositions||a.ui.ddmanager.prepareOffsets(e,t)})},drag:function(n,r){n.options.refreshPositions&&a.ui.ddmanager.prepareOffsets(n,r),a.each(a.ui.ddmanager.droppables[n.options.scope]||[],function(){if(!this.options.disabled&&!this.greedyChild&&this.visible){var e,t,i,s=a.ui.intersect(n,this,this.options.tolerance,r),o=!s&&this.isover?"isout":s&&!this.isover?"isover":null;o&&(this.options.greedy&&(t=this.options.scope,(i=this.element.parents(":data(ui-droppable)").filter(function(){return a(this).droppable("instance").options.scope===t})).length&&((e=a(i[0]).droppable("instance")).greedyChild="isover"===o)),e&&"isover"===o&&(e.isover=!1,e.isout=!0,e._out.call(e,r)),this[o]=!0,this["isout"===o?"isover":"isout"]=!1,this["isover"===o?"_over":"_out"].call(this,r),e&&"isout"===o&&(e.isout=!1,e.isover=!0,e._over.call(e,r)))}})},dragStop:function(e,t){e.element.parentsUntil("body").unbind("scroll.droppable"),e.options.refreshPositions||a.ui.ddmanager.prepareOffsets(e,t)}},a.ui.droppable});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./draggable","./mouse","./core"],e):e(jQuery)}(function(a){a.widget("ui.droppable",{version:"1.12.1",widgetEventPrefix:"drop",options:{accept:"*",addClasses:!0,greedy:!1,scope:"default",tolerance:"intersect",activate:null,deactivate:null,drop:null,out:null,over:null},_create:function(){var e,t=this.options,i=t.accept;this.isover=!1,this.isout=!0,this.accept=a.isFunction(i)?i:function(e){return e.is(i)},this.proportions=function(){if(!arguments.length)return e||(e={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight});e=arguments[0]},this._addToManager(t.scope),t.addClasses&&this._addClass("ui-droppable")},_addToManager:function(e){a.ui.ddmanager.droppables[e]=a.ui.ddmanager.droppables[e]||[],a.ui.ddmanager.droppables[e].push(this)},_splice:function(e){for(var t=0;t<e.length;t++)e[t]===this&&e.splice(t,1)},_destroy:function(){var e=a.ui.ddmanager.droppables[this.options.scope];this._splice(e)},_setOption:function(e,t){if("accept"===e)this.accept=a.isFunction(t)?t:function(e){return e.is(t)};else if("scope"===e){var i=a.ui.ddmanager.droppables[this.options.scope];this._splice(i),this._addToManager(t)}this._super(e,t)},_activate:function(e){var t=a.ui.ddmanager.current;this._addActiveClass(),t&&this._trigger("activate",e,this.ui(t))},_deactivate:function(e){var t=a.ui.ddmanager.current;this._removeActiveClass(),t&&this._trigger("deactivate",e,this.ui(t))},_over:function(e){var t=a.ui.ddmanager.current;t&&(t.currentItem||t.element)[0]!==this.element[0]&&this.accept.call(this.element[0],t.currentItem||t.element)&&(this._addHoverClass(),this._trigger("over",e,this.ui(t)))},_out:function(e){var t=a.ui.ddmanager.current;t&&(t.currentItem||t.element)[0]!==this.element[0]&&this.accept.call(this.element[0],t.currentItem||t.element)&&(this._removeHoverClass(),this._trigger("out",e,this.ui(t)))},_drop:function(t,e){var i=e||a.ui.ddmanager.current,s=!1;return!(!i||(i.currentItem||i.element)[0]===this.element[0])&&(this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function(){var e=a(this).droppable("instance");if(e.options.greedy&&!e.options.disabled&&e.options.scope===i.options.scope&&e.accept.call(e.element[0],i.currentItem||i.element)&&l(i,a.extend(e,{offset:e.element.offset()}),e.options.tolerance,t))return!(s=!0)}),!s&&(!!this.accept.call(this.element[0],i.currentItem||i.element)&&(this._removeActiveClass(),this._removeHoverClass(),this._trigger("drop",t,this.ui(i)),this.element)))},ui:function(e){return{draggable:e.currentItem||e.element,helper:e.helper,position:e.position,offset:e.positionAbs}},_addHoverClass:function(){this._addClass("ui-droppable-hover")},_removeHoverClass:function(){this._removeClass("ui-droppable-hover")},_addActiveClass:function(){this._addClass("ui-droppable-active")},_removeActiveClass:function(){this._removeClass("ui-droppable-active")}});var l=a.ui.intersect=function(e,t,i,s){if(!t.offset)return!1;var o=(e.positionAbs||e.position.absolute).left+e.margins.left,r=(e.positionAbs||e.position.absolute).top+e.margins.top,n=o+e.helperProportions.width,a=r+e.helperProportions.height,l=t.offset.left,p=t.offset.top,d=l+t.proportions().width,c=p+t.proportions().height;switch(i){case"fit":return l<=o&&n<=d&&p<=r&&a<=c;case"intersect":return l<o+e.helperProportions.width/2&&n-e.helperProportions.width/2<d&&p<r+e.helperProportions.height/2&&a-e.helperProportions.height/2<c;case"pointer":return h(s.pageY,p,t.proportions().height)&&h(s.pageX,l,t.proportions().width);case"touch":return(p<=r&&r<=c||p<=a&&a<=c||r<p&&c<a)&&(l<=o&&o<=d||l<=n&&n<=d||o<l&&d<n);default:return!1}};function h(e,t,i){return t<=e&&e<t+i}return!(a.ui.ddmanager={current:null,droppables:{default:[]},prepareOffsets:function(e,t){var i,s,o=a.ui.ddmanager.droppables[e.options.scope]||[],r=t?t.type:null,n=(e.currentItem||e.element).find(":data(ui-droppable)").addBack();e:for(i=0;i<o.length;i++)if(!(o[i].options.disabled||e&&!o[i].accept.call(o[i].element[0],e.currentItem||e.element))){for(s=0;s<n.length;s++)if(n[s]===o[i].element[0]){o[i].proportions().height=0;continue e}o[i].visible="none"!==o[i].element.css("display"),o[i].visible&&("mousedown"===r&&o[i]._activate.call(o[i],t),o[i].offset=o[i].element.offset(),o[i].proportions({width:o[i].element[0].offsetWidth,height:o[i].element[0].offsetHeight}))}},drop:function(e,t){var i=!1;return a.each((a.ui.ddmanager.droppables[e.options.scope]||[]).slice(),function(){this.options&&(!this.options.disabled&&this.visible&&l(e,this,this.options.tolerance,t)&&(i=this._drop.call(this,t)||i),!this.options.disabled&&this.visible&&this.accept.call(this.element[0],e.currentItem||e.element)&&(this.isout=!0,this.isover=!1,this._deactivate.call(this,t)))}),i},dragStart:function(e,t){e.element.parentsUntil("body").on("scroll.droppable",function(){e.options.refreshPositions||a.ui.ddmanager.prepareOffsets(e,t)})},drag:function(r,n){r.options.refreshPositions&&a.ui.ddmanager.prepareOffsets(r,n),a.each(a.ui.ddmanager.droppables[r.options.scope]||[],function(){if(!this.options.disabled&&!this.greedyChild&&this.visible){var e,t,i,s=l(r,this,this.options.tolerance,n),o=!s&&this.isover?"isout":s&&!this.isover?"isover":null;o&&(this.options.greedy&&(t=this.options.scope,(i=this.element.parents(":data(ui-droppable)").filter(function(){return a(this).droppable("instance").options.scope===t})).length&&((e=a(i[0]).droppable("instance")).greedyChild="isover"===o)),e&&"isover"===o&&(e.isover=!1,e.isout=!0,e._out.call(e,n)),this[o]=!0,this["isout"===o?"isover":"isout"]=!1,this["isover"===o?"_over":"_out"].call(this,n),e&&"isout"===o&&(e.isout=!1,e.isover=!0,e._over.call(e,n)))}})},dragStop:function(e,t){e.element.parentsUntil("body").off("scroll.droppable"),e.options.refreshPositions||a.ui.ddmanager.prepareOffsets(e,t)}})!==a.uiBackCompat&&a.widget("ui.droppable",a.ui.droppable,{options:{hoverClass:!1,activeClass:!1},_addActiveClass:function(){this._super(),this.options.activeClass&&this.element.addClass(this.options.activeClass)},_removeActiveClass:function(){this._super(),this.options.activeClass&&this.element.removeClass(this.options.activeClass)},_addHoverClass:function(){this._super(),this.options.hoverClass&&this.element.addClass(this.options.hoverClass)},_removeHoverClass:function(){this._super(),this.options.hoverClass&&this.element.removeClass(this.options.hoverClass)}}),a.ui.droppable});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-blind.js b/wp-includes/js/jquery/ui/effect-blind.js
new file mode 100644
index 0000000000..6ab63fa1d0
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-blind.js
@@ -0,0 +1,69 @@
+/*!
+ * jQuery UI Effects Blind 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Blind Effect
+//>>group: Effects
+//>>description: Blinds the element.
+//>>docs: http://api.jqueryui.com/blind-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "blind", "hide", function( options, done ) {
+	var map = {
+			up: [ "bottom", "top" ],
+			vertical: [ "bottom", "top" ],
+			down: [ "top", "bottom" ],
+			left: [ "right", "left" ],
+			horizontal: [ "right", "left" ],
+			right: [ "left", "right" ]
+		},
+		element = $( this ),
+		direction = options.direction || "up",
+		start = element.cssClip(),
+		animate = { clip: $.extend( {}, start ) },
+		placeholder = $.effects.createPlaceholder( element );
+
+	animate.clip[ map[ direction ][ 0 ] ] = animate.clip[ map[ direction ][ 1 ] ];
+
+	if ( options.mode === "show" ) {
+		element.cssClip( animate.clip );
+		if ( placeholder ) {
+			placeholder.css( $.effects.clipToBox( animate ) );
+		}
+
+		animate.clip = start;
+	}
+
+	if ( placeholder ) {
+		placeholder.animate( $.effects.clipToBox( animate ), options.duration, options.easing );
+	}
+
+	element.animate( animate, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-blind.min.js b/wp-includes/js/jquery/ui/effect-blind.min.js
index cea78d27e3..9b06d9c59f 100644
--- a/wp-includes/js/jquery/ui/effect-blind.min.js
+++ b/wp-includes/js/jquery/ui/effect-blind.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Blind 1.11.4
+ * jQuery UI Effects Blind 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/blind-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(m){return m.effects.effect.blind=function(e,t){var s,i,o,f=m(this),n=["position","top","bottom","left","right","height","width"],c=m.effects.setMode(f,e.mode||"hide"),r=e.direction||"up",a=/up|down|vertical/.test(r),p=a?"height":"width",d=a?"top":"left",u=/up|left|vertical|horizontal/.test(r),h={},l="show"===c;f.parent().is(".ui-effects-wrapper")?m.effects.save(f.parent(),n):m.effects.save(f,n),f.show(),i=(s=m.effects.createWrapper(f).css({overflow:"hidden"}))[p](),o=parseFloat(s.css(d))||0,h[p]=l?i:0,u||(f.css(a?"bottom":"right",0).css(a?"top":"left","auto").css({position:"absolute"}),h[d]=l?o:i+o),l&&(s.css(p,0),u||s.css(d,o+i)),s.animate(h,{duration:e.duration,easing:e.easing,queue:!1,complete:function(){"hide"===c&&f.hide(),m.effects.restore(f,n),m.effects.removeWrapper(f),t()}})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(r){return r.effects.define("blind","hide",function(e,t){var i={up:["bottom","top"],vertical:["bottom","top"],down:["top","bottom"],left:["right","left"],horizontal:["right","left"],right:["left","right"]},o=r(this),n=e.direction||"up",c=o.cssClip(),f={clip:r.extend({},c)},l=r.effects.createPlaceholder(o);f.clip[i[n][0]]=f.clip[i[n][1]],"show"===e.mode&&(o.cssClip(f.clip),l&&l.css(r.effects.clipToBox(f)),f.clip=c),l&&l.animate(r.effects.clipToBox(f),e.duration,e.easing),o.animate(f,{queue:!1,duration:e.duration,easing:e.easing,complete:t})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-bounce.js b/wp-includes/js/jquery/ui/effect-bounce.js
new file mode 100644
index 0000000000..00ff5b2235
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-bounce.js
@@ -0,0 +1,109 @@
+/*!
+ * jQuery UI Effects Bounce 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Bounce Effect
+//>>group: Effects
+//>>description: Bounces an element horizontally or vertically n times.
+//>>docs: http://api.jqueryui.com/bounce-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "bounce", function( options, done ) {
+	var upAnim, downAnim, refValue,
+		element = $( this ),
+
+		// Defaults:
+		mode = options.mode,
+		hide = mode === "hide",
+		show = mode === "show",
+		direction = options.direction || "up",
+		distance = options.distance,
+		times = options.times || 5,
+
+		// Number of internal animations
+		anims = times * 2 + ( show || hide ? 1 : 0 ),
+		speed = options.duration / anims,
+		easing = options.easing,
+
+		// Utility:
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		motion = ( direction === "up" || direction === "left" ),
+		i = 0,
+
+		queuelen = element.queue().length;
+
+	$.effects.createPlaceholder( element );
+
+	refValue = element.css( ref );
+
+	// Default distance for the BIGGEST bounce is the outer Distance / 3
+	if ( !distance ) {
+		distance = element[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3;
+	}
+
+	if ( show ) {
+		downAnim = { opacity: 1 };
+		downAnim[ ref ] = refValue;
+
+		// If we are showing, force opacity 0 and set the initial position
+		// then do the "first" animation
+		element
+			.css( "opacity", 0 )
+			.css( ref, motion ? -distance * 2 : distance * 2 )
+			.animate( downAnim, speed, easing );
+	}
+
+	// Start at the smallest distance if we are hiding
+	if ( hide ) {
+		distance = distance / Math.pow( 2, times - 1 );
+	}
+
+	downAnim = {};
+	downAnim[ ref ] = refValue;
+
+	// Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
+	for ( ; i < times; i++ ) {
+		upAnim = {};
+		upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+		element
+			.animate( upAnim, speed, easing )
+			.animate( downAnim, speed, easing );
+
+		distance = hide ? distance * 2 : distance / 2;
+	}
+
+	// Last Bounce when Hiding
+	if ( hide ) {
+		upAnim = { opacity: 0 };
+		upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance;
+
+		element.animate( upAnim, speed, easing );
+	}
+
+	element.queue( done );
+
+	$.effects.unshift( element, queuelen, anims + 1 );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-bounce.min.js b/wp-includes/js/jquery/ui/effect-bounce.min.js
index 7ab6cfdf5e..8018dd8ddd 100644
--- a/wp-includes/js/jquery/ui/effect-bounce.min.js
+++ b/wp-includes/js/jquery/ui/effect-bounce.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Bounce 1.11.4
+ * jQuery UI Effects Bounce 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/bounce-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(v){return v.effects.effect.bounce=function(e,t){var i,o,f,c=v(this),n=["position","top","bottom","left","right","height","width"],a=v.effects.setMode(c,e.mode||"effect"),s="hide"===a,p="show"===a,u=e.direction||"up",r=e.distance,d=e.times||5,h=2*d+(p||s?1:0),m=e.duration/h,y=e.easing,l="up"===u||"down"===u?"top":"left",g="up"===u||"left"===u,w=c.queue(),q=w.length;for((p||s)&&n.push("opacity"),v.effects.save(c,n),c.show(),v.effects.createWrapper(c),r=r||c["top"==l?"outerHeight":"outerWidth"]()/3,p&&((f={opacity:1})[l]=0,c.css("opacity",0).css(l,g?2*-r:2*r).animate(f,m,y)),s&&(r/=Math.pow(2,d-1)),i=(f={})[l]=0;i<d;i++)(o={})[l]=(g?"-=":"+=")+r,c.animate(o,m,y).animate(f,m,y),r=s?2*r:r/2;s&&((o={opacity:0})[l]=(g?"-=":"+=")+r,c.animate(o,m,y)),c.queue(function(){s&&c.hide(),v.effects.restore(c,n),v.effects.removeWrapper(c),t()}),1<q&&w.splice.apply(w,[1,0].concat(w.splice(q,1+h))),c.dequeue()}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(w){return w.effects.define("bounce",function(e,t){var i,n,f,o=w(this),a=e.mode,c="hide"===a,u="show"===a,s=e.direction||"up",d=e.distance,r=e.times||5,p=2*r+(u||c?1:0),h=e.duration/p,m=e.easing,y="up"===s||"down"===s?"top":"left",l="up"===s||"left"===s,g=0,q=o.queue().length;for(w.effects.createPlaceholder(o),f=o.css(y),d=d||o["top"==y?"outerHeight":"outerWidth"]()/3,u&&((n={opacity:1})[y]=f,o.css("opacity",0).css(y,l?2*-d:2*d).animate(n,h,m)),c&&(d/=Math.pow(2,r-1)),(n={})[y]=f;g<r;g++)(i={})[y]=(l?"-=":"+=")+d,o.animate(i,h,m).animate(n,h,m),d=c?2*d:d/2;c&&((i={opacity:0})[y]=(l?"-=":"+=")+d,o.animate(i,h,m)),o.queue(t),w.effects.unshift(o,q,1+p)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-clip.js b/wp-includes/js/jquery/ui/effect-clip.js
new file mode 100644
index 0000000000..bdeaeb2607
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-clip.js
@@ -0,0 +1,64 @@
+/*!
+ * jQuery UI Effects Clip 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Clip Effect
+//>>group: Effects
+//>>description: Clips the element on and off like an old TV.
+//>>docs: http://api.jqueryui.com/clip-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "clip", "hide", function( options, done ) {
+	var start,
+		animate = {},
+		element = $( this ),
+		direction = options.direction || "vertical",
+		both = direction === "both",
+		horizontal = both || direction === "horizontal",
+		vertical = both || direction === "vertical";
+
+	start = element.cssClip();
+	animate.clip = {
+		top: vertical ? ( start.bottom - start.top ) / 2 : start.top,
+		right: horizontal ? ( start.right - start.left ) / 2 : start.right,
+		bottom: vertical ? ( start.bottom - start.top ) / 2 : start.bottom,
+		left: horizontal ? ( start.right - start.left ) / 2 : start.left
+	};
+
+	$.effects.createPlaceholder( element );
+
+	if ( options.mode === "show" ) {
+		element.cssClip( animate.clip );
+		animate.clip = start;
+	}
+
+	element.animate( animate, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-clip.min.js b/wp-includes/js/jquery/ui/effect-clip.min.js
index c8786f63a9..9c77ca4d32 100644
--- a/wp-includes/js/jquery/ui/effect-clip.min.js
+++ b/wp-includes/js/jquery/ui/effect-clip.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Clip 1.11.4
+ * jQuery UI Effects Clip 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/clip-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(u){return u.effects.effect.clip=function(e,t){var i,f,o,c=u(this),n=["position","top","bottom","left","right","height","width"],s="show"===u.effects.setMode(c,e.mode||"hide"),r="vertical"===(e.direction||"vertical"),a=r?"height":"width",d=r?"top":"left",h={};u.effects.save(c,n),c.show(),i=u.effects.createWrapper(c).css({overflow:"hidden"}),o=(f="IMG"===c[0].tagName?i:c)[a](),s&&(f.css(a,0),f.css(d,o/2)),h[a]=s?o:0,h[d]=s?0:o/2,f.animate(h,{queue:!1,duration:e.duration,easing:e.easing,complete:function(){s||c.hide(),u.effects.restore(c,n),u.effects.removeWrapper(c),t()}})}});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./effect"],t):t(jQuery)}(function(a){return a.effects.define("clip","hide",function(t,e){var i,o={},n=a(this),c=t.direction||"vertical",f="both"===c,r=f||"horizontal"===c,l=f||"vertical"===c;i=n.cssClip(),o.clip={top:l?(i.bottom-i.top)/2:i.top,right:r?(i.right-i.left)/2:i.right,bottom:l?(i.bottom-i.top)/2:i.bottom,left:r?(i.right-i.left)/2:i.left},a.effects.createPlaceholder(n),"show"===t.mode&&(n.cssClip(o.clip),o.clip=i),n.animate(o,{queue:!1,duration:t.duration,easing:t.easing,complete:e})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-drop.js b/wp-includes/js/jquery/ui/effect-drop.js
new file mode 100644
index 0000000000..b38fe5ff60
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-drop.js
@@ -0,0 +1,68 @@
+/*!
+ * jQuery UI Effects Drop 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Drop Effect
+//>>group: Effects
+//>>description: Moves an element in one direction and hides it at the same time.
+//>>docs: http://api.jqueryui.com/drop-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "drop", "hide", function( options, done ) {
+
+	var distance,
+		element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+		direction = options.direction || "left",
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		motion = ( direction === "up" || direction === "left" ) ? "-=" : "+=",
+		oppositeMotion = ( motion === "+=" ) ? "-=" : "+=",
+		animation = {
+			opacity: 0
+		};
+
+	$.effects.createPlaceholder( element );
+
+	distance = options.distance ||
+		element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ) / 2;
+
+	animation[ ref ] = motion + distance;
+
+	if ( show ) {
+		element.css( animation );
+
+		animation[ ref ] = oppositeMotion + distance;
+		animation.opacity = 1;
+	}
+
+	// Animate
+	element.animate( animation, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-drop.min.js b/wp-includes/js/jquery/ui/effect-drop.min.js
index 3d9766fb19..8cbd08e037 100644
--- a/wp-includes/js/jquery/ui/effect-drop.min.js
+++ b/wp-includes/js/jquery/ui/effect-drop.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Drop 1.11.4
+ * jQuery UI Effects Drop 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/drop-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(a){return a.effects.effect.drop=function(e,t){var o,i=a(this),f=["position","top","bottom","left","right","opacity","height","width"],n=a.effects.setMode(i,e.mode||"hide"),s="show"===n,c=e.direction||"left",p="up"===c||"down"===c?"top":"left",r="up"===c||"left"===c?"pos":"neg",d={opacity:s?1:0};a.effects.save(i,f),i.show(),a.effects.createWrapper(i),o=e.distance||i["top"==p?"outerHeight":"outerWidth"](!0)/2,s&&i.css("opacity",0).css(p,"pos"==r?-o:o),d[p]=(s?"pos"==r?"+=":"-=":"pos"==r?"-=":"+=")+o,i.animate(d,{queue:!1,duration:e.duration,easing:e.easing,complete:function(){"hide"===n&&i.hide(),a.effects.restore(i,f),a.effects.removeWrapper(i),t()}})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(r){return r.effects.define("drop","hide",function(e,t){var i,n=r(this),o="show"===e.mode,f=e.direction||"left",c="up"===f||"down"===f?"top":"left",d="up"===f||"left"===f?"-=":"+=",u="+="==d?"-=":"+=",a={opacity:0};r.effects.createPlaceholder(n),i=e.distance||n["top"==c?"outerHeight":"outerWidth"](!0)/2,a[c]=d+i,o&&(n.css(a),a[c]=u+i,a.opacity=1),n.animate(a,{queue:!1,duration:e.duration,easing:e.easing,complete:t})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-explode.js b/wp-includes/js/jquery/ui/effect-explode.js
new file mode 100644
index 0000000000..89a2c83f7f
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-explode.js
@@ -0,0 +1,110 @@
+/*!
+ * jQuery UI Effects Explode 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Explode Effect
+//>>group: Effects
+// jscs:disable maximumLineLength
+//>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/explode-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "explode", "hide", function( options, done ) {
+
+	var i, j, left, top, mx, my,
+		rows = options.pieces ? Math.round( Math.sqrt( options.pieces ) ) : 3,
+		cells = rows,
+		element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+
+		// Show and then visibility:hidden the element before calculating offset
+		offset = element.show().css( "visibility", "hidden" ).offset(),
+
+		// Width and height of a piece
+		width = Math.ceil( element.outerWidth() / cells ),
+		height = Math.ceil( element.outerHeight() / rows ),
+		pieces = [];
+
+	// Children animate complete:
+	function childComplete() {
+		pieces.push( this );
+		if ( pieces.length === rows * cells ) {
+			animComplete();
+		}
+	}
+
+	// Clone the element for each row and cell.
+	for ( i = 0; i < rows; i++ ) { // ===>
+		top = offset.top + i * height;
+		my = i - ( rows - 1 ) / 2;
+
+		for ( j = 0; j < cells; j++ ) { // |||
+			left = offset.left + j * width;
+			mx = j - ( cells - 1 ) / 2;
+
+			// Create a clone of the now hidden main element that will be absolute positioned
+			// within a wrapper div off the -left and -top equal to size of our pieces
+			element
+				.clone()
+				.appendTo( "body" )
+				.wrap( "<div></div>" )
+				.css( {
+					position: "absolute",
+					visibility: "visible",
+					left: -j * width,
+					top: -i * height
+				} )
+
+				// Select the wrapper - make it overflow: hidden and absolute positioned based on
+				// where the original was located +left and +top equal to the size of pieces
+				.parent()
+					.addClass( "ui-effects-explode" )
+					.css( {
+						position: "absolute",
+						overflow: "hidden",
+						width: width,
+						height: height,
+						left: left + ( show ? mx * width : 0 ),
+						top: top + ( show ? my * height : 0 ),
+						opacity: show ? 0 : 1
+					} )
+					.animate( {
+						left: left + ( show ? 0 : mx * width ),
+						top: top + ( show ? 0 : my * height ),
+						opacity: show ? 1 : 0
+					}, options.duration || 500, options.easing, childComplete );
+		}
+	}
+
+	function animComplete() {
+		element.css( {
+			visibility: "visible"
+		} );
+		$( pieces ).remove();
+		done();
+	}
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-explode.min.js b/wp-includes/js/jquery/ui/effect-explode.min.js
index 9d6ae2fef8..cf10a7ac6b 100644
--- a/wp-includes/js/jquery/ui/effect-explode.min.js
+++ b/wp-includes/js/jquery/ui/effect-explode.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Explode 1.11.4
+ * jQuery UI Effects Explode 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/explode-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(b){return b.effects.effect.explode=function(e,i){var t,o,s,f,n,d,c=e.pieces?Math.round(Math.sqrt(e.pieces)):3,a=c,h=b(this),l="show"===b.effects.setMode(h,e.mode||"hide"),p=h.show().css("visibility","hidden").offset(),u=Math.ceil(h.outerWidth()/a),r=Math.ceil(h.outerHeight()/c),v=[];function y(){v.push(this),v.length===c*a&&function(){h.css({visibility:"visible"}),b(v).remove(),l||h.hide();i()}()}for(t=0;t<c;t++)for(f=p.top+t*r,d=t-(c-1)/2,o=0;o<a;o++)s=p.left+o*u,n=o-(a-1)/2,h.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-o*u,top:-t*r}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:u,height:r,left:s+(l?n*u:0),top:f+(l?d*r:0),opacity:l?0:1}).animate({left:s+(l?0:n*u),top:f+(l?0:d*r),opacity:l?1:0},e.duration||500,e.easing,y)}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(b){return b.effects.define("explode","hide",function(e,i){var t,o,s,n,f,d,a=e.pieces?Math.round(Math.sqrt(e.pieces)):3,c=a,l=b(this),h="show"===e.mode,p=l.show().css("visibility","hidden").offset(),r=Math.ceil(l.outerWidth()/c),u=Math.ceil(l.outerHeight()/a),v=[];function y(){v.push(this),v.length===a*c&&(l.css({visibility:"visible"}),b(v).remove(),i())}for(t=0;t<a;t++)for(n=p.top+t*u,d=t-(a-1)/2,o=0;o<c;o++)s=p.left+o*r,f=o-(c-1)/2,l.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-o*r,top:-t*u}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:r,height:u,left:s+(h?f*r:0),top:n+(h?d*u:0),opacity:h?0:1}).animate({left:s+(h?0:f*r),top:n+(h?0:d*u),opacity:h?1:0},e.duration||500,e.easing,y)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-fade.js b/wp-includes/js/jquery/ui/effect-fade.js
new file mode 100644
index 0000000000..8ea555204a
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-fade.js
@@ -0,0 +1,46 @@
+/*!
+ * jQuery UI Effects Fade 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Fade Effect
+//>>group: Effects
+//>>description: Fades the element.
+//>>docs: http://api.jqueryui.com/fade-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "fade", "toggle", function( options, done ) {
+	var show = options.mode === "show";
+
+	$( this )
+		.css( "opacity", show ? 0 : 1 )
+		.animate( {
+			opacity: show ? 1 : 0
+		}, {
+			queue: false,
+			duration: options.duration,
+			easing: options.easing,
+			complete: done
+		} );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-fade.min.js b/wp-includes/js/jquery/ui/effect-fade.min.js
index dad2fd0981..2140d2bb53 100644
--- a/wp-includes/js/jquery/ui/effect-fade.min.js
+++ b/wp-includes/js/jquery/ui/effect-fade.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Fade 1.11.4
+ * jQuery UI Effects Fade 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/fade-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(i){return i.effects.effect.fade=function(e,t){var f=i(this),n=i.effects.setMode(f,e.mode||"toggle");f.animate({opacity:n},{queue:!1,duration:e.duration,easing:e.easing,complete:t})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(t){return t.effects.define("fade","toggle",function(e,n){var i="show"===e.mode;t(this).css("opacity",i?0:1).animate({opacity:i?1:0},{queue:!1,duration:e.duration,easing:e.easing,complete:n})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-fold.js b/wp-includes/js/jquery/ui/effect-fold.js
new file mode 100644
index 0000000000..357689954e
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-fold.js
@@ -0,0 +1,88 @@
+/*!
+ * jQuery UI Effects Fold 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Fold Effect
+//>>group: Effects
+//>>description: Folds an element first horizontally and then vertically.
+//>>docs: http://api.jqueryui.com/fold-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "fold", "hide", function( options, done ) {
+
+	// Create element
+	var element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+		hide = mode === "hide",
+		size = options.size || 15,
+		percent = /([0-9]+)%/.exec( size ),
+		horizFirst = !!options.horizFirst,
+		ref = horizFirst ? [ "right", "bottom" ] : [ "bottom", "right" ],
+		duration = options.duration / 2,
+
+		placeholder = $.effects.createPlaceholder( element ),
+
+		start = element.cssClip(),
+		animation1 = { clip: $.extend( {}, start ) },
+		animation2 = { clip: $.extend( {}, start ) },
+
+		distance = [ start[ ref[ 0 ] ], start[ ref[ 1 ] ] ],
+
+		queuelen = element.queue().length;
+
+	if ( percent ) {
+		size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ];
+	}
+	animation1.clip[ ref[ 0 ] ] = size;
+	animation2.clip[ ref[ 0 ] ] = size;
+	animation2.clip[ ref[ 1 ] ] = 0;
+
+	if ( show ) {
+		element.cssClip( animation2.clip );
+		if ( placeholder ) {
+			placeholder.css( $.effects.clipToBox( animation2 ) );
+		}
+
+		animation2.clip = start;
+	}
+
+	// Animate
+	element
+		.queue( function( next ) {
+			if ( placeholder ) {
+				placeholder
+					.animate( $.effects.clipToBox( animation1 ), duration, options.easing )
+					.animate( $.effects.clipToBox( animation2 ), duration, options.easing );
+			}
+
+			next();
+		} )
+		.animate( animation1, duration, options.easing )
+		.animate( animation2, duration, options.easing )
+		.queue( done );
+
+	$.effects.unshift( element, queuelen, 4 );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-fold.min.js b/wp-includes/js/jquery/ui/effect-fold.min.js
index c82d131207..15230a3a7b 100644
--- a/wp-includes/js/jquery/ui/effect-fold.min.js
+++ b/wp-includes/js/jquery/ui/effect-fold.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Fold 1.11.4
+ * jQuery UI Effects Fold 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/fold-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(v){return v.effects.effect.fold=function(e,t){var i,h,f=v(this),n=["position","top","bottom","left","right","height","width"],o=v.effects.setMode(f,e.mode||"hide"),s="show"===o,d="hide"===o,r=e.size||15,c=/([0-9]+)%/.exec(r),a=!!e.horizFirst,g=s!=a,w=g?["width","height"]:["height","width"],u=e.duration/2,p={},m={};v.effects.save(f,n),f.show(),i=v.effects.createWrapper(f).css({overflow:"hidden"}),h=g?[i.width(),i.height()]:[i.height(),i.width()],c&&(r=parseInt(c[1],10)/100*h[d?0:1]),s&&i.css(a?{height:0,width:r}:{height:r,width:0}),p[w[0]]=s?h[0]:r,m[w[1]]=s?h[1]:0,i.animate(p,u,e.easing).animate(m,u,e.easing,function(){d&&f.hide(),v.effects.restore(f,n),v.effects.removeWrapper(f),t()})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(g){return g.effects.define("fold","hide",function(i,e){var t=g(this),n=i.mode,c="show"===n,f="hide"===n,o=i.size||15,s=/([0-9]+)%/.exec(o),a=!!i.horizFirst?["right","bottom"]:["bottom","right"],l=i.duration/2,u=g.effects.createPlaceholder(t),p=t.cssClip(),d={clip:g.extend({},p)},r={clip:g.extend({},p)},h=[p[a[0]],p[a[1]]],m=t.queue().length;s&&(o=parseInt(s[1],10)/100*h[f?0:1]),d.clip[a[0]]=o,r.clip[a[0]]=o,r.clip[a[1]]=0,c&&(t.cssClip(r.clip),u&&u.css(g.effects.clipToBox(r)),r.clip=p),t.queue(function(e){u&&u.animate(g.effects.clipToBox(d),l,i.easing).animate(g.effects.clipToBox(r),l,i.easing),e()}).animate(d,l,i.easing).animate(r,l,i.easing).queue(e),g.effects.unshift(t,m,4)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-highlight.js b/wp-includes/js/jquery/ui/effect-highlight.js
new file mode 100644
index 0000000000..0f48bf33cb
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-highlight.js
@@ -0,0 +1,56 @@
+/*!
+ * jQuery UI Effects Highlight 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Highlight Effect
+//>>group: Effects
+//>>description: Highlights the background of an element in a defined color for a custom duration.
+//>>docs: http://api.jqueryui.com/highlight-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "highlight", "show", function( options, done ) {
+	var element = $( this ),
+		animation = {
+			backgroundColor: element.css( "backgroundColor" )
+		};
+
+	if ( options.mode === "hide" ) {
+		animation.opacity = 0;
+	}
+
+	$.effects.saveStyle( element );
+
+	element
+		.css( {
+			backgroundImage: "none",
+			backgroundColor: options.color || "#ffff99"
+		} )
+		.animate( animation, {
+			queue: false,
+			duration: options.duration,
+			easing: options.easing,
+			complete: done
+		} );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-highlight.min.js b/wp-includes/js/jquery/ui/effect-highlight.min.js
index 0d4ea5fdb4..2e9db8d1fe 100644
--- a/wp-includes/js/jquery/ui/effect-highlight.min.js
+++ b/wp-includes/js/jquery/ui/effect-highlight.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Highlight 1.11.4
+ * jQuery UI Effects Highlight 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/highlight-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(i){return i.effects.effect.highlight=function(e,o){var n=i(this),f=["backgroundImage","backgroundColor","opacity"],c=i.effects.setMode(n,e.mode||"show"),t={backgroundColor:n.css("backgroundColor")};"hide"===c&&(t.opacity=0),i.effects.save(n,f),n.show().css({backgroundImage:"none",backgroundColor:e.color||"#ffff99"}).animate(t,{queue:!1,duration:e.duration,easing:e.easing,complete:function(){"hide"===c&&n.hide(),i.effects.restore(n,f),o()}})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(i){return i.effects.define("highlight","show",function(e,n){var o=i(this),f={backgroundColor:o.css("backgroundColor")};"hide"===e.mode&&(f.opacity=0),i.effects.saveStyle(o),o.css({backgroundImage:"none",backgroundColor:e.color||"#ffff99"}).animate(f,{queue:!1,duration:e.duration,easing:e.easing,complete:n})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-puff.js b/wp-includes/js/jquery/ui/effect-puff.js
new file mode 100644
index 0000000000..51d5ab43ba
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-puff.js
@@ -0,0 +1,41 @@
+/*!
+ * jQuery UI Effects Puff 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Puff Effect
+//>>group: Effects
+//>>description: Creates a puff effect by scaling the element up and hiding it at the same time.
+//>>docs: http://api.jqueryui.com/puff-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect",
+			"./effect-scale"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "puff", "hide", function( options, done ) {
+	var newOptions = $.extend( true, {}, options, {
+		fade: true,
+		percent: parseInt( options.percent, 10 ) || 150
+	} );
+
+	$.effects.effect.scale.call( this, newOptions, done );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-puff.min.js b/wp-includes/js/jquery/ui/effect-puff.min.js
index 1e70c2079c..450d6ae07c 100644
--- a/wp-includes/js/jquery/ui/effect-puff.min.js
+++ b/wp-includes/js/jquery/ui/effect-puff.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Puff 1.11.4
+ * jQuery UI Effects Puff 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/puff-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect","./effect-scale"],e):e(jQuery)}(function(r){return r.effects.effect.puff=function(e,t){var f=r(this),i=r.effects.setMode(f,e.mode||"hide"),h="hide"===i,d=parseInt(e.percent,10)||150,o=d/100,u={height:f.height(),width:f.width(),outerHeight:f.outerHeight(),outerWidth:f.outerWidth()};r.extend(e,{effect:"scale",queue:!1,fade:!0,mode:i,complete:t,percent:h?d:100,from:h?u:{height:u.height*o,width:u.width*o,outerHeight:u.outerHeight*o,outerWidth:u.outerWidth*o}}),f.effect(e)}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect","./effect-scale"],e):e(jQuery)}(function(t){return t.effects.define("puff","hide",function(e,f){var n=t.extend(!0,{},e,{fade:!0,percent:parseInt(e.percent,10)||150});t.effects.effect.scale.call(this,n,f)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-pulsate.js b/wp-includes/js/jquery/ui/effect-pulsate.js
new file mode 100644
index 0000000000..065025815a
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-pulsate.js
@@ -0,0 +1,63 @@
+/*!
+ * jQuery UI Effects Pulsate 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Pulsate Effect
+//>>group: Effects
+//>>description: Pulsates an element n times by changing the opacity to zero and back.
+//>>docs: http://api.jqueryui.com/pulsate-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "pulsate", "show", function( options, done ) {
+	var element = $( this ),
+		mode = options.mode,
+		show = mode === "show",
+		hide = mode === "hide",
+		showhide = show || hide,
+
+		// Showing or hiding leaves off the "last" animation
+		anims = ( ( options.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ),
+		duration = options.duration / anims,
+		animateTo = 0,
+		i = 1,
+		queuelen = element.queue().length;
+
+	if ( show || !element.is( ":visible" ) ) {
+		element.css( "opacity", 0 ).show();
+		animateTo = 1;
+	}
+
+	// Anims - 1 opacity "toggles"
+	for ( ; i < anims; i++ ) {
+		element.animate( { opacity: animateTo }, duration, options.easing );
+		animateTo = 1 - animateTo;
+	}
+
+	element.animate( { opacity: animateTo }, duration, options.easing );
+
+	element.queue( done );
+
+	$.effects.unshift( element, queuelen, anims + 1 );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-pulsate.min.js b/wp-includes/js/jquery/ui/effect-pulsate.min.js
index eb017744ed..0bb1aa5671 100644
--- a/wp-includes/js/jquery/ui/effect-pulsate.min.js
+++ b/wp-includes/js/jquery/ui/effect-pulsate.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Pulsate 1.11.4
+ * jQuery UI Effects Pulsate 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/pulsate-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(r){return r.effects.effect.pulsate=function(e,i){var t,n=r(this),f=r.effects.setMode(n,e.mode||"show"),c="show"===f,o="hide"===f,s=c||"hide"===f,u=2*(e.times||5)+(s?1:0),a=e.duration/u,d=0,p=n.queue(),h=p.length;for(!c&&n.is(":visible")||(n.css("opacity",0).show(),d=1),t=1;t<u;t++)n.animate({opacity:d},a,e.easing),d=1-d;n.animate({opacity:d},a,e.easing),n.queue(function(){o&&n.hide(),i()}),1<h&&p.splice.apply(p,[1,0].concat(p.splice(h,1+u))),n.dequeue()}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(h){return h.effects.define("pulsate","show",function(e,i){var n=h(this),t=e.mode,f="show"===t,s=f||"hide"===t,o=2*(e.times||5)+(s?1:0),u=e.duration/o,a=0,c=1,d=n.queue().length;for(!f&&n.is(":visible")||(n.css("opacity",0).show(),a=1);c<o;c++)n.animate({opacity:a},u,e.easing),a=1-a;n.animate({opacity:a},u,e.easing),n.queue(i),h.effects.unshift(n,d,1+o)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-scale.js b/wp-includes/js/jquery/ui/effect-scale.js
new file mode 100644
index 0000000000..04daabfe6c
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-scale.js
@@ -0,0 +1,55 @@
+/*!
+ * jQuery UI Effects Scale 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Scale Effect
+//>>group: Effects
+//>>description: Grows or shrinks an element and its content.
+//>>docs: http://api.jqueryui.com/scale-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect",
+			"./effect-size"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "scale", function( options, done ) {
+
+	// Create element
+	var el = $( this ),
+		mode = options.mode,
+		percent = parseInt( options.percent, 10 ) ||
+			( parseInt( options.percent, 10 ) === 0 ? 0 : ( mode !== "effect" ? 0 : 100 ) ),
+
+		newOptions = $.extend( true, {
+			from: $.effects.scaledDimensions( el ),
+			to: $.effects.scaledDimensions( el, percent, options.direction || "both" ),
+			origin: options.origin || [ "middle", "center" ]
+		}, options );
+
+	// Fade option to support puff
+	if ( options.fade ) {
+		newOptions.from.opacity = 1;
+		newOptions.to.opacity = 0;
+	}
+
+	$.effects.effect.size.call( this, newOptions, done );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-scale.min.js b/wp-includes/js/jquery/ui/effect-scale.min.js
index 56fbc0ecb3..9ab92886b6 100644
--- a/wp-includes/js/jquery/ui/effect-scale.min.js
+++ b/wp-includes/js/jquery/ui/effect-scale.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Scale 1.11.4
+ * jQuery UI Effects Scale 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/scale-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect","./effect-size"],e):e(jQuery)}(function(a){return a.effects.effect.scale=function(e,t){var i=a(this),o=a.extend(!0,{},e),h=a.effects.setMode(i,e.mode||"effect"),f=parseInt(e.percent,10)||(0===parseInt(e.percent,10)?0:"hide"===h?0:100),r=e.direction||"both",c=e.origin,d={height:i.height(),width:i.width(),outerHeight:i.outerHeight(),outerWidth:i.outerWidth()},n="horizontal"!==r?f/100:1,u="vertical"!==r?f/100:1;o.effect="size",o.queue=!1,o.complete=t,"effect"!==h&&(o.origin=c||["middle","center"],o.restore=!0),o.from=e.from||("show"===h?{height:0,width:0,outerHeight:0,outerWidth:0}:d),o.to={height:d.height*n,width:d.width*u,outerHeight:d.outerHeight*n,outerWidth:d.outerWidth*u},o.fade&&("show"===h&&(o.from.opacity=0,o.to.opacity=1),"hide"===h&&(o.from.opacity=1,o.to.opacity=0)),i.effect(o)}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect","./effect-size"],e):e(jQuery)}(function(o){return o.effects.define("scale",function(e,f){var t=o(this),n=e.mode,i=parseInt(e.percent,10)||(0===parseInt(e.percent,10)?0:"effect"!==n?0:100),c=o.extend(!0,{from:o.effects.scaledDimensions(t),to:o.effects.scaledDimensions(t,i,e.direction||"both"),origin:e.origin||["middle","center"]},e);e.fade&&(c.from.opacity=1,c.to.opacity=0),o.effects.effect.size.call(this,c,f)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-shake.js b/wp-includes/js/jquery/ui/effect-shake.js
new file mode 100644
index 0000000000..a59e1a8899
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-shake.js
@@ -0,0 +1,73 @@
+/*!
+ * jQuery UI Effects Shake 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Shake Effect
+//>>group: Effects
+//>>description: Shakes an element horizontally or vertically n times.
+//>>docs: http://api.jqueryui.com/shake-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "shake", function( options, done ) {
+
+	var i = 1,
+		element = $( this ),
+		direction = options.direction || "left",
+		distance = options.distance || 20,
+		times = options.times || 3,
+		anims = times * 2 + 1,
+		speed = Math.round( options.duration / anims ),
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		positiveMotion = ( direction === "up" || direction === "left" ),
+		animation = {},
+		animation1 = {},
+		animation2 = {},
+
+		queuelen = element.queue().length;
+
+	$.effects.createPlaceholder( element );
+
+	// Animation
+	animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance;
+	animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2;
+	animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2;
+
+	// Animate
+	element.animate( animation, speed, options.easing );
+
+	// Shakes
+	for ( ; i < times; i++ ) {
+		element
+			.animate( animation1, speed, options.easing )
+			.animate( animation2, speed, options.easing );
+	}
+
+	element
+		.animate( animation1, speed, options.easing )
+		.animate( animation, speed / 2, options.easing )
+		.queue( done );
+
+	$.effects.unshift( element, queuelen, anims + 1 );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-shake.min.js b/wp-includes/js/jquery/ui/effect-shake.min.js
index ed525d5c63..ac2c272ef5 100644
--- a/wp-includes/js/jquery/ui/effect-shake.min.js
+++ b/wp-includes/js/jquery/ui/effect-shake.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Shake 1.11.4
+ * jQuery UI Effects Shake 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/shake-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(y){return y.effects.effect.shake=function(e,t){var i,f=y(this),n=["position","top","bottom","left","right","height","width"],a=y.effects.setMode(f,e.mode||"effect"),o=e.direction||"left",s=e.distance||20,c=e.times||3,r=2*c+1,u=Math.round(e.duration/r),d="up"===o||"down"===o?"top":"left",p="up"===o||"left"===o,h={},m={},g={},l=f.queue(),q=l.length;for(y.effects.save(f,n),f.show(),y.effects.createWrapper(f),h[d]=(p?"-=":"+=")+s,m[d]=(p?"+=":"-=")+2*s,g[d]=(p?"-=":"+=")+2*s,f.animate(h,u,e.easing),i=1;i<c;i++)f.animate(m,u,e.easing).animate(g,u,e.easing);f.animate(m,u,e.easing).animate(h,u/2,e.easing).queue(function(){"hide"===a&&f.hide(),y.effects.restore(f,n),y.effects.removeWrapper(f),t()}),1<q&&l.splice.apply(l,[1,0].concat(l.splice(q,1+r))),f.dequeue()}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(l){return l.effects.define("shake",function(e,n){var t=1,i=l(this),a=e.direction||"left",f=e.distance||20,u=e.times||3,s=2*u+1,c=Math.round(e.duration/s),o="up"===a||"down"===a?"top":"left",d="up"===a||"left"===a,r={},m={},g={},h=i.queue().length;for(l.effects.createPlaceholder(i),r[o]=(d?"-=":"+=")+f,m[o]=(d?"+=":"-=")+2*f,g[o]=(d?"-=":"+=")+2*f,i.animate(r,c,e.easing);t<u;t++)i.animate(m,c,e.easing).animate(g,c,e.easing);i.animate(m,c,e.easing).animate(r,c/2,e.easing).queue(n),l.effects.unshift(i,h,1+s)})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-size.js b/wp-includes/js/jquery/ui/effect-size.js
new file mode 100644
index 0000000000..8449271aff
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-size.js
@@ -0,0 +1,190 @@
+/*!
+ * jQuery UI Effects Size 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Size Effect
+//>>group: Effects
+//>>description: Resize an element to a specified width and height.
+//>>docs: http://api.jqueryui.com/size-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "size", function( options, done ) {
+
+	// Create element
+	var baseline, factor, temp,
+		element = $( this ),
+
+		// Copy for children
+		cProps = [ "fontSize" ],
+		vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ],
+		hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ],
+
+		// Set options
+		mode = options.mode,
+		restore = mode !== "effect",
+		scale = options.scale || "both",
+		origin = options.origin || [ "middle", "center" ],
+		position = element.css( "position" ),
+		pos = element.position(),
+		original = $.effects.scaledDimensions( element ),
+		from = options.from || original,
+		to = options.to || $.effects.scaledDimensions( element, 0 );
+
+	$.effects.createPlaceholder( element );
+
+	if ( mode === "show" ) {
+		temp = from;
+		from = to;
+		to = temp;
+	}
+
+	// Set scaling factor
+	factor = {
+		from: {
+			y: from.height / original.height,
+			x: from.width / original.width
+		},
+		to: {
+			y: to.height / original.height,
+			x: to.width / original.width
+		}
+	};
+
+	// Scale the css box
+	if ( scale === "box" || scale === "both" ) {
+
+		// Vertical props scaling
+		if ( factor.from.y !== factor.to.y ) {
+			from = $.effects.setTransition( element, vProps, factor.from.y, from );
+			to = $.effects.setTransition( element, vProps, factor.to.y, to );
+		}
+
+		// Horizontal props scaling
+		if ( factor.from.x !== factor.to.x ) {
+			from = $.effects.setTransition( element, hProps, factor.from.x, from );
+			to = $.effects.setTransition( element, hProps, factor.to.x, to );
+		}
+	}
+
+	// Scale the content
+	if ( scale === "content" || scale === "both" ) {
+
+		// Vertical props scaling
+		if ( factor.from.y !== factor.to.y ) {
+			from = $.effects.setTransition( element, cProps, factor.from.y, from );
+			to = $.effects.setTransition( element, cProps, factor.to.y, to );
+		}
+	}
+
+	// Adjust the position properties based on the provided origin points
+	if ( origin ) {
+		baseline = $.effects.getBaseline( origin, original );
+		from.top = ( original.outerHeight - from.outerHeight ) * baseline.y + pos.top;
+		from.left = ( original.outerWidth - from.outerWidth ) * baseline.x + pos.left;
+		to.top = ( original.outerHeight - to.outerHeight ) * baseline.y + pos.top;
+		to.left = ( original.outerWidth - to.outerWidth ) * baseline.x + pos.left;
+	}
+	element.css( from );
+
+	// Animate the children if desired
+	if ( scale === "content" || scale === "both" ) {
+
+		vProps = vProps.concat( [ "marginTop", "marginBottom" ] ).concat( cProps );
+		hProps = hProps.concat( [ "marginLeft", "marginRight" ] );
+
+		// Only animate children with width attributes specified
+		// TODO: is this right? should we include anything with css width specified as well
+		element.find( "*[width]" ).each( function() {
+			var child = $( this ),
+				childOriginal = $.effects.scaledDimensions( child ),
+				childFrom = {
+					height: childOriginal.height * factor.from.y,
+					width: childOriginal.width * factor.from.x,
+					outerHeight: childOriginal.outerHeight * factor.from.y,
+					outerWidth: childOriginal.outerWidth * factor.from.x
+				},
+				childTo = {
+					height: childOriginal.height * factor.to.y,
+					width: childOriginal.width * factor.to.x,
+					outerHeight: childOriginal.height * factor.to.y,
+					outerWidth: childOriginal.width * factor.to.x
+				};
+
+			// Vertical props scaling
+			if ( factor.from.y !== factor.to.y ) {
+				childFrom = $.effects.setTransition( child, vProps, factor.from.y, childFrom );
+				childTo = $.effects.setTransition( child, vProps, factor.to.y, childTo );
+			}
+
+			// Horizontal props scaling
+			if ( factor.from.x !== factor.to.x ) {
+				childFrom = $.effects.setTransition( child, hProps, factor.from.x, childFrom );
+				childTo = $.effects.setTransition( child, hProps, factor.to.x, childTo );
+			}
+
+			if ( restore ) {
+				$.effects.saveStyle( child );
+			}
+
+			// Animate children
+			child.css( childFrom );
+			child.animate( childTo, options.duration, options.easing, function() {
+
+				// Restore children
+				if ( restore ) {
+					$.effects.restoreStyle( child );
+				}
+			} );
+		} );
+	}
+
+	// Animate
+	element.animate( to, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: function() {
+
+			var offset = element.offset();
+
+			if ( to.opacity === 0 ) {
+				element.css( "opacity", from.opacity );
+			}
+
+			if ( !restore ) {
+				element
+					.css( "position", position === "static" ? "relative" : position )
+					.offset( offset );
+
+				// Need to save style here so that automatic style restoration
+				// doesn't restore to the original styles from before the animation.
+				$.effects.saveStyle( element );
+			}
+
+			done();
+		}
+	} );
+
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-size.min.js b/wp-includes/js/jquery/ui/effect-size.min.js
index 5488fd1a0b..c0c541f4ee 100644
--- a/wp-includes/js/jquery/ui/effect-size.min.js
+++ b/wp-includes/js/jquery/ui/effect-size.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Size 1.11.4
+ * jQuery UI Effects Size 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/size-effect/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./effect"],t):t(jQuery)}(function(x){return x.effects.effect.size=function(r,t){var o,e,h,n=x(this),i=["position","top","bottom","left","right","width","height","overflow","opacity"],s=["width","height","overflow"],f=["fontSize"],c=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],a=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],d=x.effects.setMode(n,r.mode||"effect"),m=r.restore||"effect"!==d,g=r.scale||"both",u=r.origin||["middle","center"],p=n.css("position"),y=m?i:["position","top","bottom","left","right","overflow","opacity"],w={height:0,width:0,outerHeight:0,outerWidth:0};"show"===d&&n.show(),o={height:n.height(),width:n.width(),outerHeight:n.outerHeight(),outerWidth:n.outerWidth()},"toggle"===r.mode&&"show"===d?(n.from=r.to||w,n.to=r.from||o):(n.from=r.from||("show"===d?w:o),n.to=r.to||("hide"===d?w:o)),h={from:{y:n.from.height/o.height,x:n.from.width/o.width},to:{y:n.to.height/o.height,x:n.to.width/o.width}},"box"!==g&&"both"!==g||(h.from.y!==h.to.y&&(y=y.concat(c),n.from=x.effects.setTransition(n,c,h.from.y,n.from),n.to=x.effects.setTransition(n,c,h.to.y,n.to)),h.from.x!==h.to.x&&(y=y.concat(a),n.from=x.effects.setTransition(n,a,h.from.x,n.from),n.to=x.effects.setTransition(n,a,h.to.x,n.to))),"content"!==g&&"both"!==g||h.from.y!==h.to.y&&(y=y.concat(f).concat(s),n.from=x.effects.setTransition(n,f,h.from.y,n.from),n.to=x.effects.setTransition(n,f,h.to.y,n.to)),x.effects.save(n,y),n.show(),x.effects.createWrapper(n),n.css("overflow","hidden").css(n.from),u&&(e=x.effects.getBaseline(u,o),n.from.top=(o.outerHeight-n.outerHeight())*e.y,n.from.left=(o.outerWidth-n.outerWidth())*e.x,n.to.top=(o.outerHeight-n.to.outerHeight)*e.y,n.to.left=(o.outerWidth-n.to.outerWidth)*e.x),n.css(n.from),"content"!==g&&"both"!==g||(c=c.concat(["marginTop","marginBottom"]).concat(f),a=a.concat(["marginLeft","marginRight"]),s=i.concat(c).concat(a),n.find("*[width]").each(function(){var t=x(this),o=t.height(),e=t.width(),i=t.outerHeight(),f=t.outerWidth();m&&x.effects.save(t,s),t.from={height:o*h.from.y,width:e*h.from.x,outerHeight:i*h.from.y,outerWidth:f*h.from.x},t.to={height:o*h.to.y,width:e*h.to.x,outerHeight:o*h.to.y,outerWidth:e*h.to.x},h.from.y!==h.to.y&&(t.from=x.effects.setTransition(t,c,h.from.y,t.from),t.to=x.effects.setTransition(t,c,h.to.y,t.to)),h.from.x!==h.to.x&&(t.from=x.effects.setTransition(t,a,h.from.x,t.from),t.to=x.effects.setTransition(t,a,h.to.x,t.to)),t.css(t.from),t.animate(t.to,r.duration,r.easing,function(){m&&x.effects.restore(t,s)})})),n.animate(n.to,{queue:!1,duration:r.duration,easing:r.easing,complete:function(){0===n.to.opacity&&n.css("opacity",n.from.opacity),"hide"===d&&n.hide(),x.effects.restore(n,y),m||("static"===p?n.css({position:"relative",top:n.to.top,left:n.to.left}):x.each(["top","left"],function(f,t){n.css(t,function(t,o){var e=parseInt(o,10),i=f?n.to.left:n.to.top;return"auto"===o?i+"px":e+i+"px"})})),x.effects.removeWrapper(n),t()}})}});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./effect"],t):t(jQuery)}(function(x){return x.effects.define("size",function(f,e){var t,n,o,i=x(this),s=["fontSize"],r=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],h=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"],c=f.mode,a="effect"!==c,d=f.scale||"both",g=f.origin||["middle","center"],m=i.css("position"),u=i.position(),y=x.effects.scaledDimensions(i),p=f.from||y,l=f.to||x.effects.scaledDimensions(i,0);x.effects.createPlaceholder(i),"show"===c&&(o=p,p=l,l=o),n={from:{y:p.height/y.height,x:p.width/y.width},to:{y:l.height/y.height,x:l.width/y.width}},"box"!==d&&"both"!==d||(n.from.y!==n.to.y&&(p=x.effects.setTransition(i,r,n.from.y,p),l=x.effects.setTransition(i,r,n.to.y,l)),n.from.x!==n.to.x&&(p=x.effects.setTransition(i,h,n.from.x,p),l=x.effects.setTransition(i,h,n.to.x,l))),"content"!==d&&"both"!==d||n.from.y!==n.to.y&&(p=x.effects.setTransition(i,s,n.from.y,p),l=x.effects.setTransition(i,s,n.to.y,l)),g&&(t=x.effects.getBaseline(g,y),p.top=(y.outerHeight-p.outerHeight)*t.y+u.top,p.left=(y.outerWidth-p.outerWidth)*t.x+u.left,l.top=(y.outerHeight-l.outerHeight)*t.y+u.top,l.left=(y.outerWidth-l.outerWidth)*t.x+u.left),i.css(p),"content"!==d&&"both"!==d||(r=r.concat(["marginTop","marginBottom"]).concat(s),h=h.concat(["marginLeft","marginRight"]),i.find("*[width]").each(function(){var t=x(this),e=x.effects.scaledDimensions(t),o={height:e.height*n.from.y,width:e.width*n.from.x,outerHeight:e.outerHeight*n.from.y,outerWidth:e.outerWidth*n.from.x},i={height:e.height*n.to.y,width:e.width*n.to.x,outerHeight:e.height*n.to.y,outerWidth:e.width*n.to.x};n.from.y!==n.to.y&&(o=x.effects.setTransition(t,r,n.from.y,o),i=x.effects.setTransition(t,r,n.to.y,i)),n.from.x!==n.to.x&&(o=x.effects.setTransition(t,h,n.from.x,o),i=x.effects.setTransition(t,h,n.to.x,i)),a&&x.effects.saveStyle(t),t.css(o),t.animate(i,f.duration,f.easing,function(){a&&x.effects.restoreStyle(t)})})),i.animate(l,{queue:!1,duration:f.duration,easing:f.easing,complete:function(){var t=i.offset();0===l.opacity&&i.css("opacity",p.opacity),a||(i.css("position","static"===m?"relative":m).offset(t),x.effects.saveStyle(i)),e()}})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-slide.js b/wp-includes/js/jquery/ui/effect-slide.js
new file mode 100644
index 0000000000..055d1d4879
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-slide.js
@@ -0,0 +1,75 @@
+/*!
+ * jQuery UI Effects Slide 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Slide Effect
+//>>group: Effects
+//>>description: Slides an element in and out of the viewport.
+//>>docs: http://api.jqueryui.com/slide-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.effects.define( "slide", "show", function( options, done ) {
+	var startClip, startRef,
+		element = $( this ),
+		map = {
+			up: [ "bottom", "top" ],
+			down: [ "top", "bottom" ],
+			left: [ "right", "left" ],
+			right: [ "left", "right" ]
+		},
+		mode = options.mode,
+		direction = options.direction || "left",
+		ref = ( direction === "up" || direction === "down" ) ? "top" : "left",
+		positiveMotion = ( direction === "up" || direction === "left" ),
+		distance = options.distance ||
+			element[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ),
+		animation = {};
+
+	$.effects.createPlaceholder( element );
+
+	startClip = element.cssClip();
+	startRef = element.position()[ ref ];
+
+	// Define hide animation
+	animation[ ref ] = ( positiveMotion ? -1 : 1 ) * distance + startRef;
+	animation.clip = element.cssClip();
+	animation.clip[ map[ direction ][ 1 ] ] = animation.clip[ map[ direction ][ 0 ] ];
+
+	// Reverse the animation if we're showing
+	if ( mode === "show" ) {
+		element.cssClip( animation.clip );
+		element.css( ref, animation[ ref ] );
+		animation.clip = startClip;
+		animation[ ref ] = startRef;
+	}
+
+	// Actually animate
+	element.animate( animation, {
+		queue: false,
+		duration: options.duration,
+		easing: options.easing,
+		complete: done
+	} );
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-slide.min.js b/wp-includes/js/jquery/ui/effect-slide.min.js
index e3743159b8..ff2ba45745 100644
--- a/wp-includes/js/jquery/ui/effect-slide.min.js
+++ b/wp-includes/js/jquery/ui/effect-slide.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Slide 1.11.4
+ * jQuery UI Effects Slide 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/slide-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(a){return a.effects.effect.slide=function(e,t){var f,i=a(this),o=["position","top","bottom","left","right","width","height"],n=a.effects.setMode(i,e.mode||"show"),s="show"===n,r=e.direction||"left",c="up"===r||"down"===r?"top":"left",d="up"===r||"left"===r,u={};a.effects.save(i,o),i.show(),f=e.distance||i["top"==c?"outerHeight":"outerWidth"](!0),a.effects.createWrapper(i).css({overflow:"hidden"}),s&&i.css(c,d?isNaN(f)?"-"+f:-f:f),u[c]=(s?d?"+=":"-=":d?"-=":"+=")+f,i.animate(u,{queue:!1,duration:e.duration,easing:e.easing,complete:function(){"hide"===n&&i.hide(),a.effects.restore(i,o),a.effects.removeWrapper(i),t()}})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(r){return r.effects.define("slide","show",function(e,t){var i,o,n=r(this),c={up:["bottom","top"],down:["top","bottom"],left:["right","left"],right:["left","right"]},f=e.mode,l=e.direction||"left",p="up"===l||"down"===l?"top":"left",s="up"===l||"left"===l,u=e.distance||n["top"==p?"outerHeight":"outerWidth"](!0),d={};r.effects.createPlaceholder(n),i=n.cssClip(),o=n.position()[p],d[p]=(s?-1:1)*u+o,d.clip=n.cssClip(),d.clip[c[l][1]]=d.clip[c[l][0]],"show"===f&&(n.cssClip(d.clip),n.css(p,d[p]),d.clip=i,d[p]=o),n.animate(d,{queue:!1,duration:e.duration,easing:e.easing,complete:t})})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect-transfer.js b/wp-includes/js/jquery/ui/effect-transfer.js
new file mode 100644
index 0000000000..6c2e3ac1ad
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect-transfer.js
@@ -0,0 +1,39 @@
+/*!
+ * jQuery UI Effects Transfer 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Transfer Effect
+//>>group: Effects
+//>>description: Displays a transfer effect from one element to another.
+//>>docs: http://api.jqueryui.com/transfer-effect/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./effect"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+var effect;
+if ( $.uiBackCompat !== false ) {
+	effect = $.effects.define( "transfer", function( options, done ) {
+		$( this ).transfer( options, done );
+	} );
+}
+return effect;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect-transfer.min.js b/wp-includes/js/jquery/ui/effect-transfer.min.js
index f89da80310..7a2fa5f784 100644
--- a/wp-includes/js/jquery/ui/effect-transfer.min.js
+++ b/wp-includes/js/jquery/ui/effect-transfer.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Effects Transfer 1.11.4
+ * jQuery UI Effects Transfer 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/transfer-effect/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(u){return u.effects.effect.transfer=function(e,t){var i=u(this),n=u(e.to),f="fixed"===n.css("position"),o=u("body"),s=f?o.scrollTop():0,d=f?o.scrollLeft():0,r=n.offset(),c={top:r.top-s,left:r.left-d,height:n.innerHeight(),width:n.innerWidth()},a=i.offset(),l=u("<div class='ui-effects-transfer'></div>").appendTo(document.body).addClass(e.className).css({top:a.top-s,left:a.left-d,height:i.innerHeight(),width:i.innerWidth(),position:f?"fixed":"absolute"}).animate(c,e.duration,e.easing,function(){l.remove(),t()})}});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./effect"],e):e(jQuery)}(function(n){var e;return!1!==n.uiBackCompat&&(e=n.effects.define("transfer",function(e,f){n(this).transfer(e,f)})),e});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/effect.js b/wp-includes/js/jquery/ui/effect.js
new file mode 100644
index 0000000000..d1031bb3a7
--- /dev/null
+++ b/wp-includes/js/jquery/ui/effect.js
@@ -0,0 +1,1639 @@
+/*!
+ * jQuery UI Effects 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Effects Core
+//>>group: Effects
+// jscs:disable maximumLineLength
+//>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/category/effects-core/
+//>>demos: http://jqueryui.com/effect/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [ "jquery" ], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+// Include version.js
+$.ui = $.ui || {};
+$.ui.version = "1.12.1";
+
+var dataSpace = "ui-effects-",
+	dataSpaceStyle = "ui-effects-style",
+	dataSpaceAnimated = "ui-effects-animated",
+
+	// Create a local jQuery because jQuery Color relies on it and the
+	// global may not exist with AMD and a custom build (#10199)
+	jQuery = $;
+
+$.effects = {
+	effect: {}
+};
+
+/*!
+ * jQuery Color Animations v2.1.2
+ * https://github.com/jquery/jquery-color
+ *
+ * Copyright 2014 jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ *
+ * Date: Wed Jan 16 08:47:09 2013 -0600
+ */
+( function( jQuery, undefined ) {
+
+	var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor " +
+		"borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor",
+
+	// Plusequals test for += 100 -= 100
+	rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
+
+	// A set of RE's that can match strings and generate color tuples.
+	stringParsers = [ {
+			re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+			parse: function( execResult ) {
+				return [
+					execResult[ 1 ],
+					execResult[ 2 ],
+					execResult[ 3 ],
+					execResult[ 4 ]
+				];
+			}
+		}, {
+			re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+			parse: function( execResult ) {
+				return [
+					execResult[ 1 ] * 2.55,
+					execResult[ 2 ] * 2.55,
+					execResult[ 3 ] * 2.55,
+					execResult[ 4 ]
+				];
+			}
+		}, {
+
+			// This regex ignores A-F because it's compared against an already lowercased string
+			re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
+			parse: function( execResult ) {
+				return [
+					parseInt( execResult[ 1 ], 16 ),
+					parseInt( execResult[ 2 ], 16 ),
+					parseInt( execResult[ 3 ], 16 )
+				];
+			}
+		}, {
+
+			// This regex ignores A-F because it's compared against an already lowercased string
+			re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
+			parse: function( execResult ) {
+				return [
+					parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ),
+					parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ),
+					parseInt( execResult[ 3 ] + execResult[ 3 ], 16 )
+				];
+			}
+		}, {
+			re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
+			space: "hsla",
+			parse: function( execResult ) {
+				return [
+					execResult[ 1 ],
+					execResult[ 2 ] / 100,
+					execResult[ 3 ] / 100,
+					execResult[ 4 ]
+				];
+			}
+		} ],
+
+	// JQuery.Color( )
+	color = jQuery.Color = function( color, green, blue, alpha ) {
+		return new jQuery.Color.fn.parse( color, green, blue, alpha );
+	},
+	spaces = {
+		rgba: {
+			props: {
+				red: {
+					idx: 0,
+					type: "byte"
+				},
+				green: {
+					idx: 1,
+					type: "byte"
+				},
+				blue: {
+					idx: 2,
+					type: "byte"
+				}
+			}
+		},
+
+		hsla: {
+			props: {
+				hue: {
+					idx: 0,
+					type: "degrees"
+				},
+				saturation: {
+					idx: 1,
+					type: "percent"
+				},
+				lightness: {
+					idx: 2,
+					type: "percent"
+				}
+			}
+		}
+	},
+	propTypes = {
+		"byte": {
+			floor: true,
+			max: 255
+		},
+		"percent": {
+			max: 1
+		},
+		"degrees": {
+			mod: 360,
+			floor: true
+		}
+	},
+	support = color.support = {},
+
+	// Element for support tests
+	supportElem = jQuery( "<p>" )[ 0 ],
+
+	// Colors = jQuery.Color.names
+	colors,
+
+	// Local aliases of functions called often
+	each = jQuery.each;
+
+// Determine rgba support immediately
+supportElem.style.cssText = "background-color:rgba(1,1,1,.5)";
+support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1;
+
+// Define cache name and alpha properties
+// for rgba and hsla spaces
+each( spaces, function( spaceName, space ) {
+	space.cache = "_" + spaceName;
+	space.props.alpha = {
+		idx: 3,
+		type: "percent",
+		def: 1
+	};
+} );
+
+function clamp( value, prop, allowEmpty ) {
+	var type = propTypes[ prop.type ] || {};
+
+	if ( value == null ) {
+		return ( allowEmpty || !prop.def ) ? null : prop.def;
+	}
+
+	// ~~ is an short way of doing floor for positive numbers
+	value = type.floor ? ~~value : parseFloat( value );
+
+	// IE will pass in empty strings as value for alpha,
+	// which will hit this case
+	if ( isNaN( value ) ) {
+		return prop.def;
+	}
+
+	if ( type.mod ) {
+
+		// We add mod before modding to make sure that negatives values
+		// get converted properly: -10 -> 350
+		return ( value + type.mod ) % type.mod;
+	}
+
+	// For now all property types without mod have min and max
+	return 0 > value ? 0 : type.max < value ? type.max : value;
+}
+
+function stringParse( string ) {
+	var inst = color(),
+		rgba = inst._rgba = [];
+
+	string = string.toLowerCase();
+
+	each( stringParsers, function( i, parser ) {
+		var parsed,
+			match = parser.re.exec( string ),
+			values = match && parser.parse( match ),
+			spaceName = parser.space || "rgba";
+
+		if ( values ) {
+			parsed = inst[ spaceName ]( values );
+
+			// If this was an rgba parse the assignment might happen twice
+			// oh well....
+			inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ];
+			rgba = inst._rgba = parsed._rgba;
+
+			// Exit each( stringParsers ) here because we matched
+			return false;
+		}
+	} );
+
+	// Found a stringParser that handled it
+	if ( rgba.length ) {
+
+		// If this came from a parsed string, force "transparent" when alpha is 0
+		// chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
+		if ( rgba.join() === "0,0,0,0" ) {
+			jQuery.extend( rgba, colors.transparent );
+		}
+		return inst;
+	}
+
+	// Named colors
+	return colors[ string ];
+}
+
+color.fn = jQuery.extend( color.prototype, {
+	parse: function( red, green, blue, alpha ) {
+		if ( red === undefined ) {
+			this._rgba = [ null, null, null, null ];
+			return this;
+		}
+		if ( red.jquery || red.nodeType ) {
+			red = jQuery( red ).css( green );
+			green = undefined;
+		}
+
+		var inst = this,
+			type = jQuery.type( red ),
+			rgba = this._rgba = [];
+
+		// More than 1 argument specified - assume ( red, green, blue, alpha )
+		if ( green !== undefined ) {
+			red = [ red, green, blue, alpha ];
+			type = "array";
+		}
+
+		if ( type === "string" ) {
+			return this.parse( stringParse( red ) || colors._default );
+		}
+
+		if ( type === "array" ) {
+			each( spaces.rgba.props, function( key, prop ) {
+				rgba[ prop.idx ] = clamp( red[ prop.idx ], prop );
+			} );
+			return this;
+		}
+
+		if ( type === "object" ) {
+			if ( red instanceof color ) {
+				each( spaces, function( spaceName, space ) {
+					if ( red[ space.cache ] ) {
+						inst[ space.cache ] = red[ space.cache ].slice();
+					}
+				} );
+			} else {
+				each( spaces, function( spaceName, space ) {
+					var cache = space.cache;
+					each( space.props, function( key, prop ) {
+
+						// If the cache doesn't exist, and we know how to convert
+						if ( !inst[ cache ] && space.to ) {
+
+							// If the value was null, we don't need to copy it
+							// if the key was alpha, we don't need to copy it either
+							if ( key === "alpha" || red[ key ] == null ) {
+								return;
+							}
+							inst[ cache ] = space.to( inst._rgba );
+						}
+
+						// This is the only case where we allow nulls for ALL properties.
+						// call clamp with alwaysAllowEmpty
+						inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true );
+					} );
+
+					// Everything defined but alpha?
+					if ( inst[ cache ] &&
+							jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) {
+
+						// Use the default of 1
+						inst[ cache ][ 3 ] = 1;
+						if ( space.from ) {
+							inst._rgba = space.from( inst[ cache ] );
+						}
+					}
+				} );
+			}
+			return this;
+		}
+	},
+	is: function( compare ) {
+		var is = color( compare ),
+			same = true,
+			inst = this;
+
+		each( spaces, function( _, space ) {
+			var localCache,
+				isCache = is[ space.cache ];
+			if ( isCache ) {
+				localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || [];
+				each( space.props, function( _, prop ) {
+					if ( isCache[ prop.idx ] != null ) {
+						same = ( isCache[ prop.idx ] === localCache[ prop.idx ] );
+						return same;
+					}
+				} );
+			}
+			return same;
+		} );
+		return same;
+	},
+	_space: function() {
+		var used = [],
+			inst = this;
+		each( spaces, function( spaceName, space ) {
+			if ( inst[ space.cache ] ) {
+				used.push( spaceName );
+			}
+		} );
+		return used.pop();
+	},
+	transition: function( other, distance ) {
+		var end = color( other ),
+			spaceName = end._space(),
+			space = spaces[ spaceName ],
+			startColor = this.alpha() === 0 ? color( "transparent" ) : this,
+			start = startColor[ space.cache ] || space.to( startColor._rgba ),
+			result = start.slice();
+
+		end = end[ space.cache ];
+		each( space.props, function( key, prop ) {
+			var index = prop.idx,
+				startValue = start[ index ],
+				endValue = end[ index ],
+				type = propTypes[ prop.type ] || {};
+
+			// If null, don't override start value
+			if ( endValue === null ) {
+				return;
+			}
+
+			// If null - use end
+			if ( startValue === null ) {
+				result[ index ] = endValue;
+			} else {
+				if ( type.mod ) {
+					if ( endValue - startValue > type.mod / 2 ) {
+						startValue += type.mod;
+					} else if ( startValue - endValue > type.mod / 2 ) {
+						startValue -= type.mod;
+					}
+				}
+				result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop );
+			}
+		} );
+		return this[ spaceName ]( result );
+	},
+	blend: function( opaque ) {
+
+		// If we are already opaque - return ourself
+		if ( this._rgba[ 3 ] === 1 ) {
+			return this;
+		}
+
+		var rgb = this._rgba.slice(),
+			a = rgb.pop(),
+			blend = color( opaque )._rgba;
+
+		return color( jQuery.map( rgb, function( v, i ) {
+			return ( 1 - a ) * blend[ i ] + a * v;
+		} ) );
+	},
+	toRgbaString: function() {
+		var prefix = "rgba(",
+			rgba = jQuery.map( this._rgba, function( v, i ) {
+				return v == null ? ( i > 2 ? 1 : 0 ) : v;
+			} );
+
+		if ( rgba[ 3 ] === 1 ) {
+			rgba.pop();
+			prefix = "rgb(";
+		}
+
+		return prefix + rgba.join() + ")";
+	},
+	toHslaString: function() {
+		var prefix = "hsla(",
+			hsla = jQuery.map( this.hsla(), function( v, i ) {
+				if ( v == null ) {
+					v = i > 2 ? 1 : 0;
+				}
+
+				// Catch 1 and 2
+				if ( i && i < 3 ) {
+					v = Math.round( v * 100 ) + "%";
+				}
+				return v;
+			} );
+
+		if ( hsla[ 3 ] === 1 ) {
+			hsla.pop();
+			prefix = "hsl(";
+		}
+		return prefix + hsla.join() + ")";
+	},
+	toHexString: function( includeAlpha ) {
+		var rgba = this._rgba.slice(),
+			alpha = rgba.pop();
+
+		if ( includeAlpha ) {
+			rgba.push( ~~( alpha * 255 ) );
+		}
+
+		return "#" + jQuery.map( rgba, function( v ) {
+
+			// Default to 0 when nulls exist
+			v = ( v || 0 ).toString( 16 );
+			return v.length === 1 ? "0" + v : v;
+		} ).join( "" );
+	},
+	toString: function() {
+		return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString();
+	}
+} );
+color.fn.parse.prototype = color.fn;
+
+// Hsla conversions adapted from:
+// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
+
+function hue2rgb( p, q, h ) {
+	h = ( h + 1 ) % 1;
+	if ( h * 6 < 1 ) {
+		return p + ( q - p ) * h * 6;
+	}
+	if ( h * 2 < 1 ) {
+		return q;
+	}
+	if ( h * 3 < 2 ) {
+		return p + ( q - p ) * ( ( 2 / 3 ) - h ) * 6;
+	}
+	return p;
+}
+
+spaces.hsla.to = function( rgba ) {
+	if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) {
+		return [ null, null, null, rgba[ 3 ] ];
+	}
+	var r = rgba[ 0 ] / 255,
+		g = rgba[ 1 ] / 255,
+		b = rgba[ 2 ] / 255,
+		a = rgba[ 3 ],
+		max = Math.max( r, g, b ),
+		min = Math.min( r, g, b ),
+		diff = max - min,
+		add = max + min,
+		l = add * 0.5,
+		h, s;
+
+	if ( min === max ) {
+		h = 0;
+	} else if ( r === max ) {
+		h = ( 60 * ( g - b ) / diff ) + 360;
+	} else if ( g === max ) {
+		h = ( 60 * ( b - r ) / diff ) + 120;
+	} else {
+		h = ( 60 * ( r - g ) / diff ) + 240;
+	}
+
+	// Chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
+	// otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
+	if ( diff === 0 ) {
+		s = 0;
+	} else if ( l <= 0.5 ) {
+		s = diff / add;
+	} else {
+		s = diff / ( 2 - add );
+	}
+	return [ Math.round( h ) % 360, s, l, a == null ? 1 : a ];
+};
+
+spaces.hsla.from = function( hsla ) {
+	if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) {
+		return [ null, null, null, hsla[ 3 ] ];
+	}
+	var h = hsla[ 0 ] / 360,
+		s = hsla[ 1 ],
+		l = hsla[ 2 ],
+		a = hsla[ 3 ],
+		q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s,
+		p = 2 * l - q;
+
+	return [
+		Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ),
+		Math.round( hue2rgb( p, q, h ) * 255 ),
+		Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ),
+		a
+	];
+};
+
+each( spaces, function( spaceName, space ) {
+	var props = space.props,
+		cache = space.cache,
+		to = space.to,
+		from = space.from;
+
+	// Makes rgba() and hsla()
+	color.fn[ spaceName ] = function( value ) {
+
+		// Generate a cache for this space if it doesn't exist
+		if ( to && !this[ cache ] ) {
+			this[ cache ] = to( this._rgba );
+		}
+		if ( value === undefined ) {
+			return this[ cache ].slice();
+		}
+
+		var ret,
+			type = jQuery.type( value ),
+			arr = ( type === "array" || type === "object" ) ? value : arguments,
+			local = this[ cache ].slice();
+
+		each( props, function( key, prop ) {
+			var val = arr[ type === "object" ? key : prop.idx ];
+			if ( val == null ) {
+				val = local[ prop.idx ];
+			}
+			local[ prop.idx ] = clamp( val, prop );
+		} );
+
+		if ( from ) {
+			ret = color( from( local ) );
+			ret[ cache ] = local;
+			return ret;
+		} else {
+			return color( local );
+		}
+	};
+
+	// Makes red() green() blue() alpha() hue() saturation() lightness()
+	each( props, function( key, prop ) {
+
+		// Alpha is included in more than one space
+		if ( color.fn[ key ] ) {
+			return;
+		}
+		color.fn[ key ] = function( value ) {
+			var vtype = jQuery.type( value ),
+				fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ),
+				local = this[ fn ](),
+				cur = local[ prop.idx ],
+				match;
+
+			if ( vtype === "undefined" ) {
+				return cur;
+			}
+
+			if ( vtype === "function" ) {
+				value = value.call( this, cur );
+				vtype = jQuery.type( value );
+			}
+			if ( value == null && prop.empty ) {
+				return this;
+			}
+			if ( vtype === "string" ) {
+				match = rplusequals.exec( value );
+				if ( match ) {
+					value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 );
+				}
+			}
+			local[ prop.idx ] = value;
+			return this[ fn ]( local );
+		};
+	} );
+} );
+
+// Add cssHook and .fx.step function for each named hook.
+// accept a space separated string of properties
+color.hook = function( hook ) {
+	var hooks = hook.split( " " );
+	each( hooks, function( i, hook ) {
+		jQuery.cssHooks[ hook ] = {
+			set: function( elem, value ) {
+				var parsed, curElem,
+					backgroundColor = "";
+
+				if ( value !== "transparent" && ( jQuery.type( value ) !== "string" ||
+						( parsed = stringParse( value ) ) ) ) {
+					value = color( parsed || value );
+					if ( !support.rgba && value._rgba[ 3 ] !== 1 ) {
+						curElem = hook === "backgroundColor" ? elem.parentNode : elem;
+						while (
+							( backgroundColor === "" || backgroundColor === "transparent" ) &&
+							curElem && curElem.style
+						) {
+							try {
+								backgroundColor = jQuery.css( curElem, "backgroundColor" );
+								curElem = curElem.parentNode;
+							} catch ( e ) {
+							}
+						}
+
+						value = value.blend( backgroundColor && backgroundColor !== "transparent" ?
+							backgroundColor :
+							"_default" );
+					}
+
+					value = value.toRgbaString();
+				}
+				try {
+					elem.style[ hook ] = value;
+				} catch ( e ) {
+
+					// Wrapped to prevent IE from throwing errors on "invalid" values like
+					// 'auto' or 'inherit'
+				}
+			}
+		};
+		jQuery.fx.step[ hook ] = function( fx ) {
+			if ( !fx.colorInit ) {
+				fx.start = color( fx.elem, hook );
+				fx.end = color( fx.end );
+				fx.colorInit = true;
+			}
+			jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) );
+		};
+	} );
+
+};
+
+color.hook( stepHooks );
+
+jQuery.cssHooks.borderColor = {
+	expand: function( value ) {
+		var expanded = {};
+
+		each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) {
+			expanded[ "border" + part + "Color" ] = value;
+		} );
+		return expanded;
+	}
+};
+
+// Basic color names only.
+// Usage of any of the other color names requires adding yourself or including
+// jquery.color.svg-names.js.
+colors = jQuery.Color.names = {
+
+	// 4.1. Basic color keywords
+	aqua: "#00ffff",
+	black: "#000000",
+	blue: "#0000ff",
+	fuchsia: "#ff00ff",
+	gray: "#808080",
+	green: "#008000",
+	lime: "#00ff00",
+	maroon: "#800000",
+	navy: "#000080",
+	olive: "#808000",
+	purple: "#800080",
+	red: "#ff0000",
+	silver: "#c0c0c0",
+	teal: "#008080",
+	white: "#ffffff",
+	yellow: "#ffff00",
+
+	// 4.2.3. "transparent" color keyword
+	transparent: [ null, null, null, 0 ],
+
+	_default: "#ffffff"
+};
+
+} )( jQuery );
+
+/******************************************************************************/
+/****************************** CLASS ANIMATIONS ******************************/
+/******************************************************************************/
+( function() {
+
+var classAnimationActions = [ "add", "remove", "toggle" ],
+	shorthandStyles = {
+		border: 1,
+		borderBottom: 1,
+		borderColor: 1,
+		borderLeft: 1,
+		borderRight: 1,
+		borderTop: 1,
+		borderWidth: 1,
+		margin: 1,
+		padding: 1
+	};
+
+$.each(
+	[ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ],
+	function( _, prop ) {
+		$.fx.step[ prop ] = function( fx ) {
+			if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) {
+				jQuery.style( fx.elem, prop, fx.end );
+				fx.setAttr = true;
+			}
+		};
+	}
+);
+
+function getElementStyles( elem ) {
+	var key, len,
+		style = elem.ownerDocument.defaultView ?
+			elem.ownerDocument.defaultView.getComputedStyle( elem, null ) :
+			elem.currentStyle,
+		styles = {};
+
+	if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) {
+		len = style.length;
+		while ( len-- ) {
+			key = style[ len ];
+			if ( typeof style[ key ] === "string" ) {
+				styles[ $.camelCase( key ) ] = style[ key ];
+			}
+		}
+
+	// Support: Opera, IE <9
+	} else {
+		for ( key in style ) {
+			if ( typeof style[ key ] === "string" ) {
+				styles[ key ] = style[ key ];
+			}
+		}
+	}
+
+	return styles;
+}
+
+function styleDifference( oldStyle, newStyle ) {
+	var diff = {},
+		name, value;
+
+	for ( name in newStyle ) {
+		value = newStyle[ name ];
+		if ( oldStyle[ name ] !== value ) {
+			if ( !shorthandStyles[ name ] ) {
+				if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) {
+					diff[ name ] = value;
+				}
+			}
+		}
+	}
+
+	return diff;
+}
+
+// Support: jQuery <1.8
+if ( !$.fn.addBack ) {
+	$.fn.addBack = function( selector ) {
+		return this.add( selector == null ?
+			this.prevObject : this.prevObject.filter( selector )
+		);
+	};
+}
+
+$.effects.animateClass = function( value, duration, easing, callback ) {
+	var o = $.speed( duration, easing, callback );
+
+	return this.queue( function() {
+		var animated = $( this ),
+			baseClass = animated.attr( "class" ) || "",
+			applyClassChange,
+			allAnimations = o.children ? animated.find( "*" ).addBack() : animated;
+
+		// Map the animated objects to store the original styles.
+		allAnimations = allAnimations.map( function() {
+			var el = $( this );
+			return {
+				el: el,
+				start: getElementStyles( this )
+			};
+		} );
+
+		// Apply class change
+		applyClassChange = function() {
+			$.each( classAnimationActions, function( i, action ) {
+				if ( value[ action ] ) {
+					animated[ action + "Class" ]( value[ action ] );
+				}
+			} );
+		};
+		applyClassChange();
+
+		// Map all animated objects again - calculate new styles and diff
+		allAnimations = allAnimations.map( function() {
+			this.end = getElementStyles( this.el[ 0 ] );
+			this.diff = styleDifference( this.start, this.end );
+			return this;
+		} );
+
+		// Apply original class
+		animated.attr( "class", baseClass );
+
+		// Map all animated objects again - this time collecting a promise
+		allAnimations = allAnimations.map( function() {
+			var styleInfo = this,
+				dfd = $.Deferred(),
+				opts = $.extend( {}, o, {
+					queue: false,
+					complete: function() {
+						dfd.resolve( styleInfo );
+					}
+				} );
+
+			this.el.animate( this.diff, opts );
+			return dfd.promise();
+		} );
+
+		// Once all animations have completed:
+		$.when.apply( $, allAnimations.get() ).done( function() {
+
+			// Set the final class
+			applyClassChange();
+
+			// For each animated element,
+			// clear all css properties that were animated
+			$.each( arguments, function() {
+				var el = this.el;
+				$.each( this.diff, function( key ) {
+					el.css( key, "" );
+				} );
+			} );
+
+			// This is guarnteed to be there if you use jQuery.speed()
+			// it also handles dequeuing the next anim...
+			o.complete.call( animated[ 0 ] );
+		} );
+	} );
+};
+
+$.fn.extend( {
+	addClass: ( function( orig ) {
+		return function( classNames, speed, easing, callback ) {
+			return speed ?
+				$.effects.animateClass.call( this,
+					{ add: classNames }, speed, easing, callback ) :
+				orig.apply( this, arguments );
+		};
+	} )( $.fn.addClass ),
+
+	removeClass: ( function( orig ) {
+		return function( classNames, speed, easing, callback ) {
+			return arguments.length > 1 ?
+				$.effects.animateClass.call( this,
+					{ remove: classNames }, speed, easing, callback ) :
+				orig.apply( this, arguments );
+		};
+	} )( $.fn.removeClass ),
+
+	toggleClass: ( function( orig ) {
+		return function( classNames, force, speed, easing, callback ) {
+			if ( typeof force === "boolean" || force === undefined ) {
+				if ( !speed ) {
+
+					// Without speed parameter
+					return orig.apply( this, arguments );
+				} else {
+					return $.effects.animateClass.call( this,
+						( force ? { add: classNames } : { remove: classNames } ),
+						speed, easing, callback );
+				}
+			} else {
+
+				// Without force parameter
+				return $.effects.animateClass.call( this,
+					{ toggle: classNames }, force, speed, easing );
+			}
+		};
+	} )( $.fn.toggleClass ),
+
+	switchClass: function( remove, add, speed, easing, callback ) {
+		return $.effects.animateClass.call( this, {
+			add: add,
+			remove: remove
+		}, speed, easing, callback );
+	}
+} );
+
+} )();
+
+/******************************************************************************/
+/*********************************** EFFECTS **********************************/
+/******************************************************************************/
+
+( function() {
+
+if ( $.expr && $.expr.filters && $.expr.filters.animated ) {
+	$.expr.filters.animated = ( function( orig ) {
+		return function( elem ) {
+			return !!$( elem ).data( dataSpaceAnimated ) || orig( elem );
+		};
+	} )( $.expr.filters.animated );
+}
+
+if ( $.uiBackCompat !== false ) {
+	$.extend( $.effects, {
+
+		// Saves a set of properties in a data storage
+		save: function( element, set ) {
+			var i = 0, length = set.length;
+			for ( ; i < length; i++ ) {
+				if ( set[ i ] !== null ) {
+					element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] );
+				}
+			}
+		},
+
+		// Restores a set of previously saved properties from a data storage
+		restore: function( element, set ) {
+			var val, i = 0, length = set.length;
+			for ( ; i < length; i++ ) {
+				if ( set[ i ] !== null ) {
+					val = element.data( dataSpace + set[ i ] );
+					element.css( set[ i ], val );
+				}
+			}
+		},
+
+		setMode: function( el, mode ) {
+			if ( mode === "toggle" ) {
+				mode = el.is( ":hidden" ) ? "show" : "hide";
+			}
+			return mode;
+		},
+
+		// Wraps the element around a wrapper that copies position properties
+		createWrapper: function( element ) {
+
+			// If the element is already wrapped, return it
+			if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+				return element.parent();
+			}
+
+			// Wrap the element
+			var props = {
+					width: element.outerWidth( true ),
+					height: element.outerHeight( true ),
+					"float": element.css( "float" )
+				},
+				wrapper = $( "<div></div>" )
+					.addClass( "ui-effects-wrapper" )
+					.css( {
+						fontSize: "100%",
+						background: "transparent",
+						border: "none",
+						margin: 0,
+						padding: 0
+					} ),
+
+				// Store the size in case width/height are defined in % - Fixes #5245
+				size = {
+					width: element.width(),
+					height: element.height()
+				},
+				active = document.activeElement;
+
+			// Support: Firefox
+			// Firefox incorrectly exposes anonymous content
+			// https://bugzilla.mozilla.org/show_bug.cgi?id=561664
+			try {
+				active.id;
+			} catch ( e ) {
+				active = document.body;
+			}
+
+			element.wrap( wrapper );
+
+			// Fixes #7595 - Elements lose focus when wrapped.
+			if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+				$( active ).trigger( "focus" );
+			}
+
+			// Hotfix for jQuery 1.4 since some change in wrap() seems to actually
+			// lose the reference to the wrapped element
+			wrapper = element.parent();
+
+			// Transfer positioning properties to the wrapper
+			if ( element.css( "position" ) === "static" ) {
+				wrapper.css( { position: "relative" } );
+				element.css( { position: "relative" } );
+			} else {
+				$.extend( props, {
+					position: element.css( "position" ),
+					zIndex: element.css( "z-index" )
+				} );
+				$.each( [ "top", "left", "bottom", "right" ], function( i, pos ) {
+					props[ pos ] = element.css( pos );
+					if ( isNaN( parseInt( props[ pos ], 10 ) ) ) {
+						props[ pos ] = "auto";
+					}
+				} );
+				element.css( {
+					position: "relative",
+					top: 0,
+					left: 0,
+					right: "auto",
+					bottom: "auto"
+				} );
+			}
+			element.css( size );
+
+			return wrapper.css( props ).show();
+		},
+
+		removeWrapper: function( element ) {
+			var active = document.activeElement;
+
+			if ( element.parent().is( ".ui-effects-wrapper" ) ) {
+				element.parent().replaceWith( element );
+
+				// Fixes #7595 - Elements lose focus when wrapped.
+				if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) {
+					$( active ).trigger( "focus" );
+				}
+			}
+
+			return element;
+		}
+	} );
+}
+
+$.extend( $.effects, {
+	version: "1.12.1",
+
+	define: function( name, mode, effect ) {
+		if ( !effect ) {
+			effect = mode;
+			mode = "effect";
+		}
+
+		$.effects.effect[ name ] = effect;
+		$.effects.effect[ name ].mode = mode;
+
+		return effect;
+	},
+
+	scaledDimensions: function( element, percent, direction ) {
+		if ( percent === 0 ) {
+			return {
+				height: 0,
+				width: 0,
+				outerHeight: 0,
+				outerWidth: 0
+			};
+		}
+
+		var x = direction !== "horizontal" ? ( ( percent || 100 ) / 100 ) : 1,
+			y = direction !== "vertical" ? ( ( percent || 100 ) / 100 ) : 1;
+
+		return {
+			height: element.height() * y,
+			width: element.width() * x,
+			outerHeight: element.outerHeight() * y,
+			outerWidth: element.outerWidth() * x
+		};
+
+	},
+
+	clipToBox: function( animation ) {
+		return {
+			width: animation.clip.right - animation.clip.left,
+			height: animation.clip.bottom - animation.clip.top,
+			left: animation.clip.left,
+			top: animation.clip.top
+		};
+	},
+
+	// Injects recently queued functions to be first in line (after "inprogress")
+	unshift: function( element, queueLength, count ) {
+		var queue = element.queue();
+
+		if ( queueLength > 1 ) {
+			queue.splice.apply( queue,
+				[ 1, 0 ].concat( queue.splice( queueLength, count ) ) );
+		}
+		element.dequeue();
+	},
+
+	saveStyle: function( element ) {
+		element.data( dataSpaceStyle, element[ 0 ].style.cssText );
+	},
+
+	restoreStyle: function( element ) {
+		element[ 0 ].style.cssText = element.data( dataSpaceStyle ) || "";
+		element.removeData( dataSpaceStyle );
+	},
+
+	mode: function( element, mode ) {
+		var hidden = element.is( ":hidden" );
+
+		if ( mode === "toggle" ) {
+			mode = hidden ? "show" : "hide";
+		}
+		if ( hidden ? mode === "hide" : mode === "show" ) {
+			mode = "none";
+		}
+		return mode;
+	},
+
+	// Translates a [top,left] array into a baseline value
+	getBaseline: function( origin, original ) {
+		var y, x;
+
+		switch ( origin[ 0 ] ) {
+		case "top":
+			y = 0;
+			break;
+		case "middle":
+			y = 0.5;
+			break;
+		case "bottom":
+			y = 1;
+			break;
+		default:
+			y = origin[ 0 ] / original.height;
+		}
+
+		switch ( origin[ 1 ] ) {
+		case "left":
+			x = 0;
+			break;
+		case "center":
+			x = 0.5;
+			break;
+		case "right":
+			x = 1;
+			break;
+		default:
+			x = origin[ 1 ] / original.width;
+		}
+
+		return {
+			x: x,
+			y: y
+		};
+	},
+
+	// Creates a placeholder element so that the original element can be made absolute
+	createPlaceholder: function( element ) {
+		var placeholder,
+			cssPosition = element.css( "position" ),
+			position = element.position();
+
+		// Lock in margins first to account for form elements, which
+		// will change margin if you explicitly set height
+		// see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380
+		// Support: Safari
+		element.css( {
+			marginTop: element.css( "marginTop" ),
+			marginBottom: element.css( "marginBottom" ),
+			marginLeft: element.css( "marginLeft" ),
+			marginRight: element.css( "marginRight" )
+		} )
+		.outerWidth( element.outerWidth() )
+		.outerHeight( element.outerHeight() );
+
+		if ( /^(static|relative)/.test( cssPosition ) ) {
+			cssPosition = "absolute";
+
+			placeholder = $( "<" + element[ 0 ].nodeName + ">" ).insertAfter( element ).css( {
+
+				// Convert inline to inline block to account for inline elements
+				// that turn to inline block based on content (like img)
+				display: /^(inline|ruby)/.test( element.css( "display" ) ) ?
+					"inline-block" :
+					"block",
+				visibility: "hidden",
+
+				// Margins need to be set to account for margin collapse
+				marginTop: element.css( "marginTop" ),
+				marginBottom: element.css( "marginBottom" ),
+				marginLeft: element.css( "marginLeft" ),
+				marginRight: element.css( "marginRight" ),
+				"float": element.css( "float" )
+			} )
+			.outerWidth( element.outerWidth() )
+			.outerHeight( element.outerHeight() )
+			.addClass( "ui-effects-placeholder" );
+
+			element.data( dataSpace + "placeholder", placeholder );
+		}
+
+		element.css( {
+			position: cssPosition,
+			left: position.left,
+			top: position.top
+		} );
+
+		return placeholder;
+	},
+
+	removePlaceholder: function( element ) {
+		var dataKey = dataSpace + "placeholder",
+				placeholder = element.data( dataKey );
+
+		if ( placeholder ) {
+			placeholder.remove();
+			element.removeData( dataKey );
+		}
+	},
+
+	// Removes a placeholder if it exists and restores
+	// properties that were modified during placeholder creation
+	cleanUp: function( element ) {
+		$.effects.restoreStyle( element );
+		$.effects.removePlaceholder( element );
+	},
+
+	setTransition: function( element, list, factor, value ) {
+		value = value || {};
+		$.each( list, function( i, x ) {
+			var unit = element.cssUnit( x );
+			if ( unit[ 0 ] > 0 ) {
+				value[ x ] = unit[ 0 ] * factor + unit[ 1 ];
+			}
+		} );
+		return value;
+	}
+} );
+
+// Return an effect options object for the given parameters:
+function _normalizeArguments( effect, options, speed, callback ) {
+
+	// Allow passing all options as the first parameter
+	if ( $.isPlainObject( effect ) ) {
+		options = effect;
+		effect = effect.effect;
+	}
+
+	// Convert to an object
+	effect = { effect: effect };
+
+	// Catch (effect, null, ...)
+	if ( options == null ) {
+		options = {};
+	}
+
+	// Catch (effect, callback)
+	if ( $.isFunction( options ) ) {
+		callback = options;
+		speed = null;
+		options = {};
+	}
+
+	// Catch (effect, speed, ?)
+	if ( typeof options === "number" || $.fx.speeds[ options ] ) {
+		callback = speed;
+		speed = options;
+		options = {};
+	}
+
+	// Catch (effect, options, callback)
+	if ( $.isFunction( speed ) ) {
+		callback = speed;
+		speed = null;
+	}
+
+	// Add options to effect
+	if ( options ) {
+		$.extend( effect, options );
+	}
+
+	speed = speed || options.duration;
+	effect.duration = $.fx.off ? 0 :
+		typeof speed === "number" ? speed :
+		speed in $.fx.speeds ? $.fx.speeds[ speed ] :
+		$.fx.speeds._default;
+
+	effect.complete = callback || options.complete;
+
+	return effect;
+}
+
+function standardAnimationOption( option ) {
+
+	// Valid standard speeds (nothing, number, named speed)
+	if ( !option || typeof option === "number" || $.fx.speeds[ option ] ) {
+		return true;
+	}
+
+	// Invalid strings - treat as "normal" speed
+	if ( typeof option === "string" && !$.effects.effect[ option ] ) {
+		return true;
+	}
+
+	// Complete callback
+	if ( $.isFunction( option ) ) {
+		return true;
+	}
+
+	// Options hash (but not naming an effect)
+	if ( typeof option === "object" && !option.effect ) {
+		return true;
+	}
+
+	// Didn't match any standard API
+	return false;
+}
+
+$.fn.extend( {
+	effect: function( /* effect, options, speed, callback */ ) {
+		var args = _normalizeArguments.apply( this, arguments ),
+			effectMethod = $.effects.effect[ args.effect ],
+			defaultMode = effectMethod.mode,
+			queue = args.queue,
+			queueName = queue || "fx",
+			complete = args.complete,
+			mode = args.mode,
+			modes = [],
+			prefilter = function( next ) {
+				var el = $( this ),
+					normalizedMode = $.effects.mode( el, mode ) || defaultMode;
+
+				// Sentinel for duck-punching the :animated psuedo-selector
+				el.data( dataSpaceAnimated, true );
+
+				// Save effect mode for later use,
+				// we can't just call $.effects.mode again later,
+				// as the .show() below destroys the initial state
+				modes.push( normalizedMode );
+
+				// See $.uiBackCompat inside of run() for removal of defaultMode in 1.13
+				if ( defaultMode && ( normalizedMode === "show" ||
+						( normalizedMode === defaultMode && normalizedMode === "hide" ) ) ) {
+					el.show();
+				}
+
+				if ( !defaultMode || normalizedMode !== "none" ) {
+					$.effects.saveStyle( el );
+				}
+
+				if ( $.isFunction( next ) ) {
+					next();
+				}
+			};
+
+		if ( $.fx.off || !effectMethod ) {
+
+			// Delegate to the original method (e.g., .show()) if possible
+			if ( mode ) {
+				return this[ mode ]( args.duration, complete );
+			} else {
+				return this.each( function() {
+					if ( complete ) {
+						complete.call( this );
+					}
+				} );
+			}
+		}
+
+		function run( next ) {
+			var elem = $( this );
+
+			function cleanup() {
+				elem.removeData( dataSpaceAnimated );
+
+				$.effects.cleanUp( elem );
+
+				if ( args.mode === "hide" ) {
+					elem.hide();
+				}
+
+				done();
+			}
+
+			function done() {
+				if ( $.isFunction( complete ) ) {
+					complete.call( elem[ 0 ] );
+				}
+
+				if ( $.isFunction( next ) ) {
+					next();
+				}
+			}
+
+			// Override mode option on a per element basis,
+			// as toggle can be either show or hide depending on element state
+			args.mode = modes.shift();
+
+			if ( $.uiBackCompat !== false && !defaultMode ) {
+				if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) {
+
+					// Call the core method to track "olddisplay" properly
+					elem[ mode ]();
+					done();
+				} else {
+					effectMethod.call( elem[ 0 ], args, done );
+				}
+			} else {
+				if ( args.mode === "none" ) {
+
+					// Call the core method to track "olddisplay" properly
+					elem[ mode ]();
+					done();
+				} else {
+					effectMethod.call( elem[ 0 ], args, cleanup );
+				}
+			}
+		}
+
+		// Run prefilter on all elements first to ensure that
+		// any showing or hiding happens before placeholder creation,
+		// which ensures that any layout changes are correctly captured.
+		return queue === false ?
+			this.each( prefilter ).each( run ) :
+			this.queue( queueName, prefilter ).queue( queueName, run );
+	},
+
+	show: ( function( orig ) {
+		return function( option ) {
+			if ( standardAnimationOption( option ) ) {
+				return orig.apply( this, arguments );
+			} else {
+				var args = _normalizeArguments.apply( this, arguments );
+				args.mode = "show";
+				return this.effect.call( this, args );
+			}
+		};
+	} )( $.fn.show ),
+
+	hide: ( function( orig ) {
+		return function( option ) {
+			if ( standardAnimationOption( option ) ) {
+				return orig.apply( this, arguments );
+			} else {
+				var args = _normalizeArguments.apply( this, arguments );
+				args.mode = "hide";
+				return this.effect.call( this, args );
+			}
+		};
+	} )( $.fn.hide ),
+
+	toggle: ( function( orig ) {
+		return function( option ) {
+			if ( standardAnimationOption( option ) || typeof option === "boolean" ) {
+				return orig.apply( this, arguments );
+			} else {
+				var args = _normalizeArguments.apply( this, arguments );
+				args.mode = "toggle";
+				return this.effect.call( this, args );
+			}
+		};
+	} )( $.fn.toggle ),
+
+	cssUnit: function( key ) {
+		var style = this.css( key ),
+			val = [];
+
+		$.each( [ "em", "px", "%", "pt" ], function( i, unit ) {
+			if ( style.indexOf( unit ) > 0 ) {
+				val = [ parseFloat( style ), unit ];
+			}
+		} );
+		return val;
+	},
+
+	cssClip: function( clipObj ) {
+		if ( clipObj ) {
+			return this.css( "clip", "rect(" + clipObj.top + "px " + clipObj.right + "px " +
+				clipObj.bottom + "px " + clipObj.left + "px)" );
+		}
+		return parseClip( this.css( "clip" ), this );
+	},
+
+	transfer: function( options, done ) {
+		var element = $( this ),
+			target = $( options.to ),
+			targetFixed = target.css( "position" ) === "fixed",
+			body = $( "body" ),
+			fixTop = targetFixed ? body.scrollTop() : 0,
+			fixLeft = targetFixed ? body.scrollLeft() : 0,
+			endPosition = target.offset(),
+			animation = {
+				top: endPosition.top - fixTop,
+				left: endPosition.left - fixLeft,
+				height: target.innerHeight(),
+				width: target.innerWidth()
+			},
+			startPosition = element.offset(),
+			transfer = $( "<div class='ui-effects-transfer'></div>" )
+				.appendTo( "body" )
+				.addClass( options.className )
+				.css( {
+					top: startPosition.top - fixTop,
+					left: startPosition.left - fixLeft,
+					height: element.innerHeight(),
+					width: element.innerWidth(),
+					position: targetFixed ? "fixed" : "absolute"
+				} )
+				.animate( animation, options.duration, options.easing, function() {
+					transfer.remove();
+					if ( $.isFunction( done ) ) {
+						done();
+					}
+				} );
+	}
+} );
+
+function parseClip( str, element ) {
+		var outerWidth = element.outerWidth(),
+			outerHeight = element.outerHeight(),
+			clipRegex = /^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/,
+			values = clipRegex.exec( str ) || [ "", 0, outerWidth, outerHeight, 0 ];
+
+		return {
+			top: parseFloat( values[ 1 ] ) || 0,
+			right: values[ 2 ] === "auto" ? outerWidth : parseFloat( values[ 2 ] ),
+			bottom: values[ 3 ] === "auto" ? outerHeight : parseFloat( values[ 3 ] ),
+			left: parseFloat( values[ 4 ] ) || 0
+		};
+}
+
+$.fx.step.clip = function( fx ) {
+	if ( !fx.clipInit ) {
+		fx.start = $( fx.elem ).cssClip();
+		if ( typeof fx.end === "string" ) {
+			fx.end = parseClip( fx.end, fx.elem );
+		}
+		fx.clipInit = true;
+	}
+
+	$( fx.elem ).cssClip( {
+		top: fx.pos * ( fx.end.top - fx.start.top ) + fx.start.top,
+		right: fx.pos * ( fx.end.right - fx.start.right ) + fx.start.right,
+		bottom: fx.pos * ( fx.end.bottom - fx.start.bottom ) + fx.start.bottom,
+		left: fx.pos * ( fx.end.left - fx.start.left ) + fx.start.left
+	} );
+};
+
+} )();
+
+/******************************************************************************/
+/*********************************** EASING ***********************************/
+/******************************************************************************/
+
+( function() {
+
+// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
+
+var baseEasings = {};
+
+$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) {
+	baseEasings[ name ] = function( p ) {
+		return Math.pow( p, i + 2 );
+	};
+} );
+
+$.extend( baseEasings, {
+	Sine: function( p ) {
+		return 1 - Math.cos( p * Math.PI / 2 );
+	},
+	Circ: function( p ) {
+		return 1 - Math.sqrt( 1 - p * p );
+	},
+	Elastic: function( p ) {
+		return p === 0 || p === 1 ? p :
+			-Math.pow( 2, 8 * ( p - 1 ) ) * Math.sin( ( ( p - 1 ) * 80 - 7.5 ) * Math.PI / 15 );
+	},
+	Back: function( p ) {
+		return p * p * ( 3 * p - 2 );
+	},
+	Bounce: function( p ) {
+		var pow2,
+			bounce = 4;
+
+		while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {}
+		return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 );
+	}
+} );
+
+$.each( baseEasings, function( name, easeIn ) {
+	$.easing[ "easeIn" + name ] = easeIn;
+	$.easing[ "easeOut" + name ] = function( p ) {
+		return 1 - easeIn( 1 - p );
+	};
+	$.easing[ "easeInOut" + name ] = function( p ) {
+		return p < 0.5 ?
+			easeIn( p * 2 ) / 2 :
+			1 - easeIn( p * -2 + 2 ) / 2;
+	};
+} );
+
+} )();
+
+return $.effects;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/effect.min.js b/wp-includes/js/jquery/ui/effect.min.js
index 949fa25789..a5f2d62690 100644
--- a/wp-includes/js/jquery/ui/effect.min.js
+++ b/wp-includes/js/jquery/ui/effect.min.js
@@ -1,14 +1,12 @@
 /*!
- * jQuery UI Effects 1.11.4
+ * jQuery UI Effects 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/category/effects-core/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):t(jQuery)}(function(s){var u,l,c,d,t,p,h,g,i,e,b,a,o,f,m,y,n,r,v,x,C="ui-effects-",w=s;function _(t,e,n){var r=g[e.type]||{};return null==t?n||!e.def?null:e.def:(t=r.floor?~~t:parseFloat(t),isNaN(t)?e.def:r.mod?(t+r.mod)%r.mod:t<0?0:r.max<t?r.max:t)}function k(i){var s=p(),f=s._rgba=[];return i=i.toLowerCase(),b(t,function(t,e){var n,r=e.re.exec(i),o=r&&e.parse(r),a=e.space||"rgba";if(o)return n=s[a](o),s[h[a].cache]=n[h[a].cache],f=s._rgba=n._rgba,!1}),f.length?("0,0,0,0"===f.join()&&u.extend(f,c.transparent),s):c[i]}function M(t,e,n){return 6*(n=(n+1)%1)<1?t+(e-t)*n*6:2*n<1?e:3*n<2?t+(e-t)*(2/3-n)*6:t}function S(t){var e,n,r=t.ownerDocument.defaultView?t.ownerDocument.defaultView.getComputedStyle(t,null):t.currentStyle,o={};if(r&&r.length&&r[0]&&r[r[0]])for(n=r.length;n--;)"string"==typeof r[e=r[n]]&&(o[s.camelCase(e)]=r[e]);else for(e in r)"string"==typeof r[e]&&(o[e]=r[e]);return o}function j(t,e,n,r){return s.isPlainObject(t)&&(t=(e=t).effect),t={effect:t},null==e&&(e={}),s.isFunction(e)&&(r=e,n=null,e={}),"number"!=typeof e&&!s.fx.speeds[e]||(r=n,n=e,e={}),s.isFunction(n)&&(r=n,n=null),e&&s.extend(t,e),n=n||e.duration,t.duration=s.fx.off?0:"number"==typeof n?n:n in s.fx.speeds?s.fx.speeds[n]:s.fx.speeds._default,t.complete=r||e.complete,t}function I(t){return!(t&&"number"!=typeof t&&!s.fx.speeds[t])||("string"==typeof t&&!s.effects.effect[t]||(!!s.isFunction(t)||"object"==typeof t&&!t.effect))}return s.effects={effect:{}},
+!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):t(jQuery)}(function(d){d.ui=d.ui||{},d.ui.version="1.12.1";var u,l,f,p,t,h,g,m,s,e,b,o,i,a,c,v,n,r,y,x,C,w="ui-effects-",k="ui-effects-style",_="ui-effects-animated",S=d;function M(t,e,n){var r=m[e.type]||{};return null==t?n||!e.def?null:e.def:(t=r.floor?~~t:parseFloat(t),isNaN(t)?e.def:r.mod?(t+r.mod)%r.mod:t<0?0:r.max<t?r.max:t)}function B(s){var a=h(),c=a._rgba=[];return s=s.toLowerCase(),b(t,function(t,e){var n,r=e.re.exec(s),i=r&&e.parse(r),o=e.space||"rgba";if(i)return n=a[o](i),a[g[o].cache]=n[g[o].cache],c=a._rgba=n._rgba,!1}),c.length?("0,0,0,0"===c.join()&&u.extend(c,f.transparent),a):f[s]}function H(t,e,n){return 6*(n=(n+1)%1)<1?t+(e-t)*n*6:2*n<1?e:3*n<2?t+(e-t)*(2/3-n)*6:t}function I(t){var e,n,r=t.ownerDocument.defaultView?t.ownerDocument.defaultView.getComputedStyle(t,null):t.currentStyle,i={};if(r&&r.length&&r[0]&&r[r[0]])for(n=r.length;n--;)"string"==typeof r[e=r[n]]&&(i[d.camelCase(e)]=r[e]);else for(e in r)"string"==typeof r[e]&&(i[e]=r[e]);return i}function T(t,e,n,r){return d.isPlainObject(t)&&(t=(e=t).effect),t={effect:t},null==e&&(e={}),d.isFunction(e)&&(r=e,n=null,e={}),"number"!=typeof e&&!d.fx.speeds[e]||(r=n,n=e,e={}),d.isFunction(n)&&(r=n,n=null),e&&d.extend(t,e),n=n||e.duration,t.duration=d.fx.off?0:"number"==typeof n?n:n in d.fx.speeds?d.fx.speeds[n]:d.fx.speeds._default,t.complete=r||e.complete,t}function F(t){return!(t&&"number"!=typeof t&&!d.fx.speeds[t])||("string"==typeof t&&!d.effects.effect[t]||(!!d.isFunction(t)||"object"==typeof t&&!t.effect))}function W(t,e){var n=e.outerWidth(),r=e.outerHeight(),i=/^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/.exec(t)||["",0,n,r,0];return{top:parseFloat(i[1])||0,right:"auto"===i[2]?n:parseFloat(i[2]),bottom:"auto"===i[3]?r:parseFloat(i[3]),left:parseFloat(i[4])||0}}return d.effects={effect:{}},
 /*!
  * jQuery Color Animations v2.1.2
  * https://github.com/jquery/jquery-color
@@ -19,4 +17,4 @@
  *
  * Date: Wed Jan 16 08:47:09 2013 -0600
  */
-d=/^([\-+])=\s*(\d+\.?\d*)/,t=[{re:/rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,parse:function(t){return[t[1],t[2],t[3],t[4]]}},{re:/rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,parse:function(t){return[2.55*t[1],2.55*t[2],2.55*t[3],t[4]]}},{re:/#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,parse:function(t){return[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]}},{re:/#([a-f0-9])([a-f0-9])([a-f0-9])/,parse:function(t){return[parseInt(t[1]+t[1],16),parseInt(t[2]+t[2],16),parseInt(t[3]+t[3],16)]}},{re:/hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,space:"hsla",parse:function(t){return[t[1],t[2]/100,t[3]/100,t[4]]}}],p=(u=w).Color=function(t,e,n,r){return new u.Color.fn.parse(t,e,n,r)},h={rgba:{props:{red:{idx:0,type:"byte"},green:{idx:1,type:"byte"},blue:{idx:2,type:"byte"}}},hsla:{props:{hue:{idx:0,type:"degrees"},saturation:{idx:1,type:"percent"},lightness:{idx:2,type:"percent"}}}},g={byte:{floor:!0,max:255},percent:{max:1},degrees:{mod:360,floor:!0}},i=p.support={},e=u("<p>")[0],b=u.each,e.style.cssText="background-color:rgba(1,1,1,.5)",i.rgba=-1<e.style.backgroundColor.indexOf("rgba"),b(h,function(t,e){e.cache="_"+t,e.props.alpha={idx:3,type:"percent",def:1}}),p.fn=u.extend(p.prototype,{parse:function(o,t,e,n){if(o===l)return this._rgba=[null,null,null,null],this;(o.jquery||o.nodeType)&&(o=u(o).css(t),t=l);var a=this,r=u.type(o),i=this._rgba=[];return t!==l&&(o=[o,t,e,n],r="array"),"string"===r?this.parse(k(o)||c._default):"array"===r?(b(h.rgba.props,function(t,e){i[e.idx]=_(o[e.idx],e)}),this):"object"===r?(b(h,o instanceof p?function(t,e){o[e.cache]&&(a[e.cache]=o[e.cache].slice())}:function(t,n){var r=n.cache;b(n.props,function(t,e){if(!a[r]&&n.to){if("alpha"===t||null==o[t])return;a[r]=n.to(a._rgba)}a[r][e.idx]=_(o[t],e,!0)}),a[r]&&u.inArray(null,a[r].slice(0,3))<0&&(a[r][3]=1,n.from&&(a._rgba=n.from(a[r])))}),this):void 0},is:function(t){var o=p(t),a=!0,i=this;return b(h,function(t,e){var n,r=o[e.cache];return r&&(n=i[e.cache]||e.to&&e.to(i._rgba)||[],b(e.props,function(t,e){if(null!=r[e.idx])return a=r[e.idx]===n[e.idx]})),a}),a},_space:function(){var n=[],r=this;return b(h,function(t,e){r[e.cache]&&n.push(t)}),n.pop()},transition:function(t,i){var s=p(t),e=s._space(),n=h[e],r=0===this.alpha()?p("transparent"):this,f=r[n.cache]||n.to(r._rgba),c=f.slice();return s=s[n.cache],b(n.props,function(t,e){var n=e.idx,r=f[n],o=s[n],a=g[e.type]||{};null!==o&&(null===r?c[n]=o:(a.mod&&(o-r>a.mod/2?r+=a.mod:r-o>a.mod/2&&(r-=a.mod)),c[n]=_((o-r)*i+r,e)))}),this[e](c)},blend:function(t){if(1===this._rgba[3])return this;var e=this._rgba.slice(),n=e.pop(),r=p(t)._rgba;return p(u.map(e,function(t,e){return(1-n)*r[e]+n*t}))},toRgbaString:function(){var t="rgba(",e=u.map(this._rgba,function(t,e){return null==t?2<e?1:0:t});return 1===e[3]&&(e.pop(),t="rgb("),t+e.join()+")"},toHslaString:function(){var t="hsla(",e=u.map(this.hsla(),function(t,e){return null==t&&(t=2<e?1:0),e&&e<3&&(t=Math.round(100*t)+"%"),t});return 1===e[3]&&(e.pop(),t="hsl("),t+e.join()+")"},toHexString:function(t){var e=this._rgba.slice(),n=e.pop();return t&&e.push(~~(255*n)),"#"+u.map(e,function(t){return 1===(t=(t||0).toString(16)).length?"0"+t:t}).join("")},toString:function(){return 0===this._rgba[3]?"transparent":this.toRgbaString()}}),p.fn.parse.prototype=p.fn,h.hsla.to=function(t){if(null==t[0]||null==t[1]||null==t[2])return[null,null,null,t[3]];var e,n,r=t[0]/255,o=t[1]/255,a=t[2]/255,i=t[3],s=Math.max(r,o,a),f=Math.min(r,o,a),c=s-f,u=s+f,l=.5*u;return e=f===s?0:r===s?60*(o-a)/c+360:o===s?60*(a-r)/c+120:60*(r-o)/c+240,n=0==c?0:l<=.5?c/u:c/(2-u),[Math.round(e)%360,n,l,null==i?1:i]},h.hsla.from=function(t){if(null==t[0]||null==t[1]||null==t[2])return[null,null,null,t[3]];var e=t[0]/360,n=t[1],r=t[2],o=t[3],a=r<=.5?r*(1+n):r+n-r*n,i=2*r-a;return[Math.round(255*M(i,a,e+1/3)),Math.round(255*M(i,a,e)),Math.round(255*M(i,a,e-1/3)),o]},b(h,function(f,t){var n=t.props,i=t.cache,s=t.to,c=t.from;p.fn[f]=function(t){if(s&&!this[i]&&(this[i]=s(this._rgba)),t===l)return this[i].slice();var e,r=u.type(t),o="array"===r||"object"===r?t:arguments,a=this[i].slice();return b(n,function(t,e){var n=o["object"===r?t:e.idx];null==n&&(n=a[e.idx]),a[e.idx]=_(n,e)}),c?((e=p(c(a)))[i]=a,e):p(a)},b(n,function(i,s){p.fn[i]||(p.fn[i]=function(t){var e,n=u.type(t),r="alpha"===i?this._hsla?"hsla":"rgba":f,o=this[r](),a=o[s.idx];return"undefined"===n?a:("function"===n&&(t=t.call(this,a),n=u.type(t)),null==t&&s.empty?this:("string"===n&&(e=d.exec(t))&&(t=a+parseFloat(e[2])*("+"===e[1]?1:-1)),o[s.idx]=t,this[r](o)))})})}),p.hook=function(t){var e=t.split(" ");b(e,function(t,a){u.cssHooks[a]={set:function(t,e){var n,r,o="";if("transparent"!==e&&("string"!==u.type(e)||(n=k(e)))){if(e=p(n||e),!i.rgba&&1!==e._rgba[3]){for(r="backgroundColor"===a?t.parentNode:t;(""===o||"transparent"===o)&&r&&r.style;)try{o=u.css(r,"backgroundColor"),r=r.parentNode}catch(t){}e=e.blend(o&&"transparent"!==o?o:"_default")}e=e.toRgbaString()}try{t.style[a]=e}catch(t){}}},u.fx.step[a]=function(t){t.colorInit||(t.start=p(t.elem,a),t.end=p(t.end),t.colorInit=!0),u.cssHooks[a].set(t.elem,t.start.transition(t.end,t.pos))}})},p.hook("backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor"),u.cssHooks.borderColor={expand:function(n){var r={};return b(["Top","Right","Bottom","Left"],function(t,e){r["border"+e+"Color"]=n}),r}},c=u.Color.names={aqua:"#00ffff",black:"#000000",blue:"#0000ff",fuchsia:"#ff00ff",gray:"#808080",green:"#008000",lime:"#00ff00",maroon:"#800000",navy:"#000080",olive:"#808000",purple:"#800080",red:"#ff0000",silver:"#c0c0c0",teal:"#008080",white:"#ffffff",yellow:"#ffff00",transparent:[null,null,null,0],_default:"#ffffff"},m=["add","remove","toggle"],y={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1},s.each(["borderLeftStyle","borderRightStyle","borderBottomStyle","borderTopStyle"],function(t,e){s.fx.step[e]=function(t){("none"!==t.end&&!t.setAttr||1===t.pos&&!t.setAttr)&&(w.style(t.elem,e,t.end),t.setAttr=!0)}}),s.fn.addBack||(s.fn.addBack=function(t){return this.add(null==t?this.prevObject:this.prevObject.filter(t))}),s.effects.animateClass=function(o,t,e,n){var a=s.speed(t,e,n);return this.queue(function(){var t,n=s(this),e=n.attr("class")||"",r=a.children?n.find("*").addBack():n;r=r.map(function(){return{el:s(this),start:S(this)}}),(t=function(){s.each(m,function(t,e){o[e]&&n[e+"Class"](o[e])})})(),r=r.map(function(){return this.end=S(this.el[0]),this.diff=function(t,e){var n,r,o={};for(n in e)r=e[n],t[n]!==r&&(y[n]||!s.fx.step[n]&&isNaN(parseFloat(r))||(o[n]=r));return o}(this.start,this.end),this}),n.attr("class",e),r=r.map(function(){var t=this,e=s.Deferred(),n=s.extend({},a,{queue:!1,complete:function(){e.resolve(t)}});return this.el.animate(this.diff,n),e.promise()}),s.when.apply(s,r.get()).done(function(){t(),s.each(arguments,function(){var e=this.el;s.each(this.diff,function(t){e.css(t,"")})}),a.complete.call(n[0])})})},s.fn.extend({addClass:(f=s.fn.addClass,function(t,e,n,r){return e?s.effects.animateClass.call(this,{add:t},e,n,r):f.apply(this,arguments)}),removeClass:(o=s.fn.removeClass,function(t,e,n,r){return 1<arguments.length?s.effects.animateClass.call(this,{remove:t},e,n,r):o.apply(this,arguments)}),toggleClass:(a=s.fn.toggleClass,function(t,e,n,r,o){return"boolean"==typeof e||void 0===e?n?s.effects.animateClass.call(this,e?{add:t}:{remove:t},n,r,o):a.apply(this,arguments):s.effects.animateClass.call(this,{toggle:t},e,n,r)}),switchClass:function(t,e,n,r,o){return s.effects.animateClass.call(this,{add:e,remove:t},n,r,o)}}),s.extend(s.effects,{version:"1.11.4",save:function(t,e){for(var n=0;n<e.length;n++)null!==e[n]&&t.data(C+e[n],t[0].style[e[n]])},restore:function(t,e){var n,r;for(r=0;r<e.length;r++)null!==e[r]&&(void 0===(n=t.data(C+e[r]))&&(n=""),t.css(e[r],n))},setMode:function(t,e){return"toggle"===e&&(e=t.is(":hidden")?"show":"hide"),e},getBaseline:function(t,e){var n,r;switch(t[0]){case"top":n=0;break;case"middle":n=.5;break;case"bottom":n=1;break;default:n=t[0]/e.height}switch(t[1]){case"left":r=0;break;case"center":r=.5;break;case"right":r=1;break;default:r=t[1]/e.width}return{x:r,y:n}},createWrapper:function(n){if(n.parent().is(".ui-effects-wrapper"))return n.parent();var r={width:n.outerWidth(!0),height:n.outerHeight(!0),float:n.css("float")},t=s("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e={width:n.width(),height:n.height()},o=document.activeElement;try{o.id}catch(t){o=document.body}return n.wrap(t),n[0]!==o&&!s.contains(n[0],o)||s(o).focus(),t=n.parent(),"static"===n.css("position")?(t.css({position:"relative"}),n.css({position:"relative"})):(s.extend(r,{position:n.css("position"),zIndex:n.css("z-index")}),s.each(["top","left","bottom","right"],function(t,e){r[e]=n.css(e),isNaN(parseInt(r[e],10))&&(r[e]="auto")}),n.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),n.css(e),t.css(r).show()},removeWrapper:function(t){var e=document.activeElement;return t.parent().is(".ui-effects-wrapper")&&(t.parent().replaceWith(t),t[0]!==e&&!s.contains(t[0],e)||s(e).focus()),t},setTransition:function(r,t,o,a){return a=a||{},s.each(t,function(t,e){var n=r.cssUnit(e);0<n[0]&&(a[e]=n[0]*o+n[1])}),a}}),s.fn.extend({effect:function(){var a=j.apply(this,arguments),t=a.mode,e=a.queue,i=s.effects.effect[a.effect];if(s.fx.off||!i)return t?this[t](a.duration,a.complete):this.each(function(){a.complete&&a.complete.call(this)});function n(t){var e=s(this),n=a.complete,r=a.mode;function o(){s.isFunction(n)&&n.call(e[0]),s.isFunction(t)&&t()}(e.is(":hidden")?"hide"===r:"show"===r)?(e[r](),o()):i.call(e[0],a,o)}return!1===e?this.each(n):this.queue(e||"fx",n)},show:(v=s.fn.show,function(t){if(I(t))return v.apply(this,arguments);var e=j.apply(this,arguments);return e.mode="show",this.effect.call(this,e)}),hide:(r=s.fn.hide,function(t){if(I(t))return r.apply(this,arguments);var e=j.apply(this,arguments);return e.mode="hide",this.effect.call(this,e)}),toggle:(n=s.fn.toggle,function(t){if(I(t)||"boolean"==typeof t)return n.apply(this,arguments);var e=j.apply(this,arguments);return e.mode="toggle",this.effect.call(this,e)}),cssUnit:function(t){var n=this.css(t),r=[];return s.each(["em","px","%","pt"],function(t,e){0<n.indexOf(e)&&(r=[parseFloat(n),e])}),r}}),x={},s.each(["Quad","Cubic","Quart","Quint","Expo"],function(e,t){x[t]=function(t){return Math.pow(t,e+2)}}),s.extend(x,{Sine:function(t){return 1-Math.cos(t*Math.PI/2)},Circ:function(t){return 1-Math.sqrt(1-t*t)},Elastic:function(t){return 0===t||1===t?t:-Math.pow(2,8*(t-1))*Math.sin((80*(t-1)-7.5)*Math.PI/15)},Back:function(t){return t*t*(3*t-2)},Bounce:function(t){for(var e,n=4;t<((e=Math.pow(2,--n))-1)/11;);return 1/Math.pow(4,3-n)-7.5625*Math.pow((3*e-2)/22-t,2)}}),s.each(x,function(t,e){s.easing["easeIn"+t]=e,s.easing["easeOut"+t]=function(t){return 1-e(1-t)},s.easing["easeInOut"+t]=function(t){return t<.5?e(2*t)/2:1-e(-2*t+2)/2}}),s.effects});
\ No newline at end of file
+p=/^([\-+])=\s*(\d+\.?\d*)/,t=[{re:/rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,parse:function(t){return[t[1],t[2],t[3],t[4]]}},{re:/rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,parse:function(t){return[2.55*t[1],2.55*t[2],2.55*t[3],t[4]]}},{re:/#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,parse:function(t){return[parseInt(t[1],16),parseInt(t[2],16),parseInt(t[3],16)]}},{re:/#([a-f0-9])([a-f0-9])([a-f0-9])/,parse:function(t){return[parseInt(t[1]+t[1],16),parseInt(t[2]+t[2],16),parseInt(t[3]+t[3],16)]}},{re:/hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,space:"hsla",parse:function(t){return[t[1],t[2]/100,t[3]/100,t[4]]}}],h=(u=S).Color=function(t,e,n,r){return new u.Color.fn.parse(t,e,n,r)},g={rgba:{props:{red:{idx:0,type:"byte"},green:{idx:1,type:"byte"},blue:{idx:2,type:"byte"}}},hsla:{props:{hue:{idx:0,type:"degrees"},saturation:{idx:1,type:"percent"},lightness:{idx:2,type:"percent"}}}},m={byte:{floor:!0,max:255},percent:{max:1},degrees:{mod:360,floor:!0}},s=h.support={},e=u("<p>")[0],b=u.each,e.style.cssText="background-color:rgba(1,1,1,.5)",s.rgba=-1<e.style.backgroundColor.indexOf("rgba"),b(g,function(t,e){e.cache="_"+t,e.props.alpha={idx:3,type:"percent",def:1}}),h.fn=u.extend(h.prototype,{parse:function(i,t,e,n){if(i===l)return this._rgba=[null,null,null,null],this;(i.jquery||i.nodeType)&&(i=u(i).css(t),t=l);var o=this,r=u.type(i),s=this._rgba=[];return t!==l&&(i=[i,t,e,n],r="array"),"string"===r?this.parse(B(i)||f._default):"array"===r?(b(g.rgba.props,function(t,e){s[e.idx]=M(i[e.idx],e)}),this):"object"===r?(b(g,i instanceof h?function(t,e){i[e.cache]&&(o[e.cache]=i[e.cache].slice())}:function(t,n){var r=n.cache;b(n.props,function(t,e){if(!o[r]&&n.to){if("alpha"===t||null==i[t])return;o[r]=n.to(o._rgba)}o[r][e.idx]=M(i[t],e,!0)}),o[r]&&u.inArray(null,o[r].slice(0,3))<0&&(o[r][3]=1,n.from&&(o._rgba=n.from(o[r])))}),this):void 0},is:function(t){var i=h(t),o=!0,s=this;return b(g,function(t,e){var n,r=i[e.cache];return r&&(n=s[e.cache]||e.to&&e.to(s._rgba)||[],b(e.props,function(t,e){if(null!=r[e.idx])return o=r[e.idx]===n[e.idx]})),o}),o},_space:function(){var n=[],r=this;return b(g,function(t,e){r[e.cache]&&n.push(t)}),n.pop()},transition:function(t,s){var a=h(t),e=a._space(),n=g[e],r=0===this.alpha()?h("transparent"):this,c=r[n.cache]||n.to(r._rgba),f=c.slice();return a=a[n.cache],b(n.props,function(t,e){var n=e.idx,r=c[n],i=a[n],o=m[e.type]||{};null!==i&&(null===r?f[n]=i:(o.mod&&(i-r>o.mod/2?r+=o.mod:r-i>o.mod/2&&(r-=o.mod)),f[n]=M((i-r)*s+r,e)))}),this[e](f)},blend:function(t){if(1===this._rgba[3])return this;var e=this._rgba.slice(),n=e.pop(),r=h(t)._rgba;return h(u.map(e,function(t,e){return(1-n)*r[e]+n*t}))},toRgbaString:function(){var t="rgba(",e=u.map(this._rgba,function(t,e){return null==t?2<e?1:0:t});return 1===e[3]&&(e.pop(),t="rgb("),t+e.join()+")"},toHslaString:function(){var t="hsla(",e=u.map(this.hsla(),function(t,e){return null==t&&(t=2<e?1:0),e&&e<3&&(t=Math.round(100*t)+"%"),t});return 1===e[3]&&(e.pop(),t="hsl("),t+e.join()+")"},toHexString:function(t){var e=this._rgba.slice(),n=e.pop();return t&&e.push(~~(255*n)),"#"+u.map(e,function(t){return 1===(t=(t||0).toString(16)).length?"0"+t:t}).join("")},toString:function(){return 0===this._rgba[3]?"transparent":this.toRgbaString()}}),h.fn.parse.prototype=h.fn,g.hsla.to=function(t){if(null==t[0]||null==t[1]||null==t[2])return[null,null,null,t[3]];var e,n,r=t[0]/255,i=t[1]/255,o=t[2]/255,s=t[3],a=Math.max(r,i,o),c=Math.min(r,i,o),f=a-c,u=a+c,l=.5*u;return e=c===a?0:r===a?60*(i-o)/f+360:i===a?60*(o-r)/f+120:60*(r-i)/f+240,n=0==f?0:l<=.5?f/u:f/(2-u),[Math.round(e)%360,n,l,null==s?1:s]},g.hsla.from=function(t){if(null==t[0]||null==t[1]||null==t[2])return[null,null,null,t[3]];var e=t[0]/360,n=t[1],r=t[2],i=t[3],o=r<=.5?r*(1+n):r+n-r*n,s=2*r-o;return[Math.round(255*H(s,o,e+1/3)),Math.round(255*H(s,o,e)),Math.round(255*H(s,o,e-1/3)),i]},b(g,function(c,t){var n=t.props,s=t.cache,a=t.to,f=t.from;h.fn[c]=function(t){if(a&&!this[s]&&(this[s]=a(this._rgba)),t===l)return this[s].slice();var e,r=u.type(t),i="array"===r||"object"===r?t:arguments,o=this[s].slice();return b(n,function(t,e){var n=i["object"===r?t:e.idx];null==n&&(n=o[e.idx]),o[e.idx]=M(n,e)}),f?((e=h(f(o)))[s]=o,e):h(o)},b(n,function(s,a){h.fn[s]||(h.fn[s]=function(t){var e,n=u.type(t),r="alpha"===s?this._hsla?"hsla":"rgba":c,i=this[r](),o=i[a.idx];return"undefined"===n?o:("function"===n&&(t=t.call(this,o),n=u.type(t)),null==t&&a.empty?this:("string"===n&&(e=p.exec(t))&&(t=o+parseFloat(e[2])*("+"===e[1]?1:-1)),i[a.idx]=t,this[r](i)))})})}),h.hook=function(t){var e=t.split(" ");b(e,function(t,o){u.cssHooks[o]={set:function(t,e){var n,r,i="";if("transparent"!==e&&("string"!==u.type(e)||(n=B(e)))){if(e=h(n||e),!s.rgba&&1!==e._rgba[3]){for(r="backgroundColor"===o?t.parentNode:t;(""===i||"transparent"===i)&&r&&r.style;)try{i=u.css(r,"backgroundColor"),r=r.parentNode}catch(t){}e=e.blend(i&&"transparent"!==i?i:"_default")}e=e.toRgbaString()}try{t.style[o]=e}catch(t){}}},u.fx.step[o]=function(t){t.colorInit||(t.start=h(t.elem,o),t.end=h(t.end),t.colorInit=!0),u.cssHooks[o].set(t.elem,t.start.transition(t.end,t.pos))}})},h.hook("backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor"),u.cssHooks.borderColor={expand:function(n){var r={};return b(["Top","Right","Bottom","Left"],function(t,e){r["border"+e+"Color"]=n}),r}},f=u.Color.names={aqua:"#00ffff",black:"#000000",blue:"#0000ff",fuchsia:"#ff00ff",gray:"#808080",green:"#008000",lime:"#00ff00",maroon:"#800000",navy:"#000080",olive:"#808000",purple:"#800080",red:"#ff0000",silver:"#c0c0c0",teal:"#008080",white:"#ffffff",yellow:"#ffff00",transparent:[null,null,null,0],_default:"#ffffff"},c=["add","remove","toggle"],v={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1},d.each(["borderLeftStyle","borderRightStyle","borderBottomStyle","borderTopStyle"],function(t,e){d.fx.step[e]=function(t){("none"!==t.end&&!t.setAttr||1===t.pos&&!t.setAttr)&&(S.style(t.elem,e,t.end),t.setAttr=!0)}}),d.fn.addBack||(d.fn.addBack=function(t){return this.add(null==t?this.prevObject:this.prevObject.filter(t))}),d.effects.animateClass=function(i,t,e,n){var o=d.speed(t,e,n);return this.queue(function(){var t,n=d(this),e=n.attr("class")||"",r=o.children?n.find("*").addBack():n;r=r.map(function(){return{el:d(this),start:I(this)}}),(t=function(){d.each(c,function(t,e){i[e]&&n[e+"Class"](i[e])})})(),r=r.map(function(){return this.end=I(this.el[0]),this.diff=function(t,e){var n,r,i={};for(n in e)r=e[n],t[n]!==r&&(v[n]||!d.fx.step[n]&&isNaN(parseFloat(r))||(i[n]=r));return i}(this.start,this.end),this}),n.attr("class",e),r=r.map(function(){var t=this,e=d.Deferred(),n=d.extend({},o,{queue:!1,complete:function(){e.resolve(t)}});return this.el.animate(this.diff,n),e.promise()}),d.when.apply(d,r.get()).done(function(){t(),d.each(arguments,function(){var e=this.el;d.each(this.diff,function(t){e.css(t,"")})}),o.complete.call(n[0])})})},d.fn.extend({addClass:(a=d.fn.addClass,function(t,e,n,r){return e?d.effects.animateClass.call(this,{add:t},e,n,r):a.apply(this,arguments)}),removeClass:(i=d.fn.removeClass,function(t,e,n,r){return 1<arguments.length?d.effects.animateClass.call(this,{remove:t},e,n,r):i.apply(this,arguments)}),toggleClass:(o=d.fn.toggleClass,function(t,e,n,r,i){return"boolean"==typeof e||void 0===e?n?d.effects.animateClass.call(this,e?{add:t}:{remove:t},n,r,i):o.apply(this,arguments):d.effects.animateClass.call(this,{toggle:t},e,n,r)}),switchClass:function(t,e,n,r,i){return d.effects.animateClass.call(this,{add:e,remove:t},n,r,i)}}),d.expr&&d.expr.filters&&d.expr.filters.animated&&(d.expr.filters.animated=(n=d.expr.filters.animated,function(t){return!!d(t).data(_)||n(t)})),!1!==d.uiBackCompat&&d.extend(d.effects,{save:function(t,e){for(var n=0,r=e.length;n<r;n++)null!==e[n]&&t.data(w+e[n],t[0].style[e[n]])},restore:function(t,e){for(var n,r=0,i=e.length;r<i;r++)null!==e[r]&&(n=t.data(w+e[r]),t.css(e[r],n))},setMode:function(t,e){return"toggle"===e&&(e=t.is(":hidden")?"show":"hide"),e},createWrapper:function(n){if(n.parent().is(".ui-effects-wrapper"))return n.parent();var r={width:n.outerWidth(!0),height:n.outerHeight(!0),float:n.css("float")},t=d("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}),e={width:n.width(),height:n.height()},i=document.activeElement;try{i.id}catch(t){i=document.body}return n.wrap(t),n[0]!==i&&!d.contains(n[0],i)||d(i).trigger("focus"),t=n.parent(),"static"===n.css("position")?(t.css({position:"relative"}),n.css({position:"relative"})):(d.extend(r,{position:n.css("position"),zIndex:n.css("z-index")}),d.each(["top","left","bottom","right"],function(t,e){r[e]=n.css(e),isNaN(parseInt(r[e],10))&&(r[e]="auto")}),n.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})),n.css(e),t.css(r).show()},removeWrapper:function(t){var e=document.activeElement;return t.parent().is(".ui-effects-wrapper")&&(t.parent().replaceWith(t),t[0]!==e&&!d.contains(t[0],e)||d(e).trigger("focus")),t}}),d.extend(d.effects,{version:"1.12.1",define:function(t,e,n){return n||(n=e,e="effect"),d.effects.effect[t]=n,d.effects.effect[t].mode=e,n},scaledDimensions:function(t,e,n){if(0===e)return{height:0,width:0,outerHeight:0,outerWidth:0};var r="horizontal"!==n?(e||100)/100:1,i="vertical"!==n?(e||100)/100:1;return{height:t.height()*i,width:t.width()*r,outerHeight:t.outerHeight()*i,outerWidth:t.outerWidth()*r}},clipToBox:function(t){return{width:t.clip.right-t.clip.left,height:t.clip.bottom-t.clip.top,left:t.clip.left,top:t.clip.top}},unshift:function(t,e,n){var r=t.queue();1<e&&r.splice.apply(r,[1,0].concat(r.splice(e,n))),t.dequeue()},saveStyle:function(t){t.data(k,t[0].style.cssText)},restoreStyle:function(t){t[0].style.cssText=t.data(k)||"",t.removeData(k)},mode:function(t,e){var n=t.is(":hidden");return"toggle"===e&&(e=n?"show":"hide"),(n?"hide"===e:"show"===e)&&(e="none"),e},getBaseline:function(t,e){var n,r;switch(t[0]){case"top":n=0;break;case"middle":n=.5;break;case"bottom":n=1;break;default:n=t[0]/e.height}switch(t[1]){case"left":r=0;break;case"center":r=.5;break;case"right":r=1;break;default:r=t[1]/e.width}return{x:r,y:n}},createPlaceholder:function(t){var e,n=t.css("position"),r=t.position();return t.css({marginTop:t.css("marginTop"),marginBottom:t.css("marginBottom"),marginLeft:t.css("marginLeft"),marginRight:t.css("marginRight")}).outerWidth(t.outerWidth()).outerHeight(t.outerHeight()),/^(static|relative)/.test(n)&&(n="absolute",e=d("<"+t[0].nodeName+">").insertAfter(t).css({display:/^(inline|ruby)/.test(t.css("display"))?"inline-block":"block",visibility:"hidden",marginTop:t.css("marginTop"),marginBottom:t.css("marginBottom"),marginLeft:t.css("marginLeft"),marginRight:t.css("marginRight"),float:t.css("float")}).outerWidth(t.outerWidth()).outerHeight(t.outerHeight()).addClass("ui-effects-placeholder"),t.data(w+"placeholder",e)),t.css({position:n,left:r.left,top:r.top}),e},removePlaceholder:function(t){var e=w+"placeholder",n=t.data(e);n&&(n.remove(),t.removeData(e))},cleanUp:function(t){d.effects.restoreStyle(t),d.effects.removePlaceholder(t)},setTransition:function(r,t,i,o){return o=o||{},d.each(t,function(t,e){var n=r.cssUnit(e);0<n[0]&&(o[e]=n[0]*i+n[1])}),o}}),d.fn.extend({effect:function(){function t(t){var e=d(this),n=d.effects.mode(e,a)||o;e.data(_,!0),c.push(n),o&&("show"===n||n===o&&"hide"===n)&&e.show(),o&&"none"===n||d.effects.saveStyle(e),d.isFunction(t)&&t()}var r=T.apply(this,arguments),i=d.effects.effect[r.effect],o=i.mode,e=r.queue,n=e||"fx",s=r.complete,a=r.mode,c=[];if(d.fx.off||!i)return a?this[a](r.duration,s):this.each(function(){s&&s.call(this)});function f(t){var e=d(this);function n(){d.isFunction(s)&&s.call(e[0]),d.isFunction(t)&&t()}r.mode=c.shift(),!1===d.uiBackCompat||o?"none"===r.mode?(e[a](),n()):i.call(e[0],r,function(){e.removeData(_),d.effects.cleanUp(e),"hide"===r.mode&&e.hide(),n()}):(e.is(":hidden")?"hide"===a:"show"===a)?(e[a](),n()):i.call(e[0],r,n)}return!1===e?this.each(t).each(f):this.queue(n,t).queue(n,f)},show:(x=d.fn.show,function(t){if(F(t))return x.apply(this,arguments);var e=T.apply(this,arguments);return e.mode="show",this.effect.call(this,e)}),hide:(y=d.fn.hide,function(t){if(F(t))return y.apply(this,arguments);var e=T.apply(this,arguments);return e.mode="hide",this.effect.call(this,e)}),toggle:(r=d.fn.toggle,function(t){if(F(t)||"boolean"==typeof t)return r.apply(this,arguments);var e=T.apply(this,arguments);return e.mode="toggle",this.effect.call(this,e)}),cssUnit:function(t){var n=this.css(t),r=[];return d.each(["em","px","%","pt"],function(t,e){0<n.indexOf(e)&&(r=[parseFloat(n),e])}),r},cssClip:function(t){return t?this.css("clip","rect("+t.top+"px "+t.right+"px "+t.bottom+"px "+t.left+"px)"):W(this.css("clip"),this)},transfer:function(t,e){var n=d(this),r=d(t.to),i="fixed"===r.css("position"),o=d("body"),s=i?o.scrollTop():0,a=i?o.scrollLeft():0,c=r.offset(),f={top:c.top-s,left:c.left-a,height:r.innerHeight(),width:r.innerWidth()},u=n.offset(),l=d("<div class='ui-effects-transfer'></div>").appendTo("body").addClass(t.className).css({top:u.top-s,left:u.left-a,height:n.innerHeight(),width:n.innerWidth(),position:i?"fixed":"absolute"}).animate(f,t.duration,t.easing,function(){l.remove(),d.isFunction(e)&&e()})}}),d.fx.step.clip=function(t){t.clipInit||(t.start=d(t.elem).cssClip(),"string"==typeof t.end&&(t.end=W(t.end,t.elem)),t.clipInit=!0),d(t.elem).cssClip({top:t.pos*(t.end.top-t.start.top)+t.start.top,right:t.pos*(t.end.right-t.start.right)+t.start.right,bottom:t.pos*(t.end.bottom-t.start.bottom)+t.start.bottom,left:t.pos*(t.end.left-t.start.left)+t.start.left})},C={},d.each(["Quad","Cubic","Quart","Quint","Expo"],function(e,t){C[t]=function(t){return Math.pow(t,e+2)}}),d.extend(C,{Sine:function(t){return 1-Math.cos(t*Math.PI/2)},Circ:function(t){return 1-Math.sqrt(1-t*t)},Elastic:function(t){return 0===t||1===t?t:-Math.pow(2,8*(t-1))*Math.sin((80*(t-1)-7.5)*Math.PI/15)},Back:function(t){return t*t*(3*t-2)},Bounce:function(t){for(var e,n=4;t<((e=Math.pow(2,--n))-1)/11;);return 1/Math.pow(4,3-n)-7.5625*Math.pow((3*e-2)/22-t,2)}}),d.each(C,function(t,e){d.easing["easeIn"+t]=e,d.easing["easeOut"+t]=function(t){return 1-e(1-t)},d.easing["easeInOut"+t]=function(t){return t<.5?e(2*t)/2:1-e(-2*t+2)/2}}),d.effects});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/menu.js b/wp-includes/js/jquery/ui/menu.js
new file mode 100644
index 0000000000..f5c4f73115
--- /dev/null
+++ b/wp-includes/js/jquery/ui/menu.js
@@ -0,0 +1,668 @@
+/*!
+ * jQuery UI Menu 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Menu
+//>>group: Widgets
+//>>description: Creates nestable menus.
+//>>docs: http://api.jqueryui.com/menu/
+//>>demos: http://jqueryui.com/menu/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/menu.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.menu", {
+	version: "1.12.1",
+	defaultElement: "<ul>",
+	delay: 300,
+	options: {
+		icons: {
+			submenu: "ui-icon-caret-1-e"
+		},
+		items: "> *",
+		menus: "ul",
+		position: {
+			my: "left top",
+			at: "right top"
+		},
+		role: "menu",
+
+		// Callbacks
+		blur: null,
+		focus: null,
+		select: null
+	},
+
+	_create: function() {
+		this.activeMenu = this.element;
+
+		// Flag used to prevent firing of the click handler
+		// as the event bubbles up through nested menus
+		this.mouseHandled = false;
+		this.element
+			.uniqueId()
+			.attr( {
+				role: this.options.role,
+				tabIndex: 0
+			} );
+
+		this._addClass( "ui-menu", "ui-widget ui-widget-content" );
+		this._on( {
+
+			// Prevent focus from sticking to links inside menu after clicking
+			// them (focus should always stay on UL during navigation).
+			"mousedown .ui-menu-item": function( event ) {
+				event.preventDefault();
+			},
+			"click .ui-menu-item": function( event ) {
+				var target = $( event.target );
+				var active = $( $.ui.safeActiveElement( this.document[ 0 ] ) );
+				if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) {
+					this.select( event );
+
+					// Only set the mouseHandled flag if the event will bubble, see #9469.
+					if ( !event.isPropagationStopped() ) {
+						this.mouseHandled = true;
+					}
+
+					// Open submenu on click
+					if ( target.has( ".ui-menu" ).length ) {
+						this.expand( event );
+					} else if ( !this.element.is( ":focus" ) &&
+							active.closest( ".ui-menu" ).length ) {
+
+						// Redirect focus to the menu
+						this.element.trigger( "focus", [ true ] );
+
+						// If the active item is on the top level, let it stay active.
+						// Otherwise, blur the active item since it is no longer visible.
+						if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) {
+							clearTimeout( this.timer );
+						}
+					}
+				}
+			},
+			"mouseenter .ui-menu-item": function( event ) {
+
+				// Ignore mouse events while typeahead is active, see #10458.
+				// Prevents focusing the wrong item when typeahead causes a scroll while the mouse
+				// is over an item in the menu
+				if ( this.previousFilter ) {
+					return;
+				}
+
+				var actualTarget = $( event.target ).closest( ".ui-menu-item" ),
+					target = $( event.currentTarget );
+
+				// Ignore bubbled events on parent items, see #11641
+				if ( actualTarget[ 0 ] !== target[ 0 ] ) {
+					return;
+				}
+
+				// Remove ui-state-active class from siblings of the newly focused menu item
+				// to avoid a jump caused by adjacent elements both having a class with a border
+				this._removeClass( target.siblings().children( ".ui-state-active" ),
+					null, "ui-state-active" );
+				this.focus( event, target );
+			},
+			mouseleave: "collapseAll",
+			"mouseleave .ui-menu": "collapseAll",
+			focus: function( event, keepActiveItem ) {
+
+				// If there's already an active item, keep it active
+				// If not, activate the first item
+				var item = this.active || this.element.find( this.options.items ).eq( 0 );
+
+				if ( !keepActiveItem ) {
+					this.focus( event, item );
+				}
+			},
+			blur: function( event ) {
+				this._delay( function() {
+					var notContained = !$.contains(
+						this.element[ 0 ],
+						$.ui.safeActiveElement( this.document[ 0 ] )
+					);
+					if ( notContained ) {
+						this.collapseAll( event );
+					}
+				} );
+			},
+			keydown: "_keydown"
+		} );
+
+		this.refresh();
+
+		// Clicks outside of a menu collapse any open menus
+		this._on( this.document, {
+			click: function( event ) {
+				if ( this._closeOnDocumentClick( event ) ) {
+					this.collapseAll( event );
+				}
+
+				// Reset the mouseHandled flag
+				this.mouseHandled = false;
+			}
+		} );
+	},
+
+	_destroy: function() {
+		var items = this.element.find( ".ui-menu-item" )
+				.removeAttr( "role aria-disabled" ),
+			submenus = items.children( ".ui-menu-item-wrapper" )
+				.removeUniqueId()
+				.removeAttr( "tabIndex role aria-haspopup" );
+
+		// Destroy (sub)menus
+		this.element
+			.removeAttr( "aria-activedescendant" )
+			.find( ".ui-menu" ).addBack()
+				.removeAttr( "role aria-labelledby aria-expanded aria-hidden aria-disabled " +
+					"tabIndex" )
+				.removeUniqueId()
+				.show();
+
+		submenus.children().each( function() {
+			var elem = $( this );
+			if ( elem.data( "ui-menu-submenu-caret" ) ) {
+				elem.remove();
+			}
+		} );
+	},
+
+	_keydown: function( event ) {
+		var match, prev, character, skip,
+			preventDefault = true;
+
+		switch ( event.keyCode ) {
+		case $.ui.keyCode.PAGE_UP:
+			this.previousPage( event );
+			break;
+		case $.ui.keyCode.PAGE_DOWN:
+			this.nextPage( event );
+			break;
+		case $.ui.keyCode.HOME:
+			this._move( "first", "first", event );
+			break;
+		case $.ui.keyCode.END:
+			this._move( "last", "last", event );
+			break;
+		case $.ui.keyCode.UP:
+			this.previous( event );
+			break;
+		case $.ui.keyCode.DOWN:
+			this.next( event );
+			break;
+		case $.ui.keyCode.LEFT:
+			this.collapse( event );
+			break;
+		case $.ui.keyCode.RIGHT:
+			if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+				this.expand( event );
+			}
+			break;
+		case $.ui.keyCode.ENTER:
+		case $.ui.keyCode.SPACE:
+			this._activate( event );
+			break;
+		case $.ui.keyCode.ESCAPE:
+			this.collapse( event );
+			break;
+		default:
+			preventDefault = false;
+			prev = this.previousFilter || "";
+			skip = false;
+
+			// Support number pad values
+			character = event.keyCode >= 96 && event.keyCode <= 105 ?
+				( event.keyCode - 96 ).toString() : String.fromCharCode( event.keyCode );
+
+			clearTimeout( this.filterTimer );
+
+			if ( character === prev ) {
+				skip = true;
+			} else {
+				character = prev + character;
+			}
+
+			match = this._filterMenuItems( character );
+			match = skip && match.index( this.active.next() ) !== -1 ?
+				this.active.nextAll( ".ui-menu-item" ) :
+				match;
+
+			// If no matches on the current filter, reset to the last character pressed
+			// to move down the menu to the first item that starts with that character
+			if ( !match.length ) {
+				character = String.fromCharCode( event.keyCode );
+				match = this._filterMenuItems( character );
+			}
+
+			if ( match.length ) {
+				this.focus( event, match );
+				this.previousFilter = character;
+				this.filterTimer = this._delay( function() {
+					delete this.previousFilter;
+				}, 1000 );
+			} else {
+				delete this.previousFilter;
+			}
+		}
+
+		if ( preventDefault ) {
+			event.preventDefault();
+		}
+	},
+
+	_activate: function( event ) {
+		if ( this.active && !this.active.is( ".ui-state-disabled" ) ) {
+			if ( this.active.children( "[aria-haspopup='true']" ).length ) {
+				this.expand( event );
+			} else {
+				this.select( event );
+			}
+		}
+	},
+
+	refresh: function() {
+		var menus, items, newSubmenus, newItems, newWrappers,
+			that = this,
+			icon = this.options.icons.submenu,
+			submenus = this.element.find( this.options.menus );
+
+		this._toggleClass( "ui-menu-icons", null, !!this.element.find( ".ui-icon" ).length );
+
+		// Initialize nested menus
+		newSubmenus = submenus.filter( ":not(.ui-menu)" )
+			.hide()
+			.attr( {
+				role: this.options.role,
+				"aria-hidden": "true",
+				"aria-expanded": "false"
+			} )
+			.each( function() {
+				var menu = $( this ),
+					item = menu.prev(),
+					submenuCaret = $( "<span>" ).data( "ui-menu-submenu-caret", true );
+
+				that._addClass( submenuCaret, "ui-menu-icon", "ui-icon " + icon );
+				item
+					.attr( "aria-haspopup", "true" )
+					.prepend( submenuCaret );
+				menu.attr( "aria-labelledby", item.attr( "id" ) );
+			} );
+
+		this._addClass( newSubmenus, "ui-menu", "ui-widget ui-widget-content ui-front" );
+
+		menus = submenus.add( this.element );
+		items = menus.find( this.options.items );
+
+		// Initialize menu-items containing spaces and/or dashes only as dividers
+		items.not( ".ui-menu-item" ).each( function() {
+			var item = $( this );
+			if ( that._isDivider( item ) ) {
+				that._addClass( item, "ui-menu-divider", "ui-widget-content" );
+			}
+		} );
+
+		// Don't refresh list items that are already adapted
+		newItems = items.not( ".ui-menu-item, .ui-menu-divider" );
+		newWrappers = newItems.children()
+			.not( ".ui-menu" )
+				.uniqueId()
+				.attr( {
+					tabIndex: -1,
+					role: this._itemRole()
+				} );
+		this._addClass( newItems, "ui-menu-item" )
+			._addClass( newWrappers, "ui-menu-item-wrapper" );
+
+		// Add aria-disabled attribute to any disabled menu item
+		items.filter( ".ui-state-disabled" ).attr( "aria-disabled", "true" );
+
+		// If the active item has been removed, blur the menu
+		if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) {
+			this.blur();
+		}
+	},
+
+	_itemRole: function() {
+		return {
+			menu: "menuitem",
+			listbox: "option"
+		}[ this.options.role ];
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "icons" ) {
+			var icons = this.element.find( ".ui-menu-icon" );
+			this._removeClass( icons, null, this.options.icons.submenu )
+				._addClass( icons, null, value.submenu );
+		}
+		this._super( key, value );
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.element.attr( "aria-disabled", String( value ) );
+		this._toggleClass( null, "ui-state-disabled", !!value );
+	},
+
+	focus: function( event, item ) {
+		var nested, focused, activeParent;
+		this.blur( event, event && event.type === "focus" );
+
+		this._scrollIntoView( item );
+
+		this.active = item.first();
+
+		focused = this.active.children( ".ui-menu-item-wrapper" );
+		this._addClass( focused, null, "ui-state-active" );
+
+		// Only update aria-activedescendant if there's a role
+		// otherwise we assume focus is managed elsewhere
+		if ( this.options.role ) {
+			this.element.attr( "aria-activedescendant", focused.attr( "id" ) );
+		}
+
+		// Highlight active parent menu item, if any
+		activeParent = this.active
+			.parent()
+				.closest( ".ui-menu-item" )
+					.children( ".ui-menu-item-wrapper" );
+		this._addClass( activeParent, null, "ui-state-active" );
+
+		if ( event && event.type === "keydown" ) {
+			this._close();
+		} else {
+			this.timer = this._delay( function() {
+				this._close();
+			}, this.delay );
+		}
+
+		nested = item.children( ".ui-menu" );
+		if ( nested.length && event && ( /^mouse/.test( event.type ) ) ) {
+			this._startOpening( nested );
+		}
+		this.activeMenu = item.parent();
+
+		this._trigger( "focus", event, { item: item } );
+	},
+
+	_scrollIntoView: function( item ) {
+		var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight;
+		if ( this._hasScroll() ) {
+			borderTop = parseFloat( $.css( this.activeMenu[ 0 ], "borderTopWidth" ) ) || 0;
+			paddingTop = parseFloat( $.css( this.activeMenu[ 0 ], "paddingTop" ) ) || 0;
+			offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop;
+			scroll = this.activeMenu.scrollTop();
+			elementHeight = this.activeMenu.height();
+			itemHeight = item.outerHeight();
+
+			if ( offset < 0 ) {
+				this.activeMenu.scrollTop( scroll + offset );
+			} else if ( offset + itemHeight > elementHeight ) {
+				this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight );
+			}
+		}
+	},
+
+	blur: function( event, fromFocus ) {
+		if ( !fromFocus ) {
+			clearTimeout( this.timer );
+		}
+
+		if ( !this.active ) {
+			return;
+		}
+
+		this._removeClass( this.active.children( ".ui-menu-item-wrapper" ),
+			null, "ui-state-active" );
+
+		this._trigger( "blur", event, { item: this.active } );
+		this.active = null;
+	},
+
+	_startOpening: function( submenu ) {
+		clearTimeout( this.timer );
+
+		// Don't open if already open fixes a Firefox bug that caused a .5 pixel
+		// shift in the submenu position when mousing over the caret icon
+		if ( submenu.attr( "aria-hidden" ) !== "true" ) {
+			return;
+		}
+
+		this.timer = this._delay( function() {
+			this._close();
+			this._open( submenu );
+		}, this.delay );
+	},
+
+	_open: function( submenu ) {
+		var position = $.extend( {
+			of: this.active
+		}, this.options.position );
+
+		clearTimeout( this.timer );
+		this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) )
+			.hide()
+			.attr( "aria-hidden", "true" );
+
+		submenu
+			.show()
+			.removeAttr( "aria-hidden" )
+			.attr( "aria-expanded", "true" )
+			.position( position );
+	},
+
+	collapseAll: function( event, all ) {
+		clearTimeout( this.timer );
+		this.timer = this._delay( function() {
+
+			// If we were passed an event, look for the submenu that contains the event
+			var currentMenu = all ? this.element :
+				$( event && event.target ).closest( this.element.find( ".ui-menu" ) );
+
+			// If we found no valid submenu ancestor, use the main menu to close all
+			// sub menus anyway
+			if ( !currentMenu.length ) {
+				currentMenu = this.element;
+			}
+
+			this._close( currentMenu );
+
+			this.blur( event );
+
+			// Work around active item staying active after menu is blurred
+			this._removeClass( currentMenu.find( ".ui-state-active" ), null, "ui-state-active" );
+
+			this.activeMenu = currentMenu;
+		}, this.delay );
+	},
+
+	// With no arguments, closes the currently active menu - if nothing is active
+	// it closes all menus.  If passed an argument, it will search for menus BELOW
+	_close: function( startMenu ) {
+		if ( !startMenu ) {
+			startMenu = this.active ? this.active.parent() : this.element;
+		}
+
+		startMenu.find( ".ui-menu" )
+			.hide()
+			.attr( "aria-hidden", "true" )
+			.attr( "aria-expanded", "false" );
+	},
+
+	_closeOnDocumentClick: function( event ) {
+		return !$( event.target ).closest( ".ui-menu" ).length;
+	},
+
+	_isDivider: function( item ) {
+
+		// Match hyphen, em dash, en dash
+		return !/[^\-\u2014\u2013\s]/.test( item.text() );
+	},
+
+	collapse: function( event ) {
+		var newItem = this.active &&
+			this.active.parent().closest( ".ui-menu-item", this.element );
+		if ( newItem && newItem.length ) {
+			this._close();
+			this.focus( event, newItem );
+		}
+	},
+
+	expand: function( event ) {
+		var newItem = this.active &&
+			this.active
+				.children( ".ui-menu " )
+					.find( this.options.items )
+						.first();
+
+		if ( newItem && newItem.length ) {
+			this._open( newItem.parent() );
+
+			// Delay so Firefox will not hide activedescendant change in expanding submenu from AT
+			this._delay( function() {
+				this.focus( event, newItem );
+			} );
+		}
+	},
+
+	next: function( event ) {
+		this._move( "next", "first", event );
+	},
+
+	previous: function( event ) {
+		this._move( "prev", "last", event );
+	},
+
+	isFirstItem: function() {
+		return this.active && !this.active.prevAll( ".ui-menu-item" ).length;
+	},
+
+	isLastItem: function() {
+		return this.active && !this.active.nextAll( ".ui-menu-item" ).length;
+	},
+
+	_move: function( direction, filter, event ) {
+		var next;
+		if ( this.active ) {
+			if ( direction === "first" || direction === "last" ) {
+				next = this.active
+					[ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" )
+					.eq( -1 );
+			} else {
+				next = this.active
+					[ direction + "All" ]( ".ui-menu-item" )
+					.eq( 0 );
+			}
+		}
+		if ( !next || !next.length || !this.active ) {
+			next = this.activeMenu.find( this.options.items )[ filter ]();
+		}
+
+		this.focus( event, next );
+	},
+
+	nextPage: function( event ) {
+		var item, base, height;
+
+		if ( !this.active ) {
+			this.next( event );
+			return;
+		}
+		if ( this.isLastItem() ) {
+			return;
+		}
+		if ( this._hasScroll() ) {
+			base = this.active.offset().top;
+			height = this.element.height();
+			this.active.nextAll( ".ui-menu-item" ).each( function() {
+				item = $( this );
+				return item.offset().top - base - height < 0;
+			} );
+
+			this.focus( event, item );
+		} else {
+			this.focus( event, this.activeMenu.find( this.options.items )
+				[ !this.active ? "first" : "last" ]() );
+		}
+	},
+
+	previousPage: function( event ) {
+		var item, base, height;
+		if ( !this.active ) {
+			this.next( event );
+			return;
+		}
+		if ( this.isFirstItem() ) {
+			return;
+		}
+		if ( this._hasScroll() ) {
+			base = this.active.offset().top;
+			height = this.element.height();
+			this.active.prevAll( ".ui-menu-item" ).each( function() {
+				item = $( this );
+				return item.offset().top - base + height > 0;
+			} );
+
+			this.focus( event, item );
+		} else {
+			this.focus( event, this.activeMenu.find( this.options.items ).first() );
+		}
+	},
+
+	_hasScroll: function() {
+		return this.element.outerHeight() < this.element.prop( "scrollHeight" );
+	},
+
+	select: function( event ) {
+
+		// TODO: It should never be possible to not have an active item at this
+		// point, but the tests don't trigger mouseenter before click.
+		this.active = this.active || $( event.target ).closest( ".ui-menu-item" );
+		var ui = { item: this.active };
+		if ( !this.active.has( ".ui-menu" ).length ) {
+			this.collapseAll( event, true );
+		}
+		this._trigger( "select", event, ui );
+	},
+
+	_filterMenuItems: function( character ) {
+		var escapedCharacter = character.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ),
+			regex = new RegExp( "^" + escapedCharacter, "i" );
+
+		return this.activeMenu
+			.find( this.options.items )
+
+				// Only match on items, not dividers or other content (#10571)
+				.filter( ".ui-menu-item" )
+					.filter( function() {
+						return regex.test(
+							$.trim( $( this ).children( ".ui-menu-item-wrapper" ).text() ) );
+					} );
+	}
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/menu.min.js b/wp-includes/js/jquery/ui/menu.min.js
index b6a82fc25e..194c247e25 100644
--- a/wp-includes/js/jquery/ui/menu.min.js
+++ b/wp-includes/js/jquery/ui/menu.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Menu 1.11.4
+ * jQuery UI Menu 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/menu/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./position"],e):e(jQuery)}(function(o){return o.widget("ui.menu",{version:"1.11.4",defaultElement:"<ul>",delay:300,options:{icons:{submenu:"ui-icon-carat-1-e"},items:"> *",menus:"ul",position:{my:"left-1 top",at:"right top"},role:"menu",blur:null,focus:null,select:null},_create:function(){this.activeMenu=this.element,this.mouseHandled=!1,this.element.uniqueId().addClass("ui-menu ui-widget ui-widget-content").toggleClass("ui-menu-icons",!!this.element.find(".ui-icon").length).attr({role:this.options.role,tabIndex:0}),this.options.disabled&&this.element.addClass("ui-state-disabled").attr("aria-disabled","true"),this._on({"mousedown .ui-menu-item":function(e){e.preventDefault()},"click .ui-menu-item":function(e){var t=o(e.target);!this.mouseHandled&&t.not(".ui-state-disabled").length&&(this.select(e),e.isPropagationStopped()||(this.mouseHandled=!0),t.has(".ui-menu").length?this.expand(e):!this.element.is(":focus")&&o(this.document[0].activeElement).closest(".ui-menu").length&&(this.element.trigger("focus",[!0]),this.active&&1===this.active.parents(".ui-menu").length&&clearTimeout(this.timer)))},"mouseenter .ui-menu-item":function(e){if(!this.previousFilter){var t=o(e.currentTarget);t.siblings(".ui-state-active").removeClass("ui-state-active"),this.focus(e,t)}},mouseleave:"collapseAll","mouseleave .ui-menu":"collapseAll",focus:function(e,t){var i=this.active||this.element.find(this.options.items).eq(0);t||this.focus(e,i)},blur:function(e){this._delay(function(){o.contains(this.element[0],this.document[0].activeElement)||this.collapseAll(e)})},keydown:"_keydown"}),this.refresh(),this._on(this.document,{click:function(e){this._closeOnDocumentClick(e)&&this.collapseAll(e),this.mouseHandled=!1}})},_destroy:function(){this.element.removeAttr("aria-activedescendant").find(".ui-menu").addBack().removeClass("ui-menu ui-widget ui-widget-content ui-menu-icons ui-front").removeAttr("role").removeAttr("tabIndex").removeAttr("aria-labelledby").removeAttr("aria-expanded").removeAttr("aria-hidden").removeAttr("aria-disabled").removeUniqueId().show(),this.element.find(".ui-menu-item").removeClass("ui-menu-item").removeAttr("role").removeAttr("aria-disabled").removeUniqueId().removeClass("ui-state-hover").removeAttr("tabIndex").removeAttr("role").removeAttr("aria-haspopup").children().each(function(){var e=o(this);e.data("ui-menu-submenu-carat")&&e.remove()}),this.element.find(".ui-menu-divider").removeClass("ui-menu-divider ui-widget-content")},_keydown:function(e){var t,i,s,n,a=!0;switch(e.keyCode){case o.ui.keyCode.PAGE_UP:this.previousPage(e);break;case o.ui.keyCode.PAGE_DOWN:this.nextPage(e);break;case o.ui.keyCode.HOME:this._move("first","first",e);break;case o.ui.keyCode.END:this._move("last","last",e);break;case o.ui.keyCode.UP:this.previous(e);break;case o.ui.keyCode.DOWN:this.next(e);break;case o.ui.keyCode.LEFT:this.collapse(e);break;case o.ui.keyCode.RIGHT:this.active&&!this.active.is(".ui-state-disabled")&&this.expand(e);break;case o.ui.keyCode.ENTER:case o.ui.keyCode.SPACE:this._activate(e);break;case o.ui.keyCode.ESCAPE:this.collapse(e);break;default:a=!1,i=this.previousFilter||"",s=String.fromCharCode(e.keyCode),n=!1,clearTimeout(this.filterTimer),s===i?n=!0:s=i+s,t=this._filterMenuItems(s),(t=n&&-1!==t.index(this.active.next())?this.active.nextAll(".ui-menu-item"):t).length||(s=String.fromCharCode(e.keyCode),t=this._filterMenuItems(s)),t.length?(this.focus(e,t),this.previousFilter=s,this.filterTimer=this._delay(function(){delete this.previousFilter},1e3)):delete this.previousFilter}a&&e.preventDefault()},_activate:function(e){this.active.is(".ui-state-disabled")||(this.active.is("[aria-haspopup='true']")?this.expand(e):this.select(e))},refresh:function(){var e,t=this,s=this.options.icons.submenu,i=this.element.find(this.options.menus);this.element.toggleClass("ui-menu-icons",!!this.element.find(".ui-icon").length),i.filter(":not(.ui-menu)").addClass("ui-menu ui-widget ui-widget-content ui-front").hide().attr({role:this.options.role,"aria-hidden":"true","aria-expanded":"false"}).each(function(){var e=o(this),t=e.parent(),i=o("<span>").addClass("ui-menu-icon ui-icon "+s).data("ui-menu-submenu-carat",!0);t.attr("aria-haspopup","true").prepend(i),e.attr("aria-labelledby",t.attr("id"))}),(e=i.add(this.element).find(this.options.items)).not(".ui-menu-item").each(function(){var e=o(this);t._isDivider(e)&&e.addClass("ui-widget-content ui-menu-divider")}),e.not(".ui-menu-item, .ui-menu-divider").addClass("ui-menu-item").uniqueId().attr({tabIndex:-1,role:this._itemRole()}),e.filter(".ui-state-disabled").attr("aria-disabled","true"),this.active&&!o.contains(this.element[0],this.active[0])&&this.blur()},_itemRole:function(){return{menu:"menuitem",listbox:"option"}[this.options.role]},_setOption:function(e,t){"icons"===e&&this.element.find(".ui-menu-icon").removeClass(this.options.icons.submenu).addClass(t.submenu),"disabled"===e&&this.element.toggleClass("ui-state-disabled",!!t).attr("aria-disabled",t),this._super(e,t)},focus:function(e,t){var i,s;this.blur(e,e&&"focus"===e.type),this._scrollIntoView(t),this.active=t.first(),s=this.active.addClass("ui-state-focus").removeClass("ui-state-active"),this.options.role&&this.element.attr("aria-activedescendant",s.attr("id")),this.active.parent().closest(".ui-menu-item").addClass("ui-state-active"),e&&"keydown"===e.type?this._close():this.timer=this._delay(function(){this._close()},this.delay),(i=t.children(".ui-menu")).length&&e&&/^mouse/.test(e.type)&&this._startOpening(i),this.activeMenu=t.parent(),this._trigger("focus",e,{item:t})},_scrollIntoView:function(e){var t,i,s,n,a,u;this._hasScroll()&&(t=parseFloat(o.css(this.activeMenu[0],"borderTopWidth"))||0,i=parseFloat(o.css(this.activeMenu[0],"paddingTop"))||0,s=e.offset().top-this.activeMenu.offset().top-t-i,n=this.activeMenu.scrollTop(),a=this.activeMenu.height(),u=e.outerHeight(),s<0?this.activeMenu.scrollTop(n+s):a<s+u&&this.activeMenu.scrollTop(n+s-a+u))},blur:function(e,t){t||clearTimeout(this.timer),this.active&&(this.active.removeClass("ui-state-focus"),this.active=null,this._trigger("blur",e,{item:this.active}))},_startOpening:function(e){clearTimeout(this.timer),"true"===e.attr("aria-hidden")&&(this.timer=this._delay(function(){this._close(),this._open(e)},this.delay))},_open:function(e){var t=o.extend({of:this.active},this.options.position);clearTimeout(this.timer),this.element.find(".ui-menu").not(e.parents(".ui-menu")).hide().attr("aria-hidden","true"),e.show().removeAttr("aria-hidden").attr("aria-expanded","true").position(t)},collapseAll:function(t,i){clearTimeout(this.timer),this.timer=this._delay(function(){var e=i?this.element:o(t&&t.target).closest(this.element.find(".ui-menu"));e.length||(e=this.element),this._close(e),this.blur(t),this.activeMenu=e},this.delay)},_close:function(e){(e=e||(this.active?this.active.parent():this.element)).find(".ui-menu").hide().attr("aria-hidden","true").attr("aria-expanded","false").end().find(".ui-state-active").not(".ui-state-focus").removeClass("ui-state-active")},_closeOnDocumentClick:function(e){return!o(e.target).closest(".ui-menu").length},_isDivider:function(e){return!/[^\-\u2014\u2013\s]/.test(e.text())},collapse:function(e){var t=this.active&&this.active.parent().closest(".ui-menu-item",this.element);t&&t.length&&(this._close(),this.focus(e,t))},expand:function(e){var t=this.active&&this.active.children(".ui-menu ").find(this.options.items).first();t&&t.length&&(this._open(t.parent()),this._delay(function(){this.focus(e,t)}))},next:function(e){this._move("next","first",e)},previous:function(e){this._move("prev","last",e)},isFirstItem:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},isLastItem:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},_move:function(e,t,i){var s;this.active&&(s="first"===e||"last"===e?this.active["first"===e?"prevAll":"nextAll"](".ui-menu-item").eq(-1):this.active[e+"All"](".ui-menu-item").eq(0)),s&&s.length&&this.active||(s=this.activeMenu.find(this.options.items)[t]()),this.focus(i,s)},nextPage:function(e){var t,i,s;this.active?this.isLastItem()||(this._hasScroll()?(i=this.active.offset().top,s=this.element.height(),this.active.nextAll(".ui-menu-item").each(function(){return(t=o(this)).offset().top-i-s<0}),this.focus(e,t)):this.focus(e,this.activeMenu.find(this.options.items)[this.active?"last":"first"]())):this.next(e)},previousPage:function(e){var t,i,s;this.active?this.isFirstItem()||(this._hasScroll()?(i=this.active.offset().top,s=this.element.height(),this.active.prevAll(".ui-menu-item").each(function(){return 0<(t=o(this)).offset().top-i+s}),this.focus(e,t)):this.focus(e,this.activeMenu.find(this.options.items).first())):this.next(e)},_hasScroll:function(){return this.element.outerHeight()<this.element.prop("scrollHeight")},select:function(e){this.active=this.active||o(e.target).closest(".ui-menu-item");var t={item:this.active};this.active.has(".ui-menu").length||this.collapseAll(e,!0),this._trigger("select",e,t)},_filterMenuItems:function(e){var t=e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&"),i=new RegExp("^"+t,"i");return this.activeMenu.find(this.options.items).filter(".ui-menu-item").filter(function(){return i.test(o.trim(o(this).text()))})}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(o){return o.widget("ui.menu",{version:"1.12.1",defaultElement:"<ul>",delay:300,options:{icons:{submenu:"ui-icon-caret-1-e"},items:"> *",menus:"ul",position:{my:"left top",at:"right top"},role:"menu",blur:null,focus:null,select:null},_create:function(){this.activeMenu=this.element,this.mouseHandled=!1,this.element.uniqueId().attr({role:this.options.role,tabIndex:0}),this._addClass("ui-menu","ui-widget ui-widget-content"),this._on({"mousedown .ui-menu-item":function(e){e.preventDefault()},"click .ui-menu-item":function(e){var t=o(e.target),i=o(o.ui.safeActiveElement(this.document[0]));!this.mouseHandled&&t.not(".ui-state-disabled").length&&(this.select(e),e.isPropagationStopped()||(this.mouseHandled=!0),t.has(".ui-menu").length?this.expand(e):!this.element.is(":focus")&&i.closest(".ui-menu").length&&(this.element.trigger("focus",[!0]),this.active&&1===this.active.parents(".ui-menu").length&&clearTimeout(this.timer)))},"mouseenter .ui-menu-item":function(e){if(!this.previousFilter){var t=o(e.target).closest(".ui-menu-item"),i=o(e.currentTarget);t[0]===i[0]&&(this._removeClass(i.siblings().children(".ui-state-active"),null,"ui-state-active"),this.focus(e,i))}},mouseleave:"collapseAll","mouseleave .ui-menu":"collapseAll",focus:function(e,t){var i=this.active||this.element.find(this.options.items).eq(0);t||this.focus(e,i)},blur:function(e){this._delay(function(){o.contains(this.element[0],o.ui.safeActiveElement(this.document[0]))||this.collapseAll(e)})},keydown:"_keydown"}),this.refresh(),this._on(this.document,{click:function(e){this._closeOnDocumentClick(e)&&this.collapseAll(e),this.mouseHandled=!1}})},_destroy:function(){var e=this.element.find(".ui-menu-item").removeAttr("role aria-disabled").children(".ui-menu-item-wrapper").removeUniqueId().removeAttr("tabIndex role aria-haspopup");this.element.removeAttr("aria-activedescendant").find(".ui-menu").addBack().removeAttr("role aria-labelledby aria-expanded aria-hidden aria-disabled tabIndex").removeUniqueId().show(),e.children().each(function(){var e=o(this);e.data("ui-menu-submenu-caret")&&e.remove()})},_keydown:function(e){var t,i,s,n,a=!0;switch(e.keyCode){case o.ui.keyCode.PAGE_UP:this.previousPage(e);break;case o.ui.keyCode.PAGE_DOWN:this.nextPage(e);break;case o.ui.keyCode.HOME:this._move("first","first",e);break;case o.ui.keyCode.END:this._move("last","last",e);break;case o.ui.keyCode.UP:this.previous(e);break;case o.ui.keyCode.DOWN:this.next(e);break;case o.ui.keyCode.LEFT:this.collapse(e);break;case o.ui.keyCode.RIGHT:this.active&&!this.active.is(".ui-state-disabled")&&this.expand(e);break;case o.ui.keyCode.ENTER:case o.ui.keyCode.SPACE:this._activate(e);break;case o.ui.keyCode.ESCAPE:this.collapse(e);break;default:a=!1,i=this.previousFilter||"",n=!1,s=96<=e.keyCode&&e.keyCode<=105?(e.keyCode-96).toString():String.fromCharCode(e.keyCode),clearTimeout(this.filterTimer),s===i?n=!0:s=i+s,t=this._filterMenuItems(s),(t=n&&-1!==t.index(this.active.next())?this.active.nextAll(".ui-menu-item"):t).length||(s=String.fromCharCode(e.keyCode),t=this._filterMenuItems(s)),t.length?(this.focus(e,t),this.previousFilter=s,this.filterTimer=this._delay(function(){delete this.previousFilter},1e3)):delete this.previousFilter}a&&e.preventDefault()},_activate:function(e){this.active&&!this.active.is(".ui-state-disabled")&&(this.active.children("[aria-haspopup='true']").length?this.expand(e):this.select(e))},refresh:function(){var e,t,i,s,n=this,a=this.options.icons.submenu,u=this.element.find(this.options.menus);this._toggleClass("ui-menu-icons",null,!!this.element.find(".ui-icon").length),t=u.filter(":not(.ui-menu)").hide().attr({role:this.options.role,"aria-hidden":"true","aria-expanded":"false"}).each(function(){var e=o(this),t=e.prev(),i=o("<span>").data("ui-menu-submenu-caret",!0);n._addClass(i,"ui-menu-icon","ui-icon "+a),t.attr("aria-haspopup","true").prepend(i),e.attr("aria-labelledby",t.attr("id"))}),this._addClass(t,"ui-menu","ui-widget ui-widget-content ui-front"),(e=u.add(this.element).find(this.options.items)).not(".ui-menu-item").each(function(){var e=o(this);n._isDivider(e)&&n._addClass(e,"ui-menu-divider","ui-widget-content")}),s=(i=e.not(".ui-menu-item, .ui-menu-divider")).children().not(".ui-menu").uniqueId().attr({tabIndex:-1,role:this._itemRole()}),this._addClass(i,"ui-menu-item")._addClass(s,"ui-menu-item-wrapper"),e.filter(".ui-state-disabled").attr("aria-disabled","true"),this.active&&!o.contains(this.element[0],this.active[0])&&this.blur()},_itemRole:function(){return{menu:"menuitem",listbox:"option"}[this.options.role]},_setOption:function(e,t){if("icons"===e){var i=this.element.find(".ui-menu-icon");this._removeClass(i,null,this.options.icons.submenu)._addClass(i,null,t.submenu)}this._super(e,t)},_setOptionDisabled:function(e){this._super(e),this.element.attr("aria-disabled",String(e)),this._toggleClass(null,"ui-state-disabled",!!e)},focus:function(e,t){var i,s,n;this.blur(e,e&&"focus"===e.type),this._scrollIntoView(t),this.active=t.first(),s=this.active.children(".ui-menu-item-wrapper"),this._addClass(s,null,"ui-state-active"),this.options.role&&this.element.attr("aria-activedescendant",s.attr("id")),n=this.active.parent().closest(".ui-menu-item").children(".ui-menu-item-wrapper"),this._addClass(n,null,"ui-state-active"),e&&"keydown"===e.type?this._close():this.timer=this._delay(function(){this._close()},this.delay),(i=t.children(".ui-menu")).length&&e&&/^mouse/.test(e.type)&&this._startOpening(i),this.activeMenu=t.parent(),this._trigger("focus",e,{item:t})},_scrollIntoView:function(e){var t,i,s,n,a,u;this._hasScroll()&&(t=parseFloat(o.css(this.activeMenu[0],"borderTopWidth"))||0,i=parseFloat(o.css(this.activeMenu[0],"paddingTop"))||0,s=e.offset().top-this.activeMenu.offset().top-t-i,n=this.activeMenu.scrollTop(),a=this.activeMenu.height(),u=e.outerHeight(),s<0?this.activeMenu.scrollTop(n+s):a<s+u&&this.activeMenu.scrollTop(n+s-a+u))},blur:function(e,t){t||clearTimeout(this.timer),this.active&&(this._removeClass(this.active.children(".ui-menu-item-wrapper"),null,"ui-state-active"),this._trigger("blur",e,{item:this.active}),this.active=null)},_startOpening:function(e){clearTimeout(this.timer),"true"===e.attr("aria-hidden")&&(this.timer=this._delay(function(){this._close(),this._open(e)},this.delay))},_open:function(e){var t=o.extend({of:this.active},this.options.position);clearTimeout(this.timer),this.element.find(".ui-menu").not(e.parents(".ui-menu")).hide().attr("aria-hidden","true"),e.show().removeAttr("aria-hidden").attr("aria-expanded","true").position(t)},collapseAll:function(t,i){clearTimeout(this.timer),this.timer=this._delay(function(){var e=i?this.element:o(t&&t.target).closest(this.element.find(".ui-menu"));e.length||(e=this.element),this._close(e),this.blur(t),this._removeClass(e.find(".ui-state-active"),null,"ui-state-active"),this.activeMenu=e},this.delay)},_close:function(e){(e=e||(this.active?this.active.parent():this.element)).find(".ui-menu").hide().attr("aria-hidden","true").attr("aria-expanded","false")},_closeOnDocumentClick:function(e){return!o(e.target).closest(".ui-menu").length},_isDivider:function(e){return!/[^\-\u2014\u2013\s]/.test(e.text())},collapse:function(e){var t=this.active&&this.active.parent().closest(".ui-menu-item",this.element);t&&t.length&&(this._close(),this.focus(e,t))},expand:function(e){var t=this.active&&this.active.children(".ui-menu ").find(this.options.items).first();t&&t.length&&(this._open(t.parent()),this._delay(function(){this.focus(e,t)}))},next:function(e){this._move("next","first",e)},previous:function(e){this._move("prev","last",e)},isFirstItem:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},isLastItem:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},_move:function(e,t,i){var s;this.active&&(s="first"===e||"last"===e?this.active["first"===e?"prevAll":"nextAll"](".ui-menu-item").eq(-1):this.active[e+"All"](".ui-menu-item").eq(0)),s&&s.length&&this.active||(s=this.activeMenu.find(this.options.items)[t]()),this.focus(i,s)},nextPage:function(e){var t,i,s;this.active?this.isLastItem()||(this._hasScroll()?(i=this.active.offset().top,s=this.element.height(),this.active.nextAll(".ui-menu-item").each(function(){return(t=o(this)).offset().top-i-s<0}),this.focus(e,t)):this.focus(e,this.activeMenu.find(this.options.items)[this.active?"last":"first"]())):this.next(e)},previousPage:function(e){var t,i,s;this.active?this.isFirstItem()||(this._hasScroll()?(i=this.active.offset().top,s=this.element.height(),this.active.prevAll(".ui-menu-item").each(function(){return 0<(t=o(this)).offset().top-i+s}),this.focus(e,t)):this.focus(e,this.activeMenu.find(this.options.items).first())):this.next(e)},_hasScroll:function(){return this.element.outerHeight()<this.element.prop("scrollHeight")},select:function(e){this.active=this.active||o(e.target).closest(".ui-menu-item");var t={item:this.active};this.active.has(".ui-menu").length||this.collapseAll(e,!0),this._trigger("select",e,t)},_filterMenuItems:function(e){var t=e.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g,"\\$&"),i=new RegExp("^"+t,"i");return this.activeMenu.find(this.options.items).filter(".ui-menu-item").filter(function(){return i.test(o.trim(o(this).children(".ui-menu-item-wrapper").text()))})}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/mouse.js b/wp-includes/js/jquery/ui/mouse.js
new file mode 100644
index 0000000000..54f5e48bc4
--- /dev/null
+++ b/wp-includes/js/jquery/ui/mouse.js
@@ -0,0 +1,224 @@
+/*!
+ * jQuery UI Mouse 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Mouse
+//>>group: Widgets
+//>>description: Abstracts mouse-based interactions to assist in creating certain widgets.
+//>>docs: http://api.jqueryui.com/mouse/
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+var mouseHandled = false;
+$( document ).on( "mouseup", function() {
+	mouseHandled = false;
+} );
+
+return $.widget( "ui.mouse", {
+	version: "1.12.1",
+	options: {
+		cancel: "input, textarea, button, select, option",
+		distance: 1,
+		delay: 0
+	},
+	_mouseInit: function() {
+		var that = this;
+
+		this.element
+			.on( "mousedown." + this.widgetName, function( event ) {
+				return that._mouseDown( event );
+			} )
+			.on( "click." + this.widgetName, function( event ) {
+				if ( true === $.data( event.target, that.widgetName + ".preventClickEvent" ) ) {
+					$.removeData( event.target, that.widgetName + ".preventClickEvent" );
+					event.stopImmediatePropagation();
+					return false;
+				}
+			} );
+
+		this.started = false;
+	},
+
+	// TODO: make sure destroying one instance of mouse doesn't mess with
+	// other instances of mouse
+	_mouseDestroy: function() {
+		this.element.off( "." + this.widgetName );
+		if ( this._mouseMoveDelegate ) {
+			this.document
+				.off( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+				.off( "mouseup." + this.widgetName, this._mouseUpDelegate );
+		}
+	},
+
+	_mouseDown: function( event ) {
+
+		// don't let more than one widget handle mouseStart
+		if ( mouseHandled ) {
+			return;
+		}
+
+		this._mouseMoved = false;
+
+		// We may have missed mouseup (out of window)
+		( this._mouseStarted && this._mouseUp( event ) );
+
+		this._mouseDownEvent = event;
+
+		var that = this,
+			btnIsLeft = ( event.which === 1 ),
+
+			// event.target.nodeName works around a bug in IE 8 with
+			// disabled inputs (#7620)
+			elIsCancel = ( typeof this.options.cancel === "string" && event.target.nodeName ?
+				$( event.target ).closest( this.options.cancel ).length : false );
+		if ( !btnIsLeft || elIsCancel || !this._mouseCapture( event ) ) {
+			return true;
+		}
+
+		this.mouseDelayMet = !this.options.delay;
+		if ( !this.mouseDelayMet ) {
+			this._mouseDelayTimer = setTimeout( function() {
+				that.mouseDelayMet = true;
+			}, this.options.delay );
+		}
+
+		if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) {
+			this._mouseStarted = ( this._mouseStart( event ) !== false );
+			if ( !this._mouseStarted ) {
+				event.preventDefault();
+				return true;
+			}
+		}
+
+		// Click event may never have fired (Gecko & Opera)
+		if ( true === $.data( event.target, this.widgetName + ".preventClickEvent" ) ) {
+			$.removeData( event.target, this.widgetName + ".preventClickEvent" );
+		}
+
+		// These delegates are required to keep context
+		this._mouseMoveDelegate = function( event ) {
+			return that._mouseMove( event );
+		};
+		this._mouseUpDelegate = function( event ) {
+			return that._mouseUp( event );
+		};
+
+		this.document
+			.on( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+			.on( "mouseup." + this.widgetName, this._mouseUpDelegate );
+
+		event.preventDefault();
+
+		mouseHandled = true;
+		return true;
+	},
+
+	_mouseMove: function( event ) {
+
+		// Only check for mouseups outside the document if you've moved inside the document
+		// at least once. This prevents the firing of mouseup in the case of IE<9, which will
+		// fire a mousemove event if content is placed under the cursor. See #7778
+		// Support: IE <9
+		if ( this._mouseMoved ) {
+
+			// IE mouseup check - mouseup happened when mouse was out of window
+			if ( $.ui.ie && ( !document.documentMode || document.documentMode < 9 ) &&
+					!event.button ) {
+				return this._mouseUp( event );
+
+			// Iframe mouseup check - mouseup occurred in another document
+			} else if ( !event.which ) {
+
+				// Support: Safari <=8 - 9
+				// Safari sets which to 0 if you press any of the following keys
+				// during a drag (#14461)
+				if ( event.originalEvent.altKey || event.originalEvent.ctrlKey ||
+						event.originalEvent.metaKey || event.originalEvent.shiftKey ) {
+					this.ignoreMissingWhich = true;
+				} else if ( !this.ignoreMissingWhich ) {
+					return this._mouseUp( event );
+				}
+			}
+		}
+
+		if ( event.which || event.button ) {
+			this._mouseMoved = true;
+		}
+
+		if ( this._mouseStarted ) {
+			this._mouseDrag( event );
+			return event.preventDefault();
+		}
+
+		if ( this._mouseDistanceMet( event ) && this._mouseDelayMet( event ) ) {
+			this._mouseStarted =
+				( this._mouseStart( this._mouseDownEvent, event ) !== false );
+			( this._mouseStarted ? this._mouseDrag( event ) : this._mouseUp( event ) );
+		}
+
+		return !this._mouseStarted;
+	},
+
+	_mouseUp: function( event ) {
+		this.document
+			.off( "mousemove." + this.widgetName, this._mouseMoveDelegate )
+			.off( "mouseup." + this.widgetName, this._mouseUpDelegate );
+
+		if ( this._mouseStarted ) {
+			this._mouseStarted = false;
+
+			if ( event.target === this._mouseDownEvent.target ) {
+				$.data( event.target, this.widgetName + ".preventClickEvent", true );
+			}
+
+			this._mouseStop( event );
+		}
+
+		if ( this._mouseDelayTimer ) {
+			clearTimeout( this._mouseDelayTimer );
+			delete this._mouseDelayTimer;
+		}
+
+		this.ignoreMissingWhich = false;
+		mouseHandled = false;
+		event.preventDefault();
+	},
+
+	_mouseDistanceMet: function( event ) {
+		return ( Math.max(
+				Math.abs( this._mouseDownEvent.pageX - event.pageX ),
+				Math.abs( this._mouseDownEvent.pageY - event.pageY )
+			) >= this.options.distance
+		);
+	},
+
+	_mouseDelayMet: function( /* event */ ) {
+		return this.mouseDelayMet;
+	},
+
+	// These are placeholder methods, to be overriden by extending plugin
+	_mouseStart: function( /* event */ ) {},
+	_mouseDrag: function( /* event */ ) {},
+	_mouseStop: function( /* event */ ) {},
+	_mouseCapture: function( /* event */ ) { return true; }
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/mouse.min.js b/wp-includes/js/jquery/ui/mouse.min.js
index d9849c728a..310870e394 100644
--- a/wp-includes/js/jquery/ui/mouse.min.js
+++ b/wp-includes/js/jquery/ui/mouse.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Mouse 1.11.4
+ * jQuery UI Mouse 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/mouse/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./widget"],e):e(jQuery)}(function(o){var u=!1;return o(document).mouseup(function(){u=!1}),o.widget("ui.mouse",{version:"1.11.4",options:{cancel:"input,textarea,button,select,option",distance:1,delay:0},_mouseInit:function(){var t=this;this.element.bind("mousedown."+this.widgetName,function(e){return t._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(!0===o.data(e.target,t.widgetName+".preventClickEvent"))return o.removeData(e.target,t.widgetName+".preventClickEvent"),e.stopImmediatePropagation(),!1}),this.started=!1},_mouseDestroy:function(){this.element.unbind("."+this.widgetName),this._mouseMoveDelegate&&this.document.unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate)},_mouseDown:function(e){if(!u){this._mouseMoved=!1,this._mouseStarted&&this._mouseUp(e),this._mouseDownEvent=e;var t=this,s=1===e.which,i=!("string"!=typeof this.options.cancel||!e.target.nodeName)&&o(e.target).closest(this.options.cancel).length;return!(s&&!i&&this._mouseCapture(e))||(this.mouseDelayMet=!this.options.delay,this.mouseDelayMet||(this._mouseDelayTimer=setTimeout(function(){t.mouseDelayMet=!0},this.options.delay)),this._mouseDistanceMet(e)&&this._mouseDelayMet(e)&&(this._mouseStarted=!1!==this._mouseStart(e),!this._mouseStarted)?(e.preventDefault(),!0):(!0===o.data(e.target,this.widgetName+".preventClickEvent")&&o.removeData(e.target,this.widgetName+".preventClickEvent"),this._mouseMoveDelegate=function(e){return t._mouseMove(e)},this._mouseUpDelegate=function(e){return t._mouseUp(e)},this.document.bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate),e.preventDefault(),u=!0))}},_mouseMove:function(e){if(this._mouseMoved){if(o.ui.ie&&(!document.documentMode||document.documentMode<9)&&!e.button)return this._mouseUp(e);if(!e.which)return this._mouseUp(e)}return(e.which||e.button)&&(this._mouseMoved=!0),this._mouseStarted?(this._mouseDrag(e),e.preventDefault()):(this._mouseDistanceMet(e)&&this._mouseDelayMet(e)&&(this._mouseStarted=!1!==this._mouseStart(this._mouseDownEvent,e),this._mouseStarted?this._mouseDrag(e):this._mouseUp(e)),!this._mouseStarted)},_mouseUp:function(e){return this.document.unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,e.target===this._mouseDownEvent.target&&o.data(e.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(e)),u=!1},_mouseDistanceMet:function(e){return Math.max(Math.abs(this._mouseDownEvent.pageX-e.pageX),Math.abs(this._mouseDownEvent.pageY-e.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return!0}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(o){var n=!1;return o(document).on("mouseup",function(){n=!1}),o.widget("ui.mouse",{version:"1.12.1",options:{cancel:"input, textarea, button, select, option",distance:1,delay:0},_mouseInit:function(){var t=this;this.element.on("mousedown."+this.widgetName,function(e){return t._mouseDown(e)}).on("click."+this.widgetName,function(e){if(!0===o.data(e.target,t.widgetName+".preventClickEvent"))return o.removeData(e.target,t.widgetName+".preventClickEvent"),e.stopImmediatePropagation(),!1}),this.started=!1},_mouseDestroy:function(){this.element.off("."+this.widgetName),this._mouseMoveDelegate&&this.document.off("mousemove."+this.widgetName,this._mouseMoveDelegate).off("mouseup."+this.widgetName,this._mouseUpDelegate)},_mouseDown:function(e){if(!n){this._mouseMoved=!1,this._mouseStarted&&this._mouseUp(e),this._mouseDownEvent=e;var t=this,i=1===e.which,s=!("string"!=typeof this.options.cancel||!e.target.nodeName)&&o(e.target).closest(this.options.cancel).length;return!(i&&!s&&this._mouseCapture(e))||(this.mouseDelayMet=!this.options.delay,this.mouseDelayMet||(this._mouseDelayTimer=setTimeout(function(){t.mouseDelayMet=!0},this.options.delay)),this._mouseDistanceMet(e)&&this._mouseDelayMet(e)&&(this._mouseStarted=!1!==this._mouseStart(e),!this._mouseStarted)?(e.preventDefault(),!0):(!0===o.data(e.target,this.widgetName+".preventClickEvent")&&o.removeData(e.target,this.widgetName+".preventClickEvent"),this._mouseMoveDelegate=function(e){return t._mouseMove(e)},this._mouseUpDelegate=function(e){return t._mouseUp(e)},this.document.on("mousemove."+this.widgetName,this._mouseMoveDelegate).on("mouseup."+this.widgetName,this._mouseUpDelegate),e.preventDefault(),n=!0))}},_mouseMove:function(e){if(this._mouseMoved){if(o.ui.ie&&(!document.documentMode||document.documentMode<9)&&!e.button)return this._mouseUp(e);if(!e.which)if(e.originalEvent.altKey||e.originalEvent.ctrlKey||e.originalEvent.metaKey||e.originalEvent.shiftKey)this.ignoreMissingWhich=!0;else if(!this.ignoreMissingWhich)return this._mouseUp(e)}return(e.which||e.button)&&(this._mouseMoved=!0),this._mouseStarted?(this._mouseDrag(e),e.preventDefault()):(this._mouseDistanceMet(e)&&this._mouseDelayMet(e)&&(this._mouseStarted=!1!==this._mouseStart(this._mouseDownEvent,e),this._mouseStarted?this._mouseDrag(e):this._mouseUp(e)),!this._mouseStarted)},_mouseUp:function(e){this.document.off("mousemove."+this.widgetName,this._mouseMoveDelegate).off("mouseup."+this.widgetName,this._mouseUpDelegate),this._mouseStarted&&(this._mouseStarted=!1,e.target===this._mouseDownEvent.target&&o.data(e.target,this.widgetName+".preventClickEvent",!0),this._mouseStop(e)),this._mouseDelayTimer&&(clearTimeout(this._mouseDelayTimer),delete this._mouseDelayTimer),this.ignoreMissingWhich=!1,n=!1,e.preventDefault()},_mouseDistanceMet:function(e){return Math.max(Math.abs(this._mouseDownEvent.pageX-e.pageX),Math.abs(this._mouseDownEvent.pageY-e.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return!0}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/position.min.js b/wp-includes/js/jquery/ui/position.min.js
deleted file mode 100644
index 227af5f34f..0000000000
--- a/wp-includes/js/jquery/ui/position.min.js
+++ /dev/null
@@ -1,11 +0,0 @@
-/*!
- * jQuery UI Position 1.11.4
- * http://jqueryui.com
- *
- * Copyright jQuery Foundation and other contributors
- * Released under the MIT license.
- * http://jquery.org/license
- *
- * http://api.jqueryui.com/position/
- */
-!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):t(jQuery)}(function(I){return function(){I.ui=I.ui||{};var n,H,x=Math.max,T=Math.abs,L=Math.round,o=/left|center|right/,l=/top|center|bottom/,f=/[\+\-]\d+(\.[\d]+)?%?/,s=/^\w+/,h=/%$/,i=I.fn.position;function P(t,i,e){return[parseFloat(t[0])*(h.test(t[0])?i/100:1),parseFloat(t[1])*(h.test(t[1])?e/100:1)]}function D(t,i){return parseInt(I.css(t,i),10)||0}I.position={scrollbarWidth:function(){if(void 0!==n)return n;var t,i,e=I("<div style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>"),o=e.children()[0];return I("body").append(e),t=o.offsetWidth,e.css("overflow","scroll"),t===(i=o.offsetWidth)&&(i=e[0].clientWidth),e.remove(),n=t-i},getScrollInfo:function(t){var i=t.isWindow||t.isDocument?"":t.element.css("overflow-x"),e=t.isWindow||t.isDocument?"":t.element.css("overflow-y"),o="scroll"===i||"auto"===i&&t.width<t.element[0].scrollWidth;return{width:"scroll"===e||"auto"===e&&t.height<t.element[0].scrollHeight?I.position.scrollbarWidth():0,height:o?I.position.scrollbarWidth():0}},getWithinInfo:function(t){var i=I(t||window),e=I.isWindow(i[0]),o=!!i[0]&&9===i[0].nodeType;return{element:i,isWindow:e,isDocument:o,offset:i.offset()||{left:0,top:0},scrollLeft:i.scrollLeft(),scrollTop:i.scrollTop(),width:e||o?i.width():i.outerWidth(),height:e||o?i.height():i.outerHeight()}}},I.fn.position=function(c){if(!c||!c.of)return i.apply(this,arguments);c=I.extend({},c);var d,a,g,u,m,t,w=I(c.of),W=I.position.getWithinInfo(c.within),v=I.position.getScrollInfo(W),y=(c.collision||"flip").split(" "),b={};return t=function(t){var i=t[0];return 9===i.nodeType?{width:t.width(),height:t.height(),offset:{top:0,left:0}}:I.isWindow(i)?{width:t.width(),height:t.height(),offset:{top:t.scrollTop(),left:t.scrollLeft()}}:i.preventDefault?{width:0,height:0,offset:{top:i.pageY,left:i.pageX}}:{width:t.outerWidth(),height:t.outerHeight(),offset:t.offset()}}(w),w[0].preventDefault&&(c.at="left top"),a=t.width,g=t.height,u=t.offset,m=I.extend({},u),I.each(["my","at"],function(){var t,i,e=(c[this]||"").split(" ");1===e.length&&(e=o.test(e[0])?e.concat(["center"]):l.test(e[0])?["center"].concat(e):["center","center"]),e[0]=o.test(e[0])?e[0]:"center",e[1]=l.test(e[1])?e[1]:"center",t=f.exec(e[0]),i=f.exec(e[1]),b[this]=[t?t[0]:0,i?i[0]:0],c[this]=[s.exec(e[0])[0],s.exec(e[1])[0]]}),1===y.length&&(y[1]=y[0]),"right"===c.at[0]?m.left+=a:"center"===c.at[0]&&(m.left+=a/2),"bottom"===c.at[1]?m.top+=g:"center"===c.at[1]&&(m.top+=g/2),d=P(b.at,a,g),m.left+=d[0],m.top+=d[1],this.each(function(){var e,t,f=I(this),s=f.outerWidth(),h=f.outerHeight(),i=D(this,"marginLeft"),o=D(this,"marginTop"),n=s+i+D(this,"marginRight")+v.width,l=h+o+D(this,"marginBottom")+v.height,r=I.extend({},m),p=P(b.my,f.outerWidth(),f.outerHeight());"right"===c.my[0]?r.left-=s:"center"===c.my[0]&&(r.left-=s/2),"bottom"===c.my[1]?r.top-=h:"center"===c.my[1]&&(r.top-=h/2),r.left+=p[0],r.top+=p[1],H||(r.left=L(r.left),r.top=L(r.top)),e={marginLeft:i,marginTop:o},I.each(["left","top"],function(t,i){I.ui.position[y[t]]&&I.ui.position[y[t]][i](r,{targetWidth:a,targetHeight:g,elemWidth:s,elemHeight:h,collisionPosition:e,collisionWidth:n,collisionHeight:l,offset:[d[0]+p[0],d[1]+p[1]],my:c.my,at:c.at,within:W,elem:f})}),c.using&&(t=function(t){var i=u.left-r.left,e=i+a-s,o=u.top-r.top,n=o+g-h,l={target:{element:w,left:u.left,top:u.top,width:a,height:g},element:{element:f,left:r.left,top:r.top,width:s,height:h},horizontal:e<0?"left":0<i?"right":"center",vertical:n<0?"top":0<o?"bottom":"middle"};a<s&&T(i+e)<a&&(l.horizontal="center"),g<h&&T(o+n)<g&&(l.vertical="middle"),x(T(i),T(e))>x(T(o),T(n))?l.important="horizontal":l.important="vertical",c.using.call(this,t,l)}),f.offset(I.extend(r,{using:t}))})},I.ui.position={fit:{left:function(t,i){var e,o=i.within,n=o.isWindow?o.scrollLeft:o.offset.left,l=o.width,f=t.left-i.collisionPosition.marginLeft,s=n-f,h=f+i.collisionWidth-l-n;i.collisionWidth>l?0<s&&h<=0?(e=t.left+s+i.collisionWidth-l-n,t.left+=s-e):t.left=0<h&&s<=0?n:h<s?n+l-i.collisionWidth:n:0<s?t.left+=s:0<h?t.left-=h:t.left=x(t.left-f,t.left)},top:function(t,i){var e,o=i.within,n=o.isWindow?o.scrollTop:o.offset.top,l=i.within.height,f=t.top-i.collisionPosition.marginTop,s=n-f,h=f+i.collisionHeight-l-n;i.collisionHeight>l?0<s&&h<=0?(e=t.top+s+i.collisionHeight-l-n,t.top+=s-e):t.top=0<h&&s<=0?n:h<s?n+l-i.collisionHeight:n:0<s?t.top+=s:0<h?t.top-=h:t.top=x(t.top-f,t.top)}},flip:{left:function(t,i){var e,o,n=i.within,l=n.offset.left+n.scrollLeft,f=n.width,s=n.isWindow?n.scrollLeft:n.offset.left,h=t.left-i.collisionPosition.marginLeft,r=h-s,p=h+i.collisionWidth-f-s,c="left"===i.my[0]?-i.elemWidth:"right"===i.my[0]?i.elemWidth:0,d="left"===i.at[0]?i.targetWidth:"right"===i.at[0]?-i.targetWidth:0,a=-2*i.offset[0];r<0?((e=t.left+c+d+a+i.collisionWidth-f-l)<0||e<T(r))&&(t.left+=c+d+a):0<p&&(0<(o=t.left-i.collisionPosition.marginLeft+c+d+a-s)||T(o)<p)&&(t.left+=c+d+a)},top:function(t,i){var e,o,n=i.within,l=n.offset.top+n.scrollTop,f=n.height,s=n.isWindow?n.scrollTop:n.offset.top,h=t.top-i.collisionPosition.marginTop,r=h-s,p=h+i.collisionHeight-f-s,c="top"===i.my[1]?-i.elemHeight:"bottom"===i.my[1]?i.elemHeight:0,d="top"===i.at[1]?i.targetHeight:"bottom"===i.at[1]?-i.targetHeight:0,a=-2*i.offset[1];r<0?((o=t.top+c+d+a+i.collisionHeight-f-l)<0||o<T(r))&&(t.top+=c+d+a):0<p&&(0<(e=t.top-i.collisionPosition.marginTop+c+d+a-s)||T(e)<p)&&(t.top+=c+d+a)}},flipfit:{left:function(){I.ui.position.flip.left.apply(this,arguments),I.ui.position.fit.left.apply(this,arguments)},top:function(){I.ui.position.flip.top.apply(this,arguments),I.ui.position.fit.top.apply(this,arguments)}}},function(){var t,i,e,o,n,l=document.getElementsByTagName("body")[0],f=document.createElement("div");for(n in t=document.createElement(l?"div":"body"),e={visibility:"hidden",width:0,height:0,border:0,margin:0,background:"none"},l&&I.extend(e,{position:"absolute",left:"-1000px",top:"-1000px"}),e)t.style[n]=e[n];t.appendChild(f),(i=l||document.documentElement).insertBefore(t,i.firstChild),f.style.cssText="position: absolute; left: 10.7432222px;",o=I(f).offset().left,H=10<o&&o<11,t.innerHTML="",i.removeChild(t)}()}(),I.ui.position});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/progressbar.js b/wp-includes/js/jquery/ui/progressbar.js
new file mode 100644
index 0000000000..ff7dd90c85
--- /dev/null
+++ b/wp-includes/js/jquery/ui/progressbar.js
@@ -0,0 +1,177 @@
+/*!
+ * jQuery UI Progressbar 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Progressbar
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/progressbar/
+//>>demos: http://jqueryui.com/progressbar/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/progressbar.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.progressbar", {
+	version: "1.12.1",
+	options: {
+		classes: {
+			"ui-progressbar": "ui-corner-all",
+			"ui-progressbar-value": "ui-corner-left",
+			"ui-progressbar-complete": "ui-corner-right"
+		},
+		max: 100,
+		value: 0,
+
+		change: null,
+		complete: null
+	},
+
+	min: 0,
+
+	_create: function() {
+
+		// Constrain initial value
+		this.oldValue = this.options.value = this._constrainedValue();
+
+		this.element.attr( {
+
+			// Only set static values; aria-valuenow and aria-valuemax are
+			// set inside _refreshValue()
+			role: "progressbar",
+			"aria-valuemin": this.min
+		} );
+		this._addClass( "ui-progressbar", "ui-widget ui-widget-content" );
+
+		this.valueDiv = $( "<div>" ).appendTo( this.element );
+		this._addClass( this.valueDiv, "ui-progressbar-value", "ui-widget-header" );
+		this._refreshValue();
+	},
+
+	_destroy: function() {
+		this.element.removeAttr( "role aria-valuemin aria-valuemax aria-valuenow" );
+
+		this.valueDiv.remove();
+	},
+
+	value: function( newValue ) {
+		if ( newValue === undefined ) {
+			return this.options.value;
+		}
+
+		this.options.value = this._constrainedValue( newValue );
+		this._refreshValue();
+	},
+
+	_constrainedValue: function( newValue ) {
+		if ( newValue === undefined ) {
+			newValue = this.options.value;
+		}
+
+		this.indeterminate = newValue === false;
+
+		// Sanitize value
+		if ( typeof newValue !== "number" ) {
+			newValue = 0;
+		}
+
+		return this.indeterminate ? false :
+			Math.min( this.options.max, Math.max( this.min, newValue ) );
+	},
+
+	_setOptions: function( options ) {
+
+		// Ensure "value" option is set after other values (like max)
+		var value = options.value;
+		delete options.value;
+
+		this._super( options );
+
+		this.options.value = this._constrainedValue( value );
+		this._refreshValue();
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "max" ) {
+
+			// Don't allow a max less than min
+			value = Math.max( this.min, value );
+		}
+		this._super( key, value );
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.element.attr( "aria-disabled", value );
+		this._toggleClass( null, "ui-state-disabled", !!value );
+	},
+
+	_percentage: function() {
+		return this.indeterminate ?
+			100 :
+			100 * ( this.options.value - this.min ) / ( this.options.max - this.min );
+	},
+
+	_refreshValue: function() {
+		var value = this.options.value,
+			percentage = this._percentage();
+
+		this.valueDiv
+			.toggle( this.indeterminate || value > this.min )
+			.width( percentage.toFixed( 0 ) + "%" );
+
+		this
+			._toggleClass( this.valueDiv, "ui-progressbar-complete", null,
+				value === this.options.max )
+			._toggleClass( "ui-progressbar-indeterminate", null, this.indeterminate );
+
+		if ( this.indeterminate ) {
+			this.element.removeAttr( "aria-valuenow" );
+			if ( !this.overlayDiv ) {
+				this.overlayDiv = $( "<div>" ).appendTo( this.valueDiv );
+				this._addClass( this.overlayDiv, "ui-progressbar-overlay" );
+			}
+		} else {
+			this.element.attr( {
+				"aria-valuemax": this.options.max,
+				"aria-valuenow": value
+			} );
+			if ( this.overlayDiv ) {
+				this.overlayDiv.remove();
+				this.overlayDiv = null;
+			}
+		}
+
+		if ( this.oldValue !== value ) {
+			this.oldValue = value;
+			this._trigger( "change" );
+		}
+		if ( value === this.options.max ) {
+			this._trigger( "complete" );
+		}
+	}
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/progressbar.min.js b/wp-includes/js/jquery/ui/progressbar.min.js
index 786d63c4ff..286a86ebdb 100644
--- a/wp-includes/js/jquery/ui/progressbar.min.js
+++ b/wp-includes/js/jquery/ui/progressbar.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Progressbar 1.11.4
+ * jQuery UI Progressbar 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/progressbar/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./widget"],e):e(jQuery)}(function(t){return t.widget("ui.progressbar",{version:"1.11.4",options:{max:100,value:0,change:null,complete:null},min:0,_create:function(){this.oldValue=this.options.value=this._constrainedValue(),this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min}),this.valueDiv=t("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element),this._refreshValue()},_destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.valueDiv.remove()},value:function(e){if(void 0===e)return this.options.value;this.options.value=this._constrainedValue(e),this._refreshValue()},_constrainedValue:function(e){return void 0===e&&(e=this.options.value),this.indeterminate=!1===e,"number"!=typeof e&&(e=0),!this.indeterminate&&Math.min(this.options.max,Math.max(this.min,e))},_setOptions:function(e){var i=e.value;delete e.value,this._super(e),this.options.value=this._constrainedValue(i),this._refreshValue()},_setOption:function(e,i){"max"===e&&(i=Math.max(this.min,i)),"disabled"===e&&this.element.toggleClass("ui-state-disabled",!!i).attr("aria-disabled",i),this._super(e,i)},_percentage:function(){return this.indeterminate?100:100*(this.options.value-this.min)/(this.options.max-this.min)},_refreshValue:function(){var e=this.options.value,i=this._percentage();this.valueDiv.toggle(this.indeterminate||e>this.min).toggleClass("ui-corner-right",e===this.options.max).width(i.toFixed(0)+"%"),this.element.toggleClass("ui-progressbar-indeterminate",this.indeterminate),this.indeterminate?(this.element.removeAttr("aria-valuenow"),this.overlayDiv||(this.overlayDiv=t("<div class='ui-progressbar-overlay'></div>").appendTo(this.valueDiv))):(this.element.attr({"aria-valuemax":this.options.max,"aria-valuenow":e}),this.overlayDiv&&(this.overlayDiv.remove(),this.overlayDiv=null)),this.oldValue!==e&&(this.oldValue=e,this._trigger("change")),e===this.options.max&&this._trigger("complete")}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./core"],e):e(jQuery)}(function(t){return t.widget("ui.progressbar",{version:"1.12.1",options:{classes:{"ui-progressbar":"ui-corner-all","ui-progressbar-value":"ui-corner-left","ui-progressbar-complete":"ui-corner-right"},max:100,value:0,change:null,complete:null},min:0,_create:function(){this.oldValue=this.options.value=this._constrainedValue(),this.element.attr({role:"progressbar","aria-valuemin":this.min}),this._addClass("ui-progressbar","ui-widget ui-widget-content"),this.valueDiv=t("<div>").appendTo(this.element),this._addClass(this.valueDiv,"ui-progressbar-value","ui-widget-header"),this._refreshValue()},_destroy:function(){this.element.removeAttr("role aria-valuemin aria-valuemax aria-valuenow"),this.valueDiv.remove()},value:function(e){if(void 0===e)return this.options.value;this.options.value=this._constrainedValue(e),this._refreshValue()},_constrainedValue:function(e){return void 0===e&&(e=this.options.value),this.indeterminate=!1===e,"number"!=typeof e&&(e=0),!this.indeterminate&&Math.min(this.options.max,Math.max(this.min,e))},_setOptions:function(e){var i=e.value;delete e.value,this._super(e),this.options.value=this._constrainedValue(i),this._refreshValue()},_setOption:function(e,i){"max"===e&&(i=Math.max(this.min,i)),this._super(e,i)},_setOptionDisabled:function(e){this._super(e),this.element.attr("aria-disabled",e),this._toggleClass(null,"ui-state-disabled",!!e)},_percentage:function(){return this.indeterminate?100:100*(this.options.value-this.min)/(this.options.max-this.min)},_refreshValue:function(){var e=this.options.value,i=this._percentage();this.valueDiv.toggle(this.indeterminate||e>this.min).width(i.toFixed(0)+"%"),this._toggleClass(this.valueDiv,"ui-progressbar-complete",null,e===this.options.max)._toggleClass("ui-progressbar-indeterminate",null,this.indeterminate),this.indeterminate?(this.element.removeAttr("aria-valuenow"),this.overlayDiv||(this.overlayDiv=t("<div>").appendTo(this.valueDiv),this._addClass(this.overlayDiv,"ui-progressbar-overlay"))):(this.element.attr({"aria-valuemax":this.options.max,"aria-valuenow":e}),this.overlayDiv&&(this.overlayDiv.remove(),this.overlayDiv=null)),this.oldValue!==e&&(this.oldValue=e,this._trigger("change")),e===this.options.max&&this._trigger("complete")}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/resizable.js b/wp-includes/js/jquery/ui/resizable.js
new file mode 100644
index 0000000000..62a0fc821b
--- /dev/null
+++ b/wp-includes/js/jquery/ui/resizable.js
@@ -0,0 +1,1198 @@
+/*!
+ * jQuery UI Resizable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Resizable
+//>>group: Interactions
+//>>description: Enables resize functionality for any element.
+//>>docs: http://api.jqueryui.com/resizable/
+//>>demos: http://jqueryui.com/resizable/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/resizable.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./mouse",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.resizable", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "resize",
+	options: {
+		alsoResize: false,
+		animate: false,
+		animateDuration: "slow",
+		animateEasing: "swing",
+		aspectRatio: false,
+		autoHide: false,
+		classes: {
+			"ui-resizable-se": "ui-icon ui-icon-gripsmall-diagonal-se"
+		},
+		containment: false,
+		ghost: false,
+		grid: false,
+		handles: "e,s,se",
+		helper: false,
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 10,
+		minWidth: 10,
+
+		// See #7960
+		zIndex: 90,
+
+		// Callbacks
+		resize: null,
+		start: null,
+		stop: null
+	},
+
+	_num: function( value ) {
+		return parseFloat( value ) || 0;
+	},
+
+	_isNumber: function( value ) {
+		return !isNaN( parseFloat( value ) );
+	},
+
+	_hasScroll: function( el, a ) {
+
+		if ( $( el ).css( "overflow" ) === "hidden" ) {
+			return false;
+		}
+
+		var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop",
+			has = false;
+
+		if ( el[ scroll ] > 0 ) {
+			return true;
+		}
+
+		// TODO: determine which cases actually cause this to happen
+		// if the element doesn't have the scroll set, see if it's possible to
+		// set the scroll
+		el[ scroll ] = 1;
+		has = ( el[ scroll ] > 0 );
+		el[ scroll ] = 0;
+		return has;
+	},
+
+	_create: function() {
+
+		var margins,
+			o = this.options,
+			that = this;
+		this._addClass( "ui-resizable" );
+
+		$.extend( this, {
+			_aspectRatio: !!( o.aspectRatio ),
+			aspectRatio: o.aspectRatio,
+			originalElement: this.element,
+			_proportionallyResizeElements: [],
+			_helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null
+		} );
+
+		// Wrap the element if it cannot hold child nodes
+		if ( this.element[ 0 ].nodeName.match( /^(canvas|textarea|input|select|button|img)$/i ) ) {
+
+			this.element.wrap(
+				$( "<div class='ui-wrapper' style='overflow: hidden;'></div>" ).css( {
+					position: this.element.css( "position" ),
+					width: this.element.outerWidth(),
+					height: this.element.outerHeight(),
+					top: this.element.css( "top" ),
+					left: this.element.css( "left" )
+				} )
+			);
+
+			this.element = this.element.parent().data(
+				"ui-resizable", this.element.resizable( "instance" )
+			);
+
+			this.elementIsWrapper = true;
+
+			margins = {
+				marginTop: this.originalElement.css( "marginTop" ),
+				marginRight: this.originalElement.css( "marginRight" ),
+				marginBottom: this.originalElement.css( "marginBottom" ),
+				marginLeft: this.originalElement.css( "marginLeft" )
+			};
+
+			this.element.css( margins );
+			this.originalElement.css( "margin", 0 );
+
+			// support: Safari
+			// Prevent Safari textarea resize
+			this.originalResizeStyle = this.originalElement.css( "resize" );
+			this.originalElement.css( "resize", "none" );
+
+			this._proportionallyResizeElements.push( this.originalElement.css( {
+				position: "static",
+				zoom: 1,
+				display: "block"
+			} ) );
+
+			// Support: IE9
+			// avoid IE jump (hard set the margin)
+			this.originalElement.css( margins );
+
+			this._proportionallyResize();
+		}
+
+		this._setupHandles();
+
+		if ( o.autoHide ) {
+			$( this.element )
+				.on( "mouseenter", function() {
+					if ( o.disabled ) {
+						return;
+					}
+					that._removeClass( "ui-resizable-autohide" );
+					that._handles.show();
+				} )
+				.on( "mouseleave", function() {
+					if ( o.disabled ) {
+						return;
+					}
+					if ( !that.resizing ) {
+						that._addClass( "ui-resizable-autohide" );
+						that._handles.hide();
+					}
+				} );
+		}
+
+		this._mouseInit();
+	},
+
+	_destroy: function() {
+
+		this._mouseDestroy();
+
+		var wrapper,
+			_destroy = function( exp ) {
+				$( exp )
+					.removeData( "resizable" )
+					.removeData( "ui-resizable" )
+					.off( ".resizable" )
+					.find( ".ui-resizable-handle" )
+						.remove();
+			};
+
+		// TODO: Unwrap at same DOM position
+		if ( this.elementIsWrapper ) {
+			_destroy( this.element );
+			wrapper = this.element;
+			this.originalElement.css( {
+				position: wrapper.css( "position" ),
+				width: wrapper.outerWidth(),
+				height: wrapper.outerHeight(),
+				top: wrapper.css( "top" ),
+				left: wrapper.css( "left" )
+			} ).insertAfter( wrapper );
+			wrapper.remove();
+		}
+
+		this.originalElement.css( "resize", this.originalResizeStyle );
+		_destroy( this.originalElement );
+
+		return this;
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+
+		switch ( key ) {
+		case "handles":
+			this._removeHandles();
+			this._setupHandles();
+			break;
+		default:
+			break;
+		}
+	},
+
+	_setupHandles: function() {
+		var o = this.options, handle, i, n, hname, axis, that = this;
+		this.handles = o.handles ||
+			( !$( ".ui-resizable-handle", this.element ).length ?
+				"e,s,se" : {
+					n: ".ui-resizable-n",
+					e: ".ui-resizable-e",
+					s: ".ui-resizable-s",
+					w: ".ui-resizable-w",
+					se: ".ui-resizable-se",
+					sw: ".ui-resizable-sw",
+					ne: ".ui-resizable-ne",
+					nw: ".ui-resizable-nw"
+				} );
+
+		this._handles = $();
+		if ( this.handles.constructor === String ) {
+
+			if ( this.handles === "all" ) {
+				this.handles = "n,e,s,w,se,sw,ne,nw";
+			}
+
+			n = this.handles.split( "," );
+			this.handles = {};
+
+			for ( i = 0; i < n.length; i++ ) {
+
+				handle = $.trim( n[ i ] );
+				hname = "ui-resizable-" + handle;
+				axis = $( "<div>" );
+				this._addClass( axis, "ui-resizable-handle " + hname );
+
+				axis.css( { zIndex: o.zIndex } );
+
+				this.handles[ handle ] = ".ui-resizable-" + handle;
+				this.element.append( axis );
+			}
+
+		}
+
+		this._renderAxis = function( target ) {
+
+			var i, axis, padPos, padWrapper;
+
+			target = target || this.element;
+
+			for ( i in this.handles ) {
+
+				if ( this.handles[ i ].constructor === String ) {
+					this.handles[ i ] = this.element.children( this.handles[ i ] ).first().show();
+				} else if ( this.handles[ i ].jquery || this.handles[ i ].nodeType ) {
+					this.handles[ i ] = $( this.handles[ i ] );
+					this._on( this.handles[ i ], { "mousedown": that._mouseDown } );
+				}
+
+				if ( this.elementIsWrapper &&
+						this.originalElement[ 0 ]
+							.nodeName
+							.match( /^(textarea|input|select|button)$/i ) ) {
+					axis = $( this.handles[ i ], this.element );
+
+					padWrapper = /sw|ne|nw|se|n|s/.test( i ) ?
+						axis.outerHeight() :
+						axis.outerWidth();
+
+					padPos = [ "padding",
+						/ne|nw|n/.test( i ) ? "Top" :
+						/se|sw|s/.test( i ) ? "Bottom" :
+						/^e$/.test( i ) ? "Right" : "Left" ].join( "" );
+
+					target.css( padPos, padWrapper );
+
+					this._proportionallyResize();
+				}
+
+				this._handles = this._handles.add( this.handles[ i ] );
+			}
+		};
+
+		// TODO: make renderAxis a prototype function
+		this._renderAxis( this.element );
+
+		this._handles = this._handles.add( this.element.find( ".ui-resizable-handle" ) );
+		this._handles.disableSelection();
+
+		this._handles.on( "mouseover", function() {
+			if ( !that.resizing ) {
+				if ( this.className ) {
+					axis = this.className.match( /ui-resizable-(se|sw|ne|nw|n|e|s|w)/i );
+				}
+				that.axis = axis && axis[ 1 ] ? axis[ 1 ] : "se";
+			}
+		} );
+
+		if ( o.autoHide ) {
+			this._handles.hide();
+			this._addClass( "ui-resizable-autohide" );
+		}
+	},
+
+	_removeHandles: function() {
+		this._handles.remove();
+	},
+
+	_mouseCapture: function( event ) {
+		var i, handle,
+			capture = false;
+
+		for ( i in this.handles ) {
+			handle = $( this.handles[ i ] )[ 0 ];
+			if ( handle === event.target || $.contains( handle, event.target ) ) {
+				capture = true;
+			}
+		}
+
+		return !this.options.disabled && capture;
+	},
+
+	_mouseStart: function( event ) {
+
+		var curleft, curtop, cursor,
+			o = this.options,
+			el = this.element;
+
+		this.resizing = true;
+
+		this._renderProxy();
+
+		curleft = this._num( this.helper.css( "left" ) );
+		curtop = this._num( this.helper.css( "top" ) );
+
+		if ( o.containment ) {
+			curleft += $( o.containment ).scrollLeft() || 0;
+			curtop += $( o.containment ).scrollTop() || 0;
+		}
+
+		this.offset = this.helper.offset();
+		this.position = { left: curleft, top: curtop };
+
+		this.size = this._helper ? {
+				width: this.helper.width(),
+				height: this.helper.height()
+			} : {
+				width: el.width(),
+				height: el.height()
+			};
+
+		this.originalSize = this._helper ? {
+				width: el.outerWidth(),
+				height: el.outerHeight()
+			} : {
+				width: el.width(),
+				height: el.height()
+			};
+
+		this.sizeDiff = {
+			width: el.outerWidth() - el.width(),
+			height: el.outerHeight() - el.height()
+		};
+
+		this.originalPosition = { left: curleft, top: curtop };
+		this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+		this.aspectRatio = ( typeof o.aspectRatio === "number" ) ?
+			o.aspectRatio :
+			( ( this.originalSize.width / this.originalSize.height ) || 1 );
+
+		cursor = $( ".ui-resizable-" + this.axis ).css( "cursor" );
+		$( "body" ).css( "cursor", cursor === "auto" ? this.axis + "-resize" : cursor );
+
+		this._addClass( "ui-resizable-resizing" );
+		this._propagate( "start", event );
+		return true;
+	},
+
+	_mouseDrag: function( event ) {
+
+		var data, props,
+			smp = this.originalMousePosition,
+			a = this.axis,
+			dx = ( event.pageX - smp.left ) || 0,
+			dy = ( event.pageY - smp.top ) || 0,
+			trigger = this._change[ a ];
+
+		this._updatePrevProperties();
+
+		if ( !trigger ) {
+			return false;
+		}
+
+		data = trigger.apply( this, [ event, dx, dy ] );
+
+		this._updateVirtualBoundaries( event.shiftKey );
+		if ( this._aspectRatio || event.shiftKey ) {
+			data = this._updateRatio( data, event );
+		}
+
+		data = this._respectSize( data, event );
+
+		this._updateCache( data );
+
+		this._propagate( "resize", event );
+
+		props = this._applyChanges();
+
+		if ( !this._helper && this._proportionallyResizeElements.length ) {
+			this._proportionallyResize();
+		}
+
+		if ( !$.isEmptyObject( props ) ) {
+			this._updatePrevProperties();
+			this._trigger( "resize", event, this.ui() );
+			this._applyChanges();
+		}
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+
+		this.resizing = false;
+		var pr, ista, soffseth, soffsetw, s, left, top,
+			o = this.options, that = this;
+
+		if ( this._helper ) {
+
+			pr = this._proportionallyResizeElements;
+			ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName );
+			soffseth = ista && this._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height;
+			soffsetw = ista ? 0 : that.sizeDiff.width;
+
+			s = {
+				width: ( that.helper.width()  - soffsetw ),
+				height: ( that.helper.height() - soffseth )
+			};
+			left = ( parseFloat( that.element.css( "left" ) ) +
+				( that.position.left - that.originalPosition.left ) ) || null;
+			top = ( parseFloat( that.element.css( "top" ) ) +
+				( that.position.top - that.originalPosition.top ) ) || null;
+
+			if ( !o.animate ) {
+				this.element.css( $.extend( s, { top: top, left: left } ) );
+			}
+
+			that.helper.height( that.size.height );
+			that.helper.width( that.size.width );
+
+			if ( this._helper && !o.animate ) {
+				this._proportionallyResize();
+			}
+		}
+
+		$( "body" ).css( "cursor", "auto" );
+
+		this._removeClass( "ui-resizable-resizing" );
+
+		this._propagate( "stop", event );
+
+		if ( this._helper ) {
+			this.helper.remove();
+		}
+
+		return false;
+
+	},
+
+	_updatePrevProperties: function() {
+		this.prevPosition = {
+			top: this.position.top,
+			left: this.position.left
+		};
+		this.prevSize = {
+			width: this.size.width,
+			height: this.size.height
+		};
+	},
+
+	_applyChanges: function() {
+		var props = {};
+
+		if ( this.position.top !== this.prevPosition.top ) {
+			props.top = this.position.top + "px";
+		}
+		if ( this.position.left !== this.prevPosition.left ) {
+			props.left = this.position.left + "px";
+		}
+		if ( this.size.width !== this.prevSize.width ) {
+			props.width = this.size.width + "px";
+		}
+		if ( this.size.height !== this.prevSize.height ) {
+			props.height = this.size.height + "px";
+		}
+
+		this.helper.css( props );
+
+		return props;
+	},
+
+	_updateVirtualBoundaries: function( forceAspectRatio ) {
+		var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b,
+			o = this.options;
+
+		b = {
+			minWidth: this._isNumber( o.minWidth ) ? o.minWidth : 0,
+			maxWidth: this._isNumber( o.maxWidth ) ? o.maxWidth : Infinity,
+			minHeight: this._isNumber( o.minHeight ) ? o.minHeight : 0,
+			maxHeight: this._isNumber( o.maxHeight ) ? o.maxHeight : Infinity
+		};
+
+		if ( this._aspectRatio || forceAspectRatio ) {
+			pMinWidth = b.minHeight * this.aspectRatio;
+			pMinHeight = b.minWidth / this.aspectRatio;
+			pMaxWidth = b.maxHeight * this.aspectRatio;
+			pMaxHeight = b.maxWidth / this.aspectRatio;
+
+			if ( pMinWidth > b.minWidth ) {
+				b.minWidth = pMinWidth;
+			}
+			if ( pMinHeight > b.minHeight ) {
+				b.minHeight = pMinHeight;
+			}
+			if ( pMaxWidth < b.maxWidth ) {
+				b.maxWidth = pMaxWidth;
+			}
+			if ( pMaxHeight < b.maxHeight ) {
+				b.maxHeight = pMaxHeight;
+			}
+		}
+		this._vBoundaries = b;
+	},
+
+	_updateCache: function( data ) {
+		this.offset = this.helper.offset();
+		if ( this._isNumber( data.left ) ) {
+			this.position.left = data.left;
+		}
+		if ( this._isNumber( data.top ) ) {
+			this.position.top = data.top;
+		}
+		if ( this._isNumber( data.height ) ) {
+			this.size.height = data.height;
+		}
+		if ( this._isNumber( data.width ) ) {
+			this.size.width = data.width;
+		}
+	},
+
+	_updateRatio: function( data ) {
+
+		var cpos = this.position,
+			csize = this.size,
+			a = this.axis;
+
+		if ( this._isNumber( data.height ) ) {
+			data.width = ( data.height * this.aspectRatio );
+		} else if ( this._isNumber( data.width ) ) {
+			data.height = ( data.width / this.aspectRatio );
+		}
+
+		if ( a === "sw" ) {
+			data.left = cpos.left + ( csize.width - data.width );
+			data.top = null;
+		}
+		if ( a === "nw" ) {
+			data.top = cpos.top + ( csize.height - data.height );
+			data.left = cpos.left + ( csize.width - data.width );
+		}
+
+		return data;
+	},
+
+	_respectSize: function( data ) {
+
+		var o = this._vBoundaries,
+			a = this.axis,
+			ismaxw = this._isNumber( data.width ) && o.maxWidth && ( o.maxWidth < data.width ),
+			ismaxh = this._isNumber( data.height ) && o.maxHeight && ( o.maxHeight < data.height ),
+			isminw = this._isNumber( data.width ) && o.minWidth && ( o.minWidth > data.width ),
+			isminh = this._isNumber( data.height ) && o.minHeight && ( o.minHeight > data.height ),
+			dw = this.originalPosition.left + this.originalSize.width,
+			dh = this.originalPosition.top + this.originalSize.height,
+			cw = /sw|nw|w/.test( a ), ch = /nw|ne|n/.test( a );
+		if ( isminw ) {
+			data.width = o.minWidth;
+		}
+		if ( isminh ) {
+			data.height = o.minHeight;
+		}
+		if ( ismaxw ) {
+			data.width = o.maxWidth;
+		}
+		if ( ismaxh ) {
+			data.height = o.maxHeight;
+		}
+
+		if ( isminw && cw ) {
+			data.left = dw - o.minWidth;
+		}
+		if ( ismaxw && cw ) {
+			data.left = dw - o.maxWidth;
+		}
+		if ( isminh && ch ) {
+			data.top = dh - o.minHeight;
+		}
+		if ( ismaxh && ch ) {
+			data.top = dh - o.maxHeight;
+		}
+
+		// Fixing jump error on top/left - bug #2330
+		if ( !data.width && !data.height && !data.left && data.top ) {
+			data.top = null;
+		} else if ( !data.width && !data.height && !data.top && data.left ) {
+			data.left = null;
+		}
+
+		return data;
+	},
+
+	_getPaddingPlusBorderDimensions: function( element ) {
+		var i = 0,
+			widths = [],
+			borders = [
+				element.css( "borderTopWidth" ),
+				element.css( "borderRightWidth" ),
+				element.css( "borderBottomWidth" ),
+				element.css( "borderLeftWidth" )
+			],
+			paddings = [
+				element.css( "paddingTop" ),
+				element.css( "paddingRight" ),
+				element.css( "paddingBottom" ),
+				element.css( "paddingLeft" )
+			];
+
+		for ( ; i < 4; i++ ) {
+			widths[ i ] = ( parseFloat( borders[ i ] ) || 0 );
+			widths[ i ] += ( parseFloat( paddings[ i ] ) || 0 );
+		}
+
+		return {
+			height: widths[ 0 ] + widths[ 2 ],
+			width: widths[ 1 ] + widths[ 3 ]
+		};
+	},
+
+	_proportionallyResize: function() {
+
+		if ( !this._proportionallyResizeElements.length ) {
+			return;
+		}
+
+		var prel,
+			i = 0,
+			element = this.helper || this.element;
+
+		for ( ; i < this._proportionallyResizeElements.length; i++ ) {
+
+			prel = this._proportionallyResizeElements[ i ];
+
+			// TODO: Seems like a bug to cache this.outerDimensions
+			// considering that we are in a loop.
+			if ( !this.outerDimensions ) {
+				this.outerDimensions = this._getPaddingPlusBorderDimensions( prel );
+			}
+
+			prel.css( {
+				height: ( element.height() - this.outerDimensions.height ) || 0,
+				width: ( element.width() - this.outerDimensions.width ) || 0
+			} );
+
+		}
+
+	},
+
+	_renderProxy: function() {
+
+		var el = this.element, o = this.options;
+		this.elementOffset = el.offset();
+
+		if ( this._helper ) {
+
+			this.helper = this.helper || $( "<div style='overflow:hidden;'></div>" );
+
+			this._addClass( this.helper, this._helper );
+			this.helper.css( {
+				width: this.element.outerWidth(),
+				height: this.element.outerHeight(),
+				position: "absolute",
+				left: this.elementOffset.left + "px",
+				top: this.elementOffset.top + "px",
+				zIndex: ++o.zIndex //TODO: Don't modify option
+			} );
+
+			this.helper
+				.appendTo( "body" )
+				.disableSelection();
+
+		} else {
+			this.helper = this.element;
+		}
+
+	},
+
+	_change: {
+		e: function( event, dx ) {
+			return { width: this.originalSize.width + dx };
+		},
+		w: function( event, dx ) {
+			var cs = this.originalSize, sp = this.originalPosition;
+			return { left: sp.left + dx, width: cs.width - dx };
+		},
+		n: function( event, dx, dy ) {
+			var cs = this.originalSize, sp = this.originalPosition;
+			return { top: sp.top + dy, height: cs.height - dy };
+		},
+		s: function( event, dx, dy ) {
+			return { height: this.originalSize.height + dy };
+		},
+		se: function( event, dx, dy ) {
+			return $.extend( this._change.s.apply( this, arguments ),
+				this._change.e.apply( this, [ event, dx, dy ] ) );
+		},
+		sw: function( event, dx, dy ) {
+			return $.extend( this._change.s.apply( this, arguments ),
+				this._change.w.apply( this, [ event, dx, dy ] ) );
+		},
+		ne: function( event, dx, dy ) {
+			return $.extend( this._change.n.apply( this, arguments ),
+				this._change.e.apply( this, [ event, dx, dy ] ) );
+		},
+		nw: function( event, dx, dy ) {
+			return $.extend( this._change.n.apply( this, arguments ),
+				this._change.w.apply( this, [ event, dx, dy ] ) );
+		}
+	},
+
+	_propagate: function( n, event ) {
+		$.ui.plugin.call( this, n, [ event, this.ui() ] );
+		( n !== "resize" && this._trigger( n, event, this.ui() ) );
+	},
+
+	plugins: {},
+
+	ui: function() {
+		return {
+			originalElement: this.originalElement,
+			element: this.element,
+			helper: this.helper,
+			position: this.position,
+			size: this.size,
+			originalSize: this.originalSize,
+			originalPosition: this.originalPosition
+		};
+	}
+
+} );
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add( "resizable", "animate", {
+
+	stop: function( event ) {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options,
+			pr = that._proportionallyResizeElements,
+			ista = pr.length && ( /textarea/i ).test( pr[ 0 ].nodeName ),
+			soffseth = ista && that._hasScroll( pr[ 0 ], "left" ) ? 0 : that.sizeDiff.height,
+			soffsetw = ista ? 0 : that.sizeDiff.width,
+			style = {
+				width: ( that.size.width - soffsetw ),
+				height: ( that.size.height - soffseth )
+			},
+			left = ( parseFloat( that.element.css( "left" ) ) +
+				( that.position.left - that.originalPosition.left ) ) || null,
+			top = ( parseFloat( that.element.css( "top" ) ) +
+				( that.position.top - that.originalPosition.top ) ) || null;
+
+		that.element.animate(
+			$.extend( style, top && left ? { top: top, left: left } : {} ), {
+				duration: o.animateDuration,
+				easing: o.animateEasing,
+				step: function() {
+
+					var data = {
+						width: parseFloat( that.element.css( "width" ) ),
+						height: parseFloat( that.element.css( "height" ) ),
+						top: parseFloat( that.element.css( "top" ) ),
+						left: parseFloat( that.element.css( "left" ) )
+					};
+
+					if ( pr && pr.length ) {
+						$( pr[ 0 ] ).css( { width: data.width, height: data.height } );
+					}
+
+					// Propagating resize, and updating values for each animation step
+					that._updateCache( data );
+					that._propagate( "resize", event );
+
+				}
+			}
+		);
+	}
+
+} );
+
+$.ui.plugin.add( "resizable", "containment", {
+
+	start: function() {
+		var element, p, co, ch, cw, width, height,
+			that = $( this ).resizable( "instance" ),
+			o = that.options,
+			el = that.element,
+			oc = o.containment,
+			ce = ( oc instanceof $ ) ?
+				oc.get( 0 ) :
+				( /parent/.test( oc ) ) ? el.parent().get( 0 ) : oc;
+
+		if ( !ce ) {
+			return;
+		}
+
+		that.containerElement = $( ce );
+
+		if ( /document/.test( oc ) || oc === document ) {
+			that.containerOffset = {
+				left: 0,
+				top: 0
+			};
+			that.containerPosition = {
+				left: 0,
+				top: 0
+			};
+
+			that.parentData = {
+				element: $( document ),
+				left: 0,
+				top: 0,
+				width: $( document ).width(),
+				height: $( document ).height() || document.body.parentNode.scrollHeight
+			};
+		} else {
+			element = $( ce );
+			p = [];
+			$( [ "Top", "Right", "Left", "Bottom" ] ).each( function( i, name ) {
+				p[ i ] = that._num( element.css( "padding" + name ) );
+			} );
+
+			that.containerOffset = element.offset();
+			that.containerPosition = element.position();
+			that.containerSize = {
+				height: ( element.innerHeight() - p[ 3 ] ),
+				width: ( element.innerWidth() - p[ 1 ] )
+			};
+
+			co = that.containerOffset;
+			ch = that.containerSize.height;
+			cw = that.containerSize.width;
+			width = ( that._hasScroll ( ce, "left" ) ? ce.scrollWidth : cw );
+			height = ( that._hasScroll ( ce ) ? ce.scrollHeight : ch ) ;
+
+			that.parentData = {
+				element: ce,
+				left: co.left,
+				top: co.top,
+				width: width,
+				height: height
+			};
+		}
+	},
+
+	resize: function( event ) {
+		var woset, hoset, isParent, isOffsetRelative,
+			that = $( this ).resizable( "instance" ),
+			o = that.options,
+			co = that.containerOffset,
+			cp = that.position,
+			pRatio = that._aspectRatio || event.shiftKey,
+			cop = {
+				top: 0,
+				left: 0
+			},
+			ce = that.containerElement,
+			continueResize = true;
+
+		if ( ce[ 0 ] !== document && ( /static/ ).test( ce.css( "position" ) ) ) {
+			cop = co;
+		}
+
+		if ( cp.left < ( that._helper ? co.left : 0 ) ) {
+			that.size.width = that.size.width +
+				( that._helper ?
+					( that.position.left - co.left ) :
+					( that.position.left - cop.left ) );
+
+			if ( pRatio ) {
+				that.size.height = that.size.width / that.aspectRatio;
+				continueResize = false;
+			}
+			that.position.left = o.helper ? co.left : 0;
+		}
+
+		if ( cp.top < ( that._helper ? co.top : 0 ) ) {
+			that.size.height = that.size.height +
+				( that._helper ?
+					( that.position.top - co.top ) :
+					that.position.top );
+
+			if ( pRatio ) {
+				that.size.width = that.size.height * that.aspectRatio;
+				continueResize = false;
+			}
+			that.position.top = that._helper ? co.top : 0;
+		}
+
+		isParent = that.containerElement.get( 0 ) === that.element.parent().get( 0 );
+		isOffsetRelative = /relative|absolute/.test( that.containerElement.css( "position" ) );
+
+		if ( isParent && isOffsetRelative ) {
+			that.offset.left = that.parentData.left + that.position.left;
+			that.offset.top = that.parentData.top + that.position.top;
+		} else {
+			that.offset.left = that.element.offset().left;
+			that.offset.top = that.element.offset().top;
+		}
+
+		woset = Math.abs( that.sizeDiff.width +
+			( that._helper ?
+				that.offset.left - cop.left :
+				( that.offset.left - co.left ) ) );
+
+		hoset = Math.abs( that.sizeDiff.height +
+			( that._helper ?
+				that.offset.top - cop.top :
+				( that.offset.top - co.top ) ) );
+
+		if ( woset + that.size.width >= that.parentData.width ) {
+			that.size.width = that.parentData.width - woset;
+			if ( pRatio ) {
+				that.size.height = that.size.width / that.aspectRatio;
+				continueResize = false;
+			}
+		}
+
+		if ( hoset + that.size.height >= that.parentData.height ) {
+			that.size.height = that.parentData.height - hoset;
+			if ( pRatio ) {
+				that.size.width = that.size.height * that.aspectRatio;
+				continueResize = false;
+			}
+		}
+
+		if ( !continueResize ) {
+			that.position.left = that.prevPosition.left;
+			that.position.top = that.prevPosition.top;
+			that.size.width = that.prevSize.width;
+			that.size.height = that.prevSize.height;
+		}
+	},
+
+	stop: function() {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options,
+			co = that.containerOffset,
+			cop = that.containerPosition,
+			ce = that.containerElement,
+			helper = $( that.helper ),
+			ho = helper.offset(),
+			w = helper.outerWidth() - that.sizeDiff.width,
+			h = helper.outerHeight() - that.sizeDiff.height;
+
+		if ( that._helper && !o.animate && ( /relative/ ).test( ce.css( "position" ) ) ) {
+			$( this ).css( {
+				left: ho.left - cop.left - co.left,
+				width: w,
+				height: h
+			} );
+		}
+
+		if ( that._helper && !o.animate && ( /static/ ).test( ce.css( "position" ) ) ) {
+			$( this ).css( {
+				left: ho.left - cop.left - co.left,
+				width: w,
+				height: h
+			} );
+		}
+	}
+} );
+
+$.ui.plugin.add( "resizable", "alsoResize", {
+
+	start: function() {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options;
+
+		$( o.alsoResize ).each( function() {
+			var el = $( this );
+			el.data( "ui-resizable-alsoresize", {
+				width: parseFloat( el.width() ), height: parseFloat( el.height() ),
+				left: parseFloat( el.css( "left" ) ), top: parseFloat( el.css( "top" ) )
+			} );
+		} );
+	},
+
+	resize: function( event, ui ) {
+		var that = $( this ).resizable( "instance" ),
+			o = that.options,
+			os = that.originalSize,
+			op = that.originalPosition,
+			delta = {
+				height: ( that.size.height - os.height ) || 0,
+				width: ( that.size.width - os.width ) || 0,
+				top: ( that.position.top - op.top ) || 0,
+				left: ( that.position.left - op.left ) || 0
+			};
+
+			$( o.alsoResize ).each( function() {
+				var el = $( this ), start = $( this ).data( "ui-resizable-alsoresize" ), style = {},
+					css = el.parents( ui.originalElement[ 0 ] ).length ?
+							[ "width", "height" ] :
+							[ "width", "height", "top", "left" ];
+
+				$.each( css, function( i, prop ) {
+					var sum = ( start[ prop ] || 0 ) + ( delta[ prop ] || 0 );
+					if ( sum && sum >= 0 ) {
+						style[ prop ] = sum || null;
+					}
+				} );
+
+				el.css( style );
+			} );
+	},
+
+	stop: function() {
+		$( this ).removeData( "ui-resizable-alsoresize" );
+	}
+} );
+
+$.ui.plugin.add( "resizable", "ghost", {
+
+	start: function() {
+
+		var that = $( this ).resizable( "instance" ), cs = that.size;
+
+		that.ghost = that.originalElement.clone();
+		that.ghost.css( {
+			opacity: 0.25,
+			display: "block",
+			position: "relative",
+			height: cs.height,
+			width: cs.width,
+			margin: 0,
+			left: 0,
+			top: 0
+		} );
+
+		that._addClass( that.ghost, "ui-resizable-ghost" );
+
+		// DEPRECATED
+		// TODO: remove after 1.12
+		if ( $.uiBackCompat !== false && typeof that.options.ghost === "string" ) {
+
+			// Ghost option
+			that.ghost.addClass( this.options.ghost );
+		}
+
+		that.ghost.appendTo( that.helper );
+
+	},
+
+	resize: function() {
+		var that = $( this ).resizable( "instance" );
+		if ( that.ghost ) {
+			that.ghost.css( {
+				position: "relative",
+				height: that.size.height,
+				width: that.size.width
+			} );
+		}
+	},
+
+	stop: function() {
+		var that = $( this ).resizable( "instance" );
+		if ( that.ghost && that.helper ) {
+			that.helper.get( 0 ).removeChild( that.ghost.get( 0 ) );
+		}
+	}
+
+} );
+
+$.ui.plugin.add( "resizable", "grid", {
+
+	resize: function() {
+		var outerDimensions,
+			that = $( this ).resizable( "instance" ),
+			o = that.options,
+			cs = that.size,
+			os = that.originalSize,
+			op = that.originalPosition,
+			a = that.axis,
+			grid = typeof o.grid === "number" ? [ o.grid, o.grid ] : o.grid,
+			gridX = ( grid[ 0 ] || 1 ),
+			gridY = ( grid[ 1 ] || 1 ),
+			ox = Math.round( ( cs.width - os.width ) / gridX ) * gridX,
+			oy = Math.round( ( cs.height - os.height ) / gridY ) * gridY,
+			newWidth = os.width + ox,
+			newHeight = os.height + oy,
+			isMaxWidth = o.maxWidth && ( o.maxWidth < newWidth ),
+			isMaxHeight = o.maxHeight && ( o.maxHeight < newHeight ),
+			isMinWidth = o.minWidth && ( o.minWidth > newWidth ),
+			isMinHeight = o.minHeight && ( o.minHeight > newHeight );
+
+		o.grid = grid;
+
+		if ( isMinWidth ) {
+			newWidth += gridX;
+		}
+		if ( isMinHeight ) {
+			newHeight += gridY;
+		}
+		if ( isMaxWidth ) {
+			newWidth -= gridX;
+		}
+		if ( isMaxHeight ) {
+			newHeight -= gridY;
+		}
+
+		if ( /^(se|s|e)$/.test( a ) ) {
+			that.size.width = newWidth;
+			that.size.height = newHeight;
+		} else if ( /^(ne)$/.test( a ) ) {
+			that.size.width = newWidth;
+			that.size.height = newHeight;
+			that.position.top = op.top - oy;
+		} else if ( /^(sw)$/.test( a ) ) {
+			that.size.width = newWidth;
+			that.size.height = newHeight;
+			that.position.left = op.left - ox;
+		} else {
+			if ( newHeight - gridY <= 0 || newWidth - gridX <= 0 ) {
+				outerDimensions = that._getPaddingPlusBorderDimensions( this );
+			}
+
+			if ( newHeight - gridY > 0 ) {
+				that.size.height = newHeight;
+				that.position.top = op.top - oy;
+			} else {
+				newHeight = gridY - outerDimensions.height;
+				that.size.height = newHeight;
+				that.position.top = op.top + os.height - newHeight;
+			}
+			if ( newWidth - gridX > 0 ) {
+				that.size.width = newWidth;
+				that.position.left = op.left - ox;
+			} else {
+				newWidth = gridX - outerDimensions.width;
+				that.size.width = newWidth;
+				that.position.left = op.left + os.width - newWidth;
+			}
+		}
+	}
+
+} );
+
+return $.ui.resizable;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/resizable.min.js b/wp-includes/js/jquery/ui/resizable.min.js
index efdc6736c2..b424ef1407 100644
--- a/wp-includes/js/jquery/ui/resizable.min.js
+++ b/wp-includes/js/jquery/ui/resizable.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Resizable 1.11.4
+ * jQuery UI Resizable 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/resizable/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./mouse","./widget"],t):t(jQuery)}(function(w){return w.widget("ui.resizable",w.ui.mouse,{version:"1.11.4",widgetEventPrefix:"resize",options:{alsoResize:!1,animate:!1,animateDuration:"slow",animateEasing:"swing",aspectRatio:!1,autoHide:!1,containment:!1,ghost:!1,grid:!1,handles:"e,s,se",helper:!1,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:90,resize:null,start:null,stop:null},_num:function(t){return parseInt(t,10)||0},_isNumber:function(t){return!isNaN(parseInt(t,10))},_hasScroll:function(t,i){if("hidden"===w(t).css("overflow"))return!1;var e,s=i&&"left"===i?"scrollLeft":"scrollTop";return 0<t[s]||(t[s]=1,e=0<t[s],t[s]=0,e)},_create:function(){var t,i,e,s,n=this,h=this.options;if(this.element.addClass("ui-resizable"),w.extend(this,{_aspectRatio:!!h.aspectRatio,aspectRatio:h.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:h.helper||h.ghost||h.animate?h.helper||"ui-resizable-helper":null}),this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i)&&(this.element.wrap(w("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("ui-resizable",this.element.resizable("instance")),this.elementIsWrapper=!0,this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")}),this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0}),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css({margin:this.originalElement.css("margin")}),this._proportionallyResize()),this.handles=h.handles||(w(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se"),this._handles=w(),this.handles.constructor===String)for("all"===this.handles&&(this.handles="n,e,s,w,se,sw,ne,nw"),t=this.handles.split(","),this.handles={},i=0;i<t.length;i++)e=w.trim(t[i]),(s=w("<div class='ui-resizable-handle "+("ui-resizable-"+e)+"'></div>")).css({zIndex:h.zIndex}),"se"===e&&s.addClass("ui-icon ui-icon-gripsmall-diagonal-se"),this.handles[e]=".ui-resizable-"+e,this.element.append(s);this._renderAxis=function(t){var i,e,s,h;for(i in t=t||this.element,this.handles)this.handles[i].constructor===String?this.handles[i]=this.element.children(this.handles[i]).first().show():(this.handles[i].jquery||this.handles[i].nodeType)&&(this.handles[i]=w(this.handles[i]),this._on(this.handles[i],{mousedown:n._mouseDown})),this.elementIsWrapper&&this.originalElement[0].nodeName.match(/^(textarea|input|select|button)$/i)&&(e=w(this.handles[i],this.element),h=/sw|ne|nw|se|n|s/.test(i)?e.outerHeight():e.outerWidth(),s=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join(""),t.css(s,h),this._proportionallyResize()),this._handles=this._handles.add(this.handles[i])},this._renderAxis(this.element),this._handles=this._handles.add(this.element.find(".ui-resizable-handle")),this._handles.disableSelection(),this._handles.mouseover(function(){n.resizing||(this.className&&(s=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)),n.axis=s&&s[1]?s[1]:"se")}),h.autoHide&&(this._handles.hide(),w(this.element).addClass("ui-resizable-autohide").mouseenter(function(){h.disabled||(w(this).removeClass("ui-resizable-autohide"),n._handles.show())}).mouseleave(function(){h.disabled||n.resizing||(w(this).addClass("ui-resizable-autohide"),n._handles.hide())})),this._mouseInit()},_destroy:function(){this._mouseDestroy();function t(t){w(t).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}var i;return this.elementIsWrapper&&(t(this.element),i=this.element,this.originalElement.css({position:i.css("position"),width:i.outerWidth(),height:i.outerHeight(),top:i.css("top"),left:i.css("left")}).insertAfter(i),i.remove()),this.originalElement.css("resize",this.originalResizeStyle),t(this.originalElement),this},_mouseCapture:function(t){var i,e,s=!1;for(i in this.handles)(e=w(this.handles[i])[0])!==t.target&&!w.contains(e,t.target)||(s=!0);return!this.options.disabled&&s},_mouseStart:function(t){var i,e,s,h=this.options,n=this.element;return this.resizing=!0,this._renderProxy(),i=this._num(this.helper.css("left")),e=this._num(this.helper.css("top")),h.containment&&(i+=w(h.containment).scrollLeft()||0,e+=w(h.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:i,top:e},this.size=this._helper?{width:this.helper.width(),height:this.helper.height()}:{width:n.width(),height:n.height()},this.originalSize=this._helper?{width:n.outerWidth(),height:n.outerHeight()}:{width:n.width(),height:n.height()},this.sizeDiff={width:n.outerWidth()-n.width(),height:n.outerHeight()-n.height()},this.originalPosition={left:i,top:e},this.originalMousePosition={left:t.pageX,top:t.pageY},this.aspectRatio="number"==typeof h.aspectRatio?h.aspectRatio:this.originalSize.width/this.originalSize.height||1,s=w(".ui-resizable-"+this.axis).css("cursor"),w("body").css("cursor","auto"===s?this.axis+"-resize":s),n.addClass("ui-resizable-resizing"),this._propagate("start",t),!0},_mouseDrag:function(t){var i,e,s=this.originalMousePosition,h=this.axis,n=t.pageX-s.left||0,o=t.pageY-s.top||0,a=this._change[h];return this._updatePrevProperties(),a&&(i=a.apply(this,[t,n,o]),this._updateVirtualBoundaries(t.shiftKey),(this._aspectRatio||t.shiftKey)&&(i=this._updateRatio(i,t)),i=this._respectSize(i,t),this._updateCache(i),this._propagate("resize",t),e=this._applyChanges(),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),w.isEmptyObject(e)||(this._updatePrevProperties(),this._trigger("resize",t,this.ui()),this._applyChanges())),!1},_mouseStop:function(t){this.resizing=!1;var i,e,s,h,n,o,a,l=this.options,r=this;return this._helper&&(s=(e=(i=this._proportionallyResizeElements).length&&/textarea/i.test(i[0].nodeName))&&this._hasScroll(i[0],"left")?0:r.sizeDiff.height,h=e?0:r.sizeDiff.width,n={width:r.helper.width()-h,height:r.helper.height()-s},o=parseInt(r.element.css("left"),10)+(r.position.left-r.originalPosition.left)||null,a=parseInt(r.element.css("top"),10)+(r.position.top-r.originalPosition.top)||null,l.animate||this.element.css(w.extend(n,{top:a,left:o})),r.helper.height(r.size.height),r.helper.width(r.size.width),this._helper&&!l.animate&&this._proportionallyResize()),w("body").css("cursor","auto"),this.element.removeClass("ui-resizable-resizing"),this._propagate("stop",t),this._helper&&this.helper.remove(),!1},_updatePrevProperties:function(){this.prevPosition={top:this.position.top,left:this.position.left},this.prevSize={width:this.size.width,height:this.size.height}},_applyChanges:function(){var t={};return this.position.top!==this.prevPosition.top&&(t.top=this.position.top+"px"),this.position.left!==this.prevPosition.left&&(t.left=this.position.left+"px"),this.size.width!==this.prevSize.width&&(t.width=this.size.width+"px"),this.size.height!==this.prevSize.height&&(t.height=this.size.height+"px"),this.helper.css(t),t},_updateVirtualBoundaries:function(t){var i,e,s,h,n,o=this.options;n={minWidth:this._isNumber(o.minWidth)?o.minWidth:0,maxWidth:this._isNumber(o.maxWidth)?o.maxWidth:1/0,minHeight:this._isNumber(o.minHeight)?o.minHeight:0,maxHeight:this._isNumber(o.maxHeight)?o.maxHeight:1/0},(this._aspectRatio||t)&&(i=n.minHeight*this.aspectRatio,s=n.minWidth/this.aspectRatio,e=n.maxHeight*this.aspectRatio,h=n.maxWidth/this.aspectRatio,i>n.minWidth&&(n.minWidth=i),s>n.minHeight&&(n.minHeight=s),e<n.maxWidth&&(n.maxWidth=e),h<n.maxHeight&&(n.maxHeight=h)),this._vBoundaries=n},_updateCache:function(t){this.offset=this.helper.offset(),this._isNumber(t.left)&&(this.position.left=t.left),this._isNumber(t.top)&&(this.position.top=t.top),this._isNumber(t.height)&&(this.size.height=t.height),this._isNumber(t.width)&&(this.size.width=t.width)},_updateRatio:function(t){var i=this.position,e=this.size,s=this.axis;return this._isNumber(t.height)?t.width=t.height*this.aspectRatio:this._isNumber(t.width)&&(t.height=t.width/this.aspectRatio),"sw"===s&&(t.left=i.left+(e.width-t.width),t.top=null),"nw"===s&&(t.top=i.top+(e.height-t.height),t.left=i.left+(e.width-t.width)),t},_respectSize:function(t){var i=this._vBoundaries,e=this.axis,s=this._isNumber(t.width)&&i.maxWidth&&i.maxWidth<t.width,h=this._isNumber(t.height)&&i.maxHeight&&i.maxHeight<t.height,n=this._isNumber(t.width)&&i.minWidth&&i.minWidth>t.width,o=this._isNumber(t.height)&&i.minHeight&&i.minHeight>t.height,a=this.originalPosition.left+this.originalSize.width,l=this.position.top+this.size.height,r=/sw|nw|w/.test(e),p=/nw|ne|n/.test(e);return n&&(t.width=i.minWidth),o&&(t.height=i.minHeight),s&&(t.width=i.maxWidth),h&&(t.height=i.maxHeight),n&&r&&(t.left=a-i.minWidth),s&&r&&(t.left=a-i.maxWidth),o&&p&&(t.top=l-i.minHeight),h&&p&&(t.top=l-i.maxHeight),t.width||t.height||t.left||!t.top?t.width||t.height||t.top||!t.left||(t.left=null):t.top=null,t},_getPaddingPlusBorderDimensions:function(t){for(var i=0,e=[],s=[t.css("borderTopWidth"),t.css("borderRightWidth"),t.css("borderBottomWidth"),t.css("borderLeftWidth")],h=[t.css("paddingTop"),t.css("paddingRight"),t.css("paddingBottom"),t.css("paddingLeft")];i<4;i++)e[i]=parseInt(s[i],10)||0,e[i]+=parseInt(h[i],10)||0;return{height:e[0]+e[2],width:e[1]+e[3]}},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var t,i=0,e=this.helper||this.element;i<this._proportionallyResizeElements.length;i++)t=this._proportionallyResizeElements[i],this.outerDimensions||(this.outerDimensions=this._getPaddingPlusBorderDimensions(t)),t.css({height:e.height()-this.outerDimensions.height||0,width:e.width()-this.outerDimensions.width||0})},_renderProxy:function(){var t=this.element,i=this.options;this.elementOffset=t.offset(),this._helper?(this.helper=this.helper||w("<div style='overflow:hidden;'></div>"),this.helper.addClass(this._helper).css({width:this.element.outerWidth()-1,height:this.element.outerHeight()-1,position:"absolute",left:this.elementOffset.left+"px",top:this.elementOffset.top+"px",zIndex:++i.zIndex}),this.helper.appendTo("body").disableSelection()):this.helper=this.element},_change:{e:function(t,i){return{width:this.originalSize.width+i}},w:function(t,i){var e=this.originalSize;return{left:this.originalPosition.left+i,width:e.width-i}},n:function(t,i,e){var s=this.originalSize;return{top:this.originalPosition.top+e,height:s.height-e}},s:function(t,i,e){return{height:this.originalSize.height+e}},se:function(t,i,e){return w.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[t,i,e]))},sw:function(t,i,e){return w.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[t,i,e]))},ne:function(t,i,e){return w.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[t,i,e]))},nw:function(t,i,e){return w.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[t,i,e]))}},_propagate:function(t,i){w.ui.plugin.call(this,t,[i,this.ui()]),"resize"!==t&&this._trigger(t,i,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),w.ui.plugin.add("resizable","animate",{stop:function(i){var e=w(this).resizable("instance"),t=e.options,s=e._proportionallyResizeElements,h=s.length&&/textarea/i.test(s[0].nodeName),n=h&&e._hasScroll(s[0],"left")?0:e.sizeDiff.height,o=h?0:e.sizeDiff.width,a={width:e.size.width-o,height:e.size.height-n},l=parseInt(e.element.css("left"),10)+(e.position.left-e.originalPosition.left)||null,r=parseInt(e.element.css("top"),10)+(e.position.top-e.originalPosition.top)||null;e.element.animate(w.extend(a,r&&l?{top:r,left:l}:{}),{duration:t.animateDuration,easing:t.animateEasing,step:function(){var t={width:parseInt(e.element.css("width"),10),height:parseInt(e.element.css("height"),10),top:parseInt(e.element.css("top"),10),left:parseInt(e.element.css("left"),10)};s&&s.length&&w(s[0]).css({width:t.width,height:t.height}),e._updateCache(t),e._propagate("resize",i)}})}}),w.ui.plugin.add("resizable","containment",{start:function(){var e,s,t,i,h,n,o,a=w(this).resizable("instance"),l=a.options,r=a.element,p=l.containment,d=p instanceof w?p.get(0):/parent/.test(p)?r.parent().get(0):p;d&&(a.containerElement=w(d),/document/.test(p)||p===document?(a.containerOffset={left:0,top:0},a.containerPosition={left:0,top:0},a.parentData={element:w(document),left:0,top:0,width:w(document).width(),height:w(document).height()||document.body.parentNode.scrollHeight}):(e=w(d),s=[],w(["Top","Right","Left","Bottom"]).each(function(t,i){s[t]=a._num(e.css("padding"+i))}),a.containerOffset=e.offset(),a.containerPosition=e.position(),a.containerSize={height:e.innerHeight()-s[3],width:e.innerWidth()-s[1]},t=a.containerOffset,i=a.containerSize.height,h=a.containerSize.width,n=a._hasScroll(d,"left")?d.scrollWidth:h,o=a._hasScroll(d)?d.scrollHeight:i,a.parentData={element:d,left:t.left,top:t.top,width:n,height:o}))},resize:function(t){var i,e,s,h,n=w(this).resizable("instance"),o=n.options,a=n.containerOffset,l=n.position,r=n._aspectRatio||t.shiftKey,p={top:0,left:0},d=n.containerElement,g=!0;d[0]!==document&&/static/.test(d.css("position"))&&(p=a),l.left<(n._helper?a.left:0)&&(n.size.width=n.size.width+(n._helper?n.position.left-a.left:n.position.left-p.left),r&&(n.size.height=n.size.width/n.aspectRatio,g=!1),n.position.left=o.helper?a.left:0),l.top<(n._helper?a.top:0)&&(n.size.height=n.size.height+(n._helper?n.position.top-a.top:n.position.top),r&&(n.size.width=n.size.height*n.aspectRatio,g=!1),n.position.top=n._helper?a.top:0),s=n.containerElement.get(0)===n.element.parent().get(0),h=/relative|absolute/.test(n.containerElement.css("position")),s&&h?(n.offset.left=n.parentData.left+n.position.left,n.offset.top=n.parentData.top+n.position.top):(n.offset.left=n.element.offset().left,n.offset.top=n.element.offset().top),i=Math.abs(n.sizeDiff.width+(n._helper?n.offset.left-p.left:n.offset.left-a.left)),e=Math.abs(n.sizeDiff.height+(n._helper?n.offset.top-p.top:n.offset.top-a.top)),i+n.size.width>=n.parentData.width&&(n.size.width=n.parentData.width-i,r&&(n.size.height=n.size.width/n.aspectRatio,g=!1)),e+n.size.height>=n.parentData.height&&(n.size.height=n.parentData.height-e,r&&(n.size.width=n.size.height*n.aspectRatio,g=!1)),g||(n.position.left=n.prevPosition.left,n.position.top=n.prevPosition.top,n.size.width=n.prevSize.width,n.size.height=n.prevSize.height)},stop:function(){var t=w(this).resizable("instance"),i=t.options,e=t.containerOffset,s=t.containerPosition,h=t.containerElement,n=w(t.helper),o=n.offset(),a=n.outerWidth()-t.sizeDiff.width,l=n.outerHeight()-t.sizeDiff.height;t._helper&&!i.animate&&/relative/.test(h.css("position"))&&w(this).css({left:o.left-s.left-e.left,width:a,height:l}),t._helper&&!i.animate&&/static/.test(h.css("position"))&&w(this).css({left:o.left-s.left-e.left,width:a,height:l})}}),w.ui.plugin.add("resizable","alsoResize",{start:function(){var t=w(this).resizable("instance").options;w(t.alsoResize).each(function(){var t=w(this);t.data("ui-resizable-alsoresize",{width:parseInt(t.width(),10),height:parseInt(t.height(),10),left:parseInt(t.css("left"),10),top:parseInt(t.css("top"),10)})})},resize:function(t,e){var i=w(this).resizable("instance"),s=i.options,h=i.originalSize,n=i.originalPosition,o={height:i.size.height-h.height||0,width:i.size.width-h.width||0,top:i.position.top-n.top||0,left:i.position.left-n.left||0};w(s.alsoResize).each(function(){var t=w(this),s=w(this).data("ui-resizable-alsoresize"),h={},i=t.parents(e.originalElement[0]).length?["width","height"]:["width","height","top","left"];w.each(i,function(t,i){var e=(s[i]||0)+(o[i]||0);e&&0<=e&&(h[i]=e||null)}),t.css(h)})},stop:function(){w(this).removeData("resizable-alsoresize")}}),w.ui.plugin.add("resizable","ghost",{start:function(){var t=w(this).resizable("instance"),i=t.options,e=t.size;t.ghost=t.originalElement.clone(),t.ghost.css({opacity:.25,display:"block",position:"relative",height:e.height,width:e.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass("string"==typeof i.ghost?i.ghost:""),t.ghost.appendTo(t.helper)},resize:function(){var t=w(this).resizable("instance");t.ghost&&t.ghost.css({position:"relative",height:t.size.height,width:t.size.width})},stop:function(){var t=w(this).resizable("instance");t.ghost&&t.helper&&t.helper.get(0).removeChild(t.ghost.get(0))}}),w.ui.plugin.add("resizable","grid",{resize:function(){var t,i=w(this).resizable("instance"),e=i.options,s=i.size,h=i.originalSize,n=i.originalPosition,o=i.axis,a="number"==typeof e.grid?[e.grid,e.grid]:e.grid,l=a[0]||1,r=a[1]||1,p=Math.round((s.width-h.width)/l)*l,d=Math.round((s.height-h.height)/r)*r,g=h.width+p,u=h.height+d,m=e.maxWidth&&e.maxWidth<g,f=e.maxHeight&&e.maxHeight<u,c=e.minWidth&&e.minWidth>g,z=e.minHeight&&e.minHeight>u;e.grid=a,c&&(g+=l),z&&(u+=r),m&&(g-=l),f&&(u-=r),/^(se|s|e)$/.test(o)?(i.size.width=g,i.size.height=u):/^(ne)$/.test(o)?(i.size.width=g,i.size.height=u,i.position.top=n.top-d):/^(sw)$/.test(o)?(i.size.width=g,i.size.height=u,i.position.left=n.left-p):((u-r<=0||g-l<=0)&&(t=i._getPaddingPlusBorderDimensions(this)),0<u-r?(i.size.height=u,i.position.top=n.top-d):(u=r-t.height,i.size.height=u,i.position.top=n.top+h.height-u),0<g-l?(i.size.width=g,i.position.left=n.left-p):(g=l-t.width,i.size.width=g,i.position.left=n.left+h.width-g))}}),w.ui.resizable});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./mouse","./core"],t):t(jQuery)}(function(w){return w.widget("ui.resizable",w.ui.mouse,{version:"1.12.1",widgetEventPrefix:"resize",options:{alsoResize:!1,animate:!1,animateDuration:"slow",animateEasing:"swing",aspectRatio:!1,autoHide:!1,classes:{"ui-resizable-se":"ui-icon ui-icon-gripsmall-diagonal-se"},containment:!1,ghost:!1,grid:!1,handles:"e,s,se",helper:!1,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:90,resize:null,start:null,stop:null},_num:function(t){return parseFloat(t)||0},_isNumber:function(t){return!isNaN(parseFloat(t))},_hasScroll:function(t,i){if("hidden"===w(t).css("overflow"))return!1;var e,s=i&&"left"===i?"scrollLeft":"scrollTop";return 0<t[s]||(t[s]=1,e=0<t[s],t[s]=0,e)},_create:function(){var t,i=this.options,e=this;this._addClass("ui-resizable"),w.extend(this,{_aspectRatio:!!i.aspectRatio,aspectRatio:i.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:i.helper||i.ghost||i.animate?i.helper||"ui-resizable-helper":null}),this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i)&&(this.element.wrap(w("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")})),this.element=this.element.parent().data("ui-resizable",this.element.resizable("instance")),this.elementIsWrapper=!0,t={marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom"),marginLeft:this.originalElement.css("marginLeft")},this.element.css(t),this.originalElement.css("margin",0),this.originalResizeStyle=this.originalElement.css("resize"),this.originalElement.css("resize","none"),this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"})),this.originalElement.css(t),this._proportionallyResize()),this._setupHandles(),i.autoHide&&w(this.element).on("mouseenter",function(){i.disabled||(e._removeClass("ui-resizable-autohide"),e._handles.show())}).on("mouseleave",function(){i.disabled||e.resizing||(e._addClass("ui-resizable-autohide"),e._handles.hide())}),this._mouseInit()},_destroy:function(){this._mouseDestroy();function t(t){w(t).removeData("resizable").removeData("ui-resizable").off(".resizable").find(".ui-resizable-handle").remove()}var i;return this.elementIsWrapper&&(t(this.element),i=this.element,this.originalElement.css({position:i.css("position"),width:i.outerWidth(),height:i.outerHeight(),top:i.css("top"),left:i.css("left")}).insertAfter(i),i.remove()),this.originalElement.css("resize",this.originalResizeStyle),t(this.originalElement),this},_setOption:function(t,i){switch(this._super(t,i),t){case"handles":this._removeHandles(),this._setupHandles()}},_setupHandles:function(){var t,i,e,s,h,n=this.options,o=this;if(this.handles=n.handles||(w(".ui-resizable-handle",this.element).length?{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"}:"e,s,se"),this._handles=w(),this.handles.constructor===String)for("all"===this.handles&&(this.handles="n,e,s,w,se,sw,ne,nw"),e=this.handles.split(","),this.handles={},i=0;i<e.length;i++)s="ui-resizable-"+(t=w.trim(e[i])),h=w("<div>"),this._addClass(h,"ui-resizable-handle "+s),h.css({zIndex:n.zIndex}),this.handles[t]=".ui-resizable-"+t,this.element.append(h);this._renderAxis=function(t){var i,e,s,h;for(i in t=t||this.element,this.handles)this.handles[i].constructor===String?this.handles[i]=this.element.children(this.handles[i]).first().show():(this.handles[i].jquery||this.handles[i].nodeType)&&(this.handles[i]=w(this.handles[i]),this._on(this.handles[i],{mousedown:o._mouseDown})),this.elementIsWrapper&&this.originalElement[0].nodeName.match(/^(textarea|input|select|button)$/i)&&(e=w(this.handles[i],this.element),h=/sw|ne|nw|se|n|s/.test(i)?e.outerHeight():e.outerWidth(),s=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join(""),t.css(s,h),this._proportionallyResize()),this._handles=this._handles.add(this.handles[i])},this._renderAxis(this.element),this._handles=this._handles.add(this.element.find(".ui-resizable-handle")),this._handles.disableSelection(),this._handles.on("mouseover",function(){o.resizing||(this.className&&(h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)),o.axis=h&&h[1]?h[1]:"se")}),n.autoHide&&(this._handles.hide(),this._addClass("ui-resizable-autohide"))},_removeHandles:function(){this._handles.remove()},_mouseCapture:function(t){var i,e,s=!1;for(i in this.handles)(e=w(this.handles[i])[0])!==t.target&&!w.contains(e,t.target)||(s=!0);return!this.options.disabled&&s},_mouseStart:function(t){var i,e,s,h=this.options,n=this.element;return this.resizing=!0,this._renderProxy(),i=this._num(this.helper.css("left")),e=this._num(this.helper.css("top")),h.containment&&(i+=w(h.containment).scrollLeft()||0,e+=w(h.containment).scrollTop()||0),this.offset=this.helper.offset(),this.position={left:i,top:e},this.size=this._helper?{width:this.helper.width(),height:this.helper.height()}:{width:n.width(),height:n.height()},this.originalSize=this._helper?{width:n.outerWidth(),height:n.outerHeight()}:{width:n.width(),height:n.height()},this.sizeDiff={width:n.outerWidth()-n.width(),height:n.outerHeight()-n.height()},this.originalPosition={left:i,top:e},this.originalMousePosition={left:t.pageX,top:t.pageY},this.aspectRatio="number"==typeof h.aspectRatio?h.aspectRatio:this.originalSize.width/this.originalSize.height||1,s=w(".ui-resizable-"+this.axis).css("cursor"),w("body").css("cursor","auto"===s?this.axis+"-resize":s),this._addClass("ui-resizable-resizing"),this._propagate("start",t),!0},_mouseDrag:function(t){var i,e,s=this.originalMousePosition,h=this.axis,n=t.pageX-s.left||0,o=t.pageY-s.top||0,a=this._change[h];return this._updatePrevProperties(),a&&(i=a.apply(this,[t,n,o]),this._updateVirtualBoundaries(t.shiftKey),(this._aspectRatio||t.shiftKey)&&(i=this._updateRatio(i,t)),i=this._respectSize(i,t),this._updateCache(i),this._propagate("resize",t),e=this._applyChanges(),!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize(),w.isEmptyObject(e)||(this._updatePrevProperties(),this._trigger("resize",t,this.ui()),this._applyChanges())),!1},_mouseStop:function(t){this.resizing=!1;var i,e,s,h,n,o,a,l=this.options,r=this;return this._helper&&(s=(e=(i=this._proportionallyResizeElements).length&&/textarea/i.test(i[0].nodeName))&&this._hasScroll(i[0],"left")?0:r.sizeDiff.height,h=e?0:r.sizeDiff.width,n={width:r.helper.width()-h,height:r.helper.height()-s},o=parseFloat(r.element.css("left"))+(r.position.left-r.originalPosition.left)||null,a=parseFloat(r.element.css("top"))+(r.position.top-r.originalPosition.top)||null,l.animate||this.element.css(w.extend(n,{top:a,left:o})),r.helper.height(r.size.height),r.helper.width(r.size.width),this._helper&&!l.animate&&this._proportionallyResize()),w("body").css("cursor","auto"),this._removeClass("ui-resizable-resizing"),this._propagate("stop",t),this._helper&&this.helper.remove(),!1},_updatePrevProperties:function(){this.prevPosition={top:this.position.top,left:this.position.left},this.prevSize={width:this.size.width,height:this.size.height}},_applyChanges:function(){var t={};return this.position.top!==this.prevPosition.top&&(t.top=this.position.top+"px"),this.position.left!==this.prevPosition.left&&(t.left=this.position.left+"px"),this.size.width!==this.prevSize.width&&(t.width=this.size.width+"px"),this.size.height!==this.prevSize.height&&(t.height=this.size.height+"px"),this.helper.css(t),t},_updateVirtualBoundaries:function(t){var i,e,s,h,n,o=this.options;n={minWidth:this._isNumber(o.minWidth)?o.minWidth:0,maxWidth:this._isNumber(o.maxWidth)?o.maxWidth:1/0,minHeight:this._isNumber(o.minHeight)?o.minHeight:0,maxHeight:this._isNumber(o.maxHeight)?o.maxHeight:1/0},(this._aspectRatio||t)&&(i=n.minHeight*this.aspectRatio,s=n.minWidth/this.aspectRatio,e=n.maxHeight*this.aspectRatio,h=n.maxWidth/this.aspectRatio,i>n.minWidth&&(n.minWidth=i),s>n.minHeight&&(n.minHeight=s),e<n.maxWidth&&(n.maxWidth=e),h<n.maxHeight&&(n.maxHeight=h)),this._vBoundaries=n},_updateCache:function(t){this.offset=this.helper.offset(),this._isNumber(t.left)&&(this.position.left=t.left),this._isNumber(t.top)&&(this.position.top=t.top),this._isNumber(t.height)&&(this.size.height=t.height),this._isNumber(t.width)&&(this.size.width=t.width)},_updateRatio:function(t){var i=this.position,e=this.size,s=this.axis;return this._isNumber(t.height)?t.width=t.height*this.aspectRatio:this._isNumber(t.width)&&(t.height=t.width/this.aspectRatio),"sw"===s&&(t.left=i.left+(e.width-t.width),t.top=null),"nw"===s&&(t.top=i.top+(e.height-t.height),t.left=i.left+(e.width-t.width)),t},_respectSize:function(t){var i=this._vBoundaries,e=this.axis,s=this._isNumber(t.width)&&i.maxWidth&&i.maxWidth<t.width,h=this._isNumber(t.height)&&i.maxHeight&&i.maxHeight<t.height,n=this._isNumber(t.width)&&i.minWidth&&i.minWidth>t.width,o=this._isNumber(t.height)&&i.minHeight&&i.minHeight>t.height,a=this.originalPosition.left+this.originalSize.width,l=this.originalPosition.top+this.originalSize.height,r=/sw|nw|w/.test(e),p=/nw|ne|n/.test(e);return n&&(t.width=i.minWidth),o&&(t.height=i.minHeight),s&&(t.width=i.maxWidth),h&&(t.height=i.maxHeight),n&&r&&(t.left=a-i.minWidth),s&&r&&(t.left=a-i.maxWidth),o&&p&&(t.top=l-i.minHeight),h&&p&&(t.top=l-i.maxHeight),t.width||t.height||t.left||!t.top?t.width||t.height||t.top||!t.left||(t.left=null):t.top=null,t},_getPaddingPlusBorderDimensions:function(t){for(var i=0,e=[],s=[t.css("borderTopWidth"),t.css("borderRightWidth"),t.css("borderBottomWidth"),t.css("borderLeftWidth")],h=[t.css("paddingTop"),t.css("paddingRight"),t.css("paddingBottom"),t.css("paddingLeft")];i<4;i++)e[i]=parseFloat(s[i])||0,e[i]+=parseFloat(h[i])||0;return{height:e[0]+e[2],width:e[1]+e[3]}},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var t,i=0,e=this.helper||this.element;i<this._proportionallyResizeElements.length;i++)t=this._proportionallyResizeElements[i],this.outerDimensions||(this.outerDimensions=this._getPaddingPlusBorderDimensions(t)),t.css({height:e.height()-this.outerDimensions.height||0,width:e.width()-this.outerDimensions.width||0})},_renderProxy:function(){var t=this.element,i=this.options;this.elementOffset=t.offset(),this._helper?(this.helper=this.helper||w("<div style='overflow:hidden;'></div>"),this._addClass(this.helper,this._helper),this.helper.css({width:this.element.outerWidth(),height:this.element.outerHeight(),position:"absolute",left:this.elementOffset.left+"px",top:this.elementOffset.top+"px",zIndex:++i.zIndex}),this.helper.appendTo("body").disableSelection()):this.helper=this.element},_change:{e:function(t,i){return{width:this.originalSize.width+i}},w:function(t,i){var e=this.originalSize;return{left:this.originalPosition.left+i,width:e.width-i}},n:function(t,i,e){var s=this.originalSize;return{top:this.originalPosition.top+e,height:s.height-e}},s:function(t,i,e){return{height:this.originalSize.height+e}},se:function(t,i,e){return w.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[t,i,e]))},sw:function(t,i,e){return w.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[t,i,e]))},ne:function(t,i,e){return w.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[t,i,e]))},nw:function(t,i,e){return w.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[t,i,e]))}},_propagate:function(t,i){w.ui.plugin.call(this,t,[i,this.ui()]),"resize"!==t&&this._trigger(t,i,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}}),w.ui.plugin.add("resizable","animate",{stop:function(i){var e=w(this).resizable("instance"),t=e.options,s=e._proportionallyResizeElements,h=s.length&&/textarea/i.test(s[0].nodeName),n=h&&e._hasScroll(s[0],"left")?0:e.sizeDiff.height,o=h?0:e.sizeDiff.width,a={width:e.size.width-o,height:e.size.height-n},l=parseFloat(e.element.css("left"))+(e.position.left-e.originalPosition.left)||null,r=parseFloat(e.element.css("top"))+(e.position.top-e.originalPosition.top)||null;e.element.animate(w.extend(a,r&&l?{top:r,left:l}:{}),{duration:t.animateDuration,easing:t.animateEasing,step:function(){var t={width:parseFloat(e.element.css("width")),height:parseFloat(e.element.css("height")),top:parseFloat(e.element.css("top")),left:parseFloat(e.element.css("left"))};s&&s.length&&w(s[0]).css({width:t.width,height:t.height}),e._updateCache(t),e._propagate("resize",i)}})}}),w.ui.plugin.add("resizable","containment",{start:function(){var e,s,t,i,h,n,o,a=w(this).resizable("instance"),l=a.options,r=a.element,p=l.containment,d=p instanceof w?p.get(0):/parent/.test(p)?r.parent().get(0):p;d&&(a.containerElement=w(d),/document/.test(p)||p===document?(a.containerOffset={left:0,top:0},a.containerPosition={left:0,top:0},a.parentData={element:w(document),left:0,top:0,width:w(document).width(),height:w(document).height()||document.body.parentNode.scrollHeight}):(e=w(d),s=[],w(["Top","Right","Left","Bottom"]).each(function(t,i){s[t]=a._num(e.css("padding"+i))}),a.containerOffset=e.offset(),a.containerPosition=e.position(),a.containerSize={height:e.innerHeight()-s[3],width:e.innerWidth()-s[1]},t=a.containerOffset,i=a.containerSize.height,h=a.containerSize.width,n=a._hasScroll(d,"left")?d.scrollWidth:h,o=a._hasScroll(d)?d.scrollHeight:i,a.parentData={element:d,left:t.left,top:t.top,width:n,height:o}))},resize:function(t){var i,e,s,h,n=w(this).resizable("instance"),o=n.options,a=n.containerOffset,l=n.position,r=n._aspectRatio||t.shiftKey,p={top:0,left:0},d=n.containerElement,g=!0;d[0]!==document&&/static/.test(d.css("position"))&&(p=a),l.left<(n._helper?a.left:0)&&(n.size.width=n.size.width+(n._helper?n.position.left-a.left:n.position.left-p.left),r&&(n.size.height=n.size.width/n.aspectRatio,g=!1),n.position.left=o.helper?a.left:0),l.top<(n._helper?a.top:0)&&(n.size.height=n.size.height+(n._helper?n.position.top-a.top:n.position.top),r&&(n.size.width=n.size.height*n.aspectRatio,g=!1),n.position.top=n._helper?a.top:0),s=n.containerElement.get(0)===n.element.parent().get(0),h=/relative|absolute/.test(n.containerElement.css("position")),s&&h?(n.offset.left=n.parentData.left+n.position.left,n.offset.top=n.parentData.top+n.position.top):(n.offset.left=n.element.offset().left,n.offset.top=n.element.offset().top),i=Math.abs(n.sizeDiff.width+(n._helper?n.offset.left-p.left:n.offset.left-a.left)),e=Math.abs(n.sizeDiff.height+(n._helper?n.offset.top-p.top:n.offset.top-a.top)),i+n.size.width>=n.parentData.width&&(n.size.width=n.parentData.width-i,r&&(n.size.height=n.size.width/n.aspectRatio,g=!1)),e+n.size.height>=n.parentData.height&&(n.size.height=n.parentData.height-e,r&&(n.size.width=n.size.height*n.aspectRatio,g=!1)),g||(n.position.left=n.prevPosition.left,n.position.top=n.prevPosition.top,n.size.width=n.prevSize.width,n.size.height=n.prevSize.height)},stop:function(){var t=w(this).resizable("instance"),i=t.options,e=t.containerOffset,s=t.containerPosition,h=t.containerElement,n=w(t.helper),o=n.offset(),a=n.outerWidth()-t.sizeDiff.width,l=n.outerHeight()-t.sizeDiff.height;t._helper&&!i.animate&&/relative/.test(h.css("position"))&&w(this).css({left:o.left-s.left-e.left,width:a,height:l}),t._helper&&!i.animate&&/static/.test(h.css("position"))&&w(this).css({left:o.left-s.left-e.left,width:a,height:l})}}),w.ui.plugin.add("resizable","alsoResize",{start:function(){var t=w(this).resizable("instance").options;w(t.alsoResize).each(function(){var t=w(this);t.data("ui-resizable-alsoresize",{width:parseFloat(t.width()),height:parseFloat(t.height()),left:parseFloat(t.css("left")),top:parseFloat(t.css("top"))})})},resize:function(t,e){var i=w(this).resizable("instance"),s=i.options,h=i.originalSize,n=i.originalPosition,o={height:i.size.height-h.height||0,width:i.size.width-h.width||0,top:i.position.top-n.top||0,left:i.position.left-n.left||0};w(s.alsoResize).each(function(){var t=w(this),s=w(this).data("ui-resizable-alsoresize"),h={},i=t.parents(e.originalElement[0]).length?["width","height"]:["width","height","top","left"];w.each(i,function(t,i){var e=(s[i]||0)+(o[i]||0);e&&0<=e&&(h[i]=e||null)}),t.css(h)})},stop:function(){w(this).removeData("ui-resizable-alsoresize")}}),w.ui.plugin.add("resizable","ghost",{start:function(){var t=w(this).resizable("instance"),i=t.size;t.ghost=t.originalElement.clone(),t.ghost.css({opacity:.25,display:"block",position:"relative",height:i.height,width:i.width,margin:0,left:0,top:0}),t._addClass(t.ghost,"ui-resizable-ghost"),!1!==w.uiBackCompat&&"string"==typeof t.options.ghost&&t.ghost.addClass(this.options.ghost),t.ghost.appendTo(t.helper)},resize:function(){var t=w(this).resizable("instance");t.ghost&&t.ghost.css({position:"relative",height:t.size.height,width:t.size.width})},stop:function(){var t=w(this).resizable("instance");t.ghost&&t.helper&&t.helper.get(0).removeChild(t.ghost.get(0))}}),w.ui.plugin.add("resizable","grid",{resize:function(){var t,i=w(this).resizable("instance"),e=i.options,s=i.size,h=i.originalSize,n=i.originalPosition,o=i.axis,a="number"==typeof e.grid?[e.grid,e.grid]:e.grid,l=a[0]||1,r=a[1]||1,p=Math.round((s.width-h.width)/l)*l,d=Math.round((s.height-h.height)/r)*r,g=h.width+p,u=h.height+d,f=e.maxWidth&&e.maxWidth<g,c=e.maxHeight&&e.maxHeight<u,m=e.minWidth&&e.minWidth>g,z=e.minHeight&&e.minHeight>u;e.grid=a,m&&(g+=l),z&&(u+=r),f&&(g-=l),c&&(u-=r),/^(se|s|e)$/.test(o)?(i.size.width=g,i.size.height=u):/^(ne)$/.test(o)?(i.size.width=g,i.size.height=u,i.position.top=n.top-d):/^(sw)$/.test(o)?(i.size.width=g,i.size.height=u,i.position.left=n.left-p):((u-r<=0||g-l<=0)&&(t=i._getPaddingPlusBorderDimensions(this)),0<u-r?(i.size.height=u,i.position.top=n.top-d):(u=r-t.height,i.size.height=u,i.position.top=n.top+h.height-u),0<g-l?(i.size.width=g,i.position.left=n.left-p):(g=l-t.width,i.size.width=g,i.position.left=n.left+h.width-g))}}),w.ui.resizable});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/selectable.js b/wp-includes/js/jquery/ui/selectable.js
new file mode 100644
index 0000000000..8c0ebce159
--- /dev/null
+++ b/wp-includes/js/jquery/ui/selectable.js
@@ -0,0 +1,309 @@
+/*!
+ * jQuery UI Selectable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Selectable
+//>>group: Interactions
+//>>description: Allows groups of elements to be selected with the mouse.
+//>>docs: http://api.jqueryui.com/selectable/
+//>>demos: http://jqueryui.com/selectable/
+//>>css.structure: ../../themes/base/selectable.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./mouse",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.selectable", $.ui.mouse, {
+	version: "1.12.1",
+	options: {
+		appendTo: "body",
+		autoRefresh: true,
+		distance: 0,
+		filter: "*",
+		tolerance: "touch",
+
+		// Callbacks
+		selected: null,
+		selecting: null,
+		start: null,
+		stop: null,
+		unselected: null,
+		unselecting: null
+	},
+	_create: function() {
+		var that = this;
+
+		this._addClass( "ui-selectable" );
+
+		this.dragged = false;
+
+		// Cache selectee children based on filter
+		this.refresh = function() {
+			that.elementPos = $( that.element[ 0 ] ).offset();
+			that.selectees = $( that.options.filter, that.element[ 0 ] );
+			that._addClass( that.selectees, "ui-selectee" );
+			that.selectees.each( function() {
+				var $this = $( this ),
+					selecteeOffset = $this.offset(),
+					pos = {
+						left: selecteeOffset.left - that.elementPos.left,
+						top: selecteeOffset.top - that.elementPos.top
+					};
+				$.data( this, "selectable-item", {
+					element: this,
+					$element: $this,
+					left: pos.left,
+					top: pos.top,
+					right: pos.left + $this.outerWidth(),
+					bottom: pos.top + $this.outerHeight(),
+					startselected: false,
+					selected: $this.hasClass( "ui-selected" ),
+					selecting: $this.hasClass( "ui-selecting" ),
+					unselecting: $this.hasClass( "ui-unselecting" )
+				} );
+			} );
+		};
+		this.refresh();
+
+		this._mouseInit();
+
+		this.helper = $( "<div>" );
+		this._addClass( this.helper, "ui-selectable-helper" );
+	},
+
+	_destroy: function() {
+		this.selectees.removeData( "selectable-item" );
+		this._mouseDestroy();
+	},
+
+	_mouseStart: function( event ) {
+		var that = this,
+			options = this.options;
+
+		this.opos = [ event.pageX, event.pageY ];
+		this.elementPos = $( this.element[ 0 ] ).offset();
+
+		if ( this.options.disabled ) {
+			return;
+		}
+
+		this.selectees = $( options.filter, this.element[ 0 ] );
+
+		this._trigger( "start", event );
+
+		$( options.appendTo ).append( this.helper );
+
+		// position helper (lasso)
+		this.helper.css( {
+			"left": event.pageX,
+			"top": event.pageY,
+			"width": 0,
+			"height": 0
+		} );
+
+		if ( options.autoRefresh ) {
+			this.refresh();
+		}
+
+		this.selectees.filter( ".ui-selected" ).each( function() {
+			var selectee = $.data( this, "selectable-item" );
+			selectee.startselected = true;
+			if ( !event.metaKey && !event.ctrlKey ) {
+				that._removeClass( selectee.$element, "ui-selected" );
+				selectee.selected = false;
+				that._addClass( selectee.$element, "ui-unselecting" );
+				selectee.unselecting = true;
+
+				// selectable UNSELECTING callback
+				that._trigger( "unselecting", event, {
+					unselecting: selectee.element
+				} );
+			}
+		} );
+
+		$( event.target ).parents().addBack().each( function() {
+			var doSelect,
+				selectee = $.data( this, "selectable-item" );
+			if ( selectee ) {
+				doSelect = ( !event.metaKey && !event.ctrlKey ) ||
+					!selectee.$element.hasClass( "ui-selected" );
+				that._removeClass( selectee.$element, doSelect ? "ui-unselecting" : "ui-selected" )
+					._addClass( selectee.$element, doSelect ? "ui-selecting" : "ui-unselecting" );
+				selectee.unselecting = !doSelect;
+				selectee.selecting = doSelect;
+				selectee.selected = doSelect;
+
+				// selectable (UN)SELECTING callback
+				if ( doSelect ) {
+					that._trigger( "selecting", event, {
+						selecting: selectee.element
+					} );
+				} else {
+					that._trigger( "unselecting", event, {
+						unselecting: selectee.element
+					} );
+				}
+				return false;
+			}
+		} );
+
+	},
+
+	_mouseDrag: function( event ) {
+
+		this.dragged = true;
+
+		if ( this.options.disabled ) {
+			return;
+		}
+
+		var tmp,
+			that = this,
+			options = this.options,
+			x1 = this.opos[ 0 ],
+			y1 = this.opos[ 1 ],
+			x2 = event.pageX,
+			y2 = event.pageY;
+
+		if ( x1 > x2 ) { tmp = x2; x2 = x1; x1 = tmp; }
+		if ( y1 > y2 ) { tmp = y2; y2 = y1; y1 = tmp; }
+		this.helper.css( { left: x1, top: y1, width: x2 - x1, height: y2 - y1 } );
+
+		this.selectees.each( function() {
+			var selectee = $.data( this, "selectable-item" ),
+				hit = false,
+				offset = {};
+
+			//prevent helper from being selected if appendTo: selectable
+			if ( !selectee || selectee.element === that.element[ 0 ] ) {
+				return;
+			}
+
+			offset.left   = selectee.left   + that.elementPos.left;
+			offset.right  = selectee.right  + that.elementPos.left;
+			offset.top    = selectee.top    + that.elementPos.top;
+			offset.bottom = selectee.bottom + that.elementPos.top;
+
+			if ( options.tolerance === "touch" ) {
+				hit = ( !( offset.left > x2 || offset.right < x1 || offset.top > y2 ||
+                    offset.bottom < y1 ) );
+			} else if ( options.tolerance === "fit" ) {
+				hit = ( offset.left > x1 && offset.right < x2 && offset.top > y1 &&
+                    offset.bottom < y2 );
+			}
+
+			if ( hit ) {
+
+				// SELECT
+				if ( selectee.selected ) {
+					that._removeClass( selectee.$element, "ui-selected" );
+					selectee.selected = false;
+				}
+				if ( selectee.unselecting ) {
+					that._removeClass( selectee.$element, "ui-unselecting" );
+					selectee.unselecting = false;
+				}
+				if ( !selectee.selecting ) {
+					that._addClass( selectee.$element, "ui-selecting" );
+					selectee.selecting = true;
+
+					// selectable SELECTING callback
+					that._trigger( "selecting", event, {
+						selecting: selectee.element
+					} );
+				}
+			} else {
+
+				// UNSELECT
+				if ( selectee.selecting ) {
+					if ( ( event.metaKey || event.ctrlKey ) && selectee.startselected ) {
+						that._removeClass( selectee.$element, "ui-selecting" );
+						selectee.selecting = false;
+						that._addClass( selectee.$element, "ui-selected" );
+						selectee.selected = true;
+					} else {
+						that._removeClass( selectee.$element, "ui-selecting" );
+						selectee.selecting = false;
+						if ( selectee.startselected ) {
+							that._addClass( selectee.$element, "ui-unselecting" );
+							selectee.unselecting = true;
+						}
+
+						// selectable UNSELECTING callback
+						that._trigger( "unselecting", event, {
+							unselecting: selectee.element
+						} );
+					}
+				}
+				if ( selectee.selected ) {
+					if ( !event.metaKey && !event.ctrlKey && !selectee.startselected ) {
+						that._removeClass( selectee.$element, "ui-selected" );
+						selectee.selected = false;
+
+						that._addClass( selectee.$element, "ui-unselecting" );
+						selectee.unselecting = true;
+
+						// selectable UNSELECTING callback
+						that._trigger( "unselecting", event, {
+							unselecting: selectee.element
+						} );
+					}
+				}
+			}
+		} );
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+		var that = this;
+
+		this.dragged = false;
+
+		$( ".ui-unselecting", this.element[ 0 ] ).each( function() {
+			var selectee = $.data( this, "selectable-item" );
+			that._removeClass( selectee.$element, "ui-unselecting" );
+			selectee.unselecting = false;
+			selectee.startselected = false;
+			that._trigger( "unselected", event, {
+				unselected: selectee.element
+			} );
+		} );
+		$( ".ui-selecting", this.element[ 0 ] ).each( function() {
+			var selectee = $.data( this, "selectable-item" );
+			that._removeClass( selectee.$element, "ui-selecting" )
+				._addClass( selectee.$element, "ui-selected" );
+			selectee.selecting = false;
+			selectee.selected = true;
+			selectee.startselected = true;
+			that._trigger( "selected", event, {
+				selected: selectee.element
+			} );
+		} );
+		this._trigger( "stop", event );
+
+		this.helper.remove();
+
+		return false;
+	}
+
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/selectable.min.js b/wp-includes/js/jquery/ui/selectable.min.js
index 4abc417642..9653407624 100644
--- a/wp-includes/js/jquery/ui/selectable.min.js
+++ b/wp-includes/js/jquery/ui/selectable.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Selectable 1.11.4
+ * jQuery UI Selectable 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/selectable/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./mouse","./widget"],e):e(jQuery)}(function(u){return u.widget("ui.selectable",u.ui.mouse,{version:"1.11.4",options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch",selected:null,selecting:null,start:null,stop:null,unselected:null,unselecting:null},_create:function(){var e,t=this;this.element.addClass("ui-selectable"),this.dragged=!1,this.refresh=function(){(e=u(t.options.filter,t.element[0])).addClass("ui-selectee"),e.each(function(){var e=u(this),t=e.offset();u.data(this,"selectable-item",{element:this,$element:e,left:t.left,top:t.top,right:t.left+e.outerWidth(),bottom:t.top+e.outerHeight(),startselected:!1,selected:e.hasClass("ui-selected"),selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})},this.refresh(),this.selectees=e.addClass("ui-selectee"),this._mouseInit(),this.helper=u("<div class='ui-selectable-helper'></div>")},_destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item"),this.element.removeClass("ui-selectable ui-selectable-disabled"),this._mouseDestroy()},_mouseStart:function(s){var l=this,e=this.options;this.opos=[s.pageX,s.pageY],this.options.disabled||(this.selectees=u(e.filter,this.element[0]),this._trigger("start",s),u(e.appendTo).append(this.helper),this.helper.css({left:s.pageX,top:s.pageY,width:0,height:0}),e.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var e=u.data(this,"selectable-item");e.startselected=!0,s.metaKey||s.ctrlKey||(e.$element.removeClass("ui-selected"),e.selected=!1,e.$element.addClass("ui-unselecting"),e.unselecting=!0,l._trigger("unselecting",s,{unselecting:e.element}))}),u(s.target).parents().addBack().each(function(){var e,t=u.data(this,"selectable-item");if(t)return e=!s.metaKey&&!s.ctrlKey||!t.$element.hasClass("ui-selected"),t.$element.removeClass(e?"ui-unselecting":"ui-selected").addClass(e?"ui-selecting":"ui-unselecting"),t.unselecting=!e,t.selecting=e,(t.selected=e)?l._trigger("selecting",s,{selecting:t.element}):l._trigger("unselecting",s,{unselecting:t.element}),!1}))},_mouseDrag:function(s){if(this.dragged=!0,!this.options.disabled){var e,l=this,i=this.options,n=this.opos[0],c=this.opos[1],a=s.pageX,r=s.pageY;return a<n&&(e=a,a=n,n=e),r<c&&(e=r,r=c,c=e),this.helper.css({left:n,top:c,width:a-n,height:r-c}),this.selectees.each(function(){var e=u.data(this,"selectable-item"),t=!1;e&&e.element!==l.element[0]&&("touch"===i.tolerance?t=!(e.left>a||e.right<n||e.top>r||e.bottom<c):"fit"===i.tolerance&&(t=e.left>n&&e.right<a&&e.top>c&&e.bottom<r),t?(e.selected&&(e.$element.removeClass("ui-selected"),e.selected=!1),e.unselecting&&(e.$element.removeClass("ui-unselecting"),e.unselecting=!1),e.selecting||(e.$element.addClass("ui-selecting"),e.selecting=!0,l._trigger("selecting",s,{selecting:e.element}))):(e.selecting&&((s.metaKey||s.ctrlKey)&&e.startselected?(e.$element.removeClass("ui-selecting"),e.selecting=!1,e.$element.addClass("ui-selected"),e.selected=!0):(e.$element.removeClass("ui-selecting"),e.selecting=!1,e.startselected&&(e.$element.addClass("ui-unselecting"),e.unselecting=!0),l._trigger("unselecting",s,{unselecting:e.element}))),e.selected&&(s.metaKey||s.ctrlKey||e.startselected||(e.$element.removeClass("ui-selected"),e.selected=!1,e.$element.addClass("ui-unselecting"),e.unselecting=!0,l._trigger("unselecting",s,{unselecting:e.element})))))}),!1}},_mouseStop:function(t){var s=this;return this.dragged=!1,u(".ui-unselecting",this.element[0]).each(function(){var e=u.data(this,"selectable-item");e.$element.removeClass("ui-unselecting"),e.unselecting=!1,e.startselected=!1,s._trigger("unselected",t,{unselected:e.element})}),u(".ui-selecting",this.element[0]).each(function(){var e=u.data(this,"selectable-item");e.$element.removeClass("ui-selecting").addClass("ui-selected"),e.selecting=!1,e.selected=!0,e.startselected=!0,s._trigger("selected",t,{selected:e.element})}),this._trigger("stop",t),this.helper.remove(),!1}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./mouse","./core"],e):e(jQuery)}(function(u){return u.widget("ui.selectable",u.ui.mouse,{version:"1.12.1",options:{appendTo:"body",autoRefresh:!0,distance:0,filter:"*",tolerance:"touch",selected:null,selecting:null,start:null,stop:null,unselected:null,unselecting:null},_create:function(){var l=this;this._addClass("ui-selectable"),this.dragged=!1,this.refresh=function(){l.elementPos=u(l.element[0]).offset(),l.selectees=u(l.options.filter,l.element[0]),l._addClass(l.selectees,"ui-selectee"),l.selectees.each(function(){var e=u(this),t=e.offset(),s={left:t.left-l.elementPos.left,top:t.top-l.elementPos.top};u.data(this,"selectable-item",{element:this,$element:e,left:s.left,top:s.top,right:s.left+e.outerWidth(),bottom:s.top+e.outerHeight(),startselected:!1,selected:e.hasClass("ui-selected"),selecting:e.hasClass("ui-selecting"),unselecting:e.hasClass("ui-unselecting")})})},this.refresh(),this._mouseInit(),this.helper=u("<div>"),this._addClass(this.helper,"ui-selectable-helper")},_destroy:function(){this.selectees.removeData("selectable-item"),this._mouseDestroy()},_mouseStart:function(s){var l=this,e=this.options;this.opos=[s.pageX,s.pageY],this.elementPos=u(this.element[0]).offset(),this.options.disabled||(this.selectees=u(e.filter,this.element[0]),this._trigger("start",s),u(e.appendTo).append(this.helper),this.helper.css({left:s.pageX,top:s.pageY,width:0,height:0}),e.autoRefresh&&this.refresh(),this.selectees.filter(".ui-selected").each(function(){var e=u.data(this,"selectable-item");e.startselected=!0,s.metaKey||s.ctrlKey||(l._removeClass(e.$element,"ui-selected"),e.selected=!1,l._addClass(e.$element,"ui-unselecting"),e.unselecting=!0,l._trigger("unselecting",s,{unselecting:e.element}))}),u(s.target).parents().addBack().each(function(){var e,t=u.data(this,"selectable-item");if(t)return e=!s.metaKey&&!s.ctrlKey||!t.$element.hasClass("ui-selected"),l._removeClass(t.$element,e?"ui-unselecting":"ui-selected")._addClass(t.$element,e?"ui-selecting":"ui-unselecting"),t.unselecting=!e,t.selecting=e,(t.selected=e)?l._trigger("selecting",s,{selecting:t.element}):l._trigger("unselecting",s,{unselecting:t.element}),!1}))},_mouseDrag:function(l){if(this.dragged=!0,!this.options.disabled){var e,i=this,n=this.options,c=this.opos[0],a=this.opos[1],o=l.pageX,r=l.pageY;return o<c&&(e=o,o=c,c=e),r<a&&(e=r,r=a,a=e),this.helper.css({left:c,top:a,width:o-c,height:r-a}),this.selectees.each(function(){var e=u.data(this,"selectable-item"),t=!1,s={};e&&e.element!==i.element[0]&&(s.left=e.left+i.elementPos.left,s.right=e.right+i.elementPos.left,s.top=e.top+i.elementPos.top,s.bottom=e.bottom+i.elementPos.top,"touch"===n.tolerance?t=!(s.left>o||s.right<c||s.top>r||s.bottom<a):"fit"===n.tolerance&&(t=s.left>c&&s.right<o&&s.top>a&&s.bottom<r),t?(e.selected&&(i._removeClass(e.$element,"ui-selected"),e.selected=!1),e.unselecting&&(i._removeClass(e.$element,"ui-unselecting"),e.unselecting=!1),e.selecting||(i._addClass(e.$element,"ui-selecting"),e.selecting=!0,i._trigger("selecting",l,{selecting:e.element}))):(e.selecting&&((l.metaKey||l.ctrlKey)&&e.startselected?(i._removeClass(e.$element,"ui-selecting"),e.selecting=!1,i._addClass(e.$element,"ui-selected"),e.selected=!0):(i._removeClass(e.$element,"ui-selecting"),e.selecting=!1,e.startselected&&(i._addClass(e.$element,"ui-unselecting"),e.unselecting=!0),i._trigger("unselecting",l,{unselecting:e.element}))),e.selected&&(l.metaKey||l.ctrlKey||e.startselected||(i._removeClass(e.$element,"ui-selected"),e.selected=!1,i._addClass(e.$element,"ui-unselecting"),e.unselecting=!0,i._trigger("unselecting",l,{unselecting:e.element})))))}),!1}},_mouseStop:function(t){var s=this;return this.dragged=!1,u(".ui-unselecting",this.element[0]).each(function(){var e=u.data(this,"selectable-item");s._removeClass(e.$element,"ui-unselecting"),e.unselecting=!1,e.startselected=!1,s._trigger("unselected",t,{unselected:e.element})}),u(".ui-selecting",this.element[0]).each(function(){var e=u.data(this,"selectable-item");s._removeClass(e.$element,"ui-selecting")._addClass(e.$element,"ui-selected"),e.selecting=!1,e.selected=!0,e.startselected=!0,s._trigger("selected",t,{selected:e.element})}),this._trigger("stop",t),this.helper.remove(),!1}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/selectmenu.js b/wp-includes/js/jquery/ui/selectmenu.js
new file mode 100644
index 0000000000..0df60c949f
--- /dev/null
+++ b/wp-includes/js/jquery/ui/selectmenu.js
@@ -0,0 +1,680 @@
+/*!
+ * jQuery UI Selectmenu 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Selectmenu
+//>>group: Widgets
+// jscs:disable maximumLineLength
+//>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select.
+// jscs:enable maximumLineLength
+//>>docs: http://api.jqueryui.com/selectmenu/
+//>>demos: http://jqueryui.com/selectmenu/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./menu",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.selectmenu", [ $.ui.formResetMixin, {
+	version: "1.12.1",
+	defaultElement: "<select>",
+	options: {
+		appendTo: null,
+		classes: {
+			"ui-selectmenu-button-open": "ui-corner-top",
+			"ui-selectmenu-button-closed": "ui-corner-all"
+		},
+		disabled: null,
+		icons: {
+			button: "ui-icon-triangle-1-s"
+		},
+		position: {
+			my: "left top",
+			at: "left bottom",
+			collision: "none"
+		},
+		width: false,
+
+		// Callbacks
+		change: null,
+		close: null,
+		focus: null,
+		open: null,
+		select: null
+	},
+
+	_create: function() {
+		var selectmenuId = this.element.uniqueId().attr( "id" );
+		this.ids = {
+			element: selectmenuId,
+			button: selectmenuId + "-button",
+			menu: selectmenuId + "-menu"
+		};
+
+		this._drawButton();
+		this._drawMenu();
+		this._bindFormResetHandler();
+
+		this._rendered = false;
+		this.menuItems = $();
+	},
+
+	_drawButton: function() {
+		var icon,
+			that = this,
+			item = this._parseOption(
+				this.element.find( "option:selected" ),
+				this.element[ 0 ].selectedIndex
+			);
+
+		// Associate existing label with the new button
+		this.labels = this.element.labels().attr( "for", this.ids.button );
+		this._on( this.labels, {
+			click: function( event ) {
+				this.button.focus();
+				event.preventDefault();
+			}
+		} );
+
+		// Hide original select element
+		this.element.hide();
+
+		// Create button
+		this.button = $( "<span>", {
+			tabindex: this.options.disabled ? -1 : 0,
+			id: this.ids.button,
+			role: "combobox",
+			"aria-expanded": "false",
+			"aria-autocomplete": "list",
+			"aria-owns": this.ids.menu,
+			"aria-haspopup": "true",
+			title: this.element.attr( "title" )
+		} )
+			.insertAfter( this.element );
+
+		this._addClass( this.button, "ui-selectmenu-button ui-selectmenu-button-closed",
+			"ui-button ui-widget" );
+
+		icon = $( "<span>" ).appendTo( this.button );
+		this._addClass( icon, "ui-selectmenu-icon", "ui-icon " + this.options.icons.button );
+		this.buttonItem = this._renderButtonItem( item )
+			.appendTo( this.button );
+
+		if ( this.options.width !== false ) {
+			this._resizeButton();
+		}
+
+		this._on( this.button, this._buttonEvents );
+		this.button.one( "focusin", function() {
+
+			// Delay rendering the menu items until the button receives focus.
+			// The menu may have already been rendered via a programmatic open.
+			if ( !that._rendered ) {
+				that._refreshMenu();
+			}
+		} );
+	},
+
+	_drawMenu: function() {
+		var that = this;
+
+		// Create menu
+		this.menu = $( "<ul>", {
+			"aria-hidden": "true",
+			"aria-labelledby": this.ids.button,
+			id: this.ids.menu
+		} );
+
+		// Wrap menu
+		this.menuWrap = $( "<div>" ).append( this.menu );
+		this._addClass( this.menuWrap, "ui-selectmenu-menu", "ui-front" );
+		this.menuWrap.appendTo( this._appendTo() );
+
+		// Initialize menu widget
+		this.menuInstance = this.menu
+			.menu( {
+				classes: {
+					"ui-menu": "ui-corner-bottom"
+				},
+				role: "listbox",
+				select: function( event, ui ) {
+					event.preventDefault();
+
+					// Support: IE8
+					// If the item was selected via a click, the text selection
+					// will be destroyed in IE
+					that._setSelection();
+
+					that._select( ui.item.data( "ui-selectmenu-item" ), event );
+				},
+				focus: function( event, ui ) {
+					var item = ui.item.data( "ui-selectmenu-item" );
+
+					// Prevent inital focus from firing and check if its a newly focused item
+					if ( that.focusIndex != null && item.index !== that.focusIndex ) {
+						that._trigger( "focus", event, { item: item } );
+						if ( !that.isOpen ) {
+							that._select( item, event );
+						}
+					}
+					that.focusIndex = item.index;
+
+					that.button.attr( "aria-activedescendant",
+						that.menuItems.eq( item.index ).attr( "id" ) );
+				}
+			} )
+			.menu( "instance" );
+
+		// Don't close the menu on mouseleave
+		this.menuInstance._off( this.menu, "mouseleave" );
+
+		// Cancel the menu's collapseAll on document click
+		this.menuInstance._closeOnDocumentClick = function() {
+			return false;
+		};
+
+		// Selects often contain empty items, but never contain dividers
+		this.menuInstance._isDivider = function() {
+			return false;
+		};
+	},
+
+	refresh: function() {
+		this._refreshMenu();
+		this.buttonItem.replaceWith(
+			this.buttonItem = this._renderButtonItem(
+
+				// Fall back to an empty object in case there are no options
+				this._getSelectedItem().data( "ui-selectmenu-item" ) || {}
+			)
+		);
+		if ( this.options.width === null ) {
+			this._resizeButton();
+		}
+	},
+
+	_refreshMenu: function() {
+		var item,
+			options = this.element.find( "option" );
+
+		this.menu.empty();
+
+		this._parseOptions( options );
+		this._renderMenu( this.menu, this.items );
+
+		this.menuInstance.refresh();
+		this.menuItems = this.menu.find( "li" )
+			.not( ".ui-selectmenu-optgroup" )
+				.find( ".ui-menu-item-wrapper" );
+
+		this._rendered = true;
+
+		if ( !options.length ) {
+			return;
+		}
+
+		item = this._getSelectedItem();
+
+		// Update the menu to have the correct item focused
+		this.menuInstance.focus( null, item );
+		this._setAria( item.data( "ui-selectmenu-item" ) );
+
+		// Set disabled state
+		this._setOption( "disabled", this.element.prop( "disabled" ) );
+	},
+
+	open: function( event ) {
+		if ( this.options.disabled ) {
+			return;
+		}
+
+		// If this is the first time the menu is being opened, render the items
+		if ( !this._rendered ) {
+			this._refreshMenu();
+		} else {
+
+			// Menu clears focus on close, reset focus to selected item
+			this._removeClass( this.menu.find( ".ui-state-active" ), null, "ui-state-active" );
+			this.menuInstance.focus( null, this._getSelectedItem() );
+		}
+
+		// If there are no options, don't open the menu
+		if ( !this.menuItems.length ) {
+			return;
+		}
+
+		this.isOpen = true;
+		this._toggleAttr();
+		this._resizeMenu();
+		this._position();
+
+		this._on( this.document, this._documentClick );
+
+		this._trigger( "open", event );
+	},
+
+	_position: function() {
+		this.menuWrap.position( $.extend( { of: this.button }, this.options.position ) );
+	},
+
+	close: function( event ) {
+		if ( !this.isOpen ) {
+			return;
+		}
+
+		this.isOpen = false;
+		this._toggleAttr();
+
+		this.range = null;
+		this._off( this.document );
+
+		this._trigger( "close", event );
+	},
+
+	widget: function() {
+		return this.button;
+	},
+
+	menuWidget: function() {
+		return this.menu;
+	},
+
+	_renderButtonItem: function( item ) {
+		var buttonItem = $( "<span>" );
+
+		this._setText( buttonItem, item.label );
+		this._addClass( buttonItem, "ui-selectmenu-text" );
+
+		return buttonItem;
+	},
+
+	_renderMenu: function( ul, items ) {
+		var that = this,
+			currentOptgroup = "";
+
+		$.each( items, function( index, item ) {
+			var li;
+
+			if ( item.optgroup !== currentOptgroup ) {
+				li = $( "<li>", {
+					text: item.optgroup
+				} );
+				that._addClass( li, "ui-selectmenu-optgroup", "ui-menu-divider" +
+					( item.element.parent( "optgroup" ).prop( "disabled" ) ?
+						" ui-state-disabled" :
+						"" ) );
+
+				li.appendTo( ul );
+
+				currentOptgroup = item.optgroup;
+			}
+
+			that._renderItemData( ul, item );
+		} );
+	},
+
+	_renderItemData: function( ul, item ) {
+		return this._renderItem( ul, item ).data( "ui-selectmenu-item", item );
+	},
+
+	_renderItem: function( ul, item ) {
+		var li = $( "<li>" ),
+			wrapper = $( "<div>", {
+				title: item.element.attr( "title" )
+			} );
+
+		if ( item.disabled ) {
+			this._addClass( li, null, "ui-state-disabled" );
+		}
+		this._setText( wrapper, item.label );
+
+		return li.append( wrapper ).appendTo( ul );
+	},
+
+	_setText: function( element, value ) {
+		if ( value ) {
+			element.text( value );
+		} else {
+			element.html( "&#160;" );
+		}
+	},
+
+	_move: function( direction, event ) {
+		var item, next,
+			filter = ".ui-menu-item";
+
+		if ( this.isOpen ) {
+			item = this.menuItems.eq( this.focusIndex ).parent( "li" );
+		} else {
+			item = this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" );
+			filter += ":not(.ui-state-disabled)";
+		}
+
+		if ( direction === "first" || direction === "last" ) {
+			next = item[ direction === "first" ? "prevAll" : "nextAll" ]( filter ).eq( -1 );
+		} else {
+			next = item[ direction + "All" ]( filter ).eq( 0 );
+		}
+
+		if ( next.length ) {
+			this.menuInstance.focus( event, next );
+		}
+	},
+
+	_getSelectedItem: function() {
+		return this.menuItems.eq( this.element[ 0 ].selectedIndex ).parent( "li" );
+	},
+
+	_toggle: function( event ) {
+		this[ this.isOpen ? "close" : "open" ]( event );
+	},
+
+	_setSelection: function() {
+		var selection;
+
+		if ( !this.range ) {
+			return;
+		}
+
+		if ( window.getSelection ) {
+			selection = window.getSelection();
+			selection.removeAllRanges();
+			selection.addRange( this.range );
+
+		// Support: IE8
+		} else {
+			this.range.select();
+		}
+
+		// Support: IE
+		// Setting the text selection kills the button focus in IE, but
+		// restoring the focus doesn't kill the selection.
+		this.button.focus();
+	},
+
+	_documentClick: {
+		mousedown: function( event ) {
+			if ( !this.isOpen ) {
+				return;
+			}
+
+			if ( !$( event.target ).closest( ".ui-selectmenu-menu, #" +
+					$.ui.escapeSelector( this.ids.button ) ).length ) {
+				this.close( event );
+			}
+		}
+	},
+
+	_buttonEvents: {
+
+		// Prevent text selection from being reset when interacting with the selectmenu (#10144)
+		mousedown: function() {
+			var selection;
+
+			if ( window.getSelection ) {
+				selection = window.getSelection();
+				if ( selection.rangeCount ) {
+					this.range = selection.getRangeAt( 0 );
+				}
+
+			// Support: IE8
+			} else {
+				this.range = document.selection.createRange();
+			}
+		},
+
+		click: function( event ) {
+			this._setSelection();
+			this._toggle( event );
+		},
+
+		keydown: function( event ) {
+			var preventDefault = true;
+			switch ( event.keyCode ) {
+			case $.ui.keyCode.TAB:
+			case $.ui.keyCode.ESCAPE:
+				this.close( event );
+				preventDefault = false;
+				break;
+			case $.ui.keyCode.ENTER:
+				if ( this.isOpen ) {
+					this._selectFocusedItem( event );
+				}
+				break;
+			case $.ui.keyCode.UP:
+				if ( event.altKey ) {
+					this._toggle( event );
+				} else {
+					this._move( "prev", event );
+				}
+				break;
+			case $.ui.keyCode.DOWN:
+				if ( event.altKey ) {
+					this._toggle( event );
+				} else {
+					this._move( "next", event );
+				}
+				break;
+			case $.ui.keyCode.SPACE:
+				if ( this.isOpen ) {
+					this._selectFocusedItem( event );
+				} else {
+					this._toggle( event );
+				}
+				break;
+			case $.ui.keyCode.LEFT:
+				this._move( "prev", event );
+				break;
+			case $.ui.keyCode.RIGHT:
+				this._move( "next", event );
+				break;
+			case $.ui.keyCode.HOME:
+			case $.ui.keyCode.PAGE_UP:
+				this._move( "first", event );
+				break;
+			case $.ui.keyCode.END:
+			case $.ui.keyCode.PAGE_DOWN:
+				this._move( "last", event );
+				break;
+			default:
+				this.menu.trigger( event );
+				preventDefault = false;
+			}
+
+			if ( preventDefault ) {
+				event.preventDefault();
+			}
+		}
+	},
+
+	_selectFocusedItem: function( event ) {
+		var item = this.menuItems.eq( this.focusIndex ).parent( "li" );
+		if ( !item.hasClass( "ui-state-disabled" ) ) {
+			this._select( item.data( "ui-selectmenu-item" ), event );
+		}
+	},
+
+	_select: function( item, event ) {
+		var oldIndex = this.element[ 0 ].selectedIndex;
+
+		// Change native select element
+		this.element[ 0 ].selectedIndex = item.index;
+		this.buttonItem.replaceWith( this.buttonItem = this._renderButtonItem( item ) );
+		this._setAria( item );
+		this._trigger( "select", event, { item: item } );
+
+		if ( item.index !== oldIndex ) {
+			this._trigger( "change", event, { item: item } );
+		}
+
+		this.close( event );
+	},
+
+	_setAria: function( item ) {
+		var id = this.menuItems.eq( item.index ).attr( "id" );
+
+		this.button.attr( {
+			"aria-labelledby": id,
+			"aria-activedescendant": id
+		} );
+		this.menu.attr( "aria-activedescendant", id );
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "icons" ) {
+			var icon = this.button.find( "span.ui-icon" );
+			this._removeClass( icon, null, this.options.icons.button )
+				._addClass( icon, null, value.button );
+		}
+
+		this._super( key, value );
+
+		if ( key === "appendTo" ) {
+			this.menuWrap.appendTo( this._appendTo() );
+		}
+
+		if ( key === "width" ) {
+			this._resizeButton();
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this.menuInstance.option( "disabled", value );
+		this.button.attr( "aria-disabled", value );
+		this._toggleClass( this.button, null, "ui-state-disabled", value );
+
+		this.element.prop( "disabled", value );
+		if ( value ) {
+			this.button.attr( "tabindex", -1 );
+			this.close();
+		} else {
+			this.button.attr( "tabindex", 0 );
+		}
+	},
+
+	_appendTo: function() {
+		var element = this.options.appendTo;
+
+		if ( element ) {
+			element = element.jquery || element.nodeType ?
+				$( element ) :
+				this.document.find( element ).eq( 0 );
+		}
+
+		if ( !element || !element[ 0 ] ) {
+			element = this.element.closest( ".ui-front, dialog" );
+		}
+
+		if ( !element.length ) {
+			element = this.document[ 0 ].body;
+		}
+
+		return element;
+	},
+
+	_toggleAttr: function() {
+		this.button.attr( "aria-expanded", this.isOpen );
+
+		// We can't use two _toggleClass() calls here, because we need to make sure
+		// we always remove classes first and add them second, otherwise if both classes have the
+		// same theme class, it will be removed after we add it.
+		this._removeClass( this.button, "ui-selectmenu-button-" +
+			( this.isOpen ? "closed" : "open" ) )
+			._addClass( this.button, "ui-selectmenu-button-" +
+				( this.isOpen ? "open" : "closed" ) )
+			._toggleClass( this.menuWrap, "ui-selectmenu-open", null, this.isOpen );
+
+		this.menu.attr( "aria-hidden", !this.isOpen );
+	},
+
+	_resizeButton: function() {
+		var width = this.options.width;
+
+		// For `width: false`, just remove inline style and stop
+		if ( width === false ) {
+			this.button.css( "width", "" );
+			return;
+		}
+
+		// For `width: null`, match the width of the original element
+		if ( width === null ) {
+			width = this.element.show().outerWidth();
+			this.element.hide();
+		}
+
+		this.button.outerWidth( width );
+	},
+
+	_resizeMenu: function() {
+		this.menu.outerWidth( Math.max(
+			this.button.outerWidth(),
+
+			// Support: IE10
+			// IE10 wraps long text (possibly a rounding bug)
+			// so we add 1px to avoid the wrapping
+			this.menu.width( "" ).outerWidth() + 1
+		) );
+	},
+
+	_getCreateOptions: function() {
+		var options = this._super();
+
+		options.disabled = this.element.prop( "disabled" );
+
+		return options;
+	},
+
+	_parseOptions: function( options ) {
+		var that = this,
+			data = [];
+		options.each( function( index, item ) {
+			data.push( that._parseOption( $( item ), index ) );
+		} );
+		this.items = data;
+	},
+
+	_parseOption: function( option, index ) {
+		var optgroup = option.parent( "optgroup" );
+
+		return {
+			element: option,
+			index: index,
+			value: option.val(),
+			label: option.text(),
+			optgroup: optgroup.attr( "label" ) || "",
+			disabled: optgroup.prop( "disabled" ) || option.prop( "disabled" )
+		};
+	},
+
+	_destroy: function() {
+		this._unbindFormResetHandler();
+		this.menuWrap.remove();
+		this.button.remove();
+		this.element.show();
+		this.element.removeUniqueId();
+		this.labels.attr( "for", this.ids.element );
+	}
+} ] );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/selectmenu.min.js b/wp-includes/js/jquery/ui/selectmenu.min.js
index 1e91be38a8..457447430d 100644
--- a/wp-includes/js/jquery/ui/selectmenu.min.js
+++ b/wp-includes/js/jquery/ui/selectmenu.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Selectmenu 1.11.4
+ * jQuery UI Selectmenu 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/selectmenu
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./position","./menu"],e):e(jQuery)}(function(o){return o.widget("ui.selectmenu",{version:"1.11.4",defaultElement:"<select>",options:{appendTo:null,disabled:null,icons:{button:"ui-icon-triangle-1-s"},position:{my:"left top",at:"left bottom",collision:"none"},width:null,change:null,close:null,focus:null,open:null,select:null},_create:function(){var e=this.element.uniqueId().attr("id");this.ids={element:e,button:e+"-button",menu:e+"-menu"},this._drawButton(),this._drawMenu(),this.options.disabled&&this.disable()},_drawButton:function(){var e=this;this.label=o("label[for='"+this.ids.element+"']").attr("for",this.ids.button),this._on(this.label,{click:function(e){this.button.focus(),e.preventDefault()}}),this.element.hide(),this.button=o("<span>",{class:"ui-selectmenu-button ui-widget ui-state-default ui-corner-all",tabindex:this.options.disabled?-1:0,id:this.ids.button,role:"combobox","aria-expanded":"false","aria-autocomplete":"list","aria-owns":this.ids.menu,"aria-haspopup":"true"}).insertAfter(this.element),o("<span>",{class:"ui-icon "+this.options.icons.button}).prependTo(this.button),this.buttonText=o("<span>",{class:"ui-selectmenu-text"}).appendTo(this.button),this._setText(this.buttonText,this.element.find("option:selected").text()),this._resizeButton(),this._on(this.button,this._buttonEvents),this.button.one("focusin",function(){e.menuItems||e._refreshMenu()}),this._hoverable(this.button),this._focusable(this.button)},_drawMenu:function(){var n=this;this.menu=o("<ul>",{"aria-hidden":"true","aria-labelledby":this.ids.button,id:this.ids.menu}),this.menuWrap=o("<div>",{class:"ui-selectmenu-menu ui-front"}).append(this.menu).appendTo(this._appendTo()),this.menuInstance=this.menu.menu({role:"listbox",select:function(e,t){e.preventDefault(),n._setSelection(),n._select(t.item.data("ui-selectmenu-item"),e)},focus:function(e,t){var i=t.item.data("ui-selectmenu-item");null!=n.focusIndex&&i.index!==n.focusIndex&&(n._trigger("focus",e,{item:i}),n.isOpen||n._select(i,e)),n.focusIndex=i.index,n.button.attr("aria-activedescendant",n.menuItems.eq(i.index).attr("id"))}}).menu("instance"),this.menu.addClass("ui-corner-bottom").removeClass("ui-corner-all"),this.menuInstance._off(this.menu,"mouseleave"),this.menuInstance._closeOnDocumentClick=function(){return!1},this.menuInstance._isDivider=function(){return!1}},refresh:function(){this._refreshMenu(),this._setText(this.buttonText,this._getSelectedItem().text()),this.options.width||this._resizeButton()},_refreshMenu:function(){this.menu.empty();var e,t=this.element.find("option");t.length&&(this._parseOptions(t),this._renderMenu(this.menu,this.items),this.menuInstance.refresh(),this.menuItems=this.menu.find("li").not(".ui-selectmenu-optgroup"),e=this._getSelectedItem(),this.menuInstance.focus(null,e),this._setAria(e.data("ui-selectmenu-item")),this._setOption("disabled",this.element.prop("disabled")))},open:function(e){this.options.disabled||(this.menuItems?(this.menu.find(".ui-state-focus").removeClass("ui-state-focus"),this.menuInstance.focus(null,this._getSelectedItem())):this._refreshMenu(),this.isOpen=!0,this._toggleAttr(),this._resizeMenu(),this._position(),this._on(this.document,this._documentClick),this._trigger("open",e))},_position:function(){this.menuWrap.position(o.extend({of:this.button},this.options.position))},close:function(e){this.isOpen&&(this.isOpen=!1,this._toggleAttr(),this.range=null,this._off(this.document),this._trigger("close",e))},widget:function(){return this.button},menuWidget:function(){return this.menu},_renderMenu:function(i,e){var n=this,s="";o.each(e,function(e,t){t.optgroup!==s&&(o("<li>",{class:"ui-selectmenu-optgroup ui-menu-divider"+(t.element.parent("optgroup").prop("disabled")?" ui-state-disabled":""),text:t.optgroup}).appendTo(i),s=t.optgroup),n._renderItemData(i,t)})},_renderItemData:function(e,t){return this._renderItem(e,t).data("ui-selectmenu-item",t)},_renderItem:function(e,t){var i=o("<li>");return t.disabled&&i.addClass("ui-state-disabled"),this._setText(i,t.label),i.appendTo(e)},_setText:function(e,t){t?e.text(t):e.html("&#160;")},_move:function(e,t){var i,n,s=".ui-menu-item";this.isOpen?i=this.menuItems.eq(this.focusIndex):(i=this.menuItems.eq(this.element[0].selectedIndex),s+=":not(.ui-state-disabled)"),(n="first"===e||"last"===e?i["first"===e?"prevAll":"nextAll"](s).eq(-1):i[e+"All"](s).eq(0)).length&&this.menuInstance.focus(t,n)},_getSelectedItem:function(){return this.menuItems.eq(this.element[0].selectedIndex)},_toggle:function(e){this[this.isOpen?"close":"open"](e)},_setSelection:function(){var e;this.range&&(window.getSelection?((e=window.getSelection()).removeAllRanges(),e.addRange(this.range)):this.range.select(),this.button.focus())},_documentClick:{mousedown:function(e){this.isOpen&&(o(e.target).closest(".ui-selectmenu-menu, #"+this.ids.button).length||this.close(e))}},_buttonEvents:{mousedown:function(){var e;window.getSelection?(e=window.getSelection()).rangeCount&&(this.range=e.getRangeAt(0)):this.range=document.selection.createRange()},click:function(e){this._setSelection(),this._toggle(e)},keydown:function(e){var t=!0;switch(e.keyCode){case o.ui.keyCode.TAB:case o.ui.keyCode.ESCAPE:this.close(e),t=!1;break;case o.ui.keyCode.ENTER:this.isOpen&&this._selectFocusedItem(e);break;case o.ui.keyCode.UP:e.altKey?this._toggle(e):this._move("prev",e);break;case o.ui.keyCode.DOWN:e.altKey?this._toggle(e):this._move("next",e);break;case o.ui.keyCode.SPACE:this.isOpen?this._selectFocusedItem(e):this._toggle(e);break;case o.ui.keyCode.LEFT:this._move("prev",e);break;case o.ui.keyCode.RIGHT:this._move("next",e);break;case o.ui.keyCode.HOME:case o.ui.keyCode.PAGE_UP:this._move("first",e);break;case o.ui.keyCode.END:case o.ui.keyCode.PAGE_DOWN:this._move("last",e);break;default:this.menu.trigger(e),t=!1}t&&e.preventDefault()}},_selectFocusedItem:function(e){var t=this.menuItems.eq(this.focusIndex);t.hasClass("ui-state-disabled")||this._select(t.data("ui-selectmenu-item"),e)},_select:function(e,t){var i=this.element[0].selectedIndex;this.element[0].selectedIndex=e.index,this._setText(this.buttonText,e.label),this._setAria(e),this._trigger("select",t,{item:e}),e.index!==i&&this._trigger("change",t,{item:e}),this.close(t)},_setAria:function(e){var t=this.menuItems.eq(e.index).attr("id");this.button.attr({"aria-labelledby":t,"aria-activedescendant":t}),this.menu.attr("aria-activedescendant",t)},_setOption:function(e,t){"icons"===e&&this.button.find("span.ui-icon").removeClass(this.options.icons.button).addClass(t.button),this._super(e,t),"appendTo"===e&&this.menuWrap.appendTo(this._appendTo()),"disabled"===e&&(this.menuInstance.option("disabled",t),this.button.toggleClass("ui-state-disabled",t).attr("aria-disabled",t),this.element.prop("disabled",t),t?(this.button.attr("tabindex",-1),this.close()):this.button.attr("tabindex",0)),"width"===e&&this._resizeButton()},_appendTo:function(){var e=this.options.appendTo;return(e=e&&(e.jquery||e.nodeType?o(e):this.document.find(e).eq(0)))&&e[0]||(e=this.element.closest(".ui-front")),e.length||(e=this.document[0].body),e},_toggleAttr:function(){this.button.toggleClass("ui-corner-top",this.isOpen).toggleClass("ui-corner-all",!this.isOpen).attr("aria-expanded",this.isOpen),this.menuWrap.toggleClass("ui-selectmenu-open",this.isOpen),this.menu.attr("aria-hidden",!this.isOpen)},_resizeButton:function(){var e=this.options.width;e||(e=this.element.show().outerWidth(),this.element.hide()),this.button.outerWidth(e)},_resizeMenu:function(){this.menu.outerWidth(Math.max(this.button.outerWidth(),this.menu.width("").outerWidth()+1))},_getCreateOptions:function(){return{disabled:this.element.prop("disabled")}},_parseOptions:function(e){var s=[];e.each(function(e,t){var i=o(t),n=i.parent("optgroup");s.push({element:i,index:e,value:i.val(),label:i.text(),optgroup:n.attr("label")||"",disabled:n.prop("disabled")||i.prop("disabled")})}),this.items=s},_destroy:function(){this.menuWrap.remove(),this.button.remove(),this.element.show(),this.element.removeUniqueId(),this.label.attr("for",this.ids.element)}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./menu","./core"],e):e(jQuery)}(function(u){return u.widget("ui.selectmenu",[u.ui.formResetMixin,{version:"1.12.1",defaultElement:"<select>",options:{appendTo:null,classes:{"ui-selectmenu-button-open":"ui-corner-top","ui-selectmenu-button-closed":"ui-corner-all"},disabled:null,icons:{button:"ui-icon-triangle-1-s"},position:{my:"left top",at:"left bottom",collision:"none"},width:!1,change:null,close:null,focus:null,open:null,select:null},_create:function(){var e=this.element.uniqueId().attr("id");this.ids={element:e,button:e+"-button",menu:e+"-menu"},this._drawButton(),this._drawMenu(),this._bindFormResetHandler(),this._rendered=!1,this.menuItems=u()},_drawButton:function(){var e,t=this,i=this._parseOption(this.element.find("option:selected"),this.element[0].selectedIndex);this.labels=this.element.labels().attr("for",this.ids.button),this._on(this.labels,{click:function(e){this.button.focus(),e.preventDefault()}}),this.element.hide(),this.button=u("<span>",{tabindex:this.options.disabled?-1:0,id:this.ids.button,role:"combobox","aria-expanded":"false","aria-autocomplete":"list","aria-owns":this.ids.menu,"aria-haspopup":"true",title:this.element.attr("title")}).insertAfter(this.element),this._addClass(this.button,"ui-selectmenu-button ui-selectmenu-button-closed","ui-button ui-widget"),e=u("<span>").appendTo(this.button),this._addClass(e,"ui-selectmenu-icon","ui-icon "+this.options.icons.button),this.buttonItem=this._renderButtonItem(i).appendTo(this.button),!1!==this.options.width&&this._resizeButton(),this._on(this.button,this._buttonEvents),this.button.one("focusin",function(){t._rendered||t._refreshMenu()})},_drawMenu:function(){var n=this;this.menu=u("<ul>",{"aria-hidden":"true","aria-labelledby":this.ids.button,id:this.ids.menu}),this.menuWrap=u("<div>").append(this.menu),this._addClass(this.menuWrap,"ui-selectmenu-menu","ui-front"),this.menuWrap.appendTo(this._appendTo()),this.menuInstance=this.menu.menu({classes:{"ui-menu":"ui-corner-bottom"},role:"listbox",select:function(e,t){e.preventDefault(),n._setSelection(),n._select(t.item.data("ui-selectmenu-item"),e)},focus:function(e,t){var i=t.item.data("ui-selectmenu-item");null!=n.focusIndex&&i.index!==n.focusIndex&&(n._trigger("focus",e,{item:i}),n.isOpen||n._select(i,e)),n.focusIndex=i.index,n.button.attr("aria-activedescendant",n.menuItems.eq(i.index).attr("id"))}}).menu("instance"),this.menuInstance._off(this.menu,"mouseleave"),this.menuInstance._closeOnDocumentClick=function(){return!1},this.menuInstance._isDivider=function(){return!1}},refresh:function(){this._refreshMenu(),this.buttonItem.replaceWith(this.buttonItem=this._renderButtonItem(this._getSelectedItem().data("ui-selectmenu-item")||{})),null===this.options.width&&this._resizeButton()},_refreshMenu:function(){var e,t=this.element.find("option");this.menu.empty(),this._parseOptions(t),this._renderMenu(this.menu,this.items),this.menuInstance.refresh(),this.menuItems=this.menu.find("li").not(".ui-selectmenu-optgroup").find(".ui-menu-item-wrapper"),this._rendered=!0,t.length&&(e=this._getSelectedItem(),this.menuInstance.focus(null,e),this._setAria(e.data("ui-selectmenu-item")),this._setOption("disabled",this.element.prop("disabled")))},open:function(e){this.options.disabled||(this._rendered?(this._removeClass(this.menu.find(".ui-state-active"),null,"ui-state-active"),this.menuInstance.focus(null,this._getSelectedItem())):this._refreshMenu(),this.menuItems.length&&(this.isOpen=!0,this._toggleAttr(),this._resizeMenu(),this._position(),this._on(this.document,this._documentClick),this._trigger("open",e)))},_position:function(){this.menuWrap.position(u.extend({of:this.button},this.options.position))},close:function(e){this.isOpen&&(this.isOpen=!1,this._toggleAttr(),this.range=null,this._off(this.document),this._trigger("close",e))},widget:function(){return this.button},menuWidget:function(){return this.menu},_renderButtonItem:function(e){var t=u("<span>");return this._setText(t,e.label),this._addClass(t,"ui-selectmenu-text"),t},_renderMenu:function(n,e){var s=this,o="";u.each(e,function(e,t){var i;t.optgroup!==o&&(i=u("<li>",{text:t.optgroup}),s._addClass(i,"ui-selectmenu-optgroup","ui-menu-divider"+(t.element.parent("optgroup").prop("disabled")?" ui-state-disabled":"")),i.appendTo(n),o=t.optgroup),s._renderItemData(n,t)})},_renderItemData:function(e,t){return this._renderItem(e,t).data("ui-selectmenu-item",t)},_renderItem:function(e,t){var i=u("<li>"),n=u("<div>",{title:t.element.attr("title")});return t.disabled&&this._addClass(i,null,"ui-state-disabled"),this._setText(n,t.label),i.append(n).appendTo(e)},_setText:function(e,t){t?e.text(t):e.html("&#160;")},_move:function(e,t){var i,n,s=".ui-menu-item";this.isOpen?i=this.menuItems.eq(this.focusIndex).parent("li"):(i=this.menuItems.eq(this.element[0].selectedIndex).parent("li"),s+=":not(.ui-state-disabled)"),(n="first"===e||"last"===e?i["first"===e?"prevAll":"nextAll"](s).eq(-1):i[e+"All"](s).eq(0)).length&&this.menuInstance.focus(t,n)},_getSelectedItem:function(){return this.menuItems.eq(this.element[0].selectedIndex).parent("li")},_toggle:function(e){this[this.isOpen?"close":"open"](e)},_setSelection:function(){var e;this.range&&(window.getSelection?((e=window.getSelection()).removeAllRanges(),e.addRange(this.range)):this.range.select(),this.button.focus())},_documentClick:{mousedown:function(e){this.isOpen&&(u(e.target).closest(".ui-selectmenu-menu, #"+u.ui.escapeSelector(this.ids.button)).length||this.close(e))}},_buttonEvents:{mousedown:function(){var e;window.getSelection?(e=window.getSelection()).rangeCount&&(this.range=e.getRangeAt(0)):this.range=document.selection.createRange()},click:function(e){this._setSelection(),this._toggle(e)},keydown:function(e){var t=!0;switch(e.keyCode){case u.ui.keyCode.TAB:case u.ui.keyCode.ESCAPE:this.close(e),t=!1;break;case u.ui.keyCode.ENTER:this.isOpen&&this._selectFocusedItem(e);break;case u.ui.keyCode.UP:e.altKey?this._toggle(e):this._move("prev",e);break;case u.ui.keyCode.DOWN:e.altKey?this._toggle(e):this._move("next",e);break;case u.ui.keyCode.SPACE:this.isOpen?this._selectFocusedItem(e):this._toggle(e);break;case u.ui.keyCode.LEFT:this._move("prev",e);break;case u.ui.keyCode.RIGHT:this._move("next",e);break;case u.ui.keyCode.HOME:case u.ui.keyCode.PAGE_UP:this._move("first",e);break;case u.ui.keyCode.END:case u.ui.keyCode.PAGE_DOWN:this._move("last",e);break;default:this.menu.trigger(e),t=!1}t&&e.preventDefault()}},_selectFocusedItem:function(e){var t=this.menuItems.eq(this.focusIndex).parent("li");t.hasClass("ui-state-disabled")||this._select(t.data("ui-selectmenu-item"),e)},_select:function(e,t){var i=this.element[0].selectedIndex;this.element[0].selectedIndex=e.index,this.buttonItem.replaceWith(this.buttonItem=this._renderButtonItem(e)),this._setAria(e),this._trigger("select",t,{item:e}),e.index!==i&&this._trigger("change",t,{item:e}),this.close(t)},_setAria:function(e){var t=this.menuItems.eq(e.index).attr("id");this.button.attr({"aria-labelledby":t,"aria-activedescendant":t}),this.menu.attr("aria-activedescendant",t)},_setOption:function(e,t){if("icons"===e){var i=this.button.find("span.ui-icon");this._removeClass(i,null,this.options.icons.button)._addClass(i,null,t.button)}this._super(e,t),"appendTo"===e&&this.menuWrap.appendTo(this._appendTo()),"width"===e&&this._resizeButton()},_setOptionDisabled:function(e){this._super(e),this.menuInstance.option("disabled",e),this.button.attr("aria-disabled",e),this._toggleClass(this.button,null,"ui-state-disabled",e),this.element.prop("disabled",e),e?(this.button.attr("tabindex",-1),this.close()):this.button.attr("tabindex",0)},_appendTo:function(){var e=this.options.appendTo;return(e=e&&(e.jquery||e.nodeType?u(e):this.document.find(e).eq(0)))&&e[0]||(e=this.element.closest(".ui-front, dialog")),e.length||(e=this.document[0].body),e},_toggleAttr:function(){this.button.attr("aria-expanded",this.isOpen),this._removeClass(this.button,"ui-selectmenu-button-"+(this.isOpen?"closed":"open"))._addClass(this.button,"ui-selectmenu-button-"+(this.isOpen?"open":"closed"))._toggleClass(this.menuWrap,"ui-selectmenu-open",null,this.isOpen),this.menu.attr("aria-hidden",!this.isOpen)},_resizeButton:function(){var e=this.options.width;!1!==e?(null===e&&(e=this.element.show().outerWidth(),this.element.hide()),this.button.outerWidth(e)):this.button.css("width","")},_resizeMenu:function(){this.menu.outerWidth(Math.max(this.button.outerWidth(),this.menu.width("").outerWidth()+1))},_getCreateOptions:function(){var e=this._super();return e.disabled=this.element.prop("disabled"),e},_parseOptions:function(e){var i=this,n=[];e.each(function(e,t){n.push(i._parseOption(u(t),e))}),this.items=n},_parseOption:function(e,t){var i=e.parent("optgroup");return{element:e,index:t,value:e.val(),label:e.text(),optgroup:i.attr("label")||"",disabled:i.prop("disabled")||e.prop("disabled")}},_destroy:function(){this._unbindFormResetHandler(),this.menuWrap.remove(),this.button.remove(),this.element.show(),this.element.removeUniqueId(),this.labels.attr("for",this.ids.element)}}])});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/slider.js b/wp-includes/js/jquery/ui/slider.js
new file mode 100644
index 0000000000..bac9ad921a
--- /dev/null
+++ b/wp-includes/js/jquery/ui/slider.js
@@ -0,0 +1,750 @@
+/*!
+ * jQuery UI Slider 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Slider
+//>>group: Widgets
+//>>description: Displays a flexible slider with ranges and accessibility via keyboard.
+//>>docs: http://api.jqueryui.com/slider/
+//>>demos: http://jqueryui.com/slider/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/slider.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./mouse",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.slider", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "slide",
+
+	options: {
+		animate: false,
+		classes: {
+			"ui-slider": "ui-corner-all",
+			"ui-slider-handle": "ui-corner-all",
+
+			// Note: ui-widget-header isn't the most fittingly semantic framework class for this
+			// element, but worked best visually with a variety of themes
+			"ui-slider-range": "ui-corner-all ui-widget-header"
+		},
+		distance: 0,
+		max: 100,
+		min: 0,
+		orientation: "horizontal",
+		range: false,
+		step: 1,
+		value: 0,
+		values: null,
+
+		// Callbacks
+		change: null,
+		slide: null,
+		start: null,
+		stop: null
+	},
+
+	// Number of pages in a slider
+	// (how many times can you page up/down to go through the whole range)
+	numPages: 5,
+
+	_create: function() {
+		this._keySliding = false;
+		this._mouseSliding = false;
+		this._animateOff = true;
+		this._handleIndex = null;
+		this._detectOrientation();
+		this._mouseInit();
+		this._calculateNewMax();
+
+		this._addClass( "ui-slider ui-slider-" + this.orientation,
+			"ui-widget ui-widget-content" );
+
+		this._refresh();
+
+		this._animateOff = false;
+	},
+
+	_refresh: function() {
+		this._createRange();
+		this._createHandles();
+		this._setupEvents();
+		this._refreshValue();
+	},
+
+	_createHandles: function() {
+		var i, handleCount,
+			options = this.options,
+			existingHandles = this.element.find( ".ui-slider-handle" ),
+			handle = "<span tabindex='0'></span>",
+			handles = [];
+
+		handleCount = ( options.values && options.values.length ) || 1;
+
+		if ( existingHandles.length > handleCount ) {
+			existingHandles.slice( handleCount ).remove();
+			existingHandles = existingHandles.slice( 0, handleCount );
+		}
+
+		for ( i = existingHandles.length; i < handleCount; i++ ) {
+			handles.push( handle );
+		}
+
+		this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) );
+
+		this._addClass( this.handles, "ui-slider-handle", "ui-state-default" );
+
+		this.handle = this.handles.eq( 0 );
+
+		this.handles.each( function( i ) {
+			$( this )
+				.data( "ui-slider-handle-index", i )
+				.attr( "tabIndex", 0 );
+		} );
+	},
+
+	_createRange: function() {
+		var options = this.options;
+
+		if ( options.range ) {
+			if ( options.range === true ) {
+				if ( !options.values ) {
+					options.values = [ this._valueMin(), this._valueMin() ];
+				} else if ( options.values.length && options.values.length !== 2 ) {
+					options.values = [ options.values[ 0 ], options.values[ 0 ] ];
+				} else if ( $.isArray( options.values ) ) {
+					options.values = options.values.slice( 0 );
+				}
+			}
+
+			if ( !this.range || !this.range.length ) {
+				this.range = $( "<div>" )
+					.appendTo( this.element );
+
+				this._addClass( this.range, "ui-slider-range" );
+			} else {
+				this._removeClass( this.range, "ui-slider-range-min ui-slider-range-max" );
+
+				// Handle range switching from true to min/max
+				this.range.css( {
+					"left": "",
+					"bottom": ""
+				} );
+			}
+			if ( options.range === "min" || options.range === "max" ) {
+				this._addClass( this.range, "ui-slider-range-" + options.range );
+			}
+		} else {
+			if ( this.range ) {
+				this.range.remove();
+			}
+			this.range = null;
+		}
+	},
+
+	_setupEvents: function() {
+		this._off( this.handles );
+		this._on( this.handles, this._handleEvents );
+		this._hoverable( this.handles );
+		this._focusable( this.handles );
+	},
+
+	_destroy: function() {
+		this.handles.remove();
+		if ( this.range ) {
+			this.range.remove();
+		}
+
+		this._mouseDestroy();
+	},
+
+	_mouseCapture: function( event ) {
+		var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle,
+			that = this,
+			o = this.options;
+
+		if ( o.disabled ) {
+			return false;
+		}
+
+		this.elementSize = {
+			width: this.element.outerWidth(),
+			height: this.element.outerHeight()
+		};
+		this.elementOffset = this.element.offset();
+
+		position = { x: event.pageX, y: event.pageY };
+		normValue = this._normValueFromMouse( position );
+		distance = this._valueMax() - this._valueMin() + 1;
+		this.handles.each( function( i ) {
+			var thisDistance = Math.abs( normValue - that.values( i ) );
+			if ( ( distance > thisDistance ) ||
+				( distance === thisDistance &&
+					( i === that._lastChangedValue || that.values( i ) === o.min ) ) ) {
+				distance = thisDistance;
+				closestHandle = $( this );
+				index = i;
+			}
+		} );
+
+		allowed = this._start( event, index );
+		if ( allowed === false ) {
+			return false;
+		}
+		this._mouseSliding = true;
+
+		this._handleIndex = index;
+
+		this._addClass( closestHandle, null, "ui-state-active" );
+		closestHandle.trigger( "focus" );
+
+		offset = closestHandle.offset();
+		mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" );
+		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+			left: event.pageX - offset.left - ( closestHandle.width() / 2 ),
+			top: event.pageY - offset.top -
+				( closestHandle.height() / 2 ) -
+				( parseInt( closestHandle.css( "borderTopWidth" ), 10 ) || 0 ) -
+				( parseInt( closestHandle.css( "borderBottomWidth" ), 10 ) || 0 ) +
+				( parseInt( closestHandle.css( "marginTop" ), 10 ) || 0 )
+		};
+
+		if ( !this.handles.hasClass( "ui-state-hover" ) ) {
+			this._slide( event, index, normValue );
+		}
+		this._animateOff = true;
+		return true;
+	},
+
+	_mouseStart: function() {
+		return true;
+	},
+
+	_mouseDrag: function( event ) {
+		var position = { x: event.pageX, y: event.pageY },
+			normValue = this._normValueFromMouse( position );
+
+		this._slide( event, this._handleIndex, normValue );
+
+		return false;
+	},
+
+	_mouseStop: function( event ) {
+		this._removeClass( this.handles, null, "ui-state-active" );
+		this._mouseSliding = false;
+
+		this._stop( event, this._handleIndex );
+		this._change( event, this._handleIndex );
+
+		this._handleIndex = null;
+		this._clickOffset = null;
+		this._animateOff = false;
+
+		return false;
+	},
+
+	_detectOrientation: function() {
+		this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal";
+	},
+
+	_normValueFromMouse: function( position ) {
+		var pixelTotal,
+			pixelMouse,
+			percentMouse,
+			valueTotal,
+			valueMouse;
+
+		if ( this.orientation === "horizontal" ) {
+			pixelTotal = this.elementSize.width;
+			pixelMouse = position.x - this.elementOffset.left -
+				( this._clickOffset ? this._clickOffset.left : 0 );
+		} else {
+			pixelTotal = this.elementSize.height;
+			pixelMouse = position.y - this.elementOffset.top -
+				( this._clickOffset ? this._clickOffset.top : 0 );
+		}
+
+		percentMouse = ( pixelMouse / pixelTotal );
+		if ( percentMouse > 1 ) {
+			percentMouse = 1;
+		}
+		if ( percentMouse < 0 ) {
+			percentMouse = 0;
+		}
+		if ( this.orientation === "vertical" ) {
+			percentMouse = 1 - percentMouse;
+		}
+
+		valueTotal = this._valueMax() - this._valueMin();
+		valueMouse = this._valueMin() + percentMouse * valueTotal;
+
+		return this._trimAlignValue( valueMouse );
+	},
+
+	_uiHash: function( index, value, values ) {
+		var uiHash = {
+			handle: this.handles[ index ],
+			handleIndex: index,
+			value: value !== undefined ? value : this.value()
+		};
+
+		if ( this._hasMultipleValues() ) {
+			uiHash.value = value !== undefined ? value : this.values( index );
+			uiHash.values = values || this.values();
+		}
+
+		return uiHash;
+	},
+
+	_hasMultipleValues: function() {
+		return this.options.values && this.options.values.length;
+	},
+
+	_start: function( event, index ) {
+		return this._trigger( "start", event, this._uiHash( index ) );
+	},
+
+	_slide: function( event, index, newVal ) {
+		var allowed, otherVal,
+			currentValue = this.value(),
+			newValues = this.values();
+
+		if ( this._hasMultipleValues() ) {
+			otherVal = this.values( index ? 0 : 1 );
+			currentValue = this.values( index );
+
+			if ( this.options.values.length === 2 && this.options.range === true ) {
+				newVal =  index === 0 ? Math.min( otherVal, newVal ) : Math.max( otherVal, newVal );
+			}
+
+			newValues[ index ] = newVal;
+		}
+
+		if ( newVal === currentValue ) {
+			return;
+		}
+
+		allowed = this._trigger( "slide", event, this._uiHash( index, newVal, newValues ) );
+
+		// A slide can be canceled by returning false from the slide callback
+		if ( allowed === false ) {
+			return;
+		}
+
+		if ( this._hasMultipleValues() ) {
+			this.values( index, newVal );
+		} else {
+			this.value( newVal );
+		}
+	},
+
+	_stop: function( event, index ) {
+		this._trigger( "stop", event, this._uiHash( index ) );
+	},
+
+	_change: function( event, index ) {
+		if ( !this._keySliding && !this._mouseSliding ) {
+
+			//store the last changed value index for reference when handles overlap
+			this._lastChangedValue = index;
+			this._trigger( "change", event, this._uiHash( index ) );
+		}
+	},
+
+	value: function( newValue ) {
+		if ( arguments.length ) {
+			this.options.value = this._trimAlignValue( newValue );
+			this._refreshValue();
+			this._change( null, 0 );
+			return;
+		}
+
+		return this._value();
+	},
+
+	values: function( index, newValue ) {
+		var vals,
+			newValues,
+			i;
+
+		if ( arguments.length > 1 ) {
+			this.options.values[ index ] = this._trimAlignValue( newValue );
+			this._refreshValue();
+			this._change( null, index );
+			return;
+		}
+
+		if ( arguments.length ) {
+			if ( $.isArray( arguments[ 0 ] ) ) {
+				vals = this.options.values;
+				newValues = arguments[ 0 ];
+				for ( i = 0; i < vals.length; i += 1 ) {
+					vals[ i ] = this._trimAlignValue( newValues[ i ] );
+					this._change( null, i );
+				}
+				this._refreshValue();
+			} else {
+				if ( this._hasMultipleValues() ) {
+					return this._values( index );
+				} else {
+					return this.value();
+				}
+			}
+		} else {
+			return this._values();
+		}
+	},
+
+	_setOption: function( key, value ) {
+		var i,
+			valsLength = 0;
+
+		if ( key === "range" && this.options.range === true ) {
+			if ( value === "min" ) {
+				this.options.value = this._values( 0 );
+				this.options.values = null;
+			} else if ( value === "max" ) {
+				this.options.value = this._values( this.options.values.length - 1 );
+				this.options.values = null;
+			}
+		}
+
+		if ( $.isArray( this.options.values ) ) {
+			valsLength = this.options.values.length;
+		}
+
+		this._super( key, value );
+
+		switch ( key ) {
+			case "orientation":
+				this._detectOrientation();
+				this._removeClass( "ui-slider-horizontal ui-slider-vertical" )
+					._addClass( "ui-slider-" + this.orientation );
+				this._refreshValue();
+				if ( this.options.range ) {
+					this._refreshRange( value );
+				}
+
+				// Reset positioning from previous orientation
+				this.handles.css( value === "horizontal" ? "bottom" : "left", "" );
+				break;
+			case "value":
+				this._animateOff = true;
+				this._refreshValue();
+				this._change( null, 0 );
+				this._animateOff = false;
+				break;
+			case "values":
+				this._animateOff = true;
+				this._refreshValue();
+
+				// Start from the last handle to prevent unreachable handles (#9046)
+				for ( i = valsLength - 1; i >= 0; i-- ) {
+					this._change( null, i );
+				}
+				this._animateOff = false;
+				break;
+			case "step":
+			case "min":
+			case "max":
+				this._animateOff = true;
+				this._calculateNewMax();
+				this._refreshValue();
+				this._animateOff = false;
+				break;
+			case "range":
+				this._animateOff = true;
+				this._refresh();
+				this._animateOff = false;
+				break;
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this._toggleClass( null, "ui-state-disabled", !!value );
+	},
+
+	//internal value getter
+	// _value() returns value trimmed by min and max, aligned by step
+	_value: function() {
+		var val = this.options.value;
+		val = this._trimAlignValue( val );
+
+		return val;
+	},
+
+	//internal values getter
+	// _values() returns array of values trimmed by min and max, aligned by step
+	// _values( index ) returns single value trimmed by min and max, aligned by step
+	_values: function( index ) {
+		var val,
+			vals,
+			i;
+
+		if ( arguments.length ) {
+			val = this.options.values[ index ];
+			val = this._trimAlignValue( val );
+
+			return val;
+		} else if ( this._hasMultipleValues() ) {
+
+			// .slice() creates a copy of the array
+			// this copy gets trimmed by min and max and then returned
+			vals = this.options.values.slice();
+			for ( i = 0; i < vals.length; i += 1 ) {
+				vals[ i ] = this._trimAlignValue( vals[ i ] );
+			}
+
+			return vals;
+		} else {
+			return [];
+		}
+	},
+
+	// Returns the step-aligned value that val is closest to, between (inclusive) min and max
+	_trimAlignValue: function( val ) {
+		if ( val <= this._valueMin() ) {
+			return this._valueMin();
+		}
+		if ( val >= this._valueMax() ) {
+			return this._valueMax();
+		}
+		var step = ( this.options.step > 0 ) ? this.options.step : 1,
+			valModStep = ( val - this._valueMin() ) % step,
+			alignValue = val - valModStep;
+
+		if ( Math.abs( valModStep ) * 2 >= step ) {
+			alignValue += ( valModStep > 0 ) ? step : ( -step );
+		}
+
+		// Since JavaScript has problems with large floats, round
+		// the final value to 5 digits after the decimal point (see #4124)
+		return parseFloat( alignValue.toFixed( 5 ) );
+	},
+
+	_calculateNewMax: function() {
+		var max = this.options.max,
+			min = this._valueMin(),
+			step = this.options.step,
+			aboveMin = Math.round( ( max - min ) / step ) * step;
+		max = aboveMin + min;
+		if ( max > this.options.max ) {
+
+			//If max is not divisible by step, rounding off may increase its value
+			max -= step;
+		}
+		this.max = parseFloat( max.toFixed( this._precision() ) );
+	},
+
+	_precision: function() {
+		var precision = this._precisionOf( this.options.step );
+		if ( this.options.min !== null ) {
+			precision = Math.max( precision, this._precisionOf( this.options.min ) );
+		}
+		return precision;
+	},
+
+	_precisionOf: function( num ) {
+		var str = num.toString(),
+			decimal = str.indexOf( "." );
+		return decimal === -1 ? 0 : str.length - decimal - 1;
+	},
+
+	_valueMin: function() {
+		return this.options.min;
+	},
+
+	_valueMax: function() {
+		return this.max;
+	},
+
+	_refreshRange: function( orientation ) {
+		if ( orientation === "vertical" ) {
+			this.range.css( { "width": "", "left": "" } );
+		}
+		if ( orientation === "horizontal" ) {
+			this.range.css( { "height": "", "bottom": "" } );
+		}
+	},
+
+	_refreshValue: function() {
+		var lastValPercent, valPercent, value, valueMin, valueMax,
+			oRange = this.options.range,
+			o = this.options,
+			that = this,
+			animate = ( !this._animateOff ) ? o.animate : false,
+			_set = {};
+
+		if ( this._hasMultipleValues() ) {
+			this.handles.each( function( i ) {
+				valPercent = ( that.values( i ) - that._valueMin() ) / ( that._valueMax() -
+					that._valueMin() ) * 100;
+				_set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+				$( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+				if ( that.options.range === true ) {
+					if ( that.orientation === "horizontal" ) {
+						if ( i === 0 ) {
+							that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+								left: valPercent + "%"
+							}, o.animate );
+						}
+						if ( i === 1 ) {
+							that.range[ animate ? "animate" : "css" ]( {
+								width: ( valPercent - lastValPercent ) + "%"
+							}, {
+								queue: false,
+								duration: o.animate
+							} );
+						}
+					} else {
+						if ( i === 0 ) {
+							that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+								bottom: ( valPercent ) + "%"
+							}, o.animate );
+						}
+						if ( i === 1 ) {
+							that.range[ animate ? "animate" : "css" ]( {
+								height: ( valPercent - lastValPercent ) + "%"
+							}, {
+								queue: false,
+								duration: o.animate
+							} );
+						}
+					}
+				}
+				lastValPercent = valPercent;
+			} );
+		} else {
+			value = this.value();
+			valueMin = this._valueMin();
+			valueMax = this._valueMax();
+			valPercent = ( valueMax !== valueMin ) ?
+					( value - valueMin ) / ( valueMax - valueMin ) * 100 :
+					0;
+			_set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%";
+			this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate );
+
+			if ( oRange === "min" && this.orientation === "horizontal" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					width: valPercent + "%"
+				}, o.animate );
+			}
+			if ( oRange === "max" && this.orientation === "horizontal" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					width: ( 100 - valPercent ) + "%"
+				}, o.animate );
+			}
+			if ( oRange === "min" && this.orientation === "vertical" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					height: valPercent + "%"
+				}, o.animate );
+			}
+			if ( oRange === "max" && this.orientation === "vertical" ) {
+				this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( {
+					height: ( 100 - valPercent ) + "%"
+				}, o.animate );
+			}
+		}
+	},
+
+	_handleEvents: {
+		keydown: function( event ) {
+			var allowed, curVal, newVal, step,
+				index = $( event.target ).data( "ui-slider-handle-index" );
+
+			switch ( event.keyCode ) {
+				case $.ui.keyCode.HOME:
+				case $.ui.keyCode.END:
+				case $.ui.keyCode.PAGE_UP:
+				case $.ui.keyCode.PAGE_DOWN:
+				case $.ui.keyCode.UP:
+				case $.ui.keyCode.RIGHT:
+				case $.ui.keyCode.DOWN:
+				case $.ui.keyCode.LEFT:
+					event.preventDefault();
+					if ( !this._keySliding ) {
+						this._keySliding = true;
+						this._addClass( $( event.target ), null, "ui-state-active" );
+						allowed = this._start( event, index );
+						if ( allowed === false ) {
+							return;
+						}
+					}
+					break;
+			}
+
+			step = this.options.step;
+			if ( this._hasMultipleValues() ) {
+				curVal = newVal = this.values( index );
+			} else {
+				curVal = newVal = this.value();
+			}
+
+			switch ( event.keyCode ) {
+				case $.ui.keyCode.HOME:
+					newVal = this._valueMin();
+					break;
+				case $.ui.keyCode.END:
+					newVal = this._valueMax();
+					break;
+				case $.ui.keyCode.PAGE_UP:
+					newVal = this._trimAlignValue(
+						curVal + ( ( this._valueMax() - this._valueMin() ) / this.numPages )
+					);
+					break;
+				case $.ui.keyCode.PAGE_DOWN:
+					newVal = this._trimAlignValue(
+						curVal - ( ( this._valueMax() - this._valueMin() ) / this.numPages ) );
+					break;
+				case $.ui.keyCode.UP:
+				case $.ui.keyCode.RIGHT:
+					if ( curVal === this._valueMax() ) {
+						return;
+					}
+					newVal = this._trimAlignValue( curVal + step );
+					break;
+				case $.ui.keyCode.DOWN:
+				case $.ui.keyCode.LEFT:
+					if ( curVal === this._valueMin() ) {
+						return;
+					}
+					newVal = this._trimAlignValue( curVal - step );
+					break;
+			}
+
+			this._slide( event, index, newVal );
+		},
+		keyup: function( event ) {
+			var index = $( event.target ).data( "ui-slider-handle-index" );
+
+			if ( this._keySliding ) {
+				this._keySliding = false;
+				this._stop( event, index );
+				this._change( event, index );
+				this._removeClass( $( event.target ), null, "ui-state-active" );
+			}
+		}
+	}
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/slider.min.js b/wp-includes/js/jquery/ui/slider.min.js
index e683c1aed5..8dc03c3f96 100644
--- a/wp-includes/js/jquery/ui/slider.min.js
+++ b/wp-includes/js/jquery/ui/slider.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Slider 1.11.4
+ * jQuery UI Slider 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/slider/
  */
-!function(e){"function"==typeof define&&define.amd?define(["jquery","./core","./mouse","./widget"],e):e(jQuery)}(function(r){return r.widget("ui.slider",r.ui.mouse,{version:"1.11.4",widgetEventPrefix:"slide",options:{animate:!1,distance:0,max:100,min:0,orientation:"horizontal",range:!1,step:1,value:0,values:null,change:null,slide:null,start:null,stop:null},numPages:5,_create:function(){this._keySliding=!1,this._mouseSliding=!1,this._animateOff=!0,this._handleIndex=null,this._detectOrientation(),this._mouseInit(),this._calculateNewMax(),this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all"),this._refresh(),this._setOption("disabled",this.options.disabled),this._animateOff=!1},_refresh:function(){this._createRange(),this._createHandles(),this._setupEvents(),this._refreshValue()},_createHandles:function(){var e,t,i=this.options,s=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),a=[];for(t=i.values&&i.values.length||1,s.length>t&&(s.slice(t).remove(),s=s.slice(0,t)),e=s.length;e<t;e++)a.push("<span class='ui-slider-handle ui-state-default ui-corner-all' tabindex='0'></span>");this.handles=s.add(r(a.join("")).appendTo(this.element)),this.handle=this.handles.eq(0),this.handles.each(function(e){r(this).data("ui-slider-handle-index",e)})},_createRange:function(){var e=this.options,t="";e.range?(!0===e.range&&(e.values?e.values.length&&2!==e.values.length?e.values=[e.values[0],e.values[0]]:r.isArray(e.values)&&(e.values=e.values.slice(0)):e.values=[this._valueMin(),this._valueMin()]),this.range&&this.range.length?this.range.removeClass("ui-slider-range-min ui-slider-range-max").css({left:"",bottom:""}):(this.range=r("<div></div>").appendTo(this.element),t="ui-slider-range ui-widget-header ui-corner-all"),this.range.addClass(t+("min"===e.range||"max"===e.range?" ui-slider-range-"+e.range:""))):(this.range&&this.range.remove(),this.range=null)},_setupEvents:function(){this._off(this.handles),this._on(this.handles,this._handleEvents),this._hoverable(this.handles),this._focusable(this.handles)},_destroy:function(){this.handles.remove(),this.range&&this.range.remove(),this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-widget ui-widget-content ui-corner-all"),this._mouseDestroy()},_mouseCapture:function(e){var t,i,s,a,n,h,l,o=this,u=this.options;return!u.disabled&&(this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()},this.elementOffset=this.element.offset(),t={x:e.pageX,y:e.pageY},i=this._normValueFromMouse(t),s=this._valueMax()-this._valueMin()+1,this.handles.each(function(e){var t=Math.abs(i-o.values(e));(t<s||s===t&&(e===o._lastChangedValue||o.values(e)===u.min))&&(s=t,a=r(this),n=e)}),!1!==this._start(e,n)&&(this._mouseSliding=!0,this._handleIndex=n,a.addClass("ui-state-active").focus(),h=a.offset(),l=!r(e.target).parents().addBack().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:e.pageX-h.left-a.width()/2,top:e.pageY-h.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(e,n,i),this._animateOff=!0))},_mouseStart:function(){return!0},_mouseDrag:function(e){var t={x:e.pageX,y:e.pageY},i=this._normValueFromMouse(t);return this._slide(e,this._handleIndex,i),!1},_mouseStop:function(e){return this.handles.removeClass("ui-state-active"),this._mouseSliding=!1,this._stop(e,this._handleIndex),this._change(e,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1},_detectOrientation:function(){this.orientation="vertical"===this.options.orientation?"vertical":"horizontal"},_normValueFromMouse:function(e){var t,i,s,a;return 1<(i=("horizontal"===this.orientation?(t=this.elementSize.width,e.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(t=this.elementSize.height,e.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)))/t)&&(i=1),i<0&&(i=0),"vertical"===this.orientation&&(i=1-i),s=this._valueMax()-this._valueMin(),a=this._valueMin()+i*s,this._trimAlignValue(a)},_start:function(e,t){var i={handle:this.handles[t],value:this.value()};return this.options.values&&this.options.values.length&&(i.value=this.values(t),i.values=this.values()),this._trigger("start",e,i)},_slide:function(e,t,i){var s,a,n;this.options.values&&this.options.values.length?(s=this.values(t?0:1),2===this.options.values.length&&!0===this.options.range&&(0===t&&s<i||1===t&&i<s)&&(i=s),i!==this.values(t)&&((a=this.values())[t]=i,n=this._trigger("slide",e,{handle:this.handles[t],value:i,values:a}),s=this.values(t?0:1),!1!==n&&this.values(t,i))):i!==this.value()&&!1!==(n=this._trigger("slide",e,{handle:this.handles[t],value:i}))&&this.value(i)},_stop:function(e,t){var i={handle:this.handles[t],value:this.value()};this.options.values&&this.options.values.length&&(i.value=this.values(t),i.values=this.values()),this._trigger("stop",e,i)},_change:function(e,t){if(!this._keySliding&&!this._mouseSliding){var i={handle:this.handles[t],value:this.value()};this.options.values&&this.options.values.length&&(i.value=this.values(t),i.values=this.values()),this._lastChangedValue=t,this._trigger("change",e,i)}},value:function(e){return arguments.length?(this.options.value=this._trimAlignValue(e),this._refreshValue(),void this._change(null,0)):this._value()},values:function(e,t){var i,s,a;if(1<arguments.length)return this.options.values[e]=this._trimAlignValue(t),this._refreshValue(),void this._change(null,e);if(!arguments.length)return this._values();if(!r.isArray(e))return this.options.values&&this.options.values.length?this._values(e):this.value();for(i=this.options.values,s=e,a=0;a<i.length;a+=1)i[a]=this._trimAlignValue(s[a]),this._change(null,a);this._refreshValue()},_setOption:function(e,t){var i,s=0;switch("range"===e&&!0===this.options.range&&("min"===t?(this.options.value=this._values(0),this.options.values=null):"max"===t&&(this.options.value=this._values(this.options.values.length-1),this.options.values=null)),r.isArray(this.options.values)&&(s=this.options.values.length),"disabled"===e&&this.element.toggleClass("ui-state-disabled",!!t),this._super(e,t),e){case"orientation":this._detectOrientation(),this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation),this._refreshValue(),this.handles.css("horizontal"===t?"bottom":"left","");break;case"value":this._animateOff=!0,this._refreshValue(),this._change(null,0),this._animateOff=!1;break;case"values":for(this._animateOff=!0,this._refreshValue(),i=0;i<s;i+=1)this._change(null,i);this._animateOff=!1;break;case"step":case"min":case"max":this._animateOff=!0,this._calculateNewMax(),this._refreshValue(),this._animateOff=!1;break;case"range":this._animateOff=!0,this._refresh(),this._animateOff=!1}},_value:function(){var e=this.options.value;return e=this._trimAlignValue(e)},_values:function(e){var t,i,s;if(arguments.length)return t=this.options.values[e],t=this._trimAlignValue(t);if(this.options.values&&this.options.values.length){for(i=this.options.values.slice(),s=0;s<i.length;s+=1)i[s]=this._trimAlignValue(i[s]);return i}return[]},_trimAlignValue:function(e){if(e<=this._valueMin())return this._valueMin();if(e>=this._valueMax())return this._valueMax();var t=0<this.options.step?this.options.step:1,i=(e-this._valueMin())%t,s=e-i;return 2*Math.abs(i)>=t&&(s+=0<i?t:-t),parseFloat(s.toFixed(5))},_calculateNewMax:function(){var e=this.options.max,t=this._valueMin(),i=this.options.step;e=Math.floor(+(e-t).toFixed(this._precision())/i)*i+t,this.max=parseFloat(e.toFixed(this._precision()))},_precision:function(){var e=this._precisionOf(this.options.step);return null!==this.options.min&&(e=Math.max(e,this._precisionOf(this.options.min))),e},_precisionOf:function(e){var t=e.toString(),i=t.indexOf(".");return-1===i?0:t.length-i-1},_valueMin:function(){return this.options.min},_valueMax:function(){return this.max},_refreshValue:function(){var t,i,e,s,a,n=this.options.range,h=this.options,l=this,o=!this._animateOff&&h.animate,u={};this.options.values&&this.options.values.length?this.handles.each(function(e){i=(l.values(e)-l._valueMin())/(l._valueMax()-l._valueMin())*100,u["horizontal"===l.orientation?"left":"bottom"]=i+"%",r(this).stop(1,1)[o?"animate":"css"](u,h.animate),!0===l.options.range&&("horizontal"===l.orientation?(0===e&&l.range.stop(1,1)[o?"animate":"css"]({left:i+"%"},h.animate),1===e&&l.range[o?"animate":"css"]({width:i-t+"%"},{queue:!1,duration:h.animate})):(0===e&&l.range.stop(1,1)[o?"animate":"css"]({bottom:i+"%"},h.animate),1===e&&l.range[o?"animate":"css"]({height:i-t+"%"},{queue:!1,duration:h.animate}))),t=i}):(e=this.value(),s=this._valueMin(),a=this._valueMax(),i=a!==s?(e-s)/(a-s)*100:0,u["horizontal"===this.orientation?"left":"bottom"]=i+"%",this.handle.stop(1,1)[o?"animate":"css"](u,h.animate),"min"===n&&"horizontal"===this.orientation&&this.range.stop(1,1)[o?"animate":"css"]({width:i+"%"},h.animate),"max"===n&&"horizontal"===this.orientation&&this.range[o?"animate":"css"]({width:100-i+"%"},{queue:!1,duration:h.animate}),"min"===n&&"vertical"===this.orientation&&this.range.stop(1,1)[o?"animate":"css"]({height:i+"%"},h.animate),"max"===n&&"vertical"===this.orientation&&this.range[o?"animate":"css"]({height:100-i+"%"},{queue:!1,duration:h.animate}))},_handleEvents:{keydown:function(e){var t,i,s,a=r(e.target).data("ui-slider-handle-index");switch(e.keyCode){case r.ui.keyCode.HOME:case r.ui.keyCode.END:case r.ui.keyCode.PAGE_UP:case r.ui.keyCode.PAGE_DOWN:case r.ui.keyCode.UP:case r.ui.keyCode.RIGHT:case r.ui.keyCode.DOWN:case r.ui.keyCode.LEFT:if(e.preventDefault(),!this._keySliding&&(this._keySliding=!0,r(e.target).addClass("ui-state-active"),!1===this._start(e,a)))return}switch(s=this.options.step,t=i=this.options.values&&this.options.values.length?this.values(a):this.value(),e.keyCode){case r.ui.keyCode.HOME:i=this._valueMin();break;case r.ui.keyCode.END:i=this._valueMax();break;case r.ui.keyCode.PAGE_UP:i=this._trimAlignValue(t+(this._valueMax()-this._valueMin())/this.numPages);break;case r.ui.keyCode.PAGE_DOWN:i=this._trimAlignValue(t-(this._valueMax()-this._valueMin())/this.numPages);break;case r.ui.keyCode.UP:case r.ui.keyCode.RIGHT:if(t===this._valueMax())return;i=this._trimAlignValue(t+s);break;case r.ui.keyCode.DOWN:case r.ui.keyCode.LEFT:if(t===this._valueMin())return;i=this._trimAlignValue(t-s)}this._slide(e,a,i)},keyup:function(e){var t=r(e.target).data("ui-slider-handle-index");this._keySliding&&(this._keySliding=!1,this._stop(e,t),this._change(e,t),r(e.target).removeClass("ui-state-active"))}}})});
\ No newline at end of file
+!function(e){"function"==typeof define&&define.amd?define(["jquery","./mouse","./core"],e):e(jQuery)}(function(o){return o.widget("ui.slider",o.ui.mouse,{version:"1.12.1",widgetEventPrefix:"slide",options:{animate:!1,classes:{"ui-slider":"ui-corner-all","ui-slider-handle":"ui-corner-all","ui-slider-range":"ui-corner-all ui-widget-header"},distance:0,max:100,min:0,orientation:"horizontal",range:!1,step:1,value:0,values:null,change:null,slide:null,start:null,stop:null},numPages:5,_create:function(){this._keySliding=!1,this._mouseSliding=!1,this._animateOff=!0,this._handleIndex=null,this._detectOrientation(),this._mouseInit(),this._calculateNewMax(),this._addClass("ui-slider ui-slider-"+this.orientation,"ui-widget ui-widget-content"),this._refresh(),this._animateOff=!1},_refresh:function(){this._createRange(),this._createHandles(),this._setupEvents(),this._refreshValue()},_createHandles:function(){var e,t,i=this.options,s=this.element.find(".ui-slider-handle"),a=[];for(t=i.values&&i.values.length||1,s.length>t&&(s.slice(t).remove(),s=s.slice(0,t)),e=s.length;e<t;e++)a.push("<span tabindex='0'></span>");this.handles=s.add(o(a.join("")).appendTo(this.element)),this._addClass(this.handles,"ui-slider-handle","ui-state-default"),this.handle=this.handles.eq(0),this.handles.each(function(e){o(this).data("ui-slider-handle-index",e).attr("tabIndex",0)})},_createRange:function(){var e=this.options;e.range?(!0===e.range&&(e.values?e.values.length&&2!==e.values.length?e.values=[e.values[0],e.values[0]]:o.isArray(e.values)&&(e.values=e.values.slice(0)):e.values=[this._valueMin(),this._valueMin()]),this.range&&this.range.length?(this._removeClass(this.range,"ui-slider-range-min ui-slider-range-max"),this.range.css({left:"",bottom:""})):(this.range=o("<div>").appendTo(this.element),this._addClass(this.range,"ui-slider-range")),"min"!==e.range&&"max"!==e.range||this._addClass(this.range,"ui-slider-range-"+e.range)):(this.range&&this.range.remove(),this.range=null)},_setupEvents:function(){this._off(this.handles),this._on(this.handles,this._handleEvents),this._hoverable(this.handles),this._focusable(this.handles)},_destroy:function(){this.handles.remove(),this.range&&this.range.remove(),this._mouseDestroy()},_mouseCapture:function(e){var t,i,s,a,n,h,l,u=this,r=this.options;return!r.disabled&&(this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()},this.elementOffset=this.element.offset(),t={x:e.pageX,y:e.pageY},i=this._normValueFromMouse(t),s=this._valueMax()-this._valueMin()+1,this.handles.each(function(e){var t=Math.abs(i-u.values(e));(t<s||s===t&&(e===u._lastChangedValue||u.values(e)===r.min))&&(s=t,a=o(this),n=e)}),!1!==this._start(e,n)&&(this._mouseSliding=!0,this._handleIndex=n,this._addClass(a,null,"ui-state-active"),a.trigger("focus"),h=a.offset(),l=!o(e.target).parents().addBack().is(".ui-slider-handle"),this._clickOffset=l?{left:0,top:0}:{left:e.pageX-h.left-a.width()/2,top:e.pageY-h.top-a.height()/2-(parseInt(a.css("borderTopWidth"),10)||0)-(parseInt(a.css("borderBottomWidth"),10)||0)+(parseInt(a.css("marginTop"),10)||0)},this.handles.hasClass("ui-state-hover")||this._slide(e,n,i),this._animateOff=!0))},_mouseStart:function(){return!0},_mouseDrag:function(e){var t={x:e.pageX,y:e.pageY},i=this._normValueFromMouse(t);return this._slide(e,this._handleIndex,i),!1},_mouseStop:function(e){return this._removeClass(this.handles,null,"ui-state-active"),this._mouseSliding=!1,this._stop(e,this._handleIndex),this._change(e,this._handleIndex),this._handleIndex=null,this._clickOffset=null,this._animateOff=!1},_detectOrientation:function(){this.orientation="vertical"===this.options.orientation?"vertical":"horizontal"},_normValueFromMouse:function(e){var t,i,s,a;return 1<(i=("horizontal"===this.orientation?(t=this.elementSize.width,e.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)):(t=this.elementSize.height,e.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)))/t)&&(i=1),i<0&&(i=0),"vertical"===this.orientation&&(i=1-i),s=this._valueMax()-this._valueMin(),a=this._valueMin()+i*s,this._trimAlignValue(a)},_uiHash:function(e,t,i){var s={handle:this.handles[e],handleIndex:e,value:void 0!==t?t:this.value()};return this._hasMultipleValues()&&(s.value=void 0!==t?t:this.values(e),s.values=i||this.values()),s},_hasMultipleValues:function(){return this.options.values&&this.options.values.length},_start:function(e,t){return this._trigger("start",e,this._uiHash(t))},_slide:function(e,t,i){var s,a=this.value(),n=this.values();this._hasMultipleValues()&&(s=this.values(t?0:1),a=this.values(t),2===this.options.values.length&&!0===this.options.range&&(i=0===t?Math.min(s,i):Math.max(s,i)),n[t]=i),i!==a&&!1!==this._trigger("slide",e,this._uiHash(t,i,n))&&(this._hasMultipleValues()?this.values(t,i):this.value(i))},_stop:function(e,t){this._trigger("stop",e,this._uiHash(t))},_change:function(e,t){this._keySliding||this._mouseSliding||(this._lastChangedValue=t,this._trigger("change",e,this._uiHash(t)))},value:function(e){return arguments.length?(this.options.value=this._trimAlignValue(e),this._refreshValue(),void this._change(null,0)):this._value()},values:function(e,t){var i,s,a;if(1<arguments.length)return this.options.values[e]=this._trimAlignValue(t),this._refreshValue(),void this._change(null,e);if(!arguments.length)return this._values();if(!o.isArray(e))return this._hasMultipleValues()?this._values(e):this.value();for(i=this.options.values,s=e,a=0;a<i.length;a+=1)i[a]=this._trimAlignValue(s[a]),this._change(null,a);this._refreshValue()},_setOption:function(e,t){var i,s=0;switch("range"===e&&!0===this.options.range&&("min"===t?(this.options.value=this._values(0),this.options.values=null):"max"===t&&(this.options.value=this._values(this.options.values.length-1),this.options.values=null)),o.isArray(this.options.values)&&(s=this.options.values.length),this._super(e,t),e){case"orientation":this._detectOrientation(),this._removeClass("ui-slider-horizontal ui-slider-vertical")._addClass("ui-slider-"+this.orientation),this._refreshValue(),this.options.range&&this._refreshRange(t),this.handles.css("horizontal"===t?"bottom":"left","");break;case"value":this._animateOff=!0,this._refreshValue(),this._change(null,0),this._animateOff=!1;break;case"values":for(this._animateOff=!0,this._refreshValue(),i=s-1;0<=i;i--)this._change(null,i);this._animateOff=!1;break;case"step":case"min":case"max":this._animateOff=!0,this._calculateNewMax(),this._refreshValue(),this._animateOff=!1;break;case"range":this._animateOff=!0,this._refresh(),this._animateOff=!1}},_setOptionDisabled:function(e){this._super(e),this._toggleClass(null,"ui-state-disabled",!!e)},_value:function(){var e=this.options.value;return e=this._trimAlignValue(e)},_values:function(e){var t,i,s;if(arguments.length)return t=this.options.values[e],t=this._trimAlignValue(t);if(this._hasMultipleValues()){for(i=this.options.values.slice(),s=0;s<i.length;s+=1)i[s]=this._trimAlignValue(i[s]);return i}return[]},_trimAlignValue:function(e){if(e<=this._valueMin())return this._valueMin();if(e>=this._valueMax())return this._valueMax();var t=0<this.options.step?this.options.step:1,i=(e-this._valueMin())%t,s=e-i;return 2*Math.abs(i)>=t&&(s+=0<i?t:-t),parseFloat(s.toFixed(5))},_calculateNewMax:function(){var e=this.options.max,t=this._valueMin(),i=this.options.step;(e=Math.round((e-t)/i)*i+t)>this.options.max&&(e-=i),this.max=parseFloat(e.toFixed(this._precision()))},_precision:function(){var e=this._precisionOf(this.options.step);return null!==this.options.min&&(e=Math.max(e,this._precisionOf(this.options.min))),e},_precisionOf:function(e){var t=e.toString(),i=t.indexOf(".");return-1===i?0:t.length-i-1},_valueMin:function(){return this.options.min},_valueMax:function(){return this.max},_refreshRange:function(e){"vertical"===e&&this.range.css({width:"",left:""}),"horizontal"===e&&this.range.css({height:"",bottom:""})},_refreshValue:function(){var t,i,e,s,a,n=this.options.range,h=this.options,l=this,u=!this._animateOff&&h.animate,r={};this._hasMultipleValues()?this.handles.each(function(e){i=(l.values(e)-l._valueMin())/(l._valueMax()-l._valueMin())*100,r["horizontal"===l.orientation?"left":"bottom"]=i+"%",o(this).stop(1,1)[u?"animate":"css"](r,h.animate),!0===l.options.range&&("horizontal"===l.orientation?(0===e&&l.range.stop(1,1)[u?"animate":"css"]({left:i+"%"},h.animate),1===e&&l.range[u?"animate":"css"]({width:i-t+"%"},{queue:!1,duration:h.animate})):(0===e&&l.range.stop(1,1)[u?"animate":"css"]({bottom:i+"%"},h.animate),1===e&&l.range[u?"animate":"css"]({height:i-t+"%"},{queue:!1,duration:h.animate}))),t=i}):(e=this.value(),s=this._valueMin(),a=this._valueMax(),i=a!==s?(e-s)/(a-s)*100:0,r["horizontal"===this.orientation?"left":"bottom"]=i+"%",this.handle.stop(1,1)[u?"animate":"css"](r,h.animate),"min"===n&&"horizontal"===this.orientation&&this.range.stop(1,1)[u?"animate":"css"]({width:i+"%"},h.animate),"max"===n&&"horizontal"===this.orientation&&this.range.stop(1,1)[u?"animate":"css"]({width:100-i+"%"},h.animate),"min"===n&&"vertical"===this.orientation&&this.range.stop(1,1)[u?"animate":"css"]({height:i+"%"},h.animate),"max"===n&&"vertical"===this.orientation&&this.range.stop(1,1)[u?"animate":"css"]({height:100-i+"%"},h.animate))},_handleEvents:{keydown:function(e){var t,i,s,a=o(e.target).data("ui-slider-handle-index");switch(e.keyCode){case o.ui.keyCode.HOME:case o.ui.keyCode.END:case o.ui.keyCode.PAGE_UP:case o.ui.keyCode.PAGE_DOWN:case o.ui.keyCode.UP:case o.ui.keyCode.RIGHT:case o.ui.keyCode.DOWN:case o.ui.keyCode.LEFT:if(e.preventDefault(),!this._keySliding&&(this._keySliding=!0,this._addClass(o(e.target),null,"ui-state-active"),!1===this._start(e,a)))return}switch(s=this.options.step,t=i=this._hasMultipleValues()?this.values(a):this.value(),e.keyCode){case o.ui.keyCode.HOME:i=this._valueMin();break;case o.ui.keyCode.END:i=this._valueMax();break;case o.ui.keyCode.PAGE_UP:i=this._trimAlignValue(t+(this._valueMax()-this._valueMin())/this.numPages);break;case o.ui.keyCode.PAGE_DOWN:i=this._trimAlignValue(t-(this._valueMax()-this._valueMin())/this.numPages);break;case o.ui.keyCode.UP:case o.ui.keyCode.RIGHT:if(t===this._valueMax())return;i=this._trimAlignValue(t+s);break;case o.ui.keyCode.DOWN:case o.ui.keyCode.LEFT:if(t===this._valueMin())return;i=this._trimAlignValue(t-s)}this._slide(e,a,i)},keyup:function(e){var t=o(e.target).data("ui-slider-handle-index");this._keySliding&&(this._keySliding=!1,this._stop(e,t),this._change(e,t),this._removeClass(o(e.target),null,"ui-state-active"))}}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/sortable.js b/wp-includes/js/jquery/ui/sortable.js
new file mode 100644
index 0000000000..0f5e4c0b81
--- /dev/null
+++ b/wp-includes/js/jquery/ui/sortable.js
@@ -0,0 +1,1550 @@
+/*!
+ * jQuery UI Sortable 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Sortable
+//>>group: Interactions
+//>>description: Enables items in a list to be sorted using the mouse.
+//>>docs: http://api.jqueryui.com/sortable/
+//>>demos: http://jqueryui.com/sortable/
+//>>css.structure: ../../themes/base/sortable.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./mouse",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+return $.widget( "ui.sortable", $.ui.mouse, {
+	version: "1.12.1",
+	widgetEventPrefix: "sort",
+	ready: false,
+	options: {
+		appendTo: "parent",
+		axis: false,
+		connectWith: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		dropOnEmpty: true,
+		forcePlaceholderSize: false,
+		forceHelperSize: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		items: "> *",
+		opacity: false,
+		placeholder: false,
+		revert: false,
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		scope: "default",
+		tolerance: "intersect",
+		zIndex: 1000,
+
+		// Callbacks
+		activate: null,
+		beforeStop: null,
+		change: null,
+		deactivate: null,
+		out: null,
+		over: null,
+		receive: null,
+		remove: null,
+		sort: null,
+		start: null,
+		stop: null,
+		update: null
+	},
+
+	_isOverAxis: function( x, reference, size ) {
+		return ( x >= reference ) && ( x < ( reference + size ) );
+	},
+
+	_isFloating: function( item ) {
+		return ( /left|right/ ).test( item.css( "float" ) ) ||
+			( /inline|table-cell/ ).test( item.css( "display" ) );
+	},
+
+	_create: function() {
+		this.containerCache = {};
+		this._addClass( "ui-sortable" );
+
+		//Get the items
+		this.refresh();
+
+		//Let's determine the parent's offset
+		this.offset = this.element.offset();
+
+		//Initialize mouse events for interaction
+		this._mouseInit();
+
+		this._setHandleClassName();
+
+		//We're ready to go
+		this.ready = true;
+
+	},
+
+	_setOption: function( key, value ) {
+		this._super( key, value );
+
+		if ( key === "handle" ) {
+			this._setHandleClassName();
+		}
+	},
+
+	_setHandleClassName: function() {
+		var that = this;
+		this._removeClass( this.element.find( ".ui-sortable-handle" ), "ui-sortable-handle" );
+		$.each( this.items, function() {
+			that._addClass(
+				this.instance.options.handle ?
+					this.item.find( this.instance.options.handle ) :
+					this.item,
+				"ui-sortable-handle"
+			);
+		} );
+	},
+
+	_destroy: function() {
+		this._mouseDestroy();
+
+		for ( var i = this.items.length - 1; i >= 0; i-- ) {
+			this.items[ i ].item.removeData( this.widgetName + "-item" );
+		}
+
+		return this;
+	},
+
+	_mouseCapture: function( event, overrideHandle ) {
+		var currentItem = null,
+			validHandle = false,
+			that = this;
+
+		if ( this.reverting ) {
+			return false;
+		}
+
+		if ( this.options.disabled || this.options.type === "static" ) {
+			return false;
+		}
+
+		//We have to refresh the items data once first
+		this._refreshItems( event );
+
+		//Find out if the clicked node (or one of its parents) is a actual item in this.items
+		$( event.target ).parents().each( function() {
+			if ( $.data( this, that.widgetName + "-item" ) === that ) {
+				currentItem = $( this );
+				return false;
+			}
+		} );
+		if ( $.data( event.target, that.widgetName + "-item" ) === that ) {
+			currentItem = $( event.target );
+		}
+
+		if ( !currentItem ) {
+			return false;
+		}
+		if ( this.options.handle && !overrideHandle ) {
+			$( this.options.handle, currentItem ).find( "*" ).addBack().each( function() {
+				if ( this === event.target ) {
+					validHandle = true;
+				}
+			} );
+			if ( !validHandle ) {
+				return false;
+			}
+		}
+
+		this.currentItem = currentItem;
+		this._removeCurrentsFromItems();
+		return true;
+
+	},
+
+	_mouseStart: function( event, overrideHandle, noActivation ) {
+
+		var i, body,
+			o = this.options;
+
+		this.currentContainer = this;
+
+		//We only need to call refreshPositions, because the refreshItems call has been moved to
+		// mouseCapture
+		this.refreshPositions();
+
+		//Create and append the visible helper
+		this.helper = this._createHelper( event );
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Get the next scrolling parent
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.currentItem.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		$.extend( this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+
+			// This is a relative to absolute position minus the actual position calculation -
+			// only used for relative positioned helper
+			relative: this._getRelativeOffset()
+		} );
+
+		// Only after we got the offset, we can change the helper's position to absolute
+		// TODO: Still need to figure out a way to make relative sorting possible
+		this.helper.css( "position", "absolute" );
+		this.cssPosition = this.helper.css( "position" );
+
+		//Generate the original position
+		this.originalPosition = this._generatePosition( event );
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
+		( o.cursorAt && this._adjustOffsetFromHelper( o.cursorAt ) );
+
+		//Cache the former DOM position
+		this.domPosition = {
+			prev: this.currentItem.prev()[ 0 ],
+			parent: this.currentItem.parent()[ 0 ]
+		};
+
+		// If the helper is not the original, hide the original so it's not playing any role during
+		// the drag, won't cause anything bad this way
+		if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) {
+			this.currentItem.hide();
+		}
+
+		//Create the placeholder
+		this._createPlaceholder();
+
+		//Set a containment if given in the options
+		if ( o.containment ) {
+			this._setContainment();
+		}
+
+		if ( o.cursor && o.cursor !== "auto" ) { // cursor option
+			body = this.document.find( "body" );
+
+			// Support: IE
+			this.storedCursor = body.css( "cursor" );
+			body.css( "cursor", o.cursor );
+
+			this.storedStylesheet =
+				$( "<style>*{ cursor: " + o.cursor + " !important; }</style>" ).appendTo( body );
+		}
+
+		if ( o.opacity ) { // opacity option
+			if ( this.helper.css( "opacity" ) ) {
+				this._storedOpacity = this.helper.css( "opacity" );
+			}
+			this.helper.css( "opacity", o.opacity );
+		}
+
+		if ( o.zIndex ) { // zIndex option
+			if ( this.helper.css( "zIndex" ) ) {
+				this._storedZIndex = this.helper.css( "zIndex" );
+			}
+			this.helper.css( "zIndex", o.zIndex );
+		}
+
+		//Prepare scrolling
+		if ( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				this.scrollParent[ 0 ].tagName !== "HTML" ) {
+			this.overflowOffset = this.scrollParent.offset();
+		}
+
+		//Call callbacks
+		this._trigger( "start", event, this._uiHash() );
+
+		//Recache the helper size
+		if ( !this._preserveHelperProportions ) {
+			this._cacheHelperProportions();
+		}
+
+		//Post "activate" events to possible containers
+		if ( !noActivation ) {
+			for ( i = this.containers.length - 1; i >= 0; i-- ) {
+				this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) );
+			}
+		}
+
+		//Prepare possible droppables
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.current = this;
+		}
+
+		if ( $.ui.ddmanager && !o.dropBehaviour ) {
+			$.ui.ddmanager.prepareOffsets( this, event );
+		}
+
+		this.dragging = true;
+
+		this._addClass( this.helper, "ui-sortable-helper" );
+
+		// Execute the drag once - this causes the helper not to be visiblebefore getting its
+		// correct position
+		this._mouseDrag( event );
+		return true;
+
+	},
+
+	_mouseDrag: function( event ) {
+		var i, item, itemElement, intersection,
+			o = this.options,
+			scrolled = false;
+
+		//Compute the helpers position
+		this.position = this._generatePosition( event );
+		this.positionAbs = this._convertPositionTo( "absolute" );
+
+		if ( !this.lastPositionAbs ) {
+			this.lastPositionAbs = this.positionAbs;
+		}
+
+		//Do scrolling
+		if ( this.options.scroll ) {
+			if ( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+					this.scrollParent[ 0 ].tagName !== "HTML" ) {
+
+				if ( ( this.overflowOffset.top + this.scrollParent[ 0 ].offsetHeight ) -
+						event.pageY < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollTop =
+						scrolled = this.scrollParent[ 0 ].scrollTop + o.scrollSpeed;
+				} else if ( event.pageY - this.overflowOffset.top < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollTop =
+						scrolled = this.scrollParent[ 0 ].scrollTop - o.scrollSpeed;
+				}
+
+				if ( ( this.overflowOffset.left + this.scrollParent[ 0 ].offsetWidth ) -
+						event.pageX < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollLeft = scrolled =
+						this.scrollParent[ 0 ].scrollLeft + o.scrollSpeed;
+				} else if ( event.pageX - this.overflowOffset.left < o.scrollSensitivity ) {
+					this.scrollParent[ 0 ].scrollLeft = scrolled =
+						this.scrollParent[ 0 ].scrollLeft - o.scrollSpeed;
+				}
+
+			} else {
+
+				if ( event.pageY - this.document.scrollTop() < o.scrollSensitivity ) {
+					scrolled = this.document.scrollTop( this.document.scrollTop() - o.scrollSpeed );
+				} else if ( this.window.height() - ( event.pageY - this.document.scrollTop() ) <
+						o.scrollSensitivity ) {
+					scrolled = this.document.scrollTop( this.document.scrollTop() + o.scrollSpeed );
+				}
+
+				if ( event.pageX - this.document.scrollLeft() < o.scrollSensitivity ) {
+					scrolled = this.document.scrollLeft(
+						this.document.scrollLeft() - o.scrollSpeed
+					);
+				} else if ( this.window.width() - ( event.pageX - this.document.scrollLeft() ) <
+						o.scrollSensitivity ) {
+					scrolled = this.document.scrollLeft(
+						this.document.scrollLeft() + o.scrollSpeed
+					);
+				}
+
+			}
+
+			if ( scrolled !== false && $.ui.ddmanager && !o.dropBehaviour ) {
+				$.ui.ddmanager.prepareOffsets( this, event );
+			}
+		}
+
+		//Regenerate the absolute position used for position checks
+		this.positionAbs = this._convertPositionTo( "absolute" );
+
+		//Set the helper position
+		if ( !this.options.axis || this.options.axis !== "y" ) {
+			this.helper[ 0 ].style.left = this.position.left + "px";
+		}
+		if ( !this.options.axis || this.options.axis !== "x" ) {
+			this.helper[ 0 ].style.top = this.position.top + "px";
+		}
+
+		//Rearrange
+		for ( i = this.items.length - 1; i >= 0; i-- ) {
+
+			//Cache variables and intersection, continue if no intersection
+			item = this.items[ i ];
+			itemElement = item.item[ 0 ];
+			intersection = this._intersectsWithPointer( item );
+			if ( !intersection ) {
+				continue;
+			}
+
+			// Only put the placeholder inside the current Container, skip all
+			// items from other containers. This works because when moving
+			// an item from one container to another the
+			// currentContainer is switched before the placeholder is moved.
+			//
+			// Without this, moving items in "sub-sortables" can cause
+			// the placeholder to jitter between the outer and inner container.
+			if ( item.instance !== this.currentContainer ) {
+				continue;
+			}
+
+			// Cannot intersect with itself
+			// no useless actions that have been done before
+			// no action if the item moved is the parent of the item checked
+			if ( itemElement !== this.currentItem[ 0 ] &&
+				this.placeholder[ intersection === 1 ? "next" : "prev" ]()[ 0 ] !== itemElement &&
+				!$.contains( this.placeholder[ 0 ], itemElement ) &&
+				( this.options.type === "semi-dynamic" ?
+					!$.contains( this.element[ 0 ], itemElement ) :
+					true
+				)
+			) {
+
+				this.direction = intersection === 1 ? "down" : "up";
+
+				if ( this.options.tolerance === "pointer" || this._intersectsWithSides( item ) ) {
+					this._rearrange( event, item );
+				} else {
+					break;
+				}
+
+				this._trigger( "change", event, this._uiHash() );
+				break;
+			}
+		}
+
+		//Post events to containers
+		this._contactContainers( event );
+
+		//Interconnect with droppables
+		if ( $.ui.ddmanager ) {
+			$.ui.ddmanager.drag( this, event );
+		}
+
+		//Call callbacks
+		this._trigger( "sort", event, this._uiHash() );
+
+		this.lastPositionAbs = this.positionAbs;
+		return false;
+
+	},
+
+	_mouseStop: function( event, noPropagation ) {
+
+		if ( !event ) {
+			return;
+		}
+
+		//If we are using droppables, inform the manager about the drop
+		if ( $.ui.ddmanager && !this.options.dropBehaviour ) {
+			$.ui.ddmanager.drop( this, event );
+		}
+
+		if ( this.options.revert ) {
+			var that = this,
+				cur = this.placeholder.offset(),
+				axis = this.options.axis,
+				animation = {};
+
+			if ( !axis || axis === "x" ) {
+				animation.left = cur.left - this.offset.parent.left - this.margins.left +
+					( this.offsetParent[ 0 ] === this.document[ 0 ].body ?
+						0 :
+						this.offsetParent[ 0 ].scrollLeft
+					);
+			}
+			if ( !axis || axis === "y" ) {
+				animation.top = cur.top - this.offset.parent.top - this.margins.top +
+					( this.offsetParent[ 0 ] === this.document[ 0 ].body ?
+						0 :
+						this.offsetParent[ 0 ].scrollTop
+					);
+			}
+			this.reverting = true;
+			$( this.helper ).animate(
+				animation,
+				parseInt( this.options.revert, 10 ) || 500,
+				function() {
+					that._clear( event );
+				}
+			);
+		} else {
+			this._clear( event, noPropagation );
+		}
+
+		return false;
+
+	},
+
+	cancel: function() {
+
+		if ( this.dragging ) {
+
+			this._mouseUp( new $.Event( "mouseup", { target: null } ) );
+
+			if ( this.options.helper === "original" ) {
+				this.currentItem.css( this._storedCSS );
+				this._removeClass( this.currentItem, "ui-sortable-helper" );
+			} else {
+				this.currentItem.show();
+			}
+
+			//Post deactivating events to containers
+			for ( var i = this.containers.length - 1; i >= 0; i-- ) {
+				this.containers[ i ]._trigger( "deactivate", null, this._uiHash( this ) );
+				if ( this.containers[ i ].containerCache.over ) {
+					this.containers[ i ]._trigger( "out", null, this._uiHash( this ) );
+					this.containers[ i ].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		if ( this.placeholder ) {
+
+			//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
+			// it unbinds ALL events from the original node!
+			if ( this.placeholder[ 0 ].parentNode ) {
+				this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] );
+			}
+			if ( this.options.helper !== "original" && this.helper &&
+					this.helper[ 0 ].parentNode ) {
+				this.helper.remove();
+			}
+
+			$.extend( this, {
+				helper: null,
+				dragging: false,
+				reverting: false,
+				_noFinalSort: null
+			} );
+
+			if ( this.domPosition.prev ) {
+				$( this.domPosition.prev ).after( this.currentItem );
+			} else {
+				$( this.domPosition.parent ).prepend( this.currentItem );
+			}
+		}
+
+		return this;
+
+	},
+
+	serialize: function( o ) {
+
+		var items = this._getItemsAsjQuery( o && o.connected ),
+			str = [];
+		o = o || {};
+
+		$( items ).each( function() {
+			var res = ( $( o.item || this ).attr( o.attribute || "id" ) || "" )
+				.match( o.expression || ( /(.+)[\-=_](.+)/ ) );
+			if ( res ) {
+				str.push(
+					( o.key || res[ 1 ] + "[]" ) +
+					"=" + ( o.key && o.expression ? res[ 1 ] : res[ 2 ] ) );
+			}
+		} );
+
+		if ( !str.length && o.key ) {
+			str.push( o.key + "=" );
+		}
+
+		return str.join( "&" );
+
+	},
+
+	toArray: function( o ) {
+
+		var items = this._getItemsAsjQuery( o && o.connected ),
+			ret = [];
+
+		o = o || {};
+
+		items.each( function() {
+			ret.push( $( o.item || this ).attr( o.attribute || "id" ) || "" );
+		} );
+		return ret;
+
+	},
+
+	/* Be careful with the following core functions */
+	_intersectsWith: function( item ) {
+
+		var x1 = this.positionAbs.left,
+			x2 = x1 + this.helperProportions.width,
+			y1 = this.positionAbs.top,
+			y2 = y1 + this.helperProportions.height,
+			l = item.left,
+			r = l + item.width,
+			t = item.top,
+			b = t + item.height,
+			dyClick = this.offset.click.top,
+			dxClick = this.offset.click.left,
+			isOverElementHeight = ( this.options.axis === "x" ) || ( ( y1 + dyClick ) > t &&
+				( y1 + dyClick ) < b ),
+			isOverElementWidth = ( this.options.axis === "y" ) || ( ( x1 + dxClick ) > l &&
+				( x1 + dxClick ) < r ),
+			isOverElement = isOverElementHeight && isOverElementWidth;
+
+		if ( this.options.tolerance === "pointer" ||
+			this.options.forcePointerForContainers ||
+			( this.options.tolerance !== "pointer" &&
+				this.helperProportions[ this.floating ? "width" : "height" ] >
+				item[ this.floating ? "width" : "height" ] )
+		) {
+			return isOverElement;
+		} else {
+
+			return ( l < x1 + ( this.helperProportions.width / 2 ) && // Right Half
+				x2 - ( this.helperProportions.width / 2 ) < r && // Left Half
+				t < y1 + ( this.helperProportions.height / 2 ) && // Bottom Half
+				y2 - ( this.helperProportions.height / 2 ) < b ); // Top Half
+
+		}
+	},
+
+	_intersectsWithPointer: function( item ) {
+		var verticalDirection, horizontalDirection,
+			isOverElementHeight = ( this.options.axis === "x" ) ||
+				this._isOverAxis(
+					this.positionAbs.top + this.offset.click.top, item.top, item.height ),
+			isOverElementWidth = ( this.options.axis === "y" ) ||
+				this._isOverAxis(
+					this.positionAbs.left + this.offset.click.left, item.left, item.width ),
+			isOverElement = isOverElementHeight && isOverElementWidth;
+
+		if ( !isOverElement ) {
+			return false;
+		}
+
+		verticalDirection = this._getDragVerticalDirection();
+		horizontalDirection = this._getDragHorizontalDirection();
+
+		return this.floating ?
+			( ( horizontalDirection === "right" || verticalDirection === "down" ) ? 2 : 1 )
+			: ( verticalDirection && ( verticalDirection === "down" ? 2 : 1 ) );
+
+	},
+
+	_intersectsWithSides: function( item ) {
+
+		var isOverBottomHalf = this._isOverAxis( this.positionAbs.top +
+				this.offset.click.top, item.top + ( item.height / 2 ), item.height ),
+			isOverRightHalf = this._isOverAxis( this.positionAbs.left +
+				this.offset.click.left, item.left + ( item.width / 2 ), item.width ),
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if ( this.floating && horizontalDirection ) {
+			return ( ( horizontalDirection === "right" && isOverRightHalf ) ||
+				( horizontalDirection === "left" && !isOverRightHalf ) );
+		} else {
+			return verticalDirection && ( ( verticalDirection === "down" && isOverBottomHalf ) ||
+				( verticalDirection === "up" && !isOverBottomHalf ) );
+		}
+
+	},
+
+	_getDragVerticalDirection: function() {
+		var delta = this.positionAbs.top - this.lastPositionAbs.top;
+		return delta !== 0 && ( delta > 0 ? "down" : "up" );
+	},
+
+	_getDragHorizontalDirection: function() {
+		var delta = this.positionAbs.left - this.lastPositionAbs.left;
+		return delta !== 0 && ( delta > 0 ? "right" : "left" );
+	},
+
+	refresh: function( event ) {
+		this._refreshItems( event );
+		this._setHandleClassName();
+		this.refreshPositions();
+		return this;
+	},
+
+	_connectWith: function() {
+		var options = this.options;
+		return options.connectWith.constructor === String ?
+			[ options.connectWith ] :
+			options.connectWith;
+	},
+
+	_getItemsAsjQuery: function( connected ) {
+
+		var i, j, cur, inst,
+			items = [],
+			queries = [],
+			connectWith = this._connectWith();
+
+		if ( connectWith && connected ) {
+			for ( i = connectWith.length - 1; i >= 0; i-- ) {
+				cur = $( connectWith[ i ], this.document[ 0 ] );
+				for ( j = cur.length - 1; j >= 0; j-- ) {
+					inst = $.data( cur[ j ], this.widgetFullName );
+					if ( inst && inst !== this && !inst.options.disabled ) {
+						queries.push( [ $.isFunction( inst.options.items ) ?
+							inst.options.items.call( inst.element ) :
+							$( inst.options.items, inst.element )
+								.not( ".ui-sortable-helper" )
+								.not( ".ui-sortable-placeholder" ), inst ] );
+					}
+				}
+			}
+		}
+
+		queries.push( [ $.isFunction( this.options.items ) ?
+			this.options.items
+				.call( this.element, null, { options: this.options, item: this.currentItem } ) :
+			$( this.options.items, this.element )
+				.not( ".ui-sortable-helper" )
+				.not( ".ui-sortable-placeholder" ), this ] );
+
+		function addItems() {
+			items.push( this );
+		}
+		for ( i = queries.length - 1; i >= 0; i-- ) {
+			queries[ i ][ 0 ].each( addItems );
+		}
+
+		return $( items );
+
+	},
+
+	_removeCurrentsFromItems: function() {
+
+		var list = this.currentItem.find( ":data(" + this.widgetName + "-item)" );
+
+		this.items = $.grep( this.items, function( item ) {
+			for ( var j = 0; j < list.length; j++ ) {
+				if ( list[ j ] === item.item[ 0 ] ) {
+					return false;
+				}
+			}
+			return true;
+		} );
+
+	},
+
+	_refreshItems: function( event ) {
+
+		this.items = [];
+		this.containers = [ this ];
+
+		var i, j, cur, inst, targetData, _queries, item, queriesLength,
+			items = this.items,
+			queries = [ [ $.isFunction( this.options.items ) ?
+				this.options.items.call( this.element[ 0 ], event, { item: this.currentItem } ) :
+				$( this.options.items, this.element ), this ] ],
+			connectWith = this._connectWith();
+
+		//Shouldn't be run the first time through due to massive slow-down
+		if ( connectWith && this.ready ) {
+			for ( i = connectWith.length - 1; i >= 0; i-- ) {
+				cur = $( connectWith[ i ], this.document[ 0 ] );
+				for ( j = cur.length - 1; j >= 0; j-- ) {
+					inst = $.data( cur[ j ], this.widgetFullName );
+					if ( inst && inst !== this && !inst.options.disabled ) {
+						queries.push( [ $.isFunction( inst.options.items ) ?
+							inst.options.items
+								.call( inst.element[ 0 ], event, { item: this.currentItem } ) :
+							$( inst.options.items, inst.element ), inst ] );
+						this.containers.push( inst );
+					}
+				}
+			}
+		}
+
+		for ( i = queries.length - 1; i >= 0; i-- ) {
+			targetData = queries[ i ][ 1 ];
+			_queries = queries[ i ][ 0 ];
+
+			for ( j = 0, queriesLength = _queries.length; j < queriesLength; j++ ) {
+				item = $( _queries[ j ] );
+
+				// Data for target checking (mouse manager)
+				item.data( this.widgetName + "-item", targetData );
+
+				items.push( {
+					item: item,
+					instance: targetData,
+					width: 0, height: 0,
+					left: 0, top: 0
+				} );
+			}
+		}
+
+	},
+
+	refreshPositions: function( fast ) {
+
+		// Determine whether items are being displayed horizontally
+		this.floating = this.items.length ?
+			this.options.axis === "x" || this._isFloating( this.items[ 0 ].item ) :
+			false;
+
+		//This has to be redone because due to the item being moved out/into the offsetParent,
+		// the offsetParent's position will change
+		if ( this.offsetParent && this.helper ) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		var i, item, t, p;
+
+		for ( i = this.items.length - 1; i >= 0; i-- ) {
+			item = this.items[ i ];
+
+			//We ignore calculating positions of all connected containers when we're not over them
+			if ( item.instance !== this.currentContainer && this.currentContainer &&
+					item.item[ 0 ] !== this.currentItem[ 0 ] ) {
+				continue;
+			}
+
+			t = this.options.toleranceElement ?
+				$( this.options.toleranceElement, item.item ) :
+				item.item;
+
+			if ( !fast ) {
+				item.width = t.outerWidth();
+				item.height = t.outerHeight();
+			}
+
+			p = t.offset();
+			item.left = p.left;
+			item.top = p.top;
+		}
+
+		if ( this.options.custom && this.options.custom.refreshContainers ) {
+			this.options.custom.refreshContainers.call( this );
+		} else {
+			for ( i = this.containers.length - 1; i >= 0; i-- ) {
+				p = this.containers[ i ].element.offset();
+				this.containers[ i ].containerCache.left = p.left;
+				this.containers[ i ].containerCache.top = p.top;
+				this.containers[ i ].containerCache.width =
+					this.containers[ i ].element.outerWidth();
+				this.containers[ i ].containerCache.height =
+					this.containers[ i ].element.outerHeight();
+			}
+		}
+
+		return this;
+	},
+
+	_createPlaceholder: function( that ) {
+		that = that || this;
+		var className,
+			o = that.options;
+
+		if ( !o.placeholder || o.placeholder.constructor === String ) {
+			className = o.placeholder;
+			o.placeholder = {
+				element: function() {
+
+					var nodeName = that.currentItem[ 0 ].nodeName.toLowerCase(),
+						element = $( "<" + nodeName + ">", that.document[ 0 ] );
+
+						that._addClass( element, "ui-sortable-placeholder",
+								className || that.currentItem[ 0 ].className )
+							._removeClass( element, "ui-sortable-helper" );
+
+					if ( nodeName === "tbody" ) {
+						that._createTrPlaceholder(
+							that.currentItem.find( "tr" ).eq( 0 ),
+							$( "<tr>", that.document[ 0 ] ).appendTo( element )
+						);
+					} else if ( nodeName === "tr" ) {
+						that._createTrPlaceholder( that.currentItem, element );
+					} else if ( nodeName === "img" ) {
+						element.attr( "src", that.currentItem.attr( "src" ) );
+					}
+
+					if ( !className ) {
+						element.css( "visibility", "hidden" );
+					}
+
+					return element;
+				},
+				update: function( container, p ) {
+
+					// 1. If a className is set as 'placeholder option, we don't force sizes -
+					// the class is responsible for that
+					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a
+					// class name is specified
+					if ( className && !o.forcePlaceholderSize ) {
+						return;
+					}
+
+					//If the element doesn't have a actual height by itself (without styles coming
+					// from a stylesheet), it receives the inline height from the dragged item
+					if ( !p.height() ) {
+						p.height(
+							that.currentItem.innerHeight() -
+							parseInt( that.currentItem.css( "paddingTop" ) || 0, 10 ) -
+							parseInt( that.currentItem.css( "paddingBottom" ) || 0, 10 ) );
+					}
+					if ( !p.width() ) {
+						p.width(
+							that.currentItem.innerWidth() -
+							parseInt( that.currentItem.css( "paddingLeft" ) || 0, 10 ) -
+							parseInt( that.currentItem.css( "paddingRight" ) || 0, 10 ) );
+					}
+				}
+			};
+		}
+
+		//Create the placeholder
+		that.placeholder = $( o.placeholder.element.call( that.element, that.currentItem ) );
+
+		//Append it after the actual current item
+		that.currentItem.after( that.placeholder );
+
+		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+		o.placeholder.update( that, that.placeholder );
+
+	},
+
+	_createTrPlaceholder: function( sourceTr, targetTr ) {
+		var that = this;
+
+		sourceTr.children().each( function() {
+			$( "<td>&#160;</td>", that.document[ 0 ] )
+				.attr( "colspan", $( this ).attr( "colspan" ) || 1 )
+				.appendTo( targetTr );
+		} );
+	},
+
+	_contactContainers: function( event ) {
+		var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, cur, nearBottom,
+			floating, axis,
+			innermostContainer = null,
+			innermostIndex = null;
+
+		// Get innermost container that intersects with item
+		for ( i = this.containers.length - 1; i >= 0; i-- ) {
+
+			// Never consider a container that's located within the item itself
+			if ( $.contains( this.currentItem[ 0 ], this.containers[ i ].element[ 0 ] ) ) {
+				continue;
+			}
+
+			if ( this._intersectsWith( this.containers[ i ].containerCache ) ) {
+
+				// If we've already found a container and it's more "inner" than this, then continue
+				if ( innermostContainer &&
+						$.contains(
+							this.containers[ i ].element[ 0 ],
+							innermostContainer.element[ 0 ] ) ) {
+					continue;
+				}
+
+				innermostContainer = this.containers[ i ];
+				innermostIndex = i;
+
+			} else {
+
+				// container doesn't intersect. trigger "out" event if necessary
+				if ( this.containers[ i ].containerCache.over ) {
+					this.containers[ i ]._trigger( "out", event, this._uiHash( this ) );
+					this.containers[ i ].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		// If no intersecting containers found, return
+		if ( !innermostContainer ) {
+			return;
+		}
+
+		// Move the item into the container if it's not there already
+		if ( this.containers.length === 1 ) {
+			if ( !this.containers[ innermostIndex ].containerCache.over ) {
+				this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) );
+				this.containers[ innermostIndex ].containerCache.over = 1;
+			}
+		} else {
+
+			// When entering a new container, we will find the item with the least distance and
+			// append our item near it
+			dist = 10000;
+			itemWithLeastDistance = null;
+			floating = innermostContainer.floating || this._isFloating( this.currentItem );
+			posProperty = floating ? "left" : "top";
+			sizeProperty = floating ? "width" : "height";
+			axis = floating ? "pageX" : "pageY";
+
+			for ( j = this.items.length - 1; j >= 0; j-- ) {
+				if ( !$.contains(
+						this.containers[ innermostIndex ].element[ 0 ], this.items[ j ].item[ 0 ] )
+				) {
+					continue;
+				}
+				if ( this.items[ j ].item[ 0 ] === this.currentItem[ 0 ] ) {
+					continue;
+				}
+
+				cur = this.items[ j ].item.offset()[ posProperty ];
+				nearBottom = false;
+				if ( event[ axis ] - cur > this.items[ j ][ sizeProperty ] / 2 ) {
+					nearBottom = true;
+				}
+
+				if ( Math.abs( event[ axis ] - cur ) < dist ) {
+					dist = Math.abs( event[ axis ] - cur );
+					itemWithLeastDistance = this.items[ j ];
+					this.direction = nearBottom ? "up" : "down";
+				}
+			}
+
+			//Check if dropOnEmpty is enabled
+			if ( !itemWithLeastDistance && !this.options.dropOnEmpty ) {
+				return;
+			}
+
+			if ( this.currentContainer === this.containers[ innermostIndex ] ) {
+				if ( !this.currentContainer.containerCache.over ) {
+					this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash() );
+					this.currentContainer.containerCache.over = 1;
+				}
+				return;
+			}
+
+			itemWithLeastDistance ?
+				this._rearrange( event, itemWithLeastDistance, null, true ) :
+				this._rearrange( event, null, this.containers[ innermostIndex ].element, true );
+			this._trigger( "change", event, this._uiHash() );
+			this.containers[ innermostIndex ]._trigger( "change", event, this._uiHash( this ) );
+			this.currentContainer = this.containers[ innermostIndex ];
+
+			//Update the placeholder
+			this.options.placeholder.update( this.currentContainer, this.placeholder );
+
+			this.containers[ innermostIndex ]._trigger( "over", event, this._uiHash( this ) );
+			this.containers[ innermostIndex ].containerCache.over = 1;
+		}
+
+	},
+
+	_createHelper: function( event ) {
+
+		var o = this.options,
+			helper = $.isFunction( o.helper ) ?
+				$( o.helper.apply( this.element[ 0 ], [ event, this.currentItem ] ) ) :
+				( o.helper === "clone" ? this.currentItem.clone() : this.currentItem );
+
+		//Add the helper to the DOM if that didn't happen already
+		if ( !helper.parents( "body" ).length ) {
+			$( o.appendTo !== "parent" ?
+				o.appendTo :
+				this.currentItem[ 0 ].parentNode )[ 0 ].appendChild( helper[ 0 ] );
+		}
+
+		if ( helper[ 0 ] === this.currentItem[ 0 ] ) {
+			this._storedCSS = {
+				width: this.currentItem[ 0 ].style.width,
+				height: this.currentItem[ 0 ].style.height,
+				position: this.currentItem.css( "position" ),
+				top: this.currentItem.css( "top" ),
+				left: this.currentItem.css( "left" )
+			};
+		}
+
+		if ( !helper[ 0 ].style.width || o.forceHelperSize ) {
+			helper.width( this.currentItem.width() );
+		}
+		if ( !helper[ 0 ].style.height || o.forceHelperSize ) {
+			helper.height( this.currentItem.height() );
+		}
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function( obj ) {
+		if ( typeof obj === "string" ) {
+			obj = obj.split( " " );
+		}
+		if ( $.isArray( obj ) ) {
+			obj = { left: +obj[ 0 ], top: +obj[ 1 ] || 0 };
+		}
+		if ( "left" in obj ) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ( "right" in obj ) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ( "top" in obj ) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ( "bottom" in obj ) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the
+		// following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the
+		// next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
+		// the document, which means that the scroll is included in the initial calculation of the
+		// offset of the parent, and never recalculated upon drag
+		if ( this.cssPosition === "absolute" && this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		// This needs to be actually done for all browsers, since pageX/pageY includes this
+		// information with an ugly IE fix
+		if ( this.offsetParent[ 0 ] === this.document[ 0 ].body ||
+				( this.offsetParent[ 0 ].tagName &&
+				this.offsetParent[ 0 ].tagName.toLowerCase() === "html" && $.ui.ie ) ) {
+			po = { top: 0, left: 0 };
+		}
+
+		return {
+			top: po.top + ( parseInt( this.offsetParent.css( "borderTopWidth" ), 10 ) || 0 ),
+			left: po.left + ( parseInt( this.offsetParent.css( "borderLeftWidth" ), 10 ) || 0 )
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if ( this.cssPosition === "relative" ) {
+			var p = this.currentItem.position();
+			return {
+				top: p.top - ( parseInt( this.helper.css( "top" ), 10 ) || 0 ) +
+					this.scrollParent.scrollTop(),
+				left: p.left - ( parseInt( this.helper.css( "left" ), 10 ) || 0 ) +
+					this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: ( parseInt( this.currentItem.css( "marginLeft" ), 10 ) || 0 ),
+			top: ( parseInt( this.currentItem.css( "marginTop" ), 10 ) || 0 )
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var ce, co, over,
+			o = this.options;
+		if ( o.containment === "parent" ) {
+			o.containment = this.helper[ 0 ].parentNode;
+		}
+		if ( o.containment === "document" || o.containment === "window" ) {
+			this.containment = [
+				0 - this.offset.relative.left - this.offset.parent.left,
+				0 - this.offset.relative.top - this.offset.parent.top,
+				o.containment === "document" ?
+					this.document.width() :
+					this.window.width() - this.helperProportions.width - this.margins.left,
+				( o.containment === "document" ?
+					( this.document.height() || document.body.parentNode.scrollHeight ) :
+					this.window.height() || this.document[ 0 ].body.parentNode.scrollHeight
+				) - this.helperProportions.height - this.margins.top
+			];
+		}
+
+		if ( !( /^(document|window|parent)$/ ).test( o.containment ) ) {
+			ce = $( o.containment )[ 0 ];
+			co = $( o.containment ).offset();
+			over = ( $( ce ).css( "overflow" ) !== "hidden" );
+
+			this.containment = [
+				co.left + ( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) +
+					( parseInt( $( ce ).css( "paddingLeft" ), 10 ) || 0 ) - this.margins.left,
+				co.top + ( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) +
+					( parseInt( $( ce ).css( "paddingTop" ), 10 ) || 0 ) - this.margins.top,
+				co.left + ( over ? Math.max( ce.scrollWidth, ce.offsetWidth ) : ce.offsetWidth ) -
+					( parseInt( $( ce ).css( "borderLeftWidth" ), 10 ) || 0 ) -
+					( parseInt( $( ce ).css( "paddingRight" ), 10 ) || 0 ) -
+					this.helperProportions.width - this.margins.left,
+				co.top + ( over ? Math.max( ce.scrollHeight, ce.offsetHeight ) : ce.offsetHeight ) -
+					( parseInt( $( ce ).css( "borderTopWidth" ), 10 ) || 0 ) -
+					( parseInt( $( ce ).css( "paddingBottom" ), 10 ) || 0 ) -
+					this.helperProportions.height - this.margins.top
+			];
+		}
+
+	},
+
+	_convertPositionTo: function( d, pos ) {
+
+		if ( !pos ) {
+			pos = this.position;
+		}
+		var mod = d === "absolute" ? 1 : -1,
+			scroll = this.cssPosition === "absolute" &&
+				!( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ?
+					this.offsetParent :
+					this.scrollParent,
+			scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName );
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pos.top	+
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top * mod -
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollTop() :
+					( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod )
+			),
+			left: (
+
+				// The absolute mouse position
+				pos.left +
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left * mod +
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left * mod	-
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 :
+					scroll.scrollLeft() ) * mod )
+			)
+		};
+
+	},
+
+	_generatePosition: function( event ) {
+
+		var top, left,
+			o = this.options,
+			pageX = event.pageX,
+			pageY = event.pageY,
+			scroll = this.cssPosition === "absolute" &&
+				!( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				$.contains( this.scrollParent[ 0 ], this.offsetParent[ 0 ] ) ) ?
+					this.offsetParent :
+					this.scrollParent,
+				scrollIsRootNode = ( /(html|body)/i ).test( scroll[ 0 ].tagName );
+
+		// This is another very weird special case that only happens for relative elements:
+		// 1. If the css position is relative
+		// 2. and the scroll parent is the document or similar to the offset parent
+		// we have to refresh the relative offset during the scroll so there are no jumps
+		if ( this.cssPosition === "relative" && !( this.scrollParent[ 0 ] !== this.document[ 0 ] &&
+				this.scrollParent[ 0 ] !== this.offsetParent[ 0 ] ) ) {
+			this.offset.relative = this._getRelativeOffset();
+		}
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if ( this.originalPosition ) { //If we are not dragging yet, we won't check for options
+
+			if ( this.containment ) {
+				if ( event.pageX - this.offset.click.left < this.containment[ 0 ] ) {
+					pageX = this.containment[ 0 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top < this.containment[ 1 ] ) {
+					pageY = this.containment[ 1 ] + this.offset.click.top;
+				}
+				if ( event.pageX - this.offset.click.left > this.containment[ 2 ] ) {
+					pageX = this.containment[ 2 ] + this.offset.click.left;
+				}
+				if ( event.pageY - this.offset.click.top > this.containment[ 3 ] ) {
+					pageY = this.containment[ 3 ] + this.offset.click.top;
+				}
+			}
+
+			if ( o.grid ) {
+				top = this.originalPageY + Math.round( ( pageY - this.originalPageY ) /
+					o.grid[ 1 ] ) * o.grid[ 1 ];
+				pageY = this.containment ?
+					( ( top - this.offset.click.top >= this.containment[ 1 ] &&
+						top - this.offset.click.top <= this.containment[ 3 ] ) ?
+							top :
+							( ( top - this.offset.click.top >= this.containment[ 1 ] ) ?
+								top - o.grid[ 1 ] : top + o.grid[ 1 ] ) ) :
+								top;
+
+				left = this.originalPageX + Math.round( ( pageX - this.originalPageX ) /
+					o.grid[ 0 ] ) * o.grid[ 0 ];
+				pageX = this.containment ?
+					( ( left - this.offset.click.left >= this.containment[ 0 ] &&
+						left - this.offset.click.left <= this.containment[ 2 ] ) ?
+							left :
+							( ( left - this.offset.click.left >= this.containment[ 0 ] ) ?
+								left - o.grid[ 0 ] : left + o.grid[ 0 ] ) ) :
+								left;
+			}
+
+		}
+
+		return {
+			top: (
+
+				// The absolute mouse position
+				pageY -
+
+				// Click offset (relative to the element)
+				this.offset.click.top -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.top -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.top +
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollTop() :
+					( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) )
+			),
+			left: (
+
+				// The absolute mouse position
+				pageX -
+
+				// Click offset (relative to the element)
+				this.offset.click.left -
+
+				// Only for relative positioned nodes: Relative offset from element to offset parent
+				this.offset.relative.left -
+
+				// The offsetParent's offset without borders (offset + border)
+				this.offset.parent.left +
+				( ( this.cssPosition === "fixed" ?
+					-this.scrollParent.scrollLeft() :
+					scrollIsRootNode ? 0 : scroll.scrollLeft() ) )
+			)
+		};
+
+	},
+
+	_rearrange: function( event, i, a, hardRefresh ) {
+
+		a ? a[ 0 ].appendChild( this.placeholder[ 0 ] ) :
+			i.item[ 0 ].parentNode.insertBefore( this.placeholder[ 0 ],
+				( this.direction === "down" ? i.item[ 0 ] : i.item[ 0 ].nextSibling ) );
+
+		//Various things done here to improve the performance:
+		// 1. we create a setTimeout, that calls refreshPositions
+		// 2. on the instance, we have a counter variable, that get's higher after every append
+		// 3. on the local scope, we copy the counter variable, and check in the timeout,
+		// if it's still the same
+		// 4. this lets only the last addition to the timeout stack through
+		this.counter = this.counter ? ++this.counter : 1;
+		var counter = this.counter;
+
+		this._delay( function() {
+			if ( counter === this.counter ) {
+
+				//Precompute after each DOM insertion, NOT on mousemove
+				this.refreshPositions( !hardRefresh );
+			}
+		} );
+
+	},
+
+	_clear: function( event, noPropagation ) {
+
+		this.reverting = false;
+
+		// We delay all events that have to be triggered to after the point where the placeholder
+		// has been removed and everything else normalized again
+		var i,
+			delayedTriggers = [];
+
+		// We first have to update the dom position of the actual currentItem
+		// Note: don't do it if the current item is already removed (by a user), or it gets
+		// reappended (see #4088)
+		if ( !this._noFinalSort && this.currentItem.parent().length ) {
+			this.placeholder.before( this.currentItem );
+		}
+		this._noFinalSort = null;
+
+		if ( this.helper[ 0 ] === this.currentItem[ 0 ] ) {
+			for ( i in this._storedCSS ) {
+				if ( this._storedCSS[ i ] === "auto" || this._storedCSS[ i ] === "static" ) {
+					this._storedCSS[ i ] = "";
+				}
+			}
+			this.currentItem.css( this._storedCSS );
+			this._removeClass( this.currentItem, "ui-sortable-helper" );
+		} else {
+			this.currentItem.show();
+		}
+
+		if ( this.fromOutside && !noPropagation ) {
+			delayedTriggers.push( function( event ) {
+				this._trigger( "receive", event, this._uiHash( this.fromOutside ) );
+			} );
+		}
+		if ( ( this.fromOutside ||
+				this.domPosition.prev !==
+				this.currentItem.prev().not( ".ui-sortable-helper" )[ 0 ] ||
+				this.domPosition.parent !== this.currentItem.parent()[ 0 ] ) && !noPropagation ) {
+
+			// Trigger update callback if the DOM position has changed
+			delayedTriggers.push( function( event ) {
+				this._trigger( "update", event, this._uiHash() );
+			} );
+		}
+
+		// Check if the items Container has Changed and trigger appropriate
+		// events.
+		if ( this !== this.currentContainer ) {
+			if ( !noPropagation ) {
+				delayedTriggers.push( function( event ) {
+					this._trigger( "remove", event, this._uiHash() );
+				} );
+				delayedTriggers.push( ( function( c ) {
+					return function( event ) {
+						c._trigger( "receive", event, this._uiHash( this ) );
+					};
+				} ).call( this, this.currentContainer ) );
+				delayedTriggers.push( ( function( c ) {
+					return function( event ) {
+						c._trigger( "update", event, this._uiHash( this ) );
+					};
+				} ).call( this, this.currentContainer ) );
+			}
+		}
+
+		//Post events to containers
+		function delayEvent( type, instance, container ) {
+			return function( event ) {
+				container._trigger( type, event, instance._uiHash( instance ) );
+			};
+		}
+		for ( i = this.containers.length - 1; i >= 0; i-- ) {
+			if ( !noPropagation ) {
+				delayedTriggers.push( delayEvent( "deactivate", this, this.containers[ i ] ) );
+			}
+			if ( this.containers[ i ].containerCache.over ) {
+				delayedTriggers.push( delayEvent( "out", this, this.containers[ i ] ) );
+				this.containers[ i ].containerCache.over = 0;
+			}
+		}
+
+		//Do what was originally in plugins
+		if ( this.storedCursor ) {
+			this.document.find( "body" ).css( "cursor", this.storedCursor );
+			this.storedStylesheet.remove();
+		}
+		if ( this._storedOpacity ) {
+			this.helper.css( "opacity", this._storedOpacity );
+		}
+		if ( this._storedZIndex ) {
+			this.helper.css( "zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex );
+		}
+
+		this.dragging = false;
+
+		if ( !noPropagation ) {
+			this._trigger( "beforeStop", event, this._uiHash() );
+		}
+
+		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
+		// it unbinds ALL events from the original node!
+		this.placeholder[ 0 ].parentNode.removeChild( this.placeholder[ 0 ] );
+
+		if ( !this.cancelHelperRemoval ) {
+			if ( this.helper[ 0 ] !== this.currentItem[ 0 ] ) {
+				this.helper.remove();
+			}
+			this.helper = null;
+		}
+
+		if ( !noPropagation ) {
+			for ( i = 0; i < delayedTriggers.length; i++ ) {
+
+				// Trigger all delayed events
+				delayedTriggers[ i ].call( this, event );
+			}
+			this._trigger( "stop", event, this._uiHash() );
+		}
+
+		this.fromOutside = false;
+		return !this.cancelHelperRemoval;
+
+	},
+
+	_trigger: function() {
+		if ( $.Widget.prototype._trigger.apply( this, arguments ) === false ) {
+			this.cancel();
+		}
+	},
+
+	_uiHash: function( _inst ) {
+		var inst = _inst || this;
+		return {
+			helper: inst.helper,
+			placeholder: inst.placeholder || $( [] ),
+			position: inst.position,
+			originalPosition: inst.originalPosition,
+			offset: inst.positionAbs,
+			item: inst.currentItem,
+			sender: _inst ? _inst.element : null
+		};
+	}
+
+} );
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/sortable.min.js b/wp-includes/js/jquery/ui/sortable.min.js
index 41f7907728..3ccea78761 100644
--- a/wp-includes/js/jquery/ui/sortable.min.js
+++ b/wp-includes/js/jquery/ui/sortable.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Sortable 1.11.4
+ * jQuery UI Sortable 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/sortable/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./mouse","./widget"],t):t(jQuery)}(function(u){return u.widget("ui.sortable",u.ui.mouse,{version:"1.11.4",widgetEventPrefix:"sort",ready:!1,options:{appendTo:"parent",axis:!1,connectWith:!1,containment:!1,cursor:"auto",cursorAt:!1,dropOnEmpty:!0,forcePlaceholderSize:!1,forceHelperSize:!1,grid:!1,handle:!1,helper:"original",items:"> *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3,activate:null,beforeStop:null,change:null,deactivate:null,out:null,over:null,receive:null,remove:null,sort:null,start:null,stop:null,update:null},_isOverAxis:function(t,e,i){return e<=t&&t<e+i},_isFloating:function(t){return/left|right/.test(t.css("float"))||/inline|table-cell/.test(t.css("display"))},_create:function(){this.containerCache={},this.element.addClass("ui-sortable"),this.refresh(),this.offset=this.element.offset(),this._mouseInit(),this._setHandleClassName(),this.ready=!0},_setOption:function(t,e){this._super(t,e),"handle"===t&&this._setHandleClassName()},_setHandleClassName:function(){this.element.find(".ui-sortable-handle").removeClass("ui-sortable-handle"),u.each(this.items,function(){(this.instance.options.handle?this.item.find(this.instance.options.handle):this.item).addClass("ui-sortable-handle")})},_destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").find(".ui-sortable-handle").removeClass("ui-sortable-handle"),this._mouseDestroy();for(var t=this.items.length-1;0<=t;t--)this.items[t].item.removeData(this.widgetName+"-item");return this},_mouseCapture:function(t,e){var i=null,s=!1,o=this;return!this.reverting&&(!this.options.disabled&&"static"!==this.options.type&&(this._refreshItems(t),u(t.target).parents().each(function(){if(u.data(this,o.widgetName+"-item")===o)return i=u(this),!1}),u.data(t.target,o.widgetName+"-item")===o&&(i=u(t.target)),!!i&&(!(this.options.handle&&!e&&(u(this.options.handle,i).find("*").addBack().each(function(){this===t.target&&(s=!0)}),!s))&&(this.currentItem=i,this._removeCurrentsFromItems(),!0))))},_mouseStart:function(t,e,i){var s,o,r=this.options;if((this.currentContainer=this).refreshPositions(),this.helper=this._createHelper(t),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},u.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,r.cursorAt&&this._adjustOffsetFromHelper(r.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!==this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),r.containment&&this._setContainment(),r.cursor&&"auto"!==r.cursor&&(o=this.document.find("body"),this.storedCursor=o.css("cursor"),o.css("cursor",r.cursor),this.storedStylesheet=u("<style>*{ cursor: "+r.cursor+" !important; }</style>").appendTo(o)),r.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",r.opacity)),r.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",r.zIndex)),this.scrollParent[0]!==this.document[0]&&"HTML"!==this.scrollParent[0].tagName&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",t,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions(),!i)for(s=this.containers.length-1;0<=s;s--)this.containers[s]._trigger("activate",t,this._uiHash(this));return u.ui.ddmanager&&(u.ui.ddmanager.current=this),u.ui.ddmanager&&!r.dropBehaviour&&u.ui.ddmanager.prepareOffsets(this,t),this.dragging=!0,this.helper.addClass("ui-sortable-helper"),this._mouseDrag(t),!0},_mouseDrag:function(t){var e,i,s,o,r=this.options,n=!1;for(this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs),this.options.scroll&&(this.scrollParent[0]!==this.document[0]&&"HTML"!==this.scrollParent[0].tagName?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-t.pageY<r.scrollSensitivity?this.scrollParent[0].scrollTop=n=this.scrollParent[0].scrollTop+r.scrollSpeed:t.pageY-this.overflowOffset.top<r.scrollSensitivity&&(this.scrollParent[0].scrollTop=n=this.scrollParent[0].scrollTop-r.scrollSpeed),this.overflowOffset.left+this.scrollParent[0].offsetWidth-t.pageX<r.scrollSensitivity?this.scrollParent[0].scrollLeft=n=this.scrollParent[0].scrollLeft+r.scrollSpeed:t.pageX-this.overflowOffset.left<r.scrollSensitivity&&(this.scrollParent[0].scrollLeft=n=this.scrollParent[0].scrollLeft-r.scrollSpeed)):(t.pageY-this.document.scrollTop()<r.scrollSensitivity?n=this.document.scrollTop(this.document.scrollTop()-r.scrollSpeed):this.window.height()-(t.pageY-this.document.scrollTop())<r.scrollSensitivity&&(n=this.document.scrollTop(this.document.scrollTop()+r.scrollSpeed)),t.pageX-this.document.scrollLeft()<r.scrollSensitivity?n=this.document.scrollLeft(this.document.scrollLeft()-r.scrollSpeed):this.window.width()-(t.pageX-this.document.scrollLeft())<r.scrollSensitivity&&(n=this.document.scrollLeft(this.document.scrollLeft()+r.scrollSpeed))),!1!==n&&u.ui.ddmanager&&!r.dropBehaviour&&u.ui.ddmanager.prepareOffsets(this,t)),this.positionAbs=this._convertPositionTo("absolute"),this.options.axis&&"y"===this.options.axis||(this.helper[0].style.left=this.position.left+"px"),this.options.axis&&"x"===this.options.axis||(this.helper[0].style.top=this.position.top+"px"),e=this.items.length-1;0<=e;e--)if(s=(i=this.items[e]).item[0],(o=this._intersectsWithPointer(i))&&i.instance===this.currentContainer&&!(s===this.currentItem[0]||this.placeholder[1===o?"next":"prev"]()[0]===s||u.contains(this.placeholder[0],s)||"semi-dynamic"===this.options.type&&u.contains(this.element[0],s))){if(this.direction=1===o?"down":"up","pointer"!==this.options.tolerance&&!this._intersectsWithSides(i))break;this._rearrange(t,i),this._trigger("change",t,this._uiHash());break}return this._contactContainers(t),u.ui.ddmanager&&u.ui.ddmanager.drag(this,t),this._trigger("sort",t,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(t,e){if(t){if(u.ui.ddmanager&&!this.options.dropBehaviour&&u.ui.ddmanager.drop(this,t),this.options.revert){var i=this,s=this.placeholder.offset(),o=this.options.axis,r={};o&&"x"!==o||(r.left=s.left-this.offset.parent.left-this.margins.left+(this.offsetParent[0]===this.document[0].body?0:this.offsetParent[0].scrollLeft)),o&&"y"!==o||(r.top=s.top-this.offset.parent.top-this.margins.top+(this.offsetParent[0]===this.document[0].body?0:this.offsetParent[0].scrollTop)),this.reverting=!0,u(this.helper).animate(r,parseInt(this.options.revert,10)||500,function(){i._clear(t)})}else this._clear(t,e);return!1}},cancel:function(){if(this.dragging){this._mouseUp({target:null}),"original"===this.options.helper?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var t=this.containers.length-1;0<=t;t--)this.containers[t]._trigger("deactivate",null,this._uiHash(this)),this.containers[t].containerCache.over&&(this.containers[t]._trigger("out",null,this._uiHash(this)),this.containers[t].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),"original"!==this.options.helper&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),u.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?u(this.domPosition.prev).after(this.currentItem):u(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(e){var t=this._getItemsAsjQuery(e&&e.connected),i=[];return e=e||{},u(t).each(function(){var t=(u(e.item||this).attr(e.attribute||"id")||"").match(e.expression||/(.+)[\-=_](.+)/);t&&i.push((e.key||t[1]+"[]")+"="+(e.key&&e.expression?t[1]:t[2]))}),!i.length&&e.key&&i.push(e.key+"="),i.join("&")},toArray:function(t){var e=this._getItemsAsjQuery(t&&t.connected),i=[];return t=t||{},e.each(function(){i.push(u(t.item||this).attr(t.attribute||"id")||"")}),i},_intersectsWith:function(t){var e=this.positionAbs.left,i=e+this.helperProportions.width,s=this.positionAbs.top,o=s+this.helperProportions.height,r=t.left,n=r+t.width,h=t.top,a=h+t.height,l=this.offset.click.top,c=this.offset.click.left,p="x"===this.options.axis||h<s+l&&s+l<a,f="y"===this.options.axis||r<e+c&&e+c<n,u=p&&f;return"pointer"===this.options.tolerance||this.options.forcePointerForContainers||"pointer"!==this.options.tolerance&&this.helperProportions[this.floating?"width":"height"]>t[this.floating?"width":"height"]?u:r<e+this.helperProportions.width/2&&i-this.helperProportions.width/2<n&&h<s+this.helperProportions.height/2&&o-this.helperProportions.height/2<a},_intersectsWithPointer:function(t){var e="x"===this.options.axis||this._isOverAxis(this.positionAbs.top+this.offset.click.top,t.top,t.height),i="y"===this.options.axis||this._isOverAxis(this.positionAbs.left+this.offset.click.left,t.left,t.width),s=e&&i,o=this._getDragVerticalDirection(),r=this._getDragHorizontalDirection();return!!s&&(this.floating?r&&"right"===r||"down"===o?2:1:o&&("down"===o?2:1))},_intersectsWithSides:function(t){var e=this._isOverAxis(this.positionAbs.top+this.offset.click.top,t.top+t.height/2,t.height),i=this._isOverAxis(this.positionAbs.left+this.offset.click.left,t.left+t.width/2,t.width),s=this._getDragVerticalDirection(),o=this._getDragHorizontalDirection();return this.floating&&o?"right"===o&&i||"left"===o&&!i:s&&("down"===s&&e||"up"===s&&!e)},_getDragVerticalDirection:function(){var t=this.positionAbs.top-this.lastPositionAbs.top;return 0!=t&&(0<t?"down":"up")},_getDragHorizontalDirection:function(){var t=this.positionAbs.left-this.lastPositionAbs.left;return 0!=t&&(0<t?"right":"left")},refresh:function(t){return this._refreshItems(t),this._setHandleClassName(),this.refreshPositions(),this},_connectWith:function(){var t=this.options;return t.connectWith.constructor===String?[t.connectWith]:t.connectWith},_getItemsAsjQuery:function(t){var e,i,s,o,r=[],n=[],h=this._connectWith();if(h&&t)for(e=h.length-1;0<=e;e--)for(i=(s=u(h[e],this.document[0])).length-1;0<=i;i--)(o=u.data(s[i],this.widgetFullName))&&o!==this&&!o.options.disabled&&n.push([u.isFunction(o.options.items)?o.options.items.call(o.element):u(o.options.items,o.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),o]);function a(){r.push(this)}for(n.push([u.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):u(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]),e=n.length-1;0<=e;e--)n[e][0].each(a);return u(r)},_removeCurrentsFromItems:function(){var i=this.currentItem.find(":data("+this.widgetName+"-item)");this.items=u.grep(this.items,function(t){for(var e=0;e<i.length;e++)if(i[e]===t.item[0])return!1;return!0})},_refreshItems:function(t){this.items=[],this.containers=[this];var e,i,s,o,r,n,h,a,l=this.items,c=[[u.isFunction(this.options.items)?this.options.items.call(this.element[0],t,{item:this.currentItem}):u(this.options.items,this.element),this]],p=this._connectWith();if(p&&this.ready)for(e=p.length-1;0<=e;e--)for(i=(s=u(p[e],this.document[0])).length-1;0<=i;i--)(o=u.data(s[i],this.widgetFullName))&&o!==this&&!o.options.disabled&&(c.push([u.isFunction(o.options.items)?o.options.items.call(o.element[0],t,{item:this.currentItem}):u(o.options.items,o.element),o]),this.containers.push(o));for(e=c.length-1;0<=e;e--)for(r=c[e][1],i=0,a=(n=c[e][0]).length;i<a;i++)(h=u(n[i])).data(this.widgetName+"-item",r),l.push({item:h,instance:r,width:0,height:0,left:0,top:0})},refreshPositions:function(t){var e,i,s,o;for(this.floating=!!this.items.length&&("x"===this.options.axis||this._isFloating(this.items[0].item)),this.offsetParent&&this.helper&&(this.offset.parent=this._getParentOffset()),e=this.items.length-1;0<=e;e--)(i=this.items[e]).instance!==this.currentContainer&&this.currentContainer&&i.item[0]!==this.currentItem[0]||(s=this.options.toleranceElement?u(this.options.toleranceElement,i.item):i.item,t||(i.width=s.outerWidth(),i.height=s.outerHeight()),o=s.offset(),i.left=o.left,i.top=o.top);if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(e=this.containers.length-1;0<=e;e--)o=this.containers[e].element.offset(),this.containers[e].containerCache.left=o.left,this.containers[e].containerCache.top=o.top,this.containers[e].containerCache.width=this.containers[e].element.outerWidth(),this.containers[e].containerCache.height=this.containers[e].element.outerHeight();return this},_createPlaceholder:function(i){var s,o=(i=i||this).options;o.placeholder&&o.placeholder.constructor!==String||(s=o.placeholder,o.placeholder={element:function(){var t=i.currentItem[0].nodeName.toLowerCase(),e=u("<"+t+">",i.document[0]).addClass(s||i.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper");return"tbody"===t?i._createTrPlaceholder(i.currentItem.find("tr").eq(0),u("<tr>",i.document[0]).appendTo(e)):"tr"===t?i._createTrPlaceholder(i.currentItem,e):"img"===t&&e.attr("src",i.currentItem.attr("src")),s||e.css("visibility","hidden"),e},update:function(t,e){s&&!o.forcePlaceholderSize||(e.height()||e.height(i.currentItem.innerHeight()-parseInt(i.currentItem.css("paddingTop")||0,10)-parseInt(i.currentItem.css("paddingBottom")||0,10)),e.width()||e.width(i.currentItem.innerWidth()-parseInt(i.currentItem.css("paddingLeft")||0,10)-parseInt(i.currentItem.css("paddingRight")||0,10)))}}),i.placeholder=u(o.placeholder.element.call(i.element,i.currentItem)),i.currentItem.after(i.placeholder),o.placeholder.update(i,i.placeholder)},_createTrPlaceholder:function(t,e){var i=this;t.children().each(function(){u("<td>&#160;</td>",i.document[0]).attr("colspan",u(this).attr("colspan")||1).appendTo(e)})},_contactContainers:function(t){var e,i,s,o,r,n,h,a,l,c,p=null,f=null;for(e=this.containers.length-1;0<=e;e--)if(!u.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(p&&u.contains(this.containers[e].element[0],p.element[0]))continue;p=this.containers[e],f=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",t,this._uiHash(this)),this.containers[e].containerCache.over=0);if(p)if(1===this.containers.length)this.containers[f].containerCache.over||(this.containers[f]._trigger("over",t,this._uiHash(this)),this.containers[f].containerCache.over=1);else{for(s=1e4,o=null,r=(l=p.floating||this._isFloating(this.currentItem))?"left":"top",n=l?"width":"height",c=l?"clientX":"clientY",i=this.items.length-1;0<=i;i--)u.contains(this.containers[f].element[0],this.items[i].item[0])&&this.items[i].item[0]!==this.currentItem[0]&&(h=this.items[i].item.offset()[r],a=!1,t[c]-h>this.items[i][n]/2&&(a=!0),Math.abs(t[c]-h)<s&&(s=Math.abs(t[c]-h),o=this.items[i],this.direction=a?"up":"down"));if(!o&&!this.options.dropOnEmpty)return;if(this.currentContainer===this.containers[f])return void(this.currentContainer.containerCache.over||(this.containers[f]._trigger("over",t,this._uiHash()),this.currentContainer.containerCache.over=1));o?this._rearrange(t,o,null,!0):this._rearrange(t,null,this.containers[f].element,!0),this._trigger("change",t,this._uiHash()),this.containers[f]._trigger("change",t,this._uiHash(this)),this.currentContainer=this.containers[f],this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[f]._trigger("over",t,this._uiHash(this)),this.containers[f].containerCache.over=1}},_createHelper:function(t){var e=this.options,i=u.isFunction(e.helper)?u(e.helper.apply(this.element[0],[t,this.currentItem])):"clone"===e.helper?this.currentItem.clone():this.currentItem;return i.parents("body").length||u("parent"!==e.appendTo?e.appendTo:this.currentItem[0].parentNode)[0].appendChild(i[0]),i[0]===this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),i[0].style.width&&!e.forceHelperSize||i.width(this.currentItem.width()),i[0].style.height&&!e.forceHelperSize||i.height(this.currentItem.height()),i},_adjustOffsetFromHelper:function(t){"string"==typeof t&&(t=t.split(" ")),u.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();return"absolute"===this.cssPosition&&this.scrollParent[0]!==this.document[0]&&u.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop()),(this.offsetParent[0]===this.document[0].body||this.offsetParent[0].tagName&&"html"===this.offsetParent[0].tagName.toLowerCase()&&u.ui.ie)&&(t={top:0,left:0}),{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if("relative"!==this.cssPosition)return{top:0,left:0};var t=this.currentItem.position();return{top:t.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:t.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t,e,i,s=this.options;"parent"===s.containment&&(s.containment=this.helper[0].parentNode),"document"!==s.containment&&"window"!==s.containment||(this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,"document"===s.containment?this.document.width():this.window.width()-this.helperProportions.width-this.margins.left,("document"===s.containment?this.document.width():this.window.height()||this.document[0].body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]),/^(document|window|parent)$/.test(s.containment)||(t=u(s.containment)[0],e=u(s.containment).offset(),i="hidden"!==u(t).css("overflow"),this.containment=[e.left+(parseInt(u(t).css("borderLeftWidth"),10)||0)+(parseInt(u(t).css("paddingLeft"),10)||0)-this.margins.left,e.top+(parseInt(u(t).css("borderTopWidth"),10)||0)+(parseInt(u(t).css("paddingTop"),10)||0)-this.margins.top,e.left+(i?Math.max(t.scrollWidth,t.offsetWidth):t.offsetWidth)-(parseInt(u(t).css("borderLeftWidth"),10)||0)-(parseInt(u(t).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,e.top+(i?Math.max(t.scrollHeight,t.offsetHeight):t.offsetHeight)-(parseInt(u(t).css("borderTopWidth"),10)||0)-(parseInt(u(t).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top])},_convertPositionTo:function(t,e){e=e||this.position;var i="absolute"===t?1:-1,s="absolute"!==this.cssPosition||this.scrollParent[0]!==this.document[0]&&u.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName);return{top:e.top+this.offset.relative.top*i+this.offset.parent.top*i-("fixed"===this.cssPosition?-this.scrollParent.scrollTop():o?0:s.scrollTop())*i,left:e.left+this.offset.relative.left*i+this.offset.parent.left*i-("fixed"===this.cssPosition?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())*i}},_generatePosition:function(t){var e,i,s=this.options,o=t.pageX,r=t.pageY,n="absolute"!==this.cssPosition||this.scrollParent[0]!==this.document[0]&&u.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,h=/(html|body)/i.test(n[0].tagName);return"relative"!==this.cssPosition||this.scrollParent[0]!==this.document[0]&&this.scrollParent[0]!==this.offsetParent[0]||(this.offset.relative=this._getRelativeOffset()),this.originalPosition&&(this.containment&&(t.pageX-this.offset.click.left<this.containment[0]&&(o=this.containment[0]+this.offset.click.left),t.pageY-this.offset.click.top<this.containment[1]&&(r=this.containment[1]+this.offset.click.top),t.pageX-this.offset.click.left>this.containment[2]&&(o=this.containment[2]+this.offset.click.left),t.pageY-this.offset.click.top>this.containment[3]&&(r=this.containment[3]+this.offset.click.top)),s.grid&&(e=this.originalPageY+Math.round((r-this.originalPageY)/s.grid[1])*s.grid[1],r=this.containment?e-this.offset.click.top>=this.containment[1]&&e-this.offset.click.top<=this.containment[3]?e:e-this.offset.click.top>=this.containment[1]?e-s.grid[1]:e+s.grid[1]:e,i=this.originalPageX+Math.round((o-this.originalPageX)/s.grid[0])*s.grid[0],o=this.containment?i-this.offset.click.left>=this.containment[0]&&i-this.offset.click.left<=this.containment[2]?i:i-this.offset.click.left>=this.containment[0]?i-s.grid[0]:i+s.grid[0]:i)),{top:r-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+("fixed"===this.cssPosition?-this.scrollParent.scrollTop():h?0:n.scrollTop()),left:o-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+("fixed"===this.cssPosition?-this.scrollParent.scrollLeft():h?0:n.scrollLeft())}},_rearrange:function(t,e,i,s){i?i[0].appendChild(this.placeholder[0]):e.item[0].parentNode.insertBefore(this.placeholder[0],"down"===this.direction?e.item[0]:e.item[0].nextSibling),this.counter=this.counter?++this.counter:1;var o=this.counter;this._delay(function(){o===this.counter&&this.refreshPositions(!s)})},_clear:function(t,e){this.reverting=!1;var i,s=[];if(!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem),this._noFinalSort=null,this.helper[0]===this.currentItem[0]){for(i in this._storedCSS)"auto"!==this._storedCSS[i]&&"static"!==this._storedCSS[i]||(this._storedCSS[i]="");this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();function o(e,i,s){return function(t){s._trigger(e,t,i._uiHash(i))}}for(this.fromOutside&&!e&&s.push(function(t){this._trigger("receive",t,this._uiHash(this.fromOutside))}),!this.fromOutside&&this.domPosition.prev===this.currentItem.prev().not(".ui-sortable-helper")[0]&&this.domPosition.parent===this.currentItem.parent()[0]||e||s.push(function(t){this._trigger("update",t,this._uiHash())}),this!==this.currentContainer&&(e||(s.push(function(t){this._trigger("remove",t,this._uiHash())}),s.push(function(e){return function(t){e._trigger("receive",t,this._uiHash(this))}}.call(this,this.currentContainer)),s.push(function(e){return function(t){e._trigger("update",t,this._uiHash(this))}}.call(this,this.currentContainer)))),i=this.containers.length-1;0<=i;i--)e||s.push(o("deactivate",this,this.containers[i])),this.containers[i].containerCache.over&&(s.push(o("out",this,this.containers[i])),this.containers[i].containerCache.over=0);if(this.storedCursor&&(this.document.find("body").css("cursor",this.storedCursor),this.storedStylesheet.remove()),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex","auto"===this._storedZIndex?"":this._storedZIndex),this.dragging=!1,e||this._trigger("beforeStop",t,this._uiHash()),this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.cancelHelperRemoval||(this.helper[0]!==this.currentItem[0]&&this.helper.remove(),this.helper=null),!e){for(i=0;i<s.length;i++)s[i].call(this,t);this._trigger("stop",t,this._uiHash())}return this.fromOutside=!1,!this.cancelHelperRemoval},_trigger:function(){!1===u.Widget.prototype._trigger.apply(this,arguments)&&this.cancel()},_uiHash:function(t){var e=t||this;return{helper:e.helper,placeholder:e.placeholder||u([]),position:e.position,originalPosition:e.originalPosition,offset:e.positionAbs,item:e.currentItem,sender:t?t.element:null}}})});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./mouse","./core"],t):t(jQuery)}(function(u){return u.widget("ui.sortable",u.ui.mouse,{version:"1.12.1",widgetEventPrefix:"sort",ready:!1,options:{appendTo:"parent",axis:!1,connectWith:!1,containment:!1,cursor:"auto",cursorAt:!1,dropOnEmpty:!0,forcePlaceholderSize:!1,forceHelperSize:!1,grid:!1,handle:!1,helper:"original",items:"> *",opacity:!1,placeholder:!1,revert:!1,scroll:!0,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1e3,activate:null,beforeStop:null,change:null,deactivate:null,out:null,over:null,receive:null,remove:null,sort:null,start:null,stop:null,update:null},_isOverAxis:function(t,e,i){return e<=t&&t<e+i},_isFloating:function(t){return/left|right/.test(t.css("float"))||/inline|table-cell/.test(t.css("display"))},_create:function(){this.containerCache={},this._addClass("ui-sortable"),this.refresh(),this.offset=this.element.offset(),this._mouseInit(),this._setHandleClassName(),this.ready=!0},_setOption:function(t,e){this._super(t,e),"handle"===t&&this._setHandleClassName()},_setHandleClassName:function(){var t=this;this._removeClass(this.element.find(".ui-sortable-handle"),"ui-sortable-handle"),u.each(this.items,function(){t._addClass(this.instance.options.handle?this.item.find(this.instance.options.handle):this.item,"ui-sortable-handle")})},_destroy:function(){this._mouseDestroy();for(var t=this.items.length-1;0<=t;t--)this.items[t].item.removeData(this.widgetName+"-item");return this},_mouseCapture:function(t,e){var i=null,s=!1,o=this;return!this.reverting&&(!this.options.disabled&&"static"!==this.options.type&&(this._refreshItems(t),u(t.target).parents().each(function(){if(u.data(this,o.widgetName+"-item")===o)return i=u(this),!1}),u.data(t.target,o.widgetName+"-item")===o&&(i=u(t.target)),!!i&&(!(this.options.handle&&!e&&(u(this.options.handle,i).find("*").addBack().each(function(){this===t.target&&(s=!0)}),!s))&&(this.currentItem=i,this._removeCurrentsFromItems(),!0))))},_mouseStart:function(t,e,i){var s,o,r=this.options;if((this.currentContainer=this).refreshPositions(),this.helper=this._createHelper(t),this._cacheHelperProportions(),this._cacheMargins(),this.scrollParent=this.helper.scrollParent(),this.offset=this.currentItem.offset(),this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left},u.extend(this.offset,{click:{left:t.pageX-this.offset.left,top:t.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}),this.helper.css("position","absolute"),this.cssPosition=this.helper.css("position"),this.originalPosition=this._generatePosition(t),this.originalPageX=t.pageX,this.originalPageY=t.pageY,r.cursorAt&&this._adjustOffsetFromHelper(r.cursorAt),this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]},this.helper[0]!==this.currentItem[0]&&this.currentItem.hide(),this._createPlaceholder(),r.containment&&this._setContainment(),r.cursor&&"auto"!==r.cursor&&(o=this.document.find("body"),this.storedCursor=o.css("cursor"),o.css("cursor",r.cursor),this.storedStylesheet=u("<style>*{ cursor: "+r.cursor+" !important; }</style>").appendTo(o)),r.opacity&&(this.helper.css("opacity")&&(this._storedOpacity=this.helper.css("opacity")),this.helper.css("opacity",r.opacity)),r.zIndex&&(this.helper.css("zIndex")&&(this._storedZIndex=this.helper.css("zIndex")),this.helper.css("zIndex",r.zIndex)),this.scrollParent[0]!==this.document[0]&&"HTML"!==this.scrollParent[0].tagName&&(this.overflowOffset=this.scrollParent.offset()),this._trigger("start",t,this._uiHash()),this._preserveHelperProportions||this._cacheHelperProportions(),!i)for(s=this.containers.length-1;0<=s;s--)this.containers[s]._trigger("activate",t,this._uiHash(this));return u.ui.ddmanager&&(u.ui.ddmanager.current=this),u.ui.ddmanager&&!r.dropBehaviour&&u.ui.ddmanager.prepareOffsets(this,t),this.dragging=!0,this._addClass(this.helper,"ui-sortable-helper"),this._mouseDrag(t),!0},_mouseDrag:function(t){var e,i,s,o,r=this.options,n=!1;for(this.position=this._generatePosition(t),this.positionAbs=this._convertPositionTo("absolute"),this.lastPositionAbs||(this.lastPositionAbs=this.positionAbs),this.options.scroll&&(this.scrollParent[0]!==this.document[0]&&"HTML"!==this.scrollParent[0].tagName?(this.overflowOffset.top+this.scrollParent[0].offsetHeight-t.pageY<r.scrollSensitivity?this.scrollParent[0].scrollTop=n=this.scrollParent[0].scrollTop+r.scrollSpeed:t.pageY-this.overflowOffset.top<r.scrollSensitivity&&(this.scrollParent[0].scrollTop=n=this.scrollParent[0].scrollTop-r.scrollSpeed),this.overflowOffset.left+this.scrollParent[0].offsetWidth-t.pageX<r.scrollSensitivity?this.scrollParent[0].scrollLeft=n=this.scrollParent[0].scrollLeft+r.scrollSpeed:t.pageX-this.overflowOffset.left<r.scrollSensitivity&&(this.scrollParent[0].scrollLeft=n=this.scrollParent[0].scrollLeft-r.scrollSpeed)):(t.pageY-this.document.scrollTop()<r.scrollSensitivity?n=this.document.scrollTop(this.document.scrollTop()-r.scrollSpeed):this.window.height()-(t.pageY-this.document.scrollTop())<r.scrollSensitivity&&(n=this.document.scrollTop(this.document.scrollTop()+r.scrollSpeed)),t.pageX-this.document.scrollLeft()<r.scrollSensitivity?n=this.document.scrollLeft(this.document.scrollLeft()-r.scrollSpeed):this.window.width()-(t.pageX-this.document.scrollLeft())<r.scrollSensitivity&&(n=this.document.scrollLeft(this.document.scrollLeft()+r.scrollSpeed))),!1!==n&&u.ui.ddmanager&&!r.dropBehaviour&&u.ui.ddmanager.prepareOffsets(this,t)),this.positionAbs=this._convertPositionTo("absolute"),this.options.axis&&"y"===this.options.axis||(this.helper[0].style.left=this.position.left+"px"),this.options.axis&&"x"===this.options.axis||(this.helper[0].style.top=this.position.top+"px"),e=this.items.length-1;0<=e;e--)if(s=(i=this.items[e]).item[0],(o=this._intersectsWithPointer(i))&&i.instance===this.currentContainer&&!(s===this.currentItem[0]||this.placeholder[1===o?"next":"prev"]()[0]===s||u.contains(this.placeholder[0],s)||"semi-dynamic"===this.options.type&&u.contains(this.element[0],s))){if(this.direction=1===o?"down":"up","pointer"!==this.options.tolerance&&!this._intersectsWithSides(i))break;this._rearrange(t,i),this._trigger("change",t,this._uiHash());break}return this._contactContainers(t),u.ui.ddmanager&&u.ui.ddmanager.drag(this,t),this._trigger("sort",t,this._uiHash()),this.lastPositionAbs=this.positionAbs,!1},_mouseStop:function(t,e){if(t){if(u.ui.ddmanager&&!this.options.dropBehaviour&&u.ui.ddmanager.drop(this,t),this.options.revert){var i=this,s=this.placeholder.offset(),o=this.options.axis,r={};o&&"x"!==o||(r.left=s.left-this.offset.parent.left-this.margins.left+(this.offsetParent[0]===this.document[0].body?0:this.offsetParent[0].scrollLeft)),o&&"y"!==o||(r.top=s.top-this.offset.parent.top-this.margins.top+(this.offsetParent[0]===this.document[0].body?0:this.offsetParent[0].scrollTop)),this.reverting=!0,u(this.helper).animate(r,parseInt(this.options.revert,10)||500,function(){i._clear(t)})}else this._clear(t,e);return!1}},cancel:function(){if(this.dragging){this._mouseUp(new u.Event("mouseup",{target:null})),"original"===this.options.helper?(this.currentItem.css(this._storedCSS),this._removeClass(this.currentItem,"ui-sortable-helper")):this.currentItem.show();for(var t=this.containers.length-1;0<=t;t--)this.containers[t]._trigger("deactivate",null,this._uiHash(this)),this.containers[t].containerCache.over&&(this.containers[t]._trigger("out",null,this._uiHash(this)),this.containers[t].containerCache.over=0)}return this.placeholder&&(this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]),"original"!==this.options.helper&&this.helper&&this.helper[0].parentNode&&this.helper.remove(),u.extend(this,{helper:null,dragging:!1,reverting:!1,_noFinalSort:null}),this.domPosition.prev?u(this.domPosition.prev).after(this.currentItem):u(this.domPosition.parent).prepend(this.currentItem)),this},serialize:function(e){var t=this._getItemsAsjQuery(e&&e.connected),i=[];return e=e||{},u(t).each(function(){var t=(u(e.item||this).attr(e.attribute||"id")||"").match(e.expression||/(.+)[\-=_](.+)/);t&&i.push((e.key||t[1]+"[]")+"="+(e.key&&e.expression?t[1]:t[2]))}),!i.length&&e.key&&i.push(e.key+"="),i.join("&")},toArray:function(t){var e=this._getItemsAsjQuery(t&&t.connected),i=[];return t=t||{},e.each(function(){i.push(u(t.item||this).attr(t.attribute||"id")||"")}),i},_intersectsWith:function(t){var e=this.positionAbs.left,i=e+this.helperProportions.width,s=this.positionAbs.top,o=s+this.helperProportions.height,r=t.left,n=r+t.width,h=t.top,a=h+t.height,l=this.offset.click.top,c=this.offset.click.left,p="x"===this.options.axis||h<s+l&&s+l<a,f="y"===this.options.axis||r<e+c&&e+c<n,u=p&&f;return"pointer"===this.options.tolerance||this.options.forcePointerForContainers||"pointer"!==this.options.tolerance&&this.helperProportions[this.floating?"width":"height"]>t[this.floating?"width":"height"]?u:r<e+this.helperProportions.width/2&&i-this.helperProportions.width/2<n&&h<s+this.helperProportions.height/2&&o-this.helperProportions.height/2<a},_intersectsWithPointer:function(t){var e,i,s="x"===this.options.axis||this._isOverAxis(this.positionAbs.top+this.offset.click.top,t.top,t.height),o="y"===this.options.axis||this._isOverAxis(this.positionAbs.left+this.offset.click.left,t.left,t.width);return!(!s||!o)&&(e=this._getDragVerticalDirection(),i=this._getDragHorizontalDirection(),this.floating?"right"===i||"down"===e?2:1:e&&("down"===e?2:1))},_intersectsWithSides:function(t){var e=this._isOverAxis(this.positionAbs.top+this.offset.click.top,t.top+t.height/2,t.height),i=this._isOverAxis(this.positionAbs.left+this.offset.click.left,t.left+t.width/2,t.width),s=this._getDragVerticalDirection(),o=this._getDragHorizontalDirection();return this.floating&&o?"right"===o&&i||"left"===o&&!i:s&&("down"===s&&e||"up"===s&&!e)},_getDragVerticalDirection:function(){var t=this.positionAbs.top-this.lastPositionAbs.top;return 0!=t&&(0<t?"down":"up")},_getDragHorizontalDirection:function(){var t=this.positionAbs.left-this.lastPositionAbs.left;return 0!=t&&(0<t?"right":"left")},refresh:function(t){return this._refreshItems(t),this._setHandleClassName(),this.refreshPositions(),this},_connectWith:function(){var t=this.options;return t.connectWith.constructor===String?[t.connectWith]:t.connectWith},_getItemsAsjQuery:function(t){var e,i,s,o,r=[],n=[],h=this._connectWith();if(h&&t)for(e=h.length-1;0<=e;e--)for(i=(s=u(h[e],this.document[0])).length-1;0<=i;i--)(o=u.data(s[i],this.widgetFullName))&&o!==this&&!o.options.disabled&&n.push([u.isFunction(o.options.items)?o.options.items.call(o.element):u(o.options.items,o.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),o]);function a(){r.push(this)}for(n.push([u.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):u(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]),e=n.length-1;0<=e;e--)n[e][0].each(a);return u(r)},_removeCurrentsFromItems:function(){var i=this.currentItem.find(":data("+this.widgetName+"-item)");this.items=u.grep(this.items,function(t){for(var e=0;e<i.length;e++)if(i[e]===t.item[0])return!1;return!0})},_refreshItems:function(t){this.items=[],this.containers=[this];var e,i,s,o,r,n,h,a,l=this.items,c=[[u.isFunction(this.options.items)?this.options.items.call(this.element[0],t,{item:this.currentItem}):u(this.options.items,this.element),this]],p=this._connectWith();if(p&&this.ready)for(e=p.length-1;0<=e;e--)for(i=(s=u(p[e],this.document[0])).length-1;0<=i;i--)(o=u.data(s[i],this.widgetFullName))&&o!==this&&!o.options.disabled&&(c.push([u.isFunction(o.options.items)?o.options.items.call(o.element[0],t,{item:this.currentItem}):u(o.options.items,o.element),o]),this.containers.push(o));for(e=c.length-1;0<=e;e--)for(r=c[e][1],i=0,a=(n=c[e][0]).length;i<a;i++)(h=u(n[i])).data(this.widgetName+"-item",r),l.push({item:h,instance:r,width:0,height:0,left:0,top:0})},refreshPositions:function(t){var e,i,s,o;for(this.floating=!!this.items.length&&("x"===this.options.axis||this._isFloating(this.items[0].item)),this.offsetParent&&this.helper&&(this.offset.parent=this._getParentOffset()),e=this.items.length-1;0<=e;e--)(i=this.items[e]).instance!==this.currentContainer&&this.currentContainer&&i.item[0]!==this.currentItem[0]||(s=this.options.toleranceElement?u(this.options.toleranceElement,i.item):i.item,t||(i.width=s.outerWidth(),i.height=s.outerHeight()),o=s.offset(),i.left=o.left,i.top=o.top);if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(e=this.containers.length-1;0<=e;e--)o=this.containers[e].element.offset(),this.containers[e].containerCache.left=o.left,this.containers[e].containerCache.top=o.top,this.containers[e].containerCache.width=this.containers[e].element.outerWidth(),this.containers[e].containerCache.height=this.containers[e].element.outerHeight();return this},_createPlaceholder:function(i){var s,o=(i=i||this).options;o.placeholder&&o.placeholder.constructor!==String||(s=o.placeholder,o.placeholder={element:function(){var t=i.currentItem[0].nodeName.toLowerCase(),e=u("<"+t+">",i.document[0]);return i._addClass(e,"ui-sortable-placeholder",s||i.currentItem[0].className)._removeClass(e,"ui-sortable-helper"),"tbody"===t?i._createTrPlaceholder(i.currentItem.find("tr").eq(0),u("<tr>",i.document[0]).appendTo(e)):"tr"===t?i._createTrPlaceholder(i.currentItem,e):"img"===t&&e.attr("src",i.currentItem.attr("src")),s||e.css("visibility","hidden"),e},update:function(t,e){s&&!o.forcePlaceholderSize||(e.height()||e.height(i.currentItem.innerHeight()-parseInt(i.currentItem.css("paddingTop")||0,10)-parseInt(i.currentItem.css("paddingBottom")||0,10)),e.width()||e.width(i.currentItem.innerWidth()-parseInt(i.currentItem.css("paddingLeft")||0,10)-parseInt(i.currentItem.css("paddingRight")||0,10)))}}),i.placeholder=u(o.placeholder.element.call(i.element,i.currentItem)),i.currentItem.after(i.placeholder),o.placeholder.update(i,i.placeholder)},_createTrPlaceholder:function(t,e){var i=this;t.children().each(function(){u("<td>&#160;</td>",i.document[0]).attr("colspan",u(this).attr("colspan")||1).appendTo(e)})},_contactContainers:function(t){var e,i,s,o,r,n,h,a,l,c,p=null,f=null;for(e=this.containers.length-1;0<=e;e--)if(!u.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(p&&u.contains(this.containers[e].element[0],p.element[0]))continue;p=this.containers[e],f=e}else this.containers[e].containerCache.over&&(this.containers[e]._trigger("out",t,this._uiHash(this)),this.containers[e].containerCache.over=0);if(p)if(1===this.containers.length)this.containers[f].containerCache.over||(this.containers[f]._trigger("over",t,this._uiHash(this)),this.containers[f].containerCache.over=1);else{for(s=1e4,o=null,r=(l=p.floating||this._isFloating(this.currentItem))?"left":"top",n=l?"width":"height",c=l?"pageX":"pageY",i=this.items.length-1;0<=i;i--)u.contains(this.containers[f].element[0],this.items[i].item[0])&&this.items[i].item[0]!==this.currentItem[0]&&(h=this.items[i].item.offset()[r],a=!1,t[c]-h>this.items[i][n]/2&&(a=!0),Math.abs(t[c]-h)<s&&(s=Math.abs(t[c]-h),o=this.items[i],this.direction=a?"up":"down"));if(!o&&!this.options.dropOnEmpty)return;if(this.currentContainer===this.containers[f])return void(this.currentContainer.containerCache.over||(this.containers[f]._trigger("over",t,this._uiHash()),this.currentContainer.containerCache.over=1));o?this._rearrange(t,o,null,!0):this._rearrange(t,null,this.containers[f].element,!0),this._trigger("change",t,this._uiHash()),this.containers[f]._trigger("change",t,this._uiHash(this)),this.currentContainer=this.containers[f],this.options.placeholder.update(this.currentContainer,this.placeholder),this.containers[f]._trigger("over",t,this._uiHash(this)),this.containers[f].containerCache.over=1}},_createHelper:function(t){var e=this.options,i=u.isFunction(e.helper)?u(e.helper.apply(this.element[0],[t,this.currentItem])):"clone"===e.helper?this.currentItem.clone():this.currentItem;return i.parents("body").length||u("parent"!==e.appendTo?e.appendTo:this.currentItem[0].parentNode)[0].appendChild(i[0]),i[0]===this.currentItem[0]&&(this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")}),i[0].style.width&&!e.forceHelperSize||i.width(this.currentItem.width()),i[0].style.height&&!e.forceHelperSize||i.height(this.currentItem.height()),i},_adjustOffsetFromHelper:function(t){"string"==typeof t&&(t=t.split(" ")),u.isArray(t)&&(t={left:+t[0],top:+t[1]||0}),"left"in t&&(this.offset.click.left=t.left+this.margins.left),"right"in t&&(this.offset.click.left=this.helperProportions.width-t.right+this.margins.left),"top"in t&&(this.offset.click.top=t.top+this.margins.top),"bottom"in t&&(this.offset.click.top=this.helperProportions.height-t.bottom+this.margins.top)},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var t=this.offsetParent.offset();return"absolute"===this.cssPosition&&this.scrollParent[0]!==this.document[0]&&u.contains(this.scrollParent[0],this.offsetParent[0])&&(t.left+=this.scrollParent.scrollLeft(),t.top+=this.scrollParent.scrollTop()),(this.offsetParent[0]===this.document[0].body||this.offsetParent[0].tagName&&"html"===this.offsetParent[0].tagName.toLowerCase()&&u.ui.ie)&&(t={top:0,left:0}),{top:t.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:t.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if("relative"!==this.cssPosition)return{top:0,left:0};var t=this.currentItem.position();return{top:t.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:t.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var t,e,i,s=this.options;"parent"===s.containment&&(s.containment=this.helper[0].parentNode),"document"!==s.containment&&"window"!==s.containment||(this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,"document"===s.containment?this.document.width():this.window.width()-this.helperProportions.width-this.margins.left,("document"===s.containment?this.document.height()||document.body.parentNode.scrollHeight:this.window.height()||this.document[0].body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top]),/^(document|window|parent)$/.test(s.containment)||(t=u(s.containment)[0],e=u(s.containment).offset(),i="hidden"!==u(t).css("overflow"),this.containment=[e.left+(parseInt(u(t).css("borderLeftWidth"),10)||0)+(parseInt(u(t).css("paddingLeft"),10)||0)-this.margins.left,e.top+(parseInt(u(t).css("borderTopWidth"),10)||0)+(parseInt(u(t).css("paddingTop"),10)||0)-this.margins.top,e.left+(i?Math.max(t.scrollWidth,t.offsetWidth):t.offsetWidth)-(parseInt(u(t).css("borderLeftWidth"),10)||0)-(parseInt(u(t).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,e.top+(i?Math.max(t.scrollHeight,t.offsetHeight):t.offsetHeight)-(parseInt(u(t).css("borderTopWidth"),10)||0)-(parseInt(u(t).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top])},_convertPositionTo:function(t,e){e=e||this.position;var i="absolute"===t?1:-1,s="absolute"!==this.cssPosition||this.scrollParent[0]!==this.document[0]&&u.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,o=/(html|body)/i.test(s[0].tagName);return{top:e.top+this.offset.relative.top*i+this.offset.parent.top*i-("fixed"===this.cssPosition?-this.scrollParent.scrollTop():o?0:s.scrollTop())*i,left:e.left+this.offset.relative.left*i+this.offset.parent.left*i-("fixed"===this.cssPosition?-this.scrollParent.scrollLeft():o?0:s.scrollLeft())*i}},_generatePosition:function(t){var e,i,s=this.options,o=t.pageX,r=t.pageY,n="absolute"!==this.cssPosition||this.scrollParent[0]!==this.document[0]&&u.contains(this.scrollParent[0],this.offsetParent[0])?this.scrollParent:this.offsetParent,h=/(html|body)/i.test(n[0].tagName);return"relative"!==this.cssPosition||this.scrollParent[0]!==this.document[0]&&this.scrollParent[0]!==this.offsetParent[0]||(this.offset.relative=this._getRelativeOffset()),this.originalPosition&&(this.containment&&(t.pageX-this.offset.click.left<this.containment[0]&&(o=this.containment[0]+this.offset.click.left),t.pageY-this.offset.click.top<this.containment[1]&&(r=this.containment[1]+this.offset.click.top),t.pageX-this.offset.click.left>this.containment[2]&&(o=this.containment[2]+this.offset.click.left),t.pageY-this.offset.click.top>this.containment[3]&&(r=this.containment[3]+this.offset.click.top)),s.grid&&(e=this.originalPageY+Math.round((r-this.originalPageY)/s.grid[1])*s.grid[1],r=this.containment?e-this.offset.click.top>=this.containment[1]&&e-this.offset.click.top<=this.containment[3]?e:e-this.offset.click.top>=this.containment[1]?e-s.grid[1]:e+s.grid[1]:e,i=this.originalPageX+Math.round((o-this.originalPageX)/s.grid[0])*s.grid[0],o=this.containment?i-this.offset.click.left>=this.containment[0]&&i-this.offset.click.left<=this.containment[2]?i:i-this.offset.click.left>=this.containment[0]?i-s.grid[0]:i+s.grid[0]:i)),{top:r-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+("fixed"===this.cssPosition?-this.scrollParent.scrollTop():h?0:n.scrollTop()),left:o-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+("fixed"===this.cssPosition?-this.scrollParent.scrollLeft():h?0:n.scrollLeft())}},_rearrange:function(t,e,i,s){i?i[0].appendChild(this.placeholder[0]):e.item[0].parentNode.insertBefore(this.placeholder[0],"down"===this.direction?e.item[0]:e.item[0].nextSibling),this.counter=this.counter?++this.counter:1;var o=this.counter;this._delay(function(){o===this.counter&&this.refreshPositions(!s)})},_clear:function(t,e){this.reverting=!1;var i,s=[];if(!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem),this._noFinalSort=null,this.helper[0]===this.currentItem[0]){for(i in this._storedCSS)"auto"!==this._storedCSS[i]&&"static"!==this._storedCSS[i]||(this._storedCSS[i]="");this.currentItem.css(this._storedCSS),this._removeClass(this.currentItem,"ui-sortable-helper")}else this.currentItem.show();function o(e,i,s){return function(t){s._trigger(e,t,i._uiHash(i))}}for(this.fromOutside&&!e&&s.push(function(t){this._trigger("receive",t,this._uiHash(this.fromOutside))}),!this.fromOutside&&this.domPosition.prev===this.currentItem.prev().not(".ui-sortable-helper")[0]&&this.domPosition.parent===this.currentItem.parent()[0]||e||s.push(function(t){this._trigger("update",t,this._uiHash())}),this!==this.currentContainer&&(e||(s.push(function(t){this._trigger("remove",t,this._uiHash())}),s.push(function(e){return function(t){e._trigger("receive",t,this._uiHash(this))}}.call(this,this.currentContainer)),s.push(function(e){return function(t){e._trigger("update",t,this._uiHash(this))}}.call(this,this.currentContainer)))),i=this.containers.length-1;0<=i;i--)e||s.push(o("deactivate",this,this.containers[i])),this.containers[i].containerCache.over&&(s.push(o("out",this,this.containers[i])),this.containers[i].containerCache.over=0);if(this.storedCursor&&(this.document.find("body").css("cursor",this.storedCursor),this.storedStylesheet.remove()),this._storedOpacity&&this.helper.css("opacity",this._storedOpacity),this._storedZIndex&&this.helper.css("zIndex","auto"===this._storedZIndex?"":this._storedZIndex),this.dragging=!1,e||this._trigger("beforeStop",t,this._uiHash()),this.placeholder[0].parentNode.removeChild(this.placeholder[0]),this.cancelHelperRemoval||(this.helper[0]!==this.currentItem[0]&&this.helper.remove(),this.helper=null),!e){for(i=0;i<s.length;i++)s[i].call(this,t);this._trigger("stop",t,this._uiHash())}return this.fromOutside=!1,!this.cancelHelperRemoval},_trigger:function(){!1===u.Widget.prototype._trigger.apply(this,arguments)&&this.cancel()},_uiHash:function(t){var e=t||this;return{helper:e.helper,placeholder:e.placeholder||u([]),position:e.position,originalPosition:e.originalPosition,offset:e.positionAbs,item:e.currentItem,sender:t?t.element:null}}})});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/spinner.js b/wp-includes/js/jquery/ui/spinner.js
new file mode 100644
index 0000000000..d89db59474
--- /dev/null
+++ b/wp-includes/js/jquery/ui/spinner.js
@@ -0,0 +1,572 @@
+/*!
+ * jQuery UI Spinner 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Spinner
+//>>group: Widgets
+//>>description: Displays buttons to easily input numbers via the keyboard or mouse.
+//>>docs: http://api.jqueryui.com/spinner/
+//>>demos: http://jqueryui.com/spinner/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/spinner.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./button",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+function spinnerModifer( fn ) {
+	return function() {
+		var previous = this.element.val();
+		fn.apply( this, arguments );
+		this._refresh();
+		if ( previous !== this.element.val() ) {
+			this._trigger( "change" );
+		}
+	};
+}
+
+$.widget( "ui.spinner", {
+	version: "1.12.1",
+	defaultElement: "<input>",
+	widgetEventPrefix: "spin",
+	options: {
+		classes: {
+			"ui-spinner": "ui-corner-all",
+			"ui-spinner-down": "ui-corner-br",
+			"ui-spinner-up": "ui-corner-tr"
+		},
+		culture: null,
+		icons: {
+			down: "ui-icon-triangle-1-s",
+			up: "ui-icon-triangle-1-n"
+		},
+		incremental: true,
+		max: null,
+		min: null,
+		numberFormat: null,
+		page: 10,
+		step: 1,
+
+		change: null,
+		spin: null,
+		start: null,
+		stop: null
+	},
+
+	_create: function() {
+
+		// handle string values that need to be parsed
+		this._setOption( "max", this.options.max );
+		this._setOption( "min", this.options.min );
+		this._setOption( "step", this.options.step );
+
+		// Only format if there is a value, prevents the field from being marked
+		// as invalid in Firefox, see #9573.
+		if ( this.value() !== "" ) {
+
+			// Format the value, but don't constrain.
+			this._value( this.element.val(), true );
+		}
+
+		this._draw();
+		this._on( this._events );
+		this._refresh();
+
+		// Turning off autocomplete prevents the browser from remembering the
+		// value when navigating through history, so we re-enable autocomplete
+		// if the page is unloaded before the widget is destroyed. #7790
+		this._on( this.window, {
+			beforeunload: function() {
+				this.element.removeAttr( "autocomplete" );
+			}
+		} );
+	},
+
+	_getCreateOptions: function() {
+		var options = this._super();
+		var element = this.element;
+
+		$.each( [ "min", "max", "step" ], function( i, option ) {
+			var value = element.attr( option );
+			if ( value != null && value.length ) {
+				options[ option ] = value;
+			}
+		} );
+
+		return options;
+	},
+
+	_events: {
+		keydown: function( event ) {
+			if ( this._start( event ) && this._keydown( event ) ) {
+				event.preventDefault();
+			}
+		},
+		keyup: "_stop",
+		focus: function() {
+			this.previous = this.element.val();
+		},
+		blur: function( event ) {
+			if ( this.cancelBlur ) {
+				delete this.cancelBlur;
+				return;
+			}
+
+			this._stop();
+			this._refresh();
+			if ( this.previous !== this.element.val() ) {
+				this._trigger( "change", event );
+			}
+		},
+		mousewheel: function( event, delta ) {
+			if ( !delta ) {
+				return;
+			}
+			if ( !this.spinning && !this._start( event ) ) {
+				return false;
+			}
+
+			this._spin( ( delta > 0 ? 1 : -1 ) * this.options.step, event );
+			clearTimeout( this.mousewheelTimer );
+			this.mousewheelTimer = this._delay( function() {
+				if ( this.spinning ) {
+					this._stop( event );
+				}
+			}, 100 );
+			event.preventDefault();
+		},
+		"mousedown .ui-spinner-button": function( event ) {
+			var previous;
+
+			// We never want the buttons to have focus; whenever the user is
+			// interacting with the spinner, the focus should be on the input.
+			// If the input is focused then this.previous is properly set from
+			// when the input first received focus. If the input is not focused
+			// then we need to set this.previous based on the value before spinning.
+			previous = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] ) ?
+				this.previous : this.element.val();
+			function checkFocus() {
+				var isActive = this.element[ 0 ] === $.ui.safeActiveElement( this.document[ 0 ] );
+				if ( !isActive ) {
+					this.element.trigger( "focus" );
+					this.previous = previous;
+
+					// support: IE
+					// IE sets focus asynchronously, so we need to check if focus
+					// moved off of the input because the user clicked on the button.
+					this._delay( function() {
+						this.previous = previous;
+					} );
+				}
+			}
+
+			// Ensure focus is on (or stays on) the text field
+			event.preventDefault();
+			checkFocus.call( this );
+
+			// Support: IE
+			// IE doesn't prevent moving focus even with event.preventDefault()
+			// so we set a flag to know when we should ignore the blur event
+			// and check (again) if focus moved off of the input.
+			this.cancelBlur = true;
+			this._delay( function() {
+				delete this.cancelBlur;
+				checkFocus.call( this );
+			} );
+
+			if ( this._start( event ) === false ) {
+				return;
+			}
+
+			this._repeat( null, $( event.currentTarget )
+				.hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+		},
+		"mouseup .ui-spinner-button": "_stop",
+		"mouseenter .ui-spinner-button": function( event ) {
+
+			// button will add ui-state-active if mouse was down while mouseleave and kept down
+			if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) {
+				return;
+			}
+
+			if ( this._start( event ) === false ) {
+				return false;
+			}
+			this._repeat( null, $( event.currentTarget )
+				.hasClass( "ui-spinner-up" ) ? 1 : -1, event );
+		},
+
+		// TODO: do we really want to consider this a stop?
+		// shouldn't we just stop the repeater and wait until mouseup before
+		// we trigger the stop event?
+		"mouseleave .ui-spinner-button": "_stop"
+	},
+
+	// Support mobile enhanced option and make backcompat more sane
+	_enhance: function() {
+		this.uiSpinner = this.element
+			.attr( "autocomplete", "off" )
+			.wrap( "<span>" )
+			.parent()
+
+				// Add buttons
+				.append(
+					"<a></a><a></a>"
+				);
+	},
+
+	_draw: function() {
+		this._enhance();
+
+		this._addClass( this.uiSpinner, "ui-spinner", "ui-widget ui-widget-content" );
+		this._addClass( "ui-spinner-input" );
+
+		this.element.attr( "role", "spinbutton" );
+
+		// Button bindings
+		this.buttons = this.uiSpinner.children( "a" )
+			.attr( "tabIndex", -1 )
+			.attr( "aria-hidden", true )
+			.button( {
+				classes: {
+					"ui-button": ""
+				}
+			} );
+
+		// TODO: Right now button does not support classes this is already updated in button PR
+		this._removeClass( this.buttons, "ui-corner-all" );
+
+		this._addClass( this.buttons.first(), "ui-spinner-button ui-spinner-up" );
+		this._addClass( this.buttons.last(), "ui-spinner-button ui-spinner-down" );
+		this.buttons.first().button( {
+			"icon": this.options.icons.up,
+			"showLabel": false
+		} );
+		this.buttons.last().button( {
+			"icon": this.options.icons.down,
+			"showLabel": false
+		} );
+
+		// IE 6 doesn't understand height: 50% for the buttons
+		// unless the wrapper has an explicit height
+		if ( this.buttons.height() > Math.ceil( this.uiSpinner.height() * 0.5 ) &&
+				this.uiSpinner.height() > 0 ) {
+			this.uiSpinner.height( this.uiSpinner.height() );
+		}
+	},
+
+	_keydown: function( event ) {
+		var options = this.options,
+			keyCode = $.ui.keyCode;
+
+		switch ( event.keyCode ) {
+		case keyCode.UP:
+			this._repeat( null, 1, event );
+			return true;
+		case keyCode.DOWN:
+			this._repeat( null, -1, event );
+			return true;
+		case keyCode.PAGE_UP:
+			this._repeat( null, options.page, event );
+			return true;
+		case keyCode.PAGE_DOWN:
+			this._repeat( null, -options.page, event );
+			return true;
+		}
+
+		return false;
+	},
+
+	_start: function( event ) {
+		if ( !this.spinning && this._trigger( "start", event ) === false ) {
+			return false;
+		}
+
+		if ( !this.counter ) {
+			this.counter = 1;
+		}
+		this.spinning = true;
+		return true;
+	},
+
+	_repeat: function( i, steps, event ) {
+		i = i || 500;
+
+		clearTimeout( this.timer );
+		this.timer = this._delay( function() {
+			this._repeat( 40, steps, event );
+		}, i );
+
+		this._spin( steps * this.options.step, event );
+	},
+
+	_spin: function( step, event ) {
+		var value = this.value() || 0;
+
+		if ( !this.counter ) {
+			this.counter = 1;
+		}
+
+		value = this._adjustValue( value + step * this._increment( this.counter ) );
+
+		if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false ) {
+			this._value( value );
+			this.counter++;
+		}
+	},
+
+	_increment: function( i ) {
+		var incremental = this.options.incremental;
+
+		if ( incremental ) {
+			return $.isFunction( incremental ) ?
+				incremental( i ) :
+				Math.floor( i * i * i / 50000 - i * i / 500 + 17 * i / 200 + 1 );
+		}
+
+		return 1;
+	},
+
+	_precision: function() {
+		var precision = this._precisionOf( this.options.step );
+		if ( this.options.min !== null ) {
+			precision = Math.max( precision, this._precisionOf( this.options.min ) );
+		}
+		return precision;
+	},
+
+	_precisionOf: function( num ) {
+		var str = num.toString(),
+			decimal = str.indexOf( "." );
+		return decimal === -1 ? 0 : str.length - decimal - 1;
+	},
+
+	_adjustValue: function( value ) {
+		var base, aboveMin,
+			options = this.options;
+
+		// Make sure we're at a valid step
+		// - find out where we are relative to the base (min or 0)
+		base = options.min !== null ? options.min : 0;
+		aboveMin = value - base;
+
+		// - round to the nearest step
+		aboveMin = Math.round( aboveMin / options.step ) * options.step;
+
+		// - rounding is based on 0, so adjust back to our base
+		value = base + aboveMin;
+
+		// Fix precision from bad JS floating point math
+		value = parseFloat( value.toFixed( this._precision() ) );
+
+		// Clamp the value
+		if ( options.max !== null && value > options.max ) {
+			return options.max;
+		}
+		if ( options.min !== null && value < options.min ) {
+			return options.min;
+		}
+
+		return value;
+	},
+
+	_stop: function( event ) {
+		if ( !this.spinning ) {
+			return;
+		}
+
+		clearTimeout( this.timer );
+		clearTimeout( this.mousewheelTimer );
+		this.counter = 0;
+		this.spinning = false;
+		this._trigger( "stop", event );
+	},
+
+	_setOption: function( key, value ) {
+		var prevValue, first, last;
+
+		if ( key === "culture" || key === "numberFormat" ) {
+			prevValue = this._parse( this.element.val() );
+			this.options[ key ] = value;
+			this.element.val( this._format( prevValue ) );
+			return;
+		}
+
+		if ( key === "max" || key === "min" || key === "step" ) {
+			if ( typeof value === "string" ) {
+				value = this._parse( value );
+			}
+		}
+		if ( key === "icons" ) {
+			first = this.buttons.first().find( ".ui-icon" );
+			this._removeClass( first, null, this.options.icons.up );
+			this._addClass( first, null, value.up );
+			last = this.buttons.last().find( ".ui-icon" );
+			this._removeClass( last, null, this.options.icons.down );
+			this._addClass( last, null, value.down );
+		}
+
+		this._super( key, value );
+	},
+
+	_setOptionDisabled: function( value ) {
+		this._super( value );
+
+		this._toggleClass( this.uiSpinner, null, "ui-state-disabled", !!value );
+		this.element.prop( "disabled", !!value );
+		this.buttons.button( value ? "disable" : "enable" );
+	},
+
+	_setOptions: spinnerModifer( function( options ) {
+		this._super( options );
+	} ),
+
+	_parse: function( val ) {
+		if ( typeof val === "string" && val !== "" ) {
+			val = window.Globalize && this.options.numberFormat ?
+				Globalize.parseFloat( val, 10, this.options.culture ) : +val;
+		}
+		return val === "" || isNaN( val ) ? null : val;
+	},
+
+	_format: function( value ) {
+		if ( value === "" ) {
+			return "";
+		}
+		return window.Globalize && this.options.numberFormat ?
+			Globalize.format( value, this.options.numberFormat, this.options.culture ) :
+			value;
+	},
+
+	_refresh: function() {
+		this.element.attr( {
+			"aria-valuemin": this.options.min,
+			"aria-valuemax": this.options.max,
+
+			// TODO: what should we do with values that can't be parsed?
+			"aria-valuenow": this._parse( this.element.val() )
+		} );
+	},
+
+	isValid: function() {
+		var value = this.value();
+
+		// Null is invalid
+		if ( value === null ) {
+			return false;
+		}
+
+		// If value gets adjusted, it's invalid
+		return value === this._adjustValue( value );
+	},
+
+	// Update the value without triggering change
+	_value: function( value, allowAny ) {
+		var parsed;
+		if ( value !== "" ) {
+			parsed = this._parse( value );
+			if ( parsed !== null ) {
+				if ( !allowAny ) {
+					parsed = this._adjustValue( parsed );
+				}
+				value = this._format( parsed );
+			}
+		}
+		this.element.val( value );
+		this._refresh();
+	},
+
+	_destroy: function() {
+		this.element
+			.prop( "disabled", false )
+			.removeAttr( "autocomplete role aria-valuemin aria-valuemax aria-valuenow" );
+
+		this.uiSpinner.replaceWith( this.element );
+	},
+
+	stepUp: spinnerModifer( function( steps ) {
+		this._stepUp( steps );
+	} ),
+	_stepUp: function( steps ) {
+		if ( this._start() ) {
+			this._spin( ( steps || 1 ) * this.options.step );
+			this._stop();
+		}
+	},
+
+	stepDown: spinnerModifer( function( steps ) {
+		this._stepDown( steps );
+	} ),
+	_stepDown: function( steps ) {
+		if ( this._start() ) {
+			this._spin( ( steps || 1 ) * -this.options.step );
+			this._stop();
+		}
+	},
+
+	pageUp: spinnerModifer( function( pages ) {
+		this._stepUp( ( pages || 1 ) * this.options.page );
+	} ),
+
+	pageDown: spinnerModifer( function( pages ) {
+		this._stepDown( ( pages || 1 ) * this.options.page );
+	} ),
+
+	value: function( newVal ) {
+		if ( !arguments.length ) {
+			return this._parse( this.element.val() );
+		}
+		spinnerModifer( this._value ).call( this, newVal );
+	},
+
+	widget: function() {
+		return this.uiSpinner;
+	}
+} );
+
+// DEPRECATED
+// TODO: switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for spinner html extension points
+	$.widget( "ui.spinner", $.ui.spinner, {
+		_enhance: function() {
+			this.uiSpinner = this.element
+				.attr( "autocomplete", "off" )
+				.wrap( this._uiSpinnerHtml() )
+				.parent()
+
+					// Add buttons
+					.append( this._buttonHtml() );
+		},
+		_uiSpinnerHtml: function() {
+			return "<span>";
+		},
+
+		_buttonHtml: function() {
+			return "<a></a><a></a>";
+		}
+	} );
+}
+
+return $.ui.spinner;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/spinner.min.js b/wp-includes/js/jquery/ui/spinner.min.js
index d39eca842d..fc45dc21c6 100644
--- a/wp-includes/js/jquery/ui/spinner.min.js
+++ b/wp-includes/js/jquery/ui/spinner.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Spinner 1.11.4
+ * jQuery UI Spinner 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/spinner/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./button"],t):t(jQuery)}(function(o){function i(i){return function(){var t=this.element.val();i.apply(this,arguments),this._refresh(),t!==this.element.val()&&this._trigger("change")}}return o.widget("ui.spinner",{version:"1.11.4",defaultElement:"<input>",widgetEventPrefix:"spin",options:{culture:null,icons:{down:"ui-icon-triangle-1-s",up:"ui-icon-triangle-1-n"},incremental:!0,max:null,min:null,numberFormat:null,page:10,step:1,change:null,spin:null,start:null,stop:null},_create:function(){this._setOption("max",this.options.max),this._setOption("min",this.options.min),this._setOption("step",this.options.step),""!==this.value()&&this._value(this.element.val(),!0),this._draw(),this._on(this._events),this._refresh(),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_getCreateOptions:function(){var n={},s=this.element;return o.each(["min","max","step"],function(t,i){var e=s.attr(i);void 0!==e&&e.length&&(n[i]=e)}),n},_events:{keydown:function(t){this._start(t)&&this._keydown(t)&&t.preventDefault()},keyup:"_stop",focus:function(){this.previous=this.element.val()},blur:function(t){this.cancelBlur?delete this.cancelBlur:(this._stop(),this._refresh(),this.previous!==this.element.val()&&this._trigger("change",t))},mousewheel:function(t,i){if(i){if(!this.spinning&&!this._start(t))return!1;this._spin((0<i?1:-1)*this.options.step,t),clearTimeout(this.mousewheelTimer),this.mousewheelTimer=this._delay(function(){this.spinning&&this._stop(t)},100),t.preventDefault()}},"mousedown .ui-spinner-button":function(t){var i;function e(){this.element[0]===this.document[0].activeElement||(this.element.focus(),this.previous=i,this._delay(function(){this.previous=i}))}i=this.element[0]===this.document[0].activeElement?this.previous:this.element.val(),t.preventDefault(),e.call(this),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur,e.call(this)}),!1!==this._start(t)&&this._repeat(null,o(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseup .ui-spinner-button":"_stop","mouseenter .ui-spinner-button":function(t){if(o(t.currentTarget).hasClass("ui-state-active"))return!1!==this._start(t)&&void this._repeat(null,o(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseleave .ui-spinner-button":"_stop"},_draw:function(){var t=this.uiSpinner=this.element.addClass("ui-spinner-input").attr("autocomplete","off").wrap(this._uiSpinnerHtml()).parent().append(this._buttonHtml());this.element.attr("role","spinbutton"),this.buttons=t.find(".ui-spinner-button").attr("tabIndex",-1).button().removeClass("ui-corner-all"),this.buttons.height()>Math.ceil(.5*t.height())&&0<t.height()&&t.height(t.height()),this.options.disabled&&this.disable()},_keydown:function(t){var i=this.options,e=o.ui.keyCode;switch(t.keyCode){case e.UP:return this._repeat(null,1,t),!0;case e.DOWN:return this._repeat(null,-1,t),!0;case e.PAGE_UP:return this._repeat(null,i.page,t),!0;case e.PAGE_DOWN:return this._repeat(null,-i.page,t),!0}return!1},_uiSpinnerHtml:function(){return"<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>"},_buttonHtml:function(){return"<a class='ui-spinner-button ui-spinner-up ui-corner-tr'><span class='ui-icon "+this.options.icons.up+"'>&#9650;</span></a><a class='ui-spinner-button ui-spinner-down ui-corner-br'><span class='ui-icon "+this.options.icons.down+"'>&#9660;</span></a>"},_start:function(t){return!(!this.spinning&&!1===this._trigger("start",t))&&(this.counter||(this.counter=1),this.spinning=!0)},_repeat:function(t,i,e){t=t||500,clearTimeout(this.timer),this.timer=this._delay(function(){this._repeat(40,i,e)},t),this._spin(i*this.options.step,e)},_spin:function(t,i){var e=this.value()||0;this.counter||(this.counter=1),e=this._adjustValue(e+t*this._increment(this.counter)),this.spinning&&!1===this._trigger("spin",i,{value:e})||(this._value(e),this.counter++)},_increment:function(t){var i=this.options.incremental;return i?o.isFunction(i)?i(t):Math.floor(t*t*t/5e4-t*t/500+17*t/200+1):1},_precision:function(){var t=this._precisionOf(this.options.step);return null!==this.options.min&&(t=Math.max(t,this._precisionOf(this.options.min))),t},_precisionOf:function(t){var i=t.toString(),e=i.indexOf(".");return-1===e?0:i.length-e-1},_adjustValue:function(t){var i,e,n=this.options;return e=t-(i=null!==n.min?n.min:0),t=i+(e=Math.round(e/n.step)*n.step),t=parseFloat(t.toFixed(this._precision())),null!==n.max&&t>n.max?n.max:null!==n.min&&t<n.min?n.min:t},_stop:function(t){this.spinning&&(clearTimeout(this.timer),clearTimeout(this.mousewheelTimer),this.counter=0,this.spinning=!1,this._trigger("stop",t))},_setOption:function(t,i){if("culture"===t||"numberFormat"===t){var e=this._parse(this.element.val());return this.options[t]=i,void this.element.val(this._format(e))}"max"!==t&&"min"!==t&&"step"!==t||"string"==typeof i&&(i=this._parse(i)),"icons"===t&&(this.buttons.first().find(".ui-icon").removeClass(this.options.icons.up).addClass(i.up),this.buttons.last().find(".ui-icon").removeClass(this.options.icons.down).addClass(i.down)),this._super(t,i),"disabled"===t&&(this.widget().toggleClass("ui-state-disabled",!!i),this.element.prop("disabled",!!i),this.buttons.button(i?"disable":"enable"))},_setOptions:i(function(t){this._super(t)}),_parse:function(t){return"string"==typeof t&&""!==t&&(t=window.Globalize&&this.options.numberFormat?Globalize.parseFloat(t,10,this.options.culture):+t),""===t||isNaN(t)?null:t},_format:function(t){return""===t?"":window.Globalize&&this.options.numberFormat?Globalize.format(t,this.options.numberFormat,this.options.culture):t},_refresh:function(){this.element.attr({"aria-valuemin":this.options.min,"aria-valuemax":this.options.max,"aria-valuenow":this._parse(this.element.val())})},isValid:function(){var t=this.value();return null!==t&&t===this._adjustValue(t)},_value:function(t,i){var e;""!==t&&null!==(e=this._parse(t))&&(i||(e=this._adjustValue(e)),t=this._format(e)),this.element.val(t),this._refresh()},_destroy:function(){this.element.removeClass("ui-spinner-input").prop("disabled",!1).removeAttr("autocomplete").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"),this.uiSpinner.replaceWith(this.element)},stepUp:i(function(t){this._stepUp(t)}),_stepUp:function(t){this._start()&&(this._spin((t||1)*this.options.step),this._stop())},stepDown:i(function(t){this._stepDown(t)}),_stepDown:function(t){this._start()&&(this._spin((t||1)*-this.options.step),this._stop())},pageUp:i(function(t){this._stepUp((t||1)*this.options.page)}),pageDown:i(function(t){this._stepDown((t||1)*this.options.page)}),value:function(t){if(!arguments.length)return this._parse(this.element.val());i(this._value).call(this,t)},widget:function(){return this.uiSpinner}})});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./button","./core"],t):t(jQuery)}(function(o){function i(i){return function(){var t=this.element.val();i.apply(this,arguments),this._refresh(),t!==this.element.val()&&this._trigger("change")}}return o.widget("ui.spinner",{version:"1.12.1",defaultElement:"<input>",widgetEventPrefix:"spin",options:{classes:{"ui-spinner":"ui-corner-all","ui-spinner-down":"ui-corner-br","ui-spinner-up":"ui-corner-tr"},culture:null,icons:{down:"ui-icon-triangle-1-s",up:"ui-icon-triangle-1-n"},incremental:!0,max:null,min:null,numberFormat:null,page:10,step:1,change:null,spin:null,start:null,stop:null},_create:function(){this._setOption("max",this.options.max),this._setOption("min",this.options.min),this._setOption("step",this.options.step),""!==this.value()&&this._value(this.element.val(),!0),this._draw(),this._on(this._events),this._refresh(),this._on(this.window,{beforeunload:function(){this.element.removeAttr("autocomplete")}})},_getCreateOptions:function(){var e=this._super(),s=this.element;return o.each(["min","max","step"],function(t,i){var n=s.attr(i);null!=n&&n.length&&(e[i]=n)}),e},_events:{keydown:function(t){this._start(t)&&this._keydown(t)&&t.preventDefault()},keyup:"_stop",focus:function(){this.previous=this.element.val()},blur:function(t){this.cancelBlur?delete this.cancelBlur:(this._stop(),this._refresh(),this.previous!==this.element.val()&&this._trigger("change",t))},mousewheel:function(t,i){if(i){if(!this.spinning&&!this._start(t))return!1;this._spin((0<i?1:-1)*this.options.step,t),clearTimeout(this.mousewheelTimer),this.mousewheelTimer=this._delay(function(){this.spinning&&this._stop(t)},100),t.preventDefault()}},"mousedown .ui-spinner-button":function(t){var i;function n(){this.element[0]===o.ui.safeActiveElement(this.document[0])||(this.element.trigger("focus"),this.previous=i,this._delay(function(){this.previous=i}))}i=this.element[0]===o.ui.safeActiveElement(this.document[0])?this.previous:this.element.val(),t.preventDefault(),n.call(this),this.cancelBlur=!0,this._delay(function(){delete this.cancelBlur,n.call(this)}),!1!==this._start(t)&&this._repeat(null,o(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseup .ui-spinner-button":"_stop","mouseenter .ui-spinner-button":function(t){if(o(t.currentTarget).hasClass("ui-state-active"))return!1!==this._start(t)&&void this._repeat(null,o(t.currentTarget).hasClass("ui-spinner-up")?1:-1,t)},"mouseleave .ui-spinner-button":"_stop"},_enhance:function(){this.uiSpinner=this.element.attr("autocomplete","off").wrap("<span>").parent().append("<a></a><a></a>")},_draw:function(){this._enhance(),this._addClass(this.uiSpinner,"ui-spinner","ui-widget ui-widget-content"),this._addClass("ui-spinner-input"),this.element.attr("role","spinbutton"),this.buttons=this.uiSpinner.children("a").attr("tabIndex",-1).attr("aria-hidden",!0).button({classes:{"ui-button":""}}),this._removeClass(this.buttons,"ui-corner-all"),this._addClass(this.buttons.first(),"ui-spinner-button ui-spinner-up"),this._addClass(this.buttons.last(),"ui-spinner-button ui-spinner-down"),this.buttons.first().button({icon:this.options.icons.up,showLabel:!1}),this.buttons.last().button({icon:this.options.icons.down,showLabel:!1}),this.buttons.height()>Math.ceil(.5*this.uiSpinner.height())&&0<this.uiSpinner.height()&&this.uiSpinner.height(this.uiSpinner.height())},_keydown:function(t){var i=this.options,n=o.ui.keyCode;switch(t.keyCode){case n.UP:return this._repeat(null,1,t),!0;case n.DOWN:return this._repeat(null,-1,t),!0;case n.PAGE_UP:return this._repeat(null,i.page,t),!0;case n.PAGE_DOWN:return this._repeat(null,-i.page,t),!0}return!1},_start:function(t){return!(!this.spinning&&!1===this._trigger("start",t))&&(this.counter||(this.counter=1),this.spinning=!0)},_repeat:function(t,i,n){t=t||500,clearTimeout(this.timer),this.timer=this._delay(function(){this._repeat(40,i,n)},t),this._spin(i*this.options.step,n)},_spin:function(t,i){var n=this.value()||0;this.counter||(this.counter=1),n=this._adjustValue(n+t*this._increment(this.counter)),this.spinning&&!1===this._trigger("spin",i,{value:n})||(this._value(n),this.counter++)},_increment:function(t){var i=this.options.incremental;return i?o.isFunction(i)?i(t):Math.floor(t*t*t/5e4-t*t/500+17*t/200+1):1},_precision:function(){var t=this._precisionOf(this.options.step);return null!==this.options.min&&(t=Math.max(t,this._precisionOf(this.options.min))),t},_precisionOf:function(t){var i=t.toString(),n=i.indexOf(".");return-1===n?0:i.length-n-1},_adjustValue:function(t){var i,n,e=this.options;return n=t-(i=null!==e.min?e.min:0),t=i+(n=Math.round(n/e.step)*e.step),t=parseFloat(t.toFixed(this._precision())),null!==e.max&&t>e.max?e.max:null!==e.min&&t<e.min?e.min:t},_stop:function(t){this.spinning&&(clearTimeout(this.timer),clearTimeout(this.mousewheelTimer),this.counter=0,this.spinning=!1,this._trigger("stop",t))},_setOption:function(t,i){var n,e,s;if("culture"===t||"numberFormat"===t)return n=this._parse(this.element.val()),this.options[t]=i,void this.element.val(this._format(n));"max"!==t&&"min"!==t&&"step"!==t||"string"==typeof i&&(i=this._parse(i)),"icons"===t&&(e=this.buttons.first().find(".ui-icon"),this._removeClass(e,null,this.options.icons.up),this._addClass(e,null,i.up),s=this.buttons.last().find(".ui-icon"),this._removeClass(s,null,this.options.icons.down),this._addClass(s,null,i.down)),this._super(t,i)},_setOptionDisabled:function(t){this._super(t),this._toggleClass(this.uiSpinner,null,"ui-state-disabled",!!t),this.element.prop("disabled",!!t),this.buttons.button(t?"disable":"enable")},_setOptions:i(function(t){this._super(t)}),_parse:function(t){return"string"==typeof t&&""!==t&&(t=window.Globalize&&this.options.numberFormat?Globalize.parseFloat(t,10,this.options.culture):+t),""===t||isNaN(t)?null:t},_format:function(t){return""===t?"":window.Globalize&&this.options.numberFormat?Globalize.format(t,this.options.numberFormat,this.options.culture):t},_refresh:function(){this.element.attr({"aria-valuemin":this.options.min,"aria-valuemax":this.options.max,"aria-valuenow":this._parse(this.element.val())})},isValid:function(){var t=this.value();return null!==t&&t===this._adjustValue(t)},_value:function(t,i){var n;""!==t&&null!==(n=this._parse(t))&&(i||(n=this._adjustValue(n)),t=this._format(n)),this.element.val(t),this._refresh()},_destroy:function(){this.element.prop("disabled",!1).removeAttr("autocomplete role aria-valuemin aria-valuemax aria-valuenow"),this.uiSpinner.replaceWith(this.element)},stepUp:i(function(t){this._stepUp(t)}),_stepUp:function(t){this._start()&&(this._spin((t||1)*this.options.step),this._stop())},stepDown:i(function(t){this._stepDown(t)}),_stepDown:function(t){this._start()&&(this._spin((t||1)*-this.options.step),this._stop())},pageUp:i(function(t){this._stepUp((t||1)*this.options.page)}),pageDown:i(function(t){this._stepDown((t||1)*this.options.page)}),value:function(t){if(!arguments.length)return this._parse(this.element.val());i(this._value).call(this,t)},widget:function(){return this.uiSpinner}}),!1!==o.uiBackCompat&&o.widget("ui.spinner",o.ui.spinner,{_enhance:function(){this.uiSpinner=this.element.attr("autocomplete","off").wrap(this._uiSpinnerHtml()).parent().append(this._buttonHtml())},_uiSpinnerHtml:function(){return"<span>"},_buttonHtml:function(){return"<a></a><a></a>"}}),o.ui.spinner});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/tabs.js b/wp-includes/js/jquery/ui/tabs.js
new file mode 100644
index 0000000000..a896a51823
--- /dev/null
+++ b/wp-includes/js/jquery/ui/tabs.js
@@ -0,0 +1,919 @@
+/*!
+ * jQuery UI Tabs 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Tabs
+//>>group: Widgets
+//>>description: Transforms a set of container elements into a tab structure.
+//>>docs: http://api.jqueryui.com/tabs/
+//>>demos: http://jqueryui.com/tabs/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/tabs.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.tabs", {
+	version: "1.12.1",
+	delay: 300,
+	options: {
+		active: null,
+		classes: {
+			"ui-tabs": "ui-corner-all",
+			"ui-tabs-nav": "ui-corner-all",
+			"ui-tabs-panel": "ui-corner-bottom",
+			"ui-tabs-tab": "ui-corner-top"
+		},
+		collapsible: false,
+		event: "click",
+		heightStyle: "content",
+		hide: null,
+		show: null,
+
+		// Callbacks
+		activate: null,
+		beforeActivate: null,
+		beforeLoad: null,
+		load: null
+	},
+
+	_isLocal: ( function() {
+		var rhash = /#.*$/;
+
+		return function( anchor ) {
+			var anchorUrl, locationUrl;
+
+			anchorUrl = anchor.href.replace( rhash, "" );
+			locationUrl = location.href.replace( rhash, "" );
+
+			// Decoding may throw an error if the URL isn't UTF-8 (#9518)
+			try {
+				anchorUrl = decodeURIComponent( anchorUrl );
+			} catch ( error ) {}
+			try {
+				locationUrl = decodeURIComponent( locationUrl );
+			} catch ( error ) {}
+
+			return anchor.hash.length > 1 && anchorUrl === locationUrl;
+		};
+	} )(),
+
+	_create: function() {
+		var that = this,
+			options = this.options;
+
+		this.running = false;
+
+		this._addClass( "ui-tabs", "ui-widget ui-widget-content" );
+		this._toggleClass( "ui-tabs-collapsible", null, options.collapsible );
+
+		this._processTabs();
+		options.active = this._initialActive();
+
+		// Take disabling tabs via class attribute from HTML
+		// into account and update option properly.
+		if ( $.isArray( options.disabled ) ) {
+			options.disabled = $.unique( options.disabled.concat(
+				$.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) {
+					return that.tabs.index( li );
+				} )
+			) ).sort();
+		}
+
+		// Check for length avoids error when initializing empty list
+		if ( this.options.active !== false && this.anchors.length ) {
+			this.active = this._findActive( options.active );
+		} else {
+			this.active = $();
+		}
+
+		this._refresh();
+
+		if ( this.active.length ) {
+			this.load( options.active );
+		}
+	},
+
+	_initialActive: function() {
+		var active = this.options.active,
+			collapsible = this.options.collapsible,
+			locationHash = location.hash.substring( 1 );
+
+		if ( active === null ) {
+
+			// check the fragment identifier in the URL
+			if ( locationHash ) {
+				this.tabs.each( function( i, tab ) {
+					if ( $( tab ).attr( "aria-controls" ) === locationHash ) {
+						active = i;
+						return false;
+					}
+				} );
+			}
+
+			// Check for a tab marked active via a class
+			if ( active === null ) {
+				active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) );
+			}
+
+			// No active tab, set to false
+			if ( active === null || active === -1 ) {
+				active = this.tabs.length ? 0 : false;
+			}
+		}
+
+		// Handle numbers: negative, out of range
+		if ( active !== false ) {
+			active = this.tabs.index( this.tabs.eq( active ) );
+			if ( active === -1 ) {
+				active = collapsible ? false : 0;
+			}
+		}
+
+		// Don't allow collapsible: false and active: false
+		if ( !collapsible && active === false && this.anchors.length ) {
+			active = 0;
+		}
+
+		return active;
+	},
+
+	_getCreateEventData: function() {
+		return {
+			tab: this.active,
+			panel: !this.active.length ? $() : this._getPanelForTab( this.active )
+		};
+	},
+
+	_tabKeydown: function( event ) {
+		var focusedTab = $( $.ui.safeActiveElement( this.document[ 0 ] ) ).closest( "li" ),
+			selectedIndex = this.tabs.index( focusedTab ),
+			goingForward = true;
+
+		if ( this._handlePageNav( event ) ) {
+			return;
+		}
+
+		switch ( event.keyCode ) {
+		case $.ui.keyCode.RIGHT:
+		case $.ui.keyCode.DOWN:
+			selectedIndex++;
+			break;
+		case $.ui.keyCode.UP:
+		case $.ui.keyCode.LEFT:
+			goingForward = false;
+			selectedIndex--;
+			break;
+		case $.ui.keyCode.END:
+			selectedIndex = this.anchors.length - 1;
+			break;
+		case $.ui.keyCode.HOME:
+			selectedIndex = 0;
+			break;
+		case $.ui.keyCode.SPACE:
+
+			// Activate only, no collapsing
+			event.preventDefault();
+			clearTimeout( this.activating );
+			this._activate( selectedIndex );
+			return;
+		case $.ui.keyCode.ENTER:
+
+			// Toggle (cancel delayed activation, allow collapsing)
+			event.preventDefault();
+			clearTimeout( this.activating );
+
+			// Determine if we should collapse or activate
+			this._activate( selectedIndex === this.options.active ? false : selectedIndex );
+			return;
+		default:
+			return;
+		}
+
+		// Focus the appropriate tab, based on which key was pressed
+		event.preventDefault();
+		clearTimeout( this.activating );
+		selectedIndex = this._focusNextTab( selectedIndex, goingForward );
+
+		// Navigating with control/command key will prevent automatic activation
+		if ( !event.ctrlKey && !event.metaKey ) {
+
+			// Update aria-selected immediately so that AT think the tab is already selected.
+			// Otherwise AT may confuse the user by stating that they need to activate the tab,
+			// but the tab will already be activated by the time the announcement finishes.
+			focusedTab.attr( "aria-selected", "false" );
+			this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" );
+
+			this.activating = this._delay( function() {
+				this.option( "active", selectedIndex );
+			}, this.delay );
+		}
+	},
+
+	_panelKeydown: function( event ) {
+		if ( this._handlePageNav( event ) ) {
+			return;
+		}
+
+		// Ctrl+up moves focus to the current tab
+		if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) {
+			event.preventDefault();
+			this.active.trigger( "focus" );
+		}
+	},
+
+	// Alt+page up/down moves focus to the previous/next tab (and activates)
+	_handlePageNav: function( event ) {
+		if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) {
+			this._activate( this._focusNextTab( this.options.active - 1, false ) );
+			return true;
+		}
+		if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) {
+			this._activate( this._focusNextTab( this.options.active + 1, true ) );
+			return true;
+		}
+	},
+
+	_findNextTab: function( index, goingForward ) {
+		var lastTabIndex = this.tabs.length - 1;
+
+		function constrain() {
+			if ( index > lastTabIndex ) {
+				index = 0;
+			}
+			if ( index < 0 ) {
+				index = lastTabIndex;
+			}
+			return index;
+		}
+
+		while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) {
+			index = goingForward ? index + 1 : index - 1;
+		}
+
+		return index;
+	},
+
+	_focusNextTab: function( index, goingForward ) {
+		index = this._findNextTab( index, goingForward );
+		this.tabs.eq( index ).trigger( "focus" );
+		return index;
+	},
+
+	_setOption: function( key, value ) {
+		if ( key === "active" ) {
+
+			// _activate() will handle invalid values and update this.options
+			this._activate( value );
+			return;
+		}
+
+		this._super( key, value );
+
+		if ( key === "collapsible" ) {
+			this._toggleClass( "ui-tabs-collapsible", null, value );
+
+			// Setting collapsible: false while collapsed; open first panel
+			if ( !value && this.options.active === false ) {
+				this._activate( 0 );
+			}
+		}
+
+		if ( key === "event" ) {
+			this._setupEvents( value );
+		}
+
+		if ( key === "heightStyle" ) {
+			this._setupHeightStyle( value );
+		}
+	},
+
+	_sanitizeSelector: function( hash ) {
+		return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : "";
+	},
+
+	refresh: function() {
+		var options = this.options,
+			lis = this.tablist.children( ":has(a[href])" );
+
+		// Get disabled tabs from class attribute from HTML
+		// this will get converted to a boolean if needed in _refresh()
+		options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) {
+			return lis.index( tab );
+		} );
+
+		this._processTabs();
+
+		// Was collapsed or no tabs
+		if ( options.active === false || !this.anchors.length ) {
+			options.active = false;
+			this.active = $();
+
+		// was active, but active tab is gone
+		} else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) {
+
+			// all remaining tabs are disabled
+			if ( this.tabs.length === options.disabled.length ) {
+				options.active = false;
+				this.active = $();
+
+			// activate previous tab
+			} else {
+				this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) );
+			}
+
+		// was active, active tab still exists
+		} else {
+
+			// make sure active index is correct
+			options.active = this.tabs.index( this.active );
+		}
+
+		this._refresh();
+	},
+
+	_refresh: function() {
+		this._setOptionDisabled( this.options.disabled );
+		this._setupEvents( this.options.event );
+		this._setupHeightStyle( this.options.heightStyle );
+
+		this.tabs.not( this.active ).attr( {
+			"aria-selected": "false",
+			"aria-expanded": "false",
+			tabIndex: -1
+		} );
+		this.panels.not( this._getPanelForTab( this.active ) )
+			.hide()
+			.attr( {
+				"aria-hidden": "true"
+			} );
+
+		// Make sure one tab is in the tab order
+		if ( !this.active.length ) {
+			this.tabs.eq( 0 ).attr( "tabIndex", 0 );
+		} else {
+			this.active
+				.attr( {
+					"aria-selected": "true",
+					"aria-expanded": "true",
+					tabIndex: 0
+				} );
+			this._addClass( this.active, "ui-tabs-active", "ui-state-active" );
+			this._getPanelForTab( this.active )
+				.show()
+				.attr( {
+					"aria-hidden": "false"
+				} );
+		}
+	},
+
+	_processTabs: function() {
+		var that = this,
+			prevTabs = this.tabs,
+			prevAnchors = this.anchors,
+			prevPanels = this.panels;
+
+		this.tablist = this._getList().attr( "role", "tablist" );
+		this._addClass( this.tablist, "ui-tabs-nav",
+			"ui-helper-reset ui-helper-clearfix ui-widget-header" );
+
+		// Prevent users from focusing disabled tabs via click
+		this.tablist
+			.on( "mousedown" + this.eventNamespace, "> li", function( event ) {
+				if ( $( this ).is( ".ui-state-disabled" ) ) {
+					event.preventDefault();
+				}
+			} )
+
+			// Support: IE <9
+			// Preventing the default action in mousedown doesn't prevent IE
+			// from focusing the element, so if the anchor gets focused, blur.
+			// We don't have to worry about focusing the previously focused
+			// element since clicking on a non-focusable element should focus
+			// the body anyway.
+			.on( "focus" + this.eventNamespace, ".ui-tabs-anchor", function() {
+				if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) {
+					this.blur();
+				}
+			} );
+
+		this.tabs = this.tablist.find( "> li:has(a[href])" )
+			.attr( {
+				role: "tab",
+				tabIndex: -1
+			} );
+		this._addClass( this.tabs, "ui-tabs-tab", "ui-state-default" );
+
+		this.anchors = this.tabs.map( function() {
+			return $( "a", this )[ 0 ];
+		} )
+			.attr( {
+				role: "presentation",
+				tabIndex: -1
+			} );
+		this._addClass( this.anchors, "ui-tabs-anchor" );
+
+		this.panels = $();
+
+		this.anchors.each( function( i, anchor ) {
+			var selector, panel, panelId,
+				anchorId = $( anchor ).uniqueId().attr( "id" ),
+				tab = $( anchor ).closest( "li" ),
+				originalAriaControls = tab.attr( "aria-controls" );
+
+			// Inline tab
+			if ( that._isLocal( anchor ) ) {
+				selector = anchor.hash;
+				panelId = selector.substring( 1 );
+				panel = that.element.find( that._sanitizeSelector( selector ) );
+
+			// remote tab
+			} else {
+
+				// If the tab doesn't already have aria-controls,
+				// generate an id by using a throw-away element
+				panelId = tab.attr( "aria-controls" ) || $( {} ).uniqueId()[ 0 ].id;
+				selector = "#" + panelId;
+				panel = that.element.find( selector );
+				if ( !panel.length ) {
+					panel = that._createPanel( panelId );
+					panel.insertAfter( that.panels[ i - 1 ] || that.tablist );
+				}
+				panel.attr( "aria-live", "polite" );
+			}
+
+			if ( panel.length ) {
+				that.panels = that.panels.add( panel );
+			}
+			if ( originalAriaControls ) {
+				tab.data( "ui-tabs-aria-controls", originalAriaControls );
+			}
+			tab.attr( {
+				"aria-controls": panelId,
+				"aria-labelledby": anchorId
+			} );
+			panel.attr( "aria-labelledby", anchorId );
+		} );
+
+		this.panels.attr( "role", "tabpanel" );
+		this._addClass( this.panels, "ui-tabs-panel", "ui-widget-content" );
+
+		// Avoid memory leaks (#10056)
+		if ( prevTabs ) {
+			this._off( prevTabs.not( this.tabs ) );
+			this._off( prevAnchors.not( this.anchors ) );
+			this._off( prevPanels.not( this.panels ) );
+		}
+	},
+
+	// Allow overriding how to find the list for rare usage scenarios (#7715)
+	_getList: function() {
+		return this.tablist || this.element.find( "ol, ul" ).eq( 0 );
+	},
+
+	_createPanel: function( id ) {
+		return $( "<div>" )
+			.attr( "id", id )
+			.data( "ui-tabs-destroy", true );
+	},
+
+	_setOptionDisabled: function( disabled ) {
+		var currentItem, li, i;
+
+		if ( $.isArray( disabled ) ) {
+			if ( !disabled.length ) {
+				disabled = false;
+			} else if ( disabled.length === this.anchors.length ) {
+				disabled = true;
+			}
+		}
+
+		// Disable tabs
+		for ( i = 0; ( li = this.tabs[ i ] ); i++ ) {
+			currentItem = $( li );
+			if ( disabled === true || $.inArray( i, disabled ) !== -1 ) {
+				currentItem.attr( "aria-disabled", "true" );
+				this._addClass( currentItem, null, "ui-state-disabled" );
+			} else {
+				currentItem.removeAttr( "aria-disabled" );
+				this._removeClass( currentItem, null, "ui-state-disabled" );
+			}
+		}
+
+		this.options.disabled = disabled;
+
+		this._toggleClass( this.widget(), this.widgetFullName + "-disabled", null,
+			disabled === true );
+	},
+
+	_setupEvents: function( event ) {
+		var events = {};
+		if ( event ) {
+			$.each( event.split( " " ), function( index, eventName ) {
+				events[ eventName ] = "_eventHandler";
+			} );
+		}
+
+		this._off( this.anchors.add( this.tabs ).add( this.panels ) );
+
+		// Always prevent the default action, even when disabled
+		this._on( true, this.anchors, {
+			click: function( event ) {
+				event.preventDefault();
+			}
+		} );
+		this._on( this.anchors, events );
+		this._on( this.tabs, { keydown: "_tabKeydown" } );
+		this._on( this.panels, { keydown: "_panelKeydown" } );
+
+		this._focusable( this.tabs );
+		this._hoverable( this.tabs );
+	},
+
+	_setupHeightStyle: function( heightStyle ) {
+		var maxHeight,
+			parent = this.element.parent();
+
+		if ( heightStyle === "fill" ) {
+			maxHeight = parent.height();
+			maxHeight -= this.element.outerHeight() - this.element.height();
+
+			this.element.siblings( ":visible" ).each( function() {
+				var elem = $( this ),
+					position = elem.css( "position" );
+
+				if ( position === "absolute" || position === "fixed" ) {
+					return;
+				}
+				maxHeight -= elem.outerHeight( true );
+			} );
+
+			this.element.children().not( this.panels ).each( function() {
+				maxHeight -= $( this ).outerHeight( true );
+			} );
+
+			this.panels.each( function() {
+				$( this ).height( Math.max( 0, maxHeight -
+					$( this ).innerHeight() + $( this ).height() ) );
+			} )
+				.css( "overflow", "auto" );
+		} else if ( heightStyle === "auto" ) {
+			maxHeight = 0;
+			this.panels.each( function() {
+				maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() );
+			} ).height( maxHeight );
+		}
+	},
+
+	_eventHandler: function( event ) {
+		var options = this.options,
+			active = this.active,
+			anchor = $( event.currentTarget ),
+			tab = anchor.closest( "li" ),
+			clickedIsActive = tab[ 0 ] === active[ 0 ],
+			collapsing = clickedIsActive && options.collapsible,
+			toShow = collapsing ? $() : this._getPanelForTab( tab ),
+			toHide = !active.length ? $() : this._getPanelForTab( active ),
+			eventData = {
+				oldTab: active,
+				oldPanel: toHide,
+				newTab: collapsing ? $() : tab,
+				newPanel: toShow
+			};
+
+		event.preventDefault();
+
+		if ( tab.hasClass( "ui-state-disabled" ) ||
+
+				// tab is already loading
+				tab.hasClass( "ui-tabs-loading" ) ||
+
+				// can't switch durning an animation
+				this.running ||
+
+				// click on active header, but not collapsible
+				( clickedIsActive && !options.collapsible ) ||
+
+				// allow canceling activation
+				( this._trigger( "beforeActivate", event, eventData ) === false ) ) {
+			return;
+		}
+
+		options.active = collapsing ? false : this.tabs.index( tab );
+
+		this.active = clickedIsActive ? $() : tab;
+		if ( this.xhr ) {
+			this.xhr.abort();
+		}
+
+		if ( !toHide.length && !toShow.length ) {
+			$.error( "jQuery UI Tabs: Mismatching fragment identifier." );
+		}
+
+		if ( toShow.length ) {
+			this.load( this.tabs.index( tab ), event );
+		}
+		this._toggle( event, eventData );
+	},
+
+	// Handles show/hide for selecting tabs
+	_toggle: function( event, eventData ) {
+		var that = this,
+			toShow = eventData.newPanel,
+			toHide = eventData.oldPanel;
+
+		this.running = true;
+
+		function complete() {
+			that.running = false;
+			that._trigger( "activate", event, eventData );
+		}
+
+		function show() {
+			that._addClass( eventData.newTab.closest( "li" ), "ui-tabs-active", "ui-state-active" );
+
+			if ( toShow.length && that.options.show ) {
+				that._show( toShow, that.options.show, complete );
+			} else {
+				toShow.show();
+				complete();
+			}
+		}
+
+		// Start out by hiding, then showing, then completing
+		if ( toHide.length && this.options.hide ) {
+			this._hide( toHide, this.options.hide, function() {
+				that._removeClass( eventData.oldTab.closest( "li" ),
+					"ui-tabs-active", "ui-state-active" );
+				show();
+			} );
+		} else {
+			this._removeClass( eventData.oldTab.closest( "li" ),
+				"ui-tabs-active", "ui-state-active" );
+			toHide.hide();
+			show();
+		}
+
+		toHide.attr( "aria-hidden", "true" );
+		eventData.oldTab.attr( {
+			"aria-selected": "false",
+			"aria-expanded": "false"
+		} );
+
+		// If we're switching tabs, remove the old tab from the tab order.
+		// If we're opening from collapsed state, remove the previous tab from the tab order.
+		// If we're collapsing, then keep the collapsing tab in the tab order.
+		if ( toShow.length && toHide.length ) {
+			eventData.oldTab.attr( "tabIndex", -1 );
+		} else if ( toShow.length ) {
+			this.tabs.filter( function() {
+				return $( this ).attr( "tabIndex" ) === 0;
+			} )
+				.attr( "tabIndex", -1 );
+		}
+
+		toShow.attr( "aria-hidden", "false" );
+		eventData.newTab.attr( {
+			"aria-selected": "true",
+			"aria-expanded": "true",
+			tabIndex: 0
+		} );
+	},
+
+	_activate: function( index ) {
+		var anchor,
+			active = this._findActive( index );
+
+		// Trying to activate the already active panel
+		if ( active[ 0 ] === this.active[ 0 ] ) {
+			return;
+		}
+
+		// Trying to collapse, simulate a click on the current active header
+		if ( !active.length ) {
+			active = this.active;
+		}
+
+		anchor = active.find( ".ui-tabs-anchor" )[ 0 ];
+		this._eventHandler( {
+			target: anchor,
+			currentTarget: anchor,
+			preventDefault: $.noop
+		} );
+	},
+
+	_findActive: function( index ) {
+		return index === false ? $() : this.tabs.eq( index );
+	},
+
+	_getIndex: function( index ) {
+
+		// meta-function to give users option to provide a href string instead of a numerical index.
+		if ( typeof index === "string" ) {
+			index = this.anchors.index( this.anchors.filter( "[href$='" +
+				$.ui.escapeSelector( index ) + "']" ) );
+		}
+
+		return index;
+	},
+
+	_destroy: function() {
+		if ( this.xhr ) {
+			this.xhr.abort();
+		}
+
+		this.tablist
+			.removeAttr( "role" )
+			.off( this.eventNamespace );
+
+		this.anchors
+			.removeAttr( "role tabIndex" )
+			.removeUniqueId();
+
+		this.tabs.add( this.panels ).each( function() {
+			if ( $.data( this, "ui-tabs-destroy" ) ) {
+				$( this ).remove();
+			} else {
+				$( this ).removeAttr( "role tabIndex " +
+					"aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded" );
+			}
+		} );
+
+		this.tabs.each( function() {
+			var li = $( this ),
+				prev = li.data( "ui-tabs-aria-controls" );
+			if ( prev ) {
+				li
+					.attr( "aria-controls", prev )
+					.removeData( "ui-tabs-aria-controls" );
+			} else {
+				li.removeAttr( "aria-controls" );
+			}
+		} );
+
+		this.panels.show();
+
+		if ( this.options.heightStyle !== "content" ) {
+			this.panels.css( "height", "" );
+		}
+	},
+
+	enable: function( index ) {
+		var disabled = this.options.disabled;
+		if ( disabled === false ) {
+			return;
+		}
+
+		if ( index === undefined ) {
+			disabled = false;
+		} else {
+			index = this._getIndex( index );
+			if ( $.isArray( disabled ) ) {
+				disabled = $.map( disabled, function( num ) {
+					return num !== index ? num : null;
+				} );
+			} else {
+				disabled = $.map( this.tabs, function( li, num ) {
+					return num !== index ? num : null;
+				} );
+			}
+		}
+		this._setOptionDisabled( disabled );
+	},
+
+	disable: function( index ) {
+		var disabled = this.options.disabled;
+		if ( disabled === true ) {
+			return;
+		}
+
+		if ( index === undefined ) {
+			disabled = true;
+		} else {
+			index = this._getIndex( index );
+			if ( $.inArray( index, disabled ) !== -1 ) {
+				return;
+			}
+			if ( $.isArray( disabled ) ) {
+				disabled = $.merge( [ index ], disabled ).sort();
+			} else {
+				disabled = [ index ];
+			}
+		}
+		this._setOptionDisabled( disabled );
+	},
+
+	load: function( index, event ) {
+		index = this._getIndex( index );
+		var that = this,
+			tab = this.tabs.eq( index ),
+			anchor = tab.find( ".ui-tabs-anchor" ),
+			panel = this._getPanelForTab( tab ),
+			eventData = {
+				tab: tab,
+				panel: panel
+			},
+			complete = function( jqXHR, status ) {
+				if ( status === "abort" ) {
+					that.panels.stop( false, true );
+				}
+
+				that._removeClass( tab, "ui-tabs-loading" );
+				panel.removeAttr( "aria-busy" );
+
+				if ( jqXHR === that.xhr ) {
+					delete that.xhr;
+				}
+			};
+
+		// Not remote
+		if ( this._isLocal( anchor[ 0 ] ) ) {
+			return;
+		}
+
+		this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) );
+
+		// Support: jQuery <1.8
+		// jQuery <1.8 returns false if the request is canceled in beforeSend,
+		// but as of 1.8, $.ajax() always returns a jqXHR object.
+		if ( this.xhr && this.xhr.statusText !== "canceled" ) {
+			this._addClass( tab, "ui-tabs-loading" );
+			panel.attr( "aria-busy", "true" );
+
+			this.xhr
+				.done( function( response, status, jqXHR ) {
+
+					// support: jQuery <1.8
+					// http://bugs.jquery.com/ticket/11778
+					setTimeout( function() {
+						panel.html( response );
+						that._trigger( "load", event, eventData );
+
+						complete( jqXHR, status );
+					}, 1 );
+				} )
+				.fail( function( jqXHR, status ) {
+
+					// support: jQuery <1.8
+					// http://bugs.jquery.com/ticket/11778
+					setTimeout( function() {
+						complete( jqXHR, status );
+					}, 1 );
+				} );
+		}
+	},
+
+	_ajaxSettings: function( anchor, event, eventData ) {
+		var that = this;
+		return {
+
+			// Support: IE <11 only
+			// Strip any hash that exists to prevent errors with the Ajax request
+			url: anchor.attr( "href" ).replace( /#.*$/, "" ),
+			beforeSend: function( jqXHR, settings ) {
+				return that._trigger( "beforeLoad", event,
+					$.extend( { jqXHR: jqXHR, ajaxSettings: settings }, eventData ) );
+			}
+		};
+	},
+
+	_getPanelForTab: function( tab ) {
+		var id = $( tab ).attr( "aria-controls" );
+		return this.element.find( this._sanitizeSelector( "#" + id ) );
+	}
+} );
+
+// DEPRECATED
+// TODO: Switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for ui-tab class (now ui-tabs-tab)
+	$.widget( "ui.tabs", $.ui.tabs, {
+		_processTabs: function() {
+			this._superApply( arguments );
+			this._addClass( this.tabs, "ui-tab" );
+		}
+	} );
+}
+
+return $.ui.tabs;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/tabs.min.js b/wp-includes/js/jquery/ui/tabs.min.js
index 95e6f1739b..1f1b2492f5 100644
--- a/wp-includes/js/jquery/ui/tabs.min.js
+++ b/wp-includes/js/jquery/ui/tabs.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Tabs 1.11.4
+ * jQuery UI Tabs 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/tabs/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./widget"],t):t(jQuery)}(function(l){return l.widget("ui.tabs",{version:"1.11.4",delay:300,options:{active:null,collapsible:!1,event:"click",heightStyle:"content",hide:null,show:null,activate:null,beforeActivate:null,beforeLoad:null,load:null},_isLocal:(a=/#.*$/,function(t){var e,i;e=(t=t.cloneNode(!1)).href.replace(a,""),i=location.href.replace(a,"");try{e=decodeURIComponent(e)}catch(t){}try{i=decodeURIComponent(i)}catch(t){}return 1<t.hash.length&&e===i}),_create:function(){var e=this,t=this.options;this.running=!1,this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all").toggleClass("ui-tabs-collapsible",t.collapsible),this._processTabs(),t.active=this._initialActive(),l.isArray(t.disabled)&&(t.disabled=l.unique(t.disabled.concat(l.map(this.tabs.filter(".ui-state-disabled"),function(t){return e.tabs.index(t)}))).sort()),!1!==this.options.active&&this.anchors.length?this.active=this._findActive(t.active):this.active=l(),this._refresh(),this.active.length&&this.load(t.active)},_initialActive:function(){var i=this.options.active,t=this.options.collapsible,a=location.hash.substring(1);return null===i&&(a&&this.tabs.each(function(t,e){if(l(e).attr("aria-controls")===a)return i=t,!1}),null===i&&(i=this.tabs.index(this.tabs.filter(".ui-tabs-active"))),null!==i&&-1!==i||(i=!!this.tabs.length&&0)),!1!==i&&-1===(i=this.tabs.index(this.tabs.eq(i)))&&(i=!t&&0),!t&&!1===i&&this.anchors.length&&(i=0),i},_getCreateEventData:function(){return{tab:this.active,panel:this.active.length?this._getPanelForTab(this.active):l()}},_tabKeydown:function(t){var e=l(this.document[0].activeElement).closest("li"),i=this.tabs.index(e),a=!0;if(!this._handlePageNav(t)){switch(t.keyCode){case l.ui.keyCode.RIGHT:case l.ui.keyCode.DOWN:i++;break;case l.ui.keyCode.UP:case l.ui.keyCode.LEFT:a=!1,i--;break;case l.ui.keyCode.END:i=this.anchors.length-1;break;case l.ui.keyCode.HOME:i=0;break;case l.ui.keyCode.SPACE:return t.preventDefault(),clearTimeout(this.activating),void this._activate(i);case l.ui.keyCode.ENTER:return t.preventDefault(),clearTimeout(this.activating),void this._activate(i!==this.options.active&&i);default:return}t.preventDefault(),clearTimeout(this.activating),i=this._focusNextTab(i,a),t.ctrlKey||t.metaKey||(e.attr("aria-selected","false"),this.tabs.eq(i).attr("aria-selected","true"),this.activating=this._delay(function(){this.option("active",i)},this.delay))}},_panelKeydown:function(t){this._handlePageNav(t)||t.ctrlKey&&t.keyCode===l.ui.keyCode.UP&&(t.preventDefault(),this.active.focus())},_handlePageNav:function(t){return t.altKey&&t.keyCode===l.ui.keyCode.PAGE_UP?(this._activate(this._focusNextTab(this.options.active-1,!1)),!0):t.altKey&&t.keyCode===l.ui.keyCode.PAGE_DOWN?(this._activate(this._focusNextTab(this.options.active+1,!0)),!0):void 0},_findNextTab:function(t,e){var i=this.tabs.length-1;for(;-1!==l.inArray((i<t&&(t=0),t<0&&(t=i),t),this.options.disabled);)t=e?t+1:t-1;return t},_focusNextTab:function(t,e){return t=this._findNextTab(t,e),this.tabs.eq(t).focus(),t},_setOption:function(t,e){"active"!==t?"disabled"!==t?(this._super(t,e),"collapsible"===t&&(this.element.toggleClass("ui-tabs-collapsible",e),e||!1!==this.options.active||this._activate(0)),"event"===t&&this._setupEvents(e),"heightStyle"===t&&this._setupHeightStyle(e)):this._setupDisabled(e):this._activate(e)},_sanitizeSelector:function(t){return t?t.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g,"\\$&"):""},refresh:function(){var t=this.options,e=this.tablist.children(":has(a[href])");t.disabled=l.map(e.filter(".ui-state-disabled"),function(t){return e.index(t)}),this._processTabs(),!1!==t.active&&this.anchors.length?this.active.length&&!l.contains(this.tablist[0],this.active[0])?this.tabs.length===t.disabled.length?(t.active=!1,this.active=l()):this._activate(this._findNextTab(Math.max(0,t.active-1),!1)):t.active=this.tabs.index(this.active):(t.active=!1,this.active=l()),this._refresh()},_refresh:function(){this._setupDisabled(this.options.disabled),this._setupEvents(this.options.event),this._setupHeightStyle(this.options.heightStyle),this.tabs.not(this.active).attr({"aria-selected":"false","aria-expanded":"false",tabIndex:-1}),this.panels.not(this._getPanelForTab(this.active)).hide().attr({"aria-hidden":"true"}),this.active.length?(this.active.addClass("ui-tabs-active ui-state-active").attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0}),this._getPanelForTab(this.active).show().attr({"aria-hidden":"false"})):this.tabs.eq(0).attr("tabIndex",0)},_processTabs:function(){var o=this,t=this.tabs,e=this.anchors,i=this.panels;this.tablist=this._getList().addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").attr("role","tablist").delegate("> li","mousedown"+this.eventNamespace,function(t){l(this).is(".ui-state-disabled")&&t.preventDefault()}).delegate(".ui-tabs-anchor","focus"+this.eventNamespace,function(){l(this).closest("li").is(".ui-state-disabled")&&this.blur()}),this.tabs=this.tablist.find("> li:has(a[href])").addClass("ui-state-default ui-corner-top").attr({role:"tab",tabIndex:-1}),this.anchors=this.tabs.map(function(){return l("a",this)[0]}).addClass("ui-tabs-anchor").attr({role:"presentation",tabIndex:-1}),this.panels=l(),this.anchors.each(function(t,e){var i,a,s,n=l(e).uniqueId().attr("id"),r=l(e).closest("li"),h=r.attr("aria-controls");o._isLocal(e)?(s=(i=e.hash).substring(1),a=o.element.find(o._sanitizeSelector(i))):(i="#"+(s=r.attr("aria-controls")||l({}).uniqueId()[0].id),(a=o.element.find(i)).length||(a=o._createPanel(s)).insertAfter(o.panels[t-1]||o.tablist),a.attr("aria-live","polite")),a.length&&(o.panels=o.panels.add(a)),h&&r.data("ui-tabs-aria-controls",h),r.attr({"aria-controls":s,"aria-labelledby":n}),a.attr("aria-labelledby",n)}),this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").attr("role","tabpanel"),t&&(this._off(t.not(this.tabs)),this._off(e.not(this.anchors)),this._off(i.not(this.panels)))},_getList:function(){return this.tablist||this.element.find("ol,ul").eq(0)},_createPanel:function(t){return l("<div>").attr("id",t).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").data("ui-tabs-destroy",!0)},_setupDisabled:function(t){l.isArray(t)&&(t.length?t.length===this.anchors.length&&(t=!0):t=!1);for(var e,i=0;e=this.tabs[i];i++)!0===t||-1!==l.inArray(i,t)?l(e).addClass("ui-state-disabled").attr("aria-disabled","true"):l(e).removeClass("ui-state-disabled").removeAttr("aria-disabled");this.options.disabled=t},_setupEvents:function(t){var i={};t&&l.each(t.split(" "),function(t,e){i[e]="_eventHandler"}),this._off(this.anchors.add(this.tabs).add(this.panels)),this._on(!0,this.anchors,{click:function(t){t.preventDefault()}}),this._on(this.anchors,i),this._on(this.tabs,{keydown:"_tabKeydown"}),this._on(this.panels,{keydown:"_panelKeydown"}),this._focusable(this.tabs),this._hoverable(this.tabs)},_setupHeightStyle:function(t){var i,e=this.element.parent();"fill"===t?(i=e.height(),i-=this.element.outerHeight()-this.element.height(),this.element.siblings(":visible").each(function(){var t=l(this),e=t.css("position");"absolute"!==e&&"fixed"!==e&&(i-=t.outerHeight(!0))}),this.element.children().not(this.panels).each(function(){i-=l(this).outerHeight(!0)}),this.panels.each(function(){l(this).height(Math.max(0,i-l(this).innerHeight()+l(this).height()))}).css("overflow","auto")):"auto"===t&&(i=0,this.panels.each(function(){i=Math.max(i,l(this).height("").height())}).height(i))},_eventHandler:function(t){var e=this.options,i=this.active,a=l(t.currentTarget).closest("li"),s=a[0]===i[0],n=s&&e.collapsible,r=n?l():this._getPanelForTab(a),h=i.length?this._getPanelForTab(i):l(),o={oldTab:i,oldPanel:h,newTab:n?l():a,newPanel:r};t.preventDefault(),a.hasClass("ui-state-disabled")||a.hasClass("ui-tabs-loading")||this.running||s&&!e.collapsible||!1===this._trigger("beforeActivate",t,o)||(e.active=!n&&this.tabs.index(a),this.active=s?l():a,this.xhr&&this.xhr.abort(),h.length||r.length||l.error("jQuery UI Tabs: Mismatching fragment identifier."),r.length&&this.load(this.tabs.index(a),t),this._toggle(t,o))},_toggle:function(t,e){var i=this,a=e.newPanel,s=e.oldPanel;function n(){i.running=!1,i._trigger("activate",t,e)}function r(){e.newTab.closest("li").addClass("ui-tabs-active ui-state-active"),a.length&&i.options.show?i._show(a,i.options.show,n):(a.show(),n())}this.running=!0,s.length&&this.options.hide?this._hide(s,this.options.hide,function(){e.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),r()}):(e.oldTab.closest("li").removeClass("ui-tabs-active ui-state-active"),s.hide(),r()),s.attr("aria-hidden","true"),e.oldTab.attr({"aria-selected":"false","aria-expanded":"false"}),a.length&&s.length?e.oldTab.attr("tabIndex",-1):a.length&&this.tabs.filter(function(){return 0===l(this).attr("tabIndex")}).attr("tabIndex",-1),a.attr("aria-hidden","false"),e.newTab.attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0})},_activate:function(t){var e,i=this._findActive(t);i[0]!==this.active[0]&&(i.length||(i=this.active),e=i.find(".ui-tabs-anchor")[0],this._eventHandler({target:e,currentTarget:e,preventDefault:l.noop}))},_findActive:function(t){return!1===t?l():this.tabs.eq(t)},_getIndex:function(t){return"string"==typeof t&&(t=this.anchors.index(this.anchors.filter("[href$='"+t+"']"))),t},_destroy:function(){this.xhr&&this.xhr.abort(),this.element.removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible"),this.tablist.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all").removeAttr("role"),this.anchors.removeClass("ui-tabs-anchor").removeAttr("role").removeAttr("tabIndex").removeUniqueId(),this.tablist.unbind(this.eventNamespace),this.tabs.add(this.panels).each(function(){l.data(this,"ui-tabs-destroy")?l(this).remove():l(this).removeClass("ui-state-default ui-state-active ui-state-disabled ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel").removeAttr("tabIndex").removeAttr("aria-live").removeAttr("aria-busy").removeAttr("aria-selected").removeAttr("aria-labelledby").removeAttr("aria-hidden").removeAttr("aria-expanded").removeAttr("role")}),this.tabs.each(function(){var t=l(this),e=t.data("ui-tabs-aria-controls");e?t.attr("aria-controls",e).removeData("ui-tabs-aria-controls"):t.removeAttr("aria-controls")}),this.panels.show(),"content"!==this.options.heightStyle&&this.panels.css("height","")},enable:function(i){var t=this.options.disabled;!1!==t&&(t=void 0!==i&&(i=this._getIndex(i),l.isArray(t)?l.map(t,function(t){return t!==i?t:null}):l.map(this.tabs,function(t,e){return e!==i?e:null})),this._setupDisabled(t))},disable:function(t){var e=this.options.disabled;if(!0!==e){if(void 0===t)e=!0;else{if(t=this._getIndex(t),-1!==l.inArray(t,e))return;e=l.isArray(e)?l.merge([t],e).sort():[t]}this._setupDisabled(e)}},load:function(t,a){t=this._getIndex(t);function s(t,e){"abort"===e&&n.panels.stop(!1,!0),i.removeClass("ui-tabs-loading"),r.removeAttr("aria-busy"),t===n.xhr&&delete n.xhr}var n=this,i=this.tabs.eq(t),e=i.find(".ui-tabs-anchor"),r=this._getPanelForTab(i),h={tab:i,panel:r};this._isLocal(e[0])||(this.xhr=l.ajax(this._ajaxSettings(e,a,h)),this.xhr&&"canceled"!==this.xhr.statusText&&(i.addClass("ui-tabs-loading"),r.attr("aria-busy","true"),this.xhr.done(function(t,e,i){setTimeout(function(){r.html(t),n._trigger("load",a,h),s(i,e)},1)}).fail(function(t,e){setTimeout(function(){s(t,e)},1)})))},_ajaxSettings:function(t,i,a){var s=this;return{url:t.attr("href"),beforeSend:function(t,e){return s._trigger("beforeLoad",i,l.extend({jqXHR:t,ajaxSettings:e},a))}}},_getPanelForTab:function(t){var e=l(t).attr("aria-controls");return this.element.find(this._sanitizeSelector("#"+e))}});var a});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./core"],t):t(jQuery)}(function(l){var a;return l.widget("ui.tabs",{version:"1.12.1",delay:300,options:{active:null,classes:{"ui-tabs":"ui-corner-all","ui-tabs-nav":"ui-corner-all","ui-tabs-panel":"ui-corner-bottom","ui-tabs-tab":"ui-corner-top"},collapsible:!1,event:"click",heightStyle:"content",hide:null,show:null,activate:null,beforeActivate:null,beforeLoad:null,load:null},_isLocal:(a=/#.*$/,function(t){var e,i;e=t.href.replace(a,""),i=location.href.replace(a,"");try{e=decodeURIComponent(e)}catch(t){}try{i=decodeURIComponent(i)}catch(t){}return 1<t.hash.length&&e===i}),_create:function(){var e=this,t=this.options;this.running=!1,this._addClass("ui-tabs","ui-widget ui-widget-content"),this._toggleClass("ui-tabs-collapsible",null,t.collapsible),this._processTabs(),t.active=this._initialActive(),l.isArray(t.disabled)&&(t.disabled=l.unique(t.disabled.concat(l.map(this.tabs.filter(".ui-state-disabled"),function(t){return e.tabs.index(t)}))).sort()),!1!==this.options.active&&this.anchors.length?this.active=this._findActive(t.active):this.active=l(),this._refresh(),this.active.length&&this.load(t.active)},_initialActive:function(){var i=this.options.active,t=this.options.collapsible,a=location.hash.substring(1);return null===i&&(a&&this.tabs.each(function(t,e){if(l(e).attr("aria-controls")===a)return i=t,!1}),null===i&&(i=this.tabs.index(this.tabs.filter(".ui-tabs-active"))),null!==i&&-1!==i||(i=!!this.tabs.length&&0)),!1!==i&&-1===(i=this.tabs.index(this.tabs.eq(i)))&&(i=!t&&0),!t&&!1===i&&this.anchors.length&&(i=0),i},_getCreateEventData:function(){return{tab:this.active,panel:this.active.length?this._getPanelForTab(this.active):l()}},_tabKeydown:function(t){var e=l(l.ui.safeActiveElement(this.document[0])).closest("li"),i=this.tabs.index(e),a=!0;if(!this._handlePageNav(t)){switch(t.keyCode){case l.ui.keyCode.RIGHT:case l.ui.keyCode.DOWN:i++;break;case l.ui.keyCode.UP:case l.ui.keyCode.LEFT:a=!1,i--;break;case l.ui.keyCode.END:i=this.anchors.length-1;break;case l.ui.keyCode.HOME:i=0;break;case l.ui.keyCode.SPACE:return t.preventDefault(),clearTimeout(this.activating),void this._activate(i);case l.ui.keyCode.ENTER:return t.preventDefault(),clearTimeout(this.activating),void this._activate(i!==this.options.active&&i);default:return}t.preventDefault(),clearTimeout(this.activating),i=this._focusNextTab(i,a),t.ctrlKey||t.metaKey||(e.attr("aria-selected","false"),this.tabs.eq(i).attr("aria-selected","true"),this.activating=this._delay(function(){this.option("active",i)},this.delay))}},_panelKeydown:function(t){this._handlePageNav(t)||t.ctrlKey&&t.keyCode===l.ui.keyCode.UP&&(t.preventDefault(),this.active.trigger("focus"))},_handlePageNav:function(t){return t.altKey&&t.keyCode===l.ui.keyCode.PAGE_UP?(this._activate(this._focusNextTab(this.options.active-1,!1)),!0):t.altKey&&t.keyCode===l.ui.keyCode.PAGE_DOWN?(this._activate(this._focusNextTab(this.options.active+1,!0)),!0):void 0},_findNextTab:function(t,e){var i=this.tabs.length-1;for(;-1!==l.inArray((i<t&&(t=0),t<0&&(t=i),t),this.options.disabled);)t=e?t+1:t-1;return t},_focusNextTab:function(t,e){return t=this._findNextTab(t,e),this.tabs.eq(t).trigger("focus"),t},_setOption:function(t,e){"active"!==t?(this._super(t,e),"collapsible"===t&&(this._toggleClass("ui-tabs-collapsible",null,e),e||!1!==this.options.active||this._activate(0)),"event"===t&&this._setupEvents(e),"heightStyle"===t&&this._setupHeightStyle(e)):this._activate(e)},_sanitizeSelector:function(t){return t?t.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g,"\\$&"):""},refresh:function(){var t=this.options,e=this.tablist.children(":has(a[href])");t.disabled=l.map(e.filter(".ui-state-disabled"),function(t){return e.index(t)}),this._processTabs(),!1!==t.active&&this.anchors.length?this.active.length&&!l.contains(this.tablist[0],this.active[0])?this.tabs.length===t.disabled.length?(t.active=!1,this.active=l()):this._activate(this._findNextTab(Math.max(0,t.active-1),!1)):t.active=this.tabs.index(this.active):(t.active=!1,this.active=l()),this._refresh()},_refresh:function(){this._setOptionDisabled(this.options.disabled),this._setupEvents(this.options.event),this._setupHeightStyle(this.options.heightStyle),this.tabs.not(this.active).attr({"aria-selected":"false","aria-expanded":"false",tabIndex:-1}),this.panels.not(this._getPanelForTab(this.active)).hide().attr({"aria-hidden":"true"}),this.active.length?(this.active.attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0}),this._addClass(this.active,"ui-tabs-active","ui-state-active"),this._getPanelForTab(this.active).show().attr({"aria-hidden":"false"})):this.tabs.eq(0).attr("tabIndex",0)},_processTabs:function(){var o=this,t=this.tabs,e=this.anchors,i=this.panels;this.tablist=this._getList().attr("role","tablist"),this._addClass(this.tablist,"ui-tabs-nav","ui-helper-reset ui-helper-clearfix ui-widget-header"),this.tablist.on("mousedown"+this.eventNamespace,"> li",function(t){l(this).is(".ui-state-disabled")&&t.preventDefault()}).on("focus"+this.eventNamespace,".ui-tabs-anchor",function(){l(this).closest("li").is(".ui-state-disabled")&&this.blur()}),this.tabs=this.tablist.find("> li:has(a[href])").attr({role:"tab",tabIndex:-1}),this._addClass(this.tabs,"ui-tabs-tab","ui-state-default"),this.anchors=this.tabs.map(function(){return l("a",this)[0]}).attr({role:"presentation",tabIndex:-1}),this._addClass(this.anchors,"ui-tabs-anchor"),this.panels=l(),this.anchors.each(function(t,e){var i,a,s,n=l(e).uniqueId().attr("id"),h=l(e).closest("li"),r=h.attr("aria-controls");o._isLocal(e)?(s=(i=e.hash).substring(1),a=o.element.find(o._sanitizeSelector(i))):(i="#"+(s=h.attr("aria-controls")||l({}).uniqueId()[0].id),(a=o.element.find(i)).length||(a=o._createPanel(s)).insertAfter(o.panels[t-1]||o.tablist),a.attr("aria-live","polite")),a.length&&(o.panels=o.panels.add(a)),r&&h.data("ui-tabs-aria-controls",r),h.attr({"aria-controls":s,"aria-labelledby":n}),a.attr("aria-labelledby",n)}),this.panels.attr("role","tabpanel"),this._addClass(this.panels,"ui-tabs-panel","ui-widget-content"),t&&(this._off(t.not(this.tabs)),this._off(e.not(this.anchors)),this._off(i.not(this.panels)))},_getList:function(){return this.tablist||this.element.find("ol, ul").eq(0)},_createPanel:function(t){return l("<div>").attr("id",t).data("ui-tabs-destroy",!0)},_setOptionDisabled:function(t){var e,i,a;for(l.isArray(t)&&(t.length?t.length===this.anchors.length&&(t=!0):t=!1),a=0;i=this.tabs[a];a++)e=l(i),!0===t||-1!==l.inArray(a,t)?(e.attr("aria-disabled","true"),this._addClass(e,null,"ui-state-disabled")):(e.removeAttr("aria-disabled"),this._removeClass(e,null,"ui-state-disabled"));this.options.disabled=t,this._toggleClass(this.widget(),this.widgetFullName+"-disabled",null,!0===t)},_setupEvents:function(t){var i={};t&&l.each(t.split(" "),function(t,e){i[e]="_eventHandler"}),this._off(this.anchors.add(this.tabs).add(this.panels)),this._on(!0,this.anchors,{click:function(t){t.preventDefault()}}),this._on(this.anchors,i),this._on(this.tabs,{keydown:"_tabKeydown"}),this._on(this.panels,{keydown:"_panelKeydown"}),this._focusable(this.tabs),this._hoverable(this.tabs)},_setupHeightStyle:function(t){var i,e=this.element.parent();"fill"===t?(i=e.height(),i-=this.element.outerHeight()-this.element.height(),this.element.siblings(":visible").each(function(){var t=l(this),e=t.css("position");"absolute"!==e&&"fixed"!==e&&(i-=t.outerHeight(!0))}),this.element.children().not(this.panels).each(function(){i-=l(this).outerHeight(!0)}),this.panels.each(function(){l(this).height(Math.max(0,i-l(this).innerHeight()+l(this).height()))}).css("overflow","auto")):"auto"===t&&(i=0,this.panels.each(function(){i=Math.max(i,l(this).height("").height())}).height(i))},_eventHandler:function(t){var e=this.options,i=this.active,a=l(t.currentTarget).closest("li"),s=a[0]===i[0],n=s&&e.collapsible,h=n?l():this._getPanelForTab(a),r=i.length?this._getPanelForTab(i):l(),o={oldTab:i,oldPanel:r,newTab:n?l():a,newPanel:h};t.preventDefault(),a.hasClass("ui-state-disabled")||a.hasClass("ui-tabs-loading")||this.running||s&&!e.collapsible||!1===this._trigger("beforeActivate",t,o)||(e.active=!n&&this.tabs.index(a),this.active=s?l():a,this.xhr&&this.xhr.abort(),r.length||h.length||l.error("jQuery UI Tabs: Mismatching fragment identifier."),h.length&&this.load(this.tabs.index(a),t),this._toggle(t,o))},_toggle:function(t,e){var i=this,a=e.newPanel,s=e.oldPanel;function n(){i.running=!1,i._trigger("activate",t,e)}function h(){i._addClass(e.newTab.closest("li"),"ui-tabs-active","ui-state-active"),a.length&&i.options.show?i._show(a,i.options.show,n):(a.show(),n())}this.running=!0,s.length&&this.options.hide?this._hide(s,this.options.hide,function(){i._removeClass(e.oldTab.closest("li"),"ui-tabs-active","ui-state-active"),h()}):(this._removeClass(e.oldTab.closest("li"),"ui-tabs-active","ui-state-active"),s.hide(),h()),s.attr("aria-hidden","true"),e.oldTab.attr({"aria-selected":"false","aria-expanded":"false"}),a.length&&s.length?e.oldTab.attr("tabIndex",-1):a.length&&this.tabs.filter(function(){return 0===l(this).attr("tabIndex")}).attr("tabIndex",-1),a.attr("aria-hidden","false"),e.newTab.attr({"aria-selected":"true","aria-expanded":"true",tabIndex:0})},_activate:function(t){var e,i=this._findActive(t);i[0]!==this.active[0]&&(i.length||(i=this.active),e=i.find(".ui-tabs-anchor")[0],this._eventHandler({target:e,currentTarget:e,preventDefault:l.noop}))},_findActive:function(t){return!1===t?l():this.tabs.eq(t)},_getIndex:function(t){return"string"==typeof t&&(t=this.anchors.index(this.anchors.filter("[href$='"+l.ui.escapeSelector(t)+"']"))),t},_destroy:function(){this.xhr&&this.xhr.abort(),this.tablist.removeAttr("role").off(this.eventNamespace),this.anchors.removeAttr("role tabIndex").removeUniqueId(),this.tabs.add(this.panels).each(function(){l.data(this,"ui-tabs-destroy")?l(this).remove():l(this).removeAttr("role tabIndex aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded")}),this.tabs.each(function(){var t=l(this),e=t.data("ui-tabs-aria-controls");e?t.attr("aria-controls",e).removeData("ui-tabs-aria-controls"):t.removeAttr("aria-controls")}),this.panels.show(),"content"!==this.options.heightStyle&&this.panels.css("height","")},enable:function(i){var t=this.options.disabled;!1!==t&&(t=void 0!==i&&(i=this._getIndex(i),l.isArray(t)?l.map(t,function(t){return t!==i?t:null}):l.map(this.tabs,function(t,e){return e!==i?e:null})),this._setOptionDisabled(t))},disable:function(t){var e=this.options.disabled;if(!0!==e){if(void 0===t)e=!0;else{if(t=this._getIndex(t),-1!==l.inArray(t,e))return;e=l.isArray(e)?l.merge([t],e).sort():[t]}this._setOptionDisabled(e)}},load:function(t,a){t=this._getIndex(t);function s(t,e){"abort"===e&&n.panels.stop(!1,!0),n._removeClass(i,"ui-tabs-loading"),h.removeAttr("aria-busy"),t===n.xhr&&delete n.xhr}var n=this,i=this.tabs.eq(t),e=i.find(".ui-tabs-anchor"),h=this._getPanelForTab(i),r={tab:i,panel:h};this._isLocal(e[0])||(this.xhr=l.ajax(this._ajaxSettings(e,a,r)),this.xhr&&"canceled"!==this.xhr.statusText&&(this._addClass(i,"ui-tabs-loading"),h.attr("aria-busy","true"),this.xhr.done(function(t,e,i){setTimeout(function(){h.html(t),n._trigger("load",a,r),s(i,e)},1)}).fail(function(t,e){setTimeout(function(){s(t,e)},1)})))},_ajaxSettings:function(t,i,a){var s=this;return{url:t.attr("href").replace(/#.*$/,""),beforeSend:function(t,e){return s._trigger("beforeLoad",i,l.extend({jqXHR:t,ajaxSettings:e},a))}}},_getPanelForTab:function(t){var e=l(t).attr("aria-controls");return this.element.find(this._sanitizeSelector("#"+e))}}),!1!==l.uiBackCompat&&l.widget("ui.tabs",l.ui.tabs,{_processTabs:function(){this._superApply(arguments),this._addClass(this.tabs,"ui-tab")}}),l.ui.tabs});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/tooltip.js b/wp-includes/js/jquery/ui/tooltip.js
new file mode 100644
index 0000000000..b59471c295
--- /dev/null
+++ b/wp-includes/js/jquery/ui/tooltip.js
@@ -0,0 +1,516 @@
+/*!
+ * jQuery UI Tooltip 1.12.1
+ * http://jqueryui.com
+ *
+ * Copyright jQuery Foundation and other contributors
+ * Released under the MIT license.
+ * http://jquery.org/license
+ */
+
+//>>label: Tooltip
+//>>group: Widgets
+//>>description: Shows additional information for any element on hover or focus.
+//>>docs: http://api.jqueryui.com/tooltip/
+//>>demos: http://jqueryui.com/tooltip/
+//>>css.structure: ../../themes/base/core.css
+//>>css.structure: ../../themes/base/tooltip.css
+//>>css.theme: ../../themes/base/theme.css
+
+( function( factory ) {
+	if ( typeof define === "function" && define.amd ) {
+
+		// AMD. Register as an anonymous module.
+		define( [
+			"jquery",
+			"./core"
+		], factory );
+	} else {
+
+		// Browser globals
+		factory( jQuery );
+	}
+}( function( $ ) {
+
+$.widget( "ui.tooltip", {
+	version: "1.12.1",
+	options: {
+		classes: {
+			"ui-tooltip": "ui-corner-all ui-widget-shadow"
+		},
+		content: function() {
+
+			// support: IE<9, Opera in jQuery <1.7
+			// .text() can't accept undefined, so coerce to a string
+			var title = $( this ).attr( "title" ) || "";
+
+			// Escape title, since we're going from an attribute to raw HTML
+			return $( "<a>" ).text( title ).html();
+		},
+		hide: true,
+
+		// Disabled elements have inconsistent behavior across browsers (#8661)
+		items: "[title]:not([disabled])",
+		position: {
+			my: "left top+15",
+			at: "left bottom",
+			collision: "flipfit flip"
+		},
+		show: true,
+		track: false,
+
+		// Callbacks
+		close: null,
+		open: null
+	},
+
+	_addDescribedBy: function( elem, id ) {
+		var describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ );
+		describedby.push( id );
+		elem
+			.data( "ui-tooltip-id", id )
+			.attr( "aria-describedby", $.trim( describedby.join( " " ) ) );
+	},
+
+	_removeDescribedBy: function( elem ) {
+		var id = elem.data( "ui-tooltip-id" ),
+			describedby = ( elem.attr( "aria-describedby" ) || "" ).split( /\s+/ ),
+			index = $.inArray( id, describedby );
+
+		if ( index !== -1 ) {
+			describedby.splice( index, 1 );
+		}
+
+		elem.removeData( "ui-tooltip-id" );
+		describedby = $.trim( describedby.join( " " ) );
+		if ( describedby ) {
+			elem.attr( "aria-describedby", describedby );
+		} else {
+			elem.removeAttr( "aria-describedby" );
+		}
+	},
+
+	_create: function() {
+		this._on( {
+			mouseover: "open",
+			focusin: "open"
+		} );
+
+		// IDs of generated tooltips, needed for destroy
+		this.tooltips = {};
+
+		// IDs of parent tooltips where we removed the title attribute
+		this.parents = {};
+
+		// Append the aria-live region so tooltips announce correctly
+		this.liveRegion = $( "<div>" )
+			.attr( {
+				role: "log",
+				"aria-live": "assertive",
+				"aria-relevant": "additions"
+			} )
+			.appendTo( this.document[ 0 ].body );
+		this._addClass( this.liveRegion, null, "ui-helper-hidden-accessible" );
+
+		this.disabledTitles = $( [] );
+	},
+
+	_setOption: function( key, value ) {
+		var that = this;
+
+		this._super( key, value );
+
+		if ( key === "content" ) {
+			$.each( this.tooltips, function( id, tooltipData ) {
+				that._updateContent( tooltipData.element );
+			} );
+		}
+	},
+
+	_setOptionDisabled: function( value ) {
+		this[ value ? "_disable" : "_enable" ]();
+	},
+
+	_disable: function() {
+		var that = this;
+
+		// Close open tooltips
+		$.each( this.tooltips, function( id, tooltipData ) {
+			var event = $.Event( "blur" );
+			event.target = event.currentTarget = tooltipData.element[ 0 ];
+			that.close( event, true );
+		} );
+
+		// Remove title attributes to prevent native tooltips
+		this.disabledTitles = this.disabledTitles.add(
+			this.element.find( this.options.items ).addBack()
+				.filter( function() {
+					var element = $( this );
+					if ( element.is( "[title]" ) ) {
+						return element
+							.data( "ui-tooltip-title", element.attr( "title" ) )
+							.removeAttr( "title" );
+					}
+				} )
+		);
+	},
+
+	_enable: function() {
+
+		// restore title attributes
+		this.disabledTitles.each( function() {
+			var element = $( this );
+			if ( element.data( "ui-tooltip-title" ) ) {
+				element.attr( "title", element.data( "ui-tooltip-title" ) );
+			}
+		} );
+		this.disabledTitles = $( [] );
+	},
+
+	open: function( event ) {
+		var that = this,
+			target = $( event ? event.target : this.element )
+
+				// we need closest here due to mouseover bubbling,
+				// but always pointing at the same event target
+				.closest( this.options.items );
+
+		// No element to show a tooltip for or the tooltip is already open
+		if ( !target.length || target.data( "ui-tooltip-id" ) ) {
+			return;
+		}
+
+		if ( target.attr( "title" ) ) {
+			target.data( "ui-tooltip-title", target.attr( "title" ) );
+		}
+
+		target.data( "ui-tooltip-open", true );
+
+		// Kill parent tooltips, custom or native, for hover
+		if ( event && event.type === "mouseover" ) {
+			target.parents().each( function() {
+				var parent = $( this ),
+					blurEvent;
+				if ( parent.data( "ui-tooltip-open" ) ) {
+					blurEvent = $.Event( "blur" );
+					blurEvent.target = blurEvent.currentTarget = this;
+					that.close( blurEvent, true );
+				}
+				if ( parent.attr( "title" ) ) {
+					parent.uniqueId();
+					that.parents[ this.id ] = {
+						element: this,
+						title: parent.attr( "title" )
+					};
+					parent.attr( "title", "" );
+				}
+			} );
+		}
+
+		this._registerCloseHandlers( event, target );
+		this._updateContent( target, event );
+	},
+
+	_updateContent: function( target, event ) {
+		var content,
+			contentOption = this.options.content,
+			that = this,
+			eventType = event ? event.type : null;
+
+		if ( typeof contentOption === "string" || contentOption.nodeType ||
+				contentOption.jquery ) {
+			return this._open( event, target, contentOption );
+		}
+
+		content = contentOption.call( target[ 0 ], function( response ) {
+
+			// IE may instantly serve a cached response for ajax requests
+			// delay this call to _open so the other call to _open runs first
+			that._delay( function() {
+
+				// Ignore async response if tooltip was closed already
+				if ( !target.data( "ui-tooltip-open" ) ) {
+					return;
+				}
+
+				// JQuery creates a special event for focusin when it doesn't
+				// exist natively. To improve performance, the native event
+				// object is reused and the type is changed. Therefore, we can't
+				// rely on the type being correct after the event finished
+				// bubbling, so we set it back to the previous value. (#8740)
+				if ( event ) {
+					event.type = eventType;
+				}
+				this._open( event, target, response );
+			} );
+		} );
+		if ( content ) {
+			this._open( event, target, content );
+		}
+	},
+
+	_open: function( event, target, content ) {
+		var tooltipData, tooltip, delayedShow, a11yContent,
+			positionOption = $.extend( {}, this.options.position );
+
+		if ( !content ) {
+			return;
+		}
+
+		// Content can be updated multiple times. If the tooltip already
+		// exists, then just update the content and bail.
+		tooltipData = this._find( target );
+		if ( tooltipData ) {
+			tooltipData.tooltip.find( ".ui-tooltip-content" ).html( content );
+			return;
+		}
+
+		// If we have a title, clear it to prevent the native tooltip
+		// we have to check first to avoid defining a title if none exists
+		// (we don't want to cause an element to start matching [title])
+		//
+		// We use removeAttr only for key events, to allow IE to export the correct
+		// accessible attributes. For mouse events, set to empty string to avoid
+		// native tooltip showing up (happens only when removing inside mouseover).
+		if ( target.is( "[title]" ) ) {
+			if ( event && event.type === "mouseover" ) {
+				target.attr( "title", "" );
+			} else {
+				target.removeAttr( "title" );
+			}
+		}
+
+		tooltipData = this._tooltip( target );
+		tooltip = tooltipData.tooltip;
+		this._addDescribedBy( target, tooltip.attr( "id" ) );
+		tooltip.find( ".ui-tooltip-content" ).html( content );
+
+		// Support: Voiceover on OS X, JAWS on IE <= 9
+		// JAWS announces deletions even when aria-relevant="additions"
+		// Voiceover will sometimes re-read the entire log region's contents from the beginning
+		this.liveRegion.children().hide();
+		a11yContent = $( "<div>" ).html( tooltip.find( ".ui-tooltip-content" ).html() );
+		a11yContent.removeAttr( "name" ).find( "[name]" ).removeAttr( "name" );
+		a11yContent.removeAttr( "id" ).find( "[id]" ).removeAttr( "id" );
+		a11yContent.appendTo( this.liveRegion );
+
+		function position( event ) {
+			positionOption.of = event;
+			if ( tooltip.is( ":hidden" ) ) {
+				return;
+			}
+			tooltip.position( positionOption );
+		}
+		if ( this.options.track && event && /^mouse/.test( event.type ) ) {
+			this._on( this.document, {
+				mousemove: position
+			} );
+
+			// trigger once to override element-relative positioning
+			position( event );
+		} else {
+			tooltip.position( $.extend( {
+				of: target
+			}, this.options.position ) );
+		}
+
+		tooltip.hide();
+
+		this._show( tooltip, this.options.show );
+
+		// Handle tracking tooltips that are shown with a delay (#8644). As soon
+		// as the tooltip is visible, position the tooltip using the most recent
+		// event.
+		// Adds the check to add the timers only when both delay and track options are set (#14682)
+		if ( this.options.track && this.options.show && this.options.show.delay ) {
+			delayedShow = this.delayedShow = setInterval( function() {
+				if ( tooltip.is( ":visible" ) ) {
+					position( positionOption.of );
+					clearInterval( delayedShow );
+				}
+			}, $.fx.interval );
+		}
+
+		this._trigger( "open", event, { tooltip: tooltip } );
+	},
+
+	_registerCloseHandlers: function( event, target ) {
+		var events = {
+			keyup: function( event ) {
+				if ( event.keyCode === $.ui.keyCode.ESCAPE ) {
+					var fakeEvent = $.Event( event );
+					fakeEvent.currentTarget = target[ 0 ];
+					this.close( fakeEvent, true );
+				}
+			}
+		};
+
+		// Only bind remove handler for delegated targets. Non-delegated
+		// tooltips will handle this in destroy.
+		if ( target[ 0 ] !== this.element[ 0 ] ) {
+			events.remove = function() {
+				this._removeTooltip( this._find( target ).tooltip );
+			};
+		}
+
+		if ( !event || event.type === "mouseover" ) {
+			events.mouseleave = "close";
+		}
+		if ( !event || event.type === "focusin" ) {
+			events.focusout = "close";
+		}
+		this._on( true, target, events );
+	},
+
+	close: function( event ) {
+		var tooltip,
+			that = this,
+			target = $( event ? event.currentTarget : this.element ),
+			tooltipData = this._find( target );
+
+		// The tooltip may already be closed
+		if ( !tooltipData ) {
+
+			// We set ui-tooltip-open immediately upon open (in open()), but only set the
+			// additional data once there's actually content to show (in _open()). So even if the
+			// tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
+			// the period between open() and _open().
+			target.removeData( "ui-tooltip-open" );
+			return;
+		}
+
+		tooltip = tooltipData.tooltip;
+
+		// Disabling closes the tooltip, so we need to track when we're closing
+		// to avoid an infinite loop in case the tooltip becomes disabled on close
+		if ( tooltipData.closing ) {
+			return;
+		}
+
+		// Clear the interval for delayed tracking tooltips
+		clearInterval( this.delayedShow );
+
+		// Only set title if we had one before (see comment in _open())
+		// If the title attribute has changed since open(), don't restore
+		if ( target.data( "ui-tooltip-title" ) && !target.attr( "title" ) ) {
+			target.attr( "title", target.data( "ui-tooltip-title" ) );
+		}
+
+		this._removeDescribedBy( target );
+
+		tooltipData.hiding = true;
+		tooltip.stop( true );
+		this._hide( tooltip, this.options.hide, function() {
+			that._removeTooltip( $( this ) );
+		} );
+
+		target.removeData( "ui-tooltip-open" );
+		this._off( target, "mouseleave focusout keyup" );
+
+		// Remove 'remove' binding only on delegated targets
+		if ( target[ 0 ] !== this.element[ 0 ] ) {
+			this._off( target, "remove" );
+		}
+		this._off( this.document, "mousemove" );
+
+		if ( event && event.type === "mouseleave" ) {
+			$.each( this.parents, function( id, parent ) {
+				$( parent.element ).attr( "title", parent.title );
+				delete that.parents[ id ];
+			} );
+		}
+
+		tooltipData.closing = true;
+		this._trigger( "close", event, { tooltip: tooltip } );
+		if ( !tooltipData.hiding ) {
+			tooltipData.closing = false;
+		}
+	},
+
+	_tooltip: function( element ) {
+		var tooltip = $( "<div>" ).attr( "role", "tooltip" ),
+			content = $( "<div>" ).appendTo( tooltip ),
+			id = tooltip.uniqueId().attr( "id" );
+
+		this._addClass( content, "ui-tooltip-content" );
+		this._addClass( tooltip, "ui-tooltip", "ui-widget ui-widget-content" );
+
+		tooltip.appendTo( this._appendTo( element ) );
+
+		return this.tooltips[ id ] = {
+			element: element,
+			tooltip: tooltip
+		};
+	},
+
+	_find: function( target ) {
+		var id = target.data( "ui-tooltip-id" );
+		return id ? this.tooltips[ id ] : null;
+	},
+
+	_removeTooltip: function( tooltip ) {
+		tooltip.remove();
+		delete this.tooltips[ tooltip.attr( "id" ) ];
+	},
+
+	_appendTo: function( target ) {
+		var element = target.closest( ".ui-front, dialog" );
+
+		if ( !element.length ) {
+			element = this.document[ 0 ].body;
+		}
+
+		return element;
+	},
+
+	_destroy: function() {
+		var that = this;
+
+		// Close open tooltips
+		$.each( this.tooltips, function( id, tooltipData ) {
+
+			// Delegate to close method to handle common cleanup
+			var event = $.Event( "blur" ),
+				element = tooltipData.element;
+			event.target = event.currentTarget = element[ 0 ];
+			that.close( event, true );
+
+			// Remove immediately; destroying an open tooltip doesn't use the
+			// hide animation
+			$( "#" + id ).remove();
+
+			// Restore the title
+			if ( element.data( "ui-tooltip-title" ) ) {
+
+				// If the title attribute has changed since open(), don't restore
+				if ( !element.attr( "title" ) ) {
+					element.attr( "title", element.data( "ui-tooltip-title" ) );
+				}
+				element.removeData( "ui-tooltip-title" );
+			}
+		} );
+		this.liveRegion.remove();
+	}
+} );
+
+// DEPRECATED
+// TODO: Switch return back to widget declaration at top of file when this is removed
+if ( $.uiBackCompat !== false ) {
+
+	// Backcompat for tooltipClass option
+	$.widget( "ui.tooltip", $.ui.tooltip, {
+		options: {
+			tooltipClass: null
+		},
+		_tooltip: function() {
+			var tooltipData = this._superApply( arguments );
+			if ( this.options.tooltipClass ) {
+				tooltipData.tooltip.addClass( this.options.tooltipClass );
+			}
+			return tooltipData;
+		}
+	} );
+}
+
+return $.ui.tooltip;
+
+} ) );
diff --git a/wp-includes/js/jquery/ui/tooltip.min.js b/wp-includes/js/jquery/ui/tooltip.min.js
index 55db80c207..c9c3160d58 100644
--- a/wp-includes/js/jquery/ui/tooltip.min.js
+++ b/wp-includes/js/jquery/ui/tooltip.min.js
@@ -1,11 +1,9 @@
 /*!
- * jQuery UI Tooltip 1.11.4
+ * jQuery UI Tooltip 1.12.1
  * http://jqueryui.com
  *
  * Copyright jQuery Foundation and other contributors
  * Released under the MIT license.
  * http://jquery.org/license
- *
- * http://api.jqueryui.com/tooltip/
  */
-!function(t){"function"==typeof define&&define.amd?define(["jquery","./core","./widget","./position"],t):t(jQuery)}(function(d){return d.widget("ui.tooltip",{version:"1.11.4",options:{content:function(){var t=d(this).attr("title")||"";return d("<a>").text(t).html()},hide:!0,items:"[title]:not([disabled])",position:{my:"left top+15",at:"left bottom",collision:"flipfit flip"},show:!0,tooltipClass:null,track:!1,close:null,open:null},_addDescribedBy:function(t,i){var e=(t.attr("aria-describedby")||"").split(/\s+/);e.push(i),t.data("ui-tooltip-id",i).attr("aria-describedby",d.trim(e.join(" ")))},_removeDescribedBy:function(t){var i=t.data("ui-tooltip-id"),e=(t.attr("aria-describedby")||"").split(/\s+/),o=d.inArray(i,e);-1!==o&&e.splice(o,1),t.removeData("ui-tooltip-id"),(e=d.trim(e.join(" ")))?t.attr("aria-describedby",e):t.removeAttr("aria-describedby")},_create:function(){this._on({mouseover:"open",focusin:"open"}),this.tooltips={},this.parents={},this.options.disabled&&this._disable(),this.liveRegion=d("<div>").attr({role:"log","aria-live":"assertive","aria-relevant":"additions"}).addClass("ui-helper-hidden-accessible").appendTo(this.document[0].body)},_setOption:function(t,i){var e=this;if("disabled"===t)return this[i?"_disable":"_enable"](),void(this.options[t]=i);this._super(t,i),"content"===t&&d.each(this.tooltips,function(t,i){e._updateContent(i.element)})},_disable:function(){var o=this;d.each(this.tooltips,function(t,i){var e=d.Event("blur");e.target=e.currentTarget=i.element[0],o.close(e,!0)}),this.element.find(this.options.items).addBack().each(function(){var t=d(this);t.is("[title]")&&t.data("ui-tooltip-title",t.attr("title")).removeAttr("title")})},_enable:function(){this.element.find(this.options.items).addBack().each(function(){var t=d(this);t.data("ui-tooltip-title")&&t.attr("title",t.data("ui-tooltip-title"))})},open:function(t){var e=this,i=d(t?t.target:this.element).closest(this.options.items);i.length&&!i.data("ui-tooltip-id")&&(i.attr("title")&&i.data("ui-tooltip-title",i.attr("title")),i.data("ui-tooltip-open",!0),t&&"mouseover"===t.type&&i.parents().each(function(){var t,i=d(this);i.data("ui-tooltip-open")&&((t=d.Event("blur")).target=t.currentTarget=this,e.close(t,!0)),i.attr("title")&&(i.uniqueId(),e.parents[this.id]={element:this,title:i.attr("title")},i.attr("title",""))}),this._registerCloseHandlers(t,i),this._updateContent(i,t))},_updateContent:function(i,e){var t,o=this.options.content,n=this,s=e?e.type:null;if("string"==typeof o)return this._open(e,i,o);(t=o.call(i[0],function(t){n._delay(function(){i.data("ui-tooltip-open")&&(e&&(e.type=s),this._open(e,i,t))})}))&&this._open(e,i,t)},_open:function(t,i,e){var o,n,s,l,a=d.extend({},this.options.position);function r(t){a.of=t,n.is(":hidden")||n.position(a)}e&&((o=this._find(i))?o.tooltip.find(".ui-tooltip-content").html(e):(i.is("[title]")&&(t&&"mouseover"===t.type?i.attr("title",""):i.removeAttr("title")),o=this._tooltip(i),n=o.tooltip,this._addDescribedBy(i,n.attr("id")),n.find(".ui-tooltip-content").html(e),this.liveRegion.children().hide(),e.clone?(l=e.clone()).removeAttr("id").find("[id]").removeAttr("id"):l=e,d("<div>").html(l).appendTo(this.liveRegion),this.options.track&&t&&/^mouse/.test(t.type)?(this._on(this.document,{mousemove:r}),r(t)):n.position(d.extend({of:i},this.options.position)),n.hide(),this._show(n,this.options.show),this.options.show&&this.options.show.delay&&(s=this.delayedShow=setInterval(function(){n.is(":visible")&&(r(a.of),clearInterval(s))},d.fx.interval)),this._trigger("open",t,{tooltip:n})))},_registerCloseHandlers:function(t,e){var i={keyup:function(t){if(t.keyCode===d.ui.keyCode.ESCAPE){var i=d.Event(t);i.currentTarget=e[0],this.close(i,!0)}}};e[0]!==this.element[0]&&(i.remove=function(){this._removeTooltip(this._find(e).tooltip)}),t&&"mouseover"!==t.type||(i.mouseleave="close"),t&&"focusin"!==t.type||(i.focusout="close"),this._on(!0,e,i)},close:function(t){var i,e=this,o=d(t?t.currentTarget:this.element),n=this._find(o);n?(i=n.tooltip,n.closing||(clearInterval(this.delayedShow),o.data("ui-tooltip-title")&&!o.attr("title")&&o.attr("title",o.data("ui-tooltip-title")),this._removeDescribedBy(o),n.hiding=!0,i.stop(!0),this._hide(i,this.options.hide,function(){e._removeTooltip(d(this))}),o.removeData("ui-tooltip-open"),this._off(o,"mouseleave focusout keyup"),o[0]!==this.element[0]&&this._off(o,"remove"),this._off(this.document,"mousemove"),t&&"mouseleave"===t.type&&d.each(this.parents,function(t,i){d(i.element).attr("title",i.title),delete e.parents[t]}),n.closing=!0,this._trigger("close",t,{tooltip:i}),n.hiding||(n.closing=!1))):o.removeData("ui-tooltip-open")},_tooltip:function(t){var i=d("<div>").attr("role","tooltip").addClass("ui-tooltip ui-widget ui-corner-all ui-widget-content "+(this.options.tooltipClass||"")),e=i.uniqueId().attr("id");return d("<div>").addClass("ui-tooltip-content").appendTo(i),i.appendTo(this.document[0].body),this.tooltips[e]={element:t,tooltip:i}},_find:function(t){var i=t.data("ui-tooltip-id");return i?this.tooltips[i]:null},_removeTooltip:function(t){t.remove(),delete this.tooltips[t.attr("id")]},_destroy:function(){var n=this;d.each(this.tooltips,function(t,i){var e=d.Event("blur"),o=i.element;e.target=e.currentTarget=o[0],n.close(e,!0),d("#"+t).remove(),o.data("ui-tooltip-title")&&(o.attr("title")||o.attr("title",o.data("ui-tooltip-title")),o.removeData("ui-tooltip-title"))}),this.liveRegion.remove()}})});
\ No newline at end of file
+!function(t){"function"==typeof define&&define.amd?define(["jquery","./core"],t):t(jQuery)}(function(d){return d.widget("ui.tooltip",{version:"1.12.1",options:{classes:{"ui-tooltip":"ui-corner-all ui-widget-shadow"},content:function(){var t=d(this).attr("title")||"";return d("<a>").text(t).html()},hide:!0,items:"[title]:not([disabled])",position:{my:"left top+15",at:"left bottom",collision:"flipfit flip"},show:!0,track:!1,close:null,open:null},_addDescribedBy:function(t,i){var e=(t.attr("aria-describedby")||"").split(/\s+/);e.push(i),t.data("ui-tooltip-id",i).attr("aria-describedby",d.trim(e.join(" ")))},_removeDescribedBy:function(t){var i=t.data("ui-tooltip-id"),e=(t.attr("aria-describedby")||"").split(/\s+/),o=d.inArray(i,e);-1!==o&&e.splice(o,1),t.removeData("ui-tooltip-id"),(e=d.trim(e.join(" ")))?t.attr("aria-describedby",e):t.removeAttr("aria-describedby")},_create:function(){this._on({mouseover:"open",focusin:"open"}),this.tooltips={},this.parents={},this.liveRegion=d("<div>").attr({role:"log","aria-live":"assertive","aria-relevant":"additions"}).appendTo(this.document[0].body),this._addClass(this.liveRegion,null,"ui-helper-hidden-accessible"),this.disabledTitles=d([])},_setOption:function(t,i){var e=this;this._super(t,i),"content"===t&&d.each(this.tooltips,function(t,i){e._updateContent(i.element)})},_setOptionDisabled:function(t){this[t?"_disable":"_enable"]()},_disable:function(){var o=this;d.each(this.tooltips,function(t,i){var e=d.Event("blur");e.target=e.currentTarget=i.element[0],o.close(e,!0)}),this.disabledTitles=this.disabledTitles.add(this.element.find(this.options.items).addBack().filter(function(){var t=d(this);if(t.is("[title]"))return t.data("ui-tooltip-title",t.attr("title")).removeAttr("title")}))},_enable:function(){this.disabledTitles.each(function(){var t=d(this);t.data("ui-tooltip-title")&&t.attr("title",t.data("ui-tooltip-title"))}),this.disabledTitles=d([])},open:function(t){var e=this,i=d(t?t.target:this.element).closest(this.options.items);i.length&&!i.data("ui-tooltip-id")&&(i.attr("title")&&i.data("ui-tooltip-title",i.attr("title")),i.data("ui-tooltip-open",!0),t&&"mouseover"===t.type&&i.parents().each(function(){var t,i=d(this);i.data("ui-tooltip-open")&&((t=d.Event("blur")).target=t.currentTarget=this,e.close(t,!0)),i.attr("title")&&(i.uniqueId(),e.parents[this.id]={element:this,title:i.attr("title")},i.attr("title",""))}),this._registerCloseHandlers(t,i),this._updateContent(i,t))},_updateContent:function(i,e){var t,o=this.options.content,n=this,s=e?e.type:null;if("string"==typeof o||o.nodeType||o.jquery)return this._open(e,i,o);(t=o.call(i[0],function(t){n._delay(function(){i.data("ui-tooltip-open")&&(e&&(e.type=s),this._open(e,i,t))})}))&&this._open(e,i,t)},_open:function(t,i,e){var o,n,s,l,a=d.extend({},this.options.position);function r(t){a.of=t,n.is(":hidden")||n.position(a)}e&&((o=this._find(i))?o.tooltip.find(".ui-tooltip-content").html(e):(i.is("[title]")&&(t&&"mouseover"===t.type?i.attr("title",""):i.removeAttr("title")),o=this._tooltip(i),n=o.tooltip,this._addDescribedBy(i,n.attr("id")),n.find(".ui-tooltip-content").html(e),this.liveRegion.children().hide(),(l=d("<div>").html(n.find(".ui-tooltip-content").html())).removeAttr("name").find("[name]").removeAttr("name"),l.removeAttr("id").find("[id]").removeAttr("id"),l.appendTo(this.liveRegion),this.options.track&&t&&/^mouse/.test(t.type)?(this._on(this.document,{mousemove:r}),r(t)):n.position(d.extend({of:i},this.options.position)),n.hide(),this._show(n,this.options.show),this.options.track&&this.options.show&&this.options.show.delay&&(s=this.delayedShow=setInterval(function(){n.is(":visible")&&(r(a.of),clearInterval(s))},d.fx.interval)),this._trigger("open",t,{tooltip:n})))},_registerCloseHandlers:function(t,e){var i={keyup:function(t){if(t.keyCode===d.ui.keyCode.ESCAPE){var i=d.Event(t);i.currentTarget=e[0],this.close(i,!0)}}};e[0]!==this.element[0]&&(i.remove=function(){this._removeTooltip(this._find(e).tooltip)}),t&&"mouseover"!==t.type||(i.mouseleave="close"),t&&"focusin"!==t.type||(i.focusout="close"),this._on(!0,e,i)},close:function(t){var i,e=this,o=d(t?t.currentTarget:this.element),n=this._find(o);n?(i=n.tooltip,n.closing||(clearInterval(this.delayedShow),o.data("ui-tooltip-title")&&!o.attr("title")&&o.attr("title",o.data("ui-tooltip-title")),this._removeDescribedBy(o),n.hiding=!0,i.stop(!0),this._hide(i,this.options.hide,function(){e._removeTooltip(d(this))}),o.removeData("ui-tooltip-open"),this._off(o,"mouseleave focusout keyup"),o[0]!==this.element[0]&&this._off(o,"remove"),this._off(this.document,"mousemove"),t&&"mouseleave"===t.type&&d.each(this.parents,function(t,i){d(i.element).attr("title",i.title),delete e.parents[t]}),n.closing=!0,this._trigger("close",t,{tooltip:i}),n.hiding||(n.closing=!1))):o.removeData("ui-tooltip-open")},_tooltip:function(t){var i=d("<div>").attr("role","tooltip"),e=d("<div>").appendTo(i),o=i.uniqueId().attr("id");return this._addClass(e,"ui-tooltip-content"),this._addClass(i,"ui-tooltip","ui-widget ui-widget-content"),i.appendTo(this._appendTo(t)),this.tooltips[o]={element:t,tooltip:i}},_find:function(t){var i=t.data("ui-tooltip-id");return i?this.tooltips[i]:null},_removeTooltip:function(t){t.remove(),delete this.tooltips[t.attr("id")]},_appendTo:function(t){var i=t.closest(".ui-front, dialog");return i.length||(i=this.document[0].body),i},_destroy:function(){var n=this;d.each(this.tooltips,function(t,i){var e=d.Event("blur"),o=i.element;e.target=e.currentTarget=o[0],n.close(e,!0),d("#"+t).remove(),o.data("ui-tooltip-title")&&(o.attr("title")||o.attr("title",o.data("ui-tooltip-title")),o.removeData("ui-tooltip-title"))}),this.liveRegion.remove()}}),!1!==d.uiBackCompat&&d.widget("ui.tooltip",d.ui.tooltip,{options:{tooltipClass:null},_tooltip:function(){var t=this._superApply(arguments);return this.options.tooltipClass&&t.tooltip.addClass(this.options.tooltipClass),t}}),d.ui.tooltip});
\ No newline at end of file
diff --git a/wp-includes/js/jquery/ui/widget.min.js b/wp-includes/js/jquery/ui/widget.min.js
deleted file mode 100644
index f3a21172e0..0000000000
--- a/wp-includes/js/jquery/ui/widget.min.js
+++ /dev/null
@@ -1,11 +0,0 @@
-/*!
- * jQuery UI Widget 1.11.4
- * http://jqueryui.com
- *
- * Copyright jQuery Foundation and other contributors
- * Released under the MIT license.
- * http://jquery.org/license
- *
- * http://api.jqueryui.com/jQuery.widget/
- */
-!function(t){"function"==typeof define&&define.amd?define(["jquery"],t):t(jQuery)}(function(h){var s,i=0,a=Array.prototype.slice;return h.cleanData=(s=h.cleanData,function(t){var e,i,n;for(n=0;null!=(i=t[n]);n++)try{(e=h._data(i,"events"))&&e.remove&&h(i).triggerHandler("remove")}catch(t){}s(t)}),h.widget=function(t,i,e){var n,s,o,r,a={},u=t.split(".")[0];return t=t.split(".")[1],n=u+"-"+t,e||(e=i,i=h.Widget),h.expr[":"][n.toLowerCase()]=function(t){return!!h.data(t,n)},h[u]=h[u]||{},s=h[u][t],o=h[u][t]=function(t,e){if(!this._createWidget)return new o(t,e);arguments.length&&this._createWidget(t,e)},h.extend(o,s,{version:e.version,_proto:h.extend({},e),_childConstructors:[]}),(r=new i).options=h.widget.extend({},r.options),h.each(e,function(e,n){function s(){return i.prototype[e].apply(this,arguments)}function o(t){return i.prototype[e].apply(this,t)}h.isFunction(n)?a[e]=function(){var t,e=this._super,i=this._superApply;return this._super=s,this._superApply=o,t=n.apply(this,arguments),this._super=e,this._superApply=i,t}:a[e]=n}),o.prototype=h.widget.extend(r,{widgetEventPrefix:s&&r.widgetEventPrefix||t},a,{constructor:o,namespace:u,widgetName:t,widgetFullName:n}),s?(h.each(s._childConstructors,function(t,e){var i=e.prototype;h.widget(i.namespace+"."+i.widgetName,o,e._proto)}),delete s._childConstructors):i._childConstructors.push(o),h.widget.bridge(t,o),o},h.widget.extend=function(t){for(var e,i,n=a.call(arguments,1),s=0,o=n.length;s<o;s++)for(e in n[s])i=n[s][e],n[s].hasOwnProperty(e)&&void 0!==i&&(h.isPlainObject(i)?t[e]=h.isPlainObject(t[e])?h.widget.extend({},t[e],i):h.widget.extend({},i):t[e]=i);return t},h.widget.bridge=function(o,e){var r=e.prototype.widgetFullName||o;h.fn[o]=function(i){var t="string"==typeof i,n=a.call(arguments,1),s=this;return t?this.each(function(){var t,e=h.data(this,r);return"instance"===i?(s=e,!1):e?h.isFunction(e[i])&&"_"!==i.charAt(0)?(t=e[i].apply(e,n))!==e&&void 0!==t?(s=t&&t.jquery?s.pushStack(t.get()):t,!1):void 0:h.error("no such method '"+i+"' for "+o+" widget instance"):h.error("cannot call methods on "+o+" prior to initialization; attempted to call method '"+i+"'")}):(n.length&&(i=h.widget.extend.apply(null,[i].concat(n))),this.each(function(){var t=h.data(this,r);t?(t.option(i||{}),t._init&&t._init()):h.data(this,r,new e(i,this))})),s}},h.Widget=function(){},h.Widget._childConstructors=[],h.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",defaultElement:"<div>",options:{disabled:!1,create:null},_createWidget:function(t,e){e=h(e||this.defaultElement||this)[0],this.element=h(e),this.uuid=i++,this.eventNamespace="."+this.widgetName+this.uuid,this.bindings=h(),this.hoverable=h(),this.focusable=h(),e!==this&&(h.data(e,this.widgetFullName,this),this._on(!0,this.element,{remove:function(t){t.target===e&&this.destroy()}}),this.document=h(e.style?e.ownerDocument:e.document||e),this.window=h(this.document[0].defaultView||this.document[0].parentWindow)),this.options=h.widget.extend({},this.options,this._getCreateOptions(),t),this._create(),this._trigger("create",null,this._getCreateEventData()),this._init()},_getCreateOptions:h.noop,_getCreateEventData:h.noop,_create:h.noop,_init:h.noop,destroy:function(){this._destroy(),this.element.unbind(this.eventNamespace).removeData(this.widgetFullName).removeData(h.camelCase(this.widgetFullName)),this.widget().unbind(this.eventNamespace).removeAttr("aria-disabled").removeClass(this.widgetFullName+"-disabled ui-state-disabled"),this.bindings.unbind(this.eventNamespace),this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus")},_destroy:h.noop,widget:function(){return this.element},option:function(t,e){var i,n,s,o=t;if(0===arguments.length)return h.widget.extend({},this.options);if("string"==typeof t)if(o={},t=(i=t.split(".")).shift(),i.length){for(n=o[t]=h.widget.extend({},this.options[t]),s=0;s<i.length-1;s++)n[i[s]]=n[i[s]]||{},n=n[i[s]];if(t=i.pop(),1===arguments.length)return void 0===n[t]?null:n[t];n[t]=e}else{if(1===arguments.length)return void 0===this.options[t]?null:this.options[t];o[t]=e}return this._setOptions(o),this},_setOptions:function(t){var e;for(e in t)this._setOption(e,t[e]);return this},_setOption:function(t,e){return this.options[t]=e,"disabled"===t&&(this.widget().toggleClass(this.widgetFullName+"-disabled",!!e),e&&(this.hoverable.removeClass("ui-state-hover"),this.focusable.removeClass("ui-state-focus"))),this},enable:function(){return this._setOptions({disabled:!1})},disable:function(){return this._setOptions({disabled:!0})},_on:function(r,a,t){var u,d=this;"boolean"!=typeof r&&(t=a,a=r,r=!1),t?(a=u=h(a),this.bindings=this.bindings.add(a)):(t=a,a=this.element,u=this.widget()),h.each(t,function(t,e){function i(){if(r||!0!==d.options.disabled&&!h(this).hasClass("ui-state-disabled"))return("string"==typeof e?d[e]:e).apply(d,arguments)}"string"!=typeof e&&(i.guid=e.guid=e.guid||i.guid||h.guid++);var n=t.match(/^([\w:-]*)\s*(.*)$/),s=n[1]+d.eventNamespace,o=n[2];o?u.delegate(o,s,i):a.bind(s,i)})},_off:function(t,e){e=(e||"").split(" ").join(this.eventNamespace+" ")+this.eventNamespace,t.unbind(e).undelegate(e),this.bindings=h(this.bindings.not(t).get()),this.focusable=h(this.focusable.not(t).get()),this.hoverable=h(this.hoverable.not(t).get())},_delay:function(t,e){var i=this;return setTimeout(function(){return("string"==typeof t?i[t]:t).apply(i,arguments)},e||0)},_hoverable:function(t){this.hoverable=this.hoverable.add(t),this._on(t,{mouseenter:function(t){h(t.currentTarget).addClass("ui-state-hover")},mouseleave:function(t){h(t.currentTarget).removeClass("ui-state-hover")}})},_focusable:function(t){this.focusable=this.focusable.add(t),this._on(t,{focusin:function(t){h(t.currentTarget).addClass("ui-state-focus")},focusout:function(t){h(t.currentTarget).removeClass("ui-state-focus")}})},_trigger:function(t,e,i){var n,s,o=this.options[t];if(i=i||{},(e=h.Event(e)).type=(t===this.widgetEventPrefix?t:this.widgetEventPrefix+t).toLowerCase(),e.target=this.element[0],s=e.originalEvent)for(n in s)n in e||(e[n]=s[n]);return this.element.trigger(e,i),!(h.isFunction(o)&&!1===o.apply(this.element[0],[e].concat(i))||e.isDefaultPrevented())}},h.each({show:"fadeIn",hide:"fadeOut"},function(o,r){h.Widget.prototype["_"+o]=function(e,t,i){"string"==typeof t&&(t={effect:t});var n,s=t?!0===t||"number"==typeof t?r:t.effect||r:o;"number"==typeof(t=t||{})&&(t={duration:t}),n=!h.isEmptyObject(t),t.complete=i,t.delay&&e.delay(t.delay),n&&h.effects&&h.effects.effect[s]?e[o](t):s!==o&&e[s]?e[s](t.duration,t.easing,i):e.queue(function(t){h(this)[o](),i&&i.call(e[0]),t()})}}),h.widget});
\ No newline at end of file
diff --git a/wp-includes/script-loader.php b/wp-includes/script-loader.php
index ad9453292a..e595bf0d28 100644
--- a/wp-includes/script-loader.php
+++ b/wp-includes/script-loader.php
@@ -690,7 +690,7 @@ function wp_default_scripts( $scripts ) {
 		)
 	);
 
-	$scripts->add( 'wp-pointer', "/wp-includes/js/wp-pointer$suffix.js", array( 'jquery-ui-widget', 'jquery-ui-position' ), false, 1 );
+	$scripts->add( 'wp-pointer', "/wp-includes/js/wp-pointer$suffix.js", array( 'jquery-ui-core' ), false, 1 );
 	$scripts->set_translations( 'wp-pointer' );
 
 	$scripts->add( 'autosave', "/wp-includes/js/autosave$suffix.js", array( 'heartbeat' ), false, 1 );
@@ -729,50 +729,65 @@ function wp_default_scripts( $scripts ) {
 	$scripts->add( 'cropper', '/wp-includes/js/crop/cropper.js', array( 'scriptaculous-dragdrop' ) );
 
 	// jQuery.
-	$scripts->add( 'jquery', false, array( 'jquery-core' ), '1.12.4-wp' );
-	$scripts->add( 'jquery-core', '/wp-includes/js/jquery/jquery.js', array(), '1.12.4-wp' );
-	$scripts->add( 'jquery-migrate', "/wp-includes/js/jquery/jquery-migrate$suffix.js", array(), '1.4.1' );
+	// The unminified jquery.js and jquery-migrate.js are included to facilitate debugging.
+	$scripts->add( 'jquery', false, array( 'jquery-core', 'jquery-migrate' ), '3.5.1' );
+	$scripts->add( 'jquery-core', "/wp-includes/js/jquery/jquery$suffix.js", array(), '3.5.1' );
+	$scripts->add( 'jquery-migrate', "/wp-includes/js/jquery/jquery-migrate$suffix.js", array(), '3.3.1' );
 
 	// Full jQuery UI.
-	$scripts->add( 'jquery-ui-core', "/wp-includes/js/jquery/ui/core$dev_suffix.js", array( 'jquery' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-core', "/wp-includes/js/jquery/ui/effect$dev_suffix.js", array( 'jquery' ), '1.11.4', 1 );
+	// The build process in 1.12.1 has changed significantly.
+	// In order to keep backwards compatibility, and to keep the optimized loading,
+	// the source files were flattened and included with some modifications for AMD loading.
+	// A notable change is that 'jquery-ui-core' now contains 'jquery-ui-position' and 'jquery-ui-widget'.
+	$scripts->add( 'jquery-ui-core', "/wp-includes/js/jquery/ui/core$suffix.js", array( 'jquery' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-core', "/wp-includes/js/jquery/ui/effect$suffix.js", array( 'jquery' ), '1.12.1', 1 );
 
-	$scripts->add( 'jquery-effects-blind', "/wp-includes/js/jquery/ui/effect-blind$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-bounce', "/wp-includes/js/jquery/ui/effect-bounce$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-clip', "/wp-includes/js/jquery/ui/effect-clip$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-drop', "/wp-includes/js/jquery/ui/effect-drop$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-explode', "/wp-includes/js/jquery/ui/effect-explode$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-fade', "/wp-includes/js/jquery/ui/effect-fade$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-fold', "/wp-includes/js/jquery/ui/effect-fold$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-highlight', "/wp-includes/js/jquery/ui/effect-highlight$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-puff', "/wp-includes/js/jquery/ui/effect-puff$dev_suffix.js", array( 'jquery-effects-core', 'jquery-effects-scale' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-pulsate', "/wp-includes/js/jquery/ui/effect-pulsate$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-scale', "/wp-includes/js/jquery/ui/effect-scale$dev_suffix.js", array( 'jquery-effects-core', 'jquery-effects-size' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-shake', "/wp-includes/js/jquery/ui/effect-shake$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-size', "/wp-includes/js/jquery/ui/effect-size$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-slide', "/wp-includes/js/jquery/ui/effect-slide$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-effects-transfer', "/wp-includes/js/jquery/ui/effect-transfer$dev_suffix.js", array( 'jquery-effects-core' ), '1.11.4', 1 );
+	$scripts->add( 'jquery-effects-blind', "/wp-includes/js/jquery/ui/effect-blind$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-bounce', "/wp-includes/js/jquery/ui/effect-bounce$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-clip', "/wp-includes/js/jquery/ui/effect-clip$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-drop', "/wp-includes/js/jquery/ui/effect-drop$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-explode', "/wp-includes/js/jquery/ui/effect-explode$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-fade', "/wp-includes/js/jquery/ui/effect-fade$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-fold', "/wp-includes/js/jquery/ui/effect-fold$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-highlight', "/wp-includes/js/jquery/ui/effect-highlight$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-puff', "/wp-includes/js/jquery/ui/effect-puff$suffix.js", array( 'jquery-effects-core', 'jquery-effects-scale' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-pulsate', "/wp-includes/js/jquery/ui/effect-pulsate$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-scale', "/wp-includes/js/jquery/ui/effect-scale$suffix.js", array( 'jquery-effects-core', 'jquery-effects-size' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-shake', "/wp-includes/js/jquery/ui/effect-shake$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-size', "/wp-includes/js/jquery/ui/effect-size$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-slide', "/wp-includes/js/jquery/ui/effect-slide$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-effects-transfer', "/wp-includes/js/jquery/ui/effect-transfer$suffix.js", array( 'jquery-effects-core' ), '1.12.1', 1 );
 
-	$scripts->add( 'jquery-ui-accordion', "/wp-includes/js/jquery/ui/accordion$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-autocomplete', "/wp-includes/js/jquery/ui/autocomplete$dev_suffix.js", array( 'jquery-ui-menu', 'wp-a11y' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-button', "/wp-includes/js/jquery/ui/button$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-datepicker', "/wp-includes/js/jquery/ui/datepicker$dev_suffix.js", array( 'jquery-ui-core' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-dialog', "/wp-includes/js/jquery/ui/dialog$dev_suffix.js", array( 'jquery-ui-resizable', 'jquery-ui-draggable', 'jquery-ui-button', 'jquery-ui-position' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-draggable', "/wp-includes/js/jquery/ui/draggable$dev_suffix.js", array( 'jquery-ui-mouse' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-droppable', "/wp-includes/js/jquery/ui/droppable$dev_suffix.js", array( 'jquery-ui-draggable' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-menu', "/wp-includes/js/jquery/ui/menu$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget', 'jquery-ui-position' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-mouse', "/wp-includes/js/jquery/ui/mouse$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-position', "/wp-includes/js/jquery/ui/position$dev_suffix.js", array( 'jquery' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-progressbar', "/wp-includes/js/jquery/ui/progressbar$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-resizable', "/wp-includes/js/jquery/ui/resizable$dev_suffix.js", array( 'jquery-ui-mouse' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-selectable', "/wp-includes/js/jquery/ui/selectable$dev_suffix.js", array( 'jquery-ui-mouse' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-selectmenu', "/wp-includes/js/jquery/ui/selectmenu$dev_suffix.js", array( 'jquery-ui-menu' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-slider', "/wp-includes/js/jquery/ui/slider$dev_suffix.js", array( 'jquery-ui-mouse' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-sortable', "/wp-includes/js/jquery/ui/sortable$dev_suffix.js", array( 'jquery-ui-mouse' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-spinner', "/wp-includes/js/jquery/ui/spinner$dev_suffix.js", array( 'jquery-ui-button' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-tabs', "/wp-includes/js/jquery/ui/tabs$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-tooltip', "/wp-includes/js/jquery/ui/tooltip$dev_suffix.js", array( 'jquery-ui-core', 'jquery-ui-widget', 'jquery-ui-position' ), '1.11.4', 1 );
-	$scripts->add( 'jquery-ui-widget', "/wp-includes/js/jquery/ui/widget$dev_suffix.js", array( 'jquery' ), '1.11.4', 1 );
+	// Widgets
+	$scripts->add( 'jquery-ui-accordion', "/wp-includes/js/jquery/ui/accordion$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-autocomplete', "/wp-includes/js/jquery/ui/autocomplete$suffix.js", array( 'jquery-ui-menu', 'wp-a11y' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-button', "/wp-includes/js/jquery/ui/button$suffix.js", array( 'jquery-ui-core', 'jquery-ui-controlgroup', 'jquery-ui-checkboxradio' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-datepicker', "/wp-includes/js/jquery/ui/datepicker$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-dialog', "/wp-includes/js/jquery/ui/dialog$suffix.js", array( 'jquery-ui-resizable', 'jquery-ui-draggable', 'jquery-ui-button' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-menu', "/wp-includes/js/jquery/ui/menu$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-mouse', "/wp-includes/js/jquery/ui/mouse$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-progressbar', "/wp-includes/js/jquery/ui/progressbar$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-selectmenu', "/wp-includes/js/jquery/ui/selectmenu$suffix.js", array( 'jquery-ui-menu' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-slider', "/wp-includes/js/jquery/ui/slider$suffix.js", array( 'jquery-ui-mouse' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-spinner', "/wp-includes/js/jquery/ui/spinner$suffix.js", array( 'jquery-ui-button' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-tabs', "/wp-includes/js/jquery/ui/tabs$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-tooltip', "/wp-includes/js/jquery/ui/tooltip$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+
+	// New in 1.12.1
+	$scripts->add( 'jquery-ui-checkboxradio', "/wp-includes/js/jquery/ui/checkboxradio$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-controlgroup', "/wp-includes/js/jquery/ui/controlgroup$suffix.js", array( 'jquery-ui-core' ), '1.12.1', 1 );
+
+	// Interactions
+	$scripts->add( 'jquery-ui-draggable', "/wp-includes/js/jquery/ui/draggable$suffix.js", array( 'jquery-ui-mouse' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-droppable', "/wp-includes/js/jquery/ui/droppable$suffix.js", array( 'jquery-ui-draggable' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-resizable', "/wp-includes/js/jquery/ui/resizable$suffix.js", array( 'jquery-ui-mouse' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-selectable', "/wp-includes/js/jquery/ui/selectable$suffix.js", array( 'jquery-ui-mouse' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-sortable', "/wp-includes/js/jquery/ui/sortable$suffix.js", array( 'jquery-ui-mouse' ), '1.12.1', 1 );
+
+	// As of 1.12.1 `jquery-ui-position` and `jquery-ui-widget` are part of `jquery-ui-core`.
+	// Listed here for back-compat.
+	$scripts->add( 'jquery-ui-position', false, array( 'jquery-ui-core' ), '1.12.1', 1 );
+	$scripts->add( 'jquery-ui-widget', false, array( 'jquery-ui-core' ), '1.12.1', 1 );
 
 	// Strings for 'jquery-ui-autocomplete' live region messages.
 	did_action( 'init' ) && $scripts->localize(
@@ -798,7 +813,7 @@ function wp_default_scripts( $scripts ) {
 	$scripts->add( 'jquery-serialize-object', '/wp-includes/js/jquery/jquery.serialize-object.js', array( 'jquery' ), '0.2', 1 );
 	$scripts->add( 'jquery-hotkeys', "/wp-includes/js/jquery/jquery.hotkeys$suffix.js", array( 'jquery' ), '0.0.2m', 1 );
 	$scripts->add( 'jquery-table-hotkeys', "/wp-includes/js/jquery/jquery.table-hotkeys$suffix.js", array( 'jquery', 'jquery-hotkeys' ), false, 1 );
-	$scripts->add( 'jquery-touch-punch', '/wp-includes/js/jquery/jquery.ui.touch-punch.js', array( 'jquery-ui-widget', 'jquery-ui-mouse' ), '0.2.2', 1 );
+	$scripts->add( 'jquery-touch-punch', '/wp-includes/js/jquery/jquery.ui.touch-punch.js', array( 'jquery-ui-core', 'jquery-ui-mouse' ), '0.2.2', 1 );
 
 	// Not used any more, registered for backward compatibility.
 	$scripts->add( 'suggest', "/wp-includes/js/jquery/suggest$suffix.js", array( 'jquery' ), '1.1-20110113', 1 );
diff --git a/wp-includes/version.php b/wp-includes/version.php
index f45f610fe3..9f317caf63 100644
--- a/wp-includes/version.php
+++ b/wp-includes/version.php
@@ -13,7 +13,7 @@
  *
  * @global string $wp_version
  */
-$wp_version = '5.6-alpha-49100';
+$wp_version = '5.6-alpha-49101';
 
 /**
  * Holds the WordPress DB revision, increments when changes are made to the WordPress DB schema.